diff --git a/.gitignore b/.gitignore index 47f56b8b7fc6224580f4fb52377e8e3f60f76c41..e349c6824f116b86c2b319fe28b2efd2242044b2 100644 --- a/.gitignore +++ b/.gitignore @@ -47,6 +47,7 @@ install_manifest.txt compile_commands.json CTestTestfile.cmake _deps +build ### CMake Patch ### # External projects @@ -80,4 +81,8 @@ Network Trash Folder Temporary Items .apdisk +# Documentation +docs/html +docs/latex + # End of https://www.gitignore.io/api/c++,cmake diff --git a/CMakeLists.txt b/CMakeLists.txt new file mode 100644 index 0000000000000000000000000000000000000000..09df4c0d9cf1bb7707804c58454756e87962c57d --- /dev/null +++ b/CMakeLists.txt @@ -0,0 +1,21 @@ +# Specify the minimum version for CMake +cmake_minimum_required(VERSION 3.0.0) + +# Project information +project(factor-oracle CXX) + +# Source folder +add_subdirectory(src) + +# Test folder +option(BUILD_TESTS "Build Tests" ON) +if(BUILD_TESTS) + enable_testing() + add_subdirectory(tests) +endif(BUILD_TESTS) + +# Documentation folder +option(BUILD_DOCS "Build Documentation") +if(BUILD_DOCS) + add_subdirectory(docs) +endif(BUILD_DOCS) diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md new file mode 100644 index 0000000000000000000000000000000000000000..9f439b82467a28538de05910717c4f222591a302 --- /dev/null +++ b/CONTRIBUTING.md @@ -0,0 +1,11 @@ +# Style Guide + +We use the Google C++ Style Guide that can be found at https://google.github.io/styleguide/cppguide.html + +# Testing + +We use the test framework [catch2](https://github.com/catchorg/Catch2) for writing and running the test cases. + +# Documentation + +We use [Doxygen](http://www.doxygen.org/) for writing and generating the documentation. diff --git a/docs/CMakeLists.txt b/docs/CMakeLists.txt new file mode 100644 index 0000000000000000000000000000000000000000..653d9e5999773be747b753af7bf6e94d3d9e193e --- /dev/null +++ b/docs/CMakeLists.txt @@ -0,0 +1,26 @@ +# Specify the minimum version for CMake +cmake_minimum_required(VERSION 3.0.0) + +# project information +project(factor-oracle_docs) + +# check if Doxygen is installed +find_package(Doxygen) + +if (DOXYGEN_FOUND) + # set input and output files + set(DOXYGEN_IN Doxyfile) + set(DOXYGEN_OUT ${CMAKE_CURRENT_BINARY_DIR}/Doxyfile) + + # request to configure the file + configure_file(${DOXYGEN_IN} ${DOXYGEN_OUT} @ONLY) + + # note the option ALL which allows to build the docs together with the application + add_custom_target(doxygen ALL + COMMAND ${DOXYGEN_EXECUTABLE} ${DOXYGEN_OUT} + WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} + COMMENT "Generating API documentation with Doxygen" + VERBATIM) +else (DOXYGEN_FOUND) + message("Doxygen need to be installed to generate the doxygen documentation") +endif (DOXYGEN_FOUND) diff --git a/docs/Doxyfile b/docs/Doxyfile new file mode 100644 index 0000000000000000000000000000000000000000..5891bf4c11ec109eb3dd3cb31646c80ab59761fe --- /dev/null +++ b/docs/Doxyfile @@ -0,0 +1,2494 @@ +# Doxyfile 1.8.13 + +# This file describes the settings to be used by the documentation system +# doxygen (www.doxygen.org) for a project. +# +# All text after a double hash (##) is considered a comment and is placed in +# front of the TAG it is preceding. +# +# All text after a single hash (#) is considered a comment and will be ignored. +# The format is: +# TAG = value [value, ...] +# For lists, items can also be appended using: +# TAG += value [value, ...] +# Values that contain spaces should be placed between quotes (\" \"). + +#--------------------------------------------------------------------------- +# Project related configuration options +#--------------------------------------------------------------------------- + +# This tag specifies the encoding used for all characters in the config file +# that follow. The default is UTF-8 which is also the encoding used for all text +# before the first occurrence of this tag. Doxygen uses libiconv (or the iconv +# built into libc) for the transcoding. See http://www.gnu.org/software/libiconv +# for the list of possible encodings. +# The default value is: UTF-8. + +DOXYFILE_ENCODING = UTF-8 + +# The PROJECT_NAME tag is a single word (or a sequence of words surrounded by +# double-quotes, unless you are using Doxywizard) that should identify the +# project for which the documentation is generated. This name is used in the +# title of most generated pages and in a few other places. +# The default value is: My Project. + +PROJECT_NAME = "Factor Oracle" + +# The PROJECT_NUMBER tag can be used to enter a project or revision number. This +# could be handy for archiving the generated documentation or if some version +# control system is used. + +PROJECT_NUMBER = + +# Using the PROJECT_BRIEF tag one can provide an optional one line description +# for a project that appears at the top of each page and should give viewer a +# quick idea about the purpose of the project. Keep the description short. + +PROJECT_BRIEF = + +# With the PROJECT_LOGO tag one can specify a logo or an icon that is included +# in the documentation. The maximum height of the logo should not exceed 55 +# pixels and the maximum width should not exceed 200 pixels. Doxygen will copy +# the logo to the output directory. + +PROJECT_LOGO = + +# The OUTPUT_DIRECTORY tag is used to specify the (relative or absolute) path +# into which the generated documentation will be written. If a relative path is +# entered, it will be relative to the location where doxygen was started. If +# left blank the current directory will be used. + +OUTPUT_DIRECTORY = @CMAKE_CURRENT_SOURCE_DIR@/../build/docs + +# If the CREATE_SUBDIRS tag is set to YES then doxygen will create 4096 sub- +# directories (in 2 levels) under the output directory of each output format and +# will distribute the generated files over these directories. Enabling this +# option can be useful when feeding doxygen a huge amount of source files, where +# putting all generated files in the same directory would otherwise causes +# performance problems for the file system. +# The default value is: NO. + +CREATE_SUBDIRS = NO + +# If the ALLOW_UNICODE_NAMES tag is set to YES, doxygen will allow non-ASCII +# characters to appear in the names of generated files. If set to NO, non-ASCII +# characters will be escaped, for example _xE3_x81_x84 will be used for Unicode +# U+3044. +# The default value is: NO. + +ALLOW_UNICODE_NAMES = NO + +# The OUTPUT_LANGUAGE tag is used to specify the language in which all +# documentation generated by doxygen is written. Doxygen will use this +# information to generate all constant output in the proper language. +# Possible values are: Afrikaans, Arabic, Armenian, Brazilian, Catalan, Chinese, +# Chinese-Traditional, Croatian, Czech, Danish, Dutch, English (United States), +# Esperanto, Farsi (Persian), Finnish, French, German, Greek, Hungarian, +# Indonesian, Italian, Japanese, Japanese-en (Japanese with English messages), +# Korean, Korean-en (Korean with English messages), Latvian, Lithuanian, +# Macedonian, Norwegian, Persian (Farsi), Polish, Portuguese, Romanian, Russian, +# Serbian, Serbian-Cyrillic, Slovak, Slovene, Spanish, Swedish, Turkish, +# Ukrainian and Vietnamese. +# The default value is: English. + +OUTPUT_LANGUAGE = English + +# If the BRIEF_MEMBER_DESC tag is set to YES, doxygen will include brief member +# descriptions after the members that are listed in the file and class +# documentation (similar to Javadoc). Set to NO to disable this. +# The default value is: YES. + +BRIEF_MEMBER_DESC = YES + +# If the REPEAT_BRIEF tag is set to YES, doxygen will prepend the brief +# description of a member or function before the detailed description +# +# Note: If both HIDE_UNDOC_MEMBERS and BRIEF_MEMBER_DESC are set to NO, the +# brief descriptions will be completely suppressed. +# The default value is: YES. + +REPEAT_BRIEF = YES + +# This tag implements a quasi-intelligent brief description abbreviator that is +# used to form the text in various listings. Each string in this list, if found +# as the leading text of the brief description, will be stripped from the text +# and the result, after processing the whole list, is used as the annotated +# text. Otherwise, the brief description is used as-is. If left blank, the +# following values are used ($name is automatically replaced with the name of +# the entity):The $name class, The $name widget, The $name file, is, provides, +# specifies, contains, represents, a, an and the. + +ABBREVIATE_BRIEF = "The $name class" \ + "The $name widget" \ + "The $name file" \ + is \ + provides \ + specifies \ + contains \ + represents \ + a \ + an \ + the + +# If the ALWAYS_DETAILED_SEC and REPEAT_BRIEF tags are both set to YES then +# doxygen will generate a detailed section even if there is only a brief +# description. +# The default value is: NO. + +ALWAYS_DETAILED_SEC = NO + +# If the INLINE_INHERITED_MEMB tag is set to YES, doxygen will show all +# inherited members of a class in the documentation of that class as if those +# members were ordinary class members. Constructors, destructors and assignment +# operators of the base classes will not be shown. +# The default value is: NO. + +INLINE_INHERITED_MEMB = NO + +# If the FULL_PATH_NAMES tag is set to YES, doxygen will prepend the full path +# before files name in the file list and in the header files. If set to NO the +# shortest path that makes the file name unique will be used +# The default value is: YES. + +FULL_PATH_NAMES = YES + +# The STRIP_FROM_PATH tag can be used to strip a user-defined part of the path. +# Stripping is only done if one of the specified strings matches the left-hand +# part of the path. The tag can be used to show relative paths in the file list. +# If left blank the directory from which doxygen is run is used as the path to +# strip. +# +# Note that you can specify absolute paths here, but also relative paths, which +# will be relative from the directory where doxygen is started. +# This tag requires that the tag FULL_PATH_NAMES is set to YES. + +STRIP_FROM_PATH = + +# The STRIP_FROM_INC_PATH tag can be used to strip a user-defined part of the +# path mentioned in the documentation of a class, which tells the reader which +# header file to include in order to use a class. If left blank only the name of +# the header file containing the class definition is used. Otherwise one should +# specify the list of include paths that are normally passed to the compiler +# using the -I flag. + +STRIP_FROM_INC_PATH = + +# If the SHORT_NAMES tag is set to YES, doxygen will generate much shorter (but +# less readable) file names. This can be useful is your file systems doesn't +# support long names like on DOS, Mac, or CD-ROM. +# The default value is: NO. + +SHORT_NAMES = NO + +# If the JAVADOC_AUTOBRIEF tag is set to YES then doxygen will interpret the +# first line (until the first dot) of a Javadoc-style comment as the brief +# description. If set to NO, the Javadoc-style will behave just like regular Qt- +# style comments (thus requiring an explicit @brief command for a brief +# description.) +# The default value is: NO. + +JAVADOC_AUTOBRIEF = NO + +# If the QT_AUTOBRIEF tag is set to YES then doxygen will interpret the first +# line (until the first dot) of a Qt-style comment as the brief description. If +# set to NO, the Qt-style will behave just like regular Qt-style comments (thus +# requiring an explicit \brief command for a brief description.) +# The default value is: NO. + +QT_AUTOBRIEF = NO + +# The MULTILINE_CPP_IS_BRIEF tag can be set to YES to make doxygen treat a +# multi-line C++ special comment block (i.e. a block of //! or /// comments) as +# a brief description. This used to be the default behavior. The new default is +# to treat a multi-line C++ comment block as a detailed description. Set this +# tag to YES if you prefer the old behavior instead. +# +# Note that setting this tag to YES also means that rational rose comments are +# not recognized any more. +# The default value is: NO. + +MULTILINE_CPP_IS_BRIEF = NO + +# If the INHERIT_DOCS tag is set to YES then an undocumented member inherits the +# documentation from any documented member that it re-implements. +# The default value is: YES. + +INHERIT_DOCS = YES + +# If the SEPARATE_MEMBER_PAGES tag is set to YES then doxygen will produce a new +# page for each member. If set to NO, the documentation of a member will be part +# of the file/class/namespace that contains it. +# The default value is: NO. + +SEPARATE_MEMBER_PAGES = NO + +# The TAB_SIZE tag can be used to set the number of spaces in a tab. Doxygen +# uses this value to replace tabs by spaces in code fragments. +# Minimum value: 1, maximum value: 16, default value: 4. + +TAB_SIZE = 4 + +# This tag can be used to specify a number of aliases that act as commands in +# the documentation. An alias has the form: +# name=value +# For example adding +# "sideeffect=@par Side Effects:\n" +# will allow you to put the command \sideeffect (or @sideeffect) in the +# documentation, which will result in a user-defined paragraph with heading +# "Side Effects:". You can put \n's in the value part of an alias to insert +# newlines. + +ALIASES = + +# This tag can be used to specify a number of word-keyword mappings (TCL only). +# A mapping has the form "name=value". For example adding "class=itcl::class" +# will allow you to use the command class in the itcl::class meaning. + +TCL_SUBST = + +# Set the OPTIMIZE_OUTPUT_FOR_C tag to YES if your project consists of C sources +# only. Doxygen will then generate output that is more tailored for C. For +# instance, some of the names that are used will be different. The list of all +# members will be omitted, etc. +# The default value is: NO. + +OPTIMIZE_OUTPUT_FOR_C = NO + +# Set the OPTIMIZE_OUTPUT_JAVA tag to YES if your project consists of Java or +# Python sources only. Doxygen will then generate output that is more tailored +# for that language. For instance, namespaces will be presented as packages, +# qualified scopes will look different, etc. +# The default value is: NO. + +OPTIMIZE_OUTPUT_JAVA = NO + +# Set the OPTIMIZE_FOR_FORTRAN tag to YES if your project consists of Fortran +# sources. Doxygen will then generate output that is tailored for Fortran. +# The default value is: NO. + +OPTIMIZE_FOR_FORTRAN = NO + +# Set the OPTIMIZE_OUTPUT_VHDL tag to YES if your project consists of VHDL +# sources. Doxygen will then generate output that is tailored for VHDL. +# The default value is: NO. + +OPTIMIZE_OUTPUT_VHDL = NO + +# Doxygen selects the parser to use depending on the extension of the files it +# parses. With this tag you can assign which parser to use for a given +# extension. Doxygen has a built-in mapping, but you can override or extend it +# using this tag. The format is ext=language, where ext is a file extension, and +# language is one of the parsers supported by doxygen: IDL, Java, Javascript, +# C#, C, C++, D, PHP, Objective-C, Python, Fortran (fixed format Fortran: +# FortranFixed, free formatted Fortran: FortranFree, unknown formatted Fortran: +# Fortran. In the later case the parser tries to guess whether the code is fixed +# or free formatted code, this is the default for Fortran type files), VHDL. For +# instance to make doxygen treat .inc files as Fortran files (default is PHP), +# and .f files as C (default is Fortran), use: inc=Fortran f=C. +# +# Note: For files without extension you can use no_extension as a placeholder. +# +# Note that for custom extensions you also need to set FILE_PATTERNS otherwise +# the files are not read by doxygen. + +EXTENSION_MAPPING = + +# If the MARKDOWN_SUPPORT tag is enabled then doxygen pre-processes all comments +# according to the Markdown format, which allows for more readable +# documentation. See http://daringfireball.net/projects/markdown/ for details. +# The output of markdown processing is further processed by doxygen, so you can +# mix doxygen, HTML, and XML commands with Markdown formatting. Disable only in +# case of backward compatibilities issues. +# The default value is: YES. + +MARKDOWN_SUPPORT = YES + +# When the TOC_INCLUDE_HEADINGS tag is set to a non-zero value, all headings up +# to that level are automatically included in the table of contents, even if +# they do not have an id attribute. +# Note: This feature currently applies only to Markdown headings. +# Minimum value: 0, maximum value: 99, default value: 0. +# This tag requires that the tag MARKDOWN_SUPPORT is set to YES. + +TOC_INCLUDE_HEADINGS = 0 + +# When enabled doxygen tries to link words that correspond to documented +# classes, or namespaces to their corresponding documentation. Such a link can +# be prevented in individual cases by putting a % sign in front of the word or +# globally by setting AUTOLINK_SUPPORT to NO. +# The default value is: YES. + +AUTOLINK_SUPPORT = YES + +# If you use STL classes (i.e. std::string, std::vector, etc.) but do not want +# to include (a tag file for) the STL sources as input, then you should set this +# tag to YES in order to let doxygen match functions declarations and +# definitions whose arguments contain STL classes (e.g. func(std::string); +# versus func(std::string) {}). This also make the inheritance and collaboration +# diagrams that involve STL classes more complete and accurate. +# The default value is: NO. + +BUILTIN_STL_SUPPORT = NO + +# If you use Microsoft's C++/CLI language, you should set this option to YES to +# enable parsing support. +# The default value is: NO. + +CPP_CLI_SUPPORT = NO + +# Set the SIP_SUPPORT tag to YES if your project consists of sip (see: +# http://www.riverbankcomputing.co.uk/software/sip/intro) sources only. Doxygen +# will parse them like normal C++ but will assume all classes use public instead +# of private inheritance when no explicit protection keyword is present. +# The default value is: NO. + +SIP_SUPPORT = NO + +# For Microsoft's IDL there are propget and propput attributes to indicate +# getter and setter methods for a property. Setting this option to YES will make +# doxygen to replace the get and set methods by a property in the documentation. +# This will only work if the methods are indeed getting or setting a simple +# type. If this is not the case, or you want to show the methods anyway, you +# should set this option to NO. +# The default value is: YES. + +IDL_PROPERTY_SUPPORT = YES + +# If member grouping is used in the documentation and the DISTRIBUTE_GROUP_DOC +# tag is set to YES then doxygen will reuse the documentation of the first +# member in the group (if any) for the other members of the group. By default +# all members of a group must be documented explicitly. +# The default value is: NO. + +DISTRIBUTE_GROUP_DOC = NO + +# If one adds a struct or class to a group and this option is enabled, then also +# any nested class or struct is added to the same group. By default this option +# is disabled and one has to add nested compounds explicitly via \ingroup. +# The default value is: NO. + +GROUP_NESTED_COMPOUNDS = NO + +# Set the SUBGROUPING tag to YES to allow class member groups of the same type +# (for instance a group of public functions) to be put as a subgroup of that +# type (e.g. under the Public Functions section). Set it to NO to prevent +# subgrouping. Alternatively, this can be done per class using the +# \nosubgrouping command. +# The default value is: YES. + +SUBGROUPING = YES + +# When the INLINE_GROUPED_CLASSES tag is set to YES, classes, structs and unions +# are shown inside the group in which they are included (e.g. using \ingroup) +# instead of on a separate page (for HTML and Man pages) or section (for LaTeX +# and RTF). +# +# Note that this feature does not work in combination with +# SEPARATE_MEMBER_PAGES. +# The default value is: NO. + +INLINE_GROUPED_CLASSES = NO + +# When the INLINE_SIMPLE_STRUCTS tag is set to YES, structs, classes, and unions +# with only public data fields or simple typedef fields will be shown inline in +# the documentation of the scope in which they are defined (i.e. file, +# namespace, or group documentation), provided this scope is documented. If set +# to NO, structs, classes, and unions are shown on a separate page (for HTML and +# Man pages) or section (for LaTeX and RTF). +# The default value is: NO. + +INLINE_SIMPLE_STRUCTS = NO + +# When TYPEDEF_HIDES_STRUCT tag is enabled, a typedef of a struct, union, or +# enum is documented as struct, union, or enum with the name of the typedef. So +# typedef struct TypeS {} TypeT, will appear in the documentation as a struct +# with name TypeT. When disabled the typedef will appear as a member of a file, +# namespace, or class. And the struct will be named TypeS. This can typically be +# useful for C code in case the coding convention dictates that all compound +# types are typedef'ed and only the typedef is referenced, never the tag name. +# The default value is: NO. + +TYPEDEF_HIDES_STRUCT = NO + +# The size of the symbol lookup cache can be set using LOOKUP_CACHE_SIZE. This +# cache is used to resolve symbols given their name and scope. Since this can be +# an expensive process and often the same symbol appears multiple times in the +# code, doxygen keeps a cache of pre-resolved symbols. If the cache is too small +# doxygen will become slower. If the cache is too large, memory is wasted. The +# cache size is given by this formula: 2^(16+LOOKUP_CACHE_SIZE). The valid range +# is 0..9, the default is 0, corresponding to a cache size of 2^16=65536 +# symbols. At the end of a run doxygen will report the cache usage and suggest +# the optimal cache size from a speed point of view. +# Minimum value: 0, maximum value: 9, default value: 0. + +LOOKUP_CACHE_SIZE = 0 + +#--------------------------------------------------------------------------- +# Build related configuration options +#--------------------------------------------------------------------------- + +# If the EXTRACT_ALL tag is set to YES, doxygen will assume all entities in +# documentation are documented, even if no documentation was available. Private +# class members and static file members will be hidden unless the +# EXTRACT_PRIVATE respectively EXTRACT_STATIC tags are set to YES. +# Note: This will also disable the warnings about undocumented members that are +# normally produced when WARNINGS is set to YES. +# The default value is: NO. + +EXTRACT_ALL = NO + +# If the EXTRACT_PRIVATE tag is set to YES, all private members of a class will +# be included in the documentation. +# The default value is: NO. + +EXTRACT_PRIVATE = NO + +# If the EXTRACT_PACKAGE tag is set to YES, all members with package or internal +# scope will be included in the documentation. +# The default value is: NO. + +EXTRACT_PACKAGE = NO + +# If the EXTRACT_STATIC tag is set to YES, all static members of a file will be +# included in the documentation. +# The default value is: NO. + +EXTRACT_STATIC = NO + +# If the EXTRACT_LOCAL_CLASSES tag is set to YES, classes (and structs) defined +# locally in source files will be included in the documentation. If set to NO, +# only classes defined in header files are included. Does not have any effect +# for Java sources. +# The default value is: YES. + +EXTRACT_LOCAL_CLASSES = YES + +# This flag is only useful for Objective-C code. If set to YES, local methods, +# which are defined in the implementation section but not in the interface are +# included in the documentation. If set to NO, only methods in the interface are +# included. +# The default value is: NO. + +EXTRACT_LOCAL_METHODS = NO + +# If this flag is set to YES, the members of anonymous namespaces will be +# extracted and appear in the documentation as a namespace called +# 'anonymous_namespace{file}', where file will be replaced with the base name of +# the file that contains the anonymous namespace. By default anonymous namespace +# are hidden. +# The default value is: NO. + +EXTRACT_ANON_NSPACES = NO + +# If the HIDE_UNDOC_MEMBERS tag is set to YES, doxygen will hide all +# undocumented members inside documented classes or files. If set to NO these +# members will be included in the various overviews, but no documentation +# section is generated. This option has no effect if EXTRACT_ALL is enabled. +# The default value is: NO. + +HIDE_UNDOC_MEMBERS = NO + +# If the HIDE_UNDOC_CLASSES tag is set to YES, doxygen will hide all +# undocumented classes that are normally visible in the class hierarchy. If set +# to NO, these classes will be included in the various overviews. This option +# has no effect if EXTRACT_ALL is enabled. +# The default value is: NO. + +HIDE_UNDOC_CLASSES = NO + +# If the HIDE_FRIEND_COMPOUNDS tag is set to YES, doxygen will hide all friend +# (class|struct|union) declarations. If set to NO, these declarations will be +# included in the documentation. +# The default value is: NO. + +HIDE_FRIEND_COMPOUNDS = NO + +# If the HIDE_IN_BODY_DOCS tag is set to YES, doxygen will hide any +# documentation blocks found inside the body of a function. If set to NO, these +# blocks will be appended to the function's detailed documentation block. +# The default value is: NO. + +HIDE_IN_BODY_DOCS = NO + +# The INTERNAL_DOCS tag determines if documentation that is typed after a +# \internal command is included. If the tag is set to NO then the documentation +# will be excluded. Set it to YES to include the internal documentation. +# The default value is: NO. + +INTERNAL_DOCS = NO + +# If the CASE_SENSE_NAMES tag is set to NO then doxygen will only generate file +# names in lower-case letters. If set to YES, upper-case letters are also +# allowed. This is useful if you have classes or files whose names only differ +# in case and if your file system supports case sensitive file names. Windows +# and Mac users are advised to set this option to NO. +# The default value is: system dependent. + +CASE_SENSE_NAMES = YES + +# If the HIDE_SCOPE_NAMES tag is set to NO then doxygen will show members with +# their full class and namespace scopes in the documentation. If set to YES, the +# scope will be hidden. +# The default value is: NO. + +HIDE_SCOPE_NAMES = NO + +# If the HIDE_COMPOUND_REFERENCE tag is set to NO (default) then doxygen will +# append additional text to a page's title, such as Class Reference. If set to +# YES the compound reference will be hidden. +# The default value is: NO. + +HIDE_COMPOUND_REFERENCE= NO + +# If the SHOW_INCLUDE_FILES tag is set to YES then doxygen will put a list of +# the files that are included by a file in the documentation of that file. +# The default value is: YES. + +SHOW_INCLUDE_FILES = YES + +# If the SHOW_GROUPED_MEMB_INC tag is set to YES then Doxygen will add for each +# grouped member an include statement to the documentation, telling the reader +# which file to include in order to use the member. +# The default value is: NO. + +SHOW_GROUPED_MEMB_INC = NO + +# If the FORCE_LOCAL_INCLUDES tag is set to YES then doxygen will list include +# files with double quotes in the documentation rather than with sharp brackets. +# The default value is: NO. + +FORCE_LOCAL_INCLUDES = NO + +# If the INLINE_INFO tag is set to YES then a tag [inline] is inserted in the +# documentation for inline members. +# The default value is: YES. + +INLINE_INFO = YES + +# If the SORT_MEMBER_DOCS tag is set to YES then doxygen will sort the +# (detailed) documentation of file and class members alphabetically by member +# name. If set to NO, the members will appear in declaration order. +# The default value is: YES. + +SORT_MEMBER_DOCS = YES + +# If the SORT_BRIEF_DOCS tag is set to YES then doxygen will sort the brief +# descriptions of file, namespace and class members alphabetically by member +# name. If set to NO, the members will appear in declaration order. Note that +# this will also influence the order of the classes in the class list. +# The default value is: NO. + +SORT_BRIEF_DOCS = NO + +# If the SORT_MEMBERS_CTORS_1ST tag is set to YES then doxygen will sort the +# (brief and detailed) documentation of class members so that constructors and +# destructors are listed first. If set to NO the constructors will appear in the +# respective orders defined by SORT_BRIEF_DOCS and SORT_MEMBER_DOCS. +# Note: If SORT_BRIEF_DOCS is set to NO this option is ignored for sorting brief +# member documentation. +# Note: If SORT_MEMBER_DOCS is set to NO this option is ignored for sorting +# detailed member documentation. +# The default value is: NO. + +SORT_MEMBERS_CTORS_1ST = NO + +# If the SORT_GROUP_NAMES tag is set to YES then doxygen will sort the hierarchy +# of group names into alphabetical order. If set to NO the group names will +# appear in their defined order. +# The default value is: NO. + +SORT_GROUP_NAMES = NO + +# If the SORT_BY_SCOPE_NAME tag is set to YES, the class list will be sorted by +# fully-qualified names, including namespaces. If set to NO, the class list will +# be sorted only by class name, not including the namespace part. +# Note: This option is not very useful if HIDE_SCOPE_NAMES is set to YES. +# Note: This option applies only to the class list, not to the alphabetical +# list. +# The default value is: NO. + +SORT_BY_SCOPE_NAME = NO + +# If the STRICT_PROTO_MATCHING option is enabled and doxygen fails to do proper +# type resolution of all parameters of a function it will reject a match between +# the prototype and the implementation of a member function even if there is +# only one candidate or it is obvious which candidate to choose by doing a +# simple string match. By disabling STRICT_PROTO_MATCHING doxygen will still +# accept a match between prototype and implementation in such cases. +# The default value is: NO. + +STRICT_PROTO_MATCHING = NO + +# The GENERATE_TODOLIST tag can be used to enable (YES) or disable (NO) the todo +# list. This list is created by putting \todo commands in the documentation. +# The default value is: YES. + +GENERATE_TODOLIST = YES + +# The GENERATE_TESTLIST tag can be used to enable (YES) or disable (NO) the test +# list. This list is created by putting \test commands in the documentation. +# The default value is: YES. + +GENERATE_TESTLIST = YES + +# The GENERATE_BUGLIST tag can be used to enable (YES) or disable (NO) the bug +# list. This list is created by putting \bug commands in the documentation. +# The default value is: YES. + +GENERATE_BUGLIST = YES + +# The GENERATE_DEPRECATEDLIST tag can be used to enable (YES) or disable (NO) +# the deprecated list. This list is created by putting \deprecated commands in +# the documentation. +# The default value is: YES. + +GENERATE_DEPRECATEDLIST= YES + +# The ENABLED_SECTIONS tag can be used to enable conditional documentation +# sections, marked by \if <section_label> ... \endif and \cond <section_label> +# ... \endcond blocks. + +ENABLED_SECTIONS = + +# The MAX_INITIALIZER_LINES tag determines the maximum number of lines that the +# initial value of a variable or macro / define can have for it to appear in the +# documentation. If the initializer consists of more lines than specified here +# it will be hidden. Use a value of 0 to hide initializers completely. The +# appearance of the value of individual variables and macros / defines can be +# controlled using \showinitializer or \hideinitializer command in the +# documentation regardless of this setting. +# Minimum value: 0, maximum value: 10000, default value: 30. + +MAX_INITIALIZER_LINES = 30 + +# Set the SHOW_USED_FILES tag to NO to disable the list of files generated at +# the bottom of the documentation of classes and structs. If set to YES, the +# list will mention the files that were used to generate the documentation. +# The default value is: YES. + +SHOW_USED_FILES = YES + +# Set the SHOW_FILES tag to NO to disable the generation of the Files page. This +# will remove the Files entry from the Quick Index and from the Folder Tree View +# (if specified). +# The default value is: YES. + +SHOW_FILES = YES + +# Set the SHOW_NAMESPACES tag to NO to disable the generation of the Namespaces +# page. This will remove the Namespaces entry from the Quick Index and from the +# Folder Tree View (if specified). +# The default value is: YES. + +SHOW_NAMESPACES = YES + +# The FILE_VERSION_FILTER tag can be used to specify a program or script that +# doxygen should invoke to get the current version for each file (typically from +# the version control system). Doxygen will invoke the program by executing (via +# popen()) the command command input-file, where command is the value of the +# FILE_VERSION_FILTER tag, and input-file is the name of an input file provided +# by doxygen. Whatever the program writes to standard output is used as the file +# version. For an example see the documentation. + +FILE_VERSION_FILTER = + +# The LAYOUT_FILE tag can be used to specify a layout file which will be parsed +# by doxygen. The layout file controls the global structure of the generated +# output files in an output format independent way. To create the layout file +# that represents doxygen's defaults, run doxygen with the -l option. You can +# optionally specify a file name after the option, if omitted DoxygenLayout.xml +# will be used as the name of the layout file. +# +# Note that if you run doxygen from a directory containing a file called +# DoxygenLayout.xml, doxygen will parse it automatically even if the LAYOUT_FILE +# tag is left empty. + +LAYOUT_FILE = + +# The CITE_BIB_FILES tag can be used to specify one or more bib files containing +# the reference definitions. This must be a list of .bib files. The .bib +# extension is automatically appended if omitted. This requires the bibtex tool +# to be installed. See also http://en.wikipedia.org/wiki/BibTeX for more info. +# For LaTeX the style of the bibliography can be controlled using +# LATEX_BIB_STYLE. To use this feature you need bibtex and perl available in the +# search path. See also \cite for info how to create references. + +CITE_BIB_FILES = + +#--------------------------------------------------------------------------- +# Configuration options related to warning and progress messages +#--------------------------------------------------------------------------- + +# The QUIET tag can be used to turn on/off the messages that are generated to +# standard output by doxygen. If QUIET is set to YES this implies that the +# messages are off. +# The default value is: NO. + +QUIET = NO + +# The WARNINGS tag can be used to turn on/off the warning messages that are +# generated to standard error (stderr) by doxygen. If WARNINGS is set to YES +# this implies that the warnings are on. +# +# Tip: Turn warnings on while writing the documentation. +# The default value is: YES. + +WARNINGS = YES + +# If the WARN_IF_UNDOCUMENTED tag is set to YES then doxygen will generate +# warnings for undocumented members. If EXTRACT_ALL is set to YES then this flag +# will automatically be disabled. +# The default value is: YES. + +WARN_IF_UNDOCUMENTED = YES + +# If the WARN_IF_DOC_ERROR tag is set to YES, doxygen will generate warnings for +# potential errors in the documentation, such as not documenting some parameters +# in a documented function, or documenting parameters that don't exist or using +# markup commands wrongly. +# The default value is: YES. + +WARN_IF_DOC_ERROR = YES + +# This WARN_NO_PARAMDOC option can be enabled to get warnings for functions that +# are documented, but have no documentation for their parameters or return +# value. If set to NO, doxygen will only warn about wrong or incomplete +# parameter documentation, but not about the absence of documentation. +# The default value is: NO. + +WARN_NO_PARAMDOC = NO + +# If the WARN_AS_ERROR tag is set to YES then doxygen will immediately stop when +# a warning is encountered. +# The default value is: NO. + +WARN_AS_ERROR = NO + +# The WARN_FORMAT tag determines the format of the warning messages that doxygen +# can produce. The string should contain the $file, $line, and $text tags, which +# will be replaced by the file and line number from which the warning originated +# and the warning text. Optionally the format may contain $version, which will +# be replaced by the version of the file (if it could be obtained via +# FILE_VERSION_FILTER) +# The default value is: $file:$line: $text. + +WARN_FORMAT = "$file:$line: $text" + +# The WARN_LOGFILE tag can be used to specify a file to which warning and error +# messages should be written. If left blank the output is written to standard +# error (stderr). + +WARN_LOGFILE = + +#--------------------------------------------------------------------------- +# Configuration options related to the input files +#--------------------------------------------------------------------------- + +# The INPUT tag is used to specify the files and/or directories that contain +# documented source files. You may enter file names like myfile.cpp or +# directories like /usr/src/myproject. Separate the files or directories with +# spaces. See also FILE_PATTERNS and EXTENSION_MAPPING +# Note: If this tag is empty the current directory is searched. + +INPUT = @CMAKE_CURRENT_SOURCE_DIR@/../src + +# This tag can be used to specify the character encoding of the source files +# that doxygen parses. Internally doxygen uses the UTF-8 encoding. Doxygen uses +# libiconv (or the iconv built into libc) for the transcoding. See the libiconv +# documentation (see: http://www.gnu.org/software/libiconv) for the list of +# possible encodings. +# The default value is: UTF-8. + +INPUT_ENCODING = UTF-8 + +# If the value of the INPUT tag contains directories, you can use the +# FILE_PATTERNS tag to specify one or more wildcard patterns (like *.cpp and +# *.h) to filter out the source-files in the directories. +# +# Note that for custom extensions or not directly supported extensions you also +# need to set EXTENSION_MAPPING for the extension otherwise the files are not +# read by doxygen. +# +# If left blank the following patterns are tested:*.c, *.cc, *.cxx, *.cpp, +# *.c++, *.java, *.ii, *.ixx, *.ipp, *.i++, *.inl, *.idl, *.ddl, *.odl, *.h, +# *.hh, *.hxx, *.hpp, *.h++, *.cs, *.d, *.php, *.php4, *.php5, *.phtml, *.inc, +# *.m, *.markdown, *.md, *.mm, *.dox, *.py, *.pyw, *.f90, *.f95, *.f03, *.f08, +# *.f, *.for, *.tcl, *.vhd, *.vhdl, *.ucf and *.qsf. + +FILE_PATTERNS = *.c \ + *.cc \ + *.cxx \ + *.cpp \ + *.c++ \ + *.java \ + *.ii \ + *.ixx \ + *.ipp \ + *.i++ \ + *.inl \ + *.idl \ + *.ddl \ + *.odl \ + *.h \ + *.hh \ + *.hxx \ + *.hpp \ + *.h++ \ + *.cs \ + *.d \ + *.php \ + *.php4 \ + *.php5 \ + *.phtml \ + *.inc \ + *.m \ + *.markdown \ + *.md \ + *.mm \ + *.dox \ + *.py \ + *.pyw \ + *.f90 \ + *.f95 \ + *.f03 \ + *.f08 \ + *.f \ + *.for \ + *.tcl \ + *.vhd \ + *.vhdl \ + *.ucf \ + *.qsf + +# The RECURSIVE tag can be used to specify whether or not subdirectories should +# be searched for input files as well. +# The default value is: NO. + +RECURSIVE = NO + +# The EXCLUDE tag can be used to specify files and/or directories that should be +# excluded from the INPUT source files. This way you can easily exclude a +# subdirectory from a directory tree whose root is specified with the INPUT tag. +# +# Note that relative paths are relative to the directory from which doxygen is +# run. + +EXCLUDE = + +# The EXCLUDE_SYMLINKS tag can be used to select whether or not files or +# directories that are symbolic links (a Unix file system feature) are excluded +# from the input. +# The default value is: NO. + +EXCLUDE_SYMLINKS = NO + +# If the value of the INPUT tag contains directories, you can use the +# EXCLUDE_PATTERNS tag to specify one or more wildcard patterns to exclude +# certain files from those directories. +# +# Note that the wildcards are matched against the file with absolute path, so to +# exclude all test directories for example use the pattern */test/* + +EXCLUDE_PATTERNS = + +# The EXCLUDE_SYMBOLS tag can be used to specify one or more symbol names +# (namespaces, classes, functions, etc.) that should be excluded from the +# output. The symbol name can be a fully qualified name, a word, or if the +# wildcard * is used, a substring. Examples: ANamespace, AClass, +# AClass::ANamespace, ANamespace::*Test +# +# Note that the wildcards are matched against the file with absolute path, so to +# exclude all test directories use the pattern */test/* + +EXCLUDE_SYMBOLS = + +# The EXAMPLE_PATH tag can be used to specify one or more files or directories +# that contain example code fragments that are included (see the \include +# command). + +EXAMPLE_PATH = + +# If the value of the EXAMPLE_PATH tag contains directories, you can use the +# EXAMPLE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp and +# *.h) to filter out the source-files in the directories. If left blank all +# files are included. + +EXAMPLE_PATTERNS = * + +# If the EXAMPLE_RECURSIVE tag is set to YES then subdirectories will be +# searched for input files to be used with the \include or \dontinclude commands +# irrespective of the value of the RECURSIVE tag. +# The default value is: NO. + +EXAMPLE_RECURSIVE = NO + +# The IMAGE_PATH tag can be used to specify one or more files or directories +# that contain images that are to be included in the documentation (see the +# \image command). + +IMAGE_PATH = + +# The INPUT_FILTER tag can be used to specify a program that doxygen should +# invoke to filter for each input file. Doxygen will invoke the filter program +# by executing (via popen()) the command: +# +# <filter> <input-file> +# +# where <filter> is the value of the INPUT_FILTER tag, and <input-file> is the +# name of an input file. Doxygen will then use the output that the filter +# program writes to standard output. If FILTER_PATTERNS is specified, this tag +# will be ignored. +# +# Note that the filter must not add or remove lines; it is applied before the +# code is scanned, but not when the output code is generated. If lines are added +# or removed, the anchors will not be placed correctly. +# +# Note that for custom extensions or not directly supported extensions you also +# need to set EXTENSION_MAPPING for the extension otherwise the files are not +# properly processed by doxygen. + +INPUT_FILTER = + +# The FILTER_PATTERNS tag can be used to specify filters on a per file pattern +# basis. Doxygen will compare the file name with each pattern and apply the +# filter if there is a match. The filters are a list of the form: pattern=filter +# (like *.cpp=my_cpp_filter). See INPUT_FILTER for further information on how +# filters are used. If the FILTER_PATTERNS tag is empty or if none of the +# patterns match the file name, INPUT_FILTER is applied. +# +# Note that for custom extensions or not directly supported extensions you also +# need to set EXTENSION_MAPPING for the extension otherwise the files are not +# properly processed by doxygen. + +FILTER_PATTERNS = + +# If the FILTER_SOURCE_FILES tag is set to YES, the input filter (if set using +# INPUT_FILTER) will also be used to filter the input files that are used for +# producing the source files to browse (i.e. when SOURCE_BROWSER is set to YES). +# The default value is: NO. + +FILTER_SOURCE_FILES = NO + +# The FILTER_SOURCE_PATTERNS tag can be used to specify source filters per file +# pattern. A pattern will override the setting for FILTER_PATTERN (if any) and +# it is also possible to disable source filtering for a specific pattern using +# *.ext= (so without naming a filter). +# This tag requires that the tag FILTER_SOURCE_FILES is set to YES. + +FILTER_SOURCE_PATTERNS = + +# If the USE_MDFILE_AS_MAINPAGE tag refers to the name of a markdown file that +# is part of the input, its contents will be placed on the main page +# (index.html). This can be useful if you have a project on for instance GitHub +# and want to reuse the introduction page also for the doxygen output. + +USE_MDFILE_AS_MAINPAGE = + +#--------------------------------------------------------------------------- +# Configuration options related to source browsing +#--------------------------------------------------------------------------- + +# If the SOURCE_BROWSER tag is set to YES then a list of source files will be +# generated. Documented entities will be cross-referenced with these sources. +# +# Note: To get rid of all source code in the generated output, make sure that +# also VERBATIM_HEADERS is set to NO. +# The default value is: NO. + +SOURCE_BROWSER = NO + +# Setting the INLINE_SOURCES tag to YES will include the body of functions, +# classes and enums directly into the documentation. +# The default value is: NO. + +INLINE_SOURCES = NO + +# Setting the STRIP_CODE_COMMENTS tag to YES will instruct doxygen to hide any +# special comment blocks from generated source code fragments. Normal C, C++ and +# Fortran comments will always remain visible. +# The default value is: YES. + +STRIP_CODE_COMMENTS = YES + +# If the REFERENCED_BY_RELATION tag is set to YES then for each documented +# function all documented functions referencing it will be listed. +# The default value is: NO. + +REFERENCED_BY_RELATION = NO + +# If the REFERENCES_RELATION tag is set to YES then for each documented function +# all documented entities called/used by that function will be listed. +# The default value is: NO. + +REFERENCES_RELATION = NO + +# If the REFERENCES_LINK_SOURCE tag is set to YES and SOURCE_BROWSER tag is set +# to YES then the hyperlinks from functions in REFERENCES_RELATION and +# REFERENCED_BY_RELATION lists will link to the source code. Otherwise they will +# link to the documentation. +# The default value is: YES. + +REFERENCES_LINK_SOURCE = YES + +# If SOURCE_TOOLTIPS is enabled (the default) then hovering a hyperlink in the +# source code will show a tooltip with additional information such as prototype, +# brief description and links to the definition and documentation. Since this +# will make the HTML file larger and loading of large files a bit slower, you +# can opt to disable this feature. +# The default value is: YES. +# This tag requires that the tag SOURCE_BROWSER is set to YES. + +SOURCE_TOOLTIPS = YES + +# If the USE_HTAGS tag is set to YES then the references to source code will +# point to the HTML generated by the htags(1) tool instead of doxygen built-in +# source browser. The htags tool is part of GNU's global source tagging system +# (see http://www.gnu.org/software/global/global.html). You will need version +# 4.8.6 or higher. +# +# To use it do the following: +# - Install the latest version of global +# - Enable SOURCE_BROWSER and USE_HTAGS in the config file +# - Make sure the INPUT points to the root of the source tree +# - Run doxygen as normal +# +# Doxygen will invoke htags (and that will in turn invoke gtags), so these +# tools must be available from the command line (i.e. in the search path). +# +# The result: instead of the source browser generated by doxygen, the links to +# source code will now point to the output of htags. +# The default value is: NO. +# This tag requires that the tag SOURCE_BROWSER is set to YES. + +USE_HTAGS = NO + +# If the VERBATIM_HEADERS tag is set the YES then doxygen will generate a +# verbatim copy of the header file for each class for which an include is +# specified. Set to NO to disable this. +# See also: Section \class. +# The default value is: YES. + +VERBATIM_HEADERS = YES + +# If the CLANG_ASSISTED_PARSING tag is set to YES then doxygen will use the +# clang parser (see: http://clang.llvm.org/) for more accurate parsing at the +# cost of reduced performance. This can be particularly helpful with template +# rich C++ code for which doxygen's built-in parser lacks the necessary type +# information. +# Note: The availability of this option depends on whether or not doxygen was +# generated with the -Duse-libclang=ON option for CMake. +# The default value is: NO. + +CLANG_ASSISTED_PARSING = NO + +# If clang assisted parsing is enabled you can provide the compiler with command +# line options that you would normally use when invoking the compiler. Note that +# the include paths will already be set by doxygen for the files and directories +# specified with INPUT and INCLUDE_PATH. +# This tag requires that the tag CLANG_ASSISTED_PARSING is set to YES. + +CLANG_OPTIONS = + +#--------------------------------------------------------------------------- +# Configuration options related to the alphabetical class index +#--------------------------------------------------------------------------- + +# If the ALPHABETICAL_INDEX tag is set to YES, an alphabetical index of all +# compounds will be generated. Enable this if the project contains a lot of +# classes, structs, unions or interfaces. +# The default value is: YES. + +ALPHABETICAL_INDEX = YES + +# The COLS_IN_ALPHA_INDEX tag can be used to specify the number of columns in +# which the alphabetical index list will be split. +# Minimum value: 1, maximum value: 20, default value: 5. +# This tag requires that the tag ALPHABETICAL_INDEX is set to YES. + +COLS_IN_ALPHA_INDEX = 5 + +# In case all classes in a project start with a common prefix, all classes will +# be put under the same header in the alphabetical index. The IGNORE_PREFIX tag +# can be used to specify a prefix (or a list of prefixes) that should be ignored +# while generating the index headers. +# This tag requires that the tag ALPHABETICAL_INDEX is set to YES. + +IGNORE_PREFIX = + +#--------------------------------------------------------------------------- +# Configuration options related to the HTML output +#--------------------------------------------------------------------------- + +# If the GENERATE_HTML tag is set to YES, doxygen will generate HTML output +# The default value is: YES. + +GENERATE_HTML = YES + +# The HTML_OUTPUT tag is used to specify where the HTML docs will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. +# The default directory is: html. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_OUTPUT = html + +# The HTML_FILE_EXTENSION tag can be used to specify the file extension for each +# generated HTML page (for example: .htm, .php, .asp). +# The default value is: .html. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_FILE_EXTENSION = .html + +# The HTML_HEADER tag can be used to specify a user-defined HTML header file for +# each generated HTML page. If the tag is left blank doxygen will generate a +# standard header. +# +# To get valid HTML the header file that includes any scripts and style sheets +# that doxygen needs, which is dependent on the configuration options used (e.g. +# the setting GENERATE_TREEVIEW). It is highly recommended to start with a +# default header using +# doxygen -w html new_header.html new_footer.html new_stylesheet.css +# YourConfigFile +# and then modify the file new_header.html. See also section "Doxygen usage" +# for information on how to generate the default header that doxygen normally +# uses. +# Note: The header is subject to change so you typically have to regenerate the +# default header when upgrading to a newer version of doxygen. For a description +# of the possible markers and block names see the documentation. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_HEADER = + +# The HTML_FOOTER tag can be used to specify a user-defined HTML footer for each +# generated HTML page. If the tag is left blank doxygen will generate a standard +# footer. See HTML_HEADER for more information on how to generate a default +# footer and what special commands can be used inside the footer. See also +# section "Doxygen usage" for information on how to generate the default footer +# that doxygen normally uses. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_FOOTER = + +# The HTML_STYLESHEET tag can be used to specify a user-defined cascading style +# sheet that is used by each HTML page. It can be used to fine-tune the look of +# the HTML output. If left blank doxygen will generate a default style sheet. +# See also section "Doxygen usage" for information on how to generate the style +# sheet that doxygen normally uses. +# Note: It is recommended to use HTML_EXTRA_STYLESHEET instead of this tag, as +# it is more robust and this tag (HTML_STYLESHEET) will in the future become +# obsolete. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_STYLESHEET = + +# The HTML_EXTRA_STYLESHEET tag can be used to specify additional user-defined +# cascading style sheets that are included after the standard style sheets +# created by doxygen. Using this option one can overrule certain style aspects. +# This is preferred over using HTML_STYLESHEET since it does not replace the +# standard style sheet and is therefore more robust against future updates. +# Doxygen will copy the style sheet files to the output directory. +# Note: The order of the extra style sheet files is of importance (e.g. the last +# style sheet in the list overrules the setting of the previous ones in the +# list). For an example see the documentation. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_EXTRA_STYLESHEET = + +# The HTML_EXTRA_FILES tag can be used to specify one or more extra images or +# other source files which should be copied to the HTML output directory. Note +# that these files will be copied to the base HTML output directory. Use the +# $relpath^ marker in the HTML_HEADER and/or HTML_FOOTER files to load these +# files. In the HTML_STYLESHEET file, use the file name only. Also note that the +# files will be copied as-is; there are no commands or markers available. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_EXTRA_FILES = + +# The HTML_COLORSTYLE_HUE tag controls the color of the HTML output. Doxygen +# will adjust the colors in the style sheet and background images according to +# this color. Hue is specified as an angle on a colorwheel, see +# http://en.wikipedia.org/wiki/Hue for more information. For instance the value +# 0 represents red, 60 is yellow, 120 is green, 180 is cyan, 240 is blue, 300 +# purple, and 360 is red again. +# Minimum value: 0, maximum value: 359, default value: 220. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_COLORSTYLE_HUE = 220 + +# The HTML_COLORSTYLE_SAT tag controls the purity (or saturation) of the colors +# in the HTML output. For a value of 0 the output will use grayscales only. A +# value of 255 will produce the most vivid colors. +# Minimum value: 0, maximum value: 255, default value: 100. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_COLORSTYLE_SAT = 100 + +# The HTML_COLORSTYLE_GAMMA tag controls the gamma correction applied to the +# luminance component of the colors in the HTML output. Values below 100 +# gradually make the output lighter, whereas values above 100 make the output +# darker. The value divided by 100 is the actual gamma applied, so 80 represents +# a gamma of 0.8, The value 220 represents a gamma of 2.2, and 100 does not +# change the gamma. +# Minimum value: 40, maximum value: 240, default value: 80. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_COLORSTYLE_GAMMA = 80 + +# If the HTML_TIMESTAMP tag is set to YES then the footer of each generated HTML +# page will contain the date and time when the page was generated. Setting this +# to YES can help to show when doxygen was last run and thus if the +# documentation is up to date. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_TIMESTAMP = NO + +# If the HTML_DYNAMIC_SECTIONS tag is set to YES then the generated HTML +# documentation will contain sections that can be hidden and shown after the +# page has loaded. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_DYNAMIC_SECTIONS = NO + +# With HTML_INDEX_NUM_ENTRIES one can control the preferred number of entries +# shown in the various tree structured indices initially; the user can expand +# and collapse entries dynamically later on. Doxygen will expand the tree to +# such a level that at most the specified number of entries are visible (unless +# a fully collapsed tree already exceeds this amount). So setting the number of +# entries 1 will produce a full collapsed tree by default. 0 is a special value +# representing an infinite number of entries and will result in a full expanded +# tree by default. +# Minimum value: 0, maximum value: 9999, default value: 100. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_INDEX_NUM_ENTRIES = 100 + +# If the GENERATE_DOCSET tag is set to YES, additional index files will be +# generated that can be used as input for Apple's Xcode 3 integrated development +# environment (see: http://developer.apple.com/tools/xcode/), introduced with +# OSX 10.5 (Leopard). To create a documentation set, doxygen will generate a +# Makefile in the HTML output directory. Running make will produce the docset in +# that directory and running make install will install the docset in +# ~/Library/Developer/Shared/Documentation/DocSets so that Xcode will find it at +# startup. See http://developer.apple.com/tools/creatingdocsetswithdoxygen.html +# for more information. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_DOCSET = NO + +# This tag determines the name of the docset feed. A documentation feed provides +# an umbrella under which multiple documentation sets from a single provider +# (such as a company or product suite) can be grouped. +# The default value is: Doxygen generated docs. +# This tag requires that the tag GENERATE_DOCSET is set to YES. + +DOCSET_FEEDNAME = "Doxygen generated docs" + +# This tag specifies a string that should uniquely identify the documentation +# set bundle. This should be a reverse domain-name style string, e.g. +# com.mycompany.MyDocSet. Doxygen will append .docset to the name. +# The default value is: org.doxygen.Project. +# This tag requires that the tag GENERATE_DOCSET is set to YES. + +DOCSET_BUNDLE_ID = org.doxygen.Project + +# The DOCSET_PUBLISHER_ID tag specifies a string that should uniquely identify +# the documentation publisher. This should be a reverse domain-name style +# string, e.g. com.mycompany.MyDocSet.documentation. +# The default value is: org.doxygen.Publisher. +# This tag requires that the tag GENERATE_DOCSET is set to YES. + +DOCSET_PUBLISHER_ID = org.doxygen.Publisher + +# The DOCSET_PUBLISHER_NAME tag identifies the documentation publisher. +# The default value is: Publisher. +# This tag requires that the tag GENERATE_DOCSET is set to YES. + +DOCSET_PUBLISHER_NAME = Publisher + +# If the GENERATE_HTMLHELP tag is set to YES then doxygen generates three +# additional HTML index files: index.hhp, index.hhc, and index.hhk. The +# index.hhp is a project file that can be read by Microsoft's HTML Help Workshop +# (see: http://www.microsoft.com/en-us/download/details.aspx?id=21138) on +# Windows. +# +# The HTML Help Workshop contains a compiler that can convert all HTML output +# generated by doxygen into a single compiled HTML file (.chm). Compiled HTML +# files are now used as the Windows 98 help format, and will replace the old +# Windows help format (.hlp) on all Windows platforms in the future. Compressed +# HTML files also contain an index, a table of contents, and you can search for +# words in the documentation. The HTML workshop also contains a viewer for +# compressed HTML files. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_HTMLHELP = NO + +# The CHM_FILE tag can be used to specify the file name of the resulting .chm +# file. You can add a path in front of the file if the result should not be +# written to the html output directory. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +CHM_FILE = + +# The HHC_LOCATION tag can be used to specify the location (absolute path +# including file name) of the HTML help compiler (hhc.exe). If non-empty, +# doxygen will try to run the HTML help compiler on the generated index.hhp. +# The file has to be specified with full path. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +HHC_LOCATION = + +# The GENERATE_CHI flag controls if a separate .chi index file is generated +# (YES) or that it should be included in the master .chm file (NO). +# The default value is: NO. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +GENERATE_CHI = NO + +# The CHM_INDEX_ENCODING is used to encode HtmlHelp index (hhk), content (hhc) +# and project file content. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +CHM_INDEX_ENCODING = + +# The BINARY_TOC flag controls whether a binary table of contents is generated +# (YES) or a normal table of contents (NO) in the .chm file. Furthermore it +# enables the Previous and Next buttons. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +BINARY_TOC = NO + +# The TOC_EXPAND flag can be set to YES to add extra items for group members to +# the table of contents of the HTML help documentation and to the tree view. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +TOC_EXPAND = NO + +# If the GENERATE_QHP tag is set to YES and both QHP_NAMESPACE and +# QHP_VIRTUAL_FOLDER are set, an additional index file will be generated that +# can be used as input for Qt's qhelpgenerator to generate a Qt Compressed Help +# (.qch) of the generated HTML documentation. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_QHP = NO + +# If the QHG_LOCATION tag is specified, the QCH_FILE tag can be used to specify +# the file name of the resulting .qch file. The path specified is relative to +# the HTML output folder. +# This tag requires that the tag GENERATE_QHP is set to YES. + +QCH_FILE = + +# The QHP_NAMESPACE tag specifies the namespace to use when generating Qt Help +# Project output. For more information please see Qt Help Project / Namespace +# (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#namespace). +# The default value is: org.doxygen.Project. +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_NAMESPACE = org.doxygen.Project + +# The QHP_VIRTUAL_FOLDER tag specifies the namespace to use when generating Qt +# Help Project output. For more information please see Qt Help Project / Virtual +# Folders (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#virtual- +# folders). +# The default value is: doc. +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_VIRTUAL_FOLDER = doc + +# If the QHP_CUST_FILTER_NAME tag is set, it specifies the name of a custom +# filter to add. For more information please see Qt Help Project / Custom +# Filters (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#custom- +# filters). +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_CUST_FILTER_NAME = + +# The QHP_CUST_FILTER_ATTRS tag specifies the list of the attributes of the +# custom filter to add. For more information please see Qt Help Project / Custom +# Filters (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#custom- +# filters). +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_CUST_FILTER_ATTRS = + +# The QHP_SECT_FILTER_ATTRS tag specifies the list of the attributes this +# project's filter section matches. Qt Help Project / Filter Attributes (see: +# http://qt-project.org/doc/qt-4.8/qthelpproject.html#filter-attributes). +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_SECT_FILTER_ATTRS = + +# The QHG_LOCATION tag can be used to specify the location of Qt's +# qhelpgenerator. If non-empty doxygen will try to run qhelpgenerator on the +# generated .qhp file. +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHG_LOCATION = + +# If the GENERATE_ECLIPSEHELP tag is set to YES, additional index files will be +# generated, together with the HTML files, they form an Eclipse help plugin. To +# install this plugin and make it available under the help contents menu in +# Eclipse, the contents of the directory containing the HTML and XML files needs +# to be copied into the plugins directory of eclipse. The name of the directory +# within the plugins directory should be the same as the ECLIPSE_DOC_ID value. +# After copying Eclipse needs to be restarted before the help appears. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_ECLIPSEHELP = NO + +# A unique identifier for the Eclipse help plugin. When installing the plugin +# the directory name containing the HTML and XML files should also have this +# name. Each documentation set should have its own identifier. +# The default value is: org.doxygen.Project. +# This tag requires that the tag GENERATE_ECLIPSEHELP is set to YES. + +ECLIPSE_DOC_ID = org.doxygen.Project + +# If you want full control over the layout of the generated HTML pages it might +# be necessary to disable the index and replace it with your own. The +# DISABLE_INDEX tag can be used to turn on/off the condensed index (tabs) at top +# of each HTML page. A value of NO enables the index and the value YES disables +# it. Since the tabs in the index contain the same information as the navigation +# tree, you can set this option to YES if you also set GENERATE_TREEVIEW to YES. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +DISABLE_INDEX = NO + +# The GENERATE_TREEVIEW tag is used to specify whether a tree-like index +# structure should be generated to display hierarchical information. If the tag +# value is set to YES, a side panel will be generated containing a tree-like +# index structure (just like the one that is generated for HTML Help). For this +# to work a browser that supports JavaScript, DHTML, CSS and frames is required +# (i.e. any modern browser). Windows users are probably better off using the +# HTML help feature. Via custom style sheets (see HTML_EXTRA_STYLESHEET) one can +# further fine-tune the look of the index. As an example, the default style +# sheet generated by doxygen has an example that shows how to put an image at +# the root of the tree instead of the PROJECT_NAME. Since the tree basically has +# the same information as the tab index, you could consider setting +# DISABLE_INDEX to YES when enabling this option. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_TREEVIEW = NO + +# The ENUM_VALUES_PER_LINE tag can be used to set the number of enum values that +# doxygen will group on one line in the generated HTML documentation. +# +# Note that a value of 0 will completely suppress the enum values from appearing +# in the overview section. +# Minimum value: 0, maximum value: 20, default value: 4. +# This tag requires that the tag GENERATE_HTML is set to YES. + +ENUM_VALUES_PER_LINE = 4 + +# If the treeview is enabled (see GENERATE_TREEVIEW) then this tag can be used +# to set the initial width (in pixels) of the frame in which the tree is shown. +# Minimum value: 0, maximum value: 1500, default value: 250. +# This tag requires that the tag GENERATE_HTML is set to YES. + +TREEVIEW_WIDTH = 250 + +# If the EXT_LINKS_IN_WINDOW option is set to YES, doxygen will open links to +# external symbols imported via tag files in a separate window. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +EXT_LINKS_IN_WINDOW = NO + +# Use this tag to change the font size of LaTeX formulas included as images in +# the HTML documentation. When you change the font size after a successful +# doxygen run you need to manually remove any form_*.png images from the HTML +# output directory to force them to be regenerated. +# Minimum value: 8, maximum value: 50, default value: 10. +# This tag requires that the tag GENERATE_HTML is set to YES. + +FORMULA_FONTSIZE = 10 + +# Use the FORMULA_TRANPARENT tag to determine whether or not the images +# generated for formulas are transparent PNGs. Transparent PNGs are not +# supported properly for IE 6.0, but are supported on all modern browsers. +# +# Note that when changing this option you need to delete any form_*.png files in +# the HTML output directory before the changes have effect. +# The default value is: YES. +# This tag requires that the tag GENERATE_HTML is set to YES. + +FORMULA_TRANSPARENT = YES + +# Enable the USE_MATHJAX option to render LaTeX formulas using MathJax (see +# http://www.mathjax.org) which uses client side Javascript for the rendering +# instead of using pre-rendered bitmaps. Use this if you do not have LaTeX +# installed or if you want to formulas look prettier in the HTML output. When +# enabled you may also need to install MathJax separately and configure the path +# to it using the MATHJAX_RELPATH option. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +USE_MATHJAX = NO + +# When MathJax is enabled you can set the default output format to be used for +# the MathJax output. See the MathJax site (see: +# http://docs.mathjax.org/en/latest/output.html) for more details. +# Possible values are: HTML-CSS (which is slower, but has the best +# compatibility), NativeMML (i.e. MathML) and SVG. +# The default value is: HTML-CSS. +# This tag requires that the tag USE_MATHJAX is set to YES. + +MATHJAX_FORMAT = HTML-CSS + +# When MathJax is enabled you need to specify the location relative to the HTML +# output directory using the MATHJAX_RELPATH option. The destination directory +# should contain the MathJax.js script. For instance, if the mathjax directory +# is located at the same level as the HTML output directory, then +# MATHJAX_RELPATH should be ../mathjax. The default value points to the MathJax +# Content Delivery Network so you can quickly see the result without installing +# MathJax. However, it is strongly recommended to install a local copy of +# MathJax from http://www.mathjax.org before deployment. +# The default value is: http://cdn.mathjax.org/mathjax/latest. +# This tag requires that the tag USE_MATHJAX is set to YES. + +MATHJAX_RELPATH = http://cdn.mathjax.org/mathjax/latest + +# The MATHJAX_EXTENSIONS tag can be used to specify one or more MathJax +# extension names that should be enabled during MathJax rendering. For example +# MATHJAX_EXTENSIONS = TeX/AMSmath TeX/AMSsymbols +# This tag requires that the tag USE_MATHJAX is set to YES. + +MATHJAX_EXTENSIONS = + +# The MATHJAX_CODEFILE tag can be used to specify a file with javascript pieces +# of code that will be used on startup of the MathJax code. See the MathJax site +# (see: http://docs.mathjax.org/en/latest/output.html) for more details. For an +# example see the documentation. +# This tag requires that the tag USE_MATHJAX is set to YES. + +MATHJAX_CODEFILE = + +# When the SEARCHENGINE tag is enabled doxygen will generate a search box for +# the HTML output. The underlying search engine uses javascript and DHTML and +# should work on any modern browser. Note that when using HTML help +# (GENERATE_HTMLHELP), Qt help (GENERATE_QHP), or docsets (GENERATE_DOCSET) +# there is already a search function so this one should typically be disabled. +# For large projects the javascript based search engine can be slow, then +# enabling SERVER_BASED_SEARCH may provide a better solution. It is possible to +# search using the keyboard; to jump to the search box use <access key> + S +# (what the <access key> is depends on the OS and browser, but it is typically +# <CTRL>, <ALT>/<option>, or both). Inside the search box use the <cursor down +# key> to jump into the search results window, the results can be navigated +# using the <cursor keys>. Press <Enter> to select an item or <escape> to cancel +# the search. The filter options can be selected when the cursor is inside the +# search box by pressing <Shift>+<cursor down>. Also here use the <cursor keys> +# to select a filter and <Enter> or <escape> to activate or cancel the filter +# option. +# The default value is: YES. +# This tag requires that the tag GENERATE_HTML is set to YES. + +SEARCHENGINE = YES + +# When the SERVER_BASED_SEARCH tag is enabled the search engine will be +# implemented using a web server instead of a web client using Javascript. There +# are two flavors of web server based searching depending on the EXTERNAL_SEARCH +# setting. When disabled, doxygen will generate a PHP script for searching and +# an index file used by the script. When EXTERNAL_SEARCH is enabled the indexing +# and searching needs to be provided by external tools. See the section +# "External Indexing and Searching" for details. +# The default value is: NO. +# This tag requires that the tag SEARCHENGINE is set to YES. + +SERVER_BASED_SEARCH = NO + +# When EXTERNAL_SEARCH tag is enabled doxygen will no longer generate the PHP +# script for searching. Instead the search results are written to an XML file +# which needs to be processed by an external indexer. Doxygen will invoke an +# external search engine pointed to by the SEARCHENGINE_URL option to obtain the +# search results. +# +# Doxygen ships with an example indexer (doxyindexer) and search engine +# (doxysearch.cgi) which are based on the open source search engine library +# Xapian (see: http://xapian.org/). +# +# See the section "External Indexing and Searching" for details. +# The default value is: NO. +# This tag requires that the tag SEARCHENGINE is set to YES. + +EXTERNAL_SEARCH = NO + +# The SEARCHENGINE_URL should point to a search engine hosted by a web server +# which will return the search results when EXTERNAL_SEARCH is enabled. +# +# Doxygen ships with an example indexer (doxyindexer) and search engine +# (doxysearch.cgi) which are based on the open source search engine library +# Xapian (see: http://xapian.org/). See the section "External Indexing and +# Searching" for details. +# This tag requires that the tag SEARCHENGINE is set to YES. + +SEARCHENGINE_URL = + +# When SERVER_BASED_SEARCH and EXTERNAL_SEARCH are both enabled the unindexed +# search data is written to a file for indexing by an external tool. With the +# SEARCHDATA_FILE tag the name of this file can be specified. +# The default file is: searchdata.xml. +# This tag requires that the tag SEARCHENGINE is set to YES. + +SEARCHDATA_FILE = searchdata.xml + +# When SERVER_BASED_SEARCH and EXTERNAL_SEARCH are both enabled the +# EXTERNAL_SEARCH_ID tag can be used as an identifier for the project. This is +# useful in combination with EXTRA_SEARCH_MAPPINGS to search through multiple +# projects and redirect the results back to the right project. +# This tag requires that the tag SEARCHENGINE is set to YES. + +EXTERNAL_SEARCH_ID = + +# The EXTRA_SEARCH_MAPPINGS tag can be used to enable searching through doxygen +# projects other than the one defined by this configuration file, but that are +# all added to the same external search index. Each project needs to have a +# unique id set via EXTERNAL_SEARCH_ID. The search mapping then maps the id of +# to a relative location where the documentation can be found. The format is: +# EXTRA_SEARCH_MAPPINGS = tagname1=loc1 tagname2=loc2 ... +# This tag requires that the tag SEARCHENGINE is set to YES. + +EXTRA_SEARCH_MAPPINGS = + +#--------------------------------------------------------------------------- +# Configuration options related to the LaTeX output +#--------------------------------------------------------------------------- + +# If the GENERATE_LATEX tag is set to YES, doxygen will generate LaTeX output. +# The default value is: YES. + +GENERATE_LATEX = YES + +# The LATEX_OUTPUT tag is used to specify where the LaTeX docs will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. +# The default directory is: latex. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_OUTPUT = latex + +# The LATEX_CMD_NAME tag can be used to specify the LaTeX command name to be +# invoked. +# +# Note that when enabling USE_PDFLATEX this option is only used for generating +# bitmaps for formulas in the HTML output, but not in the Makefile that is +# written to the output directory. +# The default file is: latex. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_CMD_NAME = latex + +# The MAKEINDEX_CMD_NAME tag can be used to specify the command name to generate +# index for LaTeX. +# The default file is: makeindex. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +MAKEINDEX_CMD_NAME = makeindex + +# If the COMPACT_LATEX tag is set to YES, doxygen generates more compact LaTeX +# documents. This may be useful for small projects and may help to save some +# trees in general. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +COMPACT_LATEX = NO + +# The PAPER_TYPE tag can be used to set the paper type that is used by the +# printer. +# Possible values are: a4 (210 x 297 mm), letter (8.5 x 11 inches), legal (8.5 x +# 14 inches) and executive (7.25 x 10.5 inches). +# The default value is: a4. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +PAPER_TYPE = a4 + +# The EXTRA_PACKAGES tag can be used to specify one or more LaTeX package names +# that should be included in the LaTeX output. The package can be specified just +# by its name or with the correct syntax as to be used with the LaTeX +# \usepackage command. To get the times font for instance you can specify : +# EXTRA_PACKAGES=times or EXTRA_PACKAGES={times} +# To use the option intlimits with the amsmath package you can specify: +# EXTRA_PACKAGES=[intlimits]{amsmath} +# If left blank no extra packages will be included. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +EXTRA_PACKAGES = + +# The LATEX_HEADER tag can be used to specify a personal LaTeX header for the +# generated LaTeX document. The header should contain everything until the first +# chapter. If it is left blank doxygen will generate a standard header. See +# section "Doxygen usage" for information on how to let doxygen write the +# default header to a separate file. +# +# Note: Only use a user-defined header if you know what you are doing! The +# following commands have a special meaning inside the header: $title, +# $datetime, $date, $doxygenversion, $projectname, $projectnumber, +# $projectbrief, $projectlogo. Doxygen will replace $title with the empty +# string, for the replacement values of the other commands the user is referred +# to HTML_HEADER. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_HEADER = + +# The LATEX_FOOTER tag can be used to specify a personal LaTeX footer for the +# generated LaTeX document. The footer should contain everything after the last +# chapter. If it is left blank doxygen will generate a standard footer. See +# LATEX_HEADER for more information on how to generate a default footer and what +# special commands can be used inside the footer. +# +# Note: Only use a user-defined footer if you know what you are doing! +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_FOOTER = + +# The LATEX_EXTRA_STYLESHEET tag can be used to specify additional user-defined +# LaTeX style sheets that are included after the standard style sheets created +# by doxygen. Using this option one can overrule certain style aspects. Doxygen +# will copy the style sheet files to the output directory. +# Note: The order of the extra style sheet files is of importance (e.g. the last +# style sheet in the list overrules the setting of the previous ones in the +# list). +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_EXTRA_STYLESHEET = + +# The LATEX_EXTRA_FILES tag can be used to specify one or more extra images or +# other source files which should be copied to the LATEX_OUTPUT output +# directory. Note that the files will be copied as-is; there are no commands or +# markers available. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_EXTRA_FILES = + +# If the PDF_HYPERLINKS tag is set to YES, the LaTeX that is generated is +# prepared for conversion to PDF (using ps2pdf or pdflatex). The PDF file will +# contain links (just like the HTML output) instead of page references. This +# makes the output suitable for online browsing using a PDF viewer. +# The default value is: YES. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +PDF_HYPERLINKS = YES + +# If the USE_PDFLATEX tag is set to YES, doxygen will use pdflatex to generate +# the PDF file directly from the LaTeX files. Set this option to YES, to get a +# higher quality PDF documentation. +# The default value is: YES. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +USE_PDFLATEX = YES + +# If the LATEX_BATCHMODE tag is set to YES, doxygen will add the \batchmode +# command to the generated LaTeX files. This will instruct LaTeX to keep running +# if errors occur, instead of asking the user for help. This option is also used +# when generating formulas in HTML. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_BATCHMODE = NO + +# If the LATEX_HIDE_INDICES tag is set to YES then doxygen will not include the +# index chapters (such as File Index, Compound Index, etc.) in the output. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_HIDE_INDICES = NO + +# If the LATEX_SOURCE_CODE tag is set to YES then doxygen will include source +# code with syntax highlighting in the LaTeX output. +# +# Note that which sources are shown also depends on other settings such as +# SOURCE_BROWSER. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_SOURCE_CODE = NO + +# The LATEX_BIB_STYLE tag can be used to specify the style to use for the +# bibliography, e.g. plainnat, or ieeetr. See +# http://en.wikipedia.org/wiki/BibTeX and \cite for more info. +# The default value is: plain. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_BIB_STYLE = plain + +# If the LATEX_TIMESTAMP tag is set to YES then the footer of each generated +# page will contain the date and time when the page was generated. Setting this +# to NO can help when comparing the output of multiple runs. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_TIMESTAMP = NO + +#--------------------------------------------------------------------------- +# Configuration options related to the RTF output +#--------------------------------------------------------------------------- + +# If the GENERATE_RTF tag is set to YES, doxygen will generate RTF output. The +# RTF output is optimized for Word 97 and may not look too pretty with other RTF +# readers/editors. +# The default value is: NO. + +GENERATE_RTF = NO + +# The RTF_OUTPUT tag is used to specify where the RTF docs will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. +# The default directory is: rtf. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_OUTPUT = rtf + +# If the COMPACT_RTF tag is set to YES, doxygen generates more compact RTF +# documents. This may be useful for small projects and may help to save some +# trees in general. +# The default value is: NO. +# This tag requires that the tag GENERATE_RTF is set to YES. + +COMPACT_RTF = NO + +# If the RTF_HYPERLINKS tag is set to YES, the RTF that is generated will +# contain hyperlink fields. The RTF file will contain links (just like the HTML +# output) instead of page references. This makes the output suitable for online +# browsing using Word or some other Word compatible readers that support those +# fields. +# +# Note: WordPad (write) and others do not support links. +# The default value is: NO. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_HYPERLINKS = NO + +# Load stylesheet definitions from file. Syntax is similar to doxygen's config +# file, i.e. a series of assignments. You only have to provide replacements, +# missing definitions are set to their default value. +# +# See also section "Doxygen usage" for information on how to generate the +# default style sheet that doxygen normally uses. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_STYLESHEET_FILE = + +# Set optional variables used in the generation of an RTF document. Syntax is +# similar to doxygen's config file. A template extensions file can be generated +# using doxygen -e rtf extensionFile. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_EXTENSIONS_FILE = + +# If the RTF_SOURCE_CODE tag is set to YES then doxygen will include source code +# with syntax highlighting in the RTF output. +# +# Note that which sources are shown also depends on other settings such as +# SOURCE_BROWSER. +# The default value is: NO. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_SOURCE_CODE = NO + +#--------------------------------------------------------------------------- +# Configuration options related to the man page output +#--------------------------------------------------------------------------- + +# If the GENERATE_MAN tag is set to YES, doxygen will generate man pages for +# classes and files. +# The default value is: NO. + +GENERATE_MAN = NO + +# The MAN_OUTPUT tag is used to specify where the man pages will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. A directory man3 will be created inside the directory specified by +# MAN_OUTPUT. +# The default directory is: man. +# This tag requires that the tag GENERATE_MAN is set to YES. + +MAN_OUTPUT = man + +# The MAN_EXTENSION tag determines the extension that is added to the generated +# man pages. In case the manual section does not start with a number, the number +# 3 is prepended. The dot (.) at the beginning of the MAN_EXTENSION tag is +# optional. +# The default value is: .3. +# This tag requires that the tag GENERATE_MAN is set to YES. + +MAN_EXTENSION = .3 + +# The MAN_SUBDIR tag determines the name of the directory created within +# MAN_OUTPUT in which the man pages are placed. If defaults to man followed by +# MAN_EXTENSION with the initial . removed. +# This tag requires that the tag GENERATE_MAN is set to YES. + +MAN_SUBDIR = + +# If the MAN_LINKS tag is set to YES and doxygen generates man output, then it +# will generate one additional man file for each entity documented in the real +# man page(s). These additional files only source the real man page, but without +# them the man command would be unable to find the correct page. +# The default value is: NO. +# This tag requires that the tag GENERATE_MAN is set to YES. + +MAN_LINKS = NO + +#--------------------------------------------------------------------------- +# Configuration options related to the XML output +#--------------------------------------------------------------------------- + +# If the GENERATE_XML tag is set to YES, doxygen will generate an XML file that +# captures the structure of the code including all documentation. +# The default value is: NO. + +GENERATE_XML = NO + +# The XML_OUTPUT tag is used to specify where the XML pages will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. +# The default directory is: xml. +# This tag requires that the tag GENERATE_XML is set to YES. + +XML_OUTPUT = xml + +# If the XML_PROGRAMLISTING tag is set to YES, doxygen will dump the program +# listings (including syntax highlighting and cross-referencing information) to +# the XML output. Note that enabling this will significantly increase the size +# of the XML output. +# The default value is: YES. +# This tag requires that the tag GENERATE_XML is set to YES. + +XML_PROGRAMLISTING = YES + +#--------------------------------------------------------------------------- +# Configuration options related to the DOCBOOK output +#--------------------------------------------------------------------------- + +# If the GENERATE_DOCBOOK tag is set to YES, doxygen will generate Docbook files +# that can be used to generate PDF. +# The default value is: NO. + +GENERATE_DOCBOOK = NO + +# The DOCBOOK_OUTPUT tag is used to specify where the Docbook pages will be put. +# If a relative path is entered the value of OUTPUT_DIRECTORY will be put in +# front of it. +# The default directory is: docbook. +# This tag requires that the tag GENERATE_DOCBOOK is set to YES. + +DOCBOOK_OUTPUT = docbook + +# If the DOCBOOK_PROGRAMLISTING tag is set to YES, doxygen will include the +# program listings (including syntax highlighting and cross-referencing +# information) to the DOCBOOK output. Note that enabling this will significantly +# increase the size of the DOCBOOK output. +# The default value is: NO. +# This tag requires that the tag GENERATE_DOCBOOK is set to YES. + +DOCBOOK_PROGRAMLISTING = NO + +#--------------------------------------------------------------------------- +# Configuration options for the AutoGen Definitions output +#--------------------------------------------------------------------------- + +# If the GENERATE_AUTOGEN_DEF tag is set to YES, doxygen will generate an +# AutoGen Definitions (see http://autogen.sf.net) file that captures the +# structure of the code including all documentation. Note that this feature is +# still experimental and incomplete at the moment. +# The default value is: NO. + +GENERATE_AUTOGEN_DEF = NO + +#--------------------------------------------------------------------------- +# Configuration options related to the Perl module output +#--------------------------------------------------------------------------- + +# If the GENERATE_PERLMOD tag is set to YES, doxygen will generate a Perl module +# file that captures the structure of the code including all documentation. +# +# Note that this feature is still experimental and incomplete at the moment. +# The default value is: NO. + +GENERATE_PERLMOD = NO + +# If the PERLMOD_LATEX tag is set to YES, doxygen will generate the necessary +# Makefile rules, Perl scripts and LaTeX code to be able to generate PDF and DVI +# output from the Perl module output. +# The default value is: NO. +# This tag requires that the tag GENERATE_PERLMOD is set to YES. + +PERLMOD_LATEX = NO + +# If the PERLMOD_PRETTY tag is set to YES, the Perl module output will be nicely +# formatted so it can be parsed by a human reader. This is useful if you want to +# understand what is going on. On the other hand, if this tag is set to NO, the +# size of the Perl module output will be much smaller and Perl will parse it +# just the same. +# The default value is: YES. +# This tag requires that the tag GENERATE_PERLMOD is set to YES. + +PERLMOD_PRETTY = YES + +# The names of the make variables in the generated doxyrules.make file are +# prefixed with the string contained in PERLMOD_MAKEVAR_PREFIX. This is useful +# so different doxyrules.make files included by the same Makefile don't +# overwrite each other's variables. +# This tag requires that the tag GENERATE_PERLMOD is set to YES. + +PERLMOD_MAKEVAR_PREFIX = + +#--------------------------------------------------------------------------- +# Configuration options related to the preprocessor +#--------------------------------------------------------------------------- + +# If the ENABLE_PREPROCESSING tag is set to YES, doxygen will evaluate all +# C-preprocessor directives found in the sources and include files. +# The default value is: YES. + +ENABLE_PREPROCESSING = YES + +# If the MACRO_EXPANSION tag is set to YES, doxygen will expand all macro names +# in the source code. If set to NO, only conditional compilation will be +# performed. Macro expansion can be done in a controlled way by setting +# EXPAND_ONLY_PREDEF to YES. +# The default value is: NO. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +MACRO_EXPANSION = NO + +# If the EXPAND_ONLY_PREDEF and MACRO_EXPANSION tags are both set to YES then +# the macro expansion is limited to the macros specified with the PREDEFINED and +# EXPAND_AS_DEFINED tags. +# The default value is: NO. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +EXPAND_ONLY_PREDEF = NO + +# If the SEARCH_INCLUDES tag is set to YES, the include files in the +# INCLUDE_PATH will be searched if a #include is found. +# The default value is: YES. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +SEARCH_INCLUDES = YES + +# The INCLUDE_PATH tag can be used to specify one or more directories that +# contain include files that are not input files but should be processed by the +# preprocessor. +# This tag requires that the tag SEARCH_INCLUDES is set to YES. + +INCLUDE_PATH = + +# You can use the INCLUDE_FILE_PATTERNS tag to specify one or more wildcard +# patterns (like *.h and *.hpp) to filter out the header-files in the +# directories. If left blank, the patterns specified with FILE_PATTERNS will be +# used. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +INCLUDE_FILE_PATTERNS = + +# The PREDEFINED tag can be used to specify one or more macro names that are +# defined before the preprocessor is started (similar to the -D option of e.g. +# gcc). The argument of the tag is a list of macros of the form: name or +# name=definition (no spaces). If the definition and the "=" are omitted, "=1" +# is assumed. To prevent a macro definition from being undefined via #undef or +# recursively expanded use the := operator instead of the = operator. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +PREDEFINED = + +# If the MACRO_EXPANSION and EXPAND_ONLY_PREDEF tags are set to YES then this +# tag can be used to specify a list of macro names that should be expanded. The +# macro definition that is found in the sources will be used. Use the PREDEFINED +# tag if you want to use a different macro definition that overrules the +# definition found in the source code. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +EXPAND_AS_DEFINED = + +# If the SKIP_FUNCTION_MACROS tag is set to YES then doxygen's preprocessor will +# remove all references to function-like macros that are alone on a line, have +# an all uppercase name, and do not end with a semicolon. Such function macros +# are typically used for boiler-plate code, and will confuse the parser if not +# removed. +# The default value is: YES. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +SKIP_FUNCTION_MACROS = YES + +#--------------------------------------------------------------------------- +# Configuration options related to external references +#--------------------------------------------------------------------------- + +# The TAGFILES tag can be used to specify one or more tag files. For each tag +# file the location of the external documentation should be added. The format of +# a tag file without this location is as follows: +# TAGFILES = file1 file2 ... +# Adding location for the tag files is done as follows: +# TAGFILES = file1=loc1 "file2 = loc2" ... +# where loc1 and loc2 can be relative or absolute paths or URLs. See the +# section "Linking to external documentation" for more information about the use +# of tag files. +# Note: Each tag file must have a unique name (where the name does NOT include +# the path). If a tag file is not located in the directory in which doxygen is +# run, you must also specify the path to the tagfile here. + +TAGFILES = + +# When a file name is specified after GENERATE_TAGFILE, doxygen will create a +# tag file that is based on the input files it reads. See section "Linking to +# external documentation" for more information about the usage of tag files. + +GENERATE_TAGFILE = + +# If the ALLEXTERNALS tag is set to YES, all external class will be listed in +# the class index. If set to NO, only the inherited external classes will be +# listed. +# The default value is: NO. + +ALLEXTERNALS = NO + +# If the EXTERNAL_GROUPS tag is set to YES, all external groups will be listed +# in the modules index. If set to NO, only the current project's groups will be +# listed. +# The default value is: YES. + +EXTERNAL_GROUPS = YES + +# If the EXTERNAL_PAGES tag is set to YES, all external pages will be listed in +# the related pages index. If set to NO, only the current project's pages will +# be listed. +# The default value is: YES. + +EXTERNAL_PAGES = YES + +# The PERL_PATH should be the absolute path and name of the perl script +# interpreter (i.e. the result of 'which perl'). +# The default file (with absolute path) is: /usr/bin/perl. + +PERL_PATH = /usr/bin/perl + +#--------------------------------------------------------------------------- +# Configuration options related to the dot tool +#--------------------------------------------------------------------------- + +# If the CLASS_DIAGRAMS tag is set to YES, doxygen will generate a class diagram +# (in HTML and LaTeX) for classes with base or super classes. Setting the tag to +# NO turns the diagrams off. Note that this option also works with HAVE_DOT +# disabled, but it is recommended to install and use dot, since it yields more +# powerful graphs. +# The default value is: YES. + +CLASS_DIAGRAMS = YES + +# You can define message sequence charts within doxygen comments using the \msc +# command. Doxygen will then run the mscgen tool (see: +# http://www.mcternan.me.uk/mscgen/)) to produce the chart and insert it in the +# documentation. The MSCGEN_PATH tag allows you to specify the directory where +# the mscgen tool resides. If left empty the tool is assumed to be found in the +# default search path. + +MSCGEN_PATH = + +# You can include diagrams made with dia in doxygen documentation. Doxygen will +# then run dia to produce the diagram and insert it in the documentation. The +# DIA_PATH tag allows you to specify the directory where the dia binary resides. +# If left empty dia is assumed to be found in the default search path. + +DIA_PATH = + +# If set to YES the inheritance and collaboration graphs will hide inheritance +# and usage relations if the target is undocumented or is not a class. +# The default value is: YES. + +HIDE_UNDOC_RELATIONS = YES + +# If you set the HAVE_DOT tag to YES then doxygen will assume the dot tool is +# available from the path. This tool is part of Graphviz (see: +# http://www.graphviz.org/), a graph visualization toolkit from AT&T and Lucent +# Bell Labs. The other options in this section have no effect if this option is +# set to NO +# The default value is: YES. + +HAVE_DOT = YES + +# The DOT_NUM_THREADS specifies the number of dot invocations doxygen is allowed +# to run in parallel. When set to 0 doxygen will base this on the number of +# processors available in the system. You can set it explicitly to a value +# larger than 0 to get control over the balance between CPU load and processing +# speed. +# Minimum value: 0, maximum value: 32, default value: 0. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_NUM_THREADS = 0 + +# When you want a differently looking font in the dot files that doxygen +# generates you can specify the font name using DOT_FONTNAME. You need to make +# sure dot is able to find the font, which can be done by putting it in a +# standard location or by setting the DOTFONTPATH environment variable or by +# setting DOT_FONTPATH to the directory containing the font. +# The default value is: Helvetica. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_FONTNAME = Helvetica + +# The DOT_FONTSIZE tag can be used to set the size (in points) of the font of +# dot graphs. +# Minimum value: 4, maximum value: 24, default value: 10. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_FONTSIZE = 10 + +# By default doxygen will tell dot to use the default font as specified with +# DOT_FONTNAME. If you specify a different font using DOT_FONTNAME you can set +# the path where dot can find it using this tag. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_FONTPATH = + +# If the CLASS_GRAPH tag is set to YES then doxygen will generate a graph for +# each documented class showing the direct and indirect inheritance relations. +# Setting this tag to YES will force the CLASS_DIAGRAMS tag to NO. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +CLASS_GRAPH = YES + +# If the COLLABORATION_GRAPH tag is set to YES then doxygen will generate a +# graph for each documented class showing the direct and indirect implementation +# dependencies (inheritance, containment, and class references variables) of the +# class with other documented classes. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +COLLABORATION_GRAPH = YES + +# If the GROUP_GRAPHS tag is set to YES then doxygen will generate a graph for +# groups, showing the direct groups dependencies. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +GROUP_GRAPHS = YES + +# If the UML_LOOK tag is set to YES, doxygen will generate inheritance and +# collaboration diagrams in a style similar to the OMG's Unified Modeling +# Language. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +UML_LOOK = NO + +# If the UML_LOOK tag is enabled, the fields and methods are shown inside the +# class node. If there are many fields or methods and many nodes the graph may +# become too big to be useful. The UML_LIMIT_NUM_FIELDS threshold limits the +# number of items for each type to make the size more manageable. Set this to 0 +# for no limit. Note that the threshold may be exceeded by 50% before the limit +# is enforced. So when you set the threshold to 10, up to 15 fields may appear, +# but if the number exceeds 15, the total amount of fields shown is limited to +# 10. +# Minimum value: 0, maximum value: 100, default value: 10. +# This tag requires that the tag HAVE_DOT is set to YES. + +UML_LIMIT_NUM_FIELDS = 10 + +# If the TEMPLATE_RELATIONS tag is set to YES then the inheritance and +# collaboration graphs will show the relations between templates and their +# instances. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +TEMPLATE_RELATIONS = NO + +# If the INCLUDE_GRAPH, ENABLE_PREPROCESSING and SEARCH_INCLUDES tags are set to +# YES then doxygen will generate a graph for each documented file showing the +# direct and indirect include dependencies of the file with other documented +# files. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +INCLUDE_GRAPH = YES + +# If the INCLUDED_BY_GRAPH, ENABLE_PREPROCESSING and SEARCH_INCLUDES tags are +# set to YES then doxygen will generate a graph for each documented file showing +# the direct and indirect include dependencies of the file with other documented +# files. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +INCLUDED_BY_GRAPH = YES + +# If the CALL_GRAPH tag is set to YES then doxygen will generate a call +# dependency graph for every global function or class method. +# +# Note that enabling this option will significantly increase the time of a run. +# So in most cases it will be better to enable call graphs for selected +# functions only using the \callgraph command. Disabling a call graph can be +# accomplished by means of the command \hidecallgraph. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +CALL_GRAPH = NO + +# If the CALLER_GRAPH tag is set to YES then doxygen will generate a caller +# dependency graph for every global function or class method. +# +# Note that enabling this option will significantly increase the time of a run. +# So in most cases it will be better to enable caller graphs for selected +# functions only using the \callergraph command. Disabling a caller graph can be +# accomplished by means of the command \hidecallergraph. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +CALLER_GRAPH = NO + +# If the GRAPHICAL_HIERARCHY tag is set to YES then doxygen will graphical +# hierarchy of all classes instead of a textual one. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +GRAPHICAL_HIERARCHY = YES + +# If the DIRECTORY_GRAPH tag is set to YES then doxygen will show the +# dependencies a directory has on other directories in a graphical way. The +# dependency relations are determined by the #include relations between the +# files in the directories. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +DIRECTORY_GRAPH = YES + +# The DOT_IMAGE_FORMAT tag can be used to set the image format of the images +# generated by dot. For an explanation of the image formats see the section +# output formats in the documentation of the dot tool (Graphviz (see: +# http://www.graphviz.org/)). +# Note: If you choose svg you need to set HTML_FILE_EXTENSION to xhtml in order +# to make the SVG files visible in IE 9+ (other browsers do not have this +# requirement). +# Possible values are: png, png:cairo, png:cairo:cairo, png:cairo:gd, png:gd, +# png:gd:gd, jpg, jpg:cairo, jpg:cairo:gd, jpg:gd, jpg:gd:gd, gif, gif:cairo, +# gif:cairo:gd, gif:gd, gif:gd:gd, svg, png:gd, png:gd:gd, png:cairo, +# png:cairo:gd, png:cairo:cairo, png:cairo:gdiplus, png:gdiplus and +# png:gdiplus:gdiplus. +# The default value is: png. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_IMAGE_FORMAT = png + +# If DOT_IMAGE_FORMAT is set to svg, then this option can be set to YES to +# enable generation of interactive SVG images that allow zooming and panning. +# +# Note that this requires a modern browser other than Internet Explorer. Tested +# and working are Firefox, Chrome, Safari, and Opera. +# Note: For IE 9+ you need to set HTML_FILE_EXTENSION to xhtml in order to make +# the SVG files visible. Older versions of IE do not have SVG support. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +INTERACTIVE_SVG = NO + +# The DOT_PATH tag can be used to specify the path where the dot tool can be +# found. If left blank, it is assumed the dot tool can be found in the path. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_PATH = + +# The DOTFILE_DIRS tag can be used to specify one or more directories that +# contain dot files that are included in the documentation (see the \dotfile +# command). +# This tag requires that the tag HAVE_DOT is set to YES. + +DOTFILE_DIRS = + +# The MSCFILE_DIRS tag can be used to specify one or more directories that +# contain msc files that are included in the documentation (see the \mscfile +# command). + +MSCFILE_DIRS = + +# The DIAFILE_DIRS tag can be used to specify one or more directories that +# contain dia files that are included in the documentation (see the \diafile +# command). + +DIAFILE_DIRS = + +# When using plantuml, the PLANTUML_JAR_PATH tag should be used to specify the +# path where java can find the plantuml.jar file. If left blank, it is assumed +# PlantUML is not used or called during a preprocessing step. Doxygen will +# generate a warning when it encounters a \startuml command in this case and +# will not generate output for the diagram. + +PLANTUML_JAR_PATH = + +# When using plantuml, the PLANTUML_CFG_FILE tag can be used to specify a +# configuration file for plantuml. + +PLANTUML_CFG_FILE = + +# When using plantuml, the specified paths are searched for files specified by +# the !include statement in a plantuml block. + +PLANTUML_INCLUDE_PATH = + +# The DOT_GRAPH_MAX_NODES tag can be used to set the maximum number of nodes +# that will be shown in the graph. If the number of nodes in a graph becomes +# larger than this value, doxygen will truncate the graph, which is visualized +# by representing a node as a red box. Note that doxygen if the number of direct +# children of the root node in a graph is already larger than +# DOT_GRAPH_MAX_NODES then the graph will not be shown at all. Also note that +# the size of a graph can be further restricted by MAX_DOT_GRAPH_DEPTH. +# Minimum value: 0, maximum value: 10000, default value: 50. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_GRAPH_MAX_NODES = 50 + +# The MAX_DOT_GRAPH_DEPTH tag can be used to set the maximum depth of the graphs +# generated by dot. A depth value of 3 means that only nodes reachable from the +# root by following a path via at most 3 edges will be shown. Nodes that lay +# further from the root node will be omitted. Note that setting this option to 1 +# or 2 may greatly reduce the computation time needed for large code bases. Also +# note that the size of a graph can be further restricted by +# DOT_GRAPH_MAX_NODES. Using a depth of 0 means no depth restriction. +# Minimum value: 0, maximum value: 1000, default value: 0. +# This tag requires that the tag HAVE_DOT is set to YES. + +MAX_DOT_GRAPH_DEPTH = 0 + +# Set the DOT_TRANSPARENT tag to YES to generate images with a transparent +# background. This is disabled by default, because dot on Windows does not seem +# to support this out of the box. +# +# Warning: Depending on the platform used, enabling this option may lead to +# badly anti-aliased labels on the edges of a graph (i.e. they become hard to +# read). +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_TRANSPARENT = NO + +# Set the DOT_MULTI_TARGETS tag to YES to allow dot to generate multiple output +# files in one run (i.e. multiple -o and -T options on the command line). This +# makes dot run faster, but since only newer versions of dot (>1.8.10) support +# this, this feature is disabled by default. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_MULTI_TARGETS = NO + +# If the GENERATE_LEGEND tag is set to YES doxygen will generate a legend page +# explaining the meaning of the various boxes and arrows in the dot generated +# graphs. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +GENERATE_LEGEND = YES + +# If the DOT_CLEANUP tag is set to YES, doxygen will remove the intermediate dot +# files that are used to generate the various graphs. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_CLEANUP = YES diff --git a/docs/html/.gitkeep b/docs/html/.gitkeep deleted file mode 100755 index e69de29bb2d1d6434b8b29ae775ad8c2e48c5391..0000000000000000000000000000000000000000 diff --git a/docs/html/_factor_oracle_8cpp.html b/docs/html/_factor_oracle_8cpp.html deleted file mode 100644 index 99c21a0a7eb122169b51c4ab10d3c43346f7e65d..0000000000000000000000000000000000000000 --- a/docs/html/_factor_oracle_8cpp.html +++ /dev/null @@ -1,98 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: FactorOracle.cpp File Reference</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -</div><!-- top --> -<div class="header"> - <div class="summary"> -<a href="#var-members">Variables</a> </div> - <div class="headertitle"> -<div class="title">FactorOracle.cpp File Reference</div> </div> -</div><!--header--> -<div class="contents"> - -<p>A file that contains the functions needed for the creation of a Factor Oracle. -<a href="#details">More...</a></p> -<div class="textblock"><code>#include "<a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a>"</code><br /> -</div><table class="memberdecls"> -<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="var-members"></a> -Variables</h2></td></tr> -<tr class="memitem:a5eb6eb3bacab6fd40c8df6d435e06209"><td class="memItemLeft" align="right" valign="top"><a id="a5eb6eb3bacab6fd40c8df6d435e06209"></a> -int </td><td class="memItemRight" valign="bottom"><b>phi</b></td></tr> -<tr class="separator:a5eb6eb3bacab6fd40c8df6d435e06209"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:ab66ed8e0098c0a86b458672a55a9cca9"><td class="memItemLeft" align="right" valign="top"><a id="ab66ed8e0098c0a86b458672a55a9cca9"></a> -int </td><td class="memItemRight" valign="bottom"><b>k</b></td></tr> -<tr class="separator:ab66ed8e0098c0a86b458672a55a9cca9"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:aa2fc876c0cc6ed51259586d7bea34f0f"><td class="memItemLeft" align="right" valign="top"><a id="aa2fc876c0cc6ed51259586d7bea34f0f"></a> -int </td><td class="memItemRight" valign="bottom"><b>fo_iter</b></td></tr> -<tr class="separator:aa2fc876c0cc6ed51259586d7bea34f0f"><td class="memSeparator" colspan="2"> </td></tr> -</table> -<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> -<div class="textblock"><p>A file that contains the functions needed for the creation of a Factor Oracle. </p> -<p>Five main functions: FactorOracleStart, AddLetter, LengthCommonSuffix, FindBetter and FOGenerate. </p> -</div></div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/_factor_oracle_8h.html b/docs/html/_factor_oracle_8h.html deleted file mode 100644 index fa87e4b998931145be0b9f6cf5a4d82850a79df1..0000000000000000000000000000000000000000 --- a/docs/html/_factor_oracle_8h.html +++ /dev/null @@ -1,113 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: FactorOracle.h File Reference</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -</div><!-- top --> -<div class="header"> - <div class="summary"> -<a href="#nested-classes">Classes</a> | -<a href="#define-members">Macros</a> </div> - <div class="headertitle"> -<div class="title">FactorOracle.h File Reference</div> </div> -</div><!--header--> -<div class="contents"> - -<p>A file that contains the definitions of the classes needed for the creation of a Factor Oracle. -<a href="#details">More...</a></p> -<div class="textblock"><code>#include <iostream></code><br /> -<code>#include <new></code><br /> -<code>#include <string></code><br /> -<code>#include <vector></code><br /> -<code>#include <variant></code><br /> -<code>#include <random></code><br /> -<code>#include <algorithm></code><br /> -</div> -<p><a href="_factor_oracle_8h_source.html">Go to the source code of this file.</a></p> -<table class="memberdecls"> -<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="nested-classes"></a> -Classes</h2></td></tr> -<tr class="memitem:"><td class="memItemLeft" align="right" valign="top">class  </td><td class="memItemRight" valign="bottom"><a class="el" href="class_single_transition.html">SingleTransition</a></td></tr> -<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:"><td class="memItemLeft" align="right" valign="top">class  </td><td class="memItemRight" valign="bottom"><a class="el" href="class_state.html">State</a></td></tr> -<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:"><td class="memItemLeft" align="right" valign="top">class  </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td></tr> -<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> -</table><table class="memberdecls"> -<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="define-members"></a> -Macros</h2></td></tr> -<tr class="memitem:a5c71a5e59a53413cd6c270266d63b031"><td class="memItemLeft" align="right" valign="top"><a id="a5c71a5e59a53413cd6c270266d63b031"></a> -#define </td><td class="memItemRight" valign="bottom"><b>R</b>   10</td></tr> -<tr class="separator:a5c71a5e59a53413cd6c270266d63b031"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:a690f251553b39fd4f31894826141b61a"><td class="memItemLeft" align="right" valign="top"><a id="a690f251553b39fd4f31894826141b61a"></a> -#define </td><td class="memItemRight" valign="bottom"><b>RAND_MAX</b>   0x7fffffff</td></tr> -<tr class="separator:a690f251553b39fd4f31894826141b61a"><td class="memSeparator" colspan="2"> </td></tr> -</table> -<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> -<div class="textblock"><p>A file that contains the definitions of the classes needed for the creation of a Factor Oracle. </p> -<p>Three main classes: <a class="el" href="class_factor_oracle.html">FactorOracle</a>, <a class="el" href="class_state.html">State</a> and <a class="el" href="class_single_transition.html">SingleTransition</a>. </p> -</div></div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/_factor_oracle_8h_source.html b/docs/html/_factor_oracle_8h_source.html deleted file mode 100644 index b9b200b1299962b94205fe2890ce79622f407174..0000000000000000000000000000000000000000 --- a/docs/html/_factor_oracle_8h_source.html +++ /dev/null @@ -1,85 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: FactorOracle.h Source File</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -</div><!-- top --> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -<div class="header"> - <div class="headertitle"> -<div class="title">FactorOracle.h</div> </div> -</div><!--header--> -<div class="contents"> -<a href="_factor_oracle_8h.html">Go to the documentation of this file.</a><div class="fragment"><div class="line"><a name="l00001"></a><span class="lineno"> 1</span> <span class="comment">//</span></div><div class="line"><a name="l00002"></a><span class="lineno"> 2</span> <span class="comment">// Created by MARIA PAULA CARRERO on 7/16/19.</span></div><div class="line"><a name="l00003"></a><span class="lineno"> 3</span> <span class="comment">//</span></div><div class="line"><a name="l00004"></a><span class="lineno"> 4</span> <span class="preprocessor">#include <iostream></span></div><div class="line"><a name="l00005"></a><span class="lineno"> 5</span> <span class="preprocessor">#include <new></span></div><div class="line"><a name="l00006"></a><span class="lineno"> 6</span> <span class="preprocessor">#include <string></span></div><div class="line"><a name="l00007"></a><span class="lineno"> 7</span> <span class="preprocessor">#include <vector></span></div><div class="line"><a name="l00008"></a><span class="lineno"> 8</span> <span class="preprocessor">#include <variant></span></div><div class="line"><a name="l00009"></a><span class="lineno"> 9</span> <span class="preprocessor">#include <random></span></div><div class="line"><a name="l00010"></a><span class="lineno"> 10</span> <span class="preprocessor">#include <algorithm></span></div><div class="line"><a name="l00011"></a><span class="lineno"> 11</span> </div><div class="line"><a name="l00012"></a><span class="lineno"> 12</span> </div><div class="line"><a name="l00013"></a><span class="lineno"> 13</span> <span class="preprocessor">#ifndef FACTORORACLESTRING_FACTORORACLE_H</span></div><div class="line"><a name="l00014"></a><span class="lineno"> 14</span> <span class="preprocessor">#define FACTORORACLESTRING_FACTORORACLE_H</span></div><div class="line"><a name="l00015"></a><span class="lineno"> 15</span> </div><div class="line"><a name="l00016"></a><span class="lineno"> 16</span> <span class="preprocessor">#define R 10</span></div><div class="line"><a name="l00017"></a><span class="lineno"> 17</span> <span class="preprocessor">#define RAND_MAX 0x7fffffff</span></div><div class="line"><a name="l00018"></a><span class="lineno"> 18</span> </div><div class="line"><a name="l00064"></a><span class="lineno"> 64</span> <span class="keyword">using namespace </span>std;</div><div class="line"><a name="l00067"></a><span class="lineno"><a class="line" href="class_single_transition.html"> 67</a></span> <span class="keyword">class </span><a class="code" href="class_single_transition.html">SingleTransition</a></div><div class="line"><a name="l00068"></a><span class="lineno"> 68</span> {</div><div class="line"><a name="l00069"></a><span class="lineno"> 69</span> <span class="keyword">public</span>:</div><div class="line"><a name="l00070"></a><span class="lineno"><a class="line" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6"> 70</a></span>  <span class="keywordtype">int</span> <a class="code" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">first_state_</a>; </div><div class="line"><a name="l00071"></a><span class="lineno"><a class="line" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69"> 71</a></span>  <span class="keywordtype">int</span> <a class="code" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">last_state_</a>; </div><div class="line"><a name="l00072"></a><span class="lineno"><a class="line" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9"> 72</a></span>  <span class="keywordtype">char</span> <a class="code" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">symbol_</a>; </div><div class="line"><a name="l00073"></a><span class="lineno"> 73</span> };</div><div class="line"><a name="l00074"></a><span class="lineno"> 74</span> </div><div class="line"><a name="l00081"></a><span class="lineno"><a class="line" href="class_state.html"> 81</a></span> <span class="keyword">class </span><a class="code" href="class_state.html">State</a></div><div class="line"><a name="l00082"></a><span class="lineno"> 82</span> {</div><div class="line"><a name="l00083"></a><span class="lineno"> 83</span> <span class="keyword">public</span>:</div><div class="line"><a name="l00084"></a><span class="lineno"><a class="line" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724"> 84</a></span>  <span class="keywordtype">int</span> <a class="code" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">state_</a>; </div><div class="line"><a name="l00085"></a><span class="lineno"><a class="line" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8"> 85</a></span>  vector <SingleTransition> <a class="code" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">transition_</a>; </div><div class="line"><a name="l00086"></a><span class="lineno"> 86</span>  <span class="keywordtype">int</span> suffix_transition_;</div><div class="line"><a name="l00087"></a><span class="lineno"> 87</span>  <span class="keywordtype">int</span> lrs_ = 0;</div><div class="line"><a name="l00088"></a><span class="lineno"> 88</span>  <span class="keywordtype">void</span> singleTransitionResize(){</div><div class="line"><a name="l00089"></a><span class="lineno"> 89</span>  transition_.resize(R);</div><div class="line"><a name="l00090"></a><span class="lineno"> 90</span>  }</div><div class="line"><a name="l00091"></a><span class="lineno"> 91</span> };</div><div class="line"><a name="l00092"></a><span class="lineno"> 92</span> </div><div class="line"><a name="l00093"></a><span class="lineno"> 93</span> </div><div class="line"><a name="l00094"></a><span class="lineno"><a class="line" href="class_factor_oracle.html"> 94</a></span> <span class="keyword">class </span><a class="code" href="class_factor_oracle.html">FactorOracle</a></div><div class="line"><a name="l00095"></a><span class="lineno"> 95</span> {</div><div class="line"><a name="l00096"></a><span class="lineno"> 96</span> <span class="keyword">public</span>:</div><div class="line"><a name="l00097"></a><span class="lineno"><a class="line" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d"> 97</a></span>  vector <State> <a class="code" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">states_</a>; </div><div class="line"><a name="l00098"></a><span class="lineno"> 98</span>  <span class="keywordtype">void</span> AddLetter(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& States, vector <vector<int>> &T, <span class="keywordtype">int</span> i, <span class="keywordtype">string</span> word);</div><div class="line"><a name="l00099"></a><span class="lineno"> 99</span>  <span class="keywordtype">int</span> LengthCommonSuffix(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& States, <span class="keywordtype">int</span> phi_one, <span class="keywordtype">int</span> phi_two);</div><div class="line"><a name="l00100"></a><span class="lineno"> 100</span>  <span class="keywordtype">int</span> FindBetter(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& States, vector <vector<int>> &T, <span class="keywordtype">int</span> i, <span class="keywordtype">char</span> alpha, <span class="keywordtype">string</span> word);</div><div class="line"><a name="l00101"></a><span class="lineno"> 101</span>  <span class="keywordtype">string</span> FOGenerate(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& States, <span class="keywordtype">int</span> i, <span class="keywordtype">string</span> v, <span class="keywordtype">float</span> q);</div><div class="line"><a name="l00102"></a><span class="lineno"> 102</span>  <span class="keywordtype">void</span> FactorOracleStart(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& OracleRelations,<span class="keywordtype">string</span> word);</div><div class="line"><a name="l00103"></a><span class="lineno"> 103</span> </div><div class="line"><a name="l00104"></a><span class="lineno"> 104</span> };</div><div class="line"><a name="l00105"></a><span class="lineno"> 105</span> </div><div class="line"><a name="l00106"></a><span class="lineno"> 106</span> </div><div class="line"><a name="l00107"></a><span class="lineno"> 107</span> </div><div class="line"><a name="l00108"></a><span class="lineno"> 108</span> <span class="preprocessor">#endif //FACTORORACLESTRING_FACTORORACLE_H</span></div><div class="ttc" id="class_single_transition_html_ae632ebd30fd4818e999fd1009cb2a8f9"><div class="ttname"><a href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">SingleTransition::symbol_</a></div><div class="ttdeci">char symbol_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:72</div></div> -<div class="ttc" id="class_factor_oracle_html_a6e8dacf834f9ee820818c3655d77d56d"><div class="ttname"><a href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">FactorOracle::states_</a></div><div class="ttdeci">vector< State > states_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:97</div></div> -<div class="ttc" id="class_state_html"><div class="ttname"><a href="class_state.html">State</a></div><div class="ttdef"><b>Definition:</b> FactorOracle.h:81</div></div> -<div class="ttc" id="class_state_html_a2dcf672a1560830a8f93b0e9863c6724"><div class="ttname"><a href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">State::state_</a></div><div class="ttdeci">int state_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:84</div></div> -<div class="ttc" id="class_factor_oracle_html"><div class="ttname"><a href="class_factor_oracle.html">FactorOracle</a></div><div class="ttdef"><b>Definition:</b> FactorOracle.h:94</div></div> -<div class="ttc" id="class_single_transition_html_a88f7e002e072ffe7bb5eeb168cf0fea6"><div class="ttname"><a href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">SingleTransition::first_state_</a></div><div class="ttdeci">int first_state_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:70</div></div> -<div class="ttc" id="class_state_html_afd5b3d2afbba2fc03583f76a7cb08fe8"><div class="ttname"><a href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">State::transition_</a></div><div class="ttdeci">vector< SingleTransition > transition_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:85</div></div> -<div class="ttc" id="class_single_transition_html"><div class="ttname"><a href="class_single_transition.html">SingleTransition</a></div><div class="ttdef"><b>Definition:</b> FactorOracle.h:67</div></div> -<div class="ttc" id="class_single_transition_html_a9d07ad3e0f9d7728919a372111313c69"><div class="ttname"><a href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">SingleTransition::last_state_</a></div><div class="ttdeci">int last_state_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:71</div></div> -</div><!-- fragment --></div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/annotated.html b/docs/html/annotated.html deleted file mode 100644 index e0d3bb04a89af56b4e24eeac0c651522fd7ed898..0000000000000000000000000000000000000000 --- a/docs/html/annotated.html +++ /dev/null @@ -1,83 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: Class List</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -</div><!-- top --> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -<div class="header"> - <div class="headertitle"> -<div class="title">Class List</div> </div> -</div><!--header--> -<div class="contents"> -<div class="textblock">Here are the classes, structs, unions and interfaces with brief descriptions:</div><div class="directory"> -<table class="directory"> -<tr id="row_0_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icona"><span class="icon">C</span></span><a class="el" href="class_factor_oracle.html" target="_self">FactorOracle</a></td><td class="desc"></td></tr> -<tr id="row_1_"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icona"><span class="icon">C</span></span><a class="el" href="class_single_transition.html" target="_self">SingleTransition</a></td><td class="desc"></td></tr> -<tr id="row_2_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icona"><span class="icon">C</span></span><a class="el" href="class_state.html" target="_self">State</a></td><td class="desc"></td></tr> -</table> -</div><!-- directory --> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/bc_s.png b/docs/html/bc_s.png deleted file mode 100644 index 224b29aa9847d5a4b3902efd602b7ddf7d33e6c2..0000000000000000000000000000000000000000 Binary files a/docs/html/bc_s.png and /dev/null differ diff --git a/docs/html/bdwn.png b/docs/html/bdwn.png deleted file mode 100644 index 940a0b950443a0bb1b216ac03c45b8a16c955452..0000000000000000000000000000000000000000 Binary files a/docs/html/bdwn.png and /dev/null differ diff --git a/docs/html/class_factor_oracle-members.html b/docs/html/class_factor_oracle-members.html deleted file mode 100644 index a04080b39c93097a16460975056c5258410efe3c..0000000000000000000000000000000000000000 --- a/docs/html/class_factor_oracle-members.html +++ /dev/null @@ -1,85 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: Member List</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -</div><!-- top --> -<div class="header"> - <div class="headertitle"> -<div class="title">FactorOracle Member List</div> </div> -</div><!--header--> -<div class="contents"> - -<p>This is the complete list of members for <a class="el" href="class_factor_oracle.html">FactorOracle</a>, including all inherited members.</p> -<table class="directory"> - <tr class="even"><td class="entry"><a class="el" href="class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db">AddLetter</a>(FactorOracle &States, vector< vector< int >> &T, int i, string word)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr> - <tr><td class="entry"><a class="el" href="class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f">FactorOracleStart</a>(FactorOracle &OracleRelations, string word)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr> - <tr class="even"><td class="entry"><a class="el" href="class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50">FindBetter</a>(FactorOracle &States, vector< vector< int >> &T, int i, char alpha, string word)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr> - <tr><td class="entry"><a class="el" href="class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390">FOGenerate</a>(FactorOracle &States, int i, string v, float q)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr> - <tr bgcolor="#f0f0f0" class="even"><td class="entry"><b>LengthCommonSuffix</b>(FactorOracle &States, int phi_one, int phi_two) (defined in <a class="el" href="class_factor_oracle.html">FactorOracle</a>)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr> - <tr><td class="entry"><a class="el" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">states_</a></td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr> -</table></div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/class_factor_oracle.html b/docs/html/class_factor_oracle.html deleted file mode 100644 index 29859c6e62d5fd0ac1787f4cfb41735902115ed3..0000000000000000000000000000000000000000 --- a/docs/html/class_factor_oracle.html +++ /dev/null @@ -1,327 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: FactorOracle Class Reference</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -</div><!-- top --> -<div class="header"> - <div class="summary"> -<a href="#pub-methods">Public Member Functions</a> | -<a href="#pub-attribs">Public Attributes</a> | -<a href="class_factor_oracle-members.html">List of all members</a> </div> - <div class="headertitle"> -<div class="title">FactorOracle Class Reference</div> </div> -</div><!--header--> -<div class="contents"> -<table class="memberdecls"> -<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-methods"></a> -Public Member Functions</h2></td></tr> -<tr class="memitem:ae10b4d001c338a73f0f44079e842e7db"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db">AddLetter</a> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &States, vector< vector< int >> &T, int i, string word)</td></tr> -<tr class="separator:ae10b4d001c338a73f0f44079e842e7db"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:a9511ac49e53ccf3a1907db4591e1ad0b"><td class="memItemLeft" align="right" valign="top"><a id="a9511ac49e53ccf3a1907db4591e1ad0b"></a> -int </td><td class="memItemRight" valign="bottom"><b>LengthCommonSuffix</b> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &States, int phi_one, int phi_two)</td></tr> -<tr class="separator:a9511ac49e53ccf3a1907db4591e1ad0b"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:a28d2e85676712f983b1dcba83ae07d50"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50">FindBetter</a> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &States, vector< vector< int >> &T, int i, char alpha, string word)</td></tr> -<tr class="separator:a28d2e85676712f983b1dcba83ae07d50"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:abe8c4c194b309aeeff1bc05c25563390"><td class="memItemLeft" align="right" valign="top">string </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390">FOGenerate</a> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &States, int i, string v, float q)</td></tr> -<tr class="separator:abe8c4c194b309aeeff1bc05c25563390"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:a070d7b00cfcb658c5d13ff275ceae01f"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f">FactorOracleStart</a> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &OracleRelations, string word)</td></tr> -<tr class="separator:a070d7b00cfcb658c5d13ff275ceae01f"><td class="memSeparator" colspan="2"> </td></tr> -</table><table class="memberdecls"> -<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a> -Public Attributes</h2></td></tr> -<tr class="memitem:a6e8dacf834f9ee820818c3655d77d56d"><td class="memItemLeft" align="right" valign="top">vector< <a class="el" href="class_state.html">State</a> > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">states_</a></td></tr> -<tr class="separator:a6e8dacf834f9ee820818c3655d77d56d"><td class="memSeparator" colspan="2"> </td></tr> -</table> -<h2 class="groupheader">Member Function Documentation</h2> -<a id="ae10b4d001c338a73f0f44079e842e7db"></a> -<h2 class="memtitle"><span class="permalink"><a href="#ae10b4d001c338a73f0f44079e842e7db">◆ </a></span>AddLetter()</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">void FactorOracle::AddLetter </td> - <td>(</td> - <td class="paramtype"><a class="el" href="class_factor_oracle.html">FactorOracle</a> & </td> - <td class="paramname"><em>States</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">vector< vector< int >> & </td> - <td class="paramname"><em>T</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">int </td> - <td class="paramname"><em>i</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">string </td> - <td class="paramname"><em>word</em> </td> - </tr> - <tr> - <td></td> - <td>)</td> - <td></td><td></td> - </tr> - </table> -</div><div class="memdoc"> -<p>A normal member taking four arguments and returning no value.</p> -<dl class="params"><dt>Parameters</dt><dd> - <table class="params"> - <tr><td class="paramname">all_states_</td><td>a reference to a <a class="el" href="class_factor_oracle.html">FactorOracle</a> class. </td></tr> - <tr><td class="paramname">T</td><td>a reference to a vector of vector of integers. </td></tr> - <tr><td class="paramname">i</td><td>an integer argument. </td></tr> - <tr><td class="paramname">word</td><td>a string argument.</td></tr> - </table> - </dd> -</dl> -<p>< delta(i-1, p[i]) <- i</p> -<p>< k = S[i-1]</p> -<p>< phi_one = i-1</p> -<p>while k > -1 and delta(k,p[i]) is undefined do delta(k, p[i]) <- i phi_one = k k = S[k]</p> - -</div> -</div> -<a id="a070d7b00cfcb658c5d13ff275ceae01f"></a> -<h2 class="memtitle"><span class="permalink"><a href="#a070d7b00cfcb658c5d13ff275ceae01f">◆ </a></span>FactorOracleStart()</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">void FactorOracle::FactorOracleStart </td> - <td>(</td> - <td class="paramtype"><a class="el" href="class_factor_oracle.html">FactorOracle</a> & </td> - <td class="paramname"><em>OracleRelations</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">string </td> - <td class="paramname"><em>word</em> </td> - </tr> - <tr> - <td></td> - <td>)</td> - <td></td><td></td> - </tr> - </table> -</div><div class="memdoc"> -<p>A normal member taking one argument and returning no value.</p> -<dl class="params"><dt>Parameters</dt><dd> - <table class="params"> - <tr><td class="paramname">oracle_relations</td><td>a reference to a <a class="el" href="class_factor_oracle.html">FactorOracle</a> class. </td></tr> - <tr><td class="paramname">word</td><td>a string argument.</td></tr> - </table> - </dd> -</dl> -<p>< S[0] = -1</p> -<p>< for i <- 1 to m do AddLetter(i)</p> - -</div> -</div> -<a id="a28d2e85676712f983b1dcba83ae07d50"></a> -<h2 class="memtitle"><span class="permalink"><a href="#a28d2e85676712f983b1dcba83ae07d50">◆ </a></span>FindBetter()</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">int FactorOracle::FindBetter </td> - <td>(</td> - <td class="paramtype"><a class="el" href="class_factor_oracle.html">FactorOracle</a> & </td> - <td class="paramname"><em>States</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">vector< vector< int >> & </td> - <td class="paramname"><em>T</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">int </td> - <td class="paramname"><em>i</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">char </td> - <td class="paramname"><em>alpha</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">string </td> - <td class="paramname"><em>word</em> </td> - </tr> - <tr> - <td></td> - <td>)</td> - <td></td><td></td> - </tr> - </table> -</div><div class="memdoc"> -<p>A normal member taking five arguments and returning an integer value.</p> -<dl class="params"><dt>Parameters</dt><dd> - <table class="params"> - <tr><td class="paramname">all_states_</td><td>a reference to a <a class="el" href="class_factor_oracle.html">FactorOracle</a> class. </td></tr> - <tr><td class="paramname">T</td><td>a reference to a vector of vector of integers. </td></tr> - <tr><td class="paramname">i</td><td>an integer argument. </td></tr> - <tr><td class="paramname">alpha</td><td>a char argument. </td></tr> - <tr><td class="paramname">word</td><td>a string argument. </td></tr> - </table> - </dd> -</dl> -<dl class="section return"><dt>Returns</dt><dd>A better state</dd></dl> - -</div> -</div> -<a id="abe8c4c194b309aeeff1bc05c25563390"></a> -<h2 class="memtitle"><span class="permalink"><a href="#abe8c4c194b309aeeff1bc05c25563390">◆ </a></span>FOGenerate()</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">string FactorOracle::FOGenerate </td> - <td>(</td> - <td class="paramtype"><a class="el" href="class_factor_oracle.html">FactorOracle</a> & </td> - <td class="paramname"><em>States</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">int </td> - <td class="paramname"><em>i</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">string </td> - <td class="paramname"><em>v</em>, </td> - </tr> - <tr> - <td class="paramkey"></td> - <td></td> - <td class="paramtype">float </td> - <td class="paramname"><em>q</em> </td> - </tr> - <tr> - <td></td> - <td>)</td> - <td></td><td></td> - </tr> - </table> -</div><div class="memdoc"> -<p>A normal member taking four arguments and returning a string value.</p> -<dl class="params"><dt>Parameters</dt><dd> - <table class="params"> - <tr><td class="paramname">all_states_</td><td>a reference to a <a class="el" href="class_factor_oracle.html">FactorOracle</a> class. </td></tr> - <tr><td class="paramname">i</td><td>an integer argument. </td></tr> - <tr><td class="paramname">v</td><td>a string argument. </td></tr> - <tr><td class="paramname">q</td><td>a float argument. </td></tr> - </table> - </dd> -</dl> -<dl class="section return"><dt>Returns</dt><dd>The factor oracle improvisation</dd></dl> -<p>Will be used to obtain a seed for the random number engine</p> -<p>Standard mersenne_twister_engine seeded with rd()</p> -<p>float u = (float)rand() / RAND_MAX;</p> -<p>Will be used to obtain a seed for the random number engine</p> -<p>Standard mersenne_twister_engine seeded with rd() </p> - -</div> -</div> -<h2 class="groupheader">Member Data Documentation</h2> -<a id="a6e8dacf834f9ee820818c3655d77d56d"></a> -<h2 class="memtitle"><span class="permalink"><a href="#a6e8dacf834f9ee820818c3655d77d56d">◆ </a></span>states_</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">vector<<a class="el" href="class_state.html">State</a>> FactorOracle::states_</td> - </tr> - </table> -</div><div class="memdoc"> -<p>vector of all the states </p> - -</div> -</div> -<hr/>The documentation for this class was generated from the following files:<ul> -<li><a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a></li> -<li><a class="el" href="_factor_oracle_8cpp.html">FactorOracle.cpp</a></li> -</ul> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/class_single_transition-members.html b/docs/html/class_single_transition-members.html deleted file mode 100644 index da091be3d790a0ab604069058dcd824bbdb720a6..0000000000000000000000000000000000000000 --- a/docs/html/class_single_transition-members.html +++ /dev/null @@ -1,82 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: Member List</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -</div><!-- top --> -<div class="header"> - <div class="headertitle"> -<div class="title">SingleTransition Member List</div> </div> -</div><!--header--> -<div class="contents"> - -<p>This is the complete list of members for <a class="el" href="class_single_transition.html">SingleTransition</a>, including all inherited members.</p> -<table class="directory"> - <tr class="even"><td class="entry"><a class="el" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">first_state_</a></td><td class="entry"><a class="el" href="class_single_transition.html">SingleTransition</a></td><td class="entry"></td></tr> - <tr><td class="entry"><a class="el" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">last_state_</a></td><td class="entry"><a class="el" href="class_single_transition.html">SingleTransition</a></td><td class="entry"></td></tr> - <tr class="even"><td class="entry"><a class="el" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">symbol_</a></td><td class="entry"><a class="el" href="class_single_transition.html">SingleTransition</a></td><td class="entry"></td></tr> -</table></div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/class_single_transition.html b/docs/html/class_single_transition.html deleted file mode 100644 index fe31c7fb8c7a7c1ed326f222163f7e19791d7440..0000000000000000000000000000000000000000 --- a/docs/html/class_single_transition.html +++ /dev/null @@ -1,142 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: SingleTransition Class Reference</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -</div><!-- top --> -<div class="header"> - <div class="summary"> -<a href="#pub-attribs">Public Attributes</a> | -<a href="class_single_transition-members.html">List of all members</a> </div> - <div class="headertitle"> -<div class="title">SingleTransition Class Reference</div> </div> -</div><!--header--> -<div class="contents"> - -<p><code>#include <<a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a>></code></p> -<table class="memberdecls"> -<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a> -Public Attributes</h2></td></tr> -<tr class="memitem:a88f7e002e072ffe7bb5eeb168cf0fea6"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">first_state_</a></td></tr> -<tr class="separator:a88f7e002e072ffe7bb5eeb168cf0fea6"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:a9d07ad3e0f9d7728919a372111313c69"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">last_state_</a></td></tr> -<tr class="separator:a9d07ad3e0f9d7728919a372111313c69"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:ae632ebd30fd4818e999fd1009cb2a8f9"><td class="memItemLeft" align="right" valign="top">char </td><td class="memItemRight" valign="bottom"><a class="el" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">symbol_</a></td></tr> -<tr class="separator:ae632ebd30fd4818e999fd1009cb2a8f9"><td class="memSeparator" colspan="2"> </td></tr> -</table> -<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> -<div class="textblock"><p>The class <a class="el" href="class_single_transition.html">SingleTransition</a> denotes the elements that belong to each transition </p> -</div><h2 class="groupheader">Member Data Documentation</h2> -<a id="a88f7e002e072ffe7bb5eeb168cf0fea6"></a> -<h2 class="memtitle"><span class="permalink"><a href="#a88f7e002e072ffe7bb5eeb168cf0fea6">◆ </a></span>first_state_</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">int SingleTransition::first_state_</td> - </tr> - </table> -</div><div class="memdoc"> -<p>denotes the first state of the transition </p> - -</div> -</div> -<a id="a9d07ad3e0f9d7728919a372111313c69"></a> -<h2 class="memtitle"><span class="permalink"><a href="#a9d07ad3e0f9d7728919a372111313c69">◆ </a></span>last_state_</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">int SingleTransition::last_state_</td> - </tr> - </table> -</div><div class="memdoc"> -<p>denotes the last state of the transition </p> - -</div> -</div> -<a id="ae632ebd30fd4818e999fd1009cb2a8f9"></a> -<h2 class="memtitle"><span class="permalink"><a href="#ae632ebd30fd4818e999fd1009cb2a8f9">◆ </a></span>symbol_</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">char SingleTransition::symbol_</td> - </tr> - </table> -</div><div class="memdoc"> -<p>denotes the symbol (letter) of the transition </p> - -</div> -</div> -<hr/>The documentation for this class was generated from the following file:<ul> -<li><a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a></li> -</ul> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/class_state-members.html b/docs/html/class_state-members.html deleted file mode 100644 index 1823d2ba16c709e3b5a9164d9e1cdc34e611323a..0000000000000000000000000000000000000000 --- a/docs/html/class_state-members.html +++ /dev/null @@ -1,84 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: Member List</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -</div><!-- top --> -<div class="header"> - <div class="headertitle"> -<div class="title">State Member List</div> </div> -</div><!--header--> -<div class="contents"> - -<p>This is the complete list of members for <a class="el" href="class_state.html">State</a>, including all inherited members.</p> -<table class="directory"> - <tr bgcolor="#f0f0f0" class="even"><td class="entry"><b>lrs_</b> (defined in <a class="el" href="class_state.html">State</a>)</td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"></td></tr> - <tr bgcolor="#f0f0f0"><td class="entry"><b>singleTransitionResize</b>() (defined in <a class="el" href="class_state.html">State</a>)</td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"><span class="mlabel">inline</span></td></tr> - <tr class="even"><td class="entry"><a class="el" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">state_</a></td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"></td></tr> - <tr bgcolor="#f0f0f0"><td class="entry"><b>suffix_transition_</b> (defined in <a class="el" href="class_state.html">State</a>)</td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"></td></tr> - <tr class="even"><td class="entry"><a class="el" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">transition_</a></td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"></td></tr> -</table></div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/class_state.html b/docs/html/class_state.html deleted file mode 100644 index ac2bffca3aad28c84960abbcc0d2e061f1225264..0000000000000000000000000000000000000000 --- a/docs/html/class_state.html +++ /dev/null @@ -1,138 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: State Class Reference</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -</div><!-- top --> -<div class="header"> - <div class="summary"> -<a href="#pub-methods">Public Member Functions</a> | -<a href="#pub-attribs">Public Attributes</a> | -<a href="class_state-members.html">List of all members</a> </div> - <div class="headertitle"> -<div class="title">State Class Reference</div> </div> -</div><!--header--> -<div class="contents"> - -<p><code>#include <<a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a>></code></p> -<table class="memberdecls"> -<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-methods"></a> -Public Member Functions</h2></td></tr> -<tr class="memitem:a472cf58ec39b9f2158560f8aae3b89c8"><td class="memItemLeft" align="right" valign="top"><a id="a472cf58ec39b9f2158560f8aae3b89c8"></a> -void </td><td class="memItemRight" valign="bottom"><b>singleTransitionResize</b> ()</td></tr> -<tr class="separator:a472cf58ec39b9f2158560f8aae3b89c8"><td class="memSeparator" colspan="2"> </td></tr> -</table><table class="memberdecls"> -<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a> -Public Attributes</h2></td></tr> -<tr class="memitem:a2dcf672a1560830a8f93b0e9863c6724"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">state_</a></td></tr> -<tr class="separator:a2dcf672a1560830a8f93b0e9863c6724"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:afd5b3d2afbba2fc03583f76a7cb08fe8"><td class="memItemLeft" align="right" valign="top">vector< <a class="el" href="class_single_transition.html">SingleTransition</a> > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">transition_</a></td></tr> -<tr class="separator:afd5b3d2afbba2fc03583f76a7cb08fe8"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:ae1daff1d8cfaf403f5f81b74a32d18cf"><td class="memItemLeft" align="right" valign="top"><a id="ae1daff1d8cfaf403f5f81b74a32d18cf"></a> -int </td><td class="memItemRight" valign="bottom"><b>suffix_transition_</b></td></tr> -<tr class="separator:ae1daff1d8cfaf403f5f81b74a32d18cf"><td class="memSeparator" colspan="2"> </td></tr> -<tr class="memitem:a232fd4e8e92e228c5ad8542c8d45e9b6"><td class="memItemLeft" align="right" valign="top"><a id="a232fd4e8e92e228c5ad8542c8d45e9b6"></a> -int </td><td class="memItemRight" valign="bottom"><b>lrs_</b> = 0</td></tr> -<tr class="separator:a232fd4e8e92e228c5ad8542c8d45e9b6"><td class="memSeparator" colspan="2"> </td></tr> -</table> -<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> -<div class="textblock"><p>The class <a class="el" href="class_state.html">State</a> denotes the elements that belong to each state state denotes de number of the state vector <SingleTransition> transition is the vector where all forward links of the state are defined suffix_transition denotes which is the suffix link of this state lrs is the longest repeated subsequence of this state </p> -</div><h2 class="groupheader">Member Data Documentation</h2> -<a id="a2dcf672a1560830a8f93b0e9863c6724"></a> -<h2 class="memtitle"><span class="permalink"><a href="#a2dcf672a1560830a8f93b0e9863c6724">◆ </a></span>state_</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">int State::state_</td> - </tr> - </table> -</div><div class="memdoc"> -<p>denotes the number of the state </p> - -</div> -</div> -<a id="afd5b3d2afbba2fc03583f76a7cb08fe8"></a> -<h2 class="memtitle"><span class="permalink"><a href="#afd5b3d2afbba2fc03583f76a7cb08fe8">◆ </a></span>transition_</h2> - -<div class="memitem"> -<div class="memproto"> - <table class="memname"> - <tr> - <td class="memname">vector<<a class="el" href="class_single_transition.html">SingleTransition</a>> State::transition_</td> - </tr> - </table> -</div><div class="memdoc"> -<p>denotes the number of the state </p> - -</div> -</div> -<hr/>The documentation for this class was generated from the following file:<ul> -<li><a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a></li> -</ul> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/classes.html b/docs/html/classes.html deleted file mode 100644 index b217b92d21547d797fb83e7bd825cd1f3b453932..0000000000000000000000000000000000000000 --- a/docs/html/classes.html +++ /dev/null @@ -1,86 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: Class Index</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -</div><!-- top --> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -<div class="header"> - <div class="headertitle"> -<div class="title">Class Index</div> </div> -</div><!--header--> -<div class="contents"> -<div class="qindex"><a class="qindex" href="#letter_f">f</a> | <a class="qindex" href="#letter_s">s</a></div> -<table class="classindex"> -<tr><td rowspan="2" valign="bottom"><a name="letter_f"></a><table border="0" cellspacing="0" cellpadding="0"><tr><td><div class="ah">  f  </div></td></tr></table> -</td><td rowspan="2" valign="bottom"><a name="letter_s"></a><table border="0" cellspacing="0" cellpadding="0"><tr><td><div class="ah">  s  </div></td></tr></table> -</td><td valign="top"><a class="el" href="class_state.html">State</a>   </td></tr> -<tr><td></td><td></td><td></td></tr> -<tr><td valign="top"><a class="el" href="class_factor_oracle.html">FactorOracle</a>   </td><td valign="top"><a class="el" href="class_single_transition.html">SingleTransition</a>   </td><td></td></tr> -<tr><td></td><td></td><td></td></tr> -</table> -<div class="qindex"><a class="qindex" href="#letter_f">f</a> | <a class="qindex" href="#letter_s">s</a></div> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/closed.png b/docs/html/closed.png deleted file mode 100644 index 98cc2c909da37a6df914fbf67780eebd99c597f5..0000000000000000000000000000000000000000 Binary files a/docs/html/closed.png and /dev/null differ diff --git a/docs/html/doc.png b/docs/html/doc.png deleted file mode 100644 index 17edabff95f7b8da13c9516a04efe05493c29501..0000000000000000000000000000000000000000 Binary files a/docs/html/doc.png and /dev/null differ diff --git a/docs/html/doxygen.css b/docs/html/doxygen.css deleted file mode 100644 index e2515926c80d5d948bee1e24a4f8ca334efa0ad5..0000000000000000000000000000000000000000 --- a/docs/html/doxygen.css +++ /dev/null @@ -1,1764 +0,0 @@ -/* The standard CSS for doxygen 1.8.15 */ - -body, table, div, p, dl { - font: 400 14px/22px Roboto,sans-serif; -} - -p.reference, p.definition { - font: 400 14px/22px Roboto,sans-serif; -} - -/* @group Heading Levels */ - -h1.groupheader { - font-size: 150%; -} - -.title { - font: 400 14px/28px Roboto,sans-serif; - font-size: 150%; - font-weight: bold; - margin: 10px 2px; -} - -h2.groupheader { - border-bottom: 1px solid #879ECB; - color: #354C7B; - font-size: 150%; - font-weight: normal; - margin-top: 1.75em; - padding-top: 8px; - padding-bottom: 4px; - width: 100%; -} - -h3.groupheader { - font-size: 100%; -} - -h1, h2, h3, h4, h5, h6 { - -webkit-transition: text-shadow 0.5s linear; - -moz-transition: text-shadow 0.5s linear; - -ms-transition: text-shadow 0.5s linear; - -o-transition: text-shadow 0.5s linear; - transition: text-shadow 0.5s linear; - margin-right: 15px; -} - -h1.glow, h2.glow, h3.glow, h4.glow, h5.glow, h6.glow { - text-shadow: 0 0 15px cyan; -} - -dt { - font-weight: bold; -} - -div.multicol { - -moz-column-gap: 1em; - -webkit-column-gap: 1em; - -moz-column-count: 3; - -webkit-column-count: 3; -} - -p.startli, p.startdd { - margin-top: 2px; -} - -p.starttd { - margin-top: 0px; -} - -p.endli { - margin-bottom: 0px; -} - -p.enddd { - margin-bottom: 4px; -} - -p.endtd { - margin-bottom: 2px; -} - -p.interli { -} - -p.interdd { -} - -p.intertd { -} - -/* @end */ - -caption { - font-weight: bold; -} - -span.legend { - font-size: 70%; - text-align: center; -} - -h3.version { - font-size: 90%; - text-align: center; -} - -div.qindex, div.navtab{ - background-color: #EBEFF6; - border: 1px solid #A3B4D7; - text-align: center; -} - -div.qindex, div.navpath { - width: 100%; - line-height: 140%; -} - -div.navtab { - margin-right: 15px; -} - -/* @group Link Styling */ - -a { - color: #3D578C; - font-weight: normal; - text-decoration: none; -} - -.contents a:visited { - color: #4665A2; -} - -a:hover { - text-decoration: underline; -} - -a.qindex { - font-weight: bold; -} - -a.qindexHL { - font-weight: bold; - background-color: #9CAFD4; - color: #FFFFFF; - border: 1px double #869DCA; -} - -.contents a.qindexHL:visited { - color: #FFFFFF; -} - -a.el { - font-weight: bold; -} - -a.elRef { -} - -a.code, a.code:visited, a.line, a.line:visited { - color: #4665A2; -} - -a.codeRef, a.codeRef:visited, a.lineRef, a.lineRef:visited { - color: #4665A2; -} - -/* @end */ - -dl.el { - margin-left: -1cm; -} - -ul { - overflow: hidden; /*Fixed: list item bullets overlap floating elements*/ -} - -#side-nav ul { - overflow: visible; /* reset ul rule for scroll bar in GENERATE_TREEVIEW window */ -} - -#main-nav ul { - overflow: visible; /* reset ul rule for the navigation bar drop down lists */ -} - -.fragment { - text-align: left; - direction: ltr; - overflow-x: auto; /*Fixed: fragment lines overlap floating elements*/ - overflow-y: hidden; -} - -pre.fragment { - border: 1px solid #C4CFE5; - background-color: #FBFCFD; - padding: 4px 6px; - margin: 4px 8px 4px 2px; - overflow: auto; - word-wrap: break-word; - font-size: 9pt; - line-height: 125%; - font-family: monospace, fixed; - font-size: 105%; -} - -div.fragment { - padding: 0 0 1px 0; /*Fixed: last line underline overlap border*/ - margin: 4px 8px 4px 2px; - background-color: #FBFCFD; - border: 1px solid #C4CFE5; -} - -div.line { - font-family: monospace, fixed; - font-size: 13px; - min-height: 13px; - line-height: 1.0; - text-wrap: unrestricted; - white-space: -moz-pre-wrap; /* Moz */ - white-space: -pre-wrap; /* Opera 4-6 */ - white-space: -o-pre-wrap; /* Opera 7 */ - white-space: pre-wrap; /* CSS3 */ - word-wrap: break-word; /* IE 5.5+ */ - text-indent: -53px; - padding-left: 53px; - padding-bottom: 0px; - margin: 0px; - -webkit-transition-property: background-color, box-shadow; - -webkit-transition-duration: 0.5s; - -moz-transition-property: background-color, box-shadow; - -moz-transition-duration: 0.5s; - -ms-transition-property: background-color, box-shadow; - -ms-transition-duration: 0.5s; - -o-transition-property: background-color, box-shadow; - -o-transition-duration: 0.5s; - transition-property: background-color, box-shadow; - transition-duration: 0.5s; -} - -div.line:after { - content:"\000A"; - white-space: pre; -} - -div.line.glow { - background-color: cyan; - box-shadow: 0 0 10px cyan; -} - - -span.lineno { - padding-right: 4px; - text-align: right; - border-right: 2px solid #0F0; - background-color: #E8E8E8; - white-space: pre; -} -span.lineno a { - background-color: #D8D8D8; -} - -span.lineno a:hover { - background-color: #C8C8C8; -} - -.lineno { - -webkit-touch-callout: none; - -webkit-user-select: none; - -khtml-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; -} - -div.ah, span.ah { - background-color: black; - font-weight: bold; - color: #FFFFFF; - margin-bottom: 3px; - margin-top: 3px; - padding: 0.2em; - border: solid thin #333; - border-radius: 0.5em; - -webkit-border-radius: .5em; - -moz-border-radius: .5em; - box-shadow: 2px 2px 3px #999; - -webkit-box-shadow: 2px 2px 3px #999; - -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; - background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#000),color-stop(0.3, #444)); - background-image: -moz-linear-gradient(center top, #eee 0%, #444 40%, #000 110%); -} - -div.classindex ul { - list-style: none; - padding-left: 0; -} - -div.classindex span.ai { - display: inline-block; -} - -div.groupHeader { - margin-left: 16px; - margin-top: 12px; - font-weight: bold; -} - -div.groupText { - margin-left: 16px; - font-style: italic; -} - -body { - background-color: white; - color: black; - margin: 0; -} - -div.contents { - margin-top: 10px; - margin-left: 12px; - margin-right: 8px; -} - -td.indexkey { - background-color: #EBEFF6; - font-weight: bold; - border: 1px solid #C4CFE5; - margin: 2px 0px 2px 0; - padding: 2px 10px; - white-space: nowrap; - vertical-align: top; -} - -td.indexvalue { - background-color: #EBEFF6; - border: 1px solid #C4CFE5; - padding: 2px 10px; - margin: 2px 0px; -} - -tr.memlist { - background-color: #EEF1F7; -} - -p.formulaDsp { - text-align: center; -} - -img.formulaDsp { - -} - -img.formulaInl, img.inline { - vertical-align: middle; -} - -div.center { - text-align: center; - margin-top: 0px; - margin-bottom: 0px; - padding: 0px; -} - -div.center img { - border: 0px; -} - -address.footer { - text-align: right; - padding-right: 12px; -} - -img.footer { - border: 0px; - vertical-align: middle; -} - -/* @group Code Colorization */ - -span.keyword { - color: #008000 -} - -span.keywordtype { - color: #604020 -} - -span.keywordflow { - color: #e08000 -} - -span.comment { - color: #800000 -} - -span.preprocessor { - color: #806020 -} - -span.stringliteral { - color: #002080 -} - -span.charliteral { - color: #008080 -} - -span.vhdldigit { - color: #ff00ff -} - -span.vhdlchar { - color: #000000 -} - -span.vhdlkeyword { - color: #700070 -} - -span.vhdllogic { - color: #ff0000 -} - -blockquote { - background-color: #F7F8FB; - border-left: 2px solid #9CAFD4; - margin: 0 24px 0 4px; - padding: 0 12px 0 16px; -} - -blockquote.DocNodeRTL { - border-left: 0; - border-right: 2px solid #9CAFD4; - margin: 0 4px 0 24px; - padding: 0 16px 0 12px; -} - -/* @end */ - -/* -.search { - color: #003399; - font-weight: bold; -} - -form.search { - margin-bottom: 0px; - margin-top: 0px; -} - -input.search { - font-size: 75%; - color: #000080; - font-weight: normal; - background-color: #e8eef2; -} -*/ - -td.tiny { - font-size: 75%; -} - -.dirtab { - padding: 4px; - border-collapse: collapse; - border: 1px solid #A3B4D7; -} - -th.dirtab { - background: #EBEFF6; - font-weight: bold; -} - -hr { - height: 0px; - border: none; - border-top: 1px solid #4A6AAA; -} - -hr.footer { - height: 1px; -} - -/* @group Member Descriptions */ - -table.memberdecls { - border-spacing: 0px; - padding: 0px; -} - -.memberdecls td, .fieldtable tr { - -webkit-transition-property: background-color, box-shadow; - -webkit-transition-duration: 0.5s; - -moz-transition-property: background-color, box-shadow; - -moz-transition-duration: 0.5s; - -ms-transition-property: background-color, box-shadow; - -ms-transition-duration: 0.5s; - -o-transition-property: background-color, box-shadow; - -o-transition-duration: 0.5s; - transition-property: background-color, box-shadow; - transition-duration: 0.5s; -} - -.memberdecls td.glow, .fieldtable tr.glow { - background-color: cyan; - box-shadow: 0 0 15px cyan; -} - -.mdescLeft, .mdescRight, -.memItemLeft, .memItemRight, -.memTemplItemLeft, .memTemplItemRight, .memTemplParams { - background-color: #F9FAFC; - border: none; - margin: 4px; - padding: 1px 0 0 8px; -} - -.mdescLeft, .mdescRight { - padding: 0px 8px 4px 8px; - color: #555; -} - -.memSeparator { - border-bottom: 1px solid #DEE4F0; - line-height: 1px; - margin: 0px; - padding: 0px; -} - -.memItemLeft, .memTemplItemLeft { - white-space: nowrap; -} - -.memItemRight { - width: 100%; -} - -.memTemplParams { - color: #4665A2; - white-space: nowrap; - font-size: 80%; -} - -/* @end */ - -/* @group Member Details */ - -/* Styles for detailed member documentation */ - -.memtitle { - padding: 8px; - border-top: 1px solid #A8B8D9; - border-left: 1px solid #A8B8D9; - border-right: 1px solid #A8B8D9; - border-top-right-radius: 4px; - border-top-left-radius: 4px; - margin-bottom: -1px; - background-image: url('nav_f.png'); - background-repeat: repeat-x; - background-color: #E2E8F2; - line-height: 1.25; - font-weight: 300; - float:left; -} - -.permalink -{ - font-size: 65%; - display: inline-block; - vertical-align: middle; -} - -.memtemplate { - font-size: 80%; - color: #4665A2; - font-weight: normal; - margin-left: 9px; -} - -.memnav { - background-color: #EBEFF6; - border: 1px solid #A3B4D7; - text-align: center; - margin: 2px; - margin-right: 15px; - padding: 2px; -} - -.mempage { - width: 100%; -} - -.memitem { - padding: 0; - margin-bottom: 10px; - margin-right: 5px; - -webkit-transition: box-shadow 0.5s linear; - -moz-transition: box-shadow 0.5s linear; - -ms-transition: box-shadow 0.5s linear; - -o-transition: box-shadow 0.5s linear; - transition: box-shadow 0.5s linear; - display: table !important; - width: 100%; -} - -.memitem.glow { - box-shadow: 0 0 15px cyan; -} - -.memname { - font-weight: 400; - margin-left: 6px; -} - -.memname td { - vertical-align: bottom; -} - -.memproto, dl.reflist dt { - border-top: 1px solid #A8B8D9; - border-left: 1px solid #A8B8D9; - border-right: 1px solid #A8B8D9; - padding: 6px 0px 6px 0px; - color: #253555; - font-weight: bold; - text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); - background-color: #DFE5F1; - /* opera specific markup */ - box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); - border-top-right-radius: 4px; - /* firefox specific markup */ - -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; - -moz-border-radius-topright: 4px; - /* webkit specific markup */ - -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); - -webkit-border-top-right-radius: 4px; - -} - -.overload { - font-family: "courier new",courier,monospace; - font-size: 65%; -} - -.memdoc, dl.reflist dd { - border-bottom: 1px solid #A8B8D9; - border-left: 1px solid #A8B8D9; - border-right: 1px solid #A8B8D9; - padding: 6px 10px 2px 10px; - background-color: #FBFCFD; - border-top-width: 0; - background-image:url('nav_g.png'); - background-repeat:repeat-x; - background-color: #FFFFFF; - /* opera specific markup */ - border-bottom-left-radius: 4px; - border-bottom-right-radius: 4px; - box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); - /* firefox specific markup */ - -moz-border-radius-bottomleft: 4px; - -moz-border-radius-bottomright: 4px; - -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; - /* webkit specific markup */ - -webkit-border-bottom-left-radius: 4px; - -webkit-border-bottom-right-radius: 4px; - -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); -} - -dl.reflist dt { - padding: 5px; -} - -dl.reflist dd { - margin: 0px 0px 10px 0px; - padding: 5px; -} - -.paramkey { - text-align: right; -} - -.paramtype { - white-space: nowrap; -} - -.paramname { - color: #602020; - white-space: nowrap; -} -.paramname em { - font-style: normal; -} -.paramname code { - line-height: 14px; -} - -.params, .retval, .exception, .tparams { - margin-left: 0px; - padding-left: 0px; -} - -.params .paramname, .retval .paramname, .tparams .paramname { - font-weight: bold; - vertical-align: top; -} - -.params .paramtype, .tparams .paramtype { - font-style: italic; - vertical-align: top; -} - -.params .paramdir, .tparams .paramdir { - font-family: "courier new",courier,monospace; - vertical-align: top; -} - -table.mlabels { - border-spacing: 0px; -} - -td.mlabels-left { - width: 100%; - padding: 0px; -} - -td.mlabels-right { - vertical-align: bottom; - padding: 0px; - white-space: nowrap; -} - -span.mlabels { - margin-left: 8px; -} - -span.mlabel { - background-color: #728DC1; - border-top:1px solid #5373B4; - border-left:1px solid #5373B4; - border-right:1px solid #C4CFE5; - border-bottom:1px solid #C4CFE5; - text-shadow: none; - color: white; - margin-right: 4px; - padding: 2px 3px; - border-radius: 3px; - font-size: 7pt; - white-space: nowrap; - vertical-align: middle; -} - - - -/* @end */ - -/* these are for tree view inside a (index) page */ - -div.directory { - margin: 10px 0px; - border-top: 1px solid #9CAFD4; - border-bottom: 1px solid #9CAFD4; - width: 100%; -} - -.directory table { - border-collapse:collapse; -} - -.directory td { - margin: 0px; - padding: 0px; - vertical-align: top; -} - -.directory td.entry { - white-space: nowrap; - padding-right: 6px; - padding-top: 3px; -} - -.directory td.entry a { - outline:none; -} - -.directory td.entry a img { - border: none; -} - -.directory td.desc { - width: 100%; - padding-left: 6px; - padding-right: 6px; - padding-top: 3px; - border-left: 1px solid rgba(0,0,0,0.05); -} - -.directory tr.even { - padding-left: 6px; - background-color: #F7F8FB; -} - -.directory img { - vertical-align: -30%; -} - -.directory .levels { - white-space: nowrap; - width: 100%; - text-align: right; - font-size: 9pt; -} - -.directory .levels span { - cursor: pointer; - padding-left: 2px; - padding-right: 2px; - color: #3D578C; -} - -.arrow { - color: #9CAFD4; - -webkit-user-select: none; - -khtml-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; - cursor: pointer; - font-size: 80%; - display: inline-block; - width: 16px; - height: 22px; -} - -.icon { - font-family: Arial, Helvetica; - font-weight: bold; - font-size: 12px; - height: 14px; - width: 16px; - display: inline-block; - background-color: #728DC1; - color: white; - text-align: center; - border-radius: 4px; - margin-left: 2px; - margin-right: 2px; -} - -.icona { - width: 24px; - height: 22px; - display: inline-block; -} - -.iconfopen { - width: 24px; - height: 18px; - margin-bottom: 4px; - background-image:url('folderopen.png'); - background-position: 0px -4px; - background-repeat: repeat-y; - vertical-align:top; - display: inline-block; -} - -.iconfclosed { - width: 24px; - height: 18px; - margin-bottom: 4px; - background-image:url('folderclosed.png'); - background-position: 0px -4px; - background-repeat: repeat-y; - vertical-align:top; - display: inline-block; -} - -.icondoc { - width: 24px; - height: 18px; - margin-bottom: 4px; - background-image:url('doc.png'); - background-position: 0px -4px; - background-repeat: repeat-y; - vertical-align:top; - display: inline-block; -} - -table.directory { - font: 400 14px Roboto,sans-serif; -} - -/* @end */ - -div.dynheader { - margin-top: 8px; - -webkit-touch-callout: none; - -webkit-user-select: none; - -khtml-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; -} - -address { - font-style: normal; - color: #2A3D61; -} - -table.doxtable caption { - caption-side: top; -} - -table.doxtable { - border-collapse:collapse; - margin-top: 4px; - margin-bottom: 4px; -} - -table.doxtable td, table.doxtable th { - border: 1px solid #2D4068; - padding: 3px 7px 2px; -} - -table.doxtable th { - background-color: #374F7F; - color: #FFFFFF; - font-size: 110%; - padding-bottom: 4px; - padding-top: 5px; -} - -table.fieldtable { - /*width: 100%;*/ - margin-bottom: 10px; - border: 1px solid #A8B8D9; - border-spacing: 0px; - -moz-border-radius: 4px; - -webkit-border-radius: 4px; - border-radius: 4px; - -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; - -webkit-box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); - box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); -} - -.fieldtable td, .fieldtable th { - padding: 3px 7px 2px; -} - -.fieldtable td.fieldtype, .fieldtable td.fieldname { - white-space: nowrap; - border-right: 1px solid #A8B8D9; - border-bottom: 1px solid #A8B8D9; - vertical-align: top; -} - -.fieldtable td.fieldname { - padding-top: 3px; -} - -.fieldtable td.fielddoc { - border-bottom: 1px solid #A8B8D9; - /*width: 100%;*/ -} - -.fieldtable td.fielddoc p:first-child { - margin-top: 0px; -} - -.fieldtable td.fielddoc p:last-child { - margin-bottom: 2px; -} - -.fieldtable tr:last-child td { - border-bottom: none; -} - -.fieldtable th { - background-image:url('nav_f.png'); - background-repeat:repeat-x; - background-color: #E2E8F2; - font-size: 90%; - color: #253555; - padding-bottom: 4px; - padding-top: 5px; - text-align:left; - font-weight: 400; - -moz-border-radius-topleft: 4px; - -moz-border-radius-topright: 4px; - -webkit-border-top-left-radius: 4px; - -webkit-border-top-right-radius: 4px; - border-top-left-radius: 4px; - border-top-right-radius: 4px; - border-bottom: 1px solid #A8B8D9; -} - - -.tabsearch { - top: 0px; - left: 10px; - height: 36px; - background-image: url('tab_b.png'); - z-index: 101; - overflow: hidden; - font-size: 13px; -} - -.navpath ul -{ - font-size: 11px; - background-image:url('tab_b.png'); - background-repeat:repeat-x; - background-position: 0 -5px; - height:30px; - line-height:30px; - color:#8AA0CC; - border:solid 1px #C2CDE4; - overflow:hidden; - margin:0px; - padding:0px; -} - -.navpath li -{ - list-style-type:none; - float:left; - padding-left:10px; - padding-right:15px; - background-image:url('bc_s.png'); - background-repeat:no-repeat; - background-position:right; - color:#364D7C; -} - -.navpath li.navelem a -{ - height:32px; - display:block; - text-decoration: none; - outline: none; - color: #283A5D; - font-family: 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif; - text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); - text-decoration: none; -} - -.navpath li.navelem a:hover -{ - color:#6884BD; -} - -.navpath li.footer -{ - list-style-type:none; - float:right; - padding-left:10px; - padding-right:15px; - background-image:none; - background-repeat:no-repeat; - background-position:right; - color:#364D7C; - font-size: 8pt; -} - - -div.summary -{ - float: right; - font-size: 8pt; - padding-right: 5px; - width: 50%; - text-align: right; -} - -div.summary a -{ - white-space: nowrap; -} - -table.classindex -{ - margin: 10px; - white-space: nowrap; - margin-left: 3%; - margin-right: 3%; - width: 94%; - border: 0; - border-spacing: 0; - padding: 0; -} - -div.ingroups -{ - font-size: 8pt; - width: 50%; - text-align: left; -} - -div.ingroups a -{ - white-space: nowrap; -} - -div.header -{ - background-image:url('nav_h.png'); - background-repeat:repeat-x; - background-color: #F9FAFC; - margin: 0px; - border-bottom: 1px solid #C4CFE5; -} - -div.headertitle -{ - padding: 5px 5px 5px 10px; -} - -.PageDocRTL-title div.headertitle { - text-align: right; - direction: rtl; -} - -dl { - padding: 0 0 0 0; -} - -/* dl.note, dl.warning, dl.attention, dl.pre, dl.post, dl.invariant, dl.deprecated, dl.todo, dl.test, dl.bug, dl.examples */ -dl.section { - margin-left: 0px; - padding-left: 0px; -} - -dl.section.DocNodeRTL { - margin-right: 0px; - padding-right: 0px; -} - -dl.note { - margin-left: -7px; - padding-left: 3px; - border-left: 4px solid; - border-color: #D0C000; -} - -dl.note.DocNodeRTL { - margin-left: 0; - padding-left: 0; - border-left: 0; - margin-right: -7px; - padding-right: 3px; - border-right: 4px solid; - border-color: #D0C000; -} - -dl.warning, dl.attention { - margin-left: -7px; - padding-left: 3px; - border-left: 4px solid; - border-color: #FF0000; -} - -dl.warning.DocNodeRTL, dl.attention.DocNodeRTL { - margin-left: 0; - padding-left: 0; - border-left: 0; - margin-right: -7px; - padding-right: 3px; - border-right: 4px solid; - border-color: #FF0000; -} - -dl.pre, dl.post, dl.invariant { - margin-left: -7px; - padding-left: 3px; - border-left: 4px solid; - border-color: #00D000; -} - -dl.pre.DocNodeRTL, dl.post.DocNodeRTL, dl.invariant.DocNodeRTL { - margin-left: 0; - padding-left: 0; - border-left: 0; - margin-right: -7px; - padding-right: 3px; - border-right: 4px solid; - border-color: #00D000; -} - -dl.deprecated { - margin-left: -7px; - padding-left: 3px; - border-left: 4px solid; - border-color: #505050; -} - -dl.deprecated.DocNodeRTL { - margin-left: 0; - padding-left: 0; - border-left: 0; - margin-right: -7px; - padding-right: 3px; - border-right: 4px solid; - border-color: #505050; -} - -dl.todo { - margin-left: -7px; - padding-left: 3px; - border-left: 4px solid; - border-color: #00C0E0; -} - -dl.todo.DocNodeRTL { - margin-left: 0; - padding-left: 0; - border-left: 0; - margin-right: -7px; - padding-right: 3px; - border-right: 4px solid; - border-color: #00C0E0; -} - -dl.test { - margin-left: -7px; - padding-left: 3px; - border-left: 4px solid; - border-color: #3030E0; -} - -dl.test.DocNodeRTL { - margin-left: 0; - padding-left: 0; - border-left: 0; - margin-right: -7px; - padding-right: 3px; - border-right: 4px solid; - border-color: #3030E0; -} - -dl.bug { - margin-left: -7px; - padding-left: 3px; - border-left: 4px solid; - border-color: #C08050; -} - -dl.bug.DocNodeRTL { - margin-left: 0; - padding-left: 0; - border-left: 0; - margin-right: -7px; - padding-right: 3px; - border-right: 4px solid; - border-color: #C08050; -} - -dl.section dd { - margin-bottom: 6px; -} - - -#projectlogo -{ - text-align: center; - vertical-align: bottom; - border-collapse: separate; -} - -#projectlogo img -{ - border: 0px none; -} - -#projectalign -{ - vertical-align: middle; -} - -#projectname -{ - font: 300% Tahoma, Arial,sans-serif; - margin: 0px; - padding: 2px 0px; -} - -#projectbrief -{ - font: 120% Tahoma, Arial,sans-serif; - margin: 0px; - padding: 0px; -} - -#projectnumber -{ - font: 50% Tahoma, Arial,sans-serif; - margin: 0px; - padding: 0px; -} - -#titlearea -{ - padding: 0px; - margin: 0px; - width: 100%; - border-bottom: 1px solid #5373B4; -} - -.image -{ - text-align: center; -} - -.dotgraph -{ - text-align: center; -} - -.mscgraph -{ - text-align: center; -} - -.plantumlgraph -{ - text-align: center; -} - -.diagraph -{ - text-align: center; -} - -.caption -{ - font-weight: bold; -} - -div.zoom -{ - border: 1px solid #90A5CE; -} - -dl.citelist { - margin-bottom:50px; -} - -dl.citelist dt { - color:#334975; - float:left; - font-weight:bold; - margin-right:10px; - padding:5px; -} - -dl.citelist dd { - margin:2px 0; - padding:5px 0; -} - -div.toc { - padding: 14px 25px; - background-color: #F4F6FA; - border: 1px solid #D8DFEE; - border-radius: 7px 7px 7px 7px; - float: right; - height: auto; - margin: 0 8px 10px 10px; - width: 200px; -} - -.PageDocRTL-title div.toc { - float: left !important; - text-align: right; -} - -div.toc li { - background: url("bdwn.png") no-repeat scroll 0 5px transparent; - font: 10px/1.2 Verdana,DejaVu Sans,Geneva,sans-serif; - margin-top: 5px; - padding-left: 10px; - padding-top: 2px; -} - -.PageDocRTL-title div.toc li { - background-position-x: right !important; - padding-left: 0 !important; - padding-right: 10px; -} - -div.toc h3 { - font: bold 12px/1.2 Arial,FreeSans,sans-serif; - color: #4665A2; - border-bottom: 0 none; - margin: 0; -} - -div.toc ul { - list-style: none outside none; - border: medium none; - padding: 0px; -} - -div.toc li.level1 { - margin-left: 0px; -} - -div.toc li.level2 { - margin-left: 15px; -} - -div.toc li.level3 { - margin-left: 30px; -} - -div.toc li.level4 { - margin-left: 45px; -} - -.PageDocRTL-title div.toc li.level1 { - margin-left: 0 !important; - margin-right: 0; -} - -.PageDocRTL-title div.toc li.level2 { - margin-left: 0 !important; - margin-right: 15px; -} - -.PageDocRTL-title div.toc li.level3 { - margin-left: 0 !important; - margin-right: 30px; -} - -.PageDocRTL-title div.toc li.level4 { - margin-left: 0 !important; - margin-right: 45px; -} - -.inherit_header { - font-weight: bold; - color: gray; - cursor: pointer; - -webkit-touch-callout: none; - -webkit-user-select: none; - -khtml-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; -} - -.inherit_header td { - padding: 6px 0px 2px 5px; -} - -.inherit { - display: none; -} - -tr.heading h2 { - margin-top: 12px; - margin-bottom: 4px; -} - -/* tooltip related style info */ - -.ttc { - position: absolute; - display: none; -} - -#powerTip { - cursor: default; - white-space: nowrap; - background-color: white; - border: 1px solid gray; - border-radius: 4px 4px 4px 4px; - box-shadow: 1px 1px 7px gray; - display: none; - font-size: smaller; - max-width: 80%; - opacity: 0.9; - padding: 1ex 1em 1em; - position: absolute; - z-index: 2147483647; -} - -#powerTip div.ttdoc { - color: grey; - font-style: italic; -} - -#powerTip div.ttname a { - font-weight: bold; -} - -#powerTip div.ttname { - font-weight: bold; -} - -#powerTip div.ttdeci { - color: #006318; -} - -#powerTip div { - margin: 0px; - padding: 0px; - font: 12px/16px Roboto,sans-serif; -} - -#powerTip:before, #powerTip:after { - content: ""; - position: absolute; - margin: 0px; -} - -#powerTip.n:after, #powerTip.n:before, -#powerTip.s:after, #powerTip.s:before, -#powerTip.w:after, #powerTip.w:before, -#powerTip.e:after, #powerTip.e:before, -#powerTip.ne:after, #powerTip.ne:before, -#powerTip.se:after, #powerTip.se:before, -#powerTip.nw:after, #powerTip.nw:before, -#powerTip.sw:after, #powerTip.sw:before { - border: solid transparent; - content: " "; - height: 0; - width: 0; - position: absolute; -} - -#powerTip.n:after, #powerTip.s:after, -#powerTip.w:after, #powerTip.e:after, -#powerTip.nw:after, #powerTip.ne:after, -#powerTip.sw:after, #powerTip.se:after { - border-color: rgba(255, 255, 255, 0); -} - -#powerTip.n:before, #powerTip.s:before, -#powerTip.w:before, #powerTip.e:before, -#powerTip.nw:before, #powerTip.ne:before, -#powerTip.sw:before, #powerTip.se:before { - border-color: rgba(128, 128, 128, 0); -} - -#powerTip.n:after, #powerTip.n:before, -#powerTip.ne:after, #powerTip.ne:before, -#powerTip.nw:after, #powerTip.nw:before { - top: 100%; -} - -#powerTip.n:after, #powerTip.ne:after, #powerTip.nw:after { - border-top-color: #FFFFFF; - border-width: 10px; - margin: 0px -10px; -} -#powerTip.n:before { - border-top-color: #808080; - border-width: 11px; - margin: 0px -11px; -} -#powerTip.n:after, #powerTip.n:before { - left: 50%; -} - -#powerTip.nw:after, #powerTip.nw:before { - right: 14px; -} - -#powerTip.ne:after, #powerTip.ne:before { - left: 14px; -} - -#powerTip.s:after, #powerTip.s:before, -#powerTip.se:after, #powerTip.se:before, -#powerTip.sw:after, #powerTip.sw:before { - bottom: 100%; -} - -#powerTip.s:after, #powerTip.se:after, #powerTip.sw:after { - border-bottom-color: #FFFFFF; - border-width: 10px; - margin: 0px -10px; -} - -#powerTip.s:before, #powerTip.se:before, #powerTip.sw:before { - border-bottom-color: #808080; - border-width: 11px; - margin: 0px -11px; -} - -#powerTip.s:after, #powerTip.s:before { - left: 50%; -} - -#powerTip.sw:after, #powerTip.sw:before { - right: 14px; -} - -#powerTip.se:after, #powerTip.se:before { - left: 14px; -} - -#powerTip.e:after, #powerTip.e:before { - left: 100%; -} -#powerTip.e:after { - border-left-color: #FFFFFF; - border-width: 10px; - top: 50%; - margin-top: -10px; -} -#powerTip.e:before { - border-left-color: #808080; - border-width: 11px; - top: 50%; - margin-top: -11px; -} - -#powerTip.w:after, #powerTip.w:before { - right: 100%; -} -#powerTip.w:after { - border-right-color: #FFFFFF; - border-width: 10px; - top: 50%; - margin-top: -10px; -} -#powerTip.w:before { - border-right-color: #808080; - border-width: 11px; - top: 50%; - margin-top: -11px; -} - -@media print -{ - #top { display: none; } - #side-nav { display: none; } - #nav-path { display: none; } - body { overflow:visible; } - h1, h2, h3, h4, h5, h6 { page-break-after: avoid; } - .summary { display: none; } - .memitem { page-break-inside: avoid; } - #doc-content - { - margin-left:0 !important; - height:auto !important; - width:auto !important; - overflow:inherit; - display:inline; - } -} - -/* @group Markdown */ - -/* -table.markdownTable { - border-collapse:collapse; - margin-top: 4px; - margin-bottom: 4px; -} - -table.markdownTable td, table.markdownTable th { - border: 1px solid #2D4068; - padding: 3px 7px 2px; -} - -table.markdownTableHead tr { -} - -table.markdownTableBodyLeft td, table.markdownTable th { - border: 1px solid #2D4068; - padding: 3px 7px 2px; -} - -th.markdownTableHeadLeft th.markdownTableHeadRight th.markdownTableHeadCenter th.markdownTableHeadNone { - background-color: #374F7F; - color: #FFFFFF; - font-size: 110%; - padding-bottom: 4px; - padding-top: 5px; -} - -th.markdownTableHeadLeft { - text-align: left -} - -th.markdownTableHeadRight { - text-align: right -} - -th.markdownTableHeadCenter { - text-align: center -} -*/ - -table.markdownTable { - border-collapse:collapse; - margin-top: 4px; - margin-bottom: 4px; -} - -table.markdownTable td, table.markdownTable th { - border: 1px solid #2D4068; - padding: 3px 7px 2px; -} - -table.markdownTable tr { -} - -th.markdownTableHeadLeft, th.markdownTableHeadRight, th.markdownTableHeadCenter, th.markdownTableHeadNone { - background-color: #374F7F; - color: #FFFFFF; - font-size: 110%; - padding-bottom: 4px; - padding-top: 5px; -} - -th.markdownTableHeadLeft, td.markdownTableBodyLeft { - text-align: left -} - -th.markdownTableHeadRight, td.markdownTableBodyRight { - text-align: right -} - -th.markdownTableHeadCenter, td.markdownTableBodyCenter { - text-align: center -} - -.DocNodeRTL { - text-align: right; - direction: rtl; -} - -.DocNodeLTR { - text-align: left; - direction: ltr; -} - -table.DocNodeRTL { - width: auto; - margin-right: 0; - margin-left: auto; -} - -table.DocNodeLTR { - width: auto; - margin-right: auto; - margin-left: 0; -} - -tt, code, kbd, samp -{ - display: inline-block; - direction:ltr; -} -/* @end */ - -u { - text-decoration: underline; -} - diff --git a/docs/html/doxygen.png b/docs/html/doxygen.png deleted file mode 100644 index 3ff17d807fd8aa003bed8bb2a69e8f0909592fd1..0000000000000000000000000000000000000000 Binary files a/docs/html/doxygen.png and /dev/null differ diff --git a/docs/html/dynsections.js b/docs/html/dynsections.js deleted file mode 100644 index ea0a7b39a1bb1d393cdf0b7060d323dad27564f2..0000000000000000000000000000000000000000 --- a/docs/html/dynsections.js +++ /dev/null @@ -1,120 +0,0 @@ -/* - @licstart The following is the entire license notice for the - JavaScript code in this file. - - Copyright (C) 1997-2017 by Dimitri van Heesch - - This program is free software; you can redistribute it and/or modify - it under the terms of the GNU General Public License as published by - the Free Software Foundation; either version 2 of the License, or - (at your option) any later version. - - This program is distributed in the hope that it will be useful, - but WITHOUT ANY WARRANTY; without even the implied warranty of - MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - GNU General Public License for more details. - - You should have received a copy of the GNU General Public License along - with this program; if not, write to the Free Software Foundation, Inc., - 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. - - @licend The above is the entire license notice - for the JavaScript code in this file - */ -function toggleVisibility(linkObj) -{ - var base = $(linkObj).attr('id'); - var summary = $('#'+base+'-summary'); - var content = $('#'+base+'-content'); - var trigger = $('#'+base+'-trigger'); - var src=$(trigger).attr('src'); - if (content.is(':visible')===true) { - content.hide(); - summary.show(); - $(linkObj).addClass('closed').removeClass('opened'); - $(trigger).attr('src',src.substring(0,src.length-8)+'closed.png'); - } else { - content.show(); - summary.hide(); - $(linkObj).removeClass('closed').addClass('opened'); - $(trigger).attr('src',src.substring(0,src.length-10)+'open.png'); - } - return false; -} - -function updateStripes() -{ - $('table.directory tr'). - removeClass('even').filter(':visible:even').addClass('even'); -} - -function toggleLevel(level) -{ - $('table.directory tr').each(function() { - var l = this.id.split('_').length-1; - var i = $('#img'+this.id.substring(3)); - var a = $('#arr'+this.id.substring(3)); - if (l<level+1) { - i.removeClass('iconfopen iconfclosed').addClass('iconfopen'); - a.html('▼'); - $(this).show(); - } else if (l==level+1) { - i.removeClass('iconfclosed iconfopen').addClass('iconfclosed'); - a.html('►'); - $(this).show(); - } else { - $(this).hide(); - } - }); - updateStripes(); -} - -function toggleFolder(id) -{ - // the clicked row - var currentRow = $('#row_'+id); - - // all rows after the clicked row - var rows = currentRow.nextAll("tr"); - - var re = new RegExp('^row_'+id+'\\d+_$', "i"); //only one sub - - // only match elements AFTER this one (can't hide elements before) - var childRows = rows.filter(function() { return this.id.match(re); }); - - // first row is visible we are HIDING - if (childRows.filter(':first').is(':visible')===true) { - // replace down arrow by right arrow for current row - var currentRowSpans = currentRow.find("span"); - currentRowSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed"); - currentRowSpans.filter(".arrow").html('►'); - rows.filter("[id^=row_"+id+"]").hide(); // hide all children - } else { // we are SHOWING - // replace right arrow by down arrow for current row - var currentRowSpans = currentRow.find("span"); - currentRowSpans.filter(".iconfclosed").removeClass("iconfclosed").addClass("iconfopen"); - currentRowSpans.filter(".arrow").html('▼'); - // replace down arrows by right arrows for child rows - var childRowsSpans = childRows.find("span"); - childRowsSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed"); - childRowsSpans.filter(".arrow").html('►'); - childRows.show(); //show all children - } - updateStripes(); -} - - -function toggleInherit(id) -{ - var rows = $('tr.inherit.'+id); - var img = $('tr.inherit_header.'+id+' img'); - var src = $(img).attr('src'); - if (rows.filter(':first').is(':visible')===true) { - rows.css('display','none'); - $(img).attr('src',src.substring(0,src.length-8)+'closed.png'); - } else { - rows.css('display','table-row'); // using show() causes jump in firefox - $(img).attr('src',src.substring(0,src.length-10)+'open.png'); - } -} -/* @license-end */ diff --git a/docs/html/files.html b/docs/html/files.html deleted file mode 100644 index 760ec802306a965fdce472381fc00855a1d36be3..0000000000000000000000000000000000000000 --- a/docs/html/files.html +++ /dev/null @@ -1,83 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: File List</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -</div><!-- top --> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -<div class="header"> - <div class="headertitle"> -<div class="title">File List</div> </div> -</div><!--header--> -<div class="contents"> -<div class="textblock">Here is a list of all documented files with brief descriptions:</div><div class="directory"> -<table class="directory"> -<tr id="row_0_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icondoc"></span><a class="el" href="_factor_oracle_8cpp.html" target="_self">FactorOracle.cpp</a></td><td class="desc">A file that contains the functions needed for the creation of a Factor Oracle </td></tr> -<tr id="row_1_"><td class="entry"><span style="width:16px;display:inline-block;"> </span><a href="_factor_oracle_8h_source.html"><span class="icondoc"></span></a><a class="el" href="_factor_oracle_8h.html" target="_self">FactorOracle.h</a></td><td class="desc">A file that contains the definitions of the classes needed for the creation of a Factor Oracle </td></tr> -<tr id="row_2_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icondoc"></span><a class="el" href="main_8cpp.html" target="_self">main.cpp</a></td><td class="desc">A file that contains the main functions, which starts all the algorithm </td></tr> -</table> -</div><!-- directory --> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/folderclosed.png b/docs/html/folderclosed.png deleted file mode 100644 index bb8ab35edce8e97554e360005ee9fc5bffb36e66..0000000000000000000000000000000000000000 Binary files a/docs/html/folderclosed.png and /dev/null differ diff --git a/docs/html/folderopen.png b/docs/html/folderopen.png deleted file mode 100644 index d6c7f676a3b3ef8c2c307d319dff3c6a604eb227..0000000000000000000000000000000000000000 Binary files a/docs/html/folderopen.png and /dev/null differ diff --git a/docs/html/functions.html b/docs/html/functions.html deleted file mode 100644 index e1749a3d9224816a8adce072c71c26894210d11e..0000000000000000000000000000000000000000 --- a/docs/html/functions.html +++ /dev/null @@ -1,104 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: Class Members</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -</div><!-- top --> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -<div class="contents"> -<div class="textblock">Here is a list of all documented class members with links to the class documentation for each member:</div><ul> -<li>AddLetter() -: <a class="el" href="class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db">FactorOracle</a> -</li> -<li>FactorOracleStart() -: <a class="el" href="class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f">FactorOracle</a> -</li> -<li>FindBetter() -: <a class="el" href="class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50">FactorOracle</a> -</li> -<li>first_state_ -: <a class="el" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">SingleTransition</a> -</li> -<li>FOGenerate() -: <a class="el" href="class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390">FactorOracle</a> -</li> -<li>last_state_ -: <a class="el" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">SingleTransition</a> -</li> -<li>state_ -: <a class="el" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">State</a> -</li> -<li>states_ -: <a class="el" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">FactorOracle</a> -</li> -<li>symbol_ -: <a class="el" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">SingleTransition</a> -</li> -<li>transition_ -: <a class="el" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">State</a> -</li> -</ul> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/functions_func.html b/docs/html/functions_func.html deleted file mode 100644 index 6c257e06fabf8d07af8502063de2857951936966..0000000000000000000000000000000000000000 --- a/docs/html/functions_func.html +++ /dev/null @@ -1,86 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: Class Members - Functions</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -</div><!-- top --> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -<div class="contents"> - <ul> -<li>AddLetter() -: <a class="el" href="class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db">FactorOracle</a> -</li> -<li>FactorOracleStart() -: <a class="el" href="class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f">FactorOracle</a> -</li> -<li>FindBetter() -: <a class="el" href="class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50">FactorOracle</a> -</li> -<li>FOGenerate() -: <a class="el" href="class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390">FactorOracle</a> -</li> -</ul> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/functions_vars.html b/docs/html/functions_vars.html deleted file mode 100644 index cfd8c17ec941e228ebd0c2bb4bb917af8ac9844e..0000000000000000000000000000000000000000 --- a/docs/html/functions_vars.html +++ /dev/null @@ -1,92 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: Class Members - Variables</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -</div><!-- top --> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -<div class="contents"> - <ul> -<li>first_state_ -: <a class="el" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">SingleTransition</a> -</li> -<li>last_state_ -: <a class="el" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">SingleTransition</a> -</li> -<li>state_ -: <a class="el" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">State</a> -</li> -<li>states_ -: <a class="el" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">FactorOracle</a> -</li> -<li>symbol_ -: <a class="el" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">SingleTransition</a> -</li> -<li>transition_ -: <a class="el" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">State</a> -</li> -</ul> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/index.html b/docs/html/index.html deleted file mode 100644 index 106d560ba653c51fb39490b1168996429a3388c0..0000000000000000000000000000000000000000 --- a/docs/html/index.html +++ /dev/null @@ -1,76 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: Main Page</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -</div><!-- top --> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -<div class="header"> - <div class="headertitle"> -<div class="title">My Project Documentation</div> </div> -</div><!--header--> -<div class="contents"> -</div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/jquery.js b/docs/html/jquery.js deleted file mode 100644 index 1ee895ca3201fb9627f704a0bb8ad45fe9408412..0000000000000000000000000000000000000000 --- a/docs/html/jquery.js +++ /dev/null @@ -1,87 +0,0 @@ -/*! - * jQuery JavaScript Library v1.7.2 - * http://jquery.com/ - * - * Copyright 2011, John Resig - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * Includes Sizzle.js - * http://sizzlejs.com/ - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. - * - * Date: Wed Mar 21 12:46:34 2012 -0700 - */ -(function(bd,L){var av=bd.document,bu=bd.navigator,bm=bd.location;var b=(function(){var bF=function(b0,b1){return new bF.fn.init(b0,b1,bD)},bU=bd.jQuery,bH=bd.$,bD,bY=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bM=/\S/,bI=/^\s+/,bE=/\s+$/,bA=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bN=/^[\],:{}\s]*$/,bW=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bP=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bJ=/(?:^|:|,)(?:\s*\[)+/g,by=/(webkit)[ \/]([\w.]+)/,bR=/(opera)(?:.*version)?[ \/]([\w.]+)/,bQ=/(msie) ([\w.]+)/,bS=/(mozilla)(?:.*? rv:([\w.]+))?/,bB=/-([a-z]|[0-9])/ig,bZ=/^-ms-/,bT=function(b0,b1){return(b1+"").toUpperCase()},bX=bu.userAgent,bV,bC,e,bL=Object.prototype.toString,bG=Object.prototype.hasOwnProperty,bz=Array.prototype.push,bK=Array.prototype.slice,bO=String.prototype.trim,bv=Array.prototype.indexOf,bx={};bF.fn=bF.prototype={constructor:bF,init:function(b0,b4,b3){var b2,b5,b1,b6;if(!b0){return this}if(b0.nodeType){this.context=this[0]=b0;this.length=1;return this}if(b0==="body"&&!b4&&av.body){this.context=av;this[0]=av.body;this.selector=b0;this.length=1;return this}if(typeof b0==="string"){if(b0.charAt(0)==="<"&&b0.charAt(b0.length-1)===">"&&b0.length>=3){b2=[null,b0,null]}else{b2=bY.exec(b0)}if(b2&&(b2[1]||!b4)){if(b2[1]){b4=b4 instanceof bF?b4[0]:b4;b6=(b4?b4.ownerDocument||b4:av);b1=bA.exec(b0);if(b1){if(bF.isPlainObject(b4)){b0=[av.createElement(b1[1])];bF.fn.attr.call(b0,b4,true)}else{b0=[b6.createElement(b1[1])]}}else{b1=bF.buildFragment([b2[1]],[b6]);b0=(b1.cacheable?bF.clone(b1.fragment):b1.fragment).childNodes}return bF.merge(this,b0)}else{b5=av.getElementById(b2[2]);if(b5&&b5.parentNode){if(b5.id!==b2[2]){return b3.find(b0)}this.length=1;this[0]=b5}this.context=av;this.selector=b0;return this}}else{if(!b4||b4.jquery){return(b4||b3).find(b0)}else{return this.constructor(b4).find(b0)}}}else{if(bF.isFunction(b0)){return b3.ready(b0)}}if(b0.selector!==L){this.selector=b0.selector;this.context=b0.context}return bF.makeArray(b0,this)},selector:"",jquery:"1.7.2",length:0,size:function(){return this.length},toArray:function(){return bK.call(this,0)},get:function(b0){return b0==null?this.toArray():(b0<0?this[this.length+b0]:this[b0])},pushStack:function(b1,b3,b0){var b2=this.constructor();if(bF.isArray(b1)){bz.apply(b2,b1)}else{bF.merge(b2,b1)}b2.prevObject=this;b2.context=this.context;if(b3==="find"){b2.selector=this.selector+(this.selector?" ":"")+b0}else{if(b3){b2.selector=this.selector+"."+b3+"("+b0+")"}}return b2},each:function(b1,b0){return bF.each(this,b1,b0)},ready:function(b0){bF.bindReady();bC.add(b0);return this},eq:function(b0){b0=+b0;return b0===-1?this.slice(b0):this.slice(b0,b0+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bK.apply(this,arguments),"slice",bK.call(arguments).join(","))},map:function(b0){return this.pushStack(bF.map(this,function(b2,b1){return b0.call(b2,b1,b2)}))},end:function(){return this.prevObject||this.constructor(null)},push:bz,sort:[].sort,splice:[].splice};bF.fn.init.prototype=bF.fn;bF.extend=bF.fn.extend=function(){var b9,b2,b0,b1,b6,b7,b5=arguments[0]||{},b4=1,b3=arguments.length,b8=false;if(typeof b5==="boolean"){b8=b5;b5=arguments[1]||{};b4=2}if(typeof b5!=="object"&&!bF.isFunction(b5)){b5={}}if(b3===b4){b5=this;--b4}for(;b4<b3;b4++){if((b9=arguments[b4])!=null){for(b2 in b9){b0=b5[b2];b1=b9[b2];if(b5===b1){continue}if(b8&&b1&&(bF.isPlainObject(b1)||(b6=bF.isArray(b1)))){if(b6){b6=false;b7=b0&&bF.isArray(b0)?b0:[]}else{b7=b0&&bF.isPlainObject(b0)?b0:{}}b5[b2]=bF.extend(b8,b7,b1)}else{if(b1!==L){b5[b2]=b1}}}}}return b5};bF.extend({noConflict:function(b0){if(bd.$===bF){bd.$=bH}if(b0&&bd.jQuery===bF){bd.jQuery=bU}return bF},isReady:false,readyWait:1,holdReady:function(b0){if(b0){bF.readyWait++}else{bF.ready(true)}},ready:function(b0){if((b0===true&&!--bF.readyWait)||(b0!==true&&!bF.isReady)){if(!av.body){return setTimeout(bF.ready,1)}bF.isReady=true;if(b0!==true&&--bF.readyWait>0){return}bC.fireWith(av,[bF]);if(bF.fn.trigger){bF(av).trigger("ready").off("ready")}}},bindReady:function(){if(bC){return}bC=bF.Callbacks("once memory");if(av.readyState==="complete"){return setTimeout(bF.ready,1)}if(av.addEventListener){av.addEventListener("DOMContentLoaded",e,false);bd.addEventListener("load",bF.ready,false)}else{if(av.attachEvent){av.attachEvent("onreadystatechange",e);bd.attachEvent("onload",bF.ready);var b0=false;try{b0=bd.frameElement==null}catch(b1){}if(av.documentElement.doScroll&&b0){bw()}}}},isFunction:function(b0){return bF.type(b0)==="function"},isArray:Array.isArray||function(b0){return bF.type(b0)==="array"},isWindow:function(b0){return b0!=null&&b0==b0.window},isNumeric:function(b0){return !isNaN(parseFloat(b0))&&isFinite(b0)},type:function(b0){return b0==null?String(b0):bx[bL.call(b0)]||"object"},isPlainObject:function(b2){if(!b2||bF.type(b2)!=="object"||b2.nodeType||bF.isWindow(b2)){return false}try{if(b2.constructor&&!bG.call(b2,"constructor")&&!bG.call(b2.constructor.prototype,"isPrototypeOf")){return false}}catch(b1){return false}var b0;for(b0 in b2){}return b0===L||bG.call(b2,b0)},isEmptyObject:function(b1){for(var b0 in b1){return false}return true},error:function(b0){throw new Error(b0)},parseJSON:function(b0){if(typeof b0!=="string"||!b0){return null}b0=bF.trim(b0);if(bd.JSON&&bd.JSON.parse){return bd.JSON.parse(b0)}if(bN.test(b0.replace(bW,"@").replace(bP,"]").replace(bJ,""))){return(new Function("return "+b0))()}bF.error("Invalid JSON: "+b0)},parseXML:function(b2){if(typeof b2!=="string"||!b2){return null}var b0,b1;try{if(bd.DOMParser){b1=new DOMParser();b0=b1.parseFromString(b2,"text/xml")}else{b0=new ActiveXObject("Microsoft.XMLDOM");b0.async="false";b0.loadXML(b2)}}catch(b3){b0=L}if(!b0||!b0.documentElement||b0.getElementsByTagName("parsererror").length){bF.error("Invalid XML: "+b2)}return b0},noop:function(){},globalEval:function(b0){if(b0&&bM.test(b0)){(bd.execScript||function(b1){bd["eval"].call(bd,b1)})(b0)}},camelCase:function(b0){return b0.replace(bZ,"ms-").replace(bB,bT)},nodeName:function(b1,b0){return b1.nodeName&&b1.nodeName.toUpperCase()===b0.toUpperCase()},each:function(b3,b6,b2){var b1,b4=0,b5=b3.length,b0=b5===L||bF.isFunction(b3);if(b2){if(b0){for(b1 in b3){if(b6.apply(b3[b1],b2)===false){break}}}else{for(;b4<b5;){if(b6.apply(b3[b4++],b2)===false){break}}}}else{if(b0){for(b1 in b3){if(b6.call(b3[b1],b1,b3[b1])===false){break}}}else{for(;b4<b5;){if(b6.call(b3[b4],b4,b3[b4++])===false){break}}}}return b3},trim:bO?function(b0){return b0==null?"":bO.call(b0)}:function(b0){return b0==null?"":b0.toString().replace(bI,"").replace(bE,"")},makeArray:function(b3,b1){var b0=b1||[];if(b3!=null){var b2=bF.type(b3);if(b3.length==null||b2==="string"||b2==="function"||b2==="regexp"||bF.isWindow(b3)){bz.call(b0,b3)}else{bF.merge(b0,b3)}}return b0},inArray:function(b2,b3,b1){var b0;if(b3){if(bv){return bv.call(b3,b2,b1)}b0=b3.length;b1=b1?b1<0?Math.max(0,b0+b1):b1:0;for(;b1<b0;b1++){if(b1 in b3&&b3[b1]===b2){return b1}}}return -1},merge:function(b4,b2){var b3=b4.length,b1=0;if(typeof b2.length==="number"){for(var b0=b2.length;b1<b0;b1++){b4[b3++]=b2[b1]}}else{while(b2[b1]!==L){b4[b3++]=b2[b1++]}}b4.length=b3;return b4},grep:function(b1,b6,b0){var b2=[],b5;b0=!!b0;for(var b3=0,b4=b1.length;b3<b4;b3++){b5=!!b6(b1[b3],b3);if(b0!==b5){b2.push(b1[b3])}}return b2},map:function(b0,b7,b8){var b5,b6,b4=[],b2=0,b1=b0.length,b3=b0 instanceof bF||b1!==L&&typeof b1==="number"&&((b1>0&&b0[0]&&b0[b1-1])||b1===0||bF.isArray(b0));if(b3){for(;b2<b1;b2++){b5=b7(b0[b2],b2,b8);if(b5!=null){b4[b4.length]=b5}}}else{for(b6 in b0){b5=b7(b0[b6],b6,b8);if(b5!=null){b4[b4.length]=b5}}}return b4.concat.apply([],b4)},guid:1,proxy:function(b4,b3){if(typeof b3==="string"){var b2=b4[b3];b3=b4;b4=b2}if(!bF.isFunction(b4)){return L}var b0=bK.call(arguments,2),b1=function(){return b4.apply(b3,b0.concat(bK.call(arguments)))};b1.guid=b4.guid=b4.guid||b1.guid||bF.guid++;return b1},access:function(b0,b6,b9,b7,b4,ca,b8){var b2,b5=b9==null,b3=0,b1=b0.length;if(b9&&typeof b9==="object"){for(b3 in b9){bF.access(b0,b6,b3,b9[b3],1,ca,b7)}b4=1}else{if(b7!==L){b2=b8===L&&bF.isFunction(b7);if(b5){if(b2){b2=b6;b6=function(cc,cb,cd){return b2.call(bF(cc),cd)}}else{b6.call(b0,b7);b6=null}}if(b6){for(;b3<b1;b3++){b6(b0[b3],b9,b2?b7.call(b0[b3],b3,b6(b0[b3],b9)):b7,b8)}}b4=1}}return b4?b0:b5?b6.call(b0):b1?b6(b0[0],b9):ca},now:function(){return(new Date()).getTime()},uaMatch:function(b1){b1=b1.toLowerCase();var b0=by.exec(b1)||bR.exec(b1)||bQ.exec(b1)||b1.indexOf("compatible")<0&&bS.exec(b1)||[];return{browser:b0[1]||"",version:b0[2]||"0"}},sub:function(){function b0(b3,b4){return new b0.fn.init(b3,b4)}bF.extend(true,b0,this);b0.superclass=this;b0.fn=b0.prototype=this();b0.fn.constructor=b0;b0.sub=this.sub;b0.fn.init=function b2(b3,b4){if(b4&&b4 instanceof bF&&!(b4 instanceof b0)){b4=b0(b4)}return bF.fn.init.call(this,b3,b4,b1)};b0.fn.init.prototype=b0.fn;var b1=b0(av);return b0},browser:{}});bF.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(b1,b0){bx["[object "+b0+"]"]=b0.toLowerCase()});bV=bF.uaMatch(bX);if(bV.browser){bF.browser[bV.browser]=true;bF.browser.version=bV.version}if(bF.browser.webkit){bF.browser.safari=true}if(bM.test("\xA0")){bI=/^[\s\xA0]+/;bE=/[\s\xA0]+$/}bD=bF(av);if(av.addEventListener){e=function(){av.removeEventListener("DOMContentLoaded",e,false);bF.ready()}}else{if(av.attachEvent){e=function(){if(av.readyState==="complete"){av.detachEvent("onreadystatechange",e);bF.ready()}}}}function bw(){if(bF.isReady){return}try{av.documentElement.doScroll("left")}catch(b0){setTimeout(bw,1);return}bF.ready()}return bF})();var a3={};function X(e){var bv=a3[e]={},bw,bx;e=e.split(/\s+/);for(bw=0,bx=e.length;bw<bx;bw++){bv[e[bw]]=true}return bv}b.Callbacks=function(bx){bx=bx?(a3[bx]||X(bx)):{};var bC=[],bD=[],by,e,bz,bw,bA,bB,bF=function(bG){var bH,bK,bJ,bI,bL;for(bH=0,bK=bG.length;bH<bK;bH++){bJ=bG[bH];bI=b.type(bJ);if(bI==="array"){bF(bJ)}else{if(bI==="function"){if(!bx.unique||!bE.has(bJ)){bC.push(bJ)}}}}},bv=function(bH,bG){bG=bG||[];by=!bx.memory||[bH,bG];e=true;bz=true;bB=bw||0;bw=0;bA=bC.length;for(;bC&&bB<bA;bB++){if(bC[bB].apply(bH,bG)===false&&bx.stopOnFalse){by=true;break}}bz=false;if(bC){if(!bx.once){if(bD&&bD.length){by=bD.shift();bE.fireWith(by[0],by[1])}}else{if(by===true){bE.disable()}else{bC=[]}}}},bE={add:function(){if(bC){var bG=bC.length;bF(arguments);if(bz){bA=bC.length}else{if(by&&by!==true){bw=bG;bv(by[0],by[1])}}}return this},remove:function(){if(bC){var bG=arguments,bI=0,bJ=bG.length;for(;bI<bJ;bI++){for(var bH=0;bH<bC.length;bH++){if(bG[bI]===bC[bH]){if(bz){if(bH<=bA){bA--;if(bH<=bB){bB--}}}bC.splice(bH--,1);if(bx.unique){break}}}}}return this},has:function(bH){if(bC){var bG=0,bI=bC.length;for(;bG<bI;bG++){if(bH===bC[bG]){return true}}}return false},empty:function(){bC=[];return this},disable:function(){bC=bD=by=L;return this},disabled:function(){return !bC},lock:function(){bD=L;if(!by||by===true){bE.disable()}return this},locked:function(){return !bD},fireWith:function(bH,bG){if(bD){if(bz){if(!bx.once){bD.push([bH,bG])}}else{if(!(bx.once&&by)){bv(bH,bG)}}}return this},fire:function(){bE.fireWith(this,arguments);return this},fired:function(){return !!e}};return bE};var aK=[].slice;b.extend({Deferred:function(by){var bx=b.Callbacks("once memory"),bw=b.Callbacks("once memory"),bv=b.Callbacks("memory"),e="pending",bA={resolve:bx,reject:bw,notify:bv},bC={done:bx.add,fail:bw.add,progress:bv.add,state:function(){return e},isResolved:bx.fired,isRejected:bw.fired,then:function(bE,bD,bF){bB.done(bE).fail(bD).progress(bF);return this},always:function(){bB.done.apply(bB,arguments).fail.apply(bB,arguments);return this},pipe:function(bF,bE,bD){return b.Deferred(function(bG){b.each({done:[bF,"resolve"],fail:[bE,"reject"],progress:[bD,"notify"]},function(bI,bL){var bH=bL[0],bK=bL[1],bJ;if(b.isFunction(bH)){bB[bI](function(){bJ=bH.apply(this,arguments);if(bJ&&b.isFunction(bJ.promise)){bJ.promise().then(bG.resolve,bG.reject,bG.notify)}else{bG[bK+"With"](this===bB?bG:this,[bJ])}})}else{bB[bI](bG[bK])}})}).promise()},promise:function(bE){if(bE==null){bE=bC}else{for(var bD in bC){bE[bD]=bC[bD]}}return bE}},bB=bC.promise({}),bz;for(bz in bA){bB[bz]=bA[bz].fire;bB[bz+"With"]=bA[bz].fireWith}bB.done(function(){e="resolved"},bw.disable,bv.lock).fail(function(){e="rejected"},bx.disable,bv.lock);if(by){by.call(bB,bB)}return bB},when:function(bA){var bx=aK.call(arguments,0),bv=0,e=bx.length,bB=new Array(e),bw=e,by=e,bC=e<=1&&bA&&b.isFunction(bA.promise)?bA:b.Deferred(),bE=bC.promise();function bD(bF){return function(bG){bx[bF]=arguments.length>1?aK.call(arguments,0):bG;if(!(--bw)){bC.resolveWith(bC,bx)}}}function bz(bF){return function(bG){bB[bF]=arguments.length>1?aK.call(arguments,0):bG;bC.notifyWith(bE,bB)}}if(e>1){for(;bv<e;bv++){if(bx[bv]&&bx[bv].promise&&b.isFunction(bx[bv].promise)){bx[bv].promise().then(bD(bv),bC.reject,bz(bv))}else{--bw}}if(!bw){bC.resolveWith(bC,bx)}}else{if(bC!==bA){bC.resolveWith(bC,e?[bA]:[])}}return bE}});b.support=(function(){var bI,bH,bE,bF,bx,bD,bC,bz,bJ,bA,by,bw,bv=av.createElement("div"),bG=av.documentElement;bv.setAttribute("className","t");bv.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";bH=bv.getElementsByTagName("*");bE=bv.getElementsByTagName("a")[0];if(!bH||!bH.length||!bE){return{}}bF=av.createElement("select");bx=bF.appendChild(av.createElement("option"));bD=bv.getElementsByTagName("input")[0];bI={leadingWhitespace:(bv.firstChild.nodeType===3),tbody:!bv.getElementsByTagName("tbody").length,htmlSerialize:!!bv.getElementsByTagName("link").length,style:/top/.test(bE.getAttribute("style")),hrefNormalized:(bE.getAttribute("href")==="/a"),opacity:/^0.55/.test(bE.style.opacity),cssFloat:!!bE.style.cssFloat,checkOn:(bD.value==="on"),optSelected:bx.selected,getSetAttribute:bv.className!=="t",enctype:!!av.createElement("form").enctype,html5Clone:av.createElement("nav").cloneNode(true).outerHTML!=="<:nav></:nav>",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true,pixelMargin:true};b.boxModel=bI.boxModel=(av.compatMode==="CSS1Compat");bD.checked=true;bI.noCloneChecked=bD.cloneNode(true).checked;bF.disabled=true;bI.optDisabled=!bx.disabled;try{delete bv.test}catch(bB){bI.deleteExpando=false}if(!bv.addEventListener&&bv.attachEvent&&bv.fireEvent){bv.attachEvent("onclick",function(){bI.noCloneEvent=false});bv.cloneNode(true).fireEvent("onclick")}bD=av.createElement("input");bD.value="t";bD.setAttribute("type","radio");bI.radioValue=bD.value==="t";bD.setAttribute("checked","checked");bD.setAttribute("name","t");bv.appendChild(bD);bC=av.createDocumentFragment();bC.appendChild(bv.lastChild);bI.checkClone=bC.cloneNode(true).cloneNode(true).lastChild.checked;bI.appendChecked=bD.checked;bC.removeChild(bD);bC.appendChild(bv);if(bv.attachEvent){for(by in {submit:1,change:1,focusin:1}){bA="on"+by;bw=(bA in bv);if(!bw){bv.setAttribute(bA,"return;");bw=(typeof bv[bA]==="function")}bI[by+"Bubbles"]=bw}}bC.removeChild(bv);bC=bF=bx=bv=bD=null;b(function(){var bM,bV,bW,bU,bO,bP,bR,bL,bK,bQ,bN,e,bT,bS=av.getElementsByTagName("body")[0];if(!bS){return}bL=1;bT="padding:0;margin:0;border:";bN="position:absolute;top:0;left:0;width:1px;height:1px;";e=bT+"0;visibility:hidden;";bK="style='"+bN+bT+"5px solid #000;";bQ="<div "+bK+"display:block;'><div style='"+bT+"0;display:block;overflow:hidden;'></div></div><table "+bK+"' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";bM=av.createElement("div");bM.style.cssText=e+"width:0;height:0;position:static;top:0;margin-top:"+bL+"px";bS.insertBefore(bM,bS.firstChild);bv=av.createElement("div");bM.appendChild(bv);bv.innerHTML="<table><tr><td style='"+bT+"0;display:none'></td><td>t</td></tr></table>";bz=bv.getElementsByTagName("td");bw=(bz[0].offsetHeight===0);bz[0].style.display="";bz[1].style.display="none";bI.reliableHiddenOffsets=bw&&(bz[0].offsetHeight===0);if(bd.getComputedStyle){bv.innerHTML="";bR=av.createElement("div");bR.style.width="0";bR.style.marginRight="0";bv.style.width="2px";bv.appendChild(bR);bI.reliableMarginRight=(parseInt((bd.getComputedStyle(bR,null)||{marginRight:0}).marginRight,10)||0)===0}if(typeof bv.style.zoom!=="undefined"){bv.innerHTML="";bv.style.width=bv.style.padding="1px";bv.style.border=0;bv.style.overflow="hidden";bv.style.display="inline";bv.style.zoom=1;bI.inlineBlockNeedsLayout=(bv.offsetWidth===3);bv.style.display="block";bv.style.overflow="visible";bv.innerHTML="<div style='width:5px;'></div>";bI.shrinkWrapBlocks=(bv.offsetWidth!==3)}bv.style.cssText=bN+e;bv.innerHTML=bQ;bV=bv.firstChild;bW=bV.firstChild;bO=bV.nextSibling.firstChild.firstChild;bP={doesNotAddBorder:(bW.offsetTop!==5),doesAddBorderForTableAndCells:(bO.offsetTop===5)};bW.style.position="fixed";bW.style.top="20px";bP.fixedPosition=(bW.offsetTop===20||bW.offsetTop===15);bW.style.position=bW.style.top="";bV.style.overflow="hidden";bV.style.position="relative";bP.subtractsBorderForOverflowNotVisible=(bW.offsetTop===-5);bP.doesNotIncludeMarginInBodyOffset=(bS.offsetTop!==bL);if(bd.getComputedStyle){bv.style.marginTop="1%";bI.pixelMargin=(bd.getComputedStyle(bv,null)||{marginTop:0}).marginTop!=="1%"}if(typeof bM.style.zoom!=="undefined"){bM.style.zoom=1}bS.removeChild(bM);bR=bv=bM=null;b.extend(bI,bP)});return bI})();var aT=/^(?:\{.*\}|\[.*\])$/,aA=/([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!S(e)},data:function(bx,bv,bz,by){if(!b.acceptData(bx)){return}var bG,bA,bD,bE=b.expando,bC=typeof bv==="string",bF=bx.nodeType,e=bF?b.cache:bx,bw=bF?bx[bE]:bx[bE]&&bE,bB=bv==="events";if((!bw||!e[bw]||(!bB&&!by&&!e[bw].data))&&bC&&bz===L){return}if(!bw){if(bF){bx[bE]=bw=++b.uuid}else{bw=bE}}if(!e[bw]){e[bw]={};if(!bF){e[bw].toJSON=b.noop}}if(typeof bv==="object"||typeof bv==="function"){if(by){e[bw]=b.extend(e[bw],bv)}else{e[bw].data=b.extend(e[bw].data,bv)}}bG=bA=e[bw];if(!by){if(!bA.data){bA.data={}}bA=bA.data}if(bz!==L){bA[b.camelCase(bv)]=bz}if(bB&&!bA[bv]){return bG.events}if(bC){bD=bA[bv];if(bD==null){bD=bA[b.camelCase(bv)]}}else{bD=bA}return bD},removeData:function(bx,bv,by){if(!b.acceptData(bx)){return}var bB,bA,bz,bC=b.expando,bD=bx.nodeType,e=bD?b.cache:bx,bw=bD?bx[bC]:bC;if(!e[bw]){return}if(bv){bB=by?e[bw]:e[bw].data;if(bB){if(!b.isArray(bv)){if(bv in bB){bv=[bv]}else{bv=b.camelCase(bv);if(bv in bB){bv=[bv]}else{bv=bv.split(" ")}}}for(bA=0,bz=bv.length;bA<bz;bA++){delete bB[bv[bA]]}if(!(by?S:b.isEmptyObject)(bB)){return}}}if(!by){delete e[bw].data;if(!S(e[bw])){return}}if(b.support.deleteExpando||!e.setInterval){delete e[bw]}else{e[bw]=null}if(bD){if(b.support.deleteExpando){delete bx[bC]}else{if(bx.removeAttribute){bx.removeAttribute(bC)}else{bx[bC]=null}}}},_data:function(bv,e,bw){return b.data(bv,e,bw,true)},acceptData:function(bv){if(bv.nodeName){var e=b.noData[bv.nodeName.toLowerCase()];if(e){return !(e===true||bv.getAttribute("classid")!==e)}}return true}});b.fn.extend({data:function(bD,bC){var by,bv,bB,e,bx,bw=this[0],bA=0,bz=null;if(bD===L){if(this.length){bz=b.data(bw);if(bw.nodeType===1&&!b._data(bw,"parsedAttrs")){bB=bw.attributes;for(bx=bB.length;bA<bx;bA++){e=bB[bA].name;if(e.indexOf("data-")===0){e=b.camelCase(e.substring(5));a6(bw,e,bz[e])}}b._data(bw,"parsedAttrs",true)}}return bz}if(typeof bD==="object"){return this.each(function(){b.data(this,bD)})}by=bD.split(".",2);by[1]=by[1]?"."+by[1]:"";bv=by[1]+"!";return b.access(this,function(bE){if(bE===L){bz=this.triggerHandler("getData"+bv,[by[0]]);if(bz===L&&bw){bz=b.data(bw,bD);bz=a6(bw,bD,bz)}return bz===L&&by[1]?this.data(by[0]):bz}by[1]=bE;this.each(function(){var bF=b(this);bF.triggerHandler("setData"+bv,by);b.data(this,bD,bE);bF.triggerHandler("changeData"+bv,by)})},null,bC,arguments.length>1,null,false)},removeData:function(e){return this.each(function(){b.removeData(this,e)})}});function a6(bx,bw,by){if(by===L&&bx.nodeType===1){var bv="data-"+bw.replace(aA,"-$1").toLowerCase();by=bx.getAttribute(bv);if(typeof by==="string"){try{by=by==="true"?true:by==="false"?false:by==="null"?null:b.isNumeric(by)?+by:aT.test(by)?b.parseJSON(by):by}catch(bz){}b.data(bx,bw,by)}else{by=L}}return by}function S(bv){for(var e in bv){if(e==="data"&&b.isEmptyObject(bv[e])){continue}if(e!=="toJSON"){return false}}return true}function bj(by,bx,bA){var bw=bx+"defer",bv=bx+"queue",e=bx+"mark",bz=b._data(by,bw);if(bz&&(bA==="queue"||!b._data(by,bv))&&(bA==="mark"||!b._data(by,e))){setTimeout(function(){if(!b._data(by,bv)&&!b._data(by,e)){b.removeData(by,bw,true);bz.fire()}},0)}}b.extend({_mark:function(bv,e){if(bv){e=(e||"fx")+"mark";b._data(bv,e,(b._data(bv,e)||0)+1)}},_unmark:function(by,bx,bv){if(by!==true){bv=bx;bx=by;by=false}if(bx){bv=bv||"fx";var e=bv+"mark",bw=by?0:((b._data(bx,e)||1)-1);if(bw){b._data(bx,e,bw)}else{b.removeData(bx,e,true);bj(bx,bv,"mark")}}},queue:function(bv,e,bx){var bw;if(bv){e=(e||"fx")+"queue";bw=b._data(bv,e);if(bx){if(!bw||b.isArray(bx)){bw=b._data(bv,e,b.makeArray(bx))}else{bw.push(bx)}}return bw||[]}},dequeue:function(by,bx){bx=bx||"fx";var bv=b.queue(by,bx),bw=bv.shift(),e={};if(bw==="inprogress"){bw=bv.shift()}if(bw){if(bx==="fx"){bv.unshift("inprogress")}b._data(by,bx+".run",e);bw.call(by,function(){b.dequeue(by,bx)},e)}if(!bv.length){b.removeData(by,bx+"queue "+bx+".run",true);bj(by,bx,"queue")}}});b.fn.extend({queue:function(e,bv){var bw=2;if(typeof e!=="string"){bv=e;e="fx";bw--}if(arguments.length<bw){return b.queue(this[0],e)}return bv===L?this:this.each(function(){var bx=b.queue(this,e,bv);if(e==="fx"&&bx[0]!=="inprogress"){b.dequeue(this,e)}})},dequeue:function(e){return this.each(function(){b.dequeue(this,e)})},delay:function(bv,e){bv=b.fx?b.fx.speeds[bv]||bv:bv;e=e||"fx";return this.queue(e,function(bx,bw){var by=setTimeout(bx,bv);bw.stop=function(){clearTimeout(by)}})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(bD,bw){if(typeof bD!=="string"){bw=bD;bD=L}bD=bD||"fx";var e=b.Deferred(),bv=this,by=bv.length,bB=1,bz=bD+"defer",bA=bD+"queue",bC=bD+"mark",bx;function bE(){if(!(--bB)){e.resolveWith(bv,[bv])}}while(by--){if((bx=b.data(bv[by],bz,L,true)||(b.data(bv[by],bA,L,true)||b.data(bv[by],bC,L,true))&&b.data(bv[by],bz,b.Callbacks("once memory"),true))){bB++;bx.add(bE)}}bE();return e.promise(bw)}});var aQ=/[\n\t\r]/g,ag=/\s+/,aV=/\r/g,g=/^(?:button|input)$/i,C=/^(?:button|input|object|select|textarea)$/i,l=/^a(?:rea)?$/i,ao=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,E=b.support.getSetAttribute,bf,aZ,aG;b.fn.extend({attr:function(e,bv){return b.access(this,b.attr,e,bv,arguments.length>1)},removeAttr:function(e){return this.each(function(){b.removeAttr(this,e)})},prop:function(e,bv){return b.access(this,b.prop,e,bv,arguments.length>1)},removeProp:function(e){e=b.propFix[e]||e;return this.each(function(){try{this[e]=L;delete this[e]}catch(bv){}})},addClass:function(by){var bA,bw,bv,bx,bz,bB,e;if(b.isFunction(by)){return this.each(function(bC){b(this).addClass(by.call(this,bC,this.className))})}if(by&&typeof by==="string"){bA=by.split(ag);for(bw=0,bv=this.length;bw<bv;bw++){bx=this[bw];if(bx.nodeType===1){if(!bx.className&&bA.length===1){bx.className=by}else{bz=" "+bx.className+" ";for(bB=0,e=bA.length;bB<e;bB++){if(!~bz.indexOf(" "+bA[bB]+" ")){bz+=bA[bB]+" "}}bx.className=b.trim(bz)}}}}return this},removeClass:function(bz){var bA,bw,bv,by,bx,bB,e;if(b.isFunction(bz)){return this.each(function(bC){b(this).removeClass(bz.call(this,bC,this.className))})}if((bz&&typeof bz==="string")||bz===L){bA=(bz||"").split(ag);for(bw=0,bv=this.length;bw<bv;bw++){by=this[bw];if(by.nodeType===1&&by.className){if(bz){bx=(" "+by.className+" ").replace(aQ," ");for(bB=0,e=bA.length;bB<e;bB++){bx=bx.replace(" "+bA[bB]+" "," ")}by.className=b.trim(bx)}else{by.className=""}}}}return this},toggleClass:function(bx,bv){var bw=typeof bx,e=typeof bv==="boolean";if(b.isFunction(bx)){return this.each(function(by){b(this).toggleClass(bx.call(this,by,this.className,bv),bv)})}return this.each(function(){if(bw==="string"){var bA,bz=0,by=b(this),bB=bv,bC=bx.split(ag);while((bA=bC[bz++])){bB=e?bB:!by.hasClass(bA);by[bB?"addClass":"removeClass"](bA)}}else{if(bw==="undefined"||bw==="boolean"){if(this.className){b._data(this,"__className__",this.className)}this.className=this.className||bx===false?"":b._data(this,"__className__")||""}}})},hasClass:function(e){var bx=" "+e+" ",bw=0,bv=this.length;for(;bw<bv;bw++){if(this[bw].nodeType===1&&(" "+this[bw].className+" ").replace(aQ," ").indexOf(bx)>-1){return true}}return false},val:function(bx){var e,bv,by,bw=this[0];if(!arguments.length){if(bw){e=b.valHooks[bw.type]||b.valHooks[bw.nodeName.toLowerCase()];if(e&&"get" in e&&(bv=e.get(bw,"value"))!==L){return bv}bv=bw.value;return typeof bv==="string"?bv.replace(aV,""):bv==null?"":bv}return}by=b.isFunction(bx);return this.each(function(bA){var bz=b(this),bB;if(this.nodeType!==1){return}if(by){bB=bx.call(this,bA,bz.val())}else{bB=bx}if(bB==null){bB=""}else{if(typeof bB==="number"){bB+=""}else{if(b.isArray(bB)){bB=b.map(bB,function(bC){return bC==null?"":bC+""})}}}e=b.valHooks[this.type]||b.valHooks[this.nodeName.toLowerCase()];if(!e||!("set" in e)||e.set(this,bB,"value")===L){this.value=bB}})}});b.extend({valHooks:{option:{get:function(e){var bv=e.attributes.value;return !bv||bv.specified?e.value:e.text}},select:{get:function(e){var bA,bv,bz,bx,by=e.selectedIndex,bB=[],bC=e.options,bw=e.type==="select-one";if(by<0){return null}bv=bw?by:0;bz=bw?by+1:bC.length;for(;bv<bz;bv++){bx=bC[bv];if(bx.selected&&(b.support.optDisabled?!bx.disabled:bx.getAttribute("disabled")===null)&&(!bx.parentNode.disabled||!b.nodeName(bx.parentNode,"optgroup"))){bA=b(bx).val();if(bw){return bA}bB.push(bA)}}if(bw&&!bB.length&&bC.length){return b(bC[by]).val()}return bB},set:function(bv,bw){var e=b.makeArray(bw);b(bv).find("option").each(function(){this.selected=b.inArray(b(this).val(),e)>=0});if(!e.length){bv.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(bA,bx,bB,bz){var bw,e,by,bv=bA.nodeType;if(!bA||bv===3||bv===8||bv===2){return}if(bz&&bx in b.attrFn){return b(bA)[bx](bB)}if(typeof bA.getAttribute==="undefined"){return b.prop(bA,bx,bB)}by=bv!==1||!b.isXMLDoc(bA);if(by){bx=bx.toLowerCase();e=b.attrHooks[bx]||(ao.test(bx)?aZ:bf)}if(bB!==L){if(bB===null){b.removeAttr(bA,bx);return}else{if(e&&"set" in e&&by&&(bw=e.set(bA,bB,bx))!==L){return bw}else{bA.setAttribute(bx,""+bB);return bB}}}else{if(e&&"get" in e&&by&&(bw=e.get(bA,bx))!==null){return bw}else{bw=bA.getAttribute(bx);return bw===null?L:bw}}},removeAttr:function(by,bA){var bz,bB,bw,e,bv,bx=0;if(bA&&by.nodeType===1){bB=bA.toLowerCase().split(ag);e=bB.length;for(;bx<e;bx++){bw=bB[bx];if(bw){bz=b.propFix[bw]||bw;bv=ao.test(bw);if(!bv){b.attr(by,bw,"")}by.removeAttribute(E?bw:bz);if(bv&&bz in by){by[bz]=false}}}}},attrHooks:{type:{set:function(e,bv){if(g.test(e.nodeName)&&e.parentNode){b.error("type property can't be changed")}else{if(!b.support.radioValue&&bv==="radio"&&b.nodeName(e,"input")){var bw=e.value;e.setAttribute("type",bv);if(bw){e.value=bw}return bv}}}},value:{get:function(bv,e){if(bf&&b.nodeName(bv,"button")){return bf.get(bv,e)}return e in bv?bv.value:null},set:function(bv,bw,e){if(bf&&b.nodeName(bv,"button")){return bf.set(bv,bw,e)}bv.value=bw}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(bz,bx,bA){var bw,e,by,bv=bz.nodeType;if(!bz||bv===3||bv===8||bv===2){return}by=bv!==1||!b.isXMLDoc(bz);if(by){bx=b.propFix[bx]||bx;e=b.propHooks[bx]}if(bA!==L){if(e&&"set" in e&&(bw=e.set(bz,bA,bx))!==L){return bw}else{return(bz[bx]=bA)}}else{if(e&&"get" in e&&(bw=e.get(bz,bx))!==null){return bw}else{return bz[bx]}}},propHooks:{tabIndex:{get:function(bv){var e=bv.getAttributeNode("tabindex");return e&&e.specified?parseInt(e.value,10):C.test(bv.nodeName)||l.test(bv.nodeName)&&bv.href?0:L}}}});b.attrHooks.tabindex=b.propHooks.tabIndex;aZ={get:function(bv,e){var bx,bw=b.prop(bv,e);return bw===true||typeof bw!=="boolean"&&(bx=bv.getAttributeNode(e))&&bx.nodeValue!==false?e.toLowerCase():L},set:function(bv,bx,e){var bw;if(bx===false){b.removeAttr(bv,e)}else{bw=b.propFix[e]||e;if(bw in bv){bv[bw]=true}bv.setAttribute(e,e.toLowerCase())}return e}};if(!E){aG={name:true,id:true,coords:true};bf=b.valHooks.button={get:function(bw,bv){var e;e=bw.getAttributeNode(bv);return e&&(aG[bv]?e.nodeValue!=="":e.specified)?e.nodeValue:L},set:function(bw,bx,bv){var e=bw.getAttributeNode(bv);if(!e){e=av.createAttribute(bv);bw.setAttributeNode(e)}return(e.nodeValue=bx+"")}};b.attrHooks.tabindex.set=bf.set;b.each(["width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{set:function(bw,bx){if(bx===""){bw.setAttribute(e,"auto");return bx}}})});b.attrHooks.contenteditable={get:bf.get,set:function(bv,bw,e){if(bw===""){bw="false"}bf.set(bv,bw,e)}}}if(!b.support.hrefNormalized){b.each(["href","src","width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{get:function(bx){var bw=bx.getAttribute(e,2);return bw===null?L:bw}})})}if(!b.support.style){b.attrHooks.style={get:function(e){return e.style.cssText.toLowerCase()||L},set:function(e,bv){return(e.style.cssText=""+bv)}}}if(!b.support.optSelected){b.propHooks.selected=b.extend(b.propHooks.selected,{get:function(bv){var e=bv.parentNode;if(e){e.selectedIndex;if(e.parentNode){e.parentNode.selectedIndex}}return null}})}if(!b.support.enctype){b.propFix.enctype="encoding"}if(!b.support.checkOn){b.each(["radio","checkbox"],function(){b.valHooks[this]={get:function(e){return e.getAttribute("value")===null?"on":e.value}}})}b.each(["radio","checkbox"],function(){b.valHooks[this]=b.extend(b.valHooks[this],{set:function(e,bv){if(b.isArray(bv)){return(e.checked=b.inArray(b(e).val(),bv)>=0)}}})});var be=/^(?:textarea|input|select)$/i,n=/^([^\.]*)?(?:\.(.+))?$/,J=/(?:^|\s)hover(\.\S+)?\b/,aP=/^key/,bg=/^(?:mouse|contextmenu)|click/,T=/^(?:focusinfocus|focusoutblur)$/,U=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,Y=function(e){var bv=U.exec(e);if(bv){bv[1]=(bv[1]||"").toLowerCase();bv[3]=bv[3]&&new RegExp("(?:^|\\s)"+bv[3]+"(?:\\s|$)")}return bv},j=function(bw,e){var bv=bw.attributes||{};return((!e[1]||bw.nodeName.toLowerCase()===e[1])&&(!e[2]||(bv.id||{}).value===e[2])&&(!e[3]||e[3].test((bv["class"]||{}).value)))},bt=function(e){return b.event.special.hover?e:e.replace(J,"mouseenter$1 mouseleave$1")};b.event={add:function(bx,bC,bJ,bA,by){var bD,bB,bK,bI,bH,bF,e,bG,bv,bz,bw,bE;if(bx.nodeType===3||bx.nodeType===8||!bC||!bJ||!(bD=b._data(bx))){return}if(bJ.handler){bv=bJ;bJ=bv.handler;by=bv.selector}if(!bJ.guid){bJ.guid=b.guid++}bK=bD.events;if(!bK){bD.events=bK={}}bB=bD.handle;if(!bB){bD.handle=bB=function(bL){return typeof b!=="undefined"&&(!bL||b.event.triggered!==bL.type)?b.event.dispatch.apply(bB.elem,arguments):L};bB.elem=bx}bC=b.trim(bt(bC)).split(" ");for(bI=0;bI<bC.length;bI++){bH=n.exec(bC[bI])||[];bF=bH[1];e=(bH[2]||"").split(".").sort();bE=b.event.special[bF]||{};bF=(by?bE.delegateType:bE.bindType)||bF;bE=b.event.special[bF]||{};bG=b.extend({type:bF,origType:bH[1],data:bA,handler:bJ,guid:bJ.guid,selector:by,quick:by&&Y(by),namespace:e.join(".")},bv);bw=bK[bF];if(!bw){bw=bK[bF]=[];bw.delegateCount=0;if(!bE.setup||bE.setup.call(bx,bA,e,bB)===false){if(bx.addEventListener){bx.addEventListener(bF,bB,false)}else{if(bx.attachEvent){bx.attachEvent("on"+bF,bB)}}}}if(bE.add){bE.add.call(bx,bG);if(!bG.handler.guid){bG.handler.guid=bJ.guid}}if(by){bw.splice(bw.delegateCount++,0,bG)}else{bw.push(bG)}b.event.global[bF]=true}bx=null},global:{},remove:function(bJ,bE,bv,bH,bB){var bI=b.hasData(bJ)&&b._data(bJ),bF,bx,bz,bL,bC,bA,bG,bw,by,bK,bD,e;if(!bI||!(bw=bI.events)){return}bE=b.trim(bt(bE||"")).split(" ");for(bF=0;bF<bE.length;bF++){bx=n.exec(bE[bF])||[];bz=bL=bx[1];bC=bx[2];if(!bz){for(bz in bw){b.event.remove(bJ,bz+bE[bF],bv,bH,true)}continue}by=b.event.special[bz]||{};bz=(bH?by.delegateType:by.bindType)||bz;bD=bw[bz]||[];bA=bD.length;bC=bC?new RegExp("(^|\\.)"+bC.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(bG=0;bG<bD.length;bG++){e=bD[bG];if((bB||bL===e.origType)&&(!bv||bv.guid===e.guid)&&(!bC||bC.test(e.namespace))&&(!bH||bH===e.selector||bH==="**"&&e.selector)){bD.splice(bG--,1);if(e.selector){bD.delegateCount--}if(by.remove){by.remove.call(bJ,e)}}}if(bD.length===0&&bA!==bD.length){if(!by.teardown||by.teardown.call(bJ,bC)===false){b.removeEvent(bJ,bz,bI.handle)}delete bw[bz]}}if(b.isEmptyObject(bw)){bK=bI.handle;if(bK){bK.elem=null}b.removeData(bJ,["events","handle"],true)}},customEvent:{getData:true,setData:true,changeData:true},trigger:function(bv,bD,bA,bJ){if(bA&&(bA.nodeType===3||bA.nodeType===8)){return}var bG=bv.type||bv,bx=[],e,bw,bC,bH,bz,by,bF,bE,bB,bI;if(T.test(bG+b.event.triggered)){return}if(bG.indexOf("!")>=0){bG=bG.slice(0,-1);bw=true}if(bG.indexOf(".")>=0){bx=bG.split(".");bG=bx.shift();bx.sort()}if((!bA||b.event.customEvent[bG])&&!b.event.global[bG]){return}bv=typeof bv==="object"?bv[b.expando]?bv:new b.Event(bG,bv):new b.Event(bG);bv.type=bG;bv.isTrigger=true;bv.exclusive=bw;bv.namespace=bx.join(".");bv.namespace_re=bv.namespace?new RegExp("(^|\\.)"+bx.join("\\.(?:.*\\.)?")+"(\\.|$)"):null;by=bG.indexOf(":")<0?"on"+bG:"";if(!bA){e=b.cache;for(bC in e){if(e[bC].events&&e[bC].events[bG]){b.event.trigger(bv,bD,e[bC].handle.elem,true)}}return}bv.result=L;if(!bv.target){bv.target=bA}bD=bD!=null?b.makeArray(bD):[];bD.unshift(bv);bF=b.event.special[bG]||{};if(bF.trigger&&bF.trigger.apply(bA,bD)===false){return}bB=[[bA,bF.bindType||bG]];if(!bJ&&!bF.noBubble&&!b.isWindow(bA)){bI=bF.delegateType||bG;bH=T.test(bI+bG)?bA:bA.parentNode;bz=null;for(;bH;bH=bH.parentNode){bB.push([bH,bI]);bz=bH}if(bz&&bz===bA.ownerDocument){bB.push([bz.defaultView||bz.parentWindow||bd,bI])}}for(bC=0;bC<bB.length&&!bv.isPropagationStopped();bC++){bH=bB[bC][0];bv.type=bB[bC][1];bE=(b._data(bH,"events")||{})[bv.type]&&b._data(bH,"handle");if(bE){bE.apply(bH,bD)}bE=by&&bH[by];if(bE&&b.acceptData(bH)&&bE.apply(bH,bD)===false){bv.preventDefault()}}bv.type=bG;if(!bJ&&!bv.isDefaultPrevented()){if((!bF._default||bF._default.apply(bA.ownerDocument,bD)===false)&&!(bG==="click"&&b.nodeName(bA,"a"))&&b.acceptData(bA)){if(by&&bA[bG]&&((bG!=="focus"&&bG!=="blur")||bv.target.offsetWidth!==0)&&!b.isWindow(bA)){bz=bA[by];if(bz){bA[by]=null}b.event.triggered=bG;bA[bG]();b.event.triggered=L;if(bz){bA[by]=bz}}}}return bv.result},dispatch:function(bH){bH=b.event.fix(bH||bd.event);var bD=((b._data(this,"events")||{})[bH.type]||[]),bC=bD.delegateCount,bx=[].slice.call(arguments,0),bE=!bH.exclusive&&!bH.namespace,bz=b.event.special[bH.type]||{},bv=[],bJ,bG,by,bA,bK,bI,bB,bw,e,bF,bL;bx[0]=bH;bH.delegateTarget=this;if(bz.preDispatch&&bz.preDispatch.call(this,bH)===false){return}if(bC&&!(bH.button&&bH.type==="click")){bA=b(this);bA.context=this.ownerDocument||this;for(by=bH.target;by!=this;by=by.parentNode||this){if(by.disabled!==true){bI={};bw=[];bA[0]=by;for(bJ=0;bJ<bC;bJ++){e=bD[bJ];bF=e.selector;if(bI[bF]===L){bI[bF]=(e.quick?j(by,e.quick):bA.is(bF))}if(bI[bF]){bw.push(e)}}if(bw.length){bv.push({elem:by,matches:bw})}}}}if(bD.length>bC){bv.push({elem:this,matches:bD.slice(bC)})}for(bJ=0;bJ<bv.length&&!bH.isPropagationStopped();bJ++){bB=bv[bJ];bH.currentTarget=bB.elem;for(bG=0;bG<bB.matches.length&&!bH.isImmediatePropagationStopped();bG++){e=bB.matches[bG];if(bE||(!bH.namespace&&!e.namespace)||bH.namespace_re&&bH.namespace_re.test(e.namespace)){bH.data=e.data;bH.handleObj=e;bK=((b.event.special[e.origType]||{}).handle||e.handler).apply(bB.elem,bx);if(bK!==L){bH.result=bK;if(bK===false){bH.preventDefault();bH.stopPropagation()}}}}}if(bz.postDispatch){bz.postDispatch.call(this,bH)}return bH.result},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(bv,e){if(bv.which==null){bv.which=e.charCode!=null?e.charCode:e.keyCode}return bv}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(bx,bw){var by,bz,e,bv=bw.button,bA=bw.fromElement;if(bx.pageX==null&&bw.clientX!=null){by=bx.target.ownerDocument||av;bz=by.documentElement;e=by.body;bx.pageX=bw.clientX+(bz&&bz.scrollLeft||e&&e.scrollLeft||0)-(bz&&bz.clientLeft||e&&e.clientLeft||0);bx.pageY=bw.clientY+(bz&&bz.scrollTop||e&&e.scrollTop||0)-(bz&&bz.clientTop||e&&e.clientTop||0)}if(!bx.relatedTarget&&bA){bx.relatedTarget=bA===bx.target?bw.toElement:bA}if(!bx.which&&bv!==L){bx.which=(bv&1?1:(bv&2?3:(bv&4?2:0)))}return bx}},fix:function(bw){if(bw[b.expando]){return bw}var bv,bz,e=bw,bx=b.event.fixHooks[bw.type]||{},by=bx.props?this.props.concat(bx.props):this.props;bw=b.Event(e);for(bv=by.length;bv;){bz=by[--bv];bw[bz]=e[bz]}if(!bw.target){bw.target=e.srcElement||av}if(bw.target.nodeType===3){bw.target=bw.target.parentNode}if(bw.metaKey===L){bw.metaKey=bw.ctrlKey}return bx.filter?bx.filter(bw,e):bw},special:{ready:{setup:b.bindReady},load:{noBubble:true},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(bw,bv,e){if(b.isWindow(this)){this.onbeforeunload=e}},teardown:function(bv,e){if(this.onbeforeunload===e){this.onbeforeunload=null}}}},simulate:function(bw,by,bx,bv){var bz=b.extend(new b.Event(),bx,{type:bw,isSimulated:true,originalEvent:{}});if(bv){b.event.trigger(bz,null,by)}else{b.event.dispatch.call(by,bz)}if(bz.isDefaultPrevented()){bx.preventDefault()}}};b.event.handle=b.event.dispatch;b.removeEvent=av.removeEventListener?function(bv,e,bw){if(bv.removeEventListener){bv.removeEventListener(e,bw,false)}}:function(bv,e,bw){if(bv.detachEvent){bv.detachEvent("on"+e,bw)}};b.Event=function(bv,e){if(!(this instanceof b.Event)){return new b.Event(bv,e)}if(bv&&bv.type){this.originalEvent=bv;this.type=bv.type;this.isDefaultPrevented=(bv.defaultPrevented||bv.returnValue===false||bv.getPreventDefault&&bv.getPreventDefault())?i:bl}else{this.type=bv}if(e){b.extend(this,e)}this.timeStamp=bv&&bv.timeStamp||b.now();this[b.expando]=true};function bl(){return false}function i(){return true}b.Event.prototype={preventDefault:function(){this.isDefaultPrevented=i;var bv=this.originalEvent;if(!bv){return}if(bv.preventDefault){bv.preventDefault()}else{bv.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=i;var bv=this.originalEvent;if(!bv){return}if(bv.stopPropagation){bv.stopPropagation()}bv.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=i;this.stopPropagation()},isDefaultPrevented:bl,isPropagationStopped:bl,isImmediatePropagationStopped:bl};b.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(bv,e){b.event.special[bv]={delegateType:e,bindType:e,handle:function(bz){var bB=this,bA=bz.relatedTarget,by=bz.handleObj,bw=by.selector,bx;if(!bA||(bA!==bB&&!b.contains(bB,bA))){bz.type=by.origType;bx=by.handler.apply(this,arguments);bz.type=e}return bx}}});if(!b.support.submitBubbles){b.event.special.submit={setup:function(){if(b.nodeName(this,"form")){return false}b.event.add(this,"click._submit keypress._submit",function(bx){var bw=bx.target,bv=b.nodeName(bw,"input")||b.nodeName(bw,"button")?bw.form:L;if(bv&&!bv._submit_attached){b.event.add(bv,"submit._submit",function(e){e._submit_bubble=true});bv._submit_attached=true}})},postDispatch:function(e){if(e._submit_bubble){delete e._submit_bubble;if(this.parentNode&&!e.isTrigger){b.event.simulate("submit",this.parentNode,e,true)}}},teardown:function(){if(b.nodeName(this,"form")){return false}b.event.remove(this,"._submit")}}}if(!b.support.changeBubbles){b.event.special.change={setup:function(){if(be.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio"){b.event.add(this,"propertychange._change",function(e){if(e.originalEvent.propertyName==="checked"){this._just_changed=true}});b.event.add(this,"click._change",function(e){if(this._just_changed&&!e.isTrigger){this._just_changed=false;b.event.simulate("change",this,e,true)}})}return false}b.event.add(this,"beforeactivate._change",function(bw){var bv=bw.target;if(be.test(bv.nodeName)&&!bv._change_attached){b.event.add(bv,"change._change",function(e){if(this.parentNode&&!e.isSimulated&&!e.isTrigger){b.event.simulate("change",this.parentNode,e,true)}});bv._change_attached=true}})},handle:function(bv){var e=bv.target;if(this!==e||bv.isSimulated||bv.isTrigger||(e.type!=="radio"&&e.type!=="checkbox")){return bv.handleObj.handler.apply(this,arguments)}},teardown:function(){b.event.remove(this,"._change");return be.test(this.nodeName)}}}if(!b.support.focusinBubbles){b.each({focus:"focusin",blur:"focusout"},function(bx,e){var bv=0,bw=function(by){b.event.simulate(e,by.target,b.event.fix(by),true)};b.event.special[e]={setup:function(){if(bv++===0){av.addEventListener(bx,bw,true)}},teardown:function(){if(--bv===0){av.removeEventListener(bx,bw,true)}}}})}b.fn.extend({on:function(bw,e,bz,by,bv){var bA,bx;if(typeof bw==="object"){if(typeof e!=="string"){bz=bz||e;e=L}for(bx in bw){this.on(bx,e,bz,bw[bx],bv)}return this}if(bz==null&&by==null){by=e;bz=e=L}else{if(by==null){if(typeof e==="string"){by=bz;bz=L}else{by=bz;bz=e;e=L}}}if(by===false){by=bl}else{if(!by){return this}}if(bv===1){bA=by;by=function(bB){b().off(bB);return bA.apply(this,arguments)};by.guid=bA.guid||(bA.guid=b.guid++)}return this.each(function(){b.event.add(this,bw,by,bz,e)})},one:function(bv,e,bx,bw){return this.on(bv,e,bx,bw,1)},off:function(bw,e,by){if(bw&&bw.preventDefault&&bw.handleObj){var bv=bw.handleObj;b(bw.delegateTarget).off(bv.namespace?bv.origType+"."+bv.namespace:bv.origType,bv.selector,bv.handler);return this}if(typeof bw==="object"){for(var bx in bw){this.off(bx,e,bw[bx])}return this}if(e===false||typeof e==="function"){by=e;e=L}if(by===false){by=bl}return this.each(function(){b.event.remove(this,bw,by,e)})},bind:function(e,bw,bv){return this.on(e,null,bw,bv)},unbind:function(e,bv){return this.off(e,null,bv)},live:function(e,bw,bv){b(this.context).on(e,this.selector,bw,bv);return this},die:function(e,bv){b(this.context).off(e,this.selector||"**",bv);return this},delegate:function(e,bv,bx,bw){return this.on(bv,e,bx,bw)},undelegate:function(e,bv,bw){return arguments.length==1?this.off(e,"**"):this.off(bv,e,bw)},trigger:function(e,bv){return this.each(function(){b.event.trigger(e,bv,this)})},triggerHandler:function(e,bv){if(this[0]){return b.event.trigger(e,bv,this[0],true)}},toggle:function(bx){var bv=arguments,e=bx.guid||b.guid++,bw=0,by=function(bz){var bA=(b._data(this,"lastToggle"+bx.guid)||0)%bw;b._data(this,"lastToggle"+bx.guid,bA+1);bz.preventDefault();return bv[bA].apply(this,arguments)||false};by.guid=e;while(bw<bv.length){bv[bw++].guid=e}return this.click(by)},hover:function(e,bv){return this.mouseenter(e).mouseleave(bv||e)}});b.each(("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu").split(" "),function(bv,e){b.fn[e]=function(bx,bw){if(bw==null){bw=bx;bx=null}return arguments.length>0?this.on(e,null,bx,bw):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}if(aP.test(e)){b.event.fixHooks[e]=b.event.keyHooks}if(bg.test(e)){b.event.fixHooks[e]=b.event.mouseHooks}}); -/*! - * Sizzle CSS Selector Engine - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. - * More information: http://sizzlejs.com/ - */ -(function(){var bH=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bC="sizcache"+(Math.random()+"").replace(".",""),bI=0,bL=Object.prototype.toString,bB=false,bA=true,bK=/\\/g,bO=/\r\n/g,bQ=/\W/;[0,0].sort(function(){bA=false;return 0});var by=function(bV,e,bY,bZ){bY=bY||[];e=e||av;var b1=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bV||typeof bV!=="string"){return bY}var bS,b3,b6,bR,b2,b5,b4,bX,bU=true,bT=by.isXML(e),bW=[],b0=bV;do{bH.exec("");bS=bH.exec(b0);if(bS){b0=bS[3];bW.push(bS[1]);if(bS[2]){bR=bS[3];break}}}while(bS);if(bW.length>1&&bD.exec(bV)){if(bW.length===2&&bE.relative[bW[0]]){b3=bM(bW[0]+bW[1],e,bZ)}else{b3=bE.relative[bW[0]]?[e]:by(bW.shift(),e);while(bW.length){bV=bW.shift();if(bE.relative[bV]){bV+=bW.shift()}b3=bM(bV,b3,bZ)}}}else{if(!bZ&&bW.length>1&&e.nodeType===9&&!bT&&bE.match.ID.test(bW[0])&&!bE.match.ID.test(bW[bW.length-1])){b2=by.find(bW.shift(),e,bT);e=b2.expr?by.filter(b2.expr,b2.set)[0]:b2.set[0]}if(e){b2=bZ?{expr:bW.pop(),set:bF(bZ)}:by.find(bW.pop(),bW.length===1&&(bW[0]==="~"||bW[0]==="+")&&e.parentNode?e.parentNode:e,bT);b3=b2.expr?by.filter(b2.expr,b2.set):b2.set;if(bW.length>0){b6=bF(b3)}else{bU=false}while(bW.length){b5=bW.pop();b4=b5;if(!bE.relative[b5]){b5=""}else{b4=bW.pop()}if(b4==null){b4=e}bE.relative[b5](b6,b4,bT)}}else{b6=bW=[]}}if(!b6){b6=b3}if(!b6){by.error(b5||bV)}if(bL.call(b6)==="[object Array]"){if(!bU){bY.push.apply(bY,b6)}else{if(e&&e.nodeType===1){for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&(b6[bX]===true||b6[bX].nodeType===1&&by.contains(e,b6[bX]))){bY.push(b3[bX])}}}else{for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&b6[bX].nodeType===1){bY.push(b3[bX])}}}}}else{bF(b6,bY)}if(bR){by(bR,b1,bY,bZ);by.uniqueSort(bY)}return bY};by.uniqueSort=function(bR){if(bJ){bB=bA;bR.sort(bJ);if(bB){for(var e=1;e<bR.length;e++){if(bR[e]===bR[e-1]){bR.splice(e--,1)}}}}return bR};by.matches=function(e,bR){return by(e,null,null,bR)};by.matchesSelector=function(e,bR){return by(bR,null,null,[e]).length>0};by.find=function(bX,e,bY){var bW,bS,bU,bT,bV,bR;if(!bX){return[]}for(bS=0,bU=bE.order.length;bS<bU;bS++){bV=bE.order[bS];if((bT=bE.leftMatch[bV].exec(bX))){bR=bT[1];bT.splice(1,1);if(bR.substr(bR.length-1)!=="\\"){bT[1]=(bT[1]||"").replace(bK,"");bW=bE.find[bV](bT,e,bY);if(bW!=null){bX=bX.replace(bE.match[bV],"");break}}}}if(!bW){bW=typeof e.getElementsByTagName!=="undefined"?e.getElementsByTagName("*"):[]}return{set:bW,expr:bX}};by.filter=function(b1,b0,b4,bU){var bW,e,bZ,b6,b3,bR,bT,bV,b2,bS=b1,b5=[],bY=b0,bX=b0&&b0[0]&&by.isXML(b0[0]);while(b1&&b0.length){for(bZ in bE.filter){if((bW=bE.leftMatch[bZ].exec(b1))!=null&&bW[2]){bR=bE.filter[bZ];bT=bW[1];e=false;bW.splice(1,1);if(bT.substr(bT.length-1)==="\\"){continue}if(bY===b5){b5=[]}if(bE.preFilter[bZ]){bW=bE.preFilter[bZ](bW,bY,b4,b5,bU,bX);if(!bW){e=b6=true}else{if(bW===true){continue}}}if(bW){for(bV=0;(b3=bY[bV])!=null;bV++){if(b3){b6=bR(b3,bW,bV,bY);b2=bU^b6;if(b4&&b6!=null){if(b2){e=true}else{bY[bV]=false}}else{if(b2){b5.push(b3);e=true}}}}}if(b6!==L){if(!b4){bY=b5}b1=b1.replace(bE.match[bZ],"");if(!e){return[]}break}}}if(b1===bS){if(e==null){by.error(b1)}else{break}}bS=b1}return bY};by.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)};var bw=by.getText=function(bU){var bS,bT,e=bU.nodeType,bR="";if(e){if(e===1||e===9||e===11){if(typeof bU.textContent==="string"){return bU.textContent}else{if(typeof bU.innerText==="string"){return bU.innerText.replace(bO,"")}else{for(bU=bU.firstChild;bU;bU=bU.nextSibling){bR+=bw(bU)}}}}else{if(e===3||e===4){return bU.nodeValue}}}else{for(bS=0;(bT=bU[bS]);bS++){if(bT.nodeType!==8){bR+=bw(bT)}}}return bR};var bE=by.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")},type:function(e){return e.getAttribute("type")}},relative:{"+":function(bW,bR){var bT=typeof bR==="string",bV=bT&&!bQ.test(bR),bX=bT&&!bV;if(bV){bR=bR.toLowerCase()}for(var bS=0,e=bW.length,bU;bS<e;bS++){if((bU=bW[bS])){while((bU=bU.previousSibling)&&bU.nodeType!==1){}bW[bS]=bX||bU&&bU.nodeName.toLowerCase()===bR?bU||false:bU===bR}}if(bX){by.filter(bR,bW,true)}},">":function(bW,bR){var bV,bU=typeof bR==="string",bS=0,e=bW.length;if(bU&&!bQ.test(bR)){bR=bR.toLowerCase();for(;bS<e;bS++){bV=bW[bS];if(bV){var bT=bV.parentNode;bW[bS]=bT.nodeName.toLowerCase()===bR?bT:false}}}else{for(;bS<e;bS++){bV=bW[bS];if(bV){bW[bS]=bU?bV.parentNode:bV.parentNode===bR}}if(bU){by.filter(bR,bW,true)}}},"":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("parentNode",bR,bS,bT,bU,bV)},"~":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("previousSibling",bR,bS,bT,bU,bV)}},find:{ID:function(bR,bS,bT){if(typeof bS.getElementById!=="undefined"&&!bT){var e=bS.getElementById(bR[1]);return e&&e.parentNode?[e]:[]}},NAME:function(bS,bV){if(typeof bV.getElementsByName!=="undefined"){var bR=[],bU=bV.getElementsByName(bS[1]);for(var bT=0,e=bU.length;bT<e;bT++){if(bU[bT].getAttribute("name")===bS[1]){bR.push(bU[bT])}}return bR.length===0?null:bR}},TAG:function(e,bR){if(typeof bR.getElementsByTagName!=="undefined"){return bR.getElementsByTagName(e[1])}}},preFilter:{CLASS:function(bT,bR,bS,e,bW,bX){bT=" "+bT[1].replace(bK,"")+" ";if(bX){return bT}for(var bU=0,bV;(bV=bR[bU])!=null;bU++){if(bV){if(bW^(bV.className&&(" "+bV.className+" ").replace(/[\t\n\r]/g," ").indexOf(bT)>=0)){if(!bS){e.push(bV)}}else{if(bS){bR[bU]=false}}}}return false},ID:function(e){return e[1].replace(bK,"")},TAG:function(bR,e){return bR[1].replace(bK,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){by.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bR=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bR[1]+(bR[2]||1))-0;e[3]=bR[3]-0}else{if(e[2]){by.error(e[0])}}e[0]=bI++;return e},ATTR:function(bU,bR,bS,e,bV,bW){var bT=bU[1]=bU[1].replace(bK,"");if(!bW&&bE.attrMap[bT]){bU[1]=bE.attrMap[bT]}bU[4]=(bU[4]||bU[5]||"").replace(bK,"");if(bU[2]==="~="){bU[4]=" "+bU[4]+" "}return bU},PSEUDO:function(bU,bR,bS,e,bV){if(bU[1]==="not"){if((bH.exec(bU[3])||"").length>1||/^\w/.test(bU[3])){bU[3]=by(bU[3],null,null,bR)}else{var bT=by.filter(bU[3],bR,bS,true^bV);if(!bS){e.push.apply(e,bT)}return false}}else{if(bE.match.POS.test(bU[0])||bE.match.CHILD.test(bU[0])){return true}}return bU},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bS,bR,e){return !!by(e[3],bS).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bS){var e=bS.getAttribute("type"),bR=bS.type;return bS.nodeName.toLowerCase()==="input"&&"text"===bR&&(e===bR||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bR.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bR.type},button:function(bR){var e=bR.nodeName.toLowerCase();return e==="input"&&"button"===bR.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bR,e){return e===0},last:function(bS,bR,e,bT){return bR===bT.length-1},even:function(bR,e){return e%2===0},odd:function(bR,e){return e%2===1},lt:function(bS,bR,e){return bR<e[3]-0},gt:function(bS,bR,e){return bR>e[3]-0},nth:function(bS,bR,e){return e[3]-0===bR},eq:function(bS,bR,e){return e[3]-0===bR}},filter:{PSEUDO:function(bS,bX,bW,bY){var e=bX[1],bR=bE.filters[e];if(bR){return bR(bS,bW,bX,bY)}else{if(e==="contains"){return(bS.textContent||bS.innerText||bw([bS])||"").indexOf(bX[3])>=0}else{if(e==="not"){var bT=bX[3];for(var bV=0,bU=bT.length;bV<bU;bV++){if(bT[bV]===bS){return false}}return true}else{by.error(e)}}}},CHILD:function(bS,bU){var bT,b0,bW,bZ,e,bV,bY,bX=bU[1],bR=bS;switch(bX){case"only":case"first":while((bR=bR.previousSibling)){if(bR.nodeType===1){return false}}if(bX==="first"){return true}bR=bS;case"last":while((bR=bR.nextSibling)){if(bR.nodeType===1){return false}}return true;case"nth":bT=bU[2];b0=bU[3];if(bT===1&&b0===0){return true}bW=bU[0];bZ=bS.parentNode;if(bZ&&(bZ[bC]!==bW||!bS.nodeIndex)){bV=0;for(bR=bZ.firstChild;bR;bR=bR.nextSibling){if(bR.nodeType===1){bR.nodeIndex=++bV}}bZ[bC]=bW}bY=bS.nodeIndex-b0;if(bT===0){return bY===0}else{return(bY%bT===0&&bY/bT>=0)}}},ID:function(bR,e){return bR.nodeType===1&&bR.getAttribute("id")===e},TAG:function(bR,e){return(e==="*"&&bR.nodeType===1)||!!bR.nodeName&&bR.nodeName.toLowerCase()===e},CLASS:function(bR,e){return(" "+(bR.className||bR.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bV,bT){var bS=bT[1],e=by.attr?by.attr(bV,bS):bE.attrHandle[bS]?bE.attrHandle[bS](bV):bV[bS]!=null?bV[bS]:bV.getAttribute(bS),bW=e+"",bU=bT[2],bR=bT[4];return e==null?bU==="!=":!bU&&by.attr?e!=null:bU==="="?bW===bR:bU==="*="?bW.indexOf(bR)>=0:bU==="~="?(" "+bW+" ").indexOf(bR)>=0:!bR?bW&&e!==false:bU==="!="?bW!==bR:bU==="^="?bW.indexOf(bR)===0:bU==="$="?bW.substr(bW.length-bR.length)===bR:bU==="|="?bW===bR||bW.substr(0,bR.length+1)===bR+"-":false},POS:function(bU,bR,bS,bV){var e=bR[2],bT=bE.setFilters[e];if(bT){return bT(bU,bS,bR,bV)}}}};var bD=bE.match.POS,bx=function(bR,e){return"\\"+(e-0+1)};for(var bz in bE.match){bE.match[bz]=new RegExp(bE.match[bz].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bE.leftMatch[bz]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bE.match[bz].source.replace(/\\(\d+)/g,bx))}bE.match.globalPOS=bD;var bF=function(bR,e){bR=Array.prototype.slice.call(bR,0);if(e){e.push.apply(e,bR);return e}return bR};try{Array.prototype.slice.call(av.documentElement.childNodes,0)[0].nodeType}catch(bP){bF=function(bU,bT){var bS=0,bR=bT||[];if(bL.call(bU)==="[object Array]"){Array.prototype.push.apply(bR,bU)}else{if(typeof bU.length==="number"){for(var e=bU.length;bS<e;bS++){bR.push(bU[bS])}}else{for(;bU[bS];bS++){bR.push(bU[bS])}}}return bR}}var bJ,bG;if(av.documentElement.compareDocumentPosition){bJ=function(bR,e){if(bR===e){bB=true;return 0}if(!bR.compareDocumentPosition||!e.compareDocumentPosition){return bR.compareDocumentPosition?-1:1}return bR.compareDocumentPosition(e)&4?-1:1}}else{bJ=function(bY,bX){if(bY===bX){bB=true;return 0}else{if(bY.sourceIndex&&bX.sourceIndex){return bY.sourceIndex-bX.sourceIndex}}var bV,bR,bS=[],e=[],bU=bY.parentNode,bW=bX.parentNode,bZ=bU;if(bU===bW){return bG(bY,bX)}else{if(!bU){return -1}else{if(!bW){return 1}}}while(bZ){bS.unshift(bZ);bZ=bZ.parentNode}bZ=bW;while(bZ){e.unshift(bZ);bZ=bZ.parentNode}bV=bS.length;bR=e.length;for(var bT=0;bT<bV&&bT<bR;bT++){if(bS[bT]!==e[bT]){return bG(bS[bT],e[bT])}}return bT===bV?bG(bY,e[bT],-1):bG(bS[bT],bX,1)};bG=function(bR,e,bS){if(bR===e){return bS}var bT=bR.nextSibling;while(bT){if(bT===e){return -1}bT=bT.nextSibling}return 1}}(function(){var bR=av.createElement("div"),bS="script"+(new Date()).getTime(),e=av.documentElement;bR.innerHTML="<a name='"+bS+"'/>";e.insertBefore(bR,e.firstChild);if(av.getElementById(bS)){bE.find.ID=function(bU,bV,bW){if(typeof bV.getElementById!=="undefined"&&!bW){var bT=bV.getElementById(bU[1]);return bT?bT.id===bU[1]||typeof bT.getAttributeNode!=="undefined"&&bT.getAttributeNode("id").nodeValue===bU[1]?[bT]:L:[]}};bE.filter.ID=function(bV,bT){var bU=typeof bV.getAttributeNode!=="undefined"&&bV.getAttributeNode("id");return bV.nodeType===1&&bU&&bU.nodeValue===bT}}e.removeChild(bR);e=bR=null})();(function(){var e=av.createElement("div");e.appendChild(av.createComment(""));if(e.getElementsByTagName("*").length>0){bE.find.TAG=function(bR,bV){var bU=bV.getElementsByTagName(bR[1]);if(bR[1]==="*"){var bT=[];for(var bS=0;bU[bS];bS++){if(bU[bS].nodeType===1){bT.push(bU[bS])}}bU=bT}return bU}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bE.attrHandle.href=function(bR){return bR.getAttribute("href",2)}}e=null})();if(av.querySelectorAll){(function(){var e=by,bT=av.createElement("div"),bS="__sizzle__";bT.innerHTML="<p class='TEST'></p>";if(bT.querySelectorAll&&bT.querySelectorAll(".TEST").length===0){return}by=function(b4,bV,bZ,b3){bV=bV||av;if(!b3&&!by.isXML(bV)){var b2=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b4);if(b2&&(bV.nodeType===1||bV.nodeType===9)){if(b2[1]){return bF(bV.getElementsByTagName(b4),bZ)}else{if(b2[2]&&bE.find.CLASS&&bV.getElementsByClassName){return bF(bV.getElementsByClassName(b2[2]),bZ)}}}if(bV.nodeType===9){if(b4==="body"&&bV.body){return bF([bV.body],bZ)}else{if(b2&&b2[3]){var bY=bV.getElementById(b2[3]);if(bY&&bY.parentNode){if(bY.id===b2[3]){return bF([bY],bZ)}}else{return bF([],bZ)}}}try{return bF(bV.querySelectorAll(b4),bZ)}catch(b0){}}else{if(bV.nodeType===1&&bV.nodeName.toLowerCase()!=="object"){var bW=bV,bX=bV.getAttribute("id"),bU=bX||bS,b6=bV.parentNode,b5=/^\s*[+~]/.test(b4);if(!bX){bV.setAttribute("id",bU)}else{bU=bU.replace(/'/g,"\\$&")}if(b5&&b6){bV=bV.parentNode}try{if(!b5||b6){return bF(bV.querySelectorAll("[id='"+bU+"'] "+b4),bZ)}}catch(b1){}finally{if(!bX){bW.removeAttribute("id")}}}}}return e(b4,bV,bZ,b3)};for(var bR in e){by[bR]=e[bR]}bT=null})()}(function(){var e=av.documentElement,bS=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bS){var bU=!bS.call(av.createElement("div"),"div"),bR=false;try{bS.call(av.documentElement,"[test!='']:sizzle")}catch(bT){bR=true}by.matchesSelector=function(bW,bY){bY=bY.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!by.isXML(bW)){try{if(bR||!bE.match.PSEUDO.test(bY)&&!/!=/.test(bY)){var bV=bS.call(bW,bY);if(bV||!bU||bW.document&&bW.document.nodeType!==11){return bV}}}catch(bX){}}return by(bY,null,null,[bW]).length>0}}})();(function(){var e=av.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bE.order.splice(1,0,"CLASS");bE.find.CLASS=function(bR,bS,bT){if(typeof bS.getElementsByClassName!=="undefined"&&!bT){return bS.getElementsByClassName(bR[1])}};e=null})();function bv(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1&&!bY){e[bC]=bV;e.sizset=bT}if(e.nodeName.toLowerCase()===bW){bU=e;break}e=e[bR]}bZ[bT]=bU}}}function bN(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1){if(!bY){e[bC]=bV;e.sizset=bT}if(typeof bW!=="string"){if(e===bW){bU=true;break}}else{if(by.filter(bW,[e]).length>0){bU=e;break}}}e=e[bR]}bZ[bT]=bU}}}if(av.documentElement.contains){by.contains=function(bR,e){return bR!==e&&(bR.contains?bR.contains(e):true)}}else{if(av.documentElement.compareDocumentPosition){by.contains=function(bR,e){return !!(bR.compareDocumentPosition(e)&16)}}else{by.contains=function(){return false}}}by.isXML=function(e){var bR=(e?e.ownerDocument||e:0).documentElement;return bR?bR.nodeName!=="HTML":false};var bM=function(bS,e,bW){var bV,bX=[],bU="",bY=e.nodeType?[e]:e;while((bV=bE.match.PSEUDO.exec(bS))){bU+=bV[0];bS=bS.replace(bE.match.PSEUDO,"")}bS=bE.relative[bS]?bS+"*":bS;for(var bT=0,bR=bY.length;bT<bR;bT++){by(bS,bY[bT],bX,bW)}return by.filter(bU,bX)};by.attr=b.attr;by.selectors.attrMap={};b.find=by;b.expr=by.selectors;b.expr[":"]=b.expr.filters;b.unique=by.uniqueSort;b.text=by.getText;b.isXMLDoc=by.isXML;b.contains=by.contains})();var ab=/Until$/,aq=/^(?:parents|prevUntil|prevAll)/,bb=/,/,bp=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,H=b.expr.match.globalPOS,ay={children:true,contents:true,next:true,prev:true};b.fn.extend({find:function(e){var bw=this,by,bv;if(typeof e!=="string"){return b(e).filter(function(){for(by=0,bv=bw.length;by<bv;by++){if(b.contains(bw[by],this)){return true}}})}var bx=this.pushStack("","find",e),bA,bB,bz;for(by=0,bv=this.length;by<bv;by++){bA=bx.length;b.find(e,this[by],bx);if(by>0){for(bB=bA;bB<bx.length;bB++){for(bz=0;bz<bA;bz++){if(bx[bz]===bx[bB]){bx.splice(bB--,1);break}}}}}return bx},has:function(bv){var e=b(bv);return this.filter(function(){for(var bx=0,bw=e.length;bx<bw;bx++){if(b.contains(this,e[bx])){return true}}})},not:function(e){return this.pushStack(aH(this,e,false),"not",e)},filter:function(e){return this.pushStack(aH(this,e,true),"filter",e)},is:function(e){return !!e&&(typeof e==="string"?H.test(e)?b(e,this.context).index(this[0])>=0:b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(by,bx){var bv=[],bw,e,bz=this[0];if(b.isArray(by)){var bB=1;while(bz&&bz.ownerDocument&&bz!==bx){for(bw=0;bw<by.length;bw++){if(b(bz).is(by[bw])){bv.push({selector:by[bw],elem:bz,level:bB})}}bz=bz.parentNode;bB++}return bv}var bA=H.test(by)||typeof by!=="string"?b(by,bx||this.context):0;for(bw=0,e=this.length;bw<e;bw++){bz=this[bw];while(bz){if(bA?bA.index(bz)>-1:b.find.matchesSelector(bz,by)){bv.push(bz);break}else{bz=bz.parentNode;if(!bz||!bz.ownerDocument||bz===bx||bz.nodeType===11){break}}}}bv=bv.length>1?b.unique(bv):bv;return this.pushStack(bv,"closest",by)},index:function(e){if(!e){return(this[0]&&this[0].parentNode)?this.prevAll().length:-1}if(typeof e==="string"){return b.inArray(this[0],b(e))}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bv){var bx=typeof e==="string"?b(e,bv):b.makeArray(e&&e.nodeType?[e]:e),bw=b.merge(this.get(),bx);return this.pushStack(B(bx[0])||B(bw[0])?bw:b.unique(bw))},andSelf:function(){return this.add(this.prevObject)}});function B(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bv){var e=bv.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bv,e,bw){return b.dir(bv,"parentNode",bw)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bv,e,bw){return b.dir(bv,"nextSibling",bw)},prevUntil:function(bv,e,bw){return b.dir(bv,"previousSibling",bw)},siblings:function(e){return b.sibling((e.parentNode||{}).firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bv){b.fn[e]=function(by,bw){var bx=b.map(this,bv,by);if(!ab.test(e)){bw=by}if(bw&&typeof bw==="string"){bx=b.filter(bw,bx)}bx=this.length>1&&!ay[e]?b.unique(bx):bx;if((this.length>1||bb.test(bw))&&aq.test(e)){bx=bx.reverse()}return this.pushStack(bx,e,P.call(arguments).join(","))}});b.extend({filter:function(bw,e,bv){if(bv){bw=":not("+bw+")"}return e.length===1?b.find.matchesSelector(e[0],bw)?[e[0]]:[]:b.find.matches(bw,e)},dir:function(bw,bv,by){var e=[],bx=bw[bv];while(bx&&bx.nodeType!==9&&(by===L||bx.nodeType!==1||!b(bx).is(by))){if(bx.nodeType===1){e.push(bx)}bx=bx[bv]}return e},nth:function(by,e,bw,bx){e=e||1;var bv=0;for(;by;by=by[bw]){if(by.nodeType===1&&++bv===e){break}}return by},sibling:function(bw,bv){var e=[];for(;bw;bw=bw.nextSibling){if(bw.nodeType===1&&bw!==bv){e.push(bw)}}return e}});function aH(bx,bw,e){bw=bw||0;if(b.isFunction(bw)){return b.grep(bx,function(bz,by){var bA=!!bw.call(bz,by,bz);return bA===e})}else{if(bw.nodeType){return b.grep(bx,function(bz,by){return(bz===bw)===e})}else{if(typeof bw==="string"){var bv=b.grep(bx,function(by){return by.nodeType===1});if(bp.test(bw)){return b.filter(bw,bv,!e)}else{bw=b.filter(bw,bv)}}}}return b.grep(bx,function(bz,by){return(b.inArray(bz,bw)>=0)===e})}function a(e){var bw=aS.split("|"),bv=e.createDocumentFragment();if(bv.createElement){while(bw.length){bv.createElement(bw.pop())}}return bv}var aS="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",ah=/ jQuery\d+="(?:\d+|null)"/g,ar=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,v=/<tbody/i,W=/<|&#?\w+;/,ae=/<(?:script|style)/i,O=/<(?:script|object|embed|option|style)/i,ai=new RegExp("<(?:"+aS+")[\\s/>]","i"),o=/checked\s*(?:[^=]|=\s*.checked.)/i,bn=/\/(java|ecma)script/i,aO=/^\s*<!(?:\[CDATA\[|\-\-)/,ax={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},ac=a(av);ax.optgroup=ax.option;ax.tbody=ax.tfoot=ax.colgroup=ax.caption=ax.thead;ax.th=ax.td;if(!b.support.htmlSerialize){ax._default=[1,"div<div>","</div>"]}b.fn.extend({text:function(e){return b.access(this,function(bv){return bv===L?b.text(this):this.empty().append((this[0]&&this[0].ownerDocument||av).createTextNode(bv))},null,e,arguments.length)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bw){b(this).wrapAll(e.call(this,bw))})}if(this[0]){var bv=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bv.insertBefore(this[0])}bv.map(function(){var bw=this;while(bw.firstChild&&bw.firstChild.nodeType===1){bw=bw.firstChild}return bw}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bv){b(this).wrapInner(e.call(this,bv))})}return this.each(function(){var bv=b(this),bw=bv.contents();if(bw.length){bw.wrapAll(e)}else{bv.append(e)}})},wrap:function(e){var bv=b.isFunction(e);return this.each(function(bw){b(this).wrapAll(bv?e.call(this,bw):e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this)})}else{if(arguments.length){var e=b.clean(arguments);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b.clean(arguments));return e}}},remove:function(e,bx){for(var bv=0,bw;(bw=this[bv])!=null;bv++){if(!e||b.filter(e,[bw]).length){if(!bx&&bw.nodeType===1){b.cleanData(bw.getElementsByTagName("*"));b.cleanData([bw])}if(bw.parentNode){bw.parentNode.removeChild(bw)}}}return this},empty:function(){for(var e=0,bv;(bv=this[e])!=null;e++){if(bv.nodeType===1){b.cleanData(bv.getElementsByTagName("*"))}while(bv.firstChild){bv.removeChild(bv.firstChild)}}return this},clone:function(bv,e){bv=bv==null?false:bv;e=e==null?bv:e;return this.map(function(){return b.clone(this,bv,e)})},html:function(e){return b.access(this,function(by){var bx=this[0]||{},bw=0,bv=this.length;if(by===L){return bx.nodeType===1?bx.innerHTML.replace(ah,""):null}if(typeof by==="string"&&!ae.test(by)&&(b.support.leadingWhitespace||!ar.test(by))&&!ax[(d.exec(by)||["",""])[1].toLowerCase()]){by=by.replace(R,"<$1></$2>");try{for(;bw<bv;bw++){bx=this[bw]||{};if(bx.nodeType===1){b.cleanData(bx.getElementsByTagName("*"));bx.innerHTML=by}}bx=0}catch(bz){}}if(bx){this.empty().append(by)}},null,e,arguments.length)},replaceWith:function(e){if(this[0]&&this[0].parentNode){if(b.isFunction(e)){return this.each(function(bx){var bw=b(this),bv=bw.html();bw.replaceWith(e.call(this,bx,bv))})}if(typeof e!=="string"){e=b(e).detach()}return this.each(function(){var bw=this.nextSibling,bv=this.parentNode;b(this).remove();if(bw){b(bw).before(e)}else{b(bv).append(e)}})}else{return this.length?this.pushStack(b(b.isFunction(e)?e():e),"replaceWith",e):this}},detach:function(e){return this.remove(e,true)},domManip:function(bB,bF,bE){var bx,by,bA,bD,bC=bB[0],bv=[];if(!b.support.checkClone&&arguments.length===3&&typeof bC==="string"&&o.test(bC)){return this.each(function(){b(this).domManip(bB,bF,bE,true)})}if(b.isFunction(bC)){return this.each(function(bH){var bG=b(this);bB[0]=bC.call(this,bH,bF?bG.html():L);bG.domManip(bB,bF,bE)})}if(this[0]){bD=bC&&bC.parentNode;if(b.support.parentNode&&bD&&bD.nodeType===11&&bD.childNodes.length===this.length){bx={fragment:bD}}else{bx=b.buildFragment(bB,this,bv)}bA=bx.fragment;if(bA.childNodes.length===1){by=bA=bA.firstChild}else{by=bA.firstChild}if(by){bF=bF&&b.nodeName(by,"tr");for(var bw=0,e=this.length,bz=e-1;bw<e;bw++){bE.call(bF?bc(this[bw],by):this[bw],bx.cacheable||(e>1&&bw<bz)?b.clone(bA,true,true):bA)}}if(bv.length){b.each(bv,function(bG,bH){if(bH.src){b.ajax({type:"GET",global:false,url:bH.src,async:false,dataType:"script"})}else{b.globalEval((bH.text||bH.textContent||bH.innerHTML||"").replace(aO,"/*$0*/"))}if(bH.parentNode){bH.parentNode.removeChild(bH)}})}}return this}});function bc(e,bv){return b.nodeName(e,"table")?(e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody"))):e}function s(bB,bv){if(bv.nodeType!==1||!b.hasData(bB)){return}var by,bx,e,bA=b._data(bB),bz=b._data(bv,bA),bw=bA.events;if(bw){delete bz.handle;bz.events={};for(by in bw){for(bx=0,e=bw[by].length;bx<e;bx++){b.event.add(bv,by,bw[by][bx])}}}if(bz.data){bz.data=b.extend({},bz.data)}}function aj(bv,e){var bw;if(e.nodeType!==1){return}if(e.clearAttributes){e.clearAttributes()}if(e.mergeAttributes){e.mergeAttributes(bv)}bw=e.nodeName.toLowerCase();if(bw==="object"){e.outerHTML=bv.outerHTML}else{if(bw==="input"&&(bv.type==="checkbox"||bv.type==="radio")){if(bv.checked){e.defaultChecked=e.checked=bv.checked}if(e.value!==bv.value){e.value=bv.value}}else{if(bw==="option"){e.selected=bv.defaultSelected}else{if(bw==="input"||bw==="textarea"){e.defaultValue=bv.defaultValue}else{if(bw==="script"&&e.text!==bv.text){e.text=bv.text}}}}}e.removeAttribute(b.expando);e.removeAttribute("_submit_attached");e.removeAttribute("_change_attached")}b.buildFragment=function(bz,bx,bv){var by,e,bw,bA,bB=bz[0];if(bx&&bx[0]){bA=bx[0].ownerDocument||bx[0]}if(!bA.createDocumentFragment){bA=av}if(bz.length===1&&typeof bB==="string"&&bB.length<512&&bA===av&&bB.charAt(0)==="<"&&!O.test(bB)&&(b.support.checkClone||!o.test(bB))&&(b.support.html5Clone||!ai.test(bB))){e=true;bw=b.fragments[bB];if(bw&&bw!==1){by=bw}}if(!by){by=bA.createDocumentFragment();b.clean(bz,bA,by,bv)}if(e){b.fragments[bB]=bw?by:1}return{fragment:by,cacheable:e}};b.fragments={};b.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,bv){b.fn[e]=function(bw){var bz=[],bC=b(bw),bB=this.length===1&&this[0].parentNode;if(bB&&bB.nodeType===11&&bB.childNodes.length===1&&bC.length===1){bC[bv](this[0]);return this}else{for(var bA=0,bx=bC.length;bA<bx;bA++){var by=(bA>0?this.clone(true):this).get();b(bC[bA])[bv](by);bz=bz.concat(by)}return this.pushStack(bz,e,bC.selector)}}});function bh(e){if(typeof e.getElementsByTagName!=="undefined"){return e.getElementsByTagName("*")}else{if(typeof e.querySelectorAll!=="undefined"){return e.querySelectorAll("*")}else{return[]}}}function az(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function D(e){var bv=(e.nodeName||"").toLowerCase();if(bv==="input"){az(e)}else{if(bv!=="script"&&typeof e.getElementsByTagName!=="undefined"){b.grep(e.getElementsByTagName("input"),az)}}}function am(e){var bv=av.createElement("div");ac.appendChild(bv);bv.innerHTML=e.outerHTML;return bv.firstChild}b.extend({clone:function(by,bA,bw){var e,bv,bx,bz=b.support.html5Clone||b.isXMLDoc(by)||!ai.test("<"+by.nodeName+">")?by.cloneNode(true):am(by);if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(by.nodeType===1||by.nodeType===11)&&!b.isXMLDoc(by)){aj(by,bz);e=bh(by);bv=bh(bz);for(bx=0;e[bx];++bx){if(bv[bx]){aj(e[bx],bv[bx])}}}if(bA){s(by,bz);if(bw){e=bh(by);bv=bh(bz);for(bx=0;e[bx];++bx){s(e[bx],bv[bx])}}}e=bv=null;return bz},clean:function(bI,bw,bv,bx){var bA,bH,bD,bJ=[];bw=bw||av;if(typeof bw.createElement==="undefined"){bw=bw.ownerDocument||bw[0]&&bw[0].ownerDocument||av}for(var bE=0,bG;(bG=bI[bE])!=null;bE++){if(typeof bG==="number"){bG+=""}if(!bG){continue}if(typeof bG==="string"){if(!W.test(bG)){bG=bw.createTextNode(bG)}else{bG=bG.replace(R,"<$1></$2>");var bN=(d.exec(bG)||["",""])[1].toLowerCase(),bz=ax[bN]||ax._default,bK=bz[0],bB=bw.createElement("div"),bL=ac.childNodes,bM;if(bw===av){ac.appendChild(bB)}else{a(bw).appendChild(bB)}bB.innerHTML=bz[1]+bG+bz[2];while(bK--){bB=bB.lastChild}if(!b.support.tbody){var by=v.test(bG),e=bN==="table"&&!by?bB.firstChild&&bB.firstChild.childNodes:bz[1]==="<table>"&&!by?bB.childNodes:[];for(bD=e.length-1;bD>=0;--bD){if(b.nodeName(e[bD],"tbody")&&!e[bD].childNodes.length){e[bD].parentNode.removeChild(e[bD])}}}if(!b.support.leadingWhitespace&&ar.test(bG)){bB.insertBefore(bw.createTextNode(ar.exec(bG)[0]),bB.firstChild)}bG=bB.childNodes;if(bB){bB.parentNode.removeChild(bB);if(bL.length>0){bM=bL[bL.length-1];if(bM&&bM.parentNode){bM.parentNode.removeChild(bM)}}}}}var bF;if(!b.support.appendChecked){if(bG[0]&&typeof(bF=bG.length)==="number"){for(bD=0;bD<bF;bD++){D(bG[bD])}}else{D(bG)}}if(bG.nodeType){bJ.push(bG)}else{bJ=b.merge(bJ,bG)}}if(bv){bA=function(bO){return !bO.type||bn.test(bO.type)};for(bE=0;bJ[bE];bE++){bH=bJ[bE];if(bx&&b.nodeName(bH,"script")&&(!bH.type||bn.test(bH.type))){bx.push(bH.parentNode?bH.parentNode.removeChild(bH):bH)}else{if(bH.nodeType===1){var bC=b.grep(bH.getElementsByTagName("script"),bA);bJ.splice.apply(bJ,[bE+1,0].concat(bC))}bv.appendChild(bH)}}}return bJ},cleanData:function(bv){var by,bw,e=b.cache,bB=b.event.special,bA=b.support.deleteExpando;for(var bz=0,bx;(bx=bv[bz])!=null;bz++){if(bx.nodeName&&b.noData[bx.nodeName.toLowerCase()]){continue}bw=bx[b.expando];if(bw){by=e[bw];if(by&&by.events){for(var bC in by.events){if(bB[bC]){b.event.remove(bx,bC)}else{b.removeEvent(bx,bC,by.handle)}}if(by.handle){by.handle.elem=null}}if(bA){delete bx[b.expando]}else{if(bx.removeAttribute){bx.removeAttribute(b.expando)}}delete e[bw]}}}});var al=/alpha\([^)]*\)/i,au=/opacity=([^)]*)/,y=/([A-Z]|^ms)/g,bo=/^[\-+]?(?:\d*\.)?\d+$/i,a1=/^-?(?:\d*\.)?\d+(?!px)[^\d\s]+$/i,I=/^([\-+])=([\-+.\de]+)/,aE=/^margin/,a9={position:"absolute",visibility:"hidden",display:"block"},G=["Top","Right","Bottom","Left"],Z,aJ,aY;b.fn.css=function(e,bv){return b.access(this,function(bx,bw,by){return by!==L?b.style(bx,bw,by):b.css(bx,bw)},e,bv,arguments.length>1)};b.extend({cssHooks:{opacity:{get:function(bw,bv){if(bv){var e=Z(bw,"opacity");return e===""?"1":e}else{return bw.style.opacity}}}},cssNumber:{fillOpacity:true,fontWeight:true,lineHeight:true,opacity:true,orphans:true,widows:true,zIndex:true,zoom:true},cssProps:{"float":b.support.cssFloat?"cssFloat":"styleFloat"},style:function(bx,bw,bD,by){if(!bx||bx.nodeType===3||bx.nodeType===8||!bx.style){return}var bB,bC,bz=b.camelCase(bw),bv=bx.style,bE=b.cssHooks[bz];bw=b.cssProps[bz]||bz;if(bD!==L){bC=typeof bD;if(bC==="string"&&(bB=I.exec(bD))){bD=(+(bB[1]+1)*+bB[2])+parseFloat(b.css(bx,bw));bC="number"}if(bD==null||bC==="number"&&isNaN(bD)){return}if(bC==="number"&&!b.cssNumber[bz]){bD+="px"}if(!bE||!("set" in bE)||(bD=bE.set(bx,bD))!==L){try{bv[bw]=bD}catch(bA){}}}else{if(bE&&"get" in bE&&(bB=bE.get(bx,false,by))!==L){return bB}return bv[bw]}},css:function(by,bx,bv){var bw,e;bx=b.camelCase(bx);e=b.cssHooks[bx];bx=b.cssProps[bx]||bx;if(bx==="cssFloat"){bx="float"}if(e&&"get" in e&&(bw=e.get(by,true,bv))!==L){return bw}else{if(Z){return Z(by,bx)}}},swap:function(by,bx,bz){var e={},bw,bv;for(bv in bx){e[bv]=by.style[bv];by.style[bv]=bx[bv]}bw=bz.call(by);for(bv in bx){by.style[bv]=e[bv]}return bw}});b.curCSS=b.css;if(av.defaultView&&av.defaultView.getComputedStyle){aJ=function(bA,bw){var bv,bz,e,by,bx=bA.style;bw=bw.replace(y,"-$1").toLowerCase();if((bz=bA.ownerDocument.defaultView)&&(e=bz.getComputedStyle(bA,null))){bv=e.getPropertyValue(bw);if(bv===""&&!b.contains(bA.ownerDocument.documentElement,bA)){bv=b.style(bA,bw)}}if(!b.support.pixelMargin&&e&&aE.test(bw)&&a1.test(bv)){by=bx.width;bx.width=bv;bv=e.width;bx.width=by}return bv}}if(av.documentElement.currentStyle){aY=function(bz,bw){var bA,e,by,bv=bz.currentStyle&&bz.currentStyle[bw],bx=bz.style;if(bv==null&&bx&&(by=bx[bw])){bv=by}if(a1.test(bv)){bA=bx.left;e=bz.runtimeStyle&&bz.runtimeStyle.left;if(e){bz.runtimeStyle.left=bz.currentStyle.left}bx.left=bw==="fontSize"?"1em":bv;bv=bx.pixelLeft+"px";bx.left=bA;if(e){bz.runtimeStyle.left=e}}return bv===""?"auto":bv}}Z=aJ||aY;function af(by,bw,bv){var bz=bw==="width"?by.offsetWidth:by.offsetHeight,bx=bw==="width"?1:0,e=4;if(bz>0){if(bv!=="border"){for(;bx<e;bx+=2){if(!bv){bz-=parseFloat(b.css(by,"padding"+G[bx]))||0}if(bv==="margin"){bz+=parseFloat(b.css(by,bv+G[bx]))||0}else{bz-=parseFloat(b.css(by,"border"+G[bx]+"Width"))||0}}}return bz+"px"}bz=Z(by,bw);if(bz<0||bz==null){bz=by.style[bw]}if(a1.test(bz)){return bz}bz=parseFloat(bz)||0;if(bv){for(;bx<e;bx+=2){bz+=parseFloat(b.css(by,"padding"+G[bx]))||0;if(bv!=="padding"){bz+=parseFloat(b.css(by,"border"+G[bx]+"Width"))||0}if(bv==="margin"){bz+=parseFloat(b.css(by,bv+G[bx]))||0}}}return bz+"px"}b.each(["height","width"],function(bv,e){b.cssHooks[e]={get:function(by,bx,bw){if(bx){if(by.offsetWidth!==0){return af(by,e,bw)}else{return b.swap(by,a9,function(){return af(by,e,bw)})}}},set:function(bw,bx){return bo.test(bx)?bx+"px":bx}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bv,e){return au.test((e&&bv.currentStyle?bv.currentStyle.filter:bv.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(by,bz){var bx=by.style,bv=by.currentStyle,e=b.isNumeric(bz)?"alpha(opacity="+bz*100+")":"",bw=bv&&bv.filter||bx.filter||"";bx.zoom=1;if(bz>=1&&b.trim(bw.replace(al,""))===""){bx.removeAttribute("filter");if(bv&&!bv.filter){return}}bx.filter=al.test(bw)?bw.replace(al,e):bw+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bv,e){return b.swap(bv,{display:"inline-block"},function(){if(e){return Z(bv,"margin-right")}else{return bv.style.marginRight}})}}}});if(b.expr&&b.expr.filters){b.expr.filters.hidden=function(bw){var bv=bw.offsetWidth,e=bw.offsetHeight;return(bv===0&&e===0)||(!b.support.reliableHiddenOffsets&&((bw.style&&bw.style.display)||b.css(bw,"display"))==="none")};b.expr.filters.visible=function(e){return !b.expr.filters.hidden(e)}}b.each({margin:"",padding:"",border:"Width"},function(e,bv){b.cssHooks[e+bv]={expand:function(by){var bx,bz=typeof by==="string"?by.split(" "):[by],bw={};for(bx=0;bx<4;bx++){bw[e+G[bx]+bv]=bz[bx]||bz[bx-2]||bz[0]}return bw}}});var k=/%20/g,ap=/\[\]$/,bs=/\r?\n/g,bq=/#.*$/,aD=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,a0=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,aN=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,aR=/^(?:GET|HEAD)$/,c=/^\/\//,M=/\?/,a7=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,p=/^(?:select|textarea)/i,h=/\s+/,br=/([?&])_=[^&]*/,K=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,z=b.fn.load,aa={},q={},aF,r,aW=["*/"]+["*"];try{aF=bm.href}catch(aw){aF=av.createElement("a");aF.href="";aF=aF.href}r=K.exec(aF.toLowerCase())||[];function f(e){return function(by,bA){if(typeof by!=="string"){bA=by;by="*"}if(b.isFunction(bA)){var bx=by.toLowerCase().split(h),bw=0,bz=bx.length,bv,bB,bC;for(;bw<bz;bw++){bv=bx[bw];bC=/^\+/.test(bv);if(bC){bv=bv.substr(1)||"*"}bB=e[bv]=e[bv]||[];bB[bC?"unshift":"push"](bA)}}}}function aX(bv,bE,bz,bD,bB,bx){bB=bB||bE.dataTypes[0];bx=bx||{};bx[bB]=true;var bA=bv[bB],bw=0,e=bA?bA.length:0,by=(bv===aa),bC;for(;bw<e&&(by||!bC);bw++){bC=bA[bw](bE,bz,bD);if(typeof bC==="string"){if(!by||bx[bC]){bC=L}else{bE.dataTypes.unshift(bC);bC=aX(bv,bE,bz,bD,bC,bx)}}}if((by||!bC)&&!bx["*"]){bC=aX(bv,bE,bz,bD,"*",bx)}return bC}function an(bw,bx){var bv,e,by=b.ajaxSettings.flatOptions||{};for(bv in bx){if(bx[bv]!==L){(by[bv]?bw:(e||(e={})))[bv]=bx[bv]}}if(e){b.extend(true,bw,e)}}b.fn.extend({load:function(bw,bz,bA){if(typeof bw!=="string"&&z){return z.apply(this,arguments)}else{if(!this.length){return this}}var by=bw.indexOf(" ");if(by>=0){var e=bw.slice(by,bw.length);bw=bw.slice(0,by)}var bx="GET";if(bz){if(b.isFunction(bz)){bA=bz;bz=L}else{if(typeof bz==="object"){bz=b.param(bz,b.ajaxSettings.traditional);bx="POST"}}}var bv=this;b.ajax({url:bw,type:bx,dataType:"html",data:bz,complete:function(bC,bB,bD){bD=bC.responseText;if(bC.isResolved()){bC.done(function(bE){bD=bE});bv.html(e?b("<div>").append(bD.replace(a7,"")).find(e):bD)}if(bA){bv.each(bA,[bD,bB,bC])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||p.test(this.nodeName)||a0.test(this.type))}).map(function(e,bv){var bw=b(this).val();return bw==null?null:b.isArray(bw)?b.map(bw,function(by,bx){return{name:bv.name,value:by.replace(bs,"\r\n")}}):{name:bv.name,value:bw.replace(bs,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bv){b.fn[bv]=function(bw){return this.on(bv,bw)}});b.each(["get","post"],function(e,bv){b[bv]=function(bw,by,bz,bx){if(b.isFunction(by)){bx=bx||bz;bz=by;by=L}return b.ajax({type:bv,url:bw,data:by,success:bz,dataType:bx})}});b.extend({getScript:function(e,bv){return b.get(e,L,bv,"script")},getJSON:function(e,bv,bw){return b.get(e,bv,bw,"json")},ajaxSetup:function(bv,e){if(e){an(bv,b.ajaxSettings)}else{e=bv;bv=b.ajaxSettings}an(bv,e);return bv},ajaxSettings:{url:aF,isLocal:aN.test(r[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":aW},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":bd.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML},flatOptions:{context:true,url:true}},ajaxPrefilter:f(aa),ajaxTransport:f(q),ajax:function(bz,bx){if(typeof bz==="object"){bx=bz;bz=L}bx=bx||{};var bD=b.ajaxSetup({},bx),bS=bD.context||bD,bG=bS!==bD&&(bS.nodeType||bS instanceof b)?b(bS):b.event,bR=b.Deferred(),bN=b.Callbacks("once memory"),bB=bD.statusCode||{},bC,bH={},bO={},bQ,by,bL,bE,bI,bA=0,bw,bK,bJ={readyState:0,setRequestHeader:function(bT,bU){if(!bA){var e=bT.toLowerCase();bT=bO[e]=bO[e]||bT;bH[bT]=bU}return this},getAllResponseHeaders:function(){return bA===2?bQ:null},getResponseHeader:function(bT){var e;if(bA===2){if(!by){by={};while((e=aD.exec(bQ))){by[e[1].toLowerCase()]=e[2]}}e=by[bT.toLowerCase()]}return e===L?null:e},overrideMimeType:function(e){if(!bA){bD.mimeType=e}return this},abort:function(e){e=e||"abort";if(bL){bL.abort(e)}bF(0,e);return this}};function bF(bZ,bU,b0,bW){if(bA===2){return}bA=2;if(bE){clearTimeout(bE)}bL=L;bQ=bW||"";bJ.readyState=bZ>0?4:0;var bT,b4,b3,bX=bU,bY=b0?bk(bD,bJ,b0):L,bV,b2;if(bZ>=200&&bZ<300||bZ===304){if(bD.ifModified){if((bV=bJ.getResponseHeader("Last-Modified"))){b.lastModified[bC]=bV}if((b2=bJ.getResponseHeader("Etag"))){b.etag[bC]=b2}}if(bZ===304){bX="notmodified";bT=true}else{try{b4=F(bD,bY);bX="success";bT=true}catch(b1){bX="parsererror";b3=b1}}}else{b3=bX;if(!bX||bZ){bX="error";if(bZ<0){bZ=0}}}bJ.status=bZ;bJ.statusText=""+(bU||bX);if(bT){bR.resolveWith(bS,[b4,bX,bJ])}else{bR.rejectWith(bS,[bJ,bX,b3])}bJ.statusCode(bB);bB=L;if(bw){bG.trigger("ajax"+(bT?"Success":"Error"),[bJ,bD,bT?b4:b3])}bN.fireWith(bS,[bJ,bX]);if(bw){bG.trigger("ajaxComplete",[bJ,bD]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bR.promise(bJ);bJ.success=bJ.done;bJ.error=bJ.fail;bJ.complete=bN.add;bJ.statusCode=function(bT){if(bT){var e;if(bA<2){for(e in bT){bB[e]=[bB[e],bT[e]]}}else{e=bT[bJ.status];bJ.then(e,e)}}return this};bD.url=((bz||bD.url)+"").replace(bq,"").replace(c,r[1]+"//");bD.dataTypes=b.trim(bD.dataType||"*").toLowerCase().split(h);if(bD.crossDomain==null){bI=K.exec(bD.url.toLowerCase());bD.crossDomain=!!(bI&&(bI[1]!=r[1]||bI[2]!=r[2]||(bI[3]||(bI[1]==="http:"?80:443))!=(r[3]||(r[1]==="http:"?80:443))))}if(bD.data&&bD.processData&&typeof bD.data!=="string"){bD.data=b.param(bD.data,bD.traditional)}aX(aa,bD,bx,bJ);if(bA===2){return false}bw=bD.global;bD.type=bD.type.toUpperCase();bD.hasContent=!aR.test(bD.type);if(bw&&b.active++===0){b.event.trigger("ajaxStart")}if(!bD.hasContent){if(bD.data){bD.url+=(M.test(bD.url)?"&":"?")+bD.data;delete bD.data}bC=bD.url;if(bD.cache===false){var bv=b.now(),bP=bD.url.replace(br,"$1_="+bv);bD.url=bP+((bP===bD.url)?(M.test(bD.url)?"&":"?")+"_="+bv:"")}}if(bD.data&&bD.hasContent&&bD.contentType!==false||bx.contentType){bJ.setRequestHeader("Content-Type",bD.contentType)}if(bD.ifModified){bC=bC||bD.url;if(b.lastModified[bC]){bJ.setRequestHeader("If-Modified-Since",b.lastModified[bC])}if(b.etag[bC]){bJ.setRequestHeader("If-None-Match",b.etag[bC])}}bJ.setRequestHeader("Accept",bD.dataTypes[0]&&bD.accepts[bD.dataTypes[0]]?bD.accepts[bD.dataTypes[0]]+(bD.dataTypes[0]!=="*"?", "+aW+"; q=0.01":""):bD.accepts["*"]);for(bK in bD.headers){bJ.setRequestHeader(bK,bD.headers[bK])}if(bD.beforeSend&&(bD.beforeSend.call(bS,bJ,bD)===false||bA===2)){bJ.abort();return false}for(bK in {success:1,error:1,complete:1}){bJ[bK](bD[bK])}bL=aX(q,bD,bx,bJ);if(!bL){bF(-1,"No Transport")}else{bJ.readyState=1;if(bw){bG.trigger("ajaxSend",[bJ,bD])}if(bD.async&&bD.timeout>0){bE=setTimeout(function(){bJ.abort("timeout")},bD.timeout)}try{bA=1;bL.send(bH,bF)}catch(bM){if(bA<2){bF(-1,bM)}else{throw bM}}}return bJ},param:function(e,bw){var bv=[],by=function(bz,bA){bA=b.isFunction(bA)?bA():bA;bv[bv.length]=encodeURIComponent(bz)+"="+encodeURIComponent(bA)};if(bw===L){bw=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){by(this.name,this.value)})}else{for(var bx in e){u(bx,e[bx],bw,by)}}return bv.join("&").replace(k,"+")}});function u(bw,by,bv,bx){if(b.isArray(by)){b.each(by,function(bA,bz){if(bv||ap.test(bw)){bx(bw,bz)}else{u(bw+"["+(typeof bz==="object"?bA:"")+"]",bz,bv,bx)}})}else{if(!bv&&b.type(by)==="object"){for(var e in by){u(bw+"["+e+"]",by[e],bv,bx)}}else{bx(bw,by)}}}b.extend({active:0,lastModified:{},etag:{}});function bk(bD,bC,bz){var bv=bD.contents,bB=bD.dataTypes,bw=bD.responseFields,by,bA,bx,e;for(bA in bw){if(bA in bz){bC[bw[bA]]=bz[bA]}}while(bB[0]==="*"){bB.shift();if(by===L){by=bD.mimeType||bC.getResponseHeader("content-type")}}if(by){for(bA in bv){if(bv[bA]&&bv[bA].test(by)){bB.unshift(bA);break}}}if(bB[0] in bz){bx=bB[0]}else{for(bA in bz){if(!bB[0]||bD.converters[bA+" "+bB[0]]){bx=bA;break}if(!e){e=bA}}bx=bx||e}if(bx){if(bx!==bB[0]){bB.unshift(bx)}return bz[bx]}}function F(bH,bz){if(bH.dataFilter){bz=bH.dataFilter(bz,bH.dataType)}var bD=bH.dataTypes,bG={},bA,bE,bw=bD.length,bB,bC=bD[0],bx,by,bF,bv,e;for(bA=1;bA<bw;bA++){if(bA===1){for(bE in bH.converters){if(typeof bE==="string"){bG[bE.toLowerCase()]=bH.converters[bE]}}}bx=bC;bC=bD[bA];if(bC==="*"){bC=bx}else{if(bx!=="*"&&bx!==bC){by=bx+" "+bC;bF=bG[by]||bG["* "+bC];if(!bF){e=L;for(bv in bG){bB=bv.split(" ");if(bB[0]===bx||bB[0]==="*"){e=bG[bB[1]+" "+bC];if(e){bv=bG[bv];if(bv===true){bF=e}else{if(e===true){bF=bv}}break}}}}if(!(bF||e)){b.error("No conversion from "+by.replace(" "," to "))}if(bF!==true){bz=bF?bF(bz):e(bv(bz))}}}}return bz}var aC=b.now(),t=/(\=)\?(&|$)|\?\?/i;b.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return b.expando+"_"+(aC++)}});b.ajaxPrefilter("json jsonp",function(bD,bA,bC){var bx=(typeof bD.data==="string")&&/^application\/x\-www\-form\-urlencoded/.test(bD.contentType);if(bD.dataTypes[0]==="jsonp"||bD.jsonp!==false&&(t.test(bD.url)||bx&&t.test(bD.data))){var bB,bw=bD.jsonpCallback=b.isFunction(bD.jsonpCallback)?bD.jsonpCallback():bD.jsonpCallback,bz=bd[bw],e=bD.url,by=bD.data,bv="$1"+bw+"$2";if(bD.jsonp!==false){e=e.replace(t,bv);if(bD.url===e){if(bx){by=by.replace(t,bv)}if(bD.data===by){e+=(/\?/.test(e)?"&":"?")+bD.jsonp+"="+bw}}}bD.url=e;bD.data=by;bd[bw]=function(bE){bB=[bE]};bC.always(function(){bd[bw]=bz;if(bB&&b.isFunction(bz)){bd[bw](bB[0])}});bD.converters["script json"]=function(){if(!bB){b.error(bw+" was not called")}return bB[0]};bD.dataTypes[0]="json";return"script"}});b.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){b.globalEval(e);return e}}});b.ajaxPrefilter("script",function(e){if(e.cache===L){e.cache=false}if(e.crossDomain){e.type="GET";e.global=false}});b.ajaxTransport("script",function(bw){if(bw.crossDomain){var e,bv=av.head||av.getElementsByTagName("head")[0]||av.documentElement;return{send:function(bx,by){e=av.createElement("script");e.async="async";if(bw.scriptCharset){e.charset=bw.scriptCharset}e.src=bw.url;e.onload=e.onreadystatechange=function(bA,bz){if(bz||!e.readyState||/loaded|complete/.test(e.readyState)){e.onload=e.onreadystatechange=null;if(bv&&e.parentNode){bv.removeChild(e)}e=L;if(!bz){by(200,"success")}}};bv.insertBefore(e,bv.firstChild)},abort:function(){if(e){e.onload(0,1)}}}}});var A=bd.ActiveXObject?function(){for(var e in N){N[e](0,1)}}:false,x=0,N;function aM(){try{return new bd.XMLHttpRequest()}catch(bv){}}function ak(){try{return new bd.ActiveXObject("Microsoft.XMLHTTP")}catch(bv){}}b.ajaxSettings.xhr=bd.ActiveXObject?function(){return !this.isLocal&&aM()||ak()}:aM;(function(e){b.extend(b.support,{ajax:!!e,cors:!!e&&("withCredentials" in e)})})(b.ajaxSettings.xhr());if(b.support.ajax){b.ajaxTransport(function(e){if(!e.crossDomain||b.support.cors){var bv;return{send:function(bB,bw){var bA=e.xhr(),bz,by;if(e.username){bA.open(e.type,e.url,e.async,e.username,e.password)}else{bA.open(e.type,e.url,e.async)}if(e.xhrFields){for(by in e.xhrFields){bA[by]=e.xhrFields[by]}}if(e.mimeType&&bA.overrideMimeType){bA.overrideMimeType(e.mimeType)}if(!e.crossDomain&&!bB["X-Requested-With"]){bB["X-Requested-With"]="XMLHttpRequest"}try{for(by in bB){bA.setRequestHeader(by,bB[by])}}catch(bx){}bA.send((e.hasContent&&e.data)||null);bv=function(bK,bE){var bF,bD,bC,bI,bH;try{if(bv&&(bE||bA.readyState===4)){bv=L;if(bz){bA.onreadystatechange=b.noop;if(A){delete N[bz]}}if(bE){if(bA.readyState!==4){bA.abort()}}else{bF=bA.status;bC=bA.getAllResponseHeaders();bI={};bH=bA.responseXML;if(bH&&bH.documentElement){bI.xml=bH}try{bI.text=bA.responseText}catch(bK){}try{bD=bA.statusText}catch(bJ){bD=""}if(!bF&&e.isLocal&&!e.crossDomain){bF=bI.text?200:404}else{if(bF===1223){bF=204}}}}}catch(bG){if(!bE){bw(-1,bG)}}if(bI){bw(bF,bD,bI,bC)}};if(!e.async||bA.readyState===4){bv()}else{bz=++x;if(A){if(!N){N={};b(bd).unload(A)}N[bz]=bv}bA.onreadystatechange=bv}},abort:function(){if(bv){bv(0,1)}}}}})}var Q={},ba,m,aB=/^(?:toggle|show|hide)$/,aU=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,a4,aI=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],a5;b.fn.extend({show:function(bx,bA,bz){var bw,by;if(bx||bx===0){return this.animate(a2("show",3),bx,bA,bz)}else{for(var bv=0,e=this.length;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(!b._data(bw,"olddisplay")&&by==="none"){by=bw.style.display=""}if((by===""&&b.css(bw,"display")==="none")||!b.contains(bw.ownerDocument.documentElement,bw)){b._data(bw,"olddisplay",w(bw.nodeName))}}}for(bv=0;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(by===""||by==="none"){bw.style.display=b._data(bw,"olddisplay")||""}}}return this}},hide:function(bx,bA,bz){if(bx||bx===0){return this.animate(a2("hide",3),bx,bA,bz)}else{var bw,by,bv=0,e=this.length;for(;bv<e;bv++){bw=this[bv];if(bw.style){by=b.css(bw,"display");if(by!=="none"&&!b._data(bw,"olddisplay")){b._data(bw,"olddisplay",by)}}}for(bv=0;bv<e;bv++){if(this[bv].style){this[bv].style.display="none"}}return this}},_toggle:b.fn.toggle,toggle:function(bw,bv,bx){var e=typeof bw==="boolean";if(b.isFunction(bw)&&b.isFunction(bv)){this._toggle.apply(this,arguments)}else{if(bw==null||e){this.each(function(){var by=e?bw:b(this).is(":hidden");b(this)[by?"show":"hide"]()})}else{this.animate(a2("toggle",3),bw,bv,bx)}}return this},fadeTo:function(e,bx,bw,bv){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:bx},e,bw,bv)},animate:function(bz,bw,by,bx){var e=b.speed(bw,by,bx);if(b.isEmptyObject(bz)){return this.each(e.complete,[false])}bz=b.extend({},bz);function bv(){if(e.queue===false){b._mark(this)}var bE=b.extend({},e),bL=this.nodeType===1,bJ=bL&&b(this).is(":hidden"),bB,bG,bD,bK,bN,bF,bI,bC,bH,bM,bA;bE.animatedProperties={};for(bD in bz){bB=b.camelCase(bD);if(bD!==bB){bz[bB]=bz[bD];delete bz[bD]}if((bN=b.cssHooks[bB])&&"expand" in bN){bF=bN.expand(bz[bB]);delete bz[bB];for(bD in bF){if(!(bD in bz)){bz[bD]=bF[bD]}}}}for(bB in bz){bG=bz[bB];if(b.isArray(bG)){bE.animatedProperties[bB]=bG[1];bG=bz[bB]=bG[0]}else{bE.animatedProperties[bB]=bE.specialEasing&&bE.specialEasing[bB]||bE.easing||"swing"}if(bG==="hide"&&bJ||bG==="show"&&!bJ){return bE.complete.call(this)}if(bL&&(bB==="height"||bB==="width")){bE.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(b.css(this,"display")==="inline"&&b.css(this,"float")==="none"){if(!b.support.inlineBlockNeedsLayout||w(this.nodeName)==="inline"){this.style.display="inline-block"}else{this.style.zoom=1}}}}if(bE.overflow!=null){this.style.overflow="hidden"}for(bD in bz){bK=new b.fx(this,bE,bD);bG=bz[bD];if(aB.test(bG)){bA=b._data(this,"toggle"+bD)||(bG==="toggle"?bJ?"show":"hide":0);if(bA){b._data(this,"toggle"+bD,bA==="show"?"hide":"show");bK[bA]()}else{bK[bG]()}}else{bI=aU.exec(bG);bC=bK.cur();if(bI){bH=parseFloat(bI[2]);bM=bI[3]||(b.cssNumber[bD]?"":"px");if(bM!=="px"){b.style(this,bD,(bH||1)+bM);bC=((bH||1)/bK.cur())*bC;b.style(this,bD,bC+bM)}if(bI[1]){bH=((bI[1]==="-="?-1:1)*bH)+bC}bK.custom(bC,bH,bM)}else{bK.custom(bC,bG,"")}}}return true}return e.queue===false?this.each(bv):this.queue(e.queue,bv)},stop:function(bw,bv,e){if(typeof bw!=="string"){e=bv;bv=bw;bw=L}if(bv&&bw!==false){this.queue(bw||"fx",[])}return this.each(function(){var bx,by=false,bA=b.timers,bz=b._data(this);if(!e){b._unmark(true,this)}function bB(bE,bF,bD){var bC=bF[bD];b.removeData(bE,bD,true);bC.stop(e)}if(bw==null){for(bx in bz){if(bz[bx]&&bz[bx].stop&&bx.indexOf(".run")===bx.length-4){bB(this,bz,bx)}}}else{if(bz[bx=bw+".run"]&&bz[bx].stop){bB(this,bz,bx)}}for(bx=bA.length;bx--;){if(bA[bx].elem===this&&(bw==null||bA[bx].queue===bw)){if(e){bA[bx](true)}else{bA[bx].saveState()}by=true;bA.splice(bx,1)}}if(!(e&&by)){b.dequeue(this,bw)}})}});function bi(){setTimeout(at,0);return(a5=b.now())}function at(){a5=L}function a2(bv,e){var bw={};b.each(aI.concat.apply([],aI.slice(0,e)),function(){bw[this]=bv});return bw}b.each({slideDown:a2("show",1),slideUp:a2("hide",1),slideToggle:a2("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,bv){b.fn[e]=function(bw,by,bx){return this.animate(bv,bw,by,bx)}});b.extend({speed:function(bw,bx,bv){var e=bw&&typeof bw==="object"?b.extend({},bw):{complete:bv||!bv&&bx||b.isFunction(bw)&&bw,duration:bw,easing:bv&&bx||bx&&!b.isFunction(bx)&&bx};e.duration=b.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in b.fx.speeds?b.fx.speeds[e.duration]:b.fx.speeds._default;if(e.queue==null||e.queue===true){e.queue="fx"}e.old=e.complete;e.complete=function(by){if(b.isFunction(e.old)){e.old.call(this)}if(e.queue){b.dequeue(this,e.queue)}else{if(by!==false){b._unmark(this)}}};return e},easing:{linear:function(e){return e},swing:function(e){return(-Math.cos(e*Math.PI)/2)+0.5}},timers:[],fx:function(bv,e,bw){this.options=e;this.elem=bv;this.prop=bw;e.orig=e.orig||{}}});b.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(b.fx.step[this.prop]||b.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var e,bv=b.css(this.elem,this.prop);return isNaN(e=parseFloat(bv))?!bv||bv==="auto"?0:bv:e},custom:function(bz,by,bx){var e=this,bw=b.fx;this.startTime=a5||bi();this.end=by;this.now=this.start=bz;this.pos=this.state=0;this.unit=bx||this.unit||(b.cssNumber[this.prop]?"":"px");function bv(bA){return e.step(bA)}bv.queue=this.options.queue;bv.elem=this.elem;bv.saveState=function(){if(b._data(e.elem,"fxshow"+e.prop)===L){if(e.options.hide){b._data(e.elem,"fxshow"+e.prop,e.start)}else{if(e.options.show){b._data(e.elem,"fxshow"+e.prop,e.end)}}}};if(bv()&&b.timers.push(bv)&&!a4){a4=setInterval(bw.tick,bw.interval)}},show:function(){var e=b._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=e||b.style(this.elem,this.prop);this.options.show=true;if(e!==L){this.custom(this.cur(),e)}else{this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur())}b(this.elem).show()},hide:function(){this.options.orig[this.prop]=b._data(this.elem,"fxshow"+this.prop)||b.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(by){var bA,bB,bv,bx=a5||bi(),e=true,bz=this.elem,bw=this.options;if(by||bx>=bw.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bw.animatedProperties[this.prop]=true;for(bA in bw.animatedProperties){if(bw.animatedProperties[bA]!==true){e=false}}if(e){if(bw.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bC,bD){bz.style["overflow"+bD]=bw.overflow[bC]})}if(bw.hide){b(bz).hide()}if(bw.hide||bw.show){for(bA in bw.animatedProperties){b.style(bz,bA,bw.orig[bA]);b.removeData(bz,"fxshow"+bA,true);b.removeData(bz,"toggle"+bA,true)}}bv=bw.complete;if(bv){bw.complete=false;bv.call(bz)}}return false}else{if(bw.duration==Infinity){this.now=bx}else{bB=bx-this.startTime;this.state=bB/bw.duration;this.pos=b.easing[bw.animatedProperties[this.prop]](this.state,bB,0,1,bw.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){var bw,bv=b.timers,e=0;for(;e<bv.length;e++){bw=bv[e];if(!bw()&&bv[e]===bw){bv.splice(e--,1)}}if(!bv.length){b.fx.stop()}},interval:13,stop:function(){clearInterval(a4);a4=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(e){b.style(e.elem,"opacity",e.now)},_default:function(e){if(e.elem.style&&e.elem.style[e.prop]!=null){e.elem.style[e.prop]=e.now+e.unit}else{e.elem[e.prop]=e.now}}}});b.each(aI.concat.apply([],aI),function(e,bv){if(bv.indexOf("margin")){b.fx.step[bv]=function(bw){b.style(bw.elem,bv,Math.max(0,bw.now)+bw.unit)}}});if(b.expr&&b.expr.filters){b.expr.filters.animated=function(e){return b.grep(b.timers,function(bv){return e===bv.elem}).length}}function w(bx){if(!Q[bx]){var e=av.body,bv=b("<"+bx+">").appendTo(e),bw=bv.css("display");bv.remove();if(bw==="none"||bw===""){if(!ba){ba=av.createElement("iframe");ba.frameBorder=ba.width=ba.height=0}e.appendChild(ba);if(!m||!ba.createElement){m=(ba.contentWindow||ba.contentDocument).document;m.write((b.support.boxModel?"<!doctype html>":"")+"<html><body>");m.close()}bv=m.createElement(bx);m.body.appendChild(bv);bw=b.css(bv,"display");e.removeChild(ba)}Q[bx]=bw}return Q[bx]}var a8,V=/^t(?:able|d|h)$/i,ad=/^(?:body|html)$/i;if("getBoundingClientRect" in av.documentElement){a8=function(by,bH,bw,bB){try{bB=by.getBoundingClientRect()}catch(bF){}if(!bB||!b.contains(bw,by)){return bB?{top:bB.top,left:bB.left}:{top:0,left:0}}var bC=bH.body,bD=aL(bH),bA=bw.clientTop||bC.clientTop||0,bE=bw.clientLeft||bC.clientLeft||0,bv=bD.pageYOffset||b.support.boxModel&&bw.scrollTop||bC.scrollTop,bz=bD.pageXOffset||b.support.boxModel&&bw.scrollLeft||bC.scrollLeft,bG=bB.top+bv-bA,bx=bB.left+bz-bE;return{top:bG,left:bx}}}else{a8=function(bz,bE,bx){var bC,bw=bz.offsetParent,bv=bz,bA=bE.body,bB=bE.defaultView,e=bB?bB.getComputedStyle(bz,null):bz.currentStyle,bD=bz.offsetTop,by=bz.offsetLeft;while((bz=bz.parentNode)&&bz!==bA&&bz!==bx){if(b.support.fixedPosition&&e.position==="fixed"){break}bC=bB?bB.getComputedStyle(bz,null):bz.currentStyle;bD-=bz.scrollTop;by-=bz.scrollLeft;if(bz===bw){bD+=bz.offsetTop;by+=bz.offsetLeft;if(b.support.doesNotAddBorder&&!(b.support.doesAddBorderForTableAndCells&&V.test(bz.nodeName))){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}bv=bw;bw=bz.offsetParent}if(b.support.subtractsBorderForOverflowNotVisible&&bC.overflow!=="visible"){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}e=bC}if(e.position==="relative"||e.position==="static"){bD+=bA.offsetTop;by+=bA.offsetLeft}if(b.support.fixedPosition&&e.position==="fixed"){bD+=Math.max(bx.scrollTop,bA.scrollTop);by+=Math.max(bx.scrollLeft,bA.scrollLeft)}return{top:bD,left:by}}}b.fn.offset=function(e){if(arguments.length){return e===L?this:this.each(function(bx){b.offset.setOffset(this,e,bx)})}var bv=this[0],bw=bv&&bv.ownerDocument;if(!bw){return null}if(bv===bw.body){return b.offset.bodyOffset(bv)}return a8(bv,bw,bw.documentElement)};b.offset={bodyOffset:function(e){var bw=e.offsetTop,bv=e.offsetLeft;if(b.support.doesNotIncludeMarginInBodyOffset){bw+=parseFloat(b.css(e,"marginTop"))||0;bv+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bw,left:bv}},setOffset:function(bx,bG,bA){var bB=b.css(bx,"position");if(bB==="static"){bx.style.position="relative"}var bz=b(bx),bv=bz.offset(),e=b.css(bx,"top"),bE=b.css(bx,"left"),bF=(bB==="absolute"||bB==="fixed")&&b.inArray("auto",[e,bE])>-1,bD={},bC={},bw,by;if(bF){bC=bz.position();bw=bC.top;by=bC.left}else{bw=parseFloat(e)||0;by=parseFloat(bE)||0}if(b.isFunction(bG)){bG=bG.call(bx,bA,bv)}if(bG.top!=null){bD.top=(bG.top-bv.top)+bw}if(bG.left!=null){bD.left=(bG.left-bv.left)+by}if("using" in bG){bG.using.call(bx,bD)}else{bz.css(bD)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bw=this[0],bv=this.offsetParent(),bx=this.offset(),e=ad.test(bv[0].nodeName)?{top:0,left:0}:bv.offset();bx.top-=parseFloat(b.css(bw,"marginTop"))||0;bx.left-=parseFloat(b.css(bw,"marginLeft"))||0;e.top+=parseFloat(b.css(bv[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bv[0],"borderLeftWidth"))||0;return{top:bx.top-e.top,left:bx.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||av.body;while(e&&(!ad.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(bw,bv){var e=/Y/.test(bv);b.fn[bw]=function(bx){return b.access(this,function(by,bB,bA){var bz=aL(by);if(bA===L){return bz?(bv in bz)?bz[bv]:b.support.boxModel&&bz.document.documentElement[bB]||bz.document.body[bB]:by[bB]}if(bz){bz.scrollTo(!e?bA:b(bz).scrollLeft(),e?bA:b(bz).scrollTop())}else{by[bB]=bA}},bw,bx,arguments.length,null)}});function aL(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each({Height:"height",Width:"width"},function(bw,bx){var bv="client"+bw,e="scroll"+bw,by="offset"+bw;b.fn["inner"+bw]=function(){var bz=this[0];return bz?bz.style?parseFloat(b.css(bz,bx,"padding")):this[bx]():null};b.fn["outer"+bw]=function(bA){var bz=this[0];return bz?bz.style?parseFloat(b.css(bz,bx,bA?"margin":"border")):this[bx]():null};b.fn[bx]=function(bz){return b.access(this,function(bC,bB,bD){var bF,bE,bG,bA;if(b.isWindow(bC)){bF=bC.document;bE=bF.documentElement[bv];return b.support.boxModel&&bE||bF.body&&bF.body[bv]||bE}if(bC.nodeType===9){bF=bC.documentElement;if(bF[bv]>=bF[e]){return bF[bv]}return Math.max(bC.body[e],bF[e],bC.body[by],bF[by])}if(bD===L){bG=b.css(bC,bB);bA=parseFloat(bG);return b.isNumeric(bA)?bA:bG}b(bC).css(bB,bD)},bx,bz,arguments.length,null)}});bd.jQuery=bd.$=b;if(typeof define==="function"&&define.amd&&define.amd.jQuery){define("jquery",[],function(){return b})}})(window);/*! - * jQuery UI 1.8.18 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ -(function(a,d){a.ui=a.ui||{};if(a.ui.version){return}a.extend(a.ui,{version:"1.8.18",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(e,f){return typeof e==="number"?this.each(function(){var g=this;setTimeout(function(){a(g).focus();if(f){f.call(g)}},e)}):this._focus.apply(this,arguments)},scrollParent:function(){var e;if((a.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){e=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(a.curCSS(this,"position",1))&&(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}else{e=this.parents().filter(function(){return(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!e.length?a(document):e},zIndex:function(h){if(h!==d){return this.css("zIndex",h)}if(this.length){var f=a(this[0]),e,g;while(f.length&&f[0]!==document){e=f.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){g=parseInt(f.css("zIndex"),10);if(!isNaN(g)&&g!==0){return g}}f=f.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(g,e){var f=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),k={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function j(m,l,i,n){a.each(f,function(){l-=parseFloat(a.curCSS(m,"padding"+this,true))||0;if(i){l-=parseFloat(a.curCSS(m,"border"+this+"Width",true))||0}if(n){l-=parseFloat(a.curCSS(m,"margin"+this,true))||0}});return l}a.fn["inner"+e]=function(i){if(i===d){return k["inner"+e].call(this)}return this.each(function(){a(this).css(h,j(this,i)+"px")})};a.fn["outer"+e]=function(i,l){if(typeof i!=="number"){return k["outer"+e].call(this,i)}return this.each(function(){a(this).css(h,j(this,i,true,l)+"px")})}});function c(g,e){var j=g.nodeName.toLowerCase();if("area"===j){var i=g.parentNode,h=i.name,f;if(!g.href||!h||i.nodeName.toLowerCase()!=="map"){return false}f=a("img[usemap=#"+h+"]")[0];return !!f&&b(f)}return(/input|select|textarea|button|object/.test(j)?!g.disabled:"a"==j?g.href||e:e)&&b(g)}function b(e){return !a(e).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.extend(a.expr[":"],{data:function(g,f,e){return !!a.data(g,e[3])},focusable:function(e){return c(e,!isNaN(a.attr(e,"tabindex")))},tabbable:function(g){var e=a.attr(g,"tabindex"),f=isNaN(e);return(f||e>=0)&&c(g,!f)}});a(function(){var e=document.body,f=e.appendChild(f=document.createElement("div"));f.offsetHeight;a.extend(f.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=f.offsetHeight===100;a.support.selectstart="onselectstart" in f;e.removeChild(f).style.display="none"});a.extend(a.ui,{plugin:{add:function(f,g,j){var h=a.ui[f].prototype;for(var e in j){h.plugins[e]=h.plugins[e]||[];h.plugins[e].push([g,j[e]])}},call:function(e,g,f){var j=e.plugins[g];if(!j||!e.element[0].parentNode){return}for(var h=0;h<j.length;h++){if(e.options[j[h][0]]){j[h][1].apply(e.element,f)}}}},contains:function(f,e){return document.compareDocumentPosition?f.compareDocumentPosition(e)&16:f!==e&&f.contains(e)},hasScroll:function(h,f){if(a(h).css("overflow")==="hidden"){return false}var e=(f&&f==="left")?"scrollLeft":"scrollTop",g=false;if(h[e]>0){return true}h[e]=1;g=(h[e]>0);h[e]=0;return g},isOverAxis:function(f,e,g){return(f>e)&&(f<(e+g))},isOver:function(j,f,i,h,e,g){return a.ui.isOverAxis(j,i,e)&&a.ui.isOverAxis(f,h,g)}})})(jQuery);/*! - * jQuery UI Widget 1.8.18 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Widget - */ -(function(b,d){if(b.cleanData){var c=b.cleanData;b.cleanData=function(f){for(var g=0,h;(h=f[g])!=null;g++){try{b(h).triggerHandler("remove")}catch(j){}}c(f)}}else{var a=b.fn.remove;b.fn.remove=function(e,f){return this.each(function(){if(!f){if(!e||b.filter(e,[this]).length){b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(g){}})}}return a.call(b(this),e,f)})}}b.widget=function(f,h,e){var g=f.split(".")[0],j;f=f.split(".")[1];j=g+"-"+f;if(!e){e=h;h=b.Widget}b.expr[":"][j]=function(k){return !!b.data(k,f)};b[g]=b[g]||{};b[g][f]=function(k,l){if(arguments.length){this._createWidget(k,l)}};var i=new h();i.options=b.extend(true,{},i.options);b[g][f].prototype=b.extend(true,i,{namespace:g,widgetName:f,widgetEventPrefix:b[g][f].prototype.widgetEventPrefix||f,widgetBaseClass:j},e);b.widget.bridge(f,b[g][f])};b.widget.bridge=function(f,e){b.fn[f]=function(i){var g=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!g&&h.length?b.extend.apply(null,[true,i].concat(h)):i;if(g&&i.charAt(0)==="_"){return j}if(g){this.each(function(){var k=b.data(this,f),l=k&&b.isFunction(k[i])?k[i].apply(k,h):k;if(l!==k&&l!==d){j=l;return false}})}else{this.each(function(){var k=b.data(this,f);if(k){k.option(i||{})._init()}else{b.data(this,f,new e(i,this))}})}return j}};b.Widget=function(e,f){if(arguments.length){this._createWidget(e,f)}};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(f,g){b.data(g,this.widgetName,this);this.element=b(g);this.options=b.extend(true,{},this.options,this._getCreateOptions(),f);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(f,g){var e=f;if(arguments.length===0){return b.extend({},this.options)}if(typeof f==="string"){if(g===d){return this.options[f]}e={};e[f]=g}this._setOptions(e);return this},_setOptions:function(f){var e=this;b.each(f,function(g,h){e._setOption(g,h)});return this},_setOption:function(e,f){this.options[e]=f;if(e==="disabled"){this.widget()[f?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",f)}return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,f,g){var j,i,h=this.options[e];g=g||{};f=b.Event(f);f.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();f.target=this.element[0];i=f.originalEvent;if(i){for(j in i){if(!(j in f)){f[j]=i[j]}}}this.element.trigger(f,g);return !(b.isFunction(h)&&h.call(this.element[0],f,g)===false||f.isDefaultPrevented())}}})(jQuery);/*! - * jQuery UI Mouse 1.8.18 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Mouse - * - * Depends: - * jquery.ui.widget.js - */ -(function(b,c){var a=false;b(document).mouseup(function(d){a=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var d=this;this.element.bind("mousedown."+this.widgetName,function(e){return d._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===b.data(e.target,d.widgetName+".preventClickEvent")){b.removeData(e.target,d.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(f){if(a){return}(this._mouseStarted&&this._mouseUp(f));this._mouseDownEvent=f;var e=this,g=(f.which==1),d=(typeof this.options.cancel=="string"&&f.target.nodeName?b(f.target).closest(this.options.cancel).length:false);if(!g||d||!this._mouseCapture(f)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(f)&&this._mouseDelayMet(f)){this._mouseStarted=(this._mouseStart(f)!==false);if(!this._mouseStarted){f.preventDefault();return true}}if(true===b.data(f.target,this.widgetName+".preventClickEvent")){b.removeData(f.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(h){return e._mouseMove(h)};this._mouseUpDelegate=function(h){return e._mouseUp(h)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);f.preventDefault();a=true;return true},_mouseMove:function(d){if(b.browser.msie&&!(document.documentMode>=9)&&!d.button){return this._mouseUp(d)}if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,d)!==false);(this._mouseStarted?this._mouseDrag(d):this._mouseUp(d))}return !this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(d.target==this._mouseDownEvent.target){b.data(d.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return(Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance)},_mouseDelayMet:function(d){return this.mouseDelayMet},_mouseStart:function(d){},_mouseDrag:function(d){},_mouseStop:function(d){},_mouseCapture:function(d){return true}})})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){this.element.wrap(c('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g<l.length;g++){var j=c.trim(l[g]),e="ui-resizable-"+j;var h=c('<div class="ui-resizable-handle '+e+'"></div>');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){if(k.disabled){return}c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(k.disabled){return}if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateVirtualBoundaries:function(g){var j=this.options,i,h,f,k,e;e={minWidth:a(j.minWidth)?j.minWidth:0,maxWidth:a(j.maxWidth)?j.maxWidth:Infinity,minHeight:a(j.minHeight)?j.minHeight:0,maxHeight:a(j.maxHeight)?j.maxHeight:Infinity};if(this._aspectRatio||g){i=e.minHeight*this.aspectRatio;f=e.minWidth/this.aspectRatio;h=e.maxHeight*this.aspectRatio;k=e.maxWidth/this.aspectRatio;if(i>e.minWidth){e.minWidth=i}if(f>e.minHeight){e.minHeight=f}if(h<e.maxWidth){e.maxWidth=h}if(k<e.maxHeight){e.maxHeight=k}}this._vBoundaries=e},_updateCache:function(e){var f=this.options;this.offset=this.helper.offset();if(a(e.left)){this.position.left=e.left}if(a(e.top)){this.position.top=e.top}if(a(e.height)){this.size.height=e.height}if(a(e.width)){this.size.width=e.width}},_updateRatio:function(h,g){var i=this.options,j=this.position,f=this.size,e=this.axis;if(a(h.height)){h.width=(h.height*this.aspectRatio)}else{if(a(h.width)){h.height=(h.width/this.aspectRatio)}}if(e=="sw"){h.left=j.left+(f.width-h.width);h.top=null}if(e=="nw"){h.top=j.top+(f.height-h.height);h.left=j.left+(f.width-h.width)}return h},_respectSize:function(l,g){var j=this.helper,i=this._vBoundaries,r=this._aspectRatio||g.shiftKey,q=this.axis,t=a(l.width)&&i.maxWidth&&(i.maxWidth<l.width),m=a(l.height)&&i.maxHeight&&(i.maxHeight<l.height),h=a(l.width)&&i.minWidth&&(i.minWidth>l.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(t){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(t&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f<this._proportionallyResizeElements.length;f++){var h=this._proportionallyResizeElements[f];if(!this.borderDif){var e=[h.css("borderTopWidth"),h.css("borderRightWidth"),h.css("borderBottomWidth"),h.css("borderLeftWidth")],j=[h.css("paddingTop"),h.css("paddingRight"),h.css("paddingBottom"),h.css("paddingLeft")];this.borderDif=c.map(e,function(l,n){var m=parseInt(l,10)||0,o=parseInt(j[n],10)||0;return m+o})}if(c.browser.msie&&!(!(c(g).is(":hidden")||c(g).parents(":hidden").length))){continue}h.css({height:(g.height()-this.borderDif[0]-this.borderDif[2])||0,width:(g.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var f=this.element,i=this.options;this.elementOffset=f.offset();if(this._helper){this.helper=this.helper||c('<div style="overflow:hidden;"></div>');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.18"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10)})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,u){var t=(r[u]||0)+(k[u]||0);if(t&&t>=0){p[u]=t||null}});q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(e,f){c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null;p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var t=c(this).data("resizable"),j=t.options,l=t.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}t.containerElement=c(k);if(/document/.test(g)||g==document){t.containerOffset={left:0,top:0};t.containerPosition={left:0,top:0};t.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});t.containerOffset=n.offset();t.containerPosition=n.position();t.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=t.containerOffset,e=t.containerSize.height,m=t.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);t.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var t=c(this).data("resizable"),i=t.options,f=t.containerSize,p=t.containerOffset,m=t.size,n=t.position,r=t._aspectRatio||g.shiftKey,e={top:0,left:0},h=t.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(t._helper?p.left:0)){t.size.width=t.size.width+(t._helper?(t.position.left-p.left):(t.position.left-e.left));if(r){t.size.height=t.size.width/i.aspectRatio}t.position.left=i.helper?p.left:0}if(n.top<(t._helper?p.top:0)){t.size.height=t.size.height+(t._helper?(t.position.top-p.top):t.position.top);if(r){t.size.width=t.size.height*i.aspectRatio}t.position.top=t._helper?p.top:0}t.offset.left=t.parentData.left+t.position.left;t.offset.top=t.parentData.top+t.position.top;var l=Math.abs((t._helper?t.offset.left-e.left:(t.offset.left-e.left))+t.sizeDiff.width),s=Math.abs((t._helper?t.offset.top-e.top:(t.offset.top-p.top))+t.sizeDiff.height);var k=t.containerElement.get(0)==t.element.parent().get(0),j=/relative|absolute/.test(t.containerElement.css("position"));if(k&&j){l-=t.parentData.left}if(l+t.size.width>=t.parentData.width){t.size.width=t.parentData.width-l;if(r){t.size.height=t.size.width/t.aspectRatio}}if(s+t.size.height>=t.parentData.height){t.size.height=t.parentData.height-s;if(r){t.size.width=t.size.height*t.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);/*! - * jQuery hashchange event - v1.3 - 7/21/2010 - * http://benalman.com/projects/jquery-hashchange-plugin/ - * - * Copyright (c) 2010 "Cowboy" Ben Alman - * Dual licensed under the MIT and GPL licenses. - * http://benalman.com/about/license/ - */ -(function($,e,b){var c="hashchange",h=document,f,g=$.event.special,i=h.documentMode,d="on"+c in e&&(i===b||i>7);function a(j){j=j||location.href;return"#"+j.replace(/^[^#]*#?(.*)$/,"$1")}$.fn[c]=function(j){return j?this.bind(c,j):this.trigger(c)};$.fn[c].delay=50;g[c]=$.extend(g[c],{setup:function(){if(d){return false}$(f.start)},teardown:function(){if(d){return false}$(f.stop)}});f=(function(){var j={},p,m=a(),k=function(q){return q},l=k,o=k;j.start=function(){p||n()};j.stop=function(){p&&clearTimeout(p);p=b};function n(){var r=a(),q=o(m);if(r!==m){l(m=r,q);$(e).trigger(c)}else{if(q!==m){location.href=location.href.replace(/#.*/,"")+q}}p=setTimeout(n,$.fn[c].delay)}$.browser.msie&&!d&&(function(){var q,r;j.start=function(){if(!q){r=$.fn[c].src;r=r&&r+a();q=$('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){r||l(a());n()}).attr("src",r||"javascript:0").insertAfter("body")[0].contentWindow;h.onpropertychange=function(){try{if(event.propertyName==="title"){q.document.title=h.title}}catch(s){}}}};j.stop=k;o=function(){return a(q.location.href)};l=function(v,s){var u=q.document,t=$.fn[c].domain;if(v!==s){u.title=h.title;u.open();t&&u.write('<script>document.domain="'+t+'"<\/script>');u.close();q.location.hash=v}}})();return j})()})(jQuery,this);(function(c){var a=c.scrollTo=function(f,e,d){c(window).scrollTo(f,e,d)};a.defaults={axis:"xy",duration:parseFloat(c.fn.jquery)>=1.3?0:1};a.window=function(d){return c(window)._scrollable()};c.fn._scrollable=function(){return this.map(function(){var e=this,d=!e.nodeName||c.inArray(e.nodeName.toLowerCase(),["iframe","#document","html","body"])!=-1;if(!d){return e}var f=(e.contentWindow||e).document||e.ownerDocument||e;return c.browser.safari||f.compatMode=="BackCompat"?f.body:f.documentElement})};c.fn.scrollTo=function(f,e,d){if(typeof e=="object"){d=e;e=0}if(typeof d=="function"){d={onAfter:d}}if(f=="max"){f=9000000000}d=c.extend({},a.defaults,d);e=e||d.speed||d.duration;d.queue=d.queue&&d.axis.length>1;if(d.queue){e/=2}d.offset=b(d.offset);d.over=b(d.over);return this._scrollable().each(function(){var l=this,j=c(l),k=f,i,g={},m=j.is("html,body");switch(typeof k){case"number":case"string":if(/^([+-]=)?\d+(\.\d+)?(px|%)?$/.test(k)){k=b(k);break}k=c(k,this);case"object":if(k.is||k.style){i=(k=c(k)).offset()}}c.each(d.axis.split(""),function(q,r){var s=r=="x"?"Left":"Top",u=s.toLowerCase(),p="scroll"+s,o=l[p],n=a.max(l,r);if(i){g[p]=i[u]+(m?0:o-j.offset()[u]);if(d.margin){g[p]-=parseInt(k.css("margin"+s))||0;g[p]-=parseInt(k.css("border"+s+"Width"))||0}g[p]+=d.offset[u]||0;if(d.over[u]){g[p]+=k[r=="x"?"width":"height"]()*d.over[u]}}else{var t=k[u];g[p]=t.slice&&t.slice(-1)=="%"?parseFloat(t)/100*n:t}if(/^\d+$/.test(g[p])){g[p]=g[p]<=0?0:Math.min(g[p],n)}if(!q&&d.queue){if(o!=g[p]){h(d.onAfterFirst)}delete g[p]}});h(d.onAfter);function h(n){j.animate(g,e,d.easing,n&&function(){n.call(this,f,d)})}}).end()};a.max=function(j,i){var h=i=="x"?"Width":"Height",e="scroll"+h;if(!c(j).is("html,body")){return j[e]-c(j)[h.toLowerCase()]()}var g="client"+h,f=j.ownerDocument.documentElement,d=j.ownerDocument.body;return Math.max(f[e],d[e])-Math.min(f[g],d[g])};function b(d){return typeof d=="object"?d:{top:d,left:d}}})(jQuery);/*! - PowerTip - v1.2.0 - 2013-04-03 - http://stevenbenner.github.com/jquery-powertip/ - Copyright (c) 2013 Steven Benner (http://stevenbenner.com/). - Released under MIT license. - https://raw.github.com/stevenbenner/jquery-powertip/master/LICENSE.txt -*/ -(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{a(jQuery)}}(function(k){var A=k(document),s=k(window),w=k("body");var n="displayController",e="hasActiveHover",d="forcedOpen",u="hasMouseMove",f="mouseOnToPopup",g="originalTitle",y="powertip",o="powertipjq",l="powertiptarget",E=180/Math.PI;var c={isTipOpen:false,isFixedTipOpen:false,isClosing:false,tipOpenImminent:false,activeHover:null,currentX:0,currentY:0,previousX:0,previousY:0,desyncTimeout:null,mouseTrackingActive:false,delayInProgress:false,windowWidth:0,windowHeight:0,scrollTop:0,scrollLeft:0};var p={none:0,top:1,bottom:2,left:4,right:8};k.fn.powerTip=function(F,N){if(!this.length){return this}if(k.type(F)==="string"&&k.powerTip[F]){return k.powerTip[F].call(this,this,N)}var O=k.extend({},k.fn.powerTip.defaults,F),G=new x(O);h();this.each(function M(){var R=k(this),Q=R.data(y),P=R.data(o),T=R.data(l),S;if(R.data(n)){k.powerTip.destroy(R)}S=R.attr("title");if(!Q&&!T&&!P&&S){R.data(y,S);R.data(g,S);R.removeAttr("title")}R.data(n,new t(R,O,G))});if(!O.manual){this.on({"mouseenter.powertip":function J(P){k.powerTip.show(this,P)},"mouseleave.powertip":function L(){k.powerTip.hide(this)},"focus.powertip":function K(){k.powerTip.show(this)},"blur.powertip":function H(){k.powerTip.hide(this,true)},"keydown.powertip":function I(P){if(P.keyCode===27){k.powerTip.hide(this,true)}}})}return this};k.fn.powerTip.defaults={fadeInTime:200,fadeOutTime:100,followMouse:false,popupId:"powerTip",intentSensitivity:7,intentPollInterval:100,closeDelay:100,placement:"n",smartPlacement:false,offset:10,mouseOnToPopup:false,manual:false};k.fn.powerTip.smartPlacementLists={n:["n","ne","nw","s"],e:["e","ne","se","w","nw","sw","n","s","e"],s:["s","se","sw","n"],w:["w","nw","sw","e","ne","se","n","s","w"],nw:["nw","w","sw","n","s","se","nw"],ne:["ne","e","se","n","s","sw","ne"],sw:["sw","w","nw","s","n","ne","sw"],se:["se","e","ne","s","n","nw","se"],"nw-alt":["nw-alt","n","ne-alt","sw-alt","s","se-alt","w","e"],"ne-alt":["ne-alt","n","nw-alt","se-alt","s","sw-alt","e","w"],"sw-alt":["sw-alt","s","se-alt","nw-alt","n","ne-alt","w","e"],"se-alt":["se-alt","s","sw-alt","ne-alt","n","nw-alt","e","w"]};k.powerTip={show:function z(F,G){if(G){i(G);c.previousX=G.pageX;c.previousY=G.pageY;k(F).data(n).show()}else{k(F).first().data(n).show(true,true)}return F},reposition:function r(F){k(F).first().data(n).resetPosition();return F},hide:function D(G,F){if(G){k(G).first().data(n).hide(F)}else{if(c.activeHover){c.activeHover.data(n).hide(true)}}return G},destroy:function C(G){k(G).off(".powertip").each(function F(){var I=k(this),H=[g,n,e,d];if(I.data(g)){I.attr("title",I.data(g));H.push(y)}I.removeData(H)});return G}};k.powerTip.showTip=k.powerTip.show;k.powerTip.closeTip=k.powerTip.hide;function b(){var F=this;F.top="auto";F.left="auto";F.right="auto";F.bottom="auto";F.set=function(H,G){if(k.isNumeric(G)){F[H]=Math.round(G)}}}function t(K,N,F){var J=null;function L(P,Q){M();if(!K.data(e)){if(!P){c.tipOpenImminent=true;J=setTimeout(function O(){J=null;I()},N.intentPollInterval)}else{if(Q){K.data(d,true)}F.showTip(K)}}}function G(P){M();c.tipOpenImminent=false;if(K.data(e)){K.data(d,false);if(!P){c.delayInProgress=true;J=setTimeout(function O(){J=null;F.hideTip(K);c.delayInProgress=false},N.closeDelay)}else{F.hideTip(K)}}}function I(){var Q=Math.abs(c.previousX-c.currentX),O=Math.abs(c.previousY-c.currentY),P=Q+O;if(P<N.intentSensitivity){F.showTip(K)}else{c.previousX=c.currentX;c.previousY=c.currentY;L()}}function M(){J=clearTimeout(J);c.delayInProgress=false}function H(){F.resetPosition(K)}this.show=L;this.hide=G;this.cancel=M;this.resetPosition=H}function j(){function G(M,L,J,O,P){var K=L.split("-")[0],N=new b(),I;if(q(M)){I=H(M,K)}else{I=F(M,K)}switch(L){case"n":N.set("left",I.left-(J/2));N.set("bottom",c.windowHeight-I.top+P);break;case"e":N.set("left",I.left+P);N.set("top",I.top-(O/2));break;case"s":N.set("left",I.left-(J/2));N.set("top",I.top+P);break;case"w":N.set("top",I.top-(O/2));N.set("right",c.windowWidth-I.left+P);break;case"nw":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"nw-alt":N.set("left",I.left);N.set("bottom",c.windowHeight-I.top+P);break;case"ne":N.set("left",I.left-20);N.set("bottom",c.windowHeight-I.top+P);break;case"ne-alt":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left);break;case"sw":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"sw-alt":N.set("left",I.left);N.set("top",I.top+P);break;case"se":N.set("left",I.left-20);N.set("top",I.top+P);break;case"se-alt":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left);break}return N}function F(K,J){var O=K.offset(),N=K.outerWidth(),I=K.outerHeight(),M,L;switch(J){case"n":M=O.left+N/2;L=O.top;break;case"e":M=O.left+N;L=O.top+I/2;break;case"s":M=O.left+N/2;L=O.top+I;break;case"w":M=O.left;L=O.top+I/2;break;case"nw":M=O.left;L=O.top;break;case"ne":M=O.left+N;L=O.top;break;case"sw":M=O.left;L=O.top+I;break;case"se":M=O.left+N;L=O.top+I;break}return{top:L,left:M}}function H(O,K){var S=O.closest("svg")[0],N=O[0],W=S.createSVGPoint(),L=N.getBBox(),V=N.getScreenCTM(),M=L.width/2,Q=L.height/2,P=[],I=["nw","n","ne","e","se","s","sw","w"],U,X,R,T;function J(){P.push(W.matrixTransform(V))}W.x=L.x;W.y=L.y;J();W.x+=M;J();W.x+=M;J();W.y+=Q;J();W.y+=Q;J();W.x-=M;J();W.x-=M;J();W.y-=Q;J();if(P[0].y!==P[1].y||P[0].x!==P[7].x){X=Math.atan2(V.b,V.a)*E;R=Math.ceil(((X%360)-22.5)/45);if(R<1){R+=8}while(R--){I.push(I.shift())}}for(T=0;T<P.length;T++){if(I[T]===K){U=P[T];break}}return{top:U.y+c.scrollTop,left:U.x+c.scrollLeft}}this.compute=G}function x(Q){var P=new j(),O=k("#"+Q.popupId);if(O.length===0){O=k("<div/>",{id:Q.popupId});if(w.length===0){w=k("body")}w.append(O)}if(Q.followMouse){if(!O.data(u)){A.on("mousemove",M);s.on("scroll",M);O.data(u,true)}}if(Q.mouseOnToPopup){O.on({mouseenter:function L(){if(O.data(f)){if(c.activeHover){c.activeHover.data(n).cancel()}}},mouseleave:function N(){if(c.activeHover){c.activeHover.data(n).hide()}}})}function I(S){S.data(e,true);O.queue(function R(T){H(S);T()})}function H(S){var U;if(!S.data(e)){return}if(c.isTipOpen){if(!c.isClosing){K(c.activeHover)}O.delay(100).queue(function R(V){H(S);V()});return}S.trigger("powerTipPreRender");U=B(S);if(U){O.empty().append(U)}else{return}S.trigger("powerTipRender");c.activeHover=S;c.isTipOpen=true;O.data(f,Q.mouseOnToPopup);if(!Q.followMouse){G(S);c.isFixedTipOpen=true}else{M()}O.fadeIn(Q.fadeInTime,function T(){if(!c.desyncTimeout){c.desyncTimeout=setInterval(J,500)}S.trigger("powerTipOpen")})}function K(R){c.isClosing=true;c.activeHover=null;c.isTipOpen=false;c.desyncTimeout=clearInterval(c.desyncTimeout);R.data(e,false);R.data(d,false);O.fadeOut(Q.fadeOutTime,function S(){var T=new b();c.isClosing=false;c.isFixedTipOpen=false;O.removeClass();T.set("top",c.currentY+Q.offset);T.set("left",c.currentX+Q.offset);O.css(T);R.trigger("powerTipClose")})}function M(){if(!c.isFixedTipOpen&&(c.isTipOpen||(c.tipOpenImminent&&O.data(u)))){var R=O.outerWidth(),V=O.outerHeight(),U=new b(),S,T;U.set("top",c.currentY+Q.offset);U.set("left",c.currentX+Q.offset);S=m(U,R,V);if(S!==p.none){T=a(S);if(T===1){if(S===p.right){U.set("left",c.windowWidth-R)}else{if(S===p.bottom){U.set("top",c.scrollTop+c.windowHeight-V)}}}else{U.set("left",c.currentX-R-Q.offset);U.set("top",c.currentY-V-Q.offset)}}O.css(U)}}function G(S){var R,T;if(Q.smartPlacement){R=k.fn.powerTip.smartPlacementLists[Q.placement];k.each(R,function(U,W){var V=m(F(S,W),O.outerWidth(),O.outerHeight());T=W;if(V===p.none){return false}})}else{F(S,Q.placement);T=Q.placement}O.addClass(T)}function F(U,T){var R=0,S,W,V=new b();V.set("top",0);V.set("left",0);O.css(V);do{S=O.outerWidth();W=O.outerHeight();V=P.compute(U,T,S,W,Q.offset);O.css(V)}while(++R<=5&&(S!==O.outerWidth()||W!==O.outerHeight()));return V}function J(){var R=false;if(c.isTipOpen&&!c.isClosing&&!c.delayInProgress){if(c.activeHover.data(e)===false||c.activeHover.is(":disabled")){R=true}else{if(!v(c.activeHover)&&!c.activeHover.is(":focus")&&!c.activeHover.data(d)){if(O.data(f)){if(!v(O)){R=true}}else{R=true}}}if(R){K(c.activeHover)}}}this.showTip=I;this.hideTip=K;this.resetPosition=G}function q(F){return window.SVGElement&&F[0] instanceof SVGElement}function h(){if(!c.mouseTrackingActive){c.mouseTrackingActive=true;k(function H(){c.scrollLeft=s.scrollLeft();c.scrollTop=s.scrollTop();c.windowWidth=s.width();c.windowHeight=s.height()});A.on("mousemove",i);s.on({resize:function G(){c.windowWidth=s.width();c.windowHeight=s.height()},scroll:function F(){var I=s.scrollLeft(),J=s.scrollTop();if(I!==c.scrollLeft){c.currentX+=I-c.scrollLeft;c.scrollLeft=I}if(J!==c.scrollTop){c.currentY+=J-c.scrollTop;c.scrollTop=J}}})}}function i(F){c.currentX=F.pageX;c.currentY=F.pageY}function v(F){var H=F.offset(),J=F[0].getBoundingClientRect(),I=J.right-J.left,G=J.bottom-J.top;return c.currentX>=H.left&&c.currentX<=H.left+I&&c.currentY>=H.top&&c.currentY<=H.top+G}function B(I){var G=I.data(y),F=I.data(o),K=I.data(l),H,J;if(G){if(k.isFunction(G)){G=G.call(I[0])}J=G}else{if(F){if(k.isFunction(F)){F=F.call(I[0])}if(F.length>0){J=F.clone(true,true)}}else{if(K){H=k("#"+K);if(H.length>0){J=H.html()}}}}return J}function m(M,L,K){var G=c.scrollTop,J=c.scrollLeft,I=G+c.windowHeight,F=J+c.windowWidth,H=p.none;if(M.top<G||Math.abs(M.bottom-c.windowHeight)-K<G){H|=p.top}if(M.top+K>I||Math.abs(M.bottom-c.windowHeight)>I){H|=p.bottom}if(M.left<J||M.right+L>F){H|=p.left}if(M.left+L>F||M.right<J){H|=p.right}return H}function a(G){var F=0;while(G){G&=G-1;F++}return F}}));/*! - * jQuery UI Touch Punch 0.2.3 - * - * Copyright 2011–2014, Dave Furfero - * Dual licensed under the MIT or GPL Version 2 licenses. - * - * Depends: - * jquery.ui.widget.js - * jquery.ui.mouse.js - */ -(function(b){b.support.touch="ontouchend" in document;if(!b.support.touch){return}var d=b.ui.mouse.prototype,f=d._mouseInit,c=d._mouseDestroy,a;function e(h,i){if(h.originalEvent.touches.length>1){return}h.preventDefault();var j=h.originalEvent.changedTouches[0],g=document.createEvent("MouseEvents");g.initMouseEvent(i,true,true,window,1,j.screenX,j.screenY,j.clientX,j.clientY,false,false,false,false,0,null);h.target.dispatchEvent(g)}d._touchStart=function(h){var g=this;if(a||!g._mouseCapture(h.originalEvent.changedTouches[0])){return}a=true;g._touchMoved=false;e(h,"mouseover");e(h,"mousemove");e(h,"mousedown")};d._touchMove=function(g){if(!a){return}this._touchMoved=true;e(g,"mousemove")};d._touchEnd=function(g){if(!a){return}e(g,"mouseup");e(g,"mouseout");if(!this._touchMoved){e(g,"click")}a=false};d._mouseInit=function(){var g=this;g.element.bind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});f.call(g)};d._mouseDestroy=function(){var g=this;g.element.unbind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});c.call(g)}})(jQuery);/*! - * SmartMenus jQuery Plugin - v1.0.0 - January 27, 2016 - * http://www.smartmenus.org/ - * - * Copyright Vasil Dinkov, Vadikom Web Ltd. - * http://vadikom.com - * - * Licensed MIT - */ -(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{if(typeof module==="object"&&typeof module.exports==="object"){module.exports=a(require("jquery"))}else{a(jQuery)}}}(function(a){var b=[],e=!!window.createPopup,f=false,d="ontouchstart" in window,h=false,g=window.requestAnimationFrame||function(l){return setTimeout(l,1000/60)},c=window.cancelAnimationFrame||function(l){clearTimeout(l)};function k(m){var n=".smartmenus_mouse";if(!h&&!m){var o=true,l=null;a(document).bind(i([["mousemove",function(s){var t={x:s.pageX,y:s.pageY,timeStamp:new Date().getTime()};if(l){var q=Math.abs(l.x-t.x),p=Math.abs(l.y-t.y);if((q>0||p>0)&&q<=2&&p<=2&&t.timeStamp-l.timeStamp<=300){f=true;if(o){var r=a(s.target).closest("a");if(r.is("a")){a.each(b,function(){if(a.contains(this.$root[0],r[0])){this.itemEnter({currentTarget:r[0]});return false}})}o=false}}}l=t}],[d?"touchstart":"pointerover pointermove pointerout MSPointerOver MSPointerMove MSPointerOut",function(p){if(j(p.originalEvent)){f=false}}]],n));h=true}else{if(h&&m){a(document).unbind(n);h=false}}}function j(l){return !/^(4|mouse)$/.test(l.pointerType)}function i(l,n){if(!n){n=""}var m={};a.each(l,function(o,p){m[p[0].split(" ").join(n+" ")+n]=p[1]});return m}a.SmartMenus=function(m,l){this.$root=a(m);this.opts=l;this.rootId="";this.accessIdPrefix="";this.$subArrow=null;this.activatedItems=[];this.visibleSubMenus=[];this.showTimeout=0;this.hideTimeout=0;this.scrollTimeout=0;this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.idInc=0;this.$firstLink=null;this.$firstSub=null;this.disabled=false;this.$disableOverlay=null;this.$touchScrollingSub=null;this.cssTransforms3d="perspective" in m.style||"webkitPerspective" in m.style;this.wasCollapsible=false;this.init()};a.extend(a.SmartMenus,{hideAll:function(){a.each(b,function(){this.menuHideAll()})},destroy:function(){while(b.length){b[0].destroy()}k(true)},prototype:{init:function(n){var l=this;if(!n){b.push(this);this.rootId=(new Date().getTime()+Math.random()+"").replace(/\D/g,"");this.accessIdPrefix="sm-"+this.rootId+"-";if(this.$root.hasClass("sm-rtl")){this.opts.rightToLeftSubMenus=true}var r=".smartmenus";this.$root.data("smartmenus",this).attr("data-smartmenus-id",this.rootId).dataSM("level",1).bind(i([["mouseover focusin",a.proxy(this.rootOver,this)],["mouseout focusout",a.proxy(this.rootOut,this)],["keydown",a.proxy(this.rootKeyDown,this)]],r)).delegate("a",i([["mouseenter",a.proxy(this.itemEnter,this)],["mouseleave",a.proxy(this.itemLeave,this)],["mousedown",a.proxy(this.itemDown,this)],["focus",a.proxy(this.itemFocus,this)],["blur",a.proxy(this.itemBlur,this)],["click",a.proxy(this.itemClick,this)]],r));r+=this.rootId;if(this.opts.hideOnClick){a(document).bind(i([["touchstart",a.proxy(this.docTouchStart,this)],["touchmove",a.proxy(this.docTouchMove,this)],["touchend",a.proxy(this.docTouchEnd,this)],["click",a.proxy(this.docClick,this)]],r))}a(window).bind(i([["resize orientationchange",a.proxy(this.winResize,this)]],r));if(this.opts.subIndicators){this.$subArrow=a("<span/>").addClass("sub-arrow");if(this.opts.subIndicatorsText){this.$subArrow.html(this.opts.subIndicatorsText)}}k()}this.$firstSub=this.$root.find("ul").each(function(){l.menuInit(a(this))}).eq(0);this.$firstLink=this.$root.find("a").eq(0);if(this.opts.markCurrentItem){var p=/(index|default)\.[^#\?\/]*/i,m=/#.*/,q=window.location.href.replace(p,""),o=q.replace(m,"");this.$root.find("a").each(function(){var s=this.href.replace(p,""),t=a(this);if(s==q||s==o){t.addClass("current");if(l.opts.markCurrentTree){t.parentsUntil("[data-smartmenus-id]","ul").each(function(){a(this).dataSM("parent-a").addClass("current")})}}})}this.wasCollapsible=this.isCollapsible()},destroy:function(m){if(!m){var n=".smartmenus";this.$root.removeData("smartmenus").removeAttr("data-smartmenus-id").removeDataSM("level").unbind(n).undelegate(n);n+=this.rootId;a(document).unbind(n);a(window).unbind(n);if(this.opts.subIndicators){this.$subArrow=null}}this.menuHideAll();var l=this;this.$root.find("ul").each(function(){var o=a(this);if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}if(o.dataSM("shown-before")){if(l.opts.subMenusMinWidth||l.opts.subMenusMaxWidth){o.css({width:"",minWidth:"",maxWidth:""}).removeClass("sm-nowrap")}if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}o.css({zIndex:"",top:"",left:"",marginLeft:"",marginTop:"",display:""})}if((o.attr("id")||"").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeDataSM("in-mega").removeDataSM("shown-before").removeDataSM("ie-shim").removeDataSM("scroll-arrows").removeDataSM("parent-a").removeDataSM("level").removeDataSM("beforefirstshowfired").removeAttr("role").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeAttr("aria-expanded");this.$root.find("a.has-submenu").each(function(){var o=a(this);if(o.attr("id").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeClass("has-submenu").removeDataSM("sub").removeAttr("aria-haspopup").removeAttr("aria-controls").removeAttr("aria-expanded").closest("li").removeDataSM("sub");if(this.opts.subIndicators){this.$root.find("span.sub-arrow").remove()}if(this.opts.markCurrentItem){this.$root.find("a.current").removeClass("current")}if(!m){this.$root=null;this.$firstLink=null;this.$firstSub=null;if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}b.splice(a.inArray(this,b),1)}},disable:function(l){if(!this.disabled){this.menuHideAll();if(!l&&!this.opts.isPopup&&this.$root.is(":visible")){var m=this.$root.offset();this.$disableOverlay=a('<div class="sm-jquery-disable-overlay"/>').css({position:"absolute",top:m.top,left:m.left,width:this.$root.outerWidth(),height:this.$root.outerHeight(),zIndex:this.getStartZIndex(true),opacity:0}).appendTo(document.body)}this.disabled=true}},docClick:function(l){if(this.$touchScrollingSub){this.$touchScrollingSub=null;return}if(this.visibleSubMenus.length&&!a.contains(this.$root[0],l.target)||a(l.target).is("a")){this.menuHideAll()}},docTouchEnd:function(m){if(!this.lastTouch){return}if(this.visibleSubMenus.length&&(this.lastTouch.x2===undefined||this.lastTouch.x1==this.lastTouch.x2)&&(this.lastTouch.y2===undefined||this.lastTouch.y1==this.lastTouch.y2)&&(!this.lastTouch.target||!a.contains(this.$root[0],this.lastTouch.target))){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},350)}this.lastTouch=null},docTouchMove:function(m){if(!this.lastTouch){return}var l=m.originalEvent.touches[0];this.lastTouch.x2=l.pageX;this.lastTouch.y2=l.pageY},docTouchStart:function(m){var l=m.originalEvent.touches[0];this.lastTouch={x1:l.pageX,y1:l.pageY,target:l.target}},enable:function(){if(this.disabled){if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}this.disabled=false}},getClosestMenu:function(m){var l=a(m).closest("ul");while(l.dataSM("in-mega")){l=l.parent().closest("ul")}return l[0]||null},getHeight:function(l){return this.getOffset(l,true)},getOffset:function(n,l){var m;if(n.css("display")=="none"){m={position:n[0].style.position,visibility:n[0].style.visibility};n.css({position:"absolute",visibility:"hidden"}).show()}var o=n[0].getBoundingClientRect&&n[0].getBoundingClientRect(),p=o&&(l?o.height||o.bottom-o.top:o.width||o.right-o.left);if(!p&&p!==0){p=l?n[0].offsetHeight:n[0].offsetWidth}if(m){n.hide().css(m)}return p},getStartZIndex:function(l){var m=parseInt(this[l?"$root":"$firstSub"].css("z-index"));if(!l&&isNaN(m)){m=parseInt(this.$root.css("z-index"))}return !isNaN(m)?m:1},getTouchPoint:function(l){return l.touches&&l.touches[0]||l.changedTouches&&l.changedTouches[0]||l},getViewport:function(l){var m=l?"Height":"Width",o=document.documentElement["client"+m],n=window["inner"+m];if(n){o=Math.min(o,n)}return o},getViewportHeight:function(){return this.getViewport(true)},getViewportWidth:function(){return this.getViewport()},getWidth:function(l){return this.getOffset(l)},handleEvents:function(){return !this.disabled&&this.isCSSOn()},handleItemEvents:function(l){return this.handleEvents()&&!this.isLinkInMegaMenu(l)},isCollapsible:function(){return this.$firstSub.css("position")=="static"},isCSSOn:function(){return this.$firstLink.css("display")=="block"},isFixed:function(){var l=this.$root.css("position")=="fixed";if(!l){this.$root.parentsUntil("body").each(function(){if(a(this).css("position")=="fixed"){l=true;return false}})}return l},isLinkInMegaMenu:function(l){return a(this.getClosestMenu(l[0])).hasClass("mega-menu")},isTouchMode:function(){return !f||this.opts.noMouseOver||this.isCollapsible()},itemActivate:function(p,l){var n=p.closest("ul"),q=n.dataSM("level");if(q>1&&(!this.activatedItems[q-2]||this.activatedItems[q-2][0]!=n.dataSM("parent-a")[0])){var m=this;a(n.parentsUntil("[data-smartmenus-id]","ul").get().reverse()).add(n).each(function(){m.itemActivate(a(this).dataSM("parent-a"))})}if(!this.isCollapsible()||l){this.menuHideSubMenus(!this.activatedItems[q-1]||this.activatedItems[q-1][0]!=p[0]?q-1:q)}this.activatedItems[q-1]=p;if(this.$root.triggerHandler("activate.smapi",p[0])===false){return}var o=p.dataSM("sub");if(o&&(this.isTouchMode()||(!this.opts.showOnClick||this.clickActivated))){this.menuShow(o)}},itemBlur:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}this.$root.triggerHandler("blur.smapi",l[0])},itemClick:function(o){var n=a(o.currentTarget);if(!this.handleItemEvents(n)){return}if(this.$touchScrollingSub&&this.$touchScrollingSub[0]==n.closest("ul")[0]){this.$touchScrollingSub=null;o.stopPropagation();return false}if(this.$root.triggerHandler("click.smapi",n[0])===false){return false}var p=a(o.target).is("span.sub-arrow"),m=n.dataSM("sub"),l=m?m.dataSM("level")==2:false;if(m&&!m.is(":visible")){if(this.opts.showOnClick&&l){this.clickActivated=true}this.itemActivate(n);if(m.is(":visible")){this.focusActivated=true;return false}}else{if(this.isCollapsible()&&p){this.itemActivate(n);this.menuHide(m);return false}}if(this.opts.showOnClick&&l||n.hasClass("disabled")||this.$root.triggerHandler("select.smapi",n[0])===false){return false}},itemDown:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}l.dataSM("mousedown",true)},itemEnter:function(n){var m=a(n.currentTarget);if(!this.handleItemEvents(m)){return}if(!this.isTouchMode()){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var l=this;this.showTimeout=setTimeout(function(){l.itemActivate(m)},this.opts.showOnClick&&m.closest("ul").dataSM("level")==1?1:this.opts.showTimeout)}this.$root.triggerHandler("mouseenter.smapi",m[0])},itemFocus:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(this.focusActivated&&(!this.isTouchMode()||!l.dataSM("mousedown"))&&(!this.activatedItems.length||this.activatedItems[this.activatedItems.length-1][0]!=l[0])){this.itemActivate(l,true)}this.$root.triggerHandler("focus.smapi",l[0])},itemLeave:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(!this.isTouchMode()){l[0].blur();if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}}l.removeDataSM("mousedown");this.$root.triggerHandler("mouseleave.smapi",l[0])},menuHide:function(m){if(this.$root.triggerHandler("beforehide.smapi",m[0])===false){return}m.stop(true,true);if(m.css("display")!="none"){var l=function(){m.css("z-index","")};if(this.isCollapsible()){if(this.opts.collapsibleHideFunction){this.opts.collapsibleHideFunction.call(this,m,l)}else{m.hide(this.opts.collapsibleHideDuration,l)}}else{if(this.opts.hideFunction){this.opts.hideFunction.call(this,m,l)}else{m.hide(this.opts.hideDuration,l)}}if(m.dataSM("ie-shim")){m.dataSM("ie-shim").remove().css({"-webkit-transform":"",transform:""})}if(m.dataSM("scroll")){this.menuScrollStop(m);m.css({"touch-action":"","-ms-touch-action":"","-webkit-transform":"",transform:""}).unbind(".smartmenus_scroll").removeDataSM("scroll").dataSM("scroll-arrows").hide()}m.dataSM("parent-a").removeClass("highlighted").attr("aria-expanded","false");m.attr({"aria-expanded":"false","aria-hidden":"true"});var n=m.dataSM("level");this.activatedItems.splice(n-1,1);this.visibleSubMenus.splice(a.inArray(m,this.visibleSubMenus),1);this.$root.triggerHandler("hide.smapi",m[0])}},menuHideAll:function(){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var m=this.opts.isPopup?1:0;for(var l=this.visibleSubMenus.length-1;l>=m;l--){this.menuHide(this.visibleSubMenus[l])}if(this.opts.isPopup){this.$root.stop(true,true);if(this.$root.is(":visible")){if(this.opts.hideFunction){this.opts.hideFunction.call(this,this.$root)}else{this.$root.hide(this.opts.hideDuration)}if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").remove()}}}this.activatedItems=[];this.visibleSubMenus=[];this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.$root.triggerHandler("hideAll.smapi")},menuHideSubMenus:function(n){for(var l=this.activatedItems.length-1;l>=n;l--){var m=this.activatedItems[l].dataSM("sub");if(m){this.menuHide(m)}}},menuIframeShim:function(l){if(e&&this.opts.overlapControlsInIE&&!l.dataSM("ie-shim")){l.dataSM("ie-shim",a("<iframe/>").attr({src:"javascript:0",tabindex:-9}).css({position:"absolute",top:"auto",left:"0",opacity:0,border:"0"}))}},menuInit:function(l){if(!l.dataSM("in-mega")){if(l.hasClass("mega-menu")){l.find("ul").dataSM("in-mega",true)}var q=2,m=l[0];while((m=m.parentNode.parentNode)!=this.$root[0]){q++}var n=l.prevAll("a").eq(-1);if(!n.length){n=l.prevAll().find("a").eq(-1)}n.addClass("has-submenu").dataSM("sub",l);l.dataSM("parent-a",n).dataSM("level",q).parent().dataSM("sub",l);var o=n.attr("id")||this.accessIdPrefix+(++this.idInc),p=l.attr("id")||this.accessIdPrefix+(++this.idInc);n.attr({id:o,"aria-haspopup":"true","aria-controls":p,"aria-expanded":"false"});l.attr({id:p,role:"group","aria-hidden":"true","aria-labelledby":o,"aria-expanded":"false"});if(this.opts.subIndicators){n[this.opts.subIndicatorsPos](this.$subArrow.clone())}}},menuPosition:function(K){var r=K.dataSM("parent-a"),D=r.closest("li"),E=D.parent(),l=K.dataSM("level"),t=this.getWidth(K),J=this.getHeight(K),u=r.offset(),o=u.left,m=u.top,q=this.getWidth(r),F=this.getHeight(r),H=a(window),v=H.scrollLeft(),s=H.scrollTop(),z=this.getViewportWidth(),L=this.getViewportHeight(),w=E.parent().is("[data-sm-horizontal-sub]")||l==2&&!E.hasClass("sm-vertical"),B=this.opts.rightToLeftSubMenus&&!D.is("[data-sm-reverse]")||!this.opts.rightToLeftSubMenus&&D.is("[data-sm-reverse]"),p=l==2?this.opts.mainMenuSubOffsetX:this.opts.subMenusSubOffsetX,n=l==2?this.opts.mainMenuSubOffsetY:this.opts.subMenusSubOffsetY,C,A;if(w){C=B?q-t-p:p;A=this.opts.bottomToTopSubMenus?-J-n:F+n}else{C=B?p-t:q-p;A=this.opts.bottomToTopSubMenus?F-n-J:n}if(this.opts.keepInViewport){var N=o+C,M=m+A;if(B&&N<v){C=w?v-N+C:q-p}else{if(!B&&N+t>v+z){C=w?v+z-t-N+C:p-t}}if(!w){if(J<L&&M+J>s+L){A+=s+L-J-M}else{if(J>=L||M<s){A+=s-M}}}if(w&&(M+J>s+L+0.49||M<s)||!w&&J>L+0.49){var G=this;if(!K.dataSM("scroll-arrows")){K.dataSM("scroll-arrows",a([a('<span class="scroll-up"><span class="scroll-up-arrow"></span></span>')[0],a('<span class="scroll-down"><span class="scroll-down-arrow"></span></span>')[0]]).bind({mouseenter:function(){K.dataSM("scroll").up=a(this).hasClass("scroll-up");G.menuScroll(K)},mouseleave:function(x){G.menuScrollStop(K);G.menuScrollOut(K,x)},"mousewheel DOMMouseScroll":function(x){x.preventDefault()}}).insertAfter(K))}var I=".smartmenus_scroll";K.dataSM("scroll",{y:this.cssTransforms3d?0:A-F,step:1,itemH:F,subH:J,arrowDownH:this.getHeight(K.dataSM("scroll-arrows").eq(1))}).bind(i([["mouseover",function(x){G.menuScrollOver(K,x)}],["mouseout",function(x){G.menuScrollOut(K,x)}],["mousewheel DOMMouseScroll",function(x){G.menuScrollMousewheel(K,x)}]],I)).dataSM("scroll-arrows").css({top:"auto",left:"0",marginLeft:C+(parseInt(K.css("border-left-width"))||0),width:t-(parseInt(K.css("border-left-width"))||0)-(parseInt(K.css("border-right-width"))||0),zIndex:K.css("z-index")}).eq(w&&this.opts.bottomToTopSubMenus?0:1).show();if(this.isFixed()){K.css({"touch-action":"none","-ms-touch-action":"none"}).bind(i([[d?"touchstart touchmove touchend":"pointerdown pointermove pointerup MSPointerDown MSPointerMove MSPointerUp",function(x){G.menuScrollTouch(K,x)}]],I))}}}K.css({top:"auto",left:"0",marginLeft:C,marginTop:A-F});this.menuIframeShim(K);if(K.dataSM("ie-shim")){K.dataSM("ie-shim").css({zIndex:K.css("z-index"),width:t,height:J,marginLeft:C,marginTop:A-F})}},menuScroll:function(r,m,n){var p=r.dataSM("scroll"),q=r.dataSM("scroll-arrows"),o=p.up?p.upEnd:p.downEnd,s;if(!m&&p.momentum){p.momentum*=0.92;s=p.momentum;if(s<0.5){this.menuScrollStop(r);return}}else{s=n||(m||!this.opts.scrollAccelerate?this.opts.scrollStep:Math.floor(p.step))}var l=r.dataSM("level");if(this.activatedItems[l-1]&&this.activatedItems[l-1].dataSM("sub")&&this.activatedItems[l-1].dataSM("sub").is(":visible")){this.menuHideSubMenus(l-1)}p.y=p.up&&o<=p.y||!p.up&&o>=p.y?p.y:(Math.abs(o-p.y)>s?p.y+(p.up?s:-s):o);r.add(r.dataSM("ie-shim")).css(this.cssTransforms3d?{"-webkit-transform":"translate3d(0, "+p.y+"px, 0)",transform:"translate3d(0, "+p.y+"px, 0)"}:{marginTop:p.y});if(f&&(p.up&&p.y>p.downEnd||!p.up&&p.y<p.upEnd)){q.eq(p.up?1:0).show()}if(p.y==o){if(f){q.eq(p.up?0:1).hide()}this.menuScrollStop(r)}else{if(!m){if(this.opts.scrollAccelerate&&p.step<this.opts.scrollStep){p.step+=0.2}var t=this;this.scrollTimeout=g(function(){t.menuScroll(r)})}}},menuScrollMousewheel:function(m,n){if(this.getClosestMenu(n.target)==m[0]){n=n.originalEvent;var l=(n.wheelDelta||-n.detail)>0;if(m.dataSM("scroll-arrows").eq(l?0:1).is(":visible")){m.dataSM("scroll").up=l;this.menuScroll(m,true)}}n.preventDefault()},menuScrollOut:function(l,m){if(f){if(!/^scroll-(up|down)/.test((m.relatedTarget||"").className)&&(l[0]!=m.relatedTarget&&!a.contains(l[0],m.relatedTarget)||this.getClosestMenu(m.relatedTarget)!=l[0])){l.dataSM("scroll-arrows").css("visibility","hidden")}}},menuScrollOver:function(n,o){if(f){if(!/^scroll-(up|down)/.test(o.target.className)&&this.getClosestMenu(o.target)==n[0]){this.menuScrollRefreshData(n);var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;n.dataSM("scroll-arrows").eq(0).css("margin-top",l).end().eq(1).css("margin-top",l+this.getViewportHeight()-m.arrowDownH).end().css("visibility","visible")}}},menuScrollRefreshData:function(n){var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;if(this.cssTransforms3d){l=-(parseFloat(n.css("margin-top"))-l)}a.extend(m,{upEnd:l,downEnd:l+this.getViewportHeight()-m.subH})},menuScrollStop:function(l){if(this.scrollTimeout){c(this.scrollTimeout);this.scrollTimeout=0;l.dataSM("scroll").step=1;return true}},menuScrollTouch:function(p,q){q=q.originalEvent;if(j(q)){var m=this.getTouchPoint(q);if(this.getClosestMenu(m.target)==p[0]){var o=p.dataSM("scroll");if(/(start|down)$/i.test(q.type)){if(this.menuScrollStop(p)){q.preventDefault();this.$touchScrollingSub=p}else{this.$touchScrollingSub=null}this.menuScrollRefreshData(p);a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}else{if(/move$/i.test(q.type)){var n=o.touchY!==undefined?o.touchY:o.touchStartY;if(n!==undefined&&n!=m.pageY){this.$touchScrollingSub=p;var l=n<m.pageY;if(o.up!==undefined&&o.up!=l){a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}a.extend(o,{up:l,touchY:m.pageY});this.menuScroll(p,true,Math.abs(m.pageY-n))}q.preventDefault()}else{if(o.touchY!==undefined){if(o.momentum=Math.pow(Math.abs(m.pageY-o.touchStartY)/(q.timeStamp-o.touchStartTime),2)*15){this.menuScrollStop(p);this.menuScroll(p);q.preventDefault()}delete o.touchY}}}}}},menuShow:function(n){if(!n.dataSM("beforefirstshowfired")){n.dataSM("beforefirstshowfired",true);if(this.$root.triggerHandler("beforefirstshow.smapi",n[0])===false){return}}if(this.$root.triggerHandler("beforeshow.smapi",n[0])===false){return}n.dataSM("shown-before",true).stop(true,true);if(!n.is(":visible")){var m=n.dataSM("parent-a");if(this.opts.keepHighlighted||this.isCollapsible()){m.addClass("highlighted")}if(this.isCollapsible()){n.removeClass("sm-nowrap").css({zIndex:"",width:"auto",minWidth:"",maxWidth:"",top:"",left:"",marginLeft:"",marginTop:""})}else{n.css("z-index",this.zIndexInc=(this.zIndexInc||this.getStartZIndex())+1);if(this.opts.subMenusMinWidth||this.opts.subMenusMaxWidth){n.css({width:"auto",minWidth:"",maxWidth:""}).addClass("sm-nowrap");if(this.opts.subMenusMinWidth){n.css("min-width",this.opts.subMenusMinWidth)}if(this.opts.subMenusMaxWidth){var o=this.getWidth(n);n.css("max-width",this.opts.subMenusMaxWidth);if(o>this.getWidth(n)){n.removeClass("sm-nowrap").css("width",this.opts.subMenusMaxWidth)}}}this.menuPosition(n);if(n.dataSM("ie-shim")){n.dataSM("ie-shim").insertBefore(n)}}var l=function(){n.css("overflow","")};if(this.isCollapsible()){if(this.opts.collapsibleShowFunction){this.opts.collapsibleShowFunction.call(this,n,l)}else{n.show(this.opts.collapsibleShowDuration,l)}}else{if(this.opts.showFunction){this.opts.showFunction.call(this,n,l)}else{n.show(this.opts.showDuration,l)}}m.attr("aria-expanded","true");n.attr({"aria-expanded":"true","aria-hidden":"false"});this.visibleSubMenus.push(n);this.$root.triggerHandler("show.smapi",n[0])}},popupHide:function(l){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var m=this;this.hideTimeout=setTimeout(function(){m.menuHideAll()},l?1:this.opts.hideTimeout)},popupShow:function(o,n){if(!this.opts.isPopup){alert('SmartMenus jQuery Error:\n\nIf you want to show this menu via the "popupShow" method, set the isPopup:true option.');return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}this.$root.dataSM("shown-before",true).stop(true,true);if(!this.$root.is(":visible")){this.$root.css({left:o,top:n});this.menuIframeShim(this.$root);if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").css({zIndex:this.$root.css("z-index"),width:this.getWidth(this.$root),height:this.getHeight(this.$root),left:o,top:n}).insertBefore(this.$root)}var m=this,l=function(){m.$root.css("overflow","")};if(this.opts.showFunction){this.opts.showFunction.call(this,this.$root,l)}else{this.$root.show(this.opts.showDuration,l)}this.visibleSubMenus[0]=this.$root}},refresh:function(){this.destroy(true);this.init(true)},rootKeyDown:function(o){if(!this.handleEvents()){return}switch(o.keyCode){case 27:var m=this.activatedItems[0];if(m){this.menuHideAll();m[0].focus();var n=m.dataSM("sub");if(n){this.menuHide(n)}}break;case 32:var l=a(o.target);if(l.is("a")&&this.handleItemEvents(l)){var n=l.dataSM("sub");if(n&&!n.is(":visible")){this.itemClick({currentTarget:o.target});o.preventDefault()}}break}},rootOut:function(m){if(!this.handleEvents()||this.isTouchMode()||m.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}if(!this.opts.showOnClick||!this.opts.hideOnClick){var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},this.opts.hideTimeout)}},rootOver:function(l){if(!this.handleEvents()||this.isTouchMode()||l.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}},winResize:function(m){if(!this.handleEvents()){if(this.$disableOverlay){var n=this.$root.offset();this.$disableOverlay.css({top:n.top,left:n.left,width:this.$root.outerWidth(),height:this.$root.outerHeight()})}return}if(!("onorientationchange" in window)||m.type=="orientationchange"){var l=this.isCollapsible();if(!(this.wasCollapsible&&l)){if(this.activatedItems.length){this.activatedItems[this.activatedItems.length-1][0].blur()}this.menuHideAll()}this.wasCollapsible=l}}}});a.fn.dataSM=function(l,m){if(m){return this.data(l+"_smartmenus",m)}return this.data(l+"_smartmenus")};a.fn.removeDataSM=function(l){return this.removeData(l+"_smartmenus")};a.fn.smartmenus=function(m){if(typeof m=="string"){var l=arguments,o=m;Array.prototype.shift.call(l);return this.each(function(){var p=a(this).data("smartmenus");if(p&&p[o]){p[o].apply(p,l)}})}var n=a.extend({},a.fn.smartmenus.defaults,m);return this.each(function(){new a.SmartMenus(this,n)})};a.fn.smartmenus.defaults={isPopup:false,mainMenuSubOffsetX:0,mainMenuSubOffsetY:0,subMenusSubOffsetX:0,subMenusSubOffsetY:0,subMenusMinWidth:"10em",subMenusMaxWidth:"20em",subIndicators:true,subIndicatorsPos:"prepend",subIndicatorsText:"+",scrollStep:30,scrollAccelerate:true,showTimeout:250,hideTimeout:500,showDuration:0,showFunction:null,hideDuration:0,hideFunction:function(m,l){m.fadeOut(200,l)},collapsibleShowDuration:0,collapsibleShowFunction:function(m,l){m.slideDown(200,l)},collapsibleHideDuration:0,collapsibleHideFunction:function(m,l){m.slideUp(200,l)},showOnClick:false,hideOnClick:true,noMouseOver:false,keepInViewport:true,keepHighlighted:true,markCurrentItem:false,markCurrentTree:true,rightToLeftSubMenus:false,bottomToTopSubMenus:false,overlapControlsInIE:true};return a})); \ No newline at end of file diff --git a/docs/html/main_8cpp.html b/docs/html/main_8cpp.html deleted file mode 100644 index 314d19a7492911e08e8f94bdd8d3e3ea2bcc8c1b..0000000000000000000000000000000000000000 --- a/docs/html/main_8cpp.html +++ /dev/null @@ -1,92 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta http-equiv="X-UA-Compatible" content="IE=9"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<meta name="viewport" content="width=device-width, initial-scale=1"/> -<title>My Project: main.cpp File Reference</title> -<link href="tabs.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="jquery.js"></script> -<script type="text/javascript" src="dynsections.js"></script> -<link href="search/search.css" rel="stylesheet" type="text/css"/> -<script type="text/javascript" src="search/searchdata.js"></script> -<script type="text/javascript" src="search/search.js"></script> -<link href="doxygen.css" rel="stylesheet" type="text/css" /> -</head> -<body> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> -<div id="titlearea"> -<table cellspacing="0" cellpadding="0"> - <tbody> - <tr style="height: 56px;"> - <td id="projectalign" style="padding-left: 0.5em;"> - <div id="projectname">My Project - </div> - </td> - </tr> - </tbody> -</table> -</div> -<!-- end header part --> -<!-- Generated by Doxygen 1.8.15 --> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -var searchBox = new SearchBox("searchBox", "search",false,'Search'); -/* @license-end */ -</script> -<script type="text/javascript" src="menudata.js"></script> -<script type="text/javascript" src="menu.js"></script> -<script type="text/javascript"> -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -$(function() { - initMenu('',true,false,'search.php','Search'); - $(document).ready(function() { init_search(); }); -}); -/* @license-end */</script> -<div id="main-nav"></div> -<!-- window showing the filter options --> -<div id="MSearchSelectWindow" - onmouseover="return searchBox.OnSearchSelectShow()" - onmouseout="return searchBox.OnSearchSelectHide()" - onkeydown="return searchBox.OnSearchSelectKey(event)"> -</div> - -<!-- iframe showing the search results (closed by default) --> -<div id="MSearchResultsWindow"> -<iframe src="javascript:void(0)" frameborder="0" - name="MSearchResults" id="MSearchResults"> -</iframe> -</div> - -</div><!-- top --> -<div class="header"> - <div class="summary"> -<a href="#func-members">Functions</a> </div> - <div class="headertitle"> -<div class="title">main.cpp File Reference</div> </div> -</div><!--header--> -<div class="contents"> - -<p>A file that contains the main functions, which starts all the algorithm. -<a href="#details">More...</a></p> -<div class="textblock"><code>#include "<a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a>"</code><br /> -</div><table class="memberdecls"> -<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="func-members"></a> -Functions</h2></td></tr> -<tr class="memitem:ae66f6b31b5ad750f1fe042a706a4e3d4"><td class="memItemLeft" align="right" valign="top"><a id="ae66f6b31b5ad750f1fe042a706a4e3d4"></a> -int </td><td class="memItemRight" valign="bottom"><b>main</b> ()</td></tr> -<tr class="separator:ae66f6b31b5ad750f1fe042a706a4e3d4"><td class="memSeparator" colspan="2"> </td></tr> -</table> -<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> -<div class="textblock"><p>A file that contains the main functions, which starts all the algorithm. </p> -<p>One functions: main. </p> -</div></div><!-- contents --> -<!-- start footer part --> -<hr class="footer"/><address class="footer"><small> -Generated by  <a href="http://www.doxygen.org/index.html"> -<img class="footer" src="doxygen.png" alt="doxygen"/> -</a> 1.8.15 -</small></address> -</body> -</html> diff --git a/docs/html/menu.js b/docs/html/menu.js deleted file mode 100644 index 433c15b8f01814eb5f5ee0e9bba623e07fc04cb2..0000000000000000000000000000000000000000 --- a/docs/html/menu.js +++ /dev/null @@ -1,50 +0,0 @@ -/* - @licstart The following is the entire license notice for the - JavaScript code in this file. - - Copyright (C) 1997-2017 by Dimitri van Heesch - - This program is free software; you can redistribute it and/or modify - it under the terms of the GNU General Public License as published by - the Free Software Foundation; either version 2 of the License, or - (at your option) any later version. - - This program is distributed in the hope that it will be useful, - but WITHOUT ANY WARRANTY; without even the implied warranty of - MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - GNU General Public License for more details. - - You should have received a copy of the GNU General Public License along - with this program; if not, write to the Free Software Foundation, Inc., - 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. - - @licend The above is the entire license notice - for the JavaScript code in this file - */ -function initMenu(relPath,searchEnabled,serverSide,searchPage,search) { - function makeTree(data,relPath) { - var result=''; - if ('children' in data) { - result+='<ul>'; - for (var i in data.children) { - result+='<li><a href="'+relPath+data.children[i].url+'">'+ - data.children[i].text+'</a>'+ - makeTree(data.children[i],relPath)+'</li>'; - } - result+='</ul>'; - } - return result; - } - - $('#main-nav').append(makeTree(menudata,relPath)); - $('#main-nav').children(':first').addClass('sm sm-dox').attr('id','main-menu'); - if (searchEnabled) { - if (serverSide) { - $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><div class="left"><form id="FSearchBox" action="'+relPath+searchPage+'" method="get"><img id="MSearchSelect" src="'+relPath+'search/mag.png" alt=""/><input type="text" id="MSearchField" name="query" value="'+search+'" size="20" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)"></form></div><div class="right"></div></div></li>'); - } else { - $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><span class="left"><img id="MSearchSelect" src="'+relPath+'search/mag_sel.png" onmouseover="return searchBox.OnSearchSelectShow()" onmouseout="return searchBox.OnSearchSelectHide()" alt=""/><input type="text" id="MSearchField" value="'+search+'" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)" onkeyup="searchBox.OnSearchFieldChange(event)"/></span><span class="right"><a id="MSearchClose" href="javascript:searchBox.CloseResultsWindow()"><img id="MSearchCloseImg" border="0" src="'+relPath+'search/close.png" alt=""/></a></span></div></li>'); - } - } - $('#main-menu').smartmenus(); -} -/* @license-end */ diff --git a/docs/html/menudata.js b/docs/html/menudata.js deleted file mode 100644 index e3035505b5eae494ebca183d65bf94c53a588be9..0000000000000000000000000000000000000000 --- a/docs/html/menudata.js +++ /dev/null @@ -1,34 +0,0 @@ -/* -@ @licstart The following is the entire license notice for the -JavaScript code in this file. - -Copyright (C) 1997-2017 by Dimitri van Heesch - -This program is free software; you can redistribute it and/or modify -it under the terms of the GNU General Public License as published by -the Free Software Foundation; either version 2 of the License, or -(at your option) any later version. - -This program is distributed in the hope that it will be useful, -but WITHOUT ANY WARRANTY; without even the implied warranty of - MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - GNU General Public License for more details. - -You should have received a copy of the GNU General Public License along -with this program; if not, write to the Free Software Foundation, Inc., -51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. - -@licend The above is the entire license notice -for the JavaScript code in this file -*/ -var menudata={children:[ -{text:"Main Page",url:"index.html"}, -{text:"Classes",url:"annotated.html",children:[ -{text:"Class List",url:"annotated.html"}, -{text:"Class Index",url:"classes.html"}, -{text:"Class Members",url:"functions.html",children:[ -{text:"All",url:"functions.html"}, -{text:"Functions",url:"functions_func.html"}, -{text:"Variables",url:"functions_vars.html"}]}]}, -{text:"Files",url:"files.html",children:[ -{text:"File List",url:"files.html"}]}]} diff --git a/docs/html/nav_f.png b/docs/html/nav_f.png deleted file mode 100644 index 72a58a529ed3a9ed6aa0c51a79cf207e026deee2..0000000000000000000000000000000000000000 Binary files a/docs/html/nav_f.png and /dev/null differ diff --git a/docs/html/nav_g.png b/docs/html/nav_g.png deleted file mode 100644 index 2093a237a94f6c83e19ec6e5fd42f7ddabdafa81..0000000000000000000000000000000000000000 Binary files a/docs/html/nav_g.png and /dev/null differ diff --git a/docs/html/nav_h.png b/docs/html/nav_h.png deleted file mode 100644 index 33389b101d9cd9b4c98ad286b5d9c46a6671f650..0000000000000000000000000000000000000000 Binary files a/docs/html/nav_h.png and /dev/null differ diff --git a/docs/html/open.png b/docs/html/open.png deleted file mode 100644 index 30f75c7efe2dd0c9e956e35b69777a02751f048b..0000000000000000000000000000000000000000 Binary files a/docs/html/open.png and /dev/null differ diff --git a/docs/html/search/all_0.html b/docs/html/search/all_0.html deleted file mode 100644 index 5330204c2c9385c1ecc09d4c617d84e63ac1f58f..0000000000000000000000000000000000000000 --- a/docs/html/search/all_0.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="all_0.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/all_0.js b/docs/html/search/all_0.js deleted file mode 100644 index b55324c9cbe1e2342e47f7490bed9d4eccc58986..0000000000000000000000000000000000000000 --- a/docs/html/search/all_0.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['addletter',['AddLetter',['../class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db',1,'FactorOracle']]] -]; diff --git a/docs/html/search/all_1.html b/docs/html/search/all_1.html deleted file mode 100644 index 2f46793669134fa7b331c6fb238987472e869d1e..0000000000000000000000000000000000000000 --- a/docs/html/search/all_1.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="all_1.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/all_1.js b/docs/html/search/all_1.js deleted file mode 100644 index 1feb27c9d44c7b39b6bb6a3ea0b4001084493128..0000000000000000000000000000000000000000 --- a/docs/html/search/all_1.js +++ /dev/null @@ -1,10 +0,0 @@ -var searchData= -[ - ['factororacle',['FactorOracle',['../class_factor_oracle.html',1,'']]], - ['factororacle_2ecpp',['FactorOracle.cpp',['../_factor_oracle_8cpp.html',1,'']]], - ['factororacle_2eh',['FactorOracle.h',['../_factor_oracle_8h.html',1,'']]], - ['factororaclestart',['FactorOracleStart',['../class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f',1,'FactorOracle']]], - ['findbetter',['FindBetter',['../class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50',1,'FactorOracle']]], - ['first_5fstate_5f',['first_state_',['../class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6',1,'SingleTransition']]], - ['fogenerate',['FOGenerate',['../class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390',1,'FactorOracle']]] -]; diff --git a/docs/html/search/all_2.html b/docs/html/search/all_2.html deleted file mode 100644 index 4c33d85574a614977e50b78fb110145282e259e8..0000000000000000000000000000000000000000 --- a/docs/html/search/all_2.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="all_2.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/all_2.js b/docs/html/search/all_2.js deleted file mode 100644 index 3a78109e25e392b82de81e6da93bd0efe2973a07..0000000000000000000000000000000000000000 --- a/docs/html/search/all_2.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['last_5fstate_5f',['last_state_',['../class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69',1,'SingleTransition']]] -]; diff --git a/docs/html/search/all_3.html b/docs/html/search/all_3.html deleted file mode 100644 index b634070bc727268b5df07cf78569fe35f3afbd26..0000000000000000000000000000000000000000 --- a/docs/html/search/all_3.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="all_3.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/all_3.js b/docs/html/search/all_3.js deleted file mode 100644 index c93faff152cf0159d702f29fde2f99ca41c02710..0000000000000000000000000000000000000000 --- a/docs/html/search/all_3.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['main_2ecpp',['main.cpp',['../main_8cpp.html',1,'']]] -]; diff --git a/docs/html/search/all_4.html b/docs/html/search/all_4.html deleted file mode 100644 index dd062aeaeed1812cf81a1b380ce312fcfa4913ec..0000000000000000000000000000000000000000 --- a/docs/html/search/all_4.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="all_4.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/all_4.js b/docs/html/search/all_4.js deleted file mode 100644 index fdcca205c57f624298a67b3898fdec9ded2d50e9..0000000000000000000000000000000000000000 --- a/docs/html/search/all_4.js +++ /dev/null @@ -1,8 +0,0 @@ -var searchData= -[ - ['singletransition',['SingleTransition',['../class_single_transition.html',1,'']]], - ['state',['State',['../class_state.html',1,'']]], - ['state_5f',['state_',['../class_state.html#a2dcf672a1560830a8f93b0e9863c6724',1,'State']]], - ['states_5f',['states_',['../class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d',1,'FactorOracle']]], - ['symbol_5f',['symbol_',['../class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9',1,'SingleTransition']]] -]; diff --git a/docs/html/search/all_5.html b/docs/html/search/all_5.html deleted file mode 100644 index f0780fdd34885b6ac6853d8d1ff64541586d26ab..0000000000000000000000000000000000000000 --- a/docs/html/search/all_5.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="all_5.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/all_5.js b/docs/html/search/all_5.js deleted file mode 100644 index c20449e777ef00666cfaa350916cfb47c9add63d..0000000000000000000000000000000000000000 --- a/docs/html/search/all_5.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['transition_5f',['transition_',['../class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8',1,'State']]] -]; diff --git a/docs/html/search/classes_0.html b/docs/html/search/classes_0.html deleted file mode 100644 index b3c6ec6af3ec1e40d80c36e9f7d50dd88d134bb4..0000000000000000000000000000000000000000 --- a/docs/html/search/classes_0.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="classes_0.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/classes_0.js b/docs/html/search/classes_0.js deleted file mode 100644 index acf44460e45d0510e56719aae4c701e4b5031c26..0000000000000000000000000000000000000000 --- a/docs/html/search/classes_0.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['factororacle',['FactorOracle',['../class_factor_oracle.html',1,'']]] -]; diff --git a/docs/html/search/classes_1.html b/docs/html/search/classes_1.html deleted file mode 100644 index b744c4d15f69fa15e3f1511126c32d9a81f83332..0000000000000000000000000000000000000000 --- a/docs/html/search/classes_1.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="classes_1.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/classes_1.js b/docs/html/search/classes_1.js deleted file mode 100644 index 2638cbf0fdfd1148c504e0754027d740901d2c3b..0000000000000000000000000000000000000000 --- a/docs/html/search/classes_1.js +++ /dev/null @@ -1,5 +0,0 @@ -var searchData= -[ - ['singletransition',['SingleTransition',['../class_single_transition.html',1,'']]], - ['state',['State',['../class_state.html',1,'']]] -]; diff --git a/docs/html/search/close.png b/docs/html/search/close.png deleted file mode 100644 index 9342d3dfeea7b7c4ee610987e717804b5a42ceb9..0000000000000000000000000000000000000000 Binary files a/docs/html/search/close.png and /dev/null differ diff --git a/docs/html/search/files_0.html b/docs/html/search/files_0.html deleted file mode 100644 index 40cd4554390821f622e682e89088a9114a4b22dc..0000000000000000000000000000000000000000 --- a/docs/html/search/files_0.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="files_0.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/files_0.js b/docs/html/search/files_0.js deleted file mode 100644 index c5991db20cac5ecc546fc950ee95074c3a1e66d9..0000000000000000000000000000000000000000 --- a/docs/html/search/files_0.js +++ /dev/null @@ -1,5 +0,0 @@ -var searchData= -[ - ['factororacle_2ecpp',['FactorOracle.cpp',['../_factor_oracle_8cpp.html',1,'']]], - ['factororacle_2eh',['FactorOracle.h',['../_factor_oracle_8h.html',1,'']]] -]; diff --git a/docs/html/search/files_1.html b/docs/html/search/files_1.html deleted file mode 100644 index 646d1f4cc552e09bc89f57073aa189ea1b7bc75b..0000000000000000000000000000000000000000 --- a/docs/html/search/files_1.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="files_1.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/files_1.js b/docs/html/search/files_1.js deleted file mode 100644 index c93faff152cf0159d702f29fde2f99ca41c02710..0000000000000000000000000000000000000000 --- a/docs/html/search/files_1.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['main_2ecpp',['main.cpp',['../main_8cpp.html',1,'']]] -]; diff --git a/docs/html/search/functions_0.html b/docs/html/search/functions_0.html deleted file mode 100644 index bc73761f526691046ebe143ee37064bd3c9937f4..0000000000000000000000000000000000000000 --- a/docs/html/search/functions_0.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="functions_0.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/functions_0.js b/docs/html/search/functions_0.js deleted file mode 100644 index b55324c9cbe1e2342e47f7490bed9d4eccc58986..0000000000000000000000000000000000000000 --- a/docs/html/search/functions_0.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['addletter',['AddLetter',['../class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db',1,'FactorOracle']]] -]; diff --git a/docs/html/search/functions_1.html b/docs/html/search/functions_1.html deleted file mode 100644 index bfcf880be9e64711e057e7a7b5b4aa4532eea22f..0000000000000000000000000000000000000000 --- a/docs/html/search/functions_1.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="functions_1.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/functions_1.js b/docs/html/search/functions_1.js deleted file mode 100644 index 85622473a791caa5f1dd59fb172fbba9d3a956c5..0000000000000000000000000000000000000000 --- a/docs/html/search/functions_1.js +++ /dev/null @@ -1,6 +0,0 @@ -var searchData= -[ - ['factororaclestart',['FactorOracleStart',['../class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f',1,'FactorOracle']]], - ['findbetter',['FindBetter',['../class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50',1,'FactorOracle']]], - ['fogenerate',['FOGenerate',['../class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390',1,'FactorOracle']]] -]; diff --git a/docs/html/search/mag_sel.png b/docs/html/search/mag_sel.png deleted file mode 100644 index 39c0ed52a25dd9d080ee0d42ae6c6042bdfa04d7..0000000000000000000000000000000000000000 Binary files a/docs/html/search/mag_sel.png and /dev/null differ diff --git a/docs/html/search/nomatches.html b/docs/html/search/nomatches.html deleted file mode 100644 index 4377320895b9a5b98e140ebf2f76ec09158d1156..0000000000000000000000000000000000000000 --- a/docs/html/search/nomatches.html +++ /dev/null @@ -1,12 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="NoMatches">No Matches</div> -</div> -</body> -</html> diff --git a/docs/html/search/search.css b/docs/html/search/search.css deleted file mode 100644 index 3cf9df94a419c3175edbf2ca1719a2deb7a497dd..0000000000000000000000000000000000000000 --- a/docs/html/search/search.css +++ /dev/null @@ -1,271 +0,0 @@ -/*---------------- Search Box */ - -#FSearchBox { - float: left; -} - -#MSearchBox { - white-space : nowrap; - float: none; - margin-top: 8px; - right: 0px; - width: 170px; - height: 24px; - z-index: 102; -} - -#MSearchBox .left -{ - display:block; - position:absolute; - left:10px; - width:20px; - height:19px; - background:url('search_l.png') no-repeat; - background-position:right; -} - -#MSearchSelect { - display:block; - position:absolute; - width:20px; - height:19px; -} - -.left #MSearchSelect { - left:4px; -} - -.right #MSearchSelect { - right:5px; -} - -#MSearchField { - display:block; - position:absolute; - height:19px; - background:url('search_m.png') repeat-x; - border:none; - width:115px; - margin-left:20px; - padding-left:4px; - color: #909090; - outline: none; - font: 9pt Arial, Verdana, sans-serif; - -webkit-border-radius: 0px; -} - -#FSearchBox #MSearchField { - margin-left:15px; -} - -#MSearchBox .right { - display:block; - position:absolute; - right:10px; - top:8px; - width:20px; - height:19px; - background:url('search_r.png') no-repeat; - background-position:left; -} - -#MSearchClose { - display: none; - position: absolute; - top: 4px; - background : none; - border: none; - margin: 0px 4px 0px 0px; - padding: 0px 0px; - outline: none; -} - -.left #MSearchClose { - left: 6px; -} - -.right #MSearchClose { - right: 2px; -} - -.MSearchBoxActive #MSearchField { - color: #000000; -} - -/*---------------- Search filter selection */ - -#MSearchSelectWindow { - display: none; - position: absolute; - left: 0; top: 0; - border: 1px solid #90A5CE; - background-color: #F9FAFC; - z-index: 10001; - padding-top: 4px; - padding-bottom: 4px; - -moz-border-radius: 4px; - -webkit-border-top-left-radius: 4px; - -webkit-border-top-right-radius: 4px; - -webkit-border-bottom-left-radius: 4px; - -webkit-border-bottom-right-radius: 4px; - -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); -} - -.SelectItem { - font: 8pt Arial, Verdana, sans-serif; - padding-left: 2px; - padding-right: 12px; - border: 0px; -} - -span.SelectionMark { - margin-right: 4px; - font-family: monospace; - outline-style: none; - text-decoration: none; -} - -a.SelectItem { - display: block; - outline-style: none; - color: #000000; - text-decoration: none; - padding-left: 6px; - padding-right: 12px; -} - -a.SelectItem:focus, -a.SelectItem:active { - color: #000000; - outline-style: none; - text-decoration: none; -} - -a.SelectItem:hover { - color: #FFFFFF; - background-color: #3D578C; - outline-style: none; - text-decoration: none; - cursor: pointer; - display: block; -} - -/*---------------- Search results window */ - -iframe#MSearchResults { - width: 60ex; - height: 15em; -} - -#MSearchResultsWindow { - display: none; - position: absolute; - left: 0; top: 0; - border: 1px solid #000; - background-color: #EEF1F7; - z-index:10000; -} - -/* ----------------------------------- */ - - -#SRIndex { - clear:both; - padding-bottom: 15px; -} - -.SREntry { - font-size: 10pt; - padding-left: 1ex; -} - -.SRPage .SREntry { - font-size: 8pt; - padding: 1px 5px; -} - -body.SRPage { - margin: 5px 2px; -} - -.SRChildren { - padding-left: 3ex; padding-bottom: .5em -} - -.SRPage .SRChildren { - display: none; -} - -.SRSymbol { - font-weight: bold; - color: #425E97; - font-family: Arial, Verdana, sans-serif; - text-decoration: none; - outline: none; -} - -a.SRScope { - display: block; - color: #425E97; - font-family: Arial, Verdana, sans-serif; - text-decoration: none; - outline: none; -} - -a.SRSymbol:focus, a.SRSymbol:active, -a.SRScope:focus, a.SRScope:active { - text-decoration: underline; -} - -span.SRScope { - padding-left: 4px; -} - -.SRPage .SRStatus { - padding: 2px 5px; - font-size: 8pt; - font-style: italic; -} - -.SRResult { - display: none; -} - -DIV.searchresults { - margin-left: 10px; - margin-right: 10px; -} - -/*---------------- External search page results */ - -.searchresult { - background-color: #F0F3F8; -} - -.pages b { - color: white; - padding: 5px 5px 3px 5px; - background-image: url("../tab_a.png"); - background-repeat: repeat-x; - text-shadow: 0 1px 1px #000000; -} - -.pages { - line-height: 17px; - margin-left: 4px; - text-decoration: none; -} - -.hl { - font-weight: bold; -} - -#searchresults { - margin-bottom: 20px; -} - -.searchpages { - margin-top: 10px; -} - diff --git a/docs/html/search/search.js b/docs/html/search/search.js deleted file mode 100644 index a554ab9cb5265ccf73adf8a7d278827ff8b2fbdd..0000000000000000000000000000000000000000 --- a/docs/html/search/search.js +++ /dev/null @@ -1,814 +0,0 @@ -/* - @licstart The following is the entire license notice for the - JavaScript code in this file. - - Copyright (C) 1997-2017 by Dimitri van Heesch - - This program is free software; you can redistribute it and/or modify - it under the terms of the GNU General Public License as published by - the Free Software Foundation; either version 2 of the License, or - (at your option) any later version. - - This program is distributed in the hope that it will be useful, - but WITHOUT ANY WARRANTY; without even the implied warranty of - MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - GNU General Public License for more details. - - You should have received a copy of the GNU General Public License along - with this program; if not, write to the Free Software Foundation, Inc., - 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. - - @licend The above is the entire license notice - for the JavaScript code in this file - */ -function convertToId(search) -{ - var result = ''; - for (i=0;i<search.length;i++) - { - var c = search.charAt(i); - var cn = c.charCodeAt(0); - if (c.match(/[a-z0-9\u0080-\uFFFF]/)) - { - result+=c; - } - else if (cn<16) - { - result+="_0"+cn.toString(16); - } - else - { - result+="_"+cn.toString(16); - } - } - return result; -} - -function getXPos(item) -{ - var x = 0; - if (item.offsetWidth) - { - while (item && item!=document.body) - { - x += item.offsetLeft; - item = item.offsetParent; - } - } - return x; -} - -function getYPos(item) -{ - var y = 0; - if (item.offsetWidth) - { - while (item && item!=document.body) - { - y += item.offsetTop; - item = item.offsetParent; - } - } - return y; -} - -/* A class handling everything associated with the search panel. - - Parameters: - name - The name of the global variable that will be - storing this instance. Is needed to be able to set timeouts. - resultPath - path to use for external files -*/ -function SearchBox(name, resultsPath, inFrame, label) -{ - if (!name || !resultsPath) { alert("Missing parameters to SearchBox."); } - - // ---------- Instance variables - this.name = name; - this.resultsPath = resultsPath; - this.keyTimeout = 0; - this.keyTimeoutLength = 500; - this.closeSelectionTimeout = 300; - this.lastSearchValue = ""; - this.lastResultsPage = ""; - this.hideTimeout = 0; - this.searchIndex = 0; - this.searchActive = false; - this.insideFrame = inFrame; - this.searchLabel = label; - - // ----------- DOM Elements - - this.DOMSearchField = function() - { return document.getElementById("MSearchField"); } - - this.DOMSearchSelect = function() - { return document.getElementById("MSearchSelect"); } - - this.DOMSearchSelectWindow = function() - { return document.getElementById("MSearchSelectWindow"); } - - this.DOMPopupSearchResults = function() - { return document.getElementById("MSearchResults"); } - - this.DOMPopupSearchResultsWindow = function() - { return document.getElementById("MSearchResultsWindow"); } - - this.DOMSearchClose = function() - { return document.getElementById("MSearchClose"); } - - this.DOMSearchBox = function() - { return document.getElementById("MSearchBox"); } - - // ------------ Event Handlers - - // Called when focus is added or removed from the search field. - this.OnSearchFieldFocus = function(isActive) - { - this.Activate(isActive); - } - - this.OnSearchSelectShow = function() - { - var searchSelectWindow = this.DOMSearchSelectWindow(); - var searchField = this.DOMSearchSelect(); - - if (this.insideFrame) - { - var left = getXPos(searchField); - var top = getYPos(searchField); - left += searchField.offsetWidth + 6; - top += searchField.offsetHeight; - - // show search selection popup - searchSelectWindow.style.display='block'; - left -= searchSelectWindow.offsetWidth; - searchSelectWindow.style.left = left + 'px'; - searchSelectWindow.style.top = top + 'px'; - } - else - { - var left = getXPos(searchField); - var top = getYPos(searchField); - top += searchField.offsetHeight; - - // show search selection popup - searchSelectWindow.style.display='block'; - searchSelectWindow.style.left = left + 'px'; - searchSelectWindow.style.top = top + 'px'; - } - - // stop selection hide timer - if (this.hideTimeout) - { - clearTimeout(this.hideTimeout); - this.hideTimeout=0; - } - return false; // to avoid "image drag" default event - } - - this.OnSearchSelectHide = function() - { - this.hideTimeout = setTimeout(this.name +".CloseSelectionWindow()", - this.closeSelectionTimeout); - } - - // Called when the content of the search field is changed. - this.OnSearchFieldChange = function(evt) - { - if (this.keyTimeout) // kill running timer - { - clearTimeout(this.keyTimeout); - this.keyTimeout = 0; - } - - var e = (evt) ? evt : window.event; // for IE - if (e.keyCode==40 || e.keyCode==13) - { - if (e.shiftKey==1) - { - this.OnSearchSelectShow(); - var win=this.DOMSearchSelectWindow(); - for (i=0;i<win.childNodes.length;i++) - { - var child = win.childNodes[i]; // get span within a - if (child.className=='SelectItem') - { - child.focus(); - return; - } - } - return; - } - else if (window.frames.MSearchResults.searchResults) - { - var elem = window.frames.MSearchResults.searchResults.NavNext(0); - if (elem) elem.focus(); - } - } - else if (e.keyCode==27) // Escape out of the search field - { - this.DOMSearchField().blur(); - this.DOMPopupSearchResultsWindow().style.display = 'none'; - this.DOMSearchClose().style.display = 'none'; - this.lastSearchValue = ''; - this.Activate(false); - return; - } - - // strip whitespaces - var searchValue = this.DOMSearchField().value.replace(/ +/g, ""); - - if (searchValue != this.lastSearchValue) // search value has changed - { - if (searchValue != "") // non-empty search - { - // set timer for search update - this.keyTimeout = setTimeout(this.name + '.Search()', - this.keyTimeoutLength); - } - else // empty search field - { - this.DOMPopupSearchResultsWindow().style.display = 'none'; - this.DOMSearchClose().style.display = 'none'; - this.lastSearchValue = ''; - } - } - } - - this.SelectItemCount = function(id) - { - var count=0; - var win=this.DOMSearchSelectWindow(); - for (i=0;i<win.childNodes.length;i++) - { - var child = win.childNodes[i]; // get span within a - if (child.className=='SelectItem') - { - count++; - } - } - return count; - } - - this.SelectItemSet = function(id) - { - var i,j=0; - var win=this.DOMSearchSelectWindow(); - for (i=0;i<win.childNodes.length;i++) - { - var child = win.childNodes[i]; // get span within a - if (child.className=='SelectItem') - { - var node = child.firstChild; - if (j==id) - { - node.innerHTML='•'; - } - else - { - node.innerHTML=' '; - } - j++; - } - } - } - - // Called when an search filter selection is made. - // set item with index id as the active item - this.OnSelectItem = function(id) - { - this.searchIndex = id; - this.SelectItemSet(id); - var searchValue = this.DOMSearchField().value.replace(/ +/g, ""); - if (searchValue!="" && this.searchActive) // something was found -> do a search - { - this.Search(); - } - } - - this.OnSearchSelectKey = function(evt) - { - var e = (evt) ? evt : window.event; // for IE - if (e.keyCode==40 && this.searchIndex<this.SelectItemCount()) // Down - { - this.searchIndex++; - this.OnSelectItem(this.searchIndex); - } - else if (e.keyCode==38 && this.searchIndex>0) // Up - { - this.searchIndex--; - this.OnSelectItem(this.searchIndex); - } - else if (e.keyCode==13 || e.keyCode==27) - { - this.OnSelectItem(this.searchIndex); - this.CloseSelectionWindow(); - this.DOMSearchField().focus(); - } - return false; - } - - // --------- Actions - - // Closes the results window. - this.CloseResultsWindow = function() - { - this.DOMPopupSearchResultsWindow().style.display = 'none'; - this.DOMSearchClose().style.display = 'none'; - this.Activate(false); - } - - this.CloseSelectionWindow = function() - { - this.DOMSearchSelectWindow().style.display = 'none'; - } - - // Performs a search. - this.Search = function() - { - this.keyTimeout = 0; - - // strip leading whitespace - var searchValue = this.DOMSearchField().value.replace(/^ +/, ""); - - var code = searchValue.toLowerCase().charCodeAt(0); - var idxChar = searchValue.substr(0, 1).toLowerCase(); - if ( 0xD800 <= code && code <= 0xDBFF && searchValue > 1) // surrogate pair - { - idxChar = searchValue.substr(0, 2); - } - - var resultsPage; - var resultsPageWithSearch; - var hasResultsPage; - - var idx = indexSectionsWithContent[this.searchIndex].indexOf(idxChar); - if (idx!=-1) - { - var hexCode=idx.toString(16); - resultsPage = this.resultsPath + '/' + indexSectionNames[this.searchIndex] + '_' + hexCode + '.html'; - resultsPageWithSearch = resultsPage+'?'+escape(searchValue); - hasResultsPage = true; - } - else // nothing available for this search term - { - resultsPage = this.resultsPath + '/nomatches.html'; - resultsPageWithSearch = resultsPage; - hasResultsPage = false; - } - - window.frames.MSearchResults.location = resultsPageWithSearch; - var domPopupSearchResultsWindow = this.DOMPopupSearchResultsWindow(); - - if (domPopupSearchResultsWindow.style.display!='block') - { - var domSearchBox = this.DOMSearchBox(); - this.DOMSearchClose().style.display = 'inline'; - if (this.insideFrame) - { - var domPopupSearchResults = this.DOMPopupSearchResults(); - domPopupSearchResultsWindow.style.position = 'relative'; - domPopupSearchResultsWindow.style.display = 'block'; - var width = document.body.clientWidth - 8; // the -8 is for IE :-( - domPopupSearchResultsWindow.style.width = width + 'px'; - domPopupSearchResults.style.width = width + 'px'; - } - else - { - var domPopupSearchResults = this.DOMPopupSearchResults(); - var left = getXPos(domSearchBox) + 150; // domSearchBox.offsetWidth; - var top = getYPos(domSearchBox) + 20; // domSearchBox.offsetHeight + 1; - domPopupSearchResultsWindow.style.display = 'block'; - left -= domPopupSearchResults.offsetWidth; - domPopupSearchResultsWindow.style.top = top + 'px'; - domPopupSearchResultsWindow.style.left = left + 'px'; - } - } - - this.lastSearchValue = searchValue; - this.lastResultsPage = resultsPage; - } - - // -------- Activation Functions - - // Activates or deactivates the search panel, resetting things to - // their default values if necessary. - this.Activate = function(isActive) - { - if (isActive || // open it - this.DOMPopupSearchResultsWindow().style.display == 'block' - ) - { - this.DOMSearchBox().className = 'MSearchBoxActive'; - - var searchField = this.DOMSearchField(); - - if (searchField.value == this.searchLabel) // clear "Search" term upon entry - { - searchField.value = ''; - this.searchActive = true; - } - } - else if (!isActive) // directly remove the panel - { - this.DOMSearchBox().className = 'MSearchBoxInactive'; - this.DOMSearchField().value = this.searchLabel; - this.searchActive = false; - this.lastSearchValue = '' - this.lastResultsPage = ''; - } - } -} - -// ----------------------------------------------------------------------- - -// The class that handles everything on the search results page. -function SearchResults(name) -{ - // The number of matches from the last run of <Search()>. - this.lastMatchCount = 0; - this.lastKey = 0; - this.repeatOn = false; - - // Toggles the visibility of the passed element ID. - this.FindChildElement = function(id) - { - var parentElement = document.getElementById(id); - var element = parentElement.firstChild; - - while (element && element!=parentElement) - { - if (element.nodeName == 'DIV' && element.className == 'SRChildren') - { - return element; - } - - if (element.nodeName == 'DIV' && element.hasChildNodes()) - { - element = element.firstChild; - } - else if (element.nextSibling) - { - element = element.nextSibling; - } - else - { - do - { - element = element.parentNode; - } - while (element && element!=parentElement && !element.nextSibling); - - if (element && element!=parentElement) - { - element = element.nextSibling; - } - } - } - } - - this.Toggle = function(id) - { - var element = this.FindChildElement(id); - if (element) - { - if (element.style.display == 'block') - { - element.style.display = 'none'; - } - else - { - element.style.display = 'block'; - } - } - } - - // Searches for the passed string. If there is no parameter, - // it takes it from the URL query. - // - // Always returns true, since other documents may try to call it - // and that may or may not be possible. - this.Search = function(search) - { - if (!search) // get search word from URL - { - search = window.location.search; - search = search.substring(1); // Remove the leading '?' - search = unescape(search); - } - - search = search.replace(/^ +/, ""); // strip leading spaces - search = search.replace(/ +$/, ""); // strip trailing spaces - search = search.toLowerCase(); - search = convertToId(search); - - var resultRows = document.getElementsByTagName("div"); - var matches = 0; - - var i = 0; - while (i < resultRows.length) - { - var row = resultRows.item(i); - if (row.className == "SRResult") - { - var rowMatchName = row.id.toLowerCase(); - rowMatchName = rowMatchName.replace(/^sr\d*_/, ''); // strip 'sr123_' - - if (search.length<=rowMatchName.length && - rowMatchName.substr(0, search.length)==search) - { - row.style.display = 'block'; - matches++; - } - else - { - row.style.display = 'none'; - } - } - i++; - } - document.getElementById("Searching").style.display='none'; - if (matches == 0) // no results - { - document.getElementById("NoMatches").style.display='block'; - } - else // at least one result - { - document.getElementById("NoMatches").style.display='none'; - } - this.lastMatchCount = matches; - return true; - } - - // return the first item with index index or higher that is visible - this.NavNext = function(index) - { - var focusItem; - while (1) - { - var focusName = 'Item'+index; - focusItem = document.getElementById(focusName); - if (focusItem && focusItem.parentNode.parentNode.style.display=='block') - { - break; - } - else if (!focusItem) // last element - { - break; - } - focusItem=null; - index++; - } - return focusItem; - } - - this.NavPrev = function(index) - { - var focusItem; - while (1) - { - var focusName = 'Item'+index; - focusItem = document.getElementById(focusName); - if (focusItem && focusItem.parentNode.parentNode.style.display=='block') - { - break; - } - else if (!focusItem) // last element - { - break; - } - focusItem=null; - index--; - } - return focusItem; - } - - this.ProcessKeys = function(e) - { - if (e.type == "keydown") - { - this.repeatOn = false; - this.lastKey = e.keyCode; - } - else if (e.type == "keypress") - { - if (!this.repeatOn) - { - if (this.lastKey) this.repeatOn = true; - return false; // ignore first keypress after keydown - } - } - else if (e.type == "keyup") - { - this.lastKey = 0; - this.repeatOn = false; - } - return this.lastKey!=0; - } - - this.Nav = function(evt,itemIndex) - { - var e = (evt) ? evt : window.event; // for IE - if (e.keyCode==13) return true; - if (!this.ProcessKeys(e)) return false; - - if (this.lastKey==38) // Up - { - var newIndex = itemIndex-1; - var focusItem = this.NavPrev(newIndex); - if (focusItem) - { - var child = this.FindChildElement(focusItem.parentNode.parentNode.id); - if (child && child.style.display == 'block') // children visible - { - var n=0; - var tmpElem; - while (1) // search for last child - { - tmpElem = document.getElementById('Item'+newIndex+'_c'+n); - if (tmpElem) - { - focusItem = tmpElem; - } - else // found it! - { - break; - } - n++; - } - } - } - if (focusItem) - { - focusItem.focus(); - } - else // return focus to search field - { - parent.document.getElementById("MSearchField").focus(); - } - } - else if (this.lastKey==40) // Down - { - var newIndex = itemIndex+1; - var focusItem; - var item = document.getElementById('Item'+itemIndex); - var elem = this.FindChildElement(item.parentNode.parentNode.id); - if (elem && elem.style.display == 'block') // children visible - { - focusItem = document.getElementById('Item'+itemIndex+'_c0'); - } - if (!focusItem) focusItem = this.NavNext(newIndex); - if (focusItem) focusItem.focus(); - } - else if (this.lastKey==39) // Right - { - var item = document.getElementById('Item'+itemIndex); - var elem = this.FindChildElement(item.parentNode.parentNode.id); - if (elem) elem.style.display = 'block'; - } - else if (this.lastKey==37) // Left - { - var item = document.getElementById('Item'+itemIndex); - var elem = this.FindChildElement(item.parentNode.parentNode.id); - if (elem) elem.style.display = 'none'; - } - else if (this.lastKey==27) // Escape - { - parent.searchBox.CloseResultsWindow(); - parent.document.getElementById("MSearchField").focus(); - } - else if (this.lastKey==13) // Enter - { - return true; - } - return false; - } - - this.NavChild = function(evt,itemIndex,childIndex) - { - var e = (evt) ? evt : window.event; // for IE - if (e.keyCode==13) return true; - if (!this.ProcessKeys(e)) return false; - - if (this.lastKey==38) // Up - { - if (childIndex>0) - { - var newIndex = childIndex-1; - document.getElementById('Item'+itemIndex+'_c'+newIndex).focus(); - } - else // already at first child, jump to parent - { - document.getElementById('Item'+itemIndex).focus(); - } - } - else if (this.lastKey==40) // Down - { - var newIndex = childIndex+1; - var elem = document.getElementById('Item'+itemIndex+'_c'+newIndex); - if (!elem) // last child, jump to parent next parent - { - elem = this.NavNext(itemIndex+1); - } - if (elem) - { - elem.focus(); - } - } - else if (this.lastKey==27) // Escape - { - parent.searchBox.CloseResultsWindow(); - parent.document.getElementById("MSearchField").focus(); - } - else if (this.lastKey==13) // Enter - { - return true; - } - return false; - } -} - -function setKeyActions(elem,action) -{ - elem.setAttribute('onkeydown',action); - elem.setAttribute('onkeypress',action); - elem.setAttribute('onkeyup',action); -} - -function setClassAttr(elem,attr) -{ - elem.setAttribute('class',attr); - elem.setAttribute('className',attr); -} - -function createResults() -{ - var results = document.getElementById("SRResults"); - for (var e=0; e<searchData.length; e++) - { - var id = searchData[e][0]; - var srResult = document.createElement('div'); - srResult.setAttribute('id','SR_'+id); - setClassAttr(srResult,'SRResult'); - var srEntry = document.createElement('div'); - setClassAttr(srEntry,'SREntry'); - var srLink = document.createElement('a'); - srLink.setAttribute('id','Item'+e); - setKeyActions(srLink,'return searchResults.Nav(event,'+e+')'); - setClassAttr(srLink,'SRSymbol'); - srLink.innerHTML = searchData[e][1][0]; - srEntry.appendChild(srLink); - if (searchData[e][1].length==2) // single result - { - srLink.setAttribute('href',searchData[e][1][1][0]); - if (searchData[e][1][1][1]) - { - srLink.setAttribute('target','_parent'); - } - var srScope = document.createElement('span'); - setClassAttr(srScope,'SRScope'); - srScope.innerHTML = searchData[e][1][1][2]; - srEntry.appendChild(srScope); - } - else // multiple results - { - srLink.setAttribute('href','javascript:searchResults.Toggle("SR_'+id+'")'); - var srChildren = document.createElement('div'); - setClassAttr(srChildren,'SRChildren'); - for (var c=0; c<searchData[e][1].length-1; c++) - { - var srChild = document.createElement('a'); - srChild.setAttribute('id','Item'+e+'_c'+c); - setKeyActions(srChild,'return searchResults.NavChild(event,'+e+','+c+')'); - setClassAttr(srChild,'SRScope'); - srChild.setAttribute('href',searchData[e][1][c+1][0]); - if (searchData[e][1][c+1][1]) - { - srChild.setAttribute('target','_parent'); - } - srChild.innerHTML = searchData[e][1][c+1][2]; - srChildren.appendChild(srChild); - } - srEntry.appendChild(srChildren); - } - srResult.appendChild(srEntry); - results.appendChild(srResult); - } -} - -function init_search() -{ - var results = document.getElementById("MSearchSelectWindow"); - for (var key in indexSectionLabels) - { - var link = document.createElement('a'); - link.setAttribute('class','SelectItem'); - link.setAttribute('onclick','searchBox.OnSelectItem('+key+')'); - link.href='javascript:void(0)'; - link.innerHTML='<span class="SelectionMark"> </span>'+indexSectionLabels[key]; - results.appendChild(link); - } - searchBox.OnSelectItem(0); -} -/* @license-end */ diff --git a/docs/html/search/search_l.png b/docs/html/search/search_l.png deleted file mode 100644 index fd5f7daa41a4c79b4ae9bea5aa7bdfb94e14084b..0000000000000000000000000000000000000000 Binary files a/docs/html/search/search_l.png and /dev/null differ diff --git a/docs/html/search/search_m.png b/docs/html/search/search_m.png deleted file mode 100644 index b429a16ba641960da1e52e5da85dc80fd82635c8..0000000000000000000000000000000000000000 Binary files a/docs/html/search/search_m.png and /dev/null differ diff --git a/docs/html/search/search_r.png b/docs/html/search/search_r.png deleted file mode 100644 index 1af5d21ee13e070d7600f1c4657fde843b953a69..0000000000000000000000000000000000000000 Binary files a/docs/html/search/search_r.png and /dev/null differ diff --git a/docs/html/search/searchdata.js b/docs/html/search/searchdata.js deleted file mode 100644 index f4268d2939bacc6379c6f9c6c1166714f70a020c..0000000000000000000000000000000000000000 --- a/docs/html/search/searchdata.js +++ /dev/null @@ -1,27 +0,0 @@ -var indexSectionsWithContent = -{ - 0: "aflmst", - 1: "fs", - 2: "fm", - 3: "af", - 4: "flst" -}; - -var indexSectionNames = -{ - 0: "all", - 1: "classes", - 2: "files", - 3: "functions", - 4: "variables" -}; - -var indexSectionLabels = -{ - 0: "All", - 1: "Classes", - 2: "Files", - 3: "Functions", - 4: "Variables" -}; - diff --git a/docs/html/search/variables_0.html b/docs/html/search/variables_0.html deleted file mode 100644 index 12104bcb5f353e0b3de82e8ca3cd030d75c61a69..0000000000000000000000000000000000000000 --- a/docs/html/search/variables_0.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="variables_0.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/variables_0.js b/docs/html/search/variables_0.js deleted file mode 100644 index 8ca34f438f64be9f54efda1eb41d9eb7392554d2..0000000000000000000000000000000000000000 --- a/docs/html/search/variables_0.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['first_5fstate_5f',['first_state_',['../class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6',1,'SingleTransition']]] -]; diff --git a/docs/html/search/variables_1.html b/docs/html/search/variables_1.html deleted file mode 100644 index b784017a1ab24592168ff054f3fdb3f075a5e1f1..0000000000000000000000000000000000000000 --- a/docs/html/search/variables_1.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="variables_1.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/variables_1.js b/docs/html/search/variables_1.js deleted file mode 100644 index 3a78109e25e392b82de81e6da93bd0efe2973a07..0000000000000000000000000000000000000000 --- a/docs/html/search/variables_1.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['last_5fstate_5f',['last_state_',['../class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69',1,'SingleTransition']]] -]; diff --git a/docs/html/search/variables_2.html b/docs/html/search/variables_2.html deleted file mode 100644 index 0cb98d30572d327010d02331478a7e4b3fab59e3..0000000000000000000000000000000000000000 --- a/docs/html/search/variables_2.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="variables_2.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/variables_2.js b/docs/html/search/variables_2.js deleted file mode 100644 index 2fc24d54cb173fddebac29af15d5d557356cbba8..0000000000000000000000000000000000000000 --- a/docs/html/search/variables_2.js +++ /dev/null @@ -1,6 +0,0 @@ -var searchData= -[ - ['state_5f',['state_',['../class_state.html#a2dcf672a1560830a8f93b0e9863c6724',1,'State']]], - ['states_5f',['states_',['../class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d',1,'FactorOracle']]], - ['symbol_5f',['symbol_',['../class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9',1,'SingleTransition']]] -]; diff --git a/docs/html/search/variables_3.html b/docs/html/search/variables_3.html deleted file mode 100644 index 1e83bf5a9f85974b64ef52f50bb291d1b94830a6..0000000000000000000000000000000000000000 --- a/docs/html/search/variables_3.html +++ /dev/null @@ -1,30 +0,0 @@ -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html><head><title></title> -<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> -<meta name="generator" content="Doxygen 1.8.15"/> -<link rel="stylesheet" type="text/css" href="search.css"/> -<script type="text/javascript" src="variables_3.js"></script> -<script type="text/javascript" src="search.js"></script> -</head> -<body class="SRPage"> -<div id="SRIndex"> -<div class="SRStatus" id="Loading">Loading...</div> -<div id="SRResults"></div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -createResults(); -/* @license-end */ ---></script> -<div class="SRStatus" id="Searching">Searching...</div> -<div class="SRStatus" id="NoMatches">No Matches</div> -<script type="text/javascript"><!-- -/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */ -document.getElementById("Loading").style.display="none"; -document.getElementById("NoMatches").style.display="none"; -var searchResults = new SearchResults("searchResults"); -searchResults.Search(); -/* @license-end */ ---></script> -</div> -</body> -</html> diff --git a/docs/html/search/variables_3.js b/docs/html/search/variables_3.js deleted file mode 100644 index c20449e777ef00666cfaa350916cfb47c9add63d..0000000000000000000000000000000000000000 --- a/docs/html/search/variables_3.js +++ /dev/null @@ -1,4 +0,0 @@ -var searchData= -[ - ['transition_5f',['transition_',['../class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8',1,'State']]] -]; diff --git a/docs/html/splitbar.png b/docs/html/splitbar.png deleted file mode 100644 index fe895f2c58179b471a22d8320b39a4bd7312ec8e..0000000000000000000000000000000000000000 Binary files a/docs/html/splitbar.png and /dev/null differ diff --git a/docs/html/sync_off.png b/docs/html/sync_off.png deleted file mode 100644 index 3b443fc62892114406e3d399421b2a881b897acc..0000000000000000000000000000000000000000 Binary files a/docs/html/sync_off.png and /dev/null differ diff --git a/docs/html/sync_on.png b/docs/html/sync_on.png deleted file mode 100644 index e08320fb64e6fa33b573005ed6d8fe294e19db76..0000000000000000000000000000000000000000 Binary files a/docs/html/sync_on.png and /dev/null differ diff --git a/docs/html/tab_a.png b/docs/html/tab_a.png deleted file mode 100644 index 3b725c41c5a527a3a3e40097077d0e206a681247..0000000000000000000000000000000000000000 Binary files a/docs/html/tab_a.png and /dev/null differ diff --git a/docs/html/tab_b.png b/docs/html/tab_b.png deleted file mode 100644 index e2b4a8638cb3496a016eaed9e16ffc12846dea18..0000000000000000000000000000000000000000 Binary files a/docs/html/tab_b.png and /dev/null differ diff --git a/docs/html/tab_h.png b/docs/html/tab_h.png deleted file mode 100644 index fd5cb705488e60fcf30f56fcc951dee74f3b095b..0000000000000000000000000000000000000000 Binary files a/docs/html/tab_h.png and /dev/null differ diff --git a/docs/html/tab_s.png b/docs/html/tab_s.png deleted file mode 100644 index ab478c95b67371d700a20869f7de1ddd73522d50..0000000000000000000000000000000000000000 Binary files a/docs/html/tab_s.png and /dev/null differ diff --git a/docs/html/tabs.css b/docs/html/tabs.css deleted file mode 100644 index 8ea7d549614948ae6fe47dd3a01a4a70b1611abc..0000000000000000000000000000000000000000 --- a/docs/html/tabs.css +++ /dev/null @@ -1 +0,0 @@ -.sm{position:relative;z-index:9999}.sm,.sm ul,.sm li{display:block;list-style:none;margin:0;padding:0;line-height:normal;direction:ltr;text-align:left;-webkit-tap-highlight-color:rgba(0,0,0,0)}.sm-rtl,.sm-rtl ul,.sm-rtl li{direction:rtl;text-align:right}.sm>li>h1,.sm>li>h2,.sm>li>h3,.sm>li>h4,.sm>li>h5,.sm>li>h6{margin:0;padding:0}.sm ul{display:none}.sm li,.sm a{position:relative}.sm a{display:block}.sm a.disabled{cursor:not-allowed}.sm:after{content:"\00a0";display:block;height:0;font:0/0 serif;clear:both;visibility:hidden;overflow:hidden}.sm,.sm *,.sm *:before,.sm *:after{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sm-dox{background-image:url("tab_b.png")}.sm-dox a,.sm-dox a:focus,.sm-dox a:hover,.sm-dox a:active{padding:0 12px;padding-right:43px;font-family:"Lucida Grande","Geneva","Helvetica",Arial,sans-serif;font-size:13px;font-weight:bold;line-height:36px;text-decoration:none;text-shadow:0 1px 1px rgba(255,255,255,0.9);color:#283a5d;outline:0}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox a.current{color:#d23600}.sm-dox a.disabled{color:#bbb}.sm-dox a span.sub-arrow{position:absolute;top:50%;margin-top:-14px;left:auto;right:3px;width:28px;height:28px;overflow:hidden;font:bold 12px/28px monospace !important;text-align:center;text-shadow:none;background:rgba(255,255,255,0.5);-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}.sm-dox a.highlighted span.sub-arrow:before{display:block;content:'-'}.sm-dox>li:first-child>a,.sm-dox>li:first-child>:not(ul) a{-moz-border-radius:5px 5px 0 0;-webkit-border-radius:5px;border-radius:5px 5px 0 0}.sm-dox>li:last-child>a,.sm-dox>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul{-moz-border-radius:0 0 5px 5px;-webkit-border-radius:0;border-radius:0 0 5px 5px}.sm-dox>li:last-child>a.highlighted,.sm-dox>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted{-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.sm-dox ul{background:rgba(162,162,162,0.1)}.sm-dox ul a,.sm-dox ul a:focus,.sm-dox ul a:hover,.sm-dox ul a:active{font-size:12px;border-left:8px solid transparent;line-height:36px;text-shadow:none;background-color:white;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox ul ul a,.sm-dox ul ul a:hover,.sm-dox ul ul a:focus,.sm-dox ul ul a:active{border-left:16px solid transparent}.sm-dox ul ul ul a,.sm-dox ul ul ul a:hover,.sm-dox ul ul ul a:focus,.sm-dox ul ul ul a:active{border-left:24px solid transparent}.sm-dox ul ul ul ul a,.sm-dox ul ul ul ul a:hover,.sm-dox ul ul ul ul a:focus,.sm-dox ul ul ul ul a:active{border-left:32px solid transparent}.sm-dox ul ul ul ul ul a,.sm-dox ul ul ul ul ul a:hover,.sm-dox ul ul ul ul ul a:focus,.sm-dox ul ul ul ul ul a:active{border-left:40px solid transparent}@media(min-width:768px){.sm-dox ul{position:absolute;width:12em}.sm-dox li{float:left}.sm-dox.sm-rtl li{float:right}.sm-dox ul li,.sm-dox.sm-rtl ul li,.sm-dox.sm-vertical li{float:none}.sm-dox a{white-space:nowrap}.sm-dox ul a,.sm-dox.sm-vertical a{white-space:normal}.sm-dox .sm-nowrap>li>a,.sm-dox .sm-nowrap>li>:not(ul) a{white-space:nowrap}.sm-dox{padding:0 10px;background-image:url("tab_b.png");line-height:36px}.sm-dox a span.sub-arrow{top:50%;margin-top:-2px;right:12px;width:0;height:0;border-width:4px;border-style:solid dashed dashed dashed;border-color:#283a5d transparent transparent transparent;background:transparent;-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.sm-dox a,.sm-dox a:focus,.sm-dox a:active,.sm-dox a:hover,.sm-dox a.highlighted{padding:0 12px;background-image:url("tab_s.png");background-repeat:no-repeat;background-position:right;-moz-border-radius:0 !important;-webkit-border-radius:0;border-radius:0 !important}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox a:hover span.sub-arrow{border-color:white transparent transparent transparent}.sm-dox a.has-submenu{padding-right:24px}.sm-dox li{border-top:0}.sm-dox>li>ul:before,.sm-dox>li>ul:after{content:'';position:absolute;top:-18px;left:30px;width:0;height:0;overflow:hidden;border-width:9px;border-style:dashed dashed solid dashed;border-color:transparent transparent #bbb transparent}.sm-dox>li>ul:after{top:-16px;left:31px;border-width:8px;border-color:transparent transparent #fff transparent}.sm-dox ul{border:1px solid #bbb;padding:5px 0;background:#fff;-moz-border-radius:5px !important;-webkit-border-radius:5px;border-radius:5px !important;-moz-box-shadow:0 5px 9px rgba(0,0,0,0.2);-webkit-box-shadow:0 5px 9px rgba(0,0,0,0.2);box-shadow:0 5px 9px rgba(0,0,0,0.2)}.sm-dox ul a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-color:transparent transparent transparent #555;border-style:dashed dashed dashed solid}.sm-dox ul a,.sm-dox ul a:hover,.sm-dox ul a:focus,.sm-dox ul a:active,.sm-dox ul a.highlighted{color:#555;background-image:none;border:0 !important;color:#555;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox ul a:hover span.sub-arrow{border-color:transparent transparent transparent white}.sm-dox span.scroll-up,.sm-dox span.scroll-down{position:absolute;display:none;visibility:hidden;overflow:hidden;background:#fff;height:36px}.sm-dox span.scroll-up:hover,.sm-dox span.scroll-down:hover{background:#eee}.sm-dox span.scroll-up:hover span.scroll-up-arrow,.sm-dox span.scroll-up:hover span.scroll-down-arrow{border-color:transparent transparent #d23600 transparent}.sm-dox span.scroll-down:hover span.scroll-down-arrow{border-color:#d23600 transparent transparent transparent}.sm-dox span.scroll-up-arrow,.sm-dox span.scroll-down-arrow{position:absolute;top:0;left:50%;margin-left:-6px;width:0;height:0;overflow:hidden;border-width:6px;border-style:dashed dashed solid dashed;border-color:transparent transparent #555 transparent}.sm-dox span.scroll-down-arrow{top:8px;border-style:solid dashed dashed dashed;border-color:#555 transparent transparent transparent}.sm-dox.sm-rtl a.has-submenu{padding-right:12px;padding-left:24px}.sm-dox.sm-rtl a span.sub-arrow{right:auto;left:12px}.sm-dox.sm-rtl.sm-vertical a.has-submenu{padding:10px 20px}.sm-dox.sm-rtl.sm-vertical a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-rtl>li>ul:before{left:auto;right:30px}.sm-dox.sm-rtl>li>ul:after{left:auto;right:31px}.sm-dox.sm-rtl ul a.has-submenu{padding:10px 20px !important}.sm-dox.sm-rtl ul a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-vertical{padding:10px 0;-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}.sm-dox.sm-vertical a{padding:10px 20px}.sm-dox.sm-vertical a:hover,.sm-dox.sm-vertical a:focus,.sm-dox.sm-vertical a:active,.sm-dox.sm-vertical a.highlighted{background:#fff}.sm-dox.sm-vertical a.disabled{background-image:url("tab_b.png")}.sm-dox.sm-vertical a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-style:dashed dashed dashed solid;border-color:transparent transparent transparent #555}.sm-dox.sm-vertical>li>ul:before,.sm-dox.sm-vertical>li>ul:after{display:none}.sm-dox.sm-vertical ul a{padding:10px 20px}.sm-dox.sm-vertical ul a:hover,.sm-dox.sm-vertical ul a:focus,.sm-dox.sm-vertical ul a:active,.sm-dox.sm-vertical ul a.highlighted{background:#eee}.sm-dox.sm-vertical ul a.disabled{background:#fff}} \ No newline at end of file diff --git a/docs/latex/_factor_oracle_8cpp.tex b/docs/latex/_factor_oracle_8cpp.tex deleted file mode 100644 index bb8445ce9b2f12d13e45165cb8b6675798c37292..0000000000000000000000000000000000000000 --- a/docs/latex/_factor_oracle_8cpp.tex +++ /dev/null @@ -1,26 +0,0 @@ -\hypertarget{_factor_oracle_8cpp}{}\section{Factor\+Oracle.\+cpp File Reference} -\label{_factor_oracle_8cpp}\index{FactorOracle.cpp@{FactorOracle.cpp}} - - -A file that contains the functions needed for the creation of a Factor Oracle. - - -{\ttfamily \#include \char`\"{}Factor\+Oracle.\+h\char`\"{}}\newline -\subsection*{Variables} -\begin{DoxyCompactItemize} -\item -\mbox{\Hypertarget{_factor_oracle_8cpp_a5eb6eb3bacab6fd40c8df6d435e06209}\label{_factor_oracle_8cpp_a5eb6eb3bacab6fd40c8df6d435e06209}} -int {\bfseries phi} -\item -\mbox{\Hypertarget{_factor_oracle_8cpp_ab66ed8e0098c0a86b458672a55a9cca9}\label{_factor_oracle_8cpp_ab66ed8e0098c0a86b458672a55a9cca9}} -int {\bfseries k} -\item -\mbox{\Hypertarget{_factor_oracle_8cpp_aa2fc876c0cc6ed51259586d7bea34f0f}\label{_factor_oracle_8cpp_aa2fc876c0cc6ed51259586d7bea34f0f}} -int {\bfseries fo\+\_\+iter} -\end{DoxyCompactItemize} - - -\subsection{Detailed Description} -A file that contains the functions needed for the creation of a Factor Oracle. - -Five main functions\+: Factor\+Oracle\+Start, Add\+Letter, Length\+Common\+Suffix, Find\+Better and F\+O\+Generate. \ No newline at end of file diff --git a/docs/latex/_factor_oracle_8h.tex b/docs/latex/_factor_oracle_8h.tex deleted file mode 100644 index 39ef3c5fb9138b6f8eb4f8e263d157b54e218157..0000000000000000000000000000000000000000 --- a/docs/latex/_factor_oracle_8h.tex +++ /dev/null @@ -1,38 +0,0 @@ -\hypertarget{_factor_oracle_8h}{}\section{Factor\+Oracle.\+h File Reference} -\label{_factor_oracle_8h}\index{FactorOracle.h@{FactorOracle.h}} - - -A file that contains the definitions of the classes needed for the creation of a Factor Oracle. - - -{\ttfamily \#include $<$iostream$>$}\newline -{\ttfamily \#include $<$new$>$}\newline -{\ttfamily \#include $<$string$>$}\newline -{\ttfamily \#include $<$vector$>$}\newline -{\ttfamily \#include $<$variant$>$}\newline -{\ttfamily \#include $<$random$>$}\newline -{\ttfamily \#include $<$algorithm$>$}\newline -\subsection*{Classes} -\begin{DoxyCompactItemize} -\item -class \mbox{\hyperlink{class_single_transition}{Single\+Transition}} -\item -class \mbox{\hyperlink{class_state}{State}} -\item -class \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} -\end{DoxyCompactItemize} -\subsection*{Macros} -\begin{DoxyCompactItemize} -\item -\mbox{\Hypertarget{_factor_oracle_8h_a5c71a5e59a53413cd6c270266d63b031}\label{_factor_oracle_8h_a5c71a5e59a53413cd6c270266d63b031}} -\#define {\bfseries R}~10 -\item -\mbox{\Hypertarget{_factor_oracle_8h_a690f251553b39fd4f31894826141b61a}\label{_factor_oracle_8h_a690f251553b39fd4f31894826141b61a}} -\#define {\bfseries R\+A\+N\+D\+\_\+\+M\+AX}~0x7fffffff -\end{DoxyCompactItemize} - - -\subsection{Detailed Description} -A file that contains the definitions of the classes needed for the creation of a Factor Oracle. - -Three main classes\+: \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}}, \mbox{\hyperlink{class_state}{State}} and \mbox{\hyperlink{class_single_transition}{Single\+Transition}}. \ No newline at end of file diff --git a/docs/latex/annotated.tex b/docs/latex/annotated.tex deleted file mode 100644 index 77167937b977e5d3dcff8dcccc36f2e9f81e21d0..0000000000000000000000000000000000000000 --- a/docs/latex/annotated.tex +++ /dev/null @@ -1,6 +0,0 @@ -\section{Class List} -Here are the classes, structs, unions and interfaces with brief descriptions\+:\begin{DoxyCompactList} -\item\contentsline{section}{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} }{\pageref{class_factor_oracle}}{} -\item\contentsline{section}{\mbox{\hyperlink{class_single_transition}{Single\+Transition}} }{\pageref{class_single_transition}}{} -\item\contentsline{section}{\mbox{\hyperlink{class_state}{State}} }{\pageref{class_state}}{} -\end{DoxyCompactList} diff --git a/docs/latex/class_factor_oracle.tex b/docs/latex/class_factor_oracle.tex deleted file mode 100644 index baae44ab0a83df72b4438c617c475c35362a09d9..0000000000000000000000000000000000000000 --- a/docs/latex/class_factor_oracle.tex +++ /dev/null @@ -1,135 +0,0 @@ -\hypertarget{class_factor_oracle}{}\section{Factor\+Oracle Class Reference} -\label{class_factor_oracle}\index{FactorOracle@{FactorOracle}} -\subsection*{Public Member Functions} -\begin{DoxyCompactItemize} -\item -void \mbox{\hyperlink{class_factor_oracle_ae10b4d001c338a73f0f44079e842e7db}{Add\+Letter}} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&States, vector$<$ vector$<$ int $>$$>$ \&T, int i, string word) -\item -\mbox{\Hypertarget{class_factor_oracle_a9511ac49e53ccf3a1907db4591e1ad0b}\label{class_factor_oracle_a9511ac49e53ccf3a1907db4591e1ad0b}} -int {\bfseries Length\+Common\+Suffix} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&States, int phi\+\_\+one, int phi\+\_\+two) -\item -int \mbox{\hyperlink{class_factor_oracle_a28d2e85676712f983b1dcba83ae07d50}{Find\+Better}} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&States, vector$<$ vector$<$ int $>$$>$ \&T, int i, char alpha, string word) -\item -string \mbox{\hyperlink{class_factor_oracle_abe8c4c194b309aeeff1bc05c25563390}{F\+O\+Generate}} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&States, int i, string v, float q) -\item -void \mbox{\hyperlink{class_factor_oracle_a070d7b00cfcb658c5d13ff275ceae01f}{Factor\+Oracle\+Start}} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&Oracle\+Relations, string word) -\end{DoxyCompactItemize} -\subsection*{Public Attributes} -\begin{DoxyCompactItemize} -\item -vector$<$ \mbox{\hyperlink{class_state}{State}} $>$ \mbox{\hyperlink{class_factor_oracle_a6e8dacf834f9ee820818c3655d77d56d}{states\+\_\+}} -\end{DoxyCompactItemize} - - -\subsection{Member Function Documentation} -\mbox{\Hypertarget{class_factor_oracle_ae10b4d001c338a73f0f44079e842e7db}\label{class_factor_oracle_ae10b4d001c338a73f0f44079e842e7db}} -\index{FactorOracle@{FactorOracle}!AddLetter@{AddLetter}} -\index{AddLetter@{AddLetter}!FactorOracle@{FactorOracle}} -\subsubsection{\texorpdfstring{AddLetter()}{AddLetter()}} -{\footnotesize\ttfamily void Factor\+Oracle\+::\+Add\+Letter (\begin{DoxyParamCaption}\item[{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&}]{States, }\item[{vector$<$ vector$<$ int $>$$>$ \&}]{T, }\item[{int}]{i, }\item[{string}]{word }\end{DoxyParamCaption})} - -A normal member taking four arguments and returning no value. - - -\begin{DoxyParams}{Parameters} -{\em all\+\_\+states\+\_\+} & a reference to a \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} class. \\ -\hline -{\em T} & a reference to a vector of vector of integers. \\ -\hline -{\em i} & an integer argument. \\ -\hline -{\em word} & a string argument.\\ -\hline -\end{DoxyParams} -$<$ delta(i-\/1, p\mbox{[}i\mbox{]}) $<$-\/ i - -$<$ k = S\mbox{[}i-\/1\mbox{]} - -$<$ phi\+\_\+one = i-\/1 - -while k $>$ -\/1 and delta(k,p\mbox{[}i\mbox{]}) is undefined do delta(k, p\mbox{[}i\mbox{]}) $<$-\/ i phi\+\_\+one = k k = S\mbox{[}k\mbox{]}\mbox{\Hypertarget{class_factor_oracle_a070d7b00cfcb658c5d13ff275ceae01f}\label{class_factor_oracle_a070d7b00cfcb658c5d13ff275ceae01f}} -\index{FactorOracle@{FactorOracle}!FactorOracleStart@{FactorOracleStart}} -\index{FactorOracleStart@{FactorOracleStart}!FactorOracle@{FactorOracle}} -\subsubsection{\texorpdfstring{FactorOracleStart()}{FactorOracleStart()}} -{\footnotesize\ttfamily void Factor\+Oracle\+::\+Factor\+Oracle\+Start (\begin{DoxyParamCaption}\item[{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&}]{Oracle\+Relations, }\item[{string}]{word }\end{DoxyParamCaption})} - -A normal member taking one argument and returning no value. - - -\begin{DoxyParams}{Parameters} -{\em oracle\+\_\+relations} & a reference to a \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} class. \\ -\hline -{\em word} & a string argument.\\ -\hline -\end{DoxyParams} -$<$ S\mbox{[}0\mbox{]} = -\/1 - -$<$ for i $<$-\/ 1 to m do Add\+Letter(i)\mbox{\Hypertarget{class_factor_oracle_a28d2e85676712f983b1dcba83ae07d50}\label{class_factor_oracle_a28d2e85676712f983b1dcba83ae07d50}} -\index{FactorOracle@{FactorOracle}!FindBetter@{FindBetter}} -\index{FindBetter@{FindBetter}!FactorOracle@{FactorOracle}} -\subsubsection{\texorpdfstring{FindBetter()}{FindBetter()}} -{\footnotesize\ttfamily int Factor\+Oracle\+::\+Find\+Better (\begin{DoxyParamCaption}\item[{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&}]{States, }\item[{vector$<$ vector$<$ int $>$$>$ \&}]{T, }\item[{int}]{i, }\item[{char}]{alpha, }\item[{string}]{word }\end{DoxyParamCaption})} - -A normal member taking five arguments and returning an integer value. - - -\begin{DoxyParams}{Parameters} -{\em all\+\_\+states\+\_\+} & a reference to a \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} class. \\ -\hline -{\em T} & a reference to a vector of vector of integers. \\ -\hline -{\em i} & an integer argument. \\ -\hline -{\em alpha} & a char argument. \\ -\hline -{\em word} & a string argument. \\ -\hline -\end{DoxyParams} -\begin{DoxyReturn}{Returns} -A better state -\end{DoxyReturn} -\mbox{\Hypertarget{class_factor_oracle_abe8c4c194b309aeeff1bc05c25563390}\label{class_factor_oracle_abe8c4c194b309aeeff1bc05c25563390}} -\index{FactorOracle@{FactorOracle}!FOGenerate@{FOGenerate}} -\index{FOGenerate@{FOGenerate}!FactorOracle@{FactorOracle}} -\subsubsection{\texorpdfstring{FOGenerate()}{FOGenerate()}} -{\footnotesize\ttfamily string Factor\+Oracle\+::\+F\+O\+Generate (\begin{DoxyParamCaption}\item[{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&}]{States, }\item[{int}]{i, }\item[{string}]{v, }\item[{float}]{q }\end{DoxyParamCaption})} - -A normal member taking four arguments and returning a string value. - - -\begin{DoxyParams}{Parameters} -{\em all\+\_\+states\+\_\+} & a reference to a \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} class. \\ -\hline -{\em i} & an integer argument. \\ -\hline -{\em v} & a string argument. \\ -\hline -{\em q} & a float argument. \\ -\hline -\end{DoxyParams} -\begin{DoxyReturn}{Returns} -The factor oracle improvisation -\end{DoxyReturn} -Will be used to obtain a seed for the random number engine - -Standard mersenne\+\_\+twister\+\_\+engine seeded with rd() - -float u = (float)rand() / R\+A\+N\+D\+\_\+\+M\+AX; - -Will be used to obtain a seed for the random number engine - -Standard mersenne\+\_\+twister\+\_\+engine seeded with rd() - -\subsection{Member Data Documentation} -\mbox{\Hypertarget{class_factor_oracle_a6e8dacf834f9ee820818c3655d77d56d}\label{class_factor_oracle_a6e8dacf834f9ee820818c3655d77d56d}} -\index{FactorOracle@{FactorOracle}!states\_@{states\_}} -\index{states\_@{states\_}!FactorOracle@{FactorOracle}} -\subsubsection{\texorpdfstring{states\_}{states\_}} -{\footnotesize\ttfamily vector$<$\mbox{\hyperlink{class_state}{State}}$>$ Factor\+Oracle\+::states\+\_\+} - -vector of all the states - -The documentation for this class was generated from the following files\+:\begin{DoxyCompactItemize} -\item -\mbox{\hyperlink{_factor_oracle_8h}{Factor\+Oracle.\+h}}\item -\mbox{\hyperlink{_factor_oracle_8cpp}{Factor\+Oracle.\+cpp}}\end{DoxyCompactItemize} diff --git a/docs/latex/class_single_transition.tex b/docs/latex/class_single_transition.tex deleted file mode 100644 index 5ee47cc37ce0be15653efdc7a398fc3b5b471e2f..0000000000000000000000000000000000000000 --- a/docs/latex/class_single_transition.tex +++ /dev/null @@ -1,44 +0,0 @@ -\hypertarget{class_single_transition}{}\section{Single\+Transition Class Reference} -\label{class_single_transition}\index{SingleTransition@{SingleTransition}} - - -{\ttfamily \#include $<$Factor\+Oracle.\+h$>$} - -\subsection*{Public Attributes} -\begin{DoxyCompactItemize} -\item -int \mbox{\hyperlink{class_single_transition_a88f7e002e072ffe7bb5eeb168cf0fea6}{first\+\_\+state\+\_\+}} -\item -int \mbox{\hyperlink{class_single_transition_a9d07ad3e0f9d7728919a372111313c69}{last\+\_\+state\+\_\+}} -\item -char \mbox{\hyperlink{class_single_transition_ae632ebd30fd4818e999fd1009cb2a8f9}{symbol\+\_\+}} -\end{DoxyCompactItemize} - - -\subsection{Detailed Description} -The class \mbox{\hyperlink{class_single_transition}{Single\+Transition}} denotes the elements that belong to each transition - -\subsection{Member Data Documentation} -\mbox{\Hypertarget{class_single_transition_a88f7e002e072ffe7bb5eeb168cf0fea6}\label{class_single_transition_a88f7e002e072ffe7bb5eeb168cf0fea6}} -\index{SingleTransition@{SingleTransition}!first\_state\_@{first\_state\_}} -\index{first\_state\_@{first\_state\_}!SingleTransition@{SingleTransition}} -\subsubsection{\texorpdfstring{first\_state\_}{first\_state\_}} -{\footnotesize\ttfamily int Single\+Transition\+::first\+\_\+state\+\_\+} - -denotes the first state of the transition \mbox{\Hypertarget{class_single_transition_a9d07ad3e0f9d7728919a372111313c69}\label{class_single_transition_a9d07ad3e0f9d7728919a372111313c69}} -\index{SingleTransition@{SingleTransition}!last\_state\_@{last\_state\_}} -\index{last\_state\_@{last\_state\_}!SingleTransition@{SingleTransition}} -\subsubsection{\texorpdfstring{last\_state\_}{last\_state\_}} -{\footnotesize\ttfamily int Single\+Transition\+::last\+\_\+state\+\_\+} - -denotes the last state of the transition \mbox{\Hypertarget{class_single_transition_ae632ebd30fd4818e999fd1009cb2a8f9}\label{class_single_transition_ae632ebd30fd4818e999fd1009cb2a8f9}} -\index{SingleTransition@{SingleTransition}!symbol\_@{symbol\_}} -\index{symbol\_@{symbol\_}!SingleTransition@{SingleTransition}} -\subsubsection{\texorpdfstring{symbol\_}{symbol\_}} -{\footnotesize\ttfamily char Single\+Transition\+::symbol\+\_\+} - -denotes the symbol (letter) of the transition - -The documentation for this class was generated from the following file\+:\begin{DoxyCompactItemize} -\item -\mbox{\hyperlink{_factor_oracle_8h}{Factor\+Oracle.\+h}}\end{DoxyCompactItemize} diff --git a/docs/latex/class_state.tex b/docs/latex/class_state.tex deleted file mode 100644 index edc56025961f222113546c74bba77221d993c2b4..0000000000000000000000000000000000000000 --- a/docs/latex/class_state.tex +++ /dev/null @@ -1,48 +0,0 @@ -\hypertarget{class_state}{}\section{State Class Reference} -\label{class_state}\index{State@{State}} - - -{\ttfamily \#include $<$Factor\+Oracle.\+h$>$} - -\subsection*{Public Member Functions} -\begin{DoxyCompactItemize} -\item -\mbox{\Hypertarget{class_state_a472cf58ec39b9f2158560f8aae3b89c8}\label{class_state_a472cf58ec39b9f2158560f8aae3b89c8}} -void {\bfseries single\+Transition\+Resize} () -\end{DoxyCompactItemize} -\subsection*{Public Attributes} -\begin{DoxyCompactItemize} -\item -int \mbox{\hyperlink{class_state_a2dcf672a1560830a8f93b0e9863c6724}{state\+\_\+}} -\item -vector$<$ \mbox{\hyperlink{class_single_transition}{Single\+Transition}} $>$ \mbox{\hyperlink{class_state_afd5b3d2afbba2fc03583f76a7cb08fe8}{transition\+\_\+}} -\item -\mbox{\Hypertarget{class_state_ae1daff1d8cfaf403f5f81b74a32d18cf}\label{class_state_ae1daff1d8cfaf403f5f81b74a32d18cf}} -int {\bfseries suffix\+\_\+transition\+\_\+} -\item -\mbox{\Hypertarget{class_state_a232fd4e8e92e228c5ad8542c8d45e9b6}\label{class_state_a232fd4e8e92e228c5ad8542c8d45e9b6}} -int {\bfseries lrs\+\_\+} = 0 -\end{DoxyCompactItemize} - - -\subsection{Detailed Description} -The class \mbox{\hyperlink{class_state}{State}} denotes the elements that belong to each state state denotes de number of the state vector $<$\+Single\+Transition$>$ transition is the vector where all forward links of the state are defined suffix\+\_\+transition denotes which is the suffix link of this state lrs is the longest repeated subsequence of this state - -\subsection{Member Data Documentation} -\mbox{\Hypertarget{class_state_a2dcf672a1560830a8f93b0e9863c6724}\label{class_state_a2dcf672a1560830a8f93b0e9863c6724}} -\index{State@{State}!state\_@{state\_}} -\index{state\_@{state\_}!State@{State}} -\subsubsection{\texorpdfstring{state\_}{state\_}} -{\footnotesize\ttfamily int State\+::state\+\_\+} - -denotes the number of the state \mbox{\Hypertarget{class_state_afd5b3d2afbba2fc03583f76a7cb08fe8}\label{class_state_afd5b3d2afbba2fc03583f76a7cb08fe8}} -\index{State@{State}!transition\_@{transition\_}} -\index{transition\_@{transition\_}!State@{State}} -\subsubsection{\texorpdfstring{transition\_}{transition\_}} -{\footnotesize\ttfamily vector$<$\mbox{\hyperlink{class_single_transition}{Single\+Transition}}$>$ State\+::transition\+\_\+} - -denotes the number of the state - -The documentation for this class was generated from the following file\+:\begin{DoxyCompactItemize} -\item -\mbox{\hyperlink{_factor_oracle_8h}{Factor\+Oracle.\+h}}\end{DoxyCompactItemize} diff --git a/docs/latex/doxygen.sty b/docs/latex/doxygen.sty deleted file mode 100644 index cf92712fabe94414d3f998f113c83835d014ead3..0000000000000000000000000000000000000000 --- a/docs/latex/doxygen.sty +++ /dev/null @@ -1,549 +0,0 @@ -\NeedsTeXFormat{LaTeX2e} -\ProvidesPackage{doxygen} - -% Packages used by this style file -\RequirePackage{alltt} -\RequirePackage{array} -\RequirePackage{calc} -\RequirePackage{float} -\RequirePackage{ifthen} -\RequirePackage{verbatim} -\RequirePackage[table]{xcolor} -\RequirePackage{longtable} -\RequirePackage{tabu} -\RequirePackage{fancyvrb} -\RequirePackage{tabularx} -\RequirePackage{multirow} -\RequirePackage{hanging} -\RequirePackage{ifpdf} -\RequirePackage{adjustbox} -\RequirePackage{amssymb} -\RequirePackage{stackengine} -\RequirePackage[normalem]{ulem} % for strikeout, but don't modify emphasis - -%---------- Internal commands used in this style file ---------------- - -\newcommand{\ensurespace}[1]{% - \begingroup% - \setlength{\dimen@}{#1}% - \vskip\z@\@plus\dimen@% - \penalty -100\vskip\z@\@plus -\dimen@% - \vskip\dimen@% - \penalty 9999% - \vskip -\dimen@% - \vskip\z@skip% hide the previous |\vskip| from |\addvspace| - \endgroup% -} - -\newcommand{\DoxyLabelFont}{} -\newcommand{\entrylabel}[1]{% - {% - \parbox[b]{\labelwidth-4pt}{% - \makebox[0pt][l]{\DoxyLabelFont#1}% - \vspace{1.5\baselineskip}% - }% - }% -} - -\newenvironment{DoxyDesc}[1]{% - \ensurespace{4\baselineskip}% - \begin{list}{}{% - \settowidth{\labelwidth}{20pt}% - \setlength{\parsep}{0pt}% - \setlength{\itemsep}{0pt}% - \setlength{\leftmargin}{\labelwidth+\labelsep}% - \renewcommand{\makelabel}{\entrylabel}% - }% - \item[#1]% -}{% - \end{list}% -} - -\newsavebox{\xrefbox} -\newlength{\xreflength} -\newcommand{\xreflabel}[1]{% - \sbox{\xrefbox}{#1}% - \setlength{\xreflength}{\wd\xrefbox}% - \ifthenelse{\xreflength>\labelwidth}{% - \begin{minipage}{\textwidth}% - \setlength{\parindent}{0pt}% - \hangindent=15pt\bfseries #1\vspace{1.2\itemsep}% - \end{minipage}% - }{% - \parbox[b]{\labelwidth}{\makebox[0pt][l]{\textbf{#1}}}% - }% -} - -%---------- Commands used by doxygen LaTeX output generator ---------- - -% Used by <pre> ... </pre> -\newenvironment{DoxyPre}{% - \small% - \begin{alltt}% -}{% - \end{alltt}% - \normalsize% -} -% Necessary for redefining not defined charcaters, i.e. "Replacement Character" in tex output. -\newlength{\CodeWidthChar} -\newlength{\CodeHeightChar} -\settowidth{\CodeWidthChar}{?} -\settoheight{\CodeHeightChar}{?} -% Necessary for hanging indent -\newlength{\DoxyCodeWidth} - -\newcommand\DoxyCodeLine[1]{\hangpara{\DoxyCodeWidth}{1}{#1}\par} - -\newcommand\NiceSpace{% - \discretionary{}{\kern\fontdimen2\font}{\kern\fontdimen2\font}% -} - -% Used by @code ... @endcode -\newenvironment{DoxyCode}[1]{% - \par% - \scriptsize% - \normalfont\ttfamily% - \rightskip0pt plus 1fil% - \settowidth{\DoxyCodeWidth}{000000}% - \settowidth{\CodeWidthChar}{?}% - \settoheight{\CodeHeightChar}{?}% - \setlength{\parskip}{0ex plus 0ex minus 0ex}% - \ifthenelse{\equal{#1}{0}} - { - {\lccode`~32 \lowercase{\global\let~}\NiceSpace}\obeyspaces% - } - { - {\lccode`~32 \lowercase{\global\let~}}\obeyspaces% - } - -}{% - \normalfont% - \normalsize% - \settowidth{\CodeWidthChar}{?}% - \settoheight{\CodeHeightChar}{?}% -} - -% Redefining not defined characters, i.e. "Replacement Character" in tex output. -\def\ucr{\adjustbox{width=\CodeWidthChar,height=\CodeHeightChar}{\stackinset{c}{}{c}{-.2pt}{% - \textcolor{white}{\sffamily\bfseries\small ?}}{% - \rotatebox{45}{$\blacksquare$}}}} - -% Used by @example, @include, @includelineno and @dontinclude -\newenvironment{DoxyCodeInclude}[1]{% - \DoxyCode{#1}% -}{% - \endDoxyCode% -} - -% Used by @verbatim ... @endverbatim -\newenvironment{DoxyVerb}{% - \footnotesize% - \verbatim% -}{% - \endverbatim% - \normalsize% -} - -% Used by @verbinclude -\newenvironment{DoxyVerbInclude}{% - \DoxyVerb% -}{% - \endDoxyVerb% -} - -% Used by numbered lists (using '-#' or <ol> ... </ol>) -\newenvironment{DoxyEnumerate}{% - \enumerate% -}{% - \endenumerate% -} - -% Used by bullet lists (using '-', @li, @arg, or <ul> ... </ul>) -\newenvironment{DoxyItemize}{% - \itemize% -}{% - \enditemize% -} - -% Used by description lists (using <dl> ... </dl>) -\newenvironment{DoxyDescription}{% - \description% -}{% - \enddescription% -} - -% Used by @image, @dotfile, @dot ... @enddot, and @msc ... @endmsc -% (only if caption is specified) -\newenvironment{DoxyImage}{% - \begin{figure}[H]% - \begin{center}% -}{% - \end{center}% - \end{figure}% -} - -% Used by @image, @dotfile, @dot ... @enddot, and @msc ... @endmsc -% (only if no caption is specified) -\newenvironment{DoxyImageNoCaption}{% - \begin{center}% -}{% - \end{center}% -} - -% Used by @image -% (only if inline is specified) -\newenvironment{DoxyInlineImage}{% -}{% -} - -% Used by @attention -\newenvironment{DoxyAttention}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @author and @authors -\newenvironment{DoxyAuthor}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @date -\newenvironment{DoxyDate}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @invariant -\newenvironment{DoxyInvariant}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @note -\newenvironment{DoxyNote}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @post -\newenvironment{DoxyPostcond}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @pre -\newenvironment{DoxyPrecond}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @copyright -\newenvironment{DoxyCopyright}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @remark -\newenvironment{DoxyRemark}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @return and @returns -\newenvironment{DoxyReturn}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @since -\newenvironment{DoxySince}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @see -\newenvironment{DoxySeeAlso}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @version -\newenvironment{DoxyVersion}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @warning -\newenvironment{DoxyWarning}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @internal -\newenvironment{DoxyInternal}[1]{% - \paragraph*{#1}% -}{% -} - -% Used by @par and @paragraph -\newenvironment{DoxyParagraph}[1]{% - \begin{list}{}{% - \settowidth{\labelwidth}{40pt}% - \setlength{\leftmargin}{\labelwidth}% - \setlength{\parsep}{0pt}% - \setlength{\itemsep}{-4pt}% - \renewcommand{\makelabel}{\entrylabel}% - }% - \item[#1]% -}{% - \end{list}% -} - -% Used by parameter lists -\newenvironment{DoxyParams}[2][]{% - \tabulinesep=1mm% - \par% - \ifthenelse{\equal{#1}{}}% - {\begin{longtabu*}spread 0pt [l]{|X[-1,l]|X[-1,l]|}}% name + description - {\ifthenelse{\equal{#1}{1}}% - {\begin{longtabu*}spread 0pt [l]{|X[-1,l]|X[-1,l]|X[-1,l]|}}% in/out + name + desc - {\begin{longtabu*}spread 0pt [l]{|X[-1,l]|X[-1,l]|X[-1,l]|X[-1,l]|}}% in/out + type + name + desc - } - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #2}\\[1ex]% - \hline% - \endfirsthead% - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #2}\\[1ex]% - \hline% - \endhead% -}{% - \end{longtabu*}% - \vspace{6pt}% -} - -% Used for fields of simple structs -\newenvironment{DoxyFields}[1]{% - \tabulinesep=1mm% - \par% - \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|X[-1,l]|}% - \multicolumn{3}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endfirsthead% - \multicolumn{3}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endhead% -}{% - \end{longtabu*}% - \vspace{6pt}% -} - -% Used for fields simple class style enums -\newenvironment{DoxyEnumFields}[1]{% - \tabulinesep=1mm% - \par% - \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|}% - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endfirsthead% - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endhead% -}{% - \end{longtabu*}% - \vspace{6pt}% -} - -% Used for parameters within a detailed function description -\newenvironment{DoxyParamCaption}{% - \renewcommand{\item}[2][]{\\ \hspace*{2.0cm} ##1 {\em ##2}}% -}{% -} - -% Used by return value lists -\newenvironment{DoxyRetVals}[1]{% - \tabulinesep=1mm% - \par% - \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|}% - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endfirsthead% - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endhead% -}{% - \end{longtabu*}% - \vspace{6pt}% -} - -% Used by exception lists -\newenvironment{DoxyExceptions}[1]{% - \tabulinesep=1mm% - \par% - \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|}% - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endfirsthead% - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endhead% -}{% - \end{longtabu*}% - \vspace{6pt}% -} - -% Used by template parameter lists -\newenvironment{DoxyTemplParams}[1]{% - \tabulinesep=1mm% - \par% - \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|}% - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endfirsthead% - \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% - \hline% - \endhead% -}{% - \end{longtabu*}% - \vspace{6pt}% -} - -% Used for member lists -\newenvironment{DoxyCompactItemize}{% - \begin{itemize}% - \setlength{\itemsep}{-3pt}% - \setlength{\parsep}{0pt}% - \setlength{\topsep}{0pt}% - \setlength{\partopsep}{0pt}% -}{% - \end{itemize}% -} - -% Used for member descriptions -\newenvironment{DoxyCompactList}{% - \begin{list}{}{% - \setlength{\leftmargin}{0.5cm}% - \setlength{\itemsep}{0pt}% - \setlength{\parsep}{0pt}% - \setlength{\topsep}{0pt}% - \renewcommand{\makelabel}{\hfill}% - }% -}{% - \end{list}% -} - -% Used for reference lists (@bug, @deprecated, @todo, etc.) -\newenvironment{DoxyRefList}{% - \begin{list}{}{% - \setlength{\labelwidth}{10pt}% - \setlength{\leftmargin}{\labelwidth}% - \addtolength{\leftmargin}{\labelsep}% - \renewcommand{\makelabel}{\xreflabel}% - }% -}{% - \end{list}% -} - -% Used by @bug, @deprecated, @todo, etc. -\newenvironment{DoxyRefDesc}[1]{% - \begin{list}{}{% - \renewcommand\makelabel[1]{\textbf{##1}}% - \settowidth\labelwidth{\makelabel{#1}}% - \setlength\leftmargin{\labelwidth+\labelsep}% - }% -}{% - \end{list}% -} - -% Used by parameter lists and simple sections -\newenvironment{Desc} -{\begin{list}{}{% - \settowidth{\labelwidth}{20pt}% - \setlength{\parsep}{0pt}% - \setlength{\itemsep}{0pt}% - \setlength{\leftmargin}{\labelwidth+\labelsep}% - \renewcommand{\makelabel}{\entrylabel}% - } -}{% - \end{list}% -} - -% Used by tables -\newcommand{\PBS}[1]{\let\temp=\\#1\let\\=\temp}% -\newenvironment{TabularC}[1]% -{\tabulinesep=1mm -\begin{longtabu*}spread 0pt [c]{*#1{|X[-1]}|}}% -{\end{longtabu*}\par}% - -\newenvironment{TabularNC}[1]% -{\begin{tabu}spread 0pt [l]{*#1{|X[-1]}|}}% -{\end{tabu}\par}% - -% Used for member group headers -\newenvironment{Indent}{% - \begin{list}{}{% - \setlength{\leftmargin}{0.5cm}% - }% - \item[]\ignorespaces% -}{% - \unskip% - \end{list}% -} - -% Used when hyperlinks are turned off -\newcommand{\doxyref}[3]{% - \textbf{#1} (\textnormal{#2}\,\pageref{#3})% -} - -% Used to link to a table when hyperlinks are turned on -\newcommand{\doxytablelink}[2]{% - \ref{#1}% -} - -% Used to link to a table when hyperlinks are turned off -\newcommand{\doxytableref}[3]{% - \ref{#3}% -} - -% Used by @addindex -\newcommand{\lcurly}{\{} -\newcommand{\rcurly}{\}} - -% Colors used for syntax highlighting -\definecolor{comment}{rgb}{0.5,0.0,0.0} -\definecolor{keyword}{rgb}{0.0,0.5,0.0} -\definecolor{keywordtype}{rgb}{0.38,0.25,0.125} -\definecolor{keywordflow}{rgb}{0.88,0.5,0.0} -\definecolor{preprocessor}{rgb}{0.5,0.38,0.125} -\definecolor{stringliteral}{rgb}{0.0,0.125,0.25} -\definecolor{charliteral}{rgb}{0.0,0.5,0.5} -\definecolor{vhdldigit}{rgb}{1.0,0.0,1.0} -\definecolor{vhdlkeyword}{rgb}{0.43,0.0,0.43} -\definecolor{vhdllogic}{rgb}{1.0,0.0,0.0} -\definecolor{vhdlchar}{rgb}{0.0,0.0,0.0} - -% Color used for table heading -\newcommand{\tableheadbgcolor}{lightgray}% - -% Version of hypertarget with correct landing location -\newcommand{\Hypertarget}[1]{\Hy@raisedlink{\hypertarget{#1}{}}} - -% Define caption that is also suitable in a table -\makeatletter -\def\doxyfigcaption{% -\refstepcounter{figure}% -\@dblarg{\@caption{figure}}} -\makeatother diff --git a/docs/latex/files.tex b/docs/latex/files.tex deleted file mode 100644 index dd3f8c403d91f08341f15f875d16f71e9c34e1ac..0000000000000000000000000000000000000000 --- a/docs/latex/files.tex +++ /dev/null @@ -1,6 +0,0 @@ -\section{File List} -Here is a list of all documented files with brief descriptions\+:\begin{DoxyCompactList} -\item\contentsline{section}{\mbox{\hyperlink{_factor_oracle_8cpp}{Factor\+Oracle.\+cpp}} \\*A file that contains the functions needed for the creation of a Factor Oracle }{\pageref{_factor_oracle_8cpp}}{} -\item\contentsline{section}{\mbox{\hyperlink{_factor_oracle_8h}{Factor\+Oracle.\+h}} \\*A file that contains the definitions of the classes needed for the creation of a Factor Oracle }{\pageref{_factor_oracle_8h}}{} -\item\contentsline{section}{\mbox{\hyperlink{main_8cpp}{main.\+cpp}} \\*A file that contains the main functions, which starts all the algorithm }{\pageref{main_8cpp}}{} -\end{DoxyCompactList} diff --git a/docs/latex/main_8cpp.tex b/docs/latex/main_8cpp.tex deleted file mode 100644 index 068fd1aa1a7ad359c058486d30c7155edaed339c..0000000000000000000000000000000000000000 --- a/docs/latex/main_8cpp.tex +++ /dev/null @@ -1,20 +0,0 @@ -\hypertarget{main_8cpp}{}\section{main.\+cpp File Reference} -\label{main_8cpp}\index{main.cpp@{main.cpp}} - - -A file that contains the main functions, which starts all the algorithm. - - -{\ttfamily \#include \char`\"{}Factor\+Oracle.\+h\char`\"{}}\newline -\subsection*{Functions} -\begin{DoxyCompactItemize} -\item -\mbox{\Hypertarget{main_8cpp_ae66f6b31b5ad750f1fe042a706a4e3d4}\label{main_8cpp_ae66f6b31b5ad750f1fe042a706a4e3d4}} -int {\bfseries main} () -\end{DoxyCompactItemize} - - -\subsection{Detailed Description} -A file that contains the main functions, which starts all the algorithm. - -One functions\+: main. \ No newline at end of file diff --git a/docs/latex/refman.tex b/docs/latex/refman.tex deleted file mode 100644 index 07c92b3b5a403d2066950f7c7d3d8080e5e2b507..0000000000000000000000000000000000000000 --- a/docs/latex/refman.tex +++ /dev/null @@ -1,184 +0,0 @@ -\let\mypdfximage\pdfximage\def\pdfximage{\immediate\mypdfximage}\documentclass[twoside]{book} - -% Packages required by doxygen -\usepackage{fixltx2e} -\usepackage{calc} -\usepackage{doxygen} -\usepackage{graphicx} -\usepackage[utf8]{inputenc} -\usepackage{makeidx} -\usepackage{multicol} -\usepackage{multirow} -\PassOptionsToPackage{warn}{textcomp} -\usepackage{textcomp} -\usepackage[nointegrals]{wasysym} -\usepackage[table]{xcolor} -\usepackage{ifpdf,ifxetex} - -% Font selection -\usepackage[T1]{fontenc} -\usepackage[scaled=.90]{helvet} -\usepackage{courier} -\usepackage{amssymb} -\usepackage{sectsty} -\renewcommand{\familydefault}{\sfdefault} -\allsectionsfont{% - \fontseries{bc}\selectfont% - \color{darkgray}% -} -\renewcommand{\DoxyLabelFont}{% - \fontseries{bc}\selectfont% - \color{darkgray}% -} -\newcommand{\+}{\discretionary{\mbox{\scriptsize$\hookleftarrow$}}{}{}} - -% Arguments of doxygenemoji: -% 1) ':<text>:' form of the emoji, already "LaTeX"-escaped -% 2) file with the name of the emoji without the .png extension -% in case image exist use this otherwise use the ':<text>:' form -\newcommand{\doxygenemoji}[2]{% - \IfFileExists{./#2.png}{\raisebox{-0.1em}{\includegraphics[height=0.9em]{./#2.png}}}{#1}% -} -% Page & text layout -\usepackage{geometry} -\geometry{% - a4paper,% - top=2.5cm,% - bottom=2.5cm,% - left=2.5cm,% - right=2.5cm% -} -\tolerance=750 -\hfuzz=15pt -\hbadness=750 -\setlength{\emergencystretch}{15pt} -\setlength{\parindent}{0cm} -\newcommand{\doxynormalparskip}{\setlength{\parskip}{3ex plus 2ex minus 2ex}} -\newcommand{\doxytocparskip}{\setlength{\parskip}{1ex plus 0ex minus 0ex}} -\doxynormalparskip -\makeatletter -\renewcommand{\paragraph}{% - \@startsection{paragraph}{4}{0ex}{-1.0ex}{1.0ex}{% - \normalfont\normalsize\bfseries\SS@parafont% - }% -} -\renewcommand{\subparagraph}{% - \@startsection{subparagraph}{5}{0ex}{-1.0ex}{1.0ex}{% - \normalfont\normalsize\bfseries\SS@subparafont% - }% -} -\makeatother - -% Headers & footers -\usepackage{fancyhdr} -\pagestyle{fancyplain} -\fancyhead[LE]{\fancyplain{}{\bfseries\thepage}} -\fancyhead[CE]{\fancyplain{}{}} -\fancyhead[RE]{\fancyplain{}{\bfseries\leftmark}} -\fancyhead[LO]{\fancyplain{}{\bfseries\rightmark}} -\fancyhead[CO]{\fancyplain{}{}} -\fancyhead[RO]{\fancyplain{}{\bfseries\thepage}} -\fancyfoot[LE]{\fancyplain{}{}} -\fancyfoot[CE]{\fancyplain{}{}} -\fancyfoot[RE]{\fancyplain{}{\bfseries\scriptsize Generated by Doxygen }} -\fancyfoot[LO]{\fancyplain{}{\bfseries\scriptsize Generated by Doxygen }} -\fancyfoot[CO]{\fancyplain{}{}} -\fancyfoot[RO]{\fancyplain{}{}} -\renewcommand{\footrulewidth}{0.4pt} -\renewcommand{\chaptermark}[1]{% - \markboth{#1}{}% -} -\renewcommand{\sectionmark}[1]{% - \markright{\thesection\ #1}% -} - -% Indices & bibliography -\usepackage{natbib} -\usepackage[titles]{tocloft} -\setcounter{tocdepth}{3} -\setcounter{secnumdepth}{5} -\makeindex - -\usepackage{newunicodechar} - \newunicodechar{â»}{${}^{-}$}% Superscript minus - \newunicodechar{²}{${}^{2}$}% Superscript two - \newunicodechar{³}{${}^{3}$}% Superscript three - -% Hyperlinks (required, but should be loaded last) -\ifpdf - \usepackage[pdftex,pagebackref=true]{hyperref} -\else - \ifxetex - \usepackage[pagebackref=true]{hyperref} - \else - \usepackage[ps2pdf,pagebackref=true]{hyperref} - \fi -\fi - -\hypersetup{% - colorlinks=true,% - linkcolor=blue,% - citecolor=blue,% - unicode% -} - -% Custom commands -\newcommand{\clearemptydoublepage}{% - \newpage{\pagestyle{empty}\cleardoublepage}% -} - -\usepackage{caption} -\captionsetup{labelsep=space,justification=centering,font={bf},singlelinecheck=off,skip=4pt,position=top} - -\usepackage{etoc} -\etocsettocstyle{\doxytocparskip}{\doxynormalparskip} -\renewcommand{\numberline}[1]{#1~} -%===== C O N T E N T S ===== - -\begin{document} - -% Titlepage & ToC -\hypersetup{pageanchor=false, - bookmarksnumbered=true, - pdfencoding=unicode - } -\pagenumbering{alph} -\begin{titlepage} -\vspace*{7cm} -\begin{center}% -{\Large My Project }\\ -\vspace*{1cm} -{\large Generated by Doxygen 1.8.15}\\ -\end{center} -\end{titlepage} -\clearemptydoublepage -\pagenumbering{roman} -\tableofcontents -\clearemptydoublepage -\pagenumbering{arabic} -\hypersetup{pageanchor=true} - -%--- Begin generated contents --- -\chapter{Class Index} -\input{annotated} -\chapter{File Index} -\input{files} -\chapter{Class Documentation} -\input{class_factor_oracle} -\input{class_single_transition} -\input{class_state} -\chapter{File Documentation} -\input{_factor_oracle_8cpp} -\input{_factor_oracle_8h} -\input{main_8cpp} -%--- End generated contents --- - -% Index -\backmatter -\newpage -\phantomsection -\clearemptydoublepage -\addcontentsline{toc}{chapter}{\indexname} -\printindex - -\end{document} diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt new file mode 100644 index 0000000000000000000000000000000000000000..e0c1239964a90bd92c7370615185d105033b0dde --- /dev/null +++ b/src/CMakeLists.txt @@ -0,0 +1,15 @@ +# Specify the minimum version for CMake +cmake_minimum_required(VERSION 3.0.0) + +# project information +project(factor-oracle_exec CXX) + +# Libraries +add_library(fo_libs FactorOracle.cpp) +target_include_directories(fo_libs PUBLIC ${CMAKE_CURRENT_LIST_DIR}) + + +# The main programn +add_executable(factor-oracle main.cpp) +set_property(TARGET factor-oracle PROPERTY CXX_STANDARD 14) +target_link_libraries(factor-oracle fo_libs) diff --git a/src/FactorOracle.h b/src/FactorOracle.h index 2375a620799f9812a35e1ecf9dc178afded464c3..5bd4585ae0d0d7b64759919c5d79d6c702f80994 100644 --- a/src/FactorOracle.h +++ b/src/FactorOracle.h @@ -1,14 +1,13 @@ // // Created by MARIA PAULA CARRERO on 7/16/19. // +#include <algorithm> #include <iostream> #include <new> +#include <random> #include <string> -#include <vector> #include <variant> -#include <random> -#include <algorithm> - +#include <vector> #ifndef FACTORORACLESTRING_FACTORORACLE_H #define FACTORORACLESTRING_FACTORORACLE_H @@ -17,32 +16,31 @@ #define RAND_MAX 0x7fffffff /*! \file FactorOracle.h - \brief A file that contains the definitions of the classes needed for the creation of a Factor Oracle. + \brief A file that contains the definitions of the classes needed for the + creation of a Factor Oracle. Three main classes: FactorOracle, State and SingleTransition. */ -/*! \fn void AddLetter(FactorOracle& States, vector <vector<int>> &T, int i, string word) - \brief Adds new transitions from state i-1 to state i. - \param States A reference to a FactorOracle class. - \param T A vector where each position has all the suffix transitions directed to each state. - \param i The integer of the current state. - \param word The input string. +/*! \fn void AddLetter(FactorOracle& States, vector <vector<int>> &T, int i, + string word) \brief Adds new transitions from state i-1 to state i. \param + States A reference to a FactorOracle class. \param T A vector where each + position has all the suffix transitions directed to each state. \param i The + integer of the current state. \param word The input string. */ /*! \fn int LengthCommonSuffix(FactorOracle& States, int phi_one, int phi_two) - \brief Finds the length of a common suffix ending at the position phi_one and phi_two by traversing the suffix links. - \param States A reference to a FactorOracle class. - \param phi_one The position of the state. - \param phi_two The position of the state. + \brief Finds the length of a common suffix ending at the position phi_one + and phi_two by traversing the suffix links. \param States A reference to a + FactorOracle class. \param phi_one The position of the state. \param phi_two + The position of the state. */ -/*! \fn int FindBetter(FactorOracle& States, vector <vector<int>> &T, int i, char alpha, string word) - \brief Writes \a count bytes from \a buf to the filedescriptor \a fd. - \param States a reference to a FactorOracle class. - \param T A vector where each position has all the suffix transitions directed to each state. - \param i The integer of the current state. - \param alpha The transition symbol. - \param word The input string. - \return A better state +/*! \fn int FindBetter(FactorOracle& States, vector <vector<int>> &T, int i, + char alpha, string word) \brief Writes \a count bytes from \a buf to the + filedescriptor \a fd. \param States a reference to a FactorOracle class. + \param T A vector where each position has all the suffix transitions + directed to each state. \param i The integer of the current state. \param + alpha The transition symbol. \param word The input string. \return A better + state */ /*! \fn string FOGenerate(FactorOracle& States, int i, string v, float q) \brief Generates the Factor Oracle improvisation. @@ -58,51 +56,42 @@ \param word The input string. */ - - - using namespace std; -/** The class SingleTransition denotes the elements that belong to each transition - */ -class SingleTransition -{ -public: - int first_state_; /**< denotes the first state of the transition */ - int last_state_; /**< denotes the last state of the transition */ - char symbol_; /**< denotes the symbol (letter) of the transition */ +/** The class SingleTransition denotes the elements that belong to each + * transition + */ +class SingleTransition { + public: + int first_state_; /**< denotes the first state of the transition */ + int last_state_; /**< denotes the last state of the transition */ + char symbol_; /**< denotes the symbol (letter) of the transition */ }; /** The class State denotes the elements that belong to each state * state denotes de number of the state - * vector <SingleTransition> transition is the vector where all forward links of the state are defined - * suffix_transition denotes which is the suffix link of this state - * lrs is the longest repeated subsequence of this state + * vector <SingleTransition> transition is the vector where all forward links of + * the state are defined suffix_transition denotes which is the suffix link of + * this state lrs is the longest repeated subsequence of this state * */ -class State -{ -public: - int state_; /*!< denotes the number of the state */ - vector <SingleTransition> transition_; /*!< denotes the number of the state */ - int suffix_transition_; - int lrs_ = 0; - void singleTransitionResize(){ - transition_.resize(R); - } +class State { + public: + int state_; /*!< denotes the number of the state */ + vector<SingleTransition> transition_; /*!< denotes the number of the state */ + int suffix_transition_; + int lrs_ = 0; + void singleTransitionResize() { transition_.resize(R); } }; - -class FactorOracle -{ -public: - vector <State> states_; /**< vector of all the states */ - void AddLetter(FactorOracle& States, vector <vector<int>> &T, int i, string word); - int LengthCommonSuffix(FactorOracle& States, int phi_one, int phi_two); - int FindBetter(FactorOracle& States, vector <vector<int>> &T, int i, char alpha, string word); - string FOGenerate(FactorOracle& States, int i, string v, float q); - void FactorOracleStart(FactorOracle& OracleRelations,string word); - +class FactorOracle { + public: + vector<State> states_; /**< vector of all the states */ + void AddLetter(FactorOracle& States, vector<vector<int>>& T, int i, + string word); + int LengthCommonSuffix(FactorOracle& States, int phi_one, int phi_two); + int FindBetter(FactorOracle& States, vector<vector<int>>& T, int i, + char alpha, string word); + string FOGenerate(FactorOracle& States, int& i, string v, float q); + void FactorOracleStart(FactorOracle& OracleRelations, string word); }; - - -#endif //FACTORORACLESTRING_FACTORORACLE_H +#endif // FACTORORACLESTRING_FACTORORACLE_H diff --git a/tests/CMakeLists.txt b/tests/CMakeLists.txt new file mode 100644 index 0000000000000000000000000000000000000000..77340373220dbac979d8879d8b194d0cf04c323a --- /dev/null +++ b/tests/CMakeLists.txt @@ -0,0 +1,17 @@ +# Specify the minimum version for CMake +cmake_minimum_required(VERSION 3.0.0) + +# project information +project(factor-oracle_tests CXX) + +# Requires Catch2 +set(CATCH_INCLUDE_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../third-party/catch2) +add_library(catch INTERFACE) +target_include_directories(catch INTERFACE ${CATCH_INCLUDE_DIR}) + +# Make test executable +add_executable(unit_tests main.cpp) +target_link_libraries(unit_tests catch fo_libs) + +# Enable Unit testing +add_test(NAME UnitTests COMMAND unit_tests) diff --git a/tests/factor_oracle.cpp b/tests/factor_oracle.cpp new file mode 100644 index 0000000000000000000000000000000000000000..7f156535b2127bedb9397940e5f96eeac2784f1b --- /dev/null +++ b/tests/factor_oracle.cpp @@ -0,0 +1,5 @@ +#include <catch.hpp> +#include <string> +#include "FactorOracle.hpp" + +TEST_CASE() { /** Insert here the tests */ } diff --git a/tests/main.cpp b/tests/main.cpp new file mode 100644 index 0000000000000000000000000000000000000000..0c7c351f437f5f43f3bb62beb254a9f1ecbec5a0 --- /dev/null +++ b/tests/main.cpp @@ -0,0 +1,2 @@ +#define CATCH_CONFIG_MAIN +#include "catch.hpp" diff --git a/third-party/catch2/catch.hpp b/third-party/catch2/catch.hpp new file mode 100644 index 0000000000000000000000000000000000000000..303f664ffc3b051af3e39f1b89252d4b235d57d9 --- /dev/null +++ b/third-party/catch2/catch.hpp @@ -0,0 +1,16865 @@ +/* + * Catch v2.9.1 + * Generated: 2019-06-17 11:59:24.363643 + * ---------------------------------------------------------- + * This file has been merged from multiple headers. Please don't edit it directly + * Copyright (c) 2019 Two Blue Cubes Ltd. All rights reserved. + * + * Distributed under the Boost Software License, Version 1.0. (See accompanying + * file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) + */ +#ifndef TWOBLUECUBES_SINGLE_INCLUDE_CATCH_HPP_INCLUDED +#define TWOBLUECUBES_SINGLE_INCLUDE_CATCH_HPP_INCLUDED +// start catch.hpp + + +#define CATCH_VERSION_MAJOR 2 +#define CATCH_VERSION_MINOR 9 +#define CATCH_VERSION_PATCH 1 + +#ifdef __clang__ +# pragma clang system_header +#elif defined __GNUC__ +# pragma GCC system_header +#endif + +// start catch_suppress_warnings.h + +#ifdef __clang__ +# ifdef __ICC // icpc defines the __clang__ macro +# pragma warning(push) +# pragma warning(disable: 161 1682) +# else // __ICC +# pragma clang diagnostic push +# pragma clang diagnostic ignored "-Wpadded" +# pragma clang diagnostic ignored "-Wswitch-enum" +# pragma clang diagnostic ignored "-Wcovered-switch-default" +# endif +#elif defined __GNUC__ + // Because REQUIREs trigger GCC's -Wparentheses, and because still + // supported version of g++ have only buggy support for _Pragmas, + // Wparentheses have to be suppressed globally. +# pragma GCC diagnostic ignored "-Wparentheses" // See #674 for details + +# pragma GCC diagnostic push +# pragma GCC diagnostic ignored "-Wunused-variable" +# pragma GCC diagnostic ignored "-Wpadded" +#endif +// end catch_suppress_warnings.h +#if defined(CATCH_CONFIG_MAIN) || defined(CATCH_CONFIG_RUNNER) +# define CATCH_IMPL +# define CATCH_CONFIG_ALL_PARTS +#endif + +// In the impl file, we want to have access to all parts of the headers +// Can also be used to sanely support PCHs +#if defined(CATCH_CONFIG_ALL_PARTS) +# define CATCH_CONFIG_EXTERNAL_INTERFACES +# if defined(CATCH_CONFIG_DISABLE_MATCHERS) +# undef CATCH_CONFIG_DISABLE_MATCHERS +# endif +# if !defined(CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER) +# define CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER +# endif +#endif + +#if !defined(CATCH_CONFIG_IMPL_ONLY) +// start catch_platform.h + +#ifdef __APPLE__ +# include <TargetConditionals.h> +# if TARGET_OS_OSX == 1 +# define CATCH_PLATFORM_MAC +# elif TARGET_OS_IPHONE == 1 +# define CATCH_PLATFORM_IPHONE +# endif + +#elif defined(linux) || defined(__linux) || defined(__linux__) +# define CATCH_PLATFORM_LINUX + +#elif defined(WIN32) || defined(__WIN32__) || defined(_WIN32) || defined(_MSC_VER) || defined(__MINGW32__) +# define CATCH_PLATFORM_WINDOWS +#endif + +// end catch_platform.h + +#ifdef CATCH_IMPL +# ifndef CLARA_CONFIG_MAIN +# define CLARA_CONFIG_MAIN_NOT_DEFINED +# define CLARA_CONFIG_MAIN +# endif +#endif + +// start catch_user_interfaces.h + +namespace Catch { + unsigned int rngSeed(); +} + +// end catch_user_interfaces.h +// start catch_tag_alias_autoregistrar.h + +// start catch_common.h + +// start catch_compiler_capabilities.h + +// Detect a number of compiler features - by compiler +// The following features are defined: +// +// CATCH_CONFIG_COUNTER : is the __COUNTER__ macro supported? +// CATCH_CONFIG_WINDOWS_SEH : is Windows SEH supported? +// CATCH_CONFIG_POSIX_SIGNALS : are POSIX signals supported? +// CATCH_CONFIG_DISABLE_EXCEPTIONS : Are exceptions enabled? +// **************** +// Note to maintainers: if new toggles are added please document them +// in configuration.md, too +// **************** + +// In general each macro has a _NO_<feature name> form +// (e.g. CATCH_CONFIG_NO_POSIX_SIGNALS) which disables the feature. +// Many features, at point of detection, define an _INTERNAL_ macro, so they +// can be combined, en-mass, with the _NO_ forms later. + +#ifdef __cplusplus + +# if (__cplusplus >= 201402L) || (defined(_MSVC_LANG) && _MSVC_LANG >= 201402L) +# define CATCH_CPP14_OR_GREATER +# endif + +# if (__cplusplus >= 201703L) || (defined(_MSVC_LANG) && _MSVC_LANG >= 201703L) +# define CATCH_CPP17_OR_GREATER +# endif + +#endif + +#if defined(CATCH_CPP17_OR_GREATER) +# define CATCH_INTERNAL_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS +#endif + +#ifdef __clang__ + +# define CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + _Pragma( "clang diagnostic push" ) \ + _Pragma( "clang diagnostic ignored \"-Wexit-time-destructors\"" ) \ + _Pragma( "clang diagnostic ignored \"-Wglobal-constructors\"") +# define CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \ + _Pragma( "clang diagnostic pop" ) + +# define CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS \ + _Pragma( "clang diagnostic push" ) \ + _Pragma( "clang diagnostic ignored \"-Wparentheses\"" ) +# define CATCH_INTERNAL_UNSUPPRESS_PARENTHESES_WARNINGS \ + _Pragma( "clang diagnostic pop" ) + +# define CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS \ + _Pragma( "clang diagnostic push" ) \ + _Pragma( "clang diagnostic ignored \"-Wunused-variable\"" ) +# define CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS \ + _Pragma( "clang diagnostic pop" ) + +# define CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \ + _Pragma( "clang diagnostic push" ) \ + _Pragma( "clang diagnostic ignored \"-Wgnu-zero-variadic-macro-arguments\"" ) +# define CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \ + _Pragma( "clang diagnostic pop" ) + +#endif // __clang__ + +//////////////////////////////////////////////////////////////////////////////// +// Assume that non-Windows platforms support posix signals by default +#if !defined(CATCH_PLATFORM_WINDOWS) + #define CATCH_INTERNAL_CONFIG_POSIX_SIGNALS +#endif + +//////////////////////////////////////////////////////////////////////////////// +// We know some environments not to support full POSIX signals +#if defined(__CYGWIN__) || defined(__QNX__) || defined(__EMSCRIPTEN__) || defined(__DJGPP__) + #define CATCH_INTERNAL_CONFIG_NO_POSIX_SIGNALS +#endif + +#ifdef __OS400__ +# define CATCH_INTERNAL_CONFIG_NO_POSIX_SIGNALS +# define CATCH_CONFIG_COLOUR_NONE +#endif + +//////////////////////////////////////////////////////////////////////////////// +// Android somehow still does not support std::to_string +#if defined(__ANDROID__) +# define CATCH_INTERNAL_CONFIG_NO_CPP11_TO_STRING +#endif + +//////////////////////////////////////////////////////////////////////////////// +// Not all Windows environments support SEH properly +#if defined(__MINGW32__) +# define CATCH_INTERNAL_CONFIG_NO_WINDOWS_SEH +#endif + +//////////////////////////////////////////////////////////////////////////////// +// PS4 +#if defined(__ORBIS__) +# define CATCH_INTERNAL_CONFIG_NO_NEW_CAPTURE +#endif + +//////////////////////////////////////////////////////////////////////////////// +// Cygwin +#ifdef __CYGWIN__ + +// Required for some versions of Cygwin to declare gettimeofday +// see: http://stackoverflow.com/questions/36901803/gettimeofday-not-declared-in-this-scope-cygwin +# define _BSD_SOURCE +// some versions of cygwin (most) do not support std::to_string. Use the libstd check. +// https://gcc.gnu.org/onlinedocs/gcc-4.8.2/libstdc++/api/a01053_source.html line 2812-2813 +# if !((__cplusplus >= 201103L) && defined(_GLIBCXX_USE_C99) \ + && !defined(_GLIBCXX_HAVE_BROKEN_VSWPRINTF)) + +# define CATCH_INTERNAL_CONFIG_NO_CPP11_TO_STRING + +# endif +#endif // __CYGWIN__ + +//////////////////////////////////////////////////////////////////////////////// +// Visual C++ +#ifdef _MSC_VER + +# if _MSC_VER >= 1900 // Visual Studio 2015 or newer +# define CATCH_INTERNAL_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS +# endif + +// Universal Windows platform does not support SEH +// Or console colours (or console at all...) +# if defined(WINAPI_FAMILY) && (WINAPI_FAMILY == WINAPI_FAMILY_APP) +# define CATCH_CONFIG_COLOUR_NONE +# else +# define CATCH_INTERNAL_CONFIG_WINDOWS_SEH +# endif + +// MSVC traditional preprocessor needs some workaround for __VA_ARGS__ +// _MSVC_TRADITIONAL == 0 means new conformant preprocessor +// _MSVC_TRADITIONAL == 1 means old traditional non-conformant preprocessor +# if !defined(_MSVC_TRADITIONAL) || (defined(_MSVC_TRADITIONAL) && _MSVC_TRADITIONAL) +# define CATCH_INTERNAL_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +# endif +#endif // _MSC_VER + +#if defined(_REENTRANT) || defined(_MSC_VER) +// Enable async processing, as -pthread is specified or no additional linking is required +# define CATCH_INTERNAL_CONFIG_USE_ASYNC +#endif // _MSC_VER + +//////////////////////////////////////////////////////////////////////////////// +// Check if we are compiled with -fno-exceptions or equivalent +#if defined(__EXCEPTIONS) || defined(__cpp_exceptions) || defined(_CPPUNWIND) +# define CATCH_INTERNAL_CONFIG_EXCEPTIONS_ENABLED +#endif + +//////////////////////////////////////////////////////////////////////////////// +// DJGPP +#ifdef __DJGPP__ +# define CATCH_INTERNAL_CONFIG_NO_WCHAR +#endif // __DJGPP__ + +//////////////////////////////////////////////////////////////////////////////// +// Embarcadero C++Build +#if defined(__BORLANDC__) + #define CATCH_INTERNAL_CONFIG_POLYFILL_ISNAN +#endif + +//////////////////////////////////////////////////////////////////////////////// + +// Use of __COUNTER__ is suppressed during code analysis in +// CLion/AppCode 2017.2.x and former, because __COUNTER__ is not properly +// handled by it. +// Otherwise all supported compilers support COUNTER macro, +// but user still might want to turn it off +#if ( !defined(__JETBRAINS_IDE__) || __JETBRAINS_IDE__ >= 20170300L ) + #define CATCH_INTERNAL_CONFIG_COUNTER +#endif + +//////////////////////////////////////////////////////////////////////////////// +// Check if string_view is available and usable +// The check is split apart to work around v140 (VS2015) preprocessor issue... +#if defined(__has_include) +#if __has_include(<string_view>) && defined(CATCH_CPP17_OR_GREATER) +# define CATCH_INTERNAL_CONFIG_CPP17_STRING_VIEW +#endif +#endif + +//////////////////////////////////////////////////////////////////////////////// +// Check if optional is available and usable +#if defined(__has_include) +# if __has_include(<optional>) && defined(CATCH_CPP17_OR_GREATER) +# define CATCH_INTERNAL_CONFIG_CPP17_OPTIONAL +# endif // __has_include(<optional>) && defined(CATCH_CPP17_OR_GREATER) +#endif // __has_include + +//////////////////////////////////////////////////////////////////////////////// +// Check if variant is available and usable +#if defined(__has_include) +# if __has_include(<variant>) && defined(CATCH_CPP17_OR_GREATER) +# if defined(__clang__) && (__clang_major__ < 8) + // work around clang bug with libstdc++ https://bugs.llvm.org/show_bug.cgi?id=31852 + // fix should be in clang 8, workaround in libstdc++ 8.2 +# include <ciso646> +# if defined(__GLIBCXX__) && defined(_GLIBCXX_RELEASE) && (_GLIBCXX_RELEASE < 9) +# define CATCH_CONFIG_NO_CPP17_VARIANT +# else +# define CATCH_INTERNAL_CONFIG_CPP17_VARIANT +# endif // defined(__GLIBCXX__) && defined(_GLIBCXX_RELEASE) && (_GLIBCXX_RELEASE < 9) +# else +# define CATCH_INTERNAL_CONFIG_CPP17_VARIANT +# endif // defined(__clang__) && (__clang_major__ < 8) +# endif // __has_include(<variant>) && defined(CATCH_CPP17_OR_GREATER) +#endif // __has_include + +#if defined(CATCH_INTERNAL_CONFIG_COUNTER) && !defined(CATCH_CONFIG_NO_COUNTER) && !defined(CATCH_CONFIG_COUNTER) +# define CATCH_CONFIG_COUNTER +#endif +#if defined(CATCH_INTERNAL_CONFIG_WINDOWS_SEH) && !defined(CATCH_CONFIG_NO_WINDOWS_SEH) && !defined(CATCH_CONFIG_WINDOWS_SEH) && !defined(CATCH_INTERNAL_CONFIG_NO_WINDOWS_SEH) +# define CATCH_CONFIG_WINDOWS_SEH +#endif +// This is set by default, because we assume that unix compilers are posix-signal-compatible by default. +#if defined(CATCH_INTERNAL_CONFIG_POSIX_SIGNALS) && !defined(CATCH_INTERNAL_CONFIG_NO_POSIX_SIGNALS) && !defined(CATCH_CONFIG_NO_POSIX_SIGNALS) && !defined(CATCH_CONFIG_POSIX_SIGNALS) +# define CATCH_CONFIG_POSIX_SIGNALS +#endif +// This is set by default, because we assume that compilers with no wchar_t support are just rare exceptions. +#if !defined(CATCH_INTERNAL_CONFIG_NO_WCHAR) && !defined(CATCH_CONFIG_NO_WCHAR) && !defined(CATCH_CONFIG_WCHAR) +# define CATCH_CONFIG_WCHAR +#endif + +#if !defined(CATCH_INTERNAL_CONFIG_NO_CPP11_TO_STRING) && !defined(CATCH_CONFIG_NO_CPP11_TO_STRING) && !defined(CATCH_CONFIG_CPP11_TO_STRING) +# define CATCH_CONFIG_CPP11_TO_STRING +#endif + +#if defined(CATCH_INTERNAL_CONFIG_CPP17_OPTIONAL) && !defined(CATCH_CONFIG_NO_CPP17_OPTIONAL) && !defined(CATCH_CONFIG_CPP17_OPTIONAL) +# define CATCH_CONFIG_CPP17_OPTIONAL +#endif + +#if defined(CATCH_INTERNAL_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS) && !defined(CATCH_CONFIG_NO_CPP17_UNCAUGHT_EXCEPTIONS) && !defined(CATCH_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS) +# define CATCH_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS +#endif + +#if defined(CATCH_INTERNAL_CONFIG_CPP17_STRING_VIEW) && !defined(CATCH_CONFIG_NO_CPP17_STRING_VIEW) && !defined(CATCH_CONFIG_CPP17_STRING_VIEW) +# define CATCH_CONFIG_CPP17_STRING_VIEW +#endif + +#if defined(CATCH_INTERNAL_CONFIG_CPP17_VARIANT) && !defined(CATCH_CONFIG_NO_CPP17_VARIANT) && !defined(CATCH_CONFIG_CPP17_VARIANT) +# define CATCH_CONFIG_CPP17_VARIANT +#endif + +#if defined(CATCH_CONFIG_EXPERIMENTAL_REDIRECT) +# define CATCH_INTERNAL_CONFIG_NEW_CAPTURE +#endif + +#if defined(CATCH_INTERNAL_CONFIG_NEW_CAPTURE) && !defined(CATCH_INTERNAL_CONFIG_NO_NEW_CAPTURE) && !defined(CATCH_CONFIG_NO_NEW_CAPTURE) && !defined(CATCH_CONFIG_NEW_CAPTURE) +# define CATCH_CONFIG_NEW_CAPTURE +#endif + +#if !defined(CATCH_INTERNAL_CONFIG_EXCEPTIONS_ENABLED) && !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) +# define CATCH_CONFIG_DISABLE_EXCEPTIONS +#endif + +#if defined(CATCH_INTERNAL_CONFIG_POLYFILL_ISNAN) && !defined(CATCH_CONFIG_NO_POLYFILL_ISNAN) && !defined(CATCH_CONFIG_POLYFILL_ISNAN) +# define CATCH_CONFIG_POLYFILL_ISNAN +#endif + +#if defined(CATCH_INTERNAL_CONFIG_USE_ASYNC) && !defined(CATCH_CONFIG_NO_USE_ASYNC) && !defined(CATCH_CONFIG_USE_ASYNC) +# define CATCH_CONFIG_USE_ASYNC +#endif + +#if !defined(CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS) +# define CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS +# define CATCH_INTERNAL_UNSUPPRESS_PARENTHESES_WARNINGS +#endif +#if !defined(CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS) +# define CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS +# define CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS +#endif +#if !defined(CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS) +# define CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS +# define CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS +#endif +#if !defined(CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS) +# define CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS +# define CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS +#endif + +#if defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) +#define CATCH_TRY if ((true)) +#define CATCH_CATCH_ALL if ((false)) +#define CATCH_CATCH_ANON(type) if ((false)) +#else +#define CATCH_TRY try +#define CATCH_CATCH_ALL catch (...) +#define CATCH_CATCH_ANON(type) catch (type) +#endif + +#if defined(CATCH_INTERNAL_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR) && !defined(CATCH_CONFIG_NO_TRADITIONAL_MSVC_PREPROCESSOR) && !defined(CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR) +#define CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +#endif + +// end catch_compiler_capabilities.h +#define INTERNAL_CATCH_UNIQUE_NAME_LINE2( name, line ) name##line +#define INTERNAL_CATCH_UNIQUE_NAME_LINE( name, line ) INTERNAL_CATCH_UNIQUE_NAME_LINE2( name, line ) +#ifdef CATCH_CONFIG_COUNTER +# define INTERNAL_CATCH_UNIQUE_NAME( name ) INTERNAL_CATCH_UNIQUE_NAME_LINE( name, __COUNTER__ ) +#else +# define INTERNAL_CATCH_UNIQUE_NAME( name ) INTERNAL_CATCH_UNIQUE_NAME_LINE( name, __LINE__ ) +#endif + +#include <iosfwd> +#include <string> +#include <cstdint> + +// We need a dummy global operator<< so we can bring it into Catch namespace later +struct Catch_global_namespace_dummy {}; +std::ostream& operator<<(std::ostream&, Catch_global_namespace_dummy); + +namespace Catch { + + struct CaseSensitive { enum Choice { + Yes, + No + }; }; + + class NonCopyable { + NonCopyable( NonCopyable const& ) = delete; + NonCopyable( NonCopyable && ) = delete; + NonCopyable& operator = ( NonCopyable const& ) = delete; + NonCopyable& operator = ( NonCopyable && ) = delete; + + protected: + NonCopyable(); + virtual ~NonCopyable(); + }; + + struct SourceLineInfo { + + SourceLineInfo() = delete; + SourceLineInfo( char const* _file, std::size_t _line ) noexcept + : file( _file ), + line( _line ) + {} + + SourceLineInfo( SourceLineInfo const& other ) = default; + SourceLineInfo& operator = ( SourceLineInfo const& ) = default; + SourceLineInfo( SourceLineInfo&& ) noexcept = default; + SourceLineInfo& operator = ( SourceLineInfo&& ) noexcept = default; + + bool empty() const noexcept; + bool operator == ( SourceLineInfo const& other ) const noexcept; + bool operator < ( SourceLineInfo const& other ) const noexcept; + + char const* file; + std::size_t line; + }; + + std::ostream& operator << ( std::ostream& os, SourceLineInfo const& info ); + + // Bring in operator<< from global namespace into Catch namespace + // This is necessary because the overload of operator<< above makes + // lookup stop at namespace Catch + using ::operator<<; + + // Use this in variadic streaming macros to allow + // >> +StreamEndStop + // as well as + // >> stuff +StreamEndStop + struct StreamEndStop { + std::string operator+() const; + }; + template<typename T> + T const& operator + ( T const& value, StreamEndStop ) { + return value; + } +} + +#define CATCH_INTERNAL_LINEINFO \ + ::Catch::SourceLineInfo( __FILE__, static_cast<std::size_t>( __LINE__ ) ) + +// end catch_common.h +namespace Catch { + + struct RegistrarForTagAliases { + RegistrarForTagAliases( char const* alias, char const* tag, SourceLineInfo const& lineInfo ); + }; + +} // end namespace Catch + +#define CATCH_REGISTER_TAG_ALIAS( alias, spec ) \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + namespace{ Catch::RegistrarForTagAliases INTERNAL_CATCH_UNIQUE_NAME( AutoRegisterTagAlias )( alias, spec, CATCH_INTERNAL_LINEINFO ); } \ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS + +// end catch_tag_alias_autoregistrar.h +// start catch_test_registry.h + +// start catch_interfaces_testcase.h + +#include <vector> + +namespace Catch { + + class TestSpec; + + struct ITestInvoker { + virtual void invoke () const = 0; + virtual ~ITestInvoker(); + }; + + class TestCase; + struct IConfig; + + struct ITestCaseRegistry { + virtual ~ITestCaseRegistry(); + virtual std::vector<TestCase> const& getAllTests() const = 0; + virtual std::vector<TestCase> const& getAllTestsSorted( IConfig const& config ) const = 0; + }; + + bool matchTest( TestCase const& testCase, TestSpec const& testSpec, IConfig const& config ); + std::vector<TestCase> filterTests( std::vector<TestCase> const& testCases, TestSpec const& testSpec, IConfig const& config ); + std::vector<TestCase> const& getAllTestCasesSorted( IConfig const& config ); + +} + +// end catch_interfaces_testcase.h +// start catch_stringref.h + +#include <cstddef> +#include <string> +#include <iosfwd> + +namespace Catch { + + /// A non-owning string class (similar to the forthcoming std::string_view) + /// Note that, because a StringRef may be a substring of another string, + /// it may not be null terminated. c_str() must return a null terminated + /// string, however, and so the StringRef will internally take ownership + /// (taking a copy), if necessary. In theory this ownership is not externally + /// visible - but it does mean (substring) StringRefs should not be shared between + /// threads. + class StringRef { + public: + using size_type = std::size_t; + + private: + friend struct StringRefTestAccess; + + char const* m_start; + size_type m_size; + + char* m_data = nullptr; + + void takeOwnership(); + + static constexpr char const* const s_empty = ""; + + public: // construction/ assignment + StringRef() noexcept + : StringRef( s_empty, 0 ) + {} + + StringRef( StringRef const& other ) noexcept + : m_start( other.m_start ), + m_size( other.m_size ) + {} + + StringRef( StringRef&& other ) noexcept + : m_start( other.m_start ), + m_size( other.m_size ), + m_data( other.m_data ) + { + other.m_data = nullptr; + } + + StringRef( char const* rawChars ) noexcept; + + StringRef( char const* rawChars, size_type size ) noexcept + : m_start( rawChars ), + m_size( size ) + {} + + StringRef( std::string const& stdString ) noexcept + : m_start( stdString.c_str() ), + m_size( stdString.size() ) + {} + + ~StringRef() noexcept { + delete[] m_data; + } + + auto operator = ( StringRef const &other ) noexcept -> StringRef& { + delete[] m_data; + m_data = nullptr; + m_start = other.m_start; + m_size = other.m_size; + return *this; + } + + operator std::string() const; + + void swap( StringRef& other ) noexcept; + + public: // operators + auto operator == ( StringRef const& other ) const noexcept -> bool; + auto operator != ( StringRef const& other ) const noexcept -> bool; + + auto operator[] ( size_type index ) const noexcept -> char; + + public: // named queries + auto empty() const noexcept -> bool { + return m_size == 0; + } + auto size() const noexcept -> size_type { + return m_size; + } + + auto numberOfCharacters() const noexcept -> size_type; + auto c_str() const -> char const*; + + public: // substrings and searches + auto substr( size_type start, size_type size ) const noexcept -> StringRef; + + // Returns the current start pointer. + // Note that the pointer can change when if the StringRef is a substring + auto currentData() const noexcept -> char const*; + + private: // ownership queries - may not be consistent between calls + auto isOwned() const noexcept -> bool; + auto isSubstring() const noexcept -> bool; + }; + + auto operator + ( StringRef const& lhs, StringRef const& rhs ) -> std::string; + auto operator + ( StringRef const& lhs, char const* rhs ) -> std::string; + auto operator + ( char const* lhs, StringRef const& rhs ) -> std::string; + + auto operator += ( std::string& lhs, StringRef const& sr ) -> std::string&; + auto operator << ( std::ostream& os, StringRef const& sr ) -> std::ostream&; + + inline auto operator "" _sr( char const* rawChars, std::size_t size ) noexcept -> StringRef { + return StringRef( rawChars, size ); + } + +} // namespace Catch + +inline auto operator "" _catch_sr( char const* rawChars, std::size_t size ) noexcept -> Catch::StringRef { + return Catch::StringRef( rawChars, size ); +} + +// end catch_stringref.h +// start catch_type_traits.hpp + + +#include <type_traits> + +namespace Catch{ + +#ifdef CATCH_CPP17_OR_GREATER + template <typename...> + inline constexpr auto is_unique = std::true_type{}; + + template <typename T, typename... Rest> + inline constexpr auto is_unique<T, Rest...> = std::bool_constant< + (!std::is_same_v<T, Rest> && ...) && is_unique<Rest...> + >{}; +#else + +template <typename...> +struct is_unique : std::true_type{}; + +template <typename T0, typename T1, typename... Rest> +struct is_unique<T0, T1, Rest...> : std::integral_constant +<bool, + !std::is_same<T0, T1>::value + && is_unique<T0, Rest...>::value + && is_unique<T1, Rest...>::value +>{}; + +#endif +} + +// end catch_type_traits.hpp +// start catch_preprocessor.hpp + + +#define CATCH_RECURSION_LEVEL0(...) __VA_ARGS__ +#define CATCH_RECURSION_LEVEL1(...) CATCH_RECURSION_LEVEL0(CATCH_RECURSION_LEVEL0(CATCH_RECURSION_LEVEL0(__VA_ARGS__))) +#define CATCH_RECURSION_LEVEL2(...) CATCH_RECURSION_LEVEL1(CATCH_RECURSION_LEVEL1(CATCH_RECURSION_LEVEL1(__VA_ARGS__))) +#define CATCH_RECURSION_LEVEL3(...) CATCH_RECURSION_LEVEL2(CATCH_RECURSION_LEVEL2(CATCH_RECURSION_LEVEL2(__VA_ARGS__))) +#define CATCH_RECURSION_LEVEL4(...) CATCH_RECURSION_LEVEL3(CATCH_RECURSION_LEVEL3(CATCH_RECURSION_LEVEL3(__VA_ARGS__))) +#define CATCH_RECURSION_LEVEL5(...) CATCH_RECURSION_LEVEL4(CATCH_RECURSION_LEVEL4(CATCH_RECURSION_LEVEL4(__VA_ARGS__))) + +#ifdef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +#define INTERNAL_CATCH_EXPAND_VARGS(...) __VA_ARGS__ +// MSVC needs more evaluations +#define CATCH_RECURSION_LEVEL6(...) CATCH_RECURSION_LEVEL5(CATCH_RECURSION_LEVEL5(CATCH_RECURSION_LEVEL5(__VA_ARGS__))) +#define CATCH_RECURSE(...) CATCH_RECURSION_LEVEL6(CATCH_RECURSION_LEVEL6(__VA_ARGS__)) +#else +#define CATCH_RECURSE(...) CATCH_RECURSION_LEVEL5(__VA_ARGS__) +#endif + +#define CATCH_REC_END(...) +#define CATCH_REC_OUT + +#define CATCH_EMPTY() +#define CATCH_DEFER(id) id CATCH_EMPTY() + +#define CATCH_REC_GET_END2() 0, CATCH_REC_END +#define CATCH_REC_GET_END1(...) CATCH_REC_GET_END2 +#define CATCH_REC_GET_END(...) CATCH_REC_GET_END1 +#define CATCH_REC_NEXT0(test, next, ...) next CATCH_REC_OUT +#define CATCH_REC_NEXT1(test, next) CATCH_DEFER ( CATCH_REC_NEXT0 ) ( test, next, 0) +#define CATCH_REC_NEXT(test, next) CATCH_REC_NEXT1(CATCH_REC_GET_END test, next) + +#define CATCH_REC_LIST0(f, x, peek, ...) , f(x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1) ) ( f, peek, __VA_ARGS__ ) +#define CATCH_REC_LIST1(f, x, peek, ...) , f(x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST0) ) ( f, peek, __VA_ARGS__ ) +#define CATCH_REC_LIST2(f, x, peek, ...) f(x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1) ) ( f, peek, __VA_ARGS__ ) + +#define CATCH_REC_LIST0_UD(f, userdata, x, peek, ...) , f(userdata, x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1_UD) ) ( f, userdata, peek, __VA_ARGS__ ) +#define CATCH_REC_LIST1_UD(f, userdata, x, peek, ...) , f(userdata, x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST0_UD) ) ( f, userdata, peek, __VA_ARGS__ ) +#define CATCH_REC_LIST2_UD(f, userdata, x, peek, ...) f(userdata, x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1_UD) ) ( f, userdata, peek, __VA_ARGS__ ) + +// Applies the function macro `f` to each of the remaining parameters, inserts commas between the results, +// and passes userdata as the first parameter to each invocation, +// e.g. CATCH_REC_LIST_UD(f, x, a, b, c) evaluates to f(x, a), f(x, b), f(x, c) +#define CATCH_REC_LIST_UD(f, userdata, ...) CATCH_RECURSE(CATCH_REC_LIST2_UD(f, userdata, __VA_ARGS__, ()()(), ()()(), ()()(), 0)) + +#define CATCH_REC_LIST(f, ...) CATCH_RECURSE(CATCH_REC_LIST2(f, __VA_ARGS__, ()()(), ()()(), ()()(), 0)) + +#define INTERNAL_CATCH_EXPAND1(param) INTERNAL_CATCH_EXPAND2(param) +#define INTERNAL_CATCH_EXPAND2(...) INTERNAL_CATCH_NO## __VA_ARGS__ +#define INTERNAL_CATCH_DEF(...) INTERNAL_CATCH_DEF __VA_ARGS__ +#define INTERNAL_CATCH_NOINTERNAL_CATCH_DEF +#define INTERNAL_CATCH_STRINGIZE(...) INTERNAL_CATCH_STRINGIZE2(__VA_ARGS__) +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +#define INTERNAL_CATCH_STRINGIZE2(...) #__VA_ARGS__ +#define INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS(param) INTERNAL_CATCH_STRINGIZE(INTERNAL_CATCH_REMOVE_PARENS(param)) +#else +// MSVC is adding extra space and needs another indirection to expand INTERNAL_CATCH_NOINTERNAL_CATCH_DEF +#define INTERNAL_CATCH_STRINGIZE2(...) INTERNAL_CATCH_STRINGIZE3(__VA_ARGS__) +#define INTERNAL_CATCH_STRINGIZE3(...) #__VA_ARGS__ +#define INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS(param) (INTERNAL_CATCH_STRINGIZE(INTERNAL_CATCH_REMOVE_PARENS(param)) + 1) +#endif + +#define INTERNAL_CATCH_MAKE_NAMESPACE2(...) ns_##__VA_ARGS__ +#define INTERNAL_CATCH_MAKE_NAMESPACE(name) INTERNAL_CATCH_MAKE_NAMESPACE2(name) + +#define INTERNAL_CATCH_REMOVE_PARENS(...) INTERNAL_CATCH_EXPAND1(INTERNAL_CATCH_DEF __VA_ARGS__) + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +#define INTERNAL_CATCH_MAKE_TYPE_LIST2(...) decltype(get_wrapper<INTERNAL_CATCH_REMOVE_PARENS_GEN(__VA_ARGS__)>()) +#define INTERNAL_CATCH_MAKE_TYPE_LIST(...) INTERNAL_CATCH_MAKE_TYPE_LIST2(INTERNAL_CATCH_REMOVE_PARENS(__VA_ARGS__)) +#else +#define INTERNAL_CATCH_MAKE_TYPE_LIST2(...) INTERNAL_CATCH_EXPAND_VARGS(decltype(get_wrapper<INTERNAL_CATCH_REMOVE_PARENS_GEN(__VA_ARGS__)>())) +#define INTERNAL_CATCH_MAKE_TYPE_LIST(...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_MAKE_TYPE_LIST2(INTERNAL_CATCH_REMOVE_PARENS(__VA_ARGS__))) +#endif + +#define INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(...)\ + CATCH_REC_LIST(INTERNAL_CATCH_MAKE_TYPE_LIST,__VA_ARGS__) + +#define INTERNAL_CATCH_REMOVE_PARENS_1_ARG(_0) INTERNAL_CATCH_REMOVE_PARENS(_0) +#define INTERNAL_CATCH_REMOVE_PARENS_2_ARG(_0, _1) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_1_ARG(_1) +#define INTERNAL_CATCH_REMOVE_PARENS_3_ARG(_0, _1, _2) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_2_ARG(_1, _2) +#define INTERNAL_CATCH_REMOVE_PARENS_4_ARG(_0, _1, _2, _3) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_3_ARG(_1, _2, _3) +#define INTERNAL_CATCH_REMOVE_PARENS_5_ARG(_0, _1, _2, _3, _4) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_4_ARG(_1, _2, _3, _4) +#define INTERNAL_CATCH_REMOVE_PARENS_6_ARG(_0, _1, _2, _3, _4, _5) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_5_ARG(_1, _2, _3, _4, _5) +#define INTERNAL_CATCH_REMOVE_PARENS_7_ARG(_0, _1, _2, _3, _4, _5, _6) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_6_ARG(_1, _2, _4, _5, _6) +#define INTERNAL_CATCH_REMOVE_PARENS_8_ARG(_0, _1, _2, _3, _4, _5, _6, _7) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_7_ARG(_1, _2, _3, _4, _5, _6, _7) +#define INTERNAL_CATCH_REMOVE_PARENS_9_ARG(_0, _1, _2, _3, _4, _5, _6, _7, _8) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_8_ARG(_1, _2, _3, _4, _5, _6, _7, _8) +#define INTERNAL_CATCH_REMOVE_PARENS_10_ARG(_0, _1, _2, _3, _4, _5, _6, _7, _8, _9) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_9_ARG(_1, _2, _3, _4, _5, _6, _7, _8, _9) +#define INTERNAL_CATCH_REMOVE_PARENS_11_ARG(_0, _1, _2, _3, _4, _5, _6, _7, _8, _9, _10) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_10_ARG(_1, _2, _3, _4, _5, _6, _7, _8, _9, _10) + +#define INTERNAL_CATCH_VA_NARGS_IMPL(_0, _1, _2, _3, _4, _5, _6, _7, _8, _9, _10, N, ...) N + +#define INTERNAL_CATCH_TYPE_GEN\ + template<typename...> struct TypeList {};\ + template<typename...Ts>\ + constexpr auto get_wrapper() noexcept -> TypeList<Ts...> { return {}; }\ + \ + template<template<typename...> class L1, typename...E1, template<typename...> class L2, typename...E2> \ + constexpr auto append(L1<E1...>, L2<E2...>) noexcept -> L1<E1...,E2...> { return {}; }\ + template< template<typename...> class L1, typename...E1, template<typename...> class L2, typename...E2, typename...Rest>\ + constexpr auto append(L1<E1...>, L2<E2...>, Rest...) noexcept -> decltype(append(L1<E1...,E2...>{}, Rest{}...)) { return {}; }\ + template< template<typename...> class L1, typename...E1, typename...Rest>\ + constexpr auto append(L1<E1...>, TypeList<mpl_::na>, Rest...) noexcept -> L1<E1...> { return {}; }\ + \ + template< template<typename...> class Container, template<typename...> class List, typename...elems>\ + constexpr auto rewrap(List<elems...>) noexcept -> TypeList<Container<elems...>> { return {}; }\ + template< template<typename...> class Container, template<typename...> class List, class...Elems, typename...Elements>\ + constexpr auto rewrap(List<Elems...>,Elements...) noexcept -> decltype(append(TypeList<Container<Elems...>>{}, rewrap<Container>(Elements{}...))) { return {}; }\ + \ + template<template <typename...> class Final, template< typename...> class...Containers, typename...Types>\ + constexpr auto create(TypeList<Types...>) noexcept -> decltype(append(Final<>{}, rewrap<Containers>(Types{}...)...)) { return {}; }\ + template<template <typename...> class Final, template <typename...> class List, typename...Ts>\ + constexpr auto convert(List<Ts...>) noexcept -> decltype(append(Final<>{},TypeList<Ts>{}...)) { return {}; } + +#define INTERNAL_CATCH_NTTP_1(signature, ...)\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)> struct Nttp{};\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\ + constexpr auto get_wrapper() noexcept -> Nttp<__VA_ARGS__> { return {}; } \ + \ + template< template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class Container, template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class List, INTERNAL_CATCH_REMOVE_PARENS(signature)>\ + constexpr auto rewrap(List<__VA_ARGS__>) noexcept -> TypeList<Container<__VA_ARGS__>> { return {}; }\ + template< template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class Container, template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class List, INTERNAL_CATCH_REMOVE_PARENS(signature), typename...Elements>\ + constexpr auto rewrap(List<__VA_ARGS__>,Elements...elems) noexcept -> decltype(append(TypeList<Container<__VA_ARGS__>>{}, rewrap<Container>(elems...))) { return {}; }\ + template<template <typename...> class Final, template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class...Containers, typename...Types>\ + constexpr auto create(TypeList<Types...>) noexcept -> decltype(append(Final<>{}, rewrap<Containers>(Types{}...)...)) { return {}; } + +#define INTERNAL_CATCH_DECLARE_SIG_TEST0(TestName) +#define INTERNAL_CATCH_DECLARE_SIG_TEST1(TestName, signature)\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\ + static void TestName() +#define INTERNAL_CATCH_DECLARE_SIG_TEST_X(TestName, signature, ...)\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\ + static void TestName() + +#define INTERNAL_CATCH_DEFINE_SIG_TEST0(TestName) +#define INTERNAL_CATCH_DEFINE_SIG_TEST1(TestName, signature)\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\ + static void TestName() +#define INTERNAL_CATCH_DEFINE_SIG_TEST_X(TestName, signature,...)\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\ + static void TestName() + +#define INTERNAL_CATCH_NTTP_REGISTER0(TestFunc, signature)\ + template<typename Type>\ + void reg_test(TypeList<Type>, Catch::NameAndTags nameAndTags)\ + {\ + Catch::AutoReg( Catch::makeTestInvoker(&TestFunc<Type>), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), nameAndTags);\ + } + +#define INTERNAL_CATCH_NTTP_REGISTER(TestFunc, signature, ...)\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\ + void reg_test(Nttp<__VA_ARGS__>, Catch::NameAndTags nameAndTags)\ + {\ + Catch::AutoReg( Catch::makeTestInvoker(&TestFunc<__VA_ARGS__>), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), nameAndTags);\ + } + +#define INTERNAL_CATCH_NTTP_REGISTER_METHOD0(TestName, signature, ...)\ + template<typename Type>\ + void reg_test(TypeList<Type>, Catch::StringRef className, Catch::NameAndTags nameAndTags)\ + {\ + Catch::AutoReg( Catch::makeTestInvoker(&TestName<Type>::test), CATCH_INTERNAL_LINEINFO, className, nameAndTags);\ + } + +#define INTERNAL_CATCH_NTTP_REGISTER_METHOD(TestName, signature, ...)\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\ + void reg_test(Nttp<__VA_ARGS__>, Catch::StringRef className, Catch::NameAndTags nameAndTags)\ + {\ + Catch::AutoReg( Catch::makeTestInvoker(&TestName<__VA_ARGS__>::test), CATCH_INTERNAL_LINEINFO, className, nameAndTags);\ + } + +#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD0(TestName, ClassName) +#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD1(TestName, ClassName, signature)\ + template<typename TestType> \ + struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName)<TestType> { \ + void test();\ + } + +#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X(TestName, ClassName, signature, ...)\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)> \ + struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName)<__VA_ARGS__> { \ + void test();\ + } + +#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD0(TestName) +#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD1(TestName, signature)\ + template<typename TestType> \ + void INTERNAL_CATCH_MAKE_NAMESPACE(TestName)::TestName<TestType>::test() +#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X(TestName, signature, ...)\ + template<INTERNAL_CATCH_REMOVE_PARENS(signature)> \ + void INTERNAL_CATCH_MAKE_NAMESPACE(TestName)::TestName<__VA_ARGS__>::test() + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +#define INTERNAL_CATCH_NTTP_0 +#define INTERNAL_CATCH_NTTP_GEN(...) INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__),INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_0) +#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD1, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD0)(TestName, __VA_ARGS__) +#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD1, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD0)(TestName, ClassName, __VA_ARGS__) +#define INTERNAL_CATCH_NTTP_REG_METHOD_GEN(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD0, INTERNAL_CATCH_NTTP_REGISTER_METHOD0)(TestName, __VA_ARGS__) +#define INTERNAL_CATCH_NTTP_REG_GEN(TestFunc, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER0, INTERNAL_CATCH_NTTP_REGISTER0)(TestFunc, __VA_ARGS__) +#define INTERNAL_CATCH_DEFINE_SIG_TEST(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST1, INTERNAL_CATCH_DEFINE_SIG_TEST0)(TestName, __VA_ARGS__) +#define INTERNAL_CATCH_DECLARE_SIG_TEST(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST1, INTERNAL_CATCH_DECLARE_SIG_TEST0)(TestName, __VA_ARGS__) +#define INTERNAL_CATCH_REMOVE_PARENS_GEN(...) INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_REMOVE_PARENS_11_ARG,INTERNAL_CATCH_REMOVE_PARENS_10_ARG,INTERNAL_CATCH_REMOVE_PARENS_9_ARG,INTERNAL_CATCH_REMOVE_PARENS_8_ARG,INTERNAL_CATCH_REMOVE_PARENS_7_ARG,INTERNAL_CATCH_REMOVE_PARENS_6_ARG,INTERNAL_CATCH_REMOVE_PARENS_5_ARG,INTERNAL_CATCH_REMOVE_PARENS_4_ARG,INTERNAL_CATCH_REMOVE_PARENS_3_ARG,INTERNAL_CATCH_REMOVE_PARENS_2_ARG,INTERNAL_CATCH_REMOVE_PARENS_1_ARG)(__VA_ARGS__) +#else +#define INTERNAL_CATCH_NTTP_0(signature) +#define INTERNAL_CATCH_NTTP_GEN(...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1,INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_0)( __VA_ARGS__)) +#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD1, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD0)(TestName, __VA_ARGS__)) +#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD1, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD0)(TestName, ClassName, __VA_ARGS__)) +#define INTERNAL_CATCH_NTTP_REG_METHOD_GEN(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD0, INTERNAL_CATCH_NTTP_REGISTER_METHOD0)(TestName, __VA_ARGS__)) +#define INTERNAL_CATCH_NTTP_REG_GEN(TestFunc, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER0, INTERNAL_CATCH_NTTP_REGISTER0)(TestFunc, __VA_ARGS__)) +#define INTERNAL_CATCH_DEFINE_SIG_TEST(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST1, INTERNAL_CATCH_DEFINE_SIG_TEST0)(TestName, __VA_ARGS__)) +#define INTERNAL_CATCH_DECLARE_SIG_TEST(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST1, INTERNAL_CATCH_DECLARE_SIG_TEST0)(TestName, __VA_ARGS__)) +#define INTERNAL_CATCH_REMOVE_PARENS_GEN(...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_REMOVE_PARENS_11_ARG,INTERNAL_CATCH_REMOVE_PARENS_10_ARG,INTERNAL_CATCH_REMOVE_PARENS_9_ARG,INTERNAL_CATCH_REMOVE_PARENS_8_ARG,INTERNAL_CATCH_REMOVE_PARENS_7_ARG,INTERNAL_CATCH_REMOVE_PARENS_6_ARG,INTERNAL_CATCH_REMOVE_PARENS_5_ARG,INTERNAL_CATCH_REMOVE_PARENS_4_ARG,INTERNAL_CATCH_REMOVE_PARENS_3_ARG,INTERNAL_CATCH_REMOVE_PARENS_2_ARG,INTERNAL_CATCH_REMOVE_PARENS_1_ARG)(__VA_ARGS__)) +#endif + +// end catch_preprocessor.hpp +// start catch_meta.hpp + + +#include <type_traits> + +namespace Catch { +template<typename T> +struct always_false : std::false_type {}; + +template <typename> struct true_given : std::true_type {}; +struct is_callable_tester { + template <typename Fun, typename... Args> + true_given<decltype(std::declval<Fun>()(std::declval<Args>()...))> static test(int); + template <typename...> + std::false_type static test(...); +}; + +template <typename T> +struct is_callable; + +template <typename Fun, typename... Args> +struct is_callable<Fun(Args...)> : decltype(is_callable_tester::test<Fun, Args...>(0)) {}; + +} // namespace Catch + +namespace mpl_{ + struct na; +} + +// end catch_meta.hpp +namespace Catch { + +template<typename C> +class TestInvokerAsMethod : public ITestInvoker { + void (C::*m_testAsMethod)(); +public: + TestInvokerAsMethod( void (C::*testAsMethod)() ) noexcept : m_testAsMethod( testAsMethod ) {} + + void invoke() const override { + C obj; + (obj.*m_testAsMethod)(); + } +}; + +auto makeTestInvoker( void(*testAsFunction)() ) noexcept -> ITestInvoker*; + +template<typename C> +auto makeTestInvoker( void (C::*testAsMethod)() ) noexcept -> ITestInvoker* { + return new(std::nothrow) TestInvokerAsMethod<C>( testAsMethod ); +} + +struct NameAndTags { + NameAndTags( StringRef const& name_ = StringRef(), StringRef const& tags_ = StringRef() ) noexcept; + StringRef name; + StringRef tags; +}; + +struct AutoReg : NonCopyable { + AutoReg( ITestInvoker* invoker, SourceLineInfo const& lineInfo, StringRef const& classOrMethod, NameAndTags const& nameAndTags ) noexcept; + ~AutoReg(); +}; + +} // end namespace Catch + +#if defined(CATCH_CONFIG_DISABLE) + #define INTERNAL_CATCH_TESTCASE_NO_REGISTRATION( TestName, ... ) \ + static void TestName() + #define INTERNAL_CATCH_TESTCASE_METHOD_NO_REGISTRATION( TestName, ClassName, ... ) \ + namespace{ \ + struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName) { \ + void test(); \ + }; \ + } \ + void TestName::test() + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( TestName, TestFunc, Name, Tags, Signature, ... ) \ + INTERNAL_CATCH_DEFINE_SIG_TEST(TestFunc, INTERNAL_CATCH_REMOVE_PARENS(Signature)) + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( TestNameClass, TestName, ClassName, Name, Tags, Signature, ... ) \ + namespace{ \ + namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName) { \ + INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, INTERNAL_CATCH_REMOVE_PARENS(Signature));\ + } \ + } \ + INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, INTERNAL_CATCH_REMOVE_PARENS(Signature)) + + #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(Name, Tags, ...) \ + INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ ) + #else + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(Name, Tags, ...) \ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ ) ) + #endif + + #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(Name, Tags, Signature, ...) \ + INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) + #else + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(Name, Tags, Signature, ...) \ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) ) + #endif + + #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION( ClassName, Name, Tags,... ) \ + INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ ) + #else + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION( ClassName, Name, Tags,... ) \ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ ) ) + #endif + + #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION( ClassName, Name, Tags, Signature, ... ) \ + INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ ) + #else + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION( ClassName, Name, Tags, Signature, ... ) \ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ ) ) + #endif +#endif + + /////////////////////////////////////////////////////////////////////////////// + #define INTERNAL_CATCH_TESTCASE2( TestName, ... ) \ + static void TestName(); \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + namespace{ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar )( Catch::makeTestInvoker( &TestName ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ __VA_ARGS__ } ); } /* NOLINT */ \ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \ + static void TestName() + #define INTERNAL_CATCH_TESTCASE( ... ) \ + INTERNAL_CATCH_TESTCASE2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), __VA_ARGS__ ) + + /////////////////////////////////////////////////////////////////////////////// + #define INTERNAL_CATCH_METHOD_AS_TEST_CASE( QualifiedMethod, ... ) \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + namespace{ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar )( Catch::makeTestInvoker( &QualifiedMethod ), CATCH_INTERNAL_LINEINFO, "&" #QualifiedMethod, Catch::NameAndTags{ __VA_ARGS__ } ); } /* NOLINT */ \ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS + + /////////////////////////////////////////////////////////////////////////////// + #define INTERNAL_CATCH_TEST_CASE_METHOD2( TestName, ClassName, ... )\ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + namespace{ \ + struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName) { \ + void test(); \ + }; \ + Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar ) ( Catch::makeTestInvoker( &TestName::test ), CATCH_INTERNAL_LINEINFO, #ClassName, Catch::NameAndTags{ __VA_ARGS__ } ); /* NOLINT */ \ + } \ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \ + void TestName::test() + #define INTERNAL_CATCH_TEST_CASE_METHOD( ClassName, ... ) \ + INTERNAL_CATCH_TEST_CASE_METHOD2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), ClassName, __VA_ARGS__ ) + + /////////////////////////////////////////////////////////////////////////////// + #define INTERNAL_CATCH_REGISTER_TESTCASE( Function, ... ) \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar )( Catch::makeTestInvoker( Function ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ __VA_ARGS__ } ); /* NOLINT */ \ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS + + /////////////////////////////////////////////////////////////////////////////// + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_2(TestName, TestFunc, Name, Tags, Signature, ... )\ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \ + INTERNAL_CATCH_DECLARE_SIG_TEST(TestFunc, INTERNAL_CATCH_REMOVE_PARENS(Signature));\ + namespace {\ + namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){\ + INTERNAL_CATCH_TYPE_GEN\ + INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature))\ + INTERNAL_CATCH_NTTP_REG_GEN(TestFunc,INTERNAL_CATCH_REMOVE_PARENS(Signature))\ + template<typename...Types> \ + struct TestName{\ + TestName(){\ + int index = 0; \ + constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, __VA_ARGS__)};\ + using expander = int[];\ + (void)expander{(reg_test(Types{}, Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index]), Tags } ), index++, 0)... };/* NOLINT */ \ + }\ + };\ + static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\ + TestName<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(__VA_ARGS__)>();\ + return 0;\ + }();\ + }\ + }\ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \ + CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \ + INTERNAL_CATCH_DEFINE_SIG_TEST(TestFunc,INTERNAL_CATCH_REMOVE_PARENS(Signature)) + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE(Name, Tags, ...) \ + INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ ) +#else + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE(Name, Tags, ...) \ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ ) ) +#endif + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG(Name, Tags, Signature, ...) \ + INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) +#else + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG(Name, Tags, Signature, ...) \ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) ) +#endif + + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2(TestName, TestFuncName, Name, Tags, Signature, TmplTypes, TypesList) \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \ + template<typename TestType> static void TestFuncName(); \ + namespace {\ + namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName) { \ + INTERNAL_CATCH_TYPE_GEN \ + INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature)) \ + template<typename... Types> \ + struct TestName { \ + void reg_tests() { \ + int index = 0; \ + using expander = int[]; \ + constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes))};\ + constexpr char const* types_list[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TypesList))};\ + constexpr auto num_types = sizeof(types_list) / sizeof(types_list[0]);\ + (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestFuncName<Types> ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index / num_types]) + "<" + std::string(types_list[index % num_types]) + ">", Tags } ), index++, 0)... };/* NOLINT */\ + } \ + }; \ + static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){ \ + using TestInit = decltype(create<TestName, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes)>(TypeList<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(INTERNAL_CATCH_REMOVE_PARENS(TypesList))>{})); \ + TestInit t; \ + t.reg_tests(); \ + return 0; \ + }(); \ + } \ + } \ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \ + CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \ + template<typename TestType> \ + static void TestFuncName() + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE(Name, Tags, ...)\ + INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename T,__VA_ARGS__) +#else + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE(Name, Tags, ...)\ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename T, __VA_ARGS__ ) ) +#endif + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG(Name, Tags, Signature, ...)\ + INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__) +#else + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG(Name, Tags, Signature, ...)\ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) ) +#endif + + #define INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_2(TestName, TestFunc, Name, Tags, TmplList)\ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + template<typename TestType> static void TestFunc(); \ + namespace {\ + namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){\ + INTERNAL_CATCH_TYPE_GEN\ + template<typename... Types> \ + struct TestName { \ + void reg_tests() { \ + int index = 0; \ + using expander = int[]; \ + (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestFunc<Types> ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ Name " - " + std::string(INTERNAL_CATCH_STRINGIZE(TmplList)) + " - " + std::to_string(index), Tags } ), index++, 0)... };/* NOLINT */\ + } \ + };\ + static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){ \ + using TestInit = decltype(convert<TestName>(TmplList {})); \ + TestInit t; \ + t.reg_tests(); \ + return 0; \ + }(); \ + }}\ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \ + template<typename TestType> \ + static void TestFunc() + + #define INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE(Name, Tags, TmplList) \ + INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, TmplList ) + + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( TestNameClass, TestName, ClassName, Name, Tags, Signature, ... ) \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \ + namespace {\ + namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){ \ + INTERNAL_CATCH_TYPE_GEN\ + INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature))\ + INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, INTERNAL_CATCH_REMOVE_PARENS(Signature));\ + INTERNAL_CATCH_NTTP_REG_METHOD_GEN(TestName, INTERNAL_CATCH_REMOVE_PARENS(Signature))\ + template<typename...Types> \ + struct TestNameClass{\ + TestNameClass(){\ + int index = 0; \ + constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, __VA_ARGS__)};\ + using expander = int[];\ + (void)expander{(reg_test(Types{}, #ClassName, Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index]), Tags } ), index++, 0)... };/* NOLINT */ \ + }\ + };\ + static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\ + TestNameClass<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(__VA_ARGS__)>();\ + return 0;\ + }();\ + }\ + }\ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS\ + CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS\ + INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, INTERNAL_CATCH_REMOVE_PARENS(Signature)) + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( ClassName, Name, Tags,... ) \ + INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ ) +#else + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( ClassName, Name, Tags,... ) \ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ ) ) +#endif + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... ) \ + INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ ) +#else + #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... ) \ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ ) ) +#endif + + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2(TestNameClass, TestName, ClassName, Name, Tags, Signature, TmplTypes, TypesList)\ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \ + template<typename TestType> \ + struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName <TestType>) { \ + void test();\ + };\ + namespace {\ + namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestNameClass) {\ + INTERNAL_CATCH_TYPE_GEN \ + INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature))\ + template<typename...Types>\ + struct TestNameClass{\ + void reg_tests(){\ + int index = 0;\ + using expander = int[];\ + constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes))};\ + constexpr char const* types_list[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TypesList))};\ + constexpr auto num_types = sizeof(types_list) / sizeof(types_list[0]);\ + (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestName<Types>::test ), CATCH_INTERNAL_LINEINFO, #ClassName, Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index / num_types]) + "<" + std::string(types_list[index % num_types]) + ">", Tags } ), index++, 0)... };/* NOLINT */ \ + }\ + };\ + static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\ + using TestInit = decltype(create<TestNameClass, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes)>(TypeList<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(INTERNAL_CATCH_REMOVE_PARENS(TypesList))>{}));\ + TestInit t;\ + t.reg_tests();\ + return 0;\ + }(); \ + }\ + }\ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \ + CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \ + template<typename TestType> \ + void TestName<TestType>::test() + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( ClassName, Name, Tags, ... )\ + INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, typename T, __VA_ARGS__ ) +#else + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( ClassName, Name, Tags, ... )\ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, typename T,__VA_ARGS__ ) ) +#endif + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... )\ + INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, Signature, __VA_ARGS__ ) +#else + #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... )\ + INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, Signature,__VA_ARGS__ ) ) +#endif + + #define INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD_2( TestNameClass, TestName, ClassName, Name, Tags, TmplList) \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + template<typename TestType> \ + struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName <TestType>) { \ + void test();\ + };\ + namespace {\ + namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){ \ + INTERNAL_CATCH_TYPE_GEN\ + template<typename...Types>\ + struct TestNameClass{\ + void reg_tests(){\ + int index = 0;\ + using expander = int[];\ + (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestName<Types>::test ), CATCH_INTERNAL_LINEINFO, #ClassName, Catch::NameAndTags{ Name " - " + std::string(INTERNAL_CATCH_STRINGIZE(TmplList)) + " - " + std::to_string(index), Tags } ), index++, 0)... };/* NOLINT */ \ + }\ + };\ + static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\ + using TestInit = decltype(convert<TestNameClass>(TmplList {}));\ + TestInit t;\ + t.reg_tests();\ + return 0;\ + }(); \ + }}\ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \ + template<typename TestType> \ + void TestName<TestType>::test() + +#define INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD(ClassName, Name, Tags, TmplList) \ + INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, TmplList ) + +// end catch_test_registry.h +// start catch_capture.hpp + +// start catch_assertionhandler.h + +// start catch_assertioninfo.h + +// start catch_result_type.h + +namespace Catch { + + // ResultWas::OfType enum + struct ResultWas { enum OfType { + Unknown = -1, + Ok = 0, + Info = 1, + Warning = 2, + + FailureBit = 0x10, + + ExpressionFailed = FailureBit | 1, + ExplicitFailure = FailureBit | 2, + + Exception = 0x100 | FailureBit, + + ThrewException = Exception | 1, + DidntThrowException = Exception | 2, + + FatalErrorCondition = 0x200 | FailureBit + + }; }; + + bool isOk( ResultWas::OfType resultType ); + bool isJustInfo( int flags ); + + // ResultDisposition::Flags enum + struct ResultDisposition { enum Flags { + Normal = 0x01, + + ContinueOnFailure = 0x02, // Failures fail test, but execution continues + FalseTest = 0x04, // Prefix expression with ! + SuppressFail = 0x08 // Failures are reported but do not fail the test + }; }; + + ResultDisposition::Flags operator | ( ResultDisposition::Flags lhs, ResultDisposition::Flags rhs ); + + bool shouldContinueOnFailure( int flags ); + inline bool isFalseTest( int flags ) { return ( flags & ResultDisposition::FalseTest ) != 0; } + bool shouldSuppressFailure( int flags ); + +} // end namespace Catch + +// end catch_result_type.h +namespace Catch { + + struct AssertionInfo + { + StringRef macroName; + SourceLineInfo lineInfo; + StringRef capturedExpression; + ResultDisposition::Flags resultDisposition; + + // We want to delete this constructor but a compiler bug in 4.8 means + // the struct is then treated as non-aggregate + //AssertionInfo() = delete; + }; + +} // end namespace Catch + +// end catch_assertioninfo.h +// start catch_decomposer.h + +// start catch_tostring.h + +#include <vector> +#include <cstddef> +#include <type_traits> +#include <string> +// start catch_stream.h + +#include <iosfwd> +#include <cstddef> +#include <ostream> + +namespace Catch { + + std::ostream& cout(); + std::ostream& cerr(); + std::ostream& clog(); + + class StringRef; + + struct IStream { + virtual ~IStream(); + virtual std::ostream& stream() const = 0; + }; + + auto makeStream( StringRef const &filename ) -> IStream const*; + + class ReusableStringStream { + std::size_t m_index; + std::ostream* m_oss; + public: + ReusableStringStream(); + ~ReusableStringStream(); + + auto str() const -> std::string; + + template<typename T> + auto operator << ( T const& value ) -> ReusableStringStream& { + *m_oss << value; + return *this; + } + auto get() -> std::ostream& { return *m_oss; } + }; +} + +// end catch_stream.h +// start catch_interfaces_enum_values_registry.h + +#include <vector> + +namespace Catch { + + namespace Detail { + struct EnumInfo { + StringRef m_name; + std::vector<std::pair<int, std::string>> m_values; + + ~EnumInfo(); + + StringRef lookup( int value ) const; + }; + } // namespace Detail + + struct IMutableEnumValuesRegistry { + virtual ~IMutableEnumValuesRegistry(); + + virtual Detail::EnumInfo const& registerEnum( StringRef enumName, StringRef allEnums, std::vector<int> const& values ) = 0; + + template<typename E> + Detail::EnumInfo const& registerEnum( StringRef enumName, StringRef allEnums, std::initializer_list<E> values ) { + std::vector<int> intValues; + intValues.reserve( values.size() ); + for( auto enumValue : values ) + intValues.push_back( static_cast<int>( enumValue ) ); + return registerEnum( enumName, allEnums, intValues ); + } + }; + +} // Catch + +// end catch_interfaces_enum_values_registry.h + +#ifdef CATCH_CONFIG_CPP17_STRING_VIEW +#include <string_view> +#endif + +#ifdef __OBJC__ +// start catch_objc_arc.hpp + +#import <Foundation/Foundation.h> + +#ifdef __has_feature +#define CATCH_ARC_ENABLED __has_feature(objc_arc) +#else +#define CATCH_ARC_ENABLED 0 +#endif + +void arcSafeRelease( NSObject* obj ); +id performOptionalSelector( id obj, SEL sel ); + +#if !CATCH_ARC_ENABLED +inline void arcSafeRelease( NSObject* obj ) { + [obj release]; +} +inline id performOptionalSelector( id obj, SEL sel ) { + if( [obj respondsToSelector: sel] ) + return [obj performSelector: sel]; + return nil; +} +#define CATCH_UNSAFE_UNRETAINED +#define CATCH_ARC_STRONG +#else +inline void arcSafeRelease( NSObject* ){} +inline id performOptionalSelector( id obj, SEL sel ) { +#ifdef __clang__ +#pragma clang diagnostic push +#pragma clang diagnostic ignored "-Warc-performSelector-leaks" +#endif + if( [obj respondsToSelector: sel] ) + return [obj performSelector: sel]; +#ifdef __clang__ +#pragma clang diagnostic pop +#endif + return nil; +} +#define CATCH_UNSAFE_UNRETAINED __unsafe_unretained +#define CATCH_ARC_STRONG __strong +#endif + +// end catch_objc_arc.hpp +#endif + +#ifdef _MSC_VER +#pragma warning(push) +#pragma warning(disable:4180) // We attempt to stream a function (address) by const&, which MSVC complains about but is harmless +#endif + +namespace Catch { + namespace Detail { + + extern const std::string unprintableString; + + std::string rawMemoryToString( const void *object, std::size_t size ); + + template<typename T> + std::string rawMemoryToString( const T& object ) { + return rawMemoryToString( &object, sizeof(object) ); + } + + template<typename T> + class IsStreamInsertable { + template<typename SS, typename TT> + static auto test(int) + -> decltype(std::declval<SS&>() << std::declval<TT>(), std::true_type()); + + template<typename, typename> + static auto test(...)->std::false_type; + + public: + static const bool value = decltype(test<std::ostream, const T&>(0))::value; + }; + + template<typename E> + std::string convertUnknownEnumToString( E e ); + + template<typename T> + typename std::enable_if< + !std::is_enum<T>::value && !std::is_base_of<std::exception, T>::value, + std::string>::type convertUnstreamable( T const& ) { + return Detail::unprintableString; + } + template<typename T> + typename std::enable_if< + !std::is_enum<T>::value && std::is_base_of<std::exception, T>::value, + std::string>::type convertUnstreamable(T const& ex) { + return ex.what(); + } + + template<typename T> + typename std::enable_if< + std::is_enum<T>::value + , std::string>::type convertUnstreamable( T const& value ) { + return convertUnknownEnumToString( value ); + } + +#if defined(_MANAGED) + //! Convert a CLR string to a utf8 std::string + template<typename T> + std::string clrReferenceToString( T^ ref ) { + if (ref == nullptr) + return std::string("null"); + auto bytes = System::Text::Encoding::UTF8->GetBytes(ref->ToString()); + cli::pin_ptr<System::Byte> p = &bytes[0]; + return std::string(reinterpret_cast<char const *>(p), bytes->Length); + } +#endif + + } // namespace Detail + + // If we decide for C++14, change these to enable_if_ts + template <typename T, typename = void> + struct StringMaker { + template <typename Fake = T> + static + typename std::enable_if<::Catch::Detail::IsStreamInsertable<Fake>::value, std::string>::type + convert(const Fake& value) { + ReusableStringStream rss; + // NB: call using the function-like syntax to avoid ambiguity with + // user-defined templated operator<< under clang. + rss.operator<<(value); + return rss.str(); + } + + template <typename Fake = T> + static + typename std::enable_if<!::Catch::Detail::IsStreamInsertable<Fake>::value, std::string>::type + convert( const Fake& value ) { +#if !defined(CATCH_CONFIG_FALLBACK_STRINGIFIER) + return Detail::convertUnstreamable(value); +#else + return CATCH_CONFIG_FALLBACK_STRINGIFIER(value); +#endif + } + }; + + namespace Detail { + + // This function dispatches all stringification requests inside of Catch. + // Should be preferably called fully qualified, like ::Catch::Detail::stringify + template <typename T> + std::string stringify(const T& e) { + return ::Catch::StringMaker<typename std::remove_cv<typename std::remove_reference<T>::type>::type>::convert(e); + } + + template<typename E> + std::string convertUnknownEnumToString( E e ) { + return ::Catch::Detail::stringify(static_cast<typename std::underlying_type<E>::type>(e)); + } + +#if defined(_MANAGED) + template <typename T> + std::string stringify( T^ e ) { + return ::Catch::StringMaker<T^>::convert(e); + } +#endif + + } // namespace Detail + + // Some predefined specializations + + template<> + struct StringMaker<std::string> { + static std::string convert(const std::string& str); + }; + +#ifdef CATCH_CONFIG_CPP17_STRING_VIEW + template<> + struct StringMaker<std::string_view> { + static std::string convert(std::string_view str); + }; +#endif + + template<> + struct StringMaker<char const *> { + static std::string convert(char const * str); + }; + template<> + struct StringMaker<char *> { + static std::string convert(char * str); + }; + +#ifdef CATCH_CONFIG_WCHAR + template<> + struct StringMaker<std::wstring> { + static std::string convert(const std::wstring& wstr); + }; + +# ifdef CATCH_CONFIG_CPP17_STRING_VIEW + template<> + struct StringMaker<std::wstring_view> { + static std::string convert(std::wstring_view str); + }; +# endif + + template<> + struct StringMaker<wchar_t const *> { + static std::string convert(wchar_t const * str); + }; + template<> + struct StringMaker<wchar_t *> { + static std::string convert(wchar_t * str); + }; +#endif + + // TBD: Should we use `strnlen` to ensure that we don't go out of the buffer, + // while keeping string semantics? + template<int SZ> + struct StringMaker<char[SZ]> { + static std::string convert(char const* str) { + return ::Catch::Detail::stringify(std::string{ str }); + } + }; + template<int SZ> + struct StringMaker<signed char[SZ]> { + static std::string convert(signed char const* str) { + return ::Catch::Detail::stringify(std::string{ reinterpret_cast<char const *>(str) }); + } + }; + template<int SZ> + struct StringMaker<unsigned char[SZ]> { + static std::string convert(unsigned char const* str) { + return ::Catch::Detail::stringify(std::string{ reinterpret_cast<char const *>(str) }); + } + }; + + template<> + struct StringMaker<int> { + static std::string convert(int value); + }; + template<> + struct StringMaker<long> { + static std::string convert(long value); + }; + template<> + struct StringMaker<long long> { + static std::string convert(long long value); + }; + template<> + struct StringMaker<unsigned int> { + static std::string convert(unsigned int value); + }; + template<> + struct StringMaker<unsigned long> { + static std::string convert(unsigned long value); + }; + template<> + struct StringMaker<unsigned long long> { + static std::string convert(unsigned long long value); + }; + + template<> + struct StringMaker<bool> { + static std::string convert(bool b); + }; + + template<> + struct StringMaker<char> { + static std::string convert(char c); + }; + template<> + struct StringMaker<signed char> { + static std::string convert(signed char c); + }; + template<> + struct StringMaker<unsigned char> { + static std::string convert(unsigned char c); + }; + + template<> + struct StringMaker<std::nullptr_t> { + static std::string convert(std::nullptr_t); + }; + + template<> + struct StringMaker<float> { + static std::string convert(float value); + static int precision; + }; + + template<> + struct StringMaker<double> { + static std::string convert(double value); + static int precision; + }; + + template <typename T> + struct StringMaker<T*> { + template <typename U> + static std::string convert(U* p) { + if (p) { + return ::Catch::Detail::rawMemoryToString(p); + } else { + return "nullptr"; + } + } + }; + + template <typename R, typename C> + struct StringMaker<R C::*> { + static std::string convert(R C::* p) { + if (p) { + return ::Catch::Detail::rawMemoryToString(p); + } else { + return "nullptr"; + } + } + }; + +#if defined(_MANAGED) + template <typename T> + struct StringMaker<T^> { + static std::string convert( T^ ref ) { + return ::Catch::Detail::clrReferenceToString(ref); + } + }; +#endif + + namespace Detail { + template<typename InputIterator> + std::string rangeToString(InputIterator first, InputIterator last) { + ReusableStringStream rss; + rss << "{ "; + if (first != last) { + rss << ::Catch::Detail::stringify(*first); + for (++first; first != last; ++first) + rss << ", " << ::Catch::Detail::stringify(*first); + } + rss << " }"; + return rss.str(); + } + } + +#ifdef __OBJC__ + template<> + struct StringMaker<NSString*> { + static std::string convert(NSString * nsstring) { + if (!nsstring) + return "nil"; + return std::string("@") + [nsstring UTF8String]; + } + }; + template<> + struct StringMaker<NSObject*> { + static std::string convert(NSObject* nsObject) { + return ::Catch::Detail::stringify([nsObject description]); + } + + }; + namespace Detail { + inline std::string stringify( NSString* nsstring ) { + return StringMaker<NSString*>::convert( nsstring ); + } + + } // namespace Detail +#endif // __OBJC__ + +} // namespace Catch + +////////////////////////////////////////////////////// +// Separate std-lib types stringification, so it can be selectively enabled +// This means that we do not bring in + +#if defined(CATCH_CONFIG_ENABLE_ALL_STRINGMAKERS) +# define CATCH_CONFIG_ENABLE_PAIR_STRINGMAKER +# define CATCH_CONFIG_ENABLE_TUPLE_STRINGMAKER +# define CATCH_CONFIG_ENABLE_VARIANT_STRINGMAKER +# define CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER +# define CATCH_CONFIG_ENABLE_OPTIONAL_STRINGMAKER +#endif + +// Separate std::pair specialization +#if defined(CATCH_CONFIG_ENABLE_PAIR_STRINGMAKER) +#include <utility> +namespace Catch { + template<typename T1, typename T2> + struct StringMaker<std::pair<T1, T2> > { + static std::string convert(const std::pair<T1, T2>& pair) { + ReusableStringStream rss; + rss << "{ " + << ::Catch::Detail::stringify(pair.first) + << ", " + << ::Catch::Detail::stringify(pair.second) + << " }"; + return rss.str(); + } + }; +} +#endif // CATCH_CONFIG_ENABLE_PAIR_STRINGMAKER + +#if defined(CATCH_CONFIG_ENABLE_OPTIONAL_STRINGMAKER) && defined(CATCH_CONFIG_CPP17_OPTIONAL) +#include <optional> +namespace Catch { + template<typename T> + struct StringMaker<std::optional<T> > { + static std::string convert(const std::optional<T>& optional) { + ReusableStringStream rss; + if (optional.has_value()) { + rss << ::Catch::Detail::stringify(*optional); + } else { + rss << "{ }"; + } + return rss.str(); + } + }; +} +#endif // CATCH_CONFIG_ENABLE_OPTIONAL_STRINGMAKER + +// Separate std::tuple specialization +#if defined(CATCH_CONFIG_ENABLE_TUPLE_STRINGMAKER) +#include <tuple> +namespace Catch { + namespace Detail { + template< + typename Tuple, + std::size_t N = 0, + bool = (N < std::tuple_size<Tuple>::value) + > + struct TupleElementPrinter { + static void print(const Tuple& tuple, std::ostream& os) { + os << (N ? ", " : " ") + << ::Catch::Detail::stringify(std::get<N>(tuple)); + TupleElementPrinter<Tuple, N + 1>::print(tuple, os); + } + }; + + template< + typename Tuple, + std::size_t N + > + struct TupleElementPrinter<Tuple, N, false> { + static void print(const Tuple&, std::ostream&) {} + }; + + } + + template<typename ...Types> + struct StringMaker<std::tuple<Types...>> { + static std::string convert(const std::tuple<Types...>& tuple) { + ReusableStringStream rss; + rss << '{'; + Detail::TupleElementPrinter<std::tuple<Types...>>::print(tuple, rss.get()); + rss << " }"; + return rss.str(); + } + }; +} +#endif // CATCH_CONFIG_ENABLE_TUPLE_STRINGMAKER + +#if defined(CATCH_CONFIG_ENABLE_VARIANT_STRINGMAKER) && defined(CATCH_CONFIG_CPP17_VARIANT) +#include <variant> +namespace Catch { + template<> + struct StringMaker<std::monostate> { + static std::string convert(const std::monostate&) { + return "{ }"; + } + }; + + template<typename... Elements> + struct StringMaker<std::variant<Elements...>> { + static std::string convert(const std::variant<Elements...>& variant) { + if (variant.valueless_by_exception()) { + return "{valueless variant}"; + } else { + return std::visit( + [](const auto& value) { + return ::Catch::Detail::stringify(value); + }, + variant + ); + } + } + }; +} +#endif // CATCH_CONFIG_ENABLE_VARIANT_STRINGMAKER + +namespace Catch { + struct not_this_one {}; // Tag type for detecting which begin/ end are being selected + + // Import begin/ end from std here so they are considered alongside the fallback (...) overloads in this namespace + using std::begin; + using std::end; + + not_this_one begin( ... ); + not_this_one end( ... ); + + template <typename T> + struct is_range { + static const bool value = + !std::is_same<decltype(begin(std::declval<T>())), not_this_one>::value && + !std::is_same<decltype(end(std::declval<T>())), not_this_one>::value; + }; + +#if defined(_MANAGED) // Managed types are never ranges + template <typename T> + struct is_range<T^> { + static const bool value = false; + }; +#endif + + template<typename Range> + std::string rangeToString( Range const& range ) { + return ::Catch::Detail::rangeToString( begin( range ), end( range ) ); + } + + // Handle vector<bool> specially + template<typename Allocator> + std::string rangeToString( std::vector<bool, Allocator> const& v ) { + ReusableStringStream rss; + rss << "{ "; + bool first = true; + for( bool b : v ) { + if( first ) + first = false; + else + rss << ", "; + rss << ::Catch::Detail::stringify( b ); + } + rss << " }"; + return rss.str(); + } + + template<typename R> + struct StringMaker<R, typename std::enable_if<is_range<R>::value && !::Catch::Detail::IsStreamInsertable<R>::value>::type> { + static std::string convert( R const& range ) { + return rangeToString( range ); + } + }; + + template <typename T, int SZ> + struct StringMaker<T[SZ]> { + static std::string convert(T const(&arr)[SZ]) { + return rangeToString(arr); + } + }; + +} // namespace Catch + +// Separate std::chrono::duration specialization +#if defined(CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER) +#include <ctime> +#include <ratio> +#include <chrono> + +namespace Catch { + +template <class Ratio> +struct ratio_string { + static std::string symbol(); +}; + +template <class Ratio> +std::string ratio_string<Ratio>::symbol() { + Catch::ReusableStringStream rss; + rss << '[' << Ratio::num << '/' + << Ratio::den << ']'; + return rss.str(); +} +template <> +struct ratio_string<std::atto> { + static std::string symbol(); +}; +template <> +struct ratio_string<std::femto> { + static std::string symbol(); +}; +template <> +struct ratio_string<std::pico> { + static std::string symbol(); +}; +template <> +struct ratio_string<std::nano> { + static std::string symbol(); +}; +template <> +struct ratio_string<std::micro> { + static std::string symbol(); +}; +template <> +struct ratio_string<std::milli> { + static std::string symbol(); +}; + + //////////// + // std::chrono::duration specializations + template<typename Value, typename Ratio> + struct StringMaker<std::chrono::duration<Value, Ratio>> { + static std::string convert(std::chrono::duration<Value, Ratio> const& duration) { + ReusableStringStream rss; + rss << duration.count() << ' ' << ratio_string<Ratio>::symbol() << 's'; + return rss.str(); + } + }; + template<typename Value> + struct StringMaker<std::chrono::duration<Value, std::ratio<1>>> { + static std::string convert(std::chrono::duration<Value, std::ratio<1>> const& duration) { + ReusableStringStream rss; + rss << duration.count() << " s"; + return rss.str(); + } + }; + template<typename Value> + struct StringMaker<std::chrono::duration<Value, std::ratio<60>>> { + static std::string convert(std::chrono::duration<Value, std::ratio<60>> const& duration) { + ReusableStringStream rss; + rss << duration.count() << " m"; + return rss.str(); + } + }; + template<typename Value> + struct StringMaker<std::chrono::duration<Value, std::ratio<3600>>> { + static std::string convert(std::chrono::duration<Value, std::ratio<3600>> const& duration) { + ReusableStringStream rss; + rss << duration.count() << " h"; + return rss.str(); + } + }; + + //////////// + // std::chrono::time_point specialization + // Generic time_point cannot be specialized, only std::chrono::time_point<system_clock> + template<typename Clock, typename Duration> + struct StringMaker<std::chrono::time_point<Clock, Duration>> { + static std::string convert(std::chrono::time_point<Clock, Duration> const& time_point) { + return ::Catch::Detail::stringify(time_point.time_since_epoch()) + " since epoch"; + } + }; + // std::chrono::time_point<system_clock> specialization + template<typename Duration> + struct StringMaker<std::chrono::time_point<std::chrono::system_clock, Duration>> { + static std::string convert(std::chrono::time_point<std::chrono::system_clock, Duration> const& time_point) { + auto converted = std::chrono::system_clock::to_time_t(time_point); + +#ifdef _MSC_VER + std::tm timeInfo = {}; + gmtime_s(&timeInfo, &converted); +#else + std::tm* timeInfo = std::gmtime(&converted); +#endif + + auto const timeStampSize = sizeof("2017-01-16T17:06:45Z"); + char timeStamp[timeStampSize]; + const char * const fmt = "%Y-%m-%dT%H:%M:%SZ"; + +#ifdef _MSC_VER + std::strftime(timeStamp, timeStampSize, fmt, &timeInfo); +#else + std::strftime(timeStamp, timeStampSize, fmt, timeInfo); +#endif + return std::string(timeStamp); + } + }; +} +#endif // CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER + +#define INTERNAL_CATCH_REGISTER_ENUM( enumName, ... ) \ +namespace Catch { \ + template<> struct StringMaker<enumName> { \ + static std::string convert( enumName value ) { \ + static const auto& enumInfo = ::Catch::getMutableRegistryHub().getMutableEnumValuesRegistry().registerEnum( #enumName, #__VA_ARGS__, { __VA_ARGS__ } ); \ + return enumInfo.lookup( static_cast<int>( value ) ); \ + } \ + }; \ +} + +#define CATCH_REGISTER_ENUM( enumName, ... ) INTERNAL_CATCH_REGISTER_ENUM( enumName, __VA_ARGS__ ) + +#ifdef _MSC_VER +#pragma warning(pop) +#endif + +// end catch_tostring.h +#include <iosfwd> + +#ifdef _MSC_VER +#pragma warning(push) +#pragma warning(disable:4389) // '==' : signed/unsigned mismatch +#pragma warning(disable:4018) // more "signed/unsigned mismatch" +#pragma warning(disable:4312) // Converting int to T* using reinterpret_cast (issue on x64 platform) +#pragma warning(disable:4180) // qualifier applied to function type has no meaning +#pragma warning(disable:4800) // Forcing result to true or false +#endif + +namespace Catch { + + struct ITransientExpression { + auto isBinaryExpression() const -> bool { return m_isBinaryExpression; } + auto getResult() const -> bool { return m_result; } + virtual void streamReconstructedExpression( std::ostream &os ) const = 0; + + ITransientExpression( bool isBinaryExpression, bool result ) + : m_isBinaryExpression( isBinaryExpression ), + m_result( result ) + {} + + // We don't actually need a virtual destructor, but many static analysers + // complain if it's not here :-( + virtual ~ITransientExpression(); + + bool m_isBinaryExpression; + bool m_result; + + }; + + void formatReconstructedExpression( std::ostream &os, std::string const& lhs, StringRef op, std::string const& rhs ); + + template<typename LhsT, typename RhsT> + class BinaryExpr : public ITransientExpression { + LhsT m_lhs; + StringRef m_op; + RhsT m_rhs; + + void streamReconstructedExpression( std::ostream &os ) const override { + formatReconstructedExpression + ( os, Catch::Detail::stringify( m_lhs ), m_op, Catch::Detail::stringify( m_rhs ) ); + } + + public: + BinaryExpr( bool comparisonResult, LhsT lhs, StringRef op, RhsT rhs ) + : ITransientExpression{ true, comparisonResult }, + m_lhs( lhs ), + m_op( op ), + m_rhs( rhs ) + {} + + template<typename T> + auto operator && ( T ) const -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<T>::value, + "chained comparisons are not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + + template<typename T> + auto operator || ( T ) const -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<T>::value, + "chained comparisons are not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + + template<typename T> + auto operator == ( T ) const -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<T>::value, + "chained comparisons are not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + + template<typename T> + auto operator != ( T ) const -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<T>::value, + "chained comparisons are not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + + template<typename T> + auto operator > ( T ) const -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<T>::value, + "chained comparisons are not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + + template<typename T> + auto operator < ( T ) const -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<T>::value, + "chained comparisons are not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + + template<typename T> + auto operator >= ( T ) const -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<T>::value, + "chained comparisons are not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + + template<typename T> + auto operator <= ( T ) const -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<T>::value, + "chained comparisons are not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + }; + + template<typename LhsT> + class UnaryExpr : public ITransientExpression { + LhsT m_lhs; + + void streamReconstructedExpression( std::ostream &os ) const override { + os << Catch::Detail::stringify( m_lhs ); + } + + public: + explicit UnaryExpr( LhsT lhs ) + : ITransientExpression{ false, static_cast<bool>(lhs) }, + m_lhs( lhs ) + {} + }; + + // Specialised comparison functions to handle equality comparisons between ints and pointers (NULL deduces as an int) + template<typename LhsT, typename RhsT> + auto compareEqual( LhsT const& lhs, RhsT const& rhs ) -> bool { return static_cast<bool>(lhs == rhs); } + template<typename T> + auto compareEqual( T* const& lhs, int rhs ) -> bool { return lhs == reinterpret_cast<void const*>( rhs ); } + template<typename T> + auto compareEqual( T* const& lhs, long rhs ) -> bool { return lhs == reinterpret_cast<void const*>( rhs ); } + template<typename T> + auto compareEqual( int lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) == rhs; } + template<typename T> + auto compareEqual( long lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) == rhs; } + + template<typename LhsT, typename RhsT> + auto compareNotEqual( LhsT const& lhs, RhsT&& rhs ) -> bool { return static_cast<bool>(lhs != rhs); } + template<typename T> + auto compareNotEqual( T* const& lhs, int rhs ) -> bool { return lhs != reinterpret_cast<void const*>( rhs ); } + template<typename T> + auto compareNotEqual( T* const& lhs, long rhs ) -> bool { return lhs != reinterpret_cast<void const*>( rhs ); } + template<typename T> + auto compareNotEqual( int lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) != rhs; } + template<typename T> + auto compareNotEqual( long lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) != rhs; } + + template<typename LhsT> + class ExprLhs { + LhsT m_lhs; + public: + explicit ExprLhs( LhsT lhs ) : m_lhs( lhs ) {} + + template<typename RhsT> + auto operator == ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const { + return { compareEqual( m_lhs, rhs ), m_lhs, "==", rhs }; + } + auto operator == ( bool rhs ) -> BinaryExpr<LhsT, bool> const { + return { m_lhs == rhs, m_lhs, "==", rhs }; + } + + template<typename RhsT> + auto operator != ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const { + return { compareNotEqual( m_lhs, rhs ), m_lhs, "!=", rhs }; + } + auto operator != ( bool rhs ) -> BinaryExpr<LhsT, bool> const { + return { m_lhs != rhs, m_lhs, "!=", rhs }; + } + + template<typename RhsT> + auto operator > ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const { + return { static_cast<bool>(m_lhs > rhs), m_lhs, ">", rhs }; + } + template<typename RhsT> + auto operator < ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const { + return { static_cast<bool>(m_lhs < rhs), m_lhs, "<", rhs }; + } + template<typename RhsT> + auto operator >= ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const { + return { static_cast<bool>(m_lhs >= rhs), m_lhs, ">=", rhs }; + } + template<typename RhsT> + auto operator <= ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const { + return { static_cast<bool>(m_lhs <= rhs), m_lhs, "<=", rhs }; + } + + template<typename RhsT> + auto operator && ( RhsT const& ) -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<RhsT>::value, + "operator&& is not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + + template<typename RhsT> + auto operator || ( RhsT const& ) -> BinaryExpr<LhsT, RhsT const&> const { + static_assert(always_false<RhsT>::value, + "operator|| is not supported inside assertions, " + "wrap the expression inside parentheses, or decompose it"); + } + + auto makeUnaryExpr() const -> UnaryExpr<LhsT> { + return UnaryExpr<LhsT>{ m_lhs }; + } + }; + + void handleExpression( ITransientExpression const& expr ); + + template<typename T> + void handleExpression( ExprLhs<T> const& expr ) { + handleExpression( expr.makeUnaryExpr() ); + } + + struct Decomposer { + template<typename T> + auto operator <= ( T const& lhs ) -> ExprLhs<T const&> { + return ExprLhs<T const&>{ lhs }; + } + + auto operator <=( bool value ) -> ExprLhs<bool> { + return ExprLhs<bool>{ value }; + } + }; + +} // end namespace Catch + +#ifdef _MSC_VER +#pragma warning(pop) +#endif + +// end catch_decomposer.h +// start catch_interfaces_capture.h + +#include <string> +#include <chrono> + +namespace Catch { + + class AssertionResult; + struct AssertionInfo; + struct SectionInfo; + struct SectionEndInfo; + struct MessageInfo; + struct MessageBuilder; + struct Counts; + struct AssertionReaction; + struct SourceLineInfo; + + struct ITransientExpression; + struct IGeneratorTracker; + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + struct BenchmarkInfo; + template <typename Duration = std::chrono::duration<double, std::nano>> + struct BenchmarkStats; +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + struct IResultCapture { + + virtual ~IResultCapture(); + + virtual bool sectionStarted( SectionInfo const& sectionInfo, + Counts& assertions ) = 0; + virtual void sectionEnded( SectionEndInfo const& endInfo ) = 0; + virtual void sectionEndedEarly( SectionEndInfo const& endInfo ) = 0; + + virtual auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& = 0; + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + virtual void benchmarkPreparing( std::string const& name ) = 0; + virtual void benchmarkStarting( BenchmarkInfo const& info ) = 0; + virtual void benchmarkEnded( BenchmarkStats<> const& stats ) = 0; + virtual void benchmarkFailed( std::string const& error ) = 0; +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + virtual void pushScopedMessage( MessageInfo const& message ) = 0; + virtual void popScopedMessage( MessageInfo const& message ) = 0; + + virtual void emplaceUnscopedMessage( MessageBuilder const& builder ) = 0; + + virtual void handleFatalErrorCondition( StringRef message ) = 0; + + virtual void handleExpr + ( AssertionInfo const& info, + ITransientExpression const& expr, + AssertionReaction& reaction ) = 0; + virtual void handleMessage + ( AssertionInfo const& info, + ResultWas::OfType resultType, + StringRef const& message, + AssertionReaction& reaction ) = 0; + virtual void handleUnexpectedExceptionNotThrown + ( AssertionInfo const& info, + AssertionReaction& reaction ) = 0; + virtual void handleUnexpectedInflightException + ( AssertionInfo const& info, + std::string const& message, + AssertionReaction& reaction ) = 0; + virtual void handleIncomplete + ( AssertionInfo const& info ) = 0; + virtual void handleNonExpr + ( AssertionInfo const &info, + ResultWas::OfType resultType, + AssertionReaction &reaction ) = 0; + + virtual bool lastAssertionPassed() = 0; + virtual void assertionPassed() = 0; + + // Deprecated, do not use: + virtual std::string getCurrentTestName() const = 0; + virtual const AssertionResult* getLastResult() const = 0; + virtual void exceptionEarlyReported() = 0; + }; + + IResultCapture& getResultCapture(); +} + +// end catch_interfaces_capture.h +namespace Catch { + + struct TestFailureException{}; + struct AssertionResultData; + struct IResultCapture; + class RunContext; + + class LazyExpression { + friend class AssertionHandler; + friend struct AssertionStats; + friend class RunContext; + + ITransientExpression const* m_transientExpression = nullptr; + bool m_isNegated; + public: + LazyExpression( bool isNegated ); + LazyExpression( LazyExpression const& other ); + LazyExpression& operator = ( LazyExpression const& ) = delete; + + explicit operator bool() const; + + friend auto operator << ( std::ostream& os, LazyExpression const& lazyExpr ) -> std::ostream&; + }; + + struct AssertionReaction { + bool shouldDebugBreak = false; + bool shouldThrow = false; + }; + + class AssertionHandler { + AssertionInfo m_assertionInfo; + AssertionReaction m_reaction; + bool m_completed = false; + IResultCapture& m_resultCapture; + + public: + AssertionHandler + ( StringRef const& macroName, + SourceLineInfo const& lineInfo, + StringRef capturedExpression, + ResultDisposition::Flags resultDisposition ); + ~AssertionHandler() { + if ( !m_completed ) { + m_resultCapture.handleIncomplete( m_assertionInfo ); + } + } + + template<typename T> + void handleExpr( ExprLhs<T> const& expr ) { + handleExpr( expr.makeUnaryExpr() ); + } + void handleExpr( ITransientExpression const& expr ); + + void handleMessage(ResultWas::OfType resultType, StringRef const& message); + + void handleExceptionThrownAsExpected(); + void handleUnexpectedExceptionNotThrown(); + void handleExceptionNotThrownAsExpected(); + void handleThrowingCallSkipped(); + void handleUnexpectedInflightException(); + + void complete(); + void setCompleted(); + + // query + auto allowThrows() const -> bool; + }; + + void handleExceptionMatchExpr( AssertionHandler& handler, std::string const& str, StringRef const& matcherString ); + +} // namespace Catch + +// end catch_assertionhandler.h +// start catch_message.h + +#include <string> +#include <vector> + +namespace Catch { + + struct MessageInfo { + MessageInfo( StringRef const& _macroName, + SourceLineInfo const& _lineInfo, + ResultWas::OfType _type ); + + StringRef macroName; + std::string message; + SourceLineInfo lineInfo; + ResultWas::OfType type; + unsigned int sequence; + + bool operator == ( MessageInfo const& other ) const; + bool operator < ( MessageInfo const& other ) const; + private: + static unsigned int globalCount; + }; + + struct MessageStream { + + template<typename T> + MessageStream& operator << ( T const& value ) { + m_stream << value; + return *this; + } + + ReusableStringStream m_stream; + }; + + struct MessageBuilder : MessageStream { + MessageBuilder( StringRef const& macroName, + SourceLineInfo const& lineInfo, + ResultWas::OfType type ); + + template<typename T> + MessageBuilder& operator << ( T const& value ) { + m_stream << value; + return *this; + } + + MessageInfo m_info; + }; + + class ScopedMessage { + public: + explicit ScopedMessage( MessageBuilder const& builder ); + ScopedMessage( ScopedMessage& duplicate ) = delete; + ScopedMessage( ScopedMessage&& old ); + ~ScopedMessage(); + + MessageInfo m_info; + bool m_moved; + }; + + class Capturer { + std::vector<MessageInfo> m_messages; + IResultCapture& m_resultCapture = getResultCapture(); + size_t m_captured = 0; + public: + Capturer( StringRef macroName, SourceLineInfo const& lineInfo, ResultWas::OfType resultType, StringRef names ); + ~Capturer(); + + void captureValue( size_t index, std::string const& value ); + + template<typename T> + void captureValues( size_t index, T const& value ) { + captureValue( index, Catch::Detail::stringify( value ) ); + } + + template<typename T, typename... Ts> + void captureValues( size_t index, T const& value, Ts const&... values ) { + captureValue( index, Catch::Detail::stringify(value) ); + captureValues( index+1, values... ); + } + }; + +} // end namespace Catch + +// end catch_message.h +#if !defined(CATCH_CONFIG_DISABLE) + +#if !defined(CATCH_CONFIG_DISABLE_STRINGIFICATION) + #define CATCH_INTERNAL_STRINGIFY(...) #__VA_ARGS__ +#else + #define CATCH_INTERNAL_STRINGIFY(...) "Disabled by CATCH_CONFIG_DISABLE_STRINGIFICATION" +#endif + +#if defined(CATCH_CONFIG_FAST_COMPILE) || defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) + +/////////////////////////////////////////////////////////////////////////////// +// Another way to speed-up compilation is to omit local try-catch for REQUIRE* +// macros. +#define INTERNAL_CATCH_TRY +#define INTERNAL_CATCH_CATCH( capturer ) + +#else // CATCH_CONFIG_FAST_COMPILE + +#define INTERNAL_CATCH_TRY try +#define INTERNAL_CATCH_CATCH( handler ) catch(...) { handler.handleUnexpectedInflightException(); } + +#endif + +#define INTERNAL_CATCH_REACT( handler ) handler.complete(); + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_TEST( macroName, resultDisposition, ... ) \ + do { \ + Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__), resultDisposition ); \ + INTERNAL_CATCH_TRY { \ + CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS \ + catchAssertionHandler.handleExpr( Catch::Decomposer() <= __VA_ARGS__ ); \ + CATCH_INTERNAL_UNSUPPRESS_PARENTHESES_WARNINGS \ + } INTERNAL_CATCH_CATCH( catchAssertionHandler ) \ + INTERNAL_CATCH_REACT( catchAssertionHandler ) \ + } while( (void)0, (false) && static_cast<bool>( !!(__VA_ARGS__) ) ) // the expression here is never evaluated at runtime but it forces the compiler to give it a look + // The double negation silences MSVC's C4800 warning, the static_cast forces short-circuit evaluation if the type has overloaded &&. + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_IF( macroName, resultDisposition, ... ) \ + INTERNAL_CATCH_TEST( macroName, resultDisposition, __VA_ARGS__ ); \ + if( Catch::getResultCapture().lastAssertionPassed() ) + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_ELSE( macroName, resultDisposition, ... ) \ + INTERNAL_CATCH_TEST( macroName, resultDisposition, __VA_ARGS__ ); \ + if( !Catch::getResultCapture().lastAssertionPassed() ) + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_NO_THROW( macroName, resultDisposition, ... ) \ + do { \ + Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__), resultDisposition ); \ + try { \ + static_cast<void>(__VA_ARGS__); \ + catchAssertionHandler.handleExceptionNotThrownAsExpected(); \ + } \ + catch( ... ) { \ + catchAssertionHandler.handleUnexpectedInflightException(); \ + } \ + INTERNAL_CATCH_REACT( catchAssertionHandler ) \ + } while( false ) + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_THROWS( macroName, resultDisposition, ... ) \ + do { \ + Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__), resultDisposition); \ + if( catchAssertionHandler.allowThrows() ) \ + try { \ + static_cast<void>(__VA_ARGS__); \ + catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \ + } \ + catch( ... ) { \ + catchAssertionHandler.handleExceptionThrownAsExpected(); \ + } \ + else \ + catchAssertionHandler.handleThrowingCallSkipped(); \ + INTERNAL_CATCH_REACT( catchAssertionHandler ) \ + } while( false ) + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_THROWS_AS( macroName, exceptionType, resultDisposition, expr ) \ + do { \ + Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(expr) ", " CATCH_INTERNAL_STRINGIFY(exceptionType), resultDisposition ); \ + if( catchAssertionHandler.allowThrows() ) \ + try { \ + static_cast<void>(expr); \ + catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \ + } \ + catch( exceptionType const& ) { \ + catchAssertionHandler.handleExceptionThrownAsExpected(); \ + } \ + catch( ... ) { \ + catchAssertionHandler.handleUnexpectedInflightException(); \ + } \ + else \ + catchAssertionHandler.handleThrowingCallSkipped(); \ + INTERNAL_CATCH_REACT( catchAssertionHandler ) \ + } while( false ) + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_MSG( macroName, messageType, resultDisposition, ... ) \ + do { \ + Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, Catch::StringRef(), resultDisposition ); \ + catchAssertionHandler.handleMessage( messageType, ( Catch::MessageStream() << __VA_ARGS__ + ::Catch::StreamEndStop() ).m_stream.str() ); \ + INTERNAL_CATCH_REACT( catchAssertionHandler ) \ + } while( false ) + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_CAPTURE( varName, macroName, ... ) \ + auto varName = Catch::Capturer( macroName, CATCH_INTERNAL_LINEINFO, Catch::ResultWas::Info, #__VA_ARGS__ ); \ + varName.captureValues( 0, __VA_ARGS__ ) + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_INFO( macroName, log ) \ + Catch::ScopedMessage INTERNAL_CATCH_UNIQUE_NAME( scopedMessage )( Catch::MessageBuilder( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, Catch::ResultWas::Info ) << log ); + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_UNSCOPED_INFO( macroName, log ) \ + Catch::getResultCapture().emplaceUnscopedMessage( Catch::MessageBuilder( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, Catch::ResultWas::Info ) << log ) + +/////////////////////////////////////////////////////////////////////////////// +// Although this is matcher-based, it can be used with just a string +#define INTERNAL_CATCH_THROWS_STR_MATCHES( macroName, resultDisposition, matcher, ... ) \ + do { \ + Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__) ", " CATCH_INTERNAL_STRINGIFY(matcher), resultDisposition ); \ + if( catchAssertionHandler.allowThrows() ) \ + try { \ + static_cast<void>(__VA_ARGS__); \ + catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \ + } \ + catch( ... ) { \ + Catch::handleExceptionMatchExpr( catchAssertionHandler, matcher, #matcher##_catch_sr ); \ + } \ + else \ + catchAssertionHandler.handleThrowingCallSkipped(); \ + INTERNAL_CATCH_REACT( catchAssertionHandler ) \ + } while( false ) + +#endif // CATCH_CONFIG_DISABLE + +// end catch_capture.hpp +// start catch_section.h + +// start catch_section_info.h + +// start catch_totals.h + +#include <cstddef> + +namespace Catch { + + struct Counts { + Counts operator - ( Counts const& other ) const; + Counts& operator += ( Counts const& other ); + + std::size_t total() const; + bool allPassed() const; + bool allOk() const; + + std::size_t passed = 0; + std::size_t failed = 0; + std::size_t failedButOk = 0; + }; + + struct Totals { + + Totals operator - ( Totals const& other ) const; + Totals& operator += ( Totals const& other ); + + Totals delta( Totals const& prevTotals ) const; + + int error = 0; + Counts assertions; + Counts testCases; + }; +} + +// end catch_totals.h +#include <string> + +namespace Catch { + + struct SectionInfo { + SectionInfo + ( SourceLineInfo const& _lineInfo, + std::string const& _name ); + + // Deprecated + SectionInfo + ( SourceLineInfo const& _lineInfo, + std::string const& _name, + std::string const& ) : SectionInfo( _lineInfo, _name ) {} + + std::string name; + std::string description; // !Deprecated: this will always be empty + SourceLineInfo lineInfo; + }; + + struct SectionEndInfo { + SectionInfo sectionInfo; + Counts prevAssertions; + double durationInSeconds; + }; + +} // end namespace Catch + +// end catch_section_info.h +// start catch_timer.h + +#include <cstdint> + +namespace Catch { + + auto getCurrentNanosecondsSinceEpoch() -> uint64_t; + auto getEstimatedClockResolution() -> uint64_t; + + class Timer { + uint64_t m_nanoseconds = 0; + public: + void start(); + auto getElapsedNanoseconds() const -> uint64_t; + auto getElapsedMicroseconds() const -> uint64_t; + auto getElapsedMilliseconds() const -> unsigned int; + auto getElapsedSeconds() const -> double; + }; + +} // namespace Catch + +// end catch_timer.h +#include <string> + +namespace Catch { + + class Section : NonCopyable { + public: + Section( SectionInfo const& info ); + ~Section(); + + // This indicates whether the section should be executed or not + explicit operator bool() const; + + private: + SectionInfo m_info; + + std::string m_name; + Counts m_assertions; + bool m_sectionIncluded; + Timer m_timer; + }; + +} // end namespace Catch + +#define INTERNAL_CATCH_SECTION( ... ) \ + CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS \ + if( Catch::Section const& INTERNAL_CATCH_UNIQUE_NAME( catch_internal_Section ) = Catch::SectionInfo( CATCH_INTERNAL_LINEINFO, __VA_ARGS__ ) ) \ + CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS + +#define INTERNAL_CATCH_DYNAMIC_SECTION( ... ) \ + CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS \ + if( Catch::Section const& INTERNAL_CATCH_UNIQUE_NAME( catch_internal_Section ) = Catch::SectionInfo( CATCH_INTERNAL_LINEINFO, (Catch::ReusableStringStream() << __VA_ARGS__).str() ) ) \ + CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS + +// end catch_section.h +// start catch_interfaces_exception.h + +// start catch_interfaces_registry_hub.h + +#include <string> +#include <memory> + +namespace Catch { + + class TestCase; + struct ITestCaseRegistry; + struct IExceptionTranslatorRegistry; + struct IExceptionTranslator; + struct IReporterRegistry; + struct IReporterFactory; + struct ITagAliasRegistry; + struct IMutableEnumValuesRegistry; + + class StartupExceptionRegistry; + + using IReporterFactoryPtr = std::shared_ptr<IReporterFactory>; + + struct IRegistryHub { + virtual ~IRegistryHub(); + + virtual IReporterRegistry const& getReporterRegistry() const = 0; + virtual ITestCaseRegistry const& getTestCaseRegistry() const = 0; + virtual ITagAliasRegistry const& getTagAliasRegistry() const = 0; + virtual IExceptionTranslatorRegistry const& getExceptionTranslatorRegistry() const = 0; + + virtual StartupExceptionRegistry const& getStartupExceptionRegistry() const = 0; + }; + + struct IMutableRegistryHub { + virtual ~IMutableRegistryHub(); + virtual void registerReporter( std::string const& name, IReporterFactoryPtr const& factory ) = 0; + virtual void registerListener( IReporterFactoryPtr const& factory ) = 0; + virtual void registerTest( TestCase const& testInfo ) = 0; + virtual void registerTranslator( const IExceptionTranslator* translator ) = 0; + virtual void registerTagAlias( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ) = 0; + virtual void registerStartupException() noexcept = 0; + virtual IMutableEnumValuesRegistry& getMutableEnumValuesRegistry() = 0; + }; + + IRegistryHub const& getRegistryHub(); + IMutableRegistryHub& getMutableRegistryHub(); + void cleanUp(); + std::string translateActiveException(); + +} + +// end catch_interfaces_registry_hub.h +#if defined(CATCH_CONFIG_DISABLE) + #define INTERNAL_CATCH_TRANSLATE_EXCEPTION_NO_REG( translatorName, signature) \ + static std::string translatorName( signature ) +#endif + +#include <exception> +#include <string> +#include <vector> + +namespace Catch { + using exceptionTranslateFunction = std::string(*)(); + + struct IExceptionTranslator; + using ExceptionTranslators = std::vector<std::unique_ptr<IExceptionTranslator const>>; + + struct IExceptionTranslator { + virtual ~IExceptionTranslator(); + virtual std::string translate( ExceptionTranslators::const_iterator it, ExceptionTranslators::const_iterator itEnd ) const = 0; + }; + + struct IExceptionTranslatorRegistry { + virtual ~IExceptionTranslatorRegistry(); + + virtual std::string translateActiveException() const = 0; + }; + + class ExceptionTranslatorRegistrar { + template<typename T> + class ExceptionTranslator : public IExceptionTranslator { + public: + + ExceptionTranslator( std::string(*translateFunction)( T& ) ) + : m_translateFunction( translateFunction ) + {} + + std::string translate( ExceptionTranslators::const_iterator it, ExceptionTranslators::const_iterator itEnd ) const override { + try { + if( it == itEnd ) + std::rethrow_exception(std::current_exception()); + else + return (*it)->translate( it+1, itEnd ); + } + catch( T& ex ) { + return m_translateFunction( ex ); + } + } + + protected: + std::string(*m_translateFunction)( T& ); + }; + + public: + template<typename T> + ExceptionTranslatorRegistrar( std::string(*translateFunction)( T& ) ) { + getMutableRegistryHub().registerTranslator + ( new ExceptionTranslator<T>( translateFunction ) ); + } + }; +} + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_TRANSLATE_EXCEPTION2( translatorName, signature ) \ + static std::string translatorName( signature ); \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + namespace{ Catch::ExceptionTranslatorRegistrar INTERNAL_CATCH_UNIQUE_NAME( catch_internal_ExceptionRegistrar )( &translatorName ); } \ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \ + static std::string translatorName( signature ) + +#define INTERNAL_CATCH_TRANSLATE_EXCEPTION( signature ) INTERNAL_CATCH_TRANSLATE_EXCEPTION2( INTERNAL_CATCH_UNIQUE_NAME( catch_internal_ExceptionTranslator ), signature ) + +// end catch_interfaces_exception.h +// start catch_approx.h + +#include <type_traits> + +namespace Catch { +namespace Detail { + + class Approx { + private: + bool equalityComparisonImpl(double other) const; + // Validates the new margin (margin >= 0) + // out-of-line to avoid including stdexcept in the header + void setMargin(double margin); + // Validates the new epsilon (0 < epsilon < 1) + // out-of-line to avoid including stdexcept in the header + void setEpsilon(double epsilon); + + public: + explicit Approx ( double value ); + + static Approx custom(); + + Approx operator-() const; + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + Approx operator()( T const& value ) { + Approx approx( static_cast<double>(value) ); + approx.m_epsilon = m_epsilon; + approx.m_margin = m_margin; + approx.m_scale = m_scale; + return approx; + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + explicit Approx( T const& value ): Approx(static_cast<double>(value)) + {} + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + friend bool operator == ( const T& lhs, Approx const& rhs ) { + auto lhs_v = static_cast<double>(lhs); + return rhs.equalityComparisonImpl(lhs_v); + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + friend bool operator == ( Approx const& lhs, const T& rhs ) { + return operator==( rhs, lhs ); + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + friend bool operator != ( T const& lhs, Approx const& rhs ) { + return !operator==( lhs, rhs ); + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + friend bool operator != ( Approx const& lhs, T const& rhs ) { + return !operator==( rhs, lhs ); + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + friend bool operator <= ( T const& lhs, Approx const& rhs ) { + return static_cast<double>(lhs) < rhs.m_value || lhs == rhs; + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + friend bool operator <= ( Approx const& lhs, T const& rhs ) { + return lhs.m_value < static_cast<double>(rhs) || lhs == rhs; + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + friend bool operator >= ( T const& lhs, Approx const& rhs ) { + return static_cast<double>(lhs) > rhs.m_value || lhs == rhs; + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + friend bool operator >= ( Approx const& lhs, T const& rhs ) { + return lhs.m_value > static_cast<double>(rhs) || lhs == rhs; + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + Approx& epsilon( T const& newEpsilon ) { + double epsilonAsDouble = static_cast<double>(newEpsilon); + setEpsilon(epsilonAsDouble); + return *this; + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + Approx& margin( T const& newMargin ) { + double marginAsDouble = static_cast<double>(newMargin); + setMargin(marginAsDouble); + return *this; + } + + template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + Approx& scale( T const& newScale ) { + m_scale = static_cast<double>(newScale); + return *this; + } + + std::string toString() const; + + private: + double m_epsilon; + double m_margin; + double m_scale; + double m_value; + }; +} // end namespace Detail + +namespace literals { + Detail::Approx operator "" _a(long double val); + Detail::Approx operator "" _a(unsigned long long val); +} // end namespace literals + +template<> +struct StringMaker<Catch::Detail::Approx> { + static std::string convert(Catch::Detail::Approx const& value); +}; + +} // end namespace Catch + +// end catch_approx.h +// start catch_string_manip.h + +#include <string> +#include <iosfwd> +#include <vector> + +namespace Catch { + + bool startsWith( std::string const& s, std::string const& prefix ); + bool startsWith( std::string const& s, char prefix ); + bool endsWith( std::string const& s, std::string const& suffix ); + bool endsWith( std::string const& s, char suffix ); + bool contains( std::string const& s, std::string const& infix ); + void toLowerInPlace( std::string& s ); + std::string toLower( std::string const& s ); + std::string trim( std::string const& str ); + + // !!! Be aware, returns refs into original string - make sure original string outlives them + std::vector<StringRef> splitStringRef( StringRef str, char delimiter ); + bool replaceInPlace( std::string& str, std::string const& replaceThis, std::string const& withThis ); + + struct pluralise { + pluralise( std::size_t count, std::string const& label ); + + friend std::ostream& operator << ( std::ostream& os, pluralise const& pluraliser ); + + std::size_t m_count; + std::string m_label; + }; +} + +// end catch_string_manip.h +#ifndef CATCH_CONFIG_DISABLE_MATCHERS +// start catch_capture_matchers.h + +// start catch_matchers.h + +#include <string> +#include <vector> + +namespace Catch { +namespace Matchers { + namespace Impl { + + template<typename ArgT> struct MatchAllOf; + template<typename ArgT> struct MatchAnyOf; + template<typename ArgT> struct MatchNotOf; + + class MatcherUntypedBase { + public: + MatcherUntypedBase() = default; + MatcherUntypedBase ( MatcherUntypedBase const& ) = default; + MatcherUntypedBase& operator = ( MatcherUntypedBase const& ) = delete; + std::string toString() const; + + protected: + virtual ~MatcherUntypedBase(); + virtual std::string describe() const = 0; + mutable std::string m_cachedToString; + }; + +#ifdef __clang__ +# pragma clang diagnostic push +# pragma clang diagnostic ignored "-Wnon-virtual-dtor" +#endif + + template<typename ObjectT> + struct MatcherMethod { + virtual bool match( ObjectT const& arg ) const = 0; + }; + +#ifdef __clang__ +# pragma clang diagnostic pop +#endif + + template<typename T> + struct MatcherBase : MatcherUntypedBase, MatcherMethod<T> { + + MatchAllOf<T> operator && ( MatcherBase const& other ) const; + MatchAnyOf<T> operator || ( MatcherBase const& other ) const; + MatchNotOf<T> operator ! () const; + }; + + template<typename ArgT> + struct MatchAllOf : MatcherBase<ArgT> { + bool match( ArgT const& arg ) const override { + for( auto matcher : m_matchers ) { + if (!matcher->match(arg)) + return false; + } + return true; + } + std::string describe() const override { + std::string description; + description.reserve( 4 + m_matchers.size()*32 ); + description += "( "; + bool first = true; + for( auto matcher : m_matchers ) { + if( first ) + first = false; + else + description += " and "; + description += matcher->toString(); + } + description += " )"; + return description; + } + + MatchAllOf<ArgT>& operator && ( MatcherBase<ArgT> const& other ) { + m_matchers.push_back( &other ); + return *this; + } + + std::vector<MatcherBase<ArgT> const*> m_matchers; + }; + template<typename ArgT> + struct MatchAnyOf : MatcherBase<ArgT> { + + bool match( ArgT const& arg ) const override { + for( auto matcher : m_matchers ) { + if (matcher->match(arg)) + return true; + } + return false; + } + std::string describe() const override { + std::string description; + description.reserve( 4 + m_matchers.size()*32 ); + description += "( "; + bool first = true; + for( auto matcher : m_matchers ) { + if( first ) + first = false; + else + description += " or "; + description += matcher->toString(); + } + description += " )"; + return description; + } + + MatchAnyOf<ArgT>& operator || ( MatcherBase<ArgT> const& other ) { + m_matchers.push_back( &other ); + return *this; + } + + std::vector<MatcherBase<ArgT> const*> m_matchers; + }; + + template<typename ArgT> + struct MatchNotOf : MatcherBase<ArgT> { + + MatchNotOf( MatcherBase<ArgT> const& underlyingMatcher ) : m_underlyingMatcher( underlyingMatcher ) {} + + bool match( ArgT const& arg ) const override { + return !m_underlyingMatcher.match( arg ); + } + + std::string describe() const override { + return "not " + m_underlyingMatcher.toString(); + } + MatcherBase<ArgT> const& m_underlyingMatcher; + }; + + template<typename T> + MatchAllOf<T> MatcherBase<T>::operator && ( MatcherBase const& other ) const { + return MatchAllOf<T>() && *this && other; + } + template<typename T> + MatchAnyOf<T> MatcherBase<T>::operator || ( MatcherBase const& other ) const { + return MatchAnyOf<T>() || *this || other; + } + template<typename T> + MatchNotOf<T> MatcherBase<T>::operator ! () const { + return MatchNotOf<T>( *this ); + } + + } // namespace Impl + +} // namespace Matchers + +using namespace Matchers; +using Matchers::Impl::MatcherBase; + +} // namespace Catch + +// end catch_matchers.h +// start catch_matchers_floating.h + +#include <type_traits> +#include <cmath> + +namespace Catch { +namespace Matchers { + + namespace Floating { + + enum class FloatingPointKind : uint8_t; + + struct WithinAbsMatcher : MatcherBase<double> { + WithinAbsMatcher(double target, double margin); + bool match(double const& matchee) const override; + std::string describe() const override; + private: + double m_target; + double m_margin; + }; + + struct WithinUlpsMatcher : MatcherBase<double> { + WithinUlpsMatcher(double target, int ulps, FloatingPointKind baseType); + bool match(double const& matchee) const override; + std::string describe() const override; + private: + double m_target; + int m_ulps; + FloatingPointKind m_type; + }; + + } // namespace Floating + + // The following functions create the actual matcher objects. + // This allows the types to be inferred + Floating::WithinUlpsMatcher WithinULP(double target, int maxUlpDiff); + Floating::WithinUlpsMatcher WithinULP(float target, int maxUlpDiff); + Floating::WithinAbsMatcher WithinAbs(double target, double margin); + +} // namespace Matchers +} // namespace Catch + +// end catch_matchers_floating.h +// start catch_matchers_generic.hpp + +#include <functional> +#include <string> + +namespace Catch { +namespace Matchers { +namespace Generic { + +namespace Detail { + std::string finalizeDescription(const std::string& desc); +} + +template <typename T> +class PredicateMatcher : public MatcherBase<T> { + std::function<bool(T const&)> m_predicate; + std::string m_description; +public: + + PredicateMatcher(std::function<bool(T const&)> const& elem, std::string const& descr) + :m_predicate(std::move(elem)), + m_description(Detail::finalizeDescription(descr)) + {} + + bool match( T const& item ) const override { + return m_predicate(item); + } + + std::string describe() const override { + return m_description; + } +}; + +} // namespace Generic + + // The following functions create the actual matcher objects. + // The user has to explicitly specify type to the function, because + // inferring std::function<bool(T const&)> is hard (but possible) and + // requires a lot of TMP. + template<typename T> + Generic::PredicateMatcher<T> Predicate(std::function<bool(T const&)> const& predicate, std::string const& description = "") { + return Generic::PredicateMatcher<T>(predicate, description); + } + +} // namespace Matchers +} // namespace Catch + +// end catch_matchers_generic.hpp +// start catch_matchers_string.h + +#include <string> + +namespace Catch { +namespace Matchers { + + namespace StdString { + + struct CasedString + { + CasedString( std::string const& str, CaseSensitive::Choice caseSensitivity ); + std::string adjustString( std::string const& str ) const; + std::string caseSensitivitySuffix() const; + + CaseSensitive::Choice m_caseSensitivity; + std::string m_str; + }; + + struct StringMatcherBase : MatcherBase<std::string> { + StringMatcherBase( std::string const& operation, CasedString const& comparator ); + std::string describe() const override; + + CasedString m_comparator; + std::string m_operation; + }; + + struct EqualsMatcher : StringMatcherBase { + EqualsMatcher( CasedString const& comparator ); + bool match( std::string const& source ) const override; + }; + struct ContainsMatcher : StringMatcherBase { + ContainsMatcher( CasedString const& comparator ); + bool match( std::string const& source ) const override; + }; + struct StartsWithMatcher : StringMatcherBase { + StartsWithMatcher( CasedString const& comparator ); + bool match( std::string const& source ) const override; + }; + struct EndsWithMatcher : StringMatcherBase { + EndsWithMatcher( CasedString const& comparator ); + bool match( std::string const& source ) const override; + }; + + struct RegexMatcher : MatcherBase<std::string> { + RegexMatcher( std::string regex, CaseSensitive::Choice caseSensitivity ); + bool match( std::string const& matchee ) const override; + std::string describe() const override; + + private: + std::string m_regex; + CaseSensitive::Choice m_caseSensitivity; + }; + + } // namespace StdString + + // The following functions create the actual matcher objects. + // This allows the types to be inferred + + StdString::EqualsMatcher Equals( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes ); + StdString::ContainsMatcher Contains( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes ); + StdString::EndsWithMatcher EndsWith( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes ); + StdString::StartsWithMatcher StartsWith( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes ); + StdString::RegexMatcher Matches( std::string const& regex, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes ); + +} // namespace Matchers +} // namespace Catch + +// end catch_matchers_string.h +// start catch_matchers_vector.h + +#include <algorithm> + +namespace Catch { +namespace Matchers { + + namespace Vector { + template<typename T> + struct ContainsElementMatcher : MatcherBase<std::vector<T>> { + + ContainsElementMatcher(T const &comparator) : m_comparator( comparator) {} + + bool match(std::vector<T> const &v) const override { + for (auto const& el : v) { + if (el == m_comparator) { + return true; + } + } + return false; + } + + std::string describe() const override { + return "Contains: " + ::Catch::Detail::stringify( m_comparator ); + } + + T const& m_comparator; + }; + + template<typename T> + struct ContainsMatcher : MatcherBase<std::vector<T>> { + + ContainsMatcher(std::vector<T> const &comparator) : m_comparator( comparator ) {} + + bool match(std::vector<T> const &v) const override { + // !TBD: see note in EqualsMatcher + if (m_comparator.size() > v.size()) + return false; + for (auto const& comparator : m_comparator) { + auto present = false; + for (const auto& el : v) { + if (el == comparator) { + present = true; + break; + } + } + if (!present) { + return false; + } + } + return true; + } + std::string describe() const override { + return "Contains: " + ::Catch::Detail::stringify( m_comparator ); + } + + std::vector<T> const& m_comparator; + }; + + template<typename T> + struct EqualsMatcher : MatcherBase<std::vector<T>> { + + EqualsMatcher(std::vector<T> const &comparator) : m_comparator( comparator ) {} + + bool match(std::vector<T> const &v) const override { + // !TBD: This currently works if all elements can be compared using != + // - a more general approach would be via a compare template that defaults + // to using !=. but could be specialised for, e.g. std::vector<T> etc + // - then just call that directly + if (m_comparator.size() != v.size()) + return false; + for (std::size_t i = 0; i < v.size(); ++i) + if (m_comparator[i] != v[i]) + return false; + return true; + } + std::string describe() const override { + return "Equals: " + ::Catch::Detail::stringify( m_comparator ); + } + std::vector<T> const& m_comparator; + }; + + template<typename T> + struct ApproxMatcher : MatcherBase<std::vector<T>> { + + ApproxMatcher(std::vector<T> const& comparator) : m_comparator( comparator ) {} + + bool match(std::vector<T> const &v) const override { + if (m_comparator.size() != v.size()) + return false; + for (std::size_t i = 0; i < v.size(); ++i) + if (m_comparator[i] != approx(v[i])) + return false; + return true; + } + std::string describe() const override { + return "is approx: " + ::Catch::Detail::stringify( m_comparator ); + } + template <typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + ApproxMatcher& epsilon( T const& newEpsilon ) { + approx.epsilon(newEpsilon); + return *this; + } + template <typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + ApproxMatcher& margin( T const& newMargin ) { + approx.margin(newMargin); + return *this; + } + template <typename = typename std::enable_if<std::is_constructible<double, T>::value>::type> + ApproxMatcher& scale( T const& newScale ) { + approx.scale(newScale); + return *this; + } + + std::vector<T> const& m_comparator; + mutable Catch::Detail::Approx approx = Catch::Detail::Approx::custom(); + }; + + template<typename T> + struct UnorderedEqualsMatcher : MatcherBase<std::vector<T>> { + UnorderedEqualsMatcher(std::vector<T> const& target) : m_target(target) {} + bool match(std::vector<T> const& vec) const override { + // Note: This is a reimplementation of std::is_permutation, + // because I don't want to include <algorithm> inside the common path + if (m_target.size() != vec.size()) { + return false; + } + return std::is_permutation(m_target.begin(), m_target.end(), vec.begin()); + } + + std::string describe() const override { + return "UnorderedEquals: " + ::Catch::Detail::stringify(m_target); + } + private: + std::vector<T> const& m_target; + }; + + } // namespace Vector + + // The following functions create the actual matcher objects. + // This allows the types to be inferred + + template<typename T> + Vector::ContainsMatcher<T> Contains( std::vector<T> const& comparator ) { + return Vector::ContainsMatcher<T>( comparator ); + } + + template<typename T> + Vector::ContainsElementMatcher<T> VectorContains( T const& comparator ) { + return Vector::ContainsElementMatcher<T>( comparator ); + } + + template<typename T> + Vector::EqualsMatcher<T> Equals( std::vector<T> const& comparator ) { + return Vector::EqualsMatcher<T>( comparator ); + } + + template<typename T> + Vector::ApproxMatcher<T> Approx( std::vector<T> const& comparator ) { + return Vector::ApproxMatcher<T>( comparator ); + } + + template<typename T> + Vector::UnorderedEqualsMatcher<T> UnorderedEquals(std::vector<T> const& target) { + return Vector::UnorderedEqualsMatcher<T>(target); + } + +} // namespace Matchers +} // namespace Catch + +// end catch_matchers_vector.h +namespace Catch { + + template<typename ArgT, typename MatcherT> + class MatchExpr : public ITransientExpression { + ArgT const& m_arg; + MatcherT m_matcher; + StringRef m_matcherString; + public: + MatchExpr( ArgT const& arg, MatcherT const& matcher, StringRef const& matcherString ) + : ITransientExpression{ true, matcher.match( arg ) }, + m_arg( arg ), + m_matcher( matcher ), + m_matcherString( matcherString ) + {} + + void streamReconstructedExpression( std::ostream &os ) const override { + auto matcherAsString = m_matcher.toString(); + os << Catch::Detail::stringify( m_arg ) << ' '; + if( matcherAsString == Detail::unprintableString ) + os << m_matcherString; + else + os << matcherAsString; + } + }; + + using StringMatcher = Matchers::Impl::MatcherBase<std::string>; + + void handleExceptionMatchExpr( AssertionHandler& handler, StringMatcher const& matcher, StringRef const& matcherString ); + + template<typename ArgT, typename MatcherT> + auto makeMatchExpr( ArgT const& arg, MatcherT const& matcher, StringRef const& matcherString ) -> MatchExpr<ArgT, MatcherT> { + return MatchExpr<ArgT, MatcherT>( arg, matcher, matcherString ); + } + +} // namespace Catch + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CHECK_THAT( macroName, matcher, resultDisposition, arg ) \ + do { \ + Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(arg) ", " CATCH_INTERNAL_STRINGIFY(matcher), resultDisposition ); \ + INTERNAL_CATCH_TRY { \ + catchAssertionHandler.handleExpr( Catch::makeMatchExpr( arg, matcher, #matcher##_catch_sr ) ); \ + } INTERNAL_CATCH_CATCH( catchAssertionHandler ) \ + INTERNAL_CATCH_REACT( catchAssertionHandler ) \ + } while( false ) + +/////////////////////////////////////////////////////////////////////////////// +#define INTERNAL_CATCH_THROWS_MATCHES( macroName, exceptionType, resultDisposition, matcher, ... ) \ + do { \ + Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__) ", " CATCH_INTERNAL_STRINGIFY(exceptionType) ", " CATCH_INTERNAL_STRINGIFY(matcher), resultDisposition ); \ + if( catchAssertionHandler.allowThrows() ) \ + try { \ + static_cast<void>(__VA_ARGS__ ); \ + catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \ + } \ + catch( exceptionType const& ex ) { \ + catchAssertionHandler.handleExpr( Catch::makeMatchExpr( ex, matcher, #matcher##_catch_sr ) ); \ + } \ + catch( ... ) { \ + catchAssertionHandler.handleUnexpectedInflightException(); \ + } \ + else \ + catchAssertionHandler.handleThrowingCallSkipped(); \ + INTERNAL_CATCH_REACT( catchAssertionHandler ) \ + } while( false ) + +// end catch_capture_matchers.h +#endif +// start catch_generators.hpp + +// start catch_interfaces_generatortracker.h + + +#include <memory> + +namespace Catch { + + namespace Generators { + class GeneratorUntypedBase { + public: + GeneratorUntypedBase() = default; + virtual ~GeneratorUntypedBase(); + // Attempts to move the generator to the next element + // + // Returns true iff the move succeeded (and a valid element + // can be retrieved). + virtual bool next() = 0; + }; + using GeneratorBasePtr = std::unique_ptr<GeneratorUntypedBase>; + + } // namespace Generators + + struct IGeneratorTracker { + virtual ~IGeneratorTracker(); + virtual auto hasGenerator() const -> bool = 0; + virtual auto getGenerator() const -> Generators::GeneratorBasePtr const& = 0; + virtual void setGenerator( Generators::GeneratorBasePtr&& generator ) = 0; + }; + +} // namespace Catch + +// end catch_interfaces_generatortracker.h +// start catch_enforce.h + +#include <exception> + +namespace Catch { +#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) + template <typename Ex> + [[noreturn]] + void throw_exception(Ex const& e) { + throw e; + } +#else // ^^ Exceptions are enabled // Exceptions are disabled vv + [[noreturn]] + void throw_exception(std::exception const& e); +#endif + + [[noreturn]] + void throw_logic_error(std::string const& msg); + [[noreturn]] + void throw_domain_error(std::string const& msg); + [[noreturn]] + void throw_runtime_error(std::string const& msg); + +} // namespace Catch; + +#define CATCH_MAKE_MSG(...) \ + (Catch::ReusableStringStream() << __VA_ARGS__).str() + +#define CATCH_INTERNAL_ERROR(...) \ + Catch::throw_logic_error(CATCH_MAKE_MSG( CATCH_INTERNAL_LINEINFO << ": Internal Catch2 error: " << __VA_ARGS__)); + +#define CATCH_ERROR(...) \ + Catch::throw_domain_error(CATCH_MAKE_MSG( __VA_ARGS__ )); + +#define CATCH_RUNTIME_ERROR(...) \ + Catch::throw_runtime_error(CATCH_MAKE_MSG( __VA_ARGS__ )); + +#define CATCH_ENFORCE( condition, ... ) \ + do{ if( !(condition) ) CATCH_ERROR( __VA_ARGS__ ); } while(false) + +// end catch_enforce.h +#include <memory> +#include <vector> +#include <cassert> + +#include <utility> +#include <exception> + +namespace Catch { + +class GeneratorException : public std::exception { + const char* const m_msg = ""; + +public: + GeneratorException(const char* msg): + m_msg(msg) + {} + + const char* what() const noexcept override final; +}; + +namespace Generators { + + // !TBD move this into its own location? + namespace pf{ + template<typename T, typename... Args> + std::unique_ptr<T> make_unique( Args&&... args ) { + return std::unique_ptr<T>(new T(std::forward<Args>(args)...)); + } + } + + template<typename T> + struct IGenerator : GeneratorUntypedBase { + virtual ~IGenerator() = default; + + // Returns the current element of the generator + // + // \Precondition The generator is either freshly constructed, + // or the last call to `next()` returned true + virtual T const& get() const = 0; + using type = T; + }; + + template<typename T> + class SingleValueGenerator final : public IGenerator<T> { + T m_value; + public: + SingleValueGenerator(T const& value) : m_value( value ) {} + SingleValueGenerator(T&& value) : m_value(std::move(value)) {} + + T const& get() const override { + return m_value; + } + bool next() override { + return false; + } + }; + + template<typename T> + class FixedValuesGenerator final : public IGenerator<T> { + std::vector<T> m_values; + size_t m_idx = 0; + public: + FixedValuesGenerator( std::initializer_list<T> values ) : m_values( values ) {} + + T const& get() const override { + return m_values[m_idx]; + } + bool next() override { + ++m_idx; + return m_idx < m_values.size(); + } + }; + + template <typename T> + class GeneratorWrapper final { + std::unique_ptr<IGenerator<T>> m_generator; + public: + GeneratorWrapper(std::unique_ptr<IGenerator<T>> generator): + m_generator(std::move(generator)) + {} + T const& get() const { + return m_generator->get(); + } + bool next() { + return m_generator->next(); + } + }; + + template <typename T> + GeneratorWrapper<T> value(T&& value) { + return GeneratorWrapper<T>(pf::make_unique<SingleValueGenerator<T>>(std::forward<T>(value))); + } + template <typename T> + GeneratorWrapper<T> values(std::initializer_list<T> values) { + return GeneratorWrapper<T>(pf::make_unique<FixedValuesGenerator<T>>(values)); + } + + template<typename T> + class Generators : public IGenerator<T> { + std::vector<GeneratorWrapper<T>> m_generators; + size_t m_current = 0; + + void populate(GeneratorWrapper<T>&& generator) { + m_generators.emplace_back(std::move(generator)); + } + void populate(T&& val) { + m_generators.emplace_back(value(std::move(val))); + } + template<typename U> + void populate(U&& val) { + populate(T(std::move(val))); + } + template<typename U, typename... Gs> + void populate(U&& valueOrGenerator, Gs... moreGenerators) { + populate(std::forward<U>(valueOrGenerator)); + populate(std::forward<Gs>(moreGenerators)...); + } + + public: + template <typename... Gs> + Generators(Gs... moreGenerators) { + m_generators.reserve(sizeof...(Gs)); + populate(std::forward<Gs>(moreGenerators)...); + } + + T const& get() const override { + return m_generators[m_current].get(); + } + + bool next() override { + if (m_current >= m_generators.size()) { + return false; + } + const bool current_status = m_generators[m_current].next(); + if (!current_status) { + ++m_current; + } + return m_current < m_generators.size(); + } + }; + + template<typename... Ts> + GeneratorWrapper<std::tuple<Ts...>> table( std::initializer_list<std::tuple<typename std::decay<Ts>::type...>> tuples ) { + return values<std::tuple<Ts...>>( tuples ); + } + + // Tag type to signal that a generator sequence should convert arguments to a specific type + template <typename T> + struct as {}; + + template<typename T, typename... Gs> + auto makeGenerators( GeneratorWrapper<T>&& generator, Gs... moreGenerators ) -> Generators<T> { + return Generators<T>(std::move(generator), std::forward<Gs>(moreGenerators)...); + } + template<typename T> + auto makeGenerators( GeneratorWrapper<T>&& generator ) -> Generators<T> { + return Generators<T>(std::move(generator)); + } + template<typename T, typename... Gs> + auto makeGenerators( T&& val, Gs... moreGenerators ) -> Generators<T> { + return makeGenerators( value( std::forward<T>( val ) ), std::forward<Gs>( moreGenerators )... ); + } + template<typename T, typename U, typename... Gs> + auto makeGenerators( as<T>, U&& val, Gs... moreGenerators ) -> Generators<T> { + return makeGenerators( value( T( std::forward<U>( val ) ) ), std::forward<Gs>( moreGenerators )... ); + } + + auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker&; + + template<typename L> + // Note: The type after -> is weird, because VS2015 cannot parse + // the expression used in the typedef inside, when it is in + // return type. Yeah. + auto generate( SourceLineInfo const& lineInfo, L const& generatorExpression ) -> decltype(std::declval<decltype(generatorExpression())>().get()) { + using UnderlyingType = typename decltype(generatorExpression())::type; + + IGeneratorTracker& tracker = acquireGeneratorTracker( lineInfo ); + if (!tracker.hasGenerator()) { + tracker.setGenerator(pf::make_unique<Generators<UnderlyingType>>(generatorExpression())); + } + + auto const& generator = static_cast<IGenerator<UnderlyingType> const&>( *tracker.getGenerator() ); + return generator.get(); + } + +} // namespace Generators +} // namespace Catch + +#define GENERATE( ... ) \ + Catch::Generators::generate( CATCH_INTERNAL_LINEINFO, [ ]{ using namespace Catch::Generators; return makeGenerators( __VA_ARGS__ ); } ) +#define GENERATE_COPY( ... ) \ + Catch::Generators::generate( CATCH_INTERNAL_LINEINFO, [=]{ using namespace Catch::Generators; return makeGenerators( __VA_ARGS__ ); } ) +#define GENERATE_REF( ... ) \ + Catch::Generators::generate( CATCH_INTERNAL_LINEINFO, [&]{ using namespace Catch::Generators; return makeGenerators( __VA_ARGS__ ); } ) + +// end catch_generators.hpp +// start catch_generators_generic.hpp + +namespace Catch { +namespace Generators { + + template <typename T> + class TakeGenerator : public IGenerator<T> { + GeneratorWrapper<T> m_generator; + size_t m_returned = 0; + size_t m_target; + public: + TakeGenerator(size_t target, GeneratorWrapper<T>&& generator): + m_generator(std::move(generator)), + m_target(target) + { + assert(target != 0 && "Empty generators are not allowed"); + } + T const& get() const override { + return m_generator.get(); + } + bool next() override { + ++m_returned; + if (m_returned >= m_target) { + return false; + } + + const auto success = m_generator.next(); + // If the underlying generator does not contain enough values + // then we cut short as well + if (!success) { + m_returned = m_target; + } + return success; + } + }; + + template <typename T> + GeneratorWrapper<T> take(size_t target, GeneratorWrapper<T>&& generator) { + return GeneratorWrapper<T>(pf::make_unique<TakeGenerator<T>>(target, std::move(generator))); + } + + template <typename T, typename Predicate> + class FilterGenerator : public IGenerator<T> { + GeneratorWrapper<T> m_generator; + Predicate m_predicate; + public: + template <typename P = Predicate> + FilterGenerator(P&& pred, GeneratorWrapper<T>&& generator): + m_generator(std::move(generator)), + m_predicate(std::forward<P>(pred)) + { + if (!m_predicate(m_generator.get())) { + // It might happen that there are no values that pass the + // filter. In that case we throw an exception. + auto has_initial_value = next(); + if (!has_initial_value) { + Catch::throw_exception(GeneratorException("No valid value found in filtered generator")); + } + } + } + + T const& get() const override { + return m_generator.get(); + } + + bool next() override { + bool success = m_generator.next(); + if (!success) { + return false; + } + while (!m_predicate(m_generator.get()) && (success = m_generator.next()) == true); + return success; + } + }; + + template <typename T, typename Predicate> + GeneratorWrapper<T> filter(Predicate&& pred, GeneratorWrapper<T>&& generator) { + return GeneratorWrapper<T>(std::unique_ptr<IGenerator<T>>(pf::make_unique<FilterGenerator<T, Predicate>>(std::forward<Predicate>(pred), std::move(generator)))); + } + + template <typename T> + class RepeatGenerator : public IGenerator<T> { + GeneratorWrapper<T> m_generator; + mutable std::vector<T> m_returned; + size_t m_target_repeats; + size_t m_current_repeat = 0; + size_t m_repeat_index = 0; + public: + RepeatGenerator(size_t repeats, GeneratorWrapper<T>&& generator): + m_generator(std::move(generator)), + m_target_repeats(repeats) + { + assert(m_target_repeats > 0 && "Repeat generator must repeat at least once"); + } + + T const& get() const override { + if (m_current_repeat == 0) { + m_returned.push_back(m_generator.get()); + return m_returned.back(); + } + return m_returned[m_repeat_index]; + } + + bool next() override { + // There are 2 basic cases: + // 1) We are still reading the generator + // 2) We are reading our own cache + + // In the first case, we need to poke the underlying generator. + // If it happily moves, we are left in that state, otherwise it is time to start reading from our cache + if (m_current_repeat == 0) { + const auto success = m_generator.next(); + if (!success) { + ++m_current_repeat; + } + return m_current_repeat < m_target_repeats; + } + + // In the second case, we need to move indices forward and check that we haven't run up against the end + ++m_repeat_index; + if (m_repeat_index == m_returned.size()) { + m_repeat_index = 0; + ++m_current_repeat; + } + return m_current_repeat < m_target_repeats; + } + }; + + template <typename T> + GeneratorWrapper<T> repeat(size_t repeats, GeneratorWrapper<T>&& generator) { + return GeneratorWrapper<T>(pf::make_unique<RepeatGenerator<T>>(repeats, std::move(generator))); + } + + template <typename T, typename U, typename Func> + class MapGenerator : public IGenerator<T> { + // TBD: provide static assert for mapping function, for friendly error message + GeneratorWrapper<U> m_generator; + Func m_function; + // To avoid returning dangling reference, we have to save the values + T m_cache; + public: + template <typename F2 = Func> + MapGenerator(F2&& function, GeneratorWrapper<U>&& generator) : + m_generator(std::move(generator)), + m_function(std::forward<F2>(function)), + m_cache(m_function(m_generator.get())) + {} + + T const& get() const override { + return m_cache; + } + bool next() override { + const auto success = m_generator.next(); + if (success) { + m_cache = m_function(m_generator.get()); + } + return success; + } + }; + +#if defined(__cpp_lib_is_invocable) && __cpp_lib_is_invocable >= 201703 + // std::result_of is deprecated in C++17 and removed in C++20. Hence, it is + // replaced with std::invoke_result here. Also *_t format is preferred over + // typename *::type format. + template <typename Func, typename U> + using MapFunctionReturnType = std::remove_reference_t<std::remove_cv_t<std::invoke_result_t<Func, U>>>; +#else + template <typename Func, typename U> + using MapFunctionReturnType = typename std::remove_reference<typename std::remove_cv<typename std::result_of<Func(U)>::type>::type>::type; +#endif + + template <typename Func, typename U, typename T = MapFunctionReturnType<Func, U>> + GeneratorWrapper<T> map(Func&& function, GeneratorWrapper<U>&& generator) { + return GeneratorWrapper<T>( + pf::make_unique<MapGenerator<T, U, Func>>(std::forward<Func>(function), std::move(generator)) + ); + } + + template <typename T, typename U, typename Func> + GeneratorWrapper<T> map(Func&& function, GeneratorWrapper<U>&& generator) { + return GeneratorWrapper<T>( + pf::make_unique<MapGenerator<T, U, Func>>(std::forward<Func>(function), std::move(generator)) + ); + } + + template <typename T> + class ChunkGenerator final : public IGenerator<std::vector<T>> { + std::vector<T> m_chunk; + size_t m_chunk_size; + GeneratorWrapper<T> m_generator; + bool m_used_up = false; + public: + ChunkGenerator(size_t size, GeneratorWrapper<T> generator) : + m_chunk_size(size), m_generator(std::move(generator)) + { + m_chunk.reserve(m_chunk_size); + m_chunk.push_back(m_generator.get()); + for (size_t i = 1; i < m_chunk_size; ++i) { + if (!m_generator.next()) { + Catch::throw_exception(GeneratorException("Not enough values to initialize the first chunk")); + } + m_chunk.push_back(m_generator.get()); + } + } + std::vector<T> const& get() const override { + return m_chunk; + } + bool next() override { + m_chunk.clear(); + for (size_t idx = 0; idx < m_chunk_size; ++idx) { + if (!m_generator.next()) { + return false; + } + m_chunk.push_back(m_generator.get()); + } + return true; + } + }; + + template <typename T> + GeneratorWrapper<std::vector<T>> chunk(size_t size, GeneratorWrapper<T>&& generator) { + return GeneratorWrapper<std::vector<T>>( + pf::make_unique<ChunkGenerator<T>>(size, std::move(generator)) + ); + } + +} // namespace Generators +} // namespace Catch + +// end catch_generators_generic.hpp +// start catch_generators_specific.hpp + +// start catch_context.h + +#include <memory> + +namespace Catch { + + struct IResultCapture; + struct IRunner; + struct IConfig; + struct IMutableContext; + + using IConfigPtr = std::shared_ptr<IConfig const>; + + struct IContext + { + virtual ~IContext(); + + virtual IResultCapture* getResultCapture() = 0; + virtual IRunner* getRunner() = 0; + virtual IConfigPtr const& getConfig() const = 0; + }; + + struct IMutableContext : IContext + { + virtual ~IMutableContext(); + virtual void setResultCapture( IResultCapture* resultCapture ) = 0; + virtual void setRunner( IRunner* runner ) = 0; + virtual void setConfig( IConfigPtr const& config ) = 0; + + private: + static IMutableContext *currentContext; + friend IMutableContext& getCurrentMutableContext(); + friend void cleanUpContext(); + static void createContext(); + }; + + inline IMutableContext& getCurrentMutableContext() + { + if( !IMutableContext::currentContext ) + IMutableContext::createContext(); + return *IMutableContext::currentContext; + } + + inline IContext& getCurrentContext() + { + return getCurrentMutableContext(); + } + + void cleanUpContext(); +} + +// end catch_context.h +// start catch_interfaces_config.h + +// start catch_option.hpp + +namespace Catch { + + // An optional type + template<typename T> + class Option { + public: + Option() : nullableValue( nullptr ) {} + Option( T const& _value ) + : nullableValue( new( storage ) T( _value ) ) + {} + Option( Option const& _other ) + : nullableValue( _other ? new( storage ) T( *_other ) : nullptr ) + {} + + ~Option() { + reset(); + } + + Option& operator= ( Option const& _other ) { + if( &_other != this ) { + reset(); + if( _other ) + nullableValue = new( storage ) T( *_other ); + } + return *this; + } + Option& operator = ( T const& _value ) { + reset(); + nullableValue = new( storage ) T( _value ); + return *this; + } + + void reset() { + if( nullableValue ) + nullableValue->~T(); + nullableValue = nullptr; + } + + T& operator*() { return *nullableValue; } + T const& operator*() const { return *nullableValue; } + T* operator->() { return nullableValue; } + const T* operator->() const { return nullableValue; } + + T valueOr( T const& defaultValue ) const { + return nullableValue ? *nullableValue : defaultValue; + } + + bool some() const { return nullableValue != nullptr; } + bool none() const { return nullableValue == nullptr; } + + bool operator !() const { return nullableValue == nullptr; } + explicit operator bool() const { + return some(); + } + + private: + T *nullableValue; + alignas(alignof(T)) char storage[sizeof(T)]; + }; + +} // end namespace Catch + +// end catch_option.hpp +#include <iosfwd> +#include <string> +#include <vector> +#include <memory> + +namespace Catch { + + enum class Verbosity { + Quiet = 0, + Normal, + High + }; + + struct WarnAbout { enum What { + Nothing = 0x00, + NoAssertions = 0x01, + NoTests = 0x02 + }; }; + + struct ShowDurations { enum OrNot { + DefaultForReporter, + Always, + Never + }; }; + struct RunTests { enum InWhatOrder { + InDeclarationOrder, + InLexicographicalOrder, + InRandomOrder + }; }; + struct UseColour { enum YesOrNo { + Auto, + Yes, + No + }; }; + struct WaitForKeypress { enum When { + Never, + BeforeStart = 1, + BeforeExit = 2, + BeforeStartAndExit = BeforeStart | BeforeExit + }; }; + + class TestSpec; + + struct IConfig : NonCopyable { + + virtual ~IConfig(); + + virtual bool allowThrows() const = 0; + virtual std::ostream& stream() const = 0; + virtual std::string name() const = 0; + virtual bool includeSuccessfulResults() const = 0; + virtual bool shouldDebugBreak() const = 0; + virtual bool warnAboutMissingAssertions() const = 0; + virtual bool warnAboutNoTests() const = 0; + virtual int abortAfter() const = 0; + virtual bool showInvisibles() const = 0; + virtual ShowDurations::OrNot showDurations() const = 0; + virtual TestSpec const& testSpec() const = 0; + virtual bool hasTestFilters() const = 0; + virtual std::vector<std::string> const& getTestsOrTags() const = 0; + virtual RunTests::InWhatOrder runOrder() const = 0; + virtual unsigned int rngSeed() const = 0; + virtual UseColour::YesOrNo useColour() const = 0; + virtual std::vector<std::string> const& getSectionsToRun() const = 0; + virtual Verbosity verbosity() const = 0; + + virtual bool benchmarkNoAnalysis() const = 0; + virtual int benchmarkSamples() const = 0; + virtual double benchmarkConfidenceInterval() const = 0; + virtual unsigned int benchmarkResamples() const = 0; + }; + + using IConfigPtr = std::shared_ptr<IConfig const>; +} + +// end catch_interfaces_config.h +#include <random> + +namespace Catch { +namespace Generators { + +template <typename Float> +class RandomFloatingGenerator final : public IGenerator<Float> { + // FIXME: What is the right seed? + std::minstd_rand m_rand; + std::uniform_real_distribution<Float> m_dist; + Float m_current_number; +public: + + RandomFloatingGenerator(Float a, Float b): + m_rand(getCurrentContext().getConfig()->rngSeed()), + m_dist(a, b) { + static_cast<void>(next()); + } + + Float const& get() const override { + return m_current_number; + } + bool next() override { + m_current_number = m_dist(m_rand); + return true; + } +}; + +template <typename Integer> +class RandomIntegerGenerator final : public IGenerator<Integer> { + std::minstd_rand m_rand; + std::uniform_int_distribution<Integer> m_dist; + Integer m_current_number; +public: + + RandomIntegerGenerator(Integer a, Integer b): + m_rand(getCurrentContext().getConfig()->rngSeed()), + m_dist(a, b) { + static_cast<void>(next()); + } + + Integer const& get() const override { + return m_current_number; + } + bool next() override { + m_current_number = m_dist(m_rand); + return true; + } +}; + +// TODO: Ideally this would be also constrained against the various char types, +// but I don't expect users to run into that in practice. +template <typename T> +typename std::enable_if<std::is_integral<T>::value && !std::is_same<T, bool>::value, +GeneratorWrapper<T>>::type +random(T a, T b) { + return GeneratorWrapper<T>( + pf::make_unique<RandomIntegerGenerator<T>>(a, b) + ); +} + +template <typename T> +typename std::enable_if<std::is_floating_point<T>::value, +GeneratorWrapper<T>>::type +random(T a, T b) { + return GeneratorWrapper<T>( + pf::make_unique<RandomFloatingGenerator<T>>(a, b) + ); +} + +template <typename T> +class RangeGenerator final : public IGenerator<T> { + T m_current; + T m_end; + T m_step; + bool m_positive; + +public: + RangeGenerator(T const& start, T const& end, T const& step): + m_current(start), + m_end(end), + m_step(step), + m_positive(m_step > T(0)) + { + assert(m_current != m_end && "Range start and end cannot be equal"); + assert(m_step != T(0) && "Step size cannot be zero"); + assert(((m_positive && m_current <= m_end) || (!m_positive && m_current >= m_end)) && "Step moves away from end"); + } + + RangeGenerator(T const& start, T const& end): + RangeGenerator(start, end, (start < end) ? T(1) : T(-1)) + {} + + T const& get() const override { + return m_current; + } + + bool next() override { + m_current += m_step; + return (m_positive) ? (m_current < m_end) : (m_current > m_end); + } +}; + +template <typename T> +GeneratorWrapper<T> range(T const& start, T const& end, T const& step) { + static_assert(std::is_integral<T>::value && !std::is_same<T, bool>::value, "Type must be an integer"); + return GeneratorWrapper<T>(pf::make_unique<RangeGenerator<T>>(start, end, step)); +} + +template <typename T> +GeneratorWrapper<T> range(T const& start, T const& end) { + static_assert(std::is_integral<T>::value && !std::is_same<T, bool>::value, "Type must be an integer"); + return GeneratorWrapper<T>(pf::make_unique<RangeGenerator<T>>(start, end)); +} + +} // namespace Generators +} // namespace Catch + +// end catch_generators_specific.hpp + +// These files are included here so the single_include script doesn't put them +// in the conditionally compiled sections +// start catch_test_case_info.h + +#include <string> +#include <vector> +#include <memory> + +#ifdef __clang__ +#pragma clang diagnostic push +#pragma clang diagnostic ignored "-Wpadded" +#endif + +namespace Catch { + + struct ITestInvoker; + + struct TestCaseInfo { + enum SpecialProperties{ + None = 0, + IsHidden = 1 << 1, + ShouldFail = 1 << 2, + MayFail = 1 << 3, + Throws = 1 << 4, + NonPortable = 1 << 5, + Benchmark = 1 << 6 + }; + + TestCaseInfo( std::string const& _name, + std::string const& _className, + std::string const& _description, + std::vector<std::string> const& _tags, + SourceLineInfo const& _lineInfo ); + + friend void setTags( TestCaseInfo& testCaseInfo, std::vector<std::string> tags ); + + bool isHidden() const; + bool throws() const; + bool okToFail() const; + bool expectedToFail() const; + + std::string tagsAsString() const; + + std::string name; + std::string className; + std::string description; + std::vector<std::string> tags; + std::vector<std::string> lcaseTags; + SourceLineInfo lineInfo; + SpecialProperties properties; + }; + + class TestCase : public TestCaseInfo { + public: + + TestCase( ITestInvoker* testCase, TestCaseInfo&& info ); + + TestCase withName( std::string const& _newName ) const; + + void invoke() const; + + TestCaseInfo const& getTestCaseInfo() const; + + bool operator == ( TestCase const& other ) const; + bool operator < ( TestCase const& other ) const; + + private: + std::shared_ptr<ITestInvoker> test; + }; + + TestCase makeTestCase( ITestInvoker* testCase, + std::string const& className, + NameAndTags const& nameAndTags, + SourceLineInfo const& lineInfo ); +} + +#ifdef __clang__ +#pragma clang diagnostic pop +#endif + +// end catch_test_case_info.h +// start catch_interfaces_runner.h + +namespace Catch { + + struct IRunner { + virtual ~IRunner(); + virtual bool aborting() const = 0; + }; +} + +// end catch_interfaces_runner.h + +#ifdef __OBJC__ +// start catch_objc.hpp + +#import <objc/runtime.h> + +#include <string> + +// NB. Any general catch headers included here must be included +// in catch.hpp first to make sure they are included by the single +// header for non obj-usage + +/////////////////////////////////////////////////////////////////////////////// +// This protocol is really only here for (self) documenting purposes, since +// all its methods are optional. +@protocol OcFixture + +@optional + +-(void) setUp; +-(void) tearDown; + +@end + +namespace Catch { + + class OcMethod : public ITestInvoker { + + public: + OcMethod( Class cls, SEL sel ) : m_cls( cls ), m_sel( sel ) {} + + virtual void invoke() const { + id obj = [[m_cls alloc] init]; + + performOptionalSelector( obj, @selector(setUp) ); + performOptionalSelector( obj, m_sel ); + performOptionalSelector( obj, @selector(tearDown) ); + + arcSafeRelease( obj ); + } + private: + virtual ~OcMethod() {} + + Class m_cls; + SEL m_sel; + }; + + namespace Detail{ + + inline std::string getAnnotation( Class cls, + std::string const& annotationName, + std::string const& testCaseName ) { + NSString* selStr = [[NSString alloc] initWithFormat:@"Catch_%s_%s", annotationName.c_str(), testCaseName.c_str()]; + SEL sel = NSSelectorFromString( selStr ); + arcSafeRelease( selStr ); + id value = performOptionalSelector( cls, sel ); + if( value ) + return [(NSString*)value UTF8String]; + return ""; + } + } + + inline std::size_t registerTestMethods() { + std::size_t noTestMethods = 0; + int noClasses = objc_getClassList( nullptr, 0 ); + + Class* classes = (CATCH_UNSAFE_UNRETAINED Class *)malloc( sizeof(Class) * noClasses); + objc_getClassList( classes, noClasses ); + + for( int c = 0; c < noClasses; c++ ) { + Class cls = classes[c]; + { + u_int count; + Method* methods = class_copyMethodList( cls, &count ); + for( u_int m = 0; m < count ; m++ ) { + SEL selector = method_getName(methods[m]); + std::string methodName = sel_getName(selector); + if( startsWith( methodName, "Catch_TestCase_" ) ) { + std::string testCaseName = methodName.substr( 15 ); + std::string name = Detail::getAnnotation( cls, "Name", testCaseName ); + std::string desc = Detail::getAnnotation( cls, "Description", testCaseName ); + const char* className = class_getName( cls ); + + getMutableRegistryHub().registerTest( makeTestCase( new OcMethod( cls, selector ), className, NameAndTags( name.c_str(), desc.c_str() ), SourceLineInfo("",0) ) ); + noTestMethods++; + } + } + free(methods); + } + } + return noTestMethods; + } + +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) + + namespace Matchers { + namespace Impl { + namespace NSStringMatchers { + + struct StringHolder : MatcherBase<NSString*>{ + StringHolder( NSString* substr ) : m_substr( [substr copy] ){} + StringHolder( StringHolder const& other ) : m_substr( [other.m_substr copy] ){} + StringHolder() { + arcSafeRelease( m_substr ); + } + + bool match( NSString* const& str ) const override { + return false; + } + + NSString* CATCH_ARC_STRONG m_substr; + }; + + struct Equals : StringHolder { + Equals( NSString* substr ) : StringHolder( substr ){} + + bool match( NSString* const& str ) const override { + return (str != nil || m_substr == nil ) && + [str isEqualToString:m_substr]; + } + + std::string describe() const override { + return "equals string: " + Catch::Detail::stringify( m_substr ); + } + }; + + struct Contains : StringHolder { + Contains( NSString* substr ) : StringHolder( substr ){} + + bool match( NSString* const& str ) const override { + return (str != nil || m_substr == nil ) && + [str rangeOfString:m_substr].location != NSNotFound; + } + + std::string describe() const override { + return "contains string: " + Catch::Detail::stringify( m_substr ); + } + }; + + struct StartsWith : StringHolder { + StartsWith( NSString* substr ) : StringHolder( substr ){} + + bool match( NSString* const& str ) const override { + return (str != nil || m_substr == nil ) && + [str rangeOfString:m_substr].location == 0; + } + + std::string describe() const override { + return "starts with: " + Catch::Detail::stringify( m_substr ); + } + }; + struct EndsWith : StringHolder { + EndsWith( NSString* substr ) : StringHolder( substr ){} + + bool match( NSString* const& str ) const override { + return (str != nil || m_substr == nil ) && + [str rangeOfString:m_substr].location == [str length] - [m_substr length]; + } + + std::string describe() const override { + return "ends with: " + Catch::Detail::stringify( m_substr ); + } + }; + + } // namespace NSStringMatchers + } // namespace Impl + + inline Impl::NSStringMatchers::Equals + Equals( NSString* substr ){ return Impl::NSStringMatchers::Equals( substr ); } + + inline Impl::NSStringMatchers::Contains + Contains( NSString* substr ){ return Impl::NSStringMatchers::Contains( substr ); } + + inline Impl::NSStringMatchers::StartsWith + StartsWith( NSString* substr ){ return Impl::NSStringMatchers::StartsWith( substr ); } + + inline Impl::NSStringMatchers::EndsWith + EndsWith( NSString* substr ){ return Impl::NSStringMatchers::EndsWith( substr ); } + + } // namespace Matchers + + using namespace Matchers; + +#endif // CATCH_CONFIG_DISABLE_MATCHERS + +} // namespace Catch + +/////////////////////////////////////////////////////////////////////////////// +#define OC_MAKE_UNIQUE_NAME( root, uniqueSuffix ) root##uniqueSuffix +#define OC_TEST_CASE2( name, desc, uniqueSuffix ) \ ++(NSString*) OC_MAKE_UNIQUE_NAME( Catch_Name_test_, uniqueSuffix ) \ +{ \ +return @ name; \ +} \ ++(NSString*) OC_MAKE_UNIQUE_NAME( Catch_Description_test_, uniqueSuffix ) \ +{ \ +return @ desc; \ +} \ +-(void) OC_MAKE_UNIQUE_NAME( Catch_TestCase_test_, uniqueSuffix ) + +#define OC_TEST_CASE( name, desc ) OC_TEST_CASE2( name, desc, __LINE__ ) + +// end catch_objc.hpp +#endif + +// Benchmarking needs the externally-facing parts of reporters to work +#if defined(CATCH_CONFIG_EXTERNAL_INTERFACES) || defined(CATCH_CONFIG_ENABLE_BENCHMARKING) +// start catch_external_interfaces.h + +// start catch_reporter_bases.hpp + +// start catch_interfaces_reporter.h + +// start catch_config.hpp + +// start catch_test_spec_parser.h + +#ifdef __clang__ +#pragma clang diagnostic push +#pragma clang diagnostic ignored "-Wpadded" +#endif + +// start catch_test_spec.h + +#ifdef __clang__ +#pragma clang diagnostic push +#pragma clang diagnostic ignored "-Wpadded" +#endif + +// start catch_wildcard_pattern.h + +namespace Catch +{ + class WildcardPattern { + enum WildcardPosition { + NoWildcard = 0, + WildcardAtStart = 1, + WildcardAtEnd = 2, + WildcardAtBothEnds = WildcardAtStart | WildcardAtEnd + }; + + public: + + WildcardPattern( std::string const& pattern, CaseSensitive::Choice caseSensitivity ); + virtual ~WildcardPattern() = default; + virtual bool matches( std::string const& str ) const; + + private: + std::string adjustCase( std::string const& str ) const; + CaseSensitive::Choice m_caseSensitivity; + WildcardPosition m_wildcard = NoWildcard; + std::string m_pattern; + }; +} + +// end catch_wildcard_pattern.h +#include <string> +#include <vector> +#include <memory> + +namespace Catch { + + class TestSpec { + struct Pattern { + virtual ~Pattern(); + virtual bool matches( TestCaseInfo const& testCase ) const = 0; + }; + using PatternPtr = std::shared_ptr<Pattern>; + + class NamePattern : public Pattern { + public: + NamePattern( std::string const& name ); + virtual ~NamePattern(); + bool matches( TestCaseInfo const& testCase ) const override; + private: + WildcardPattern m_wildcardPattern; + }; + + class TagPattern : public Pattern { + public: + TagPattern( std::string const& tag ); + virtual ~TagPattern(); + bool matches( TestCaseInfo const& testCase ) const override; + private: + std::string m_tag; + }; + + class ExcludedPattern : public Pattern { + public: + ExcludedPattern( PatternPtr const& underlyingPattern ); + virtual ~ExcludedPattern(); + bool matches( TestCaseInfo const& testCase ) const override; + private: + PatternPtr m_underlyingPattern; + }; + + struct Filter { + std::vector<PatternPtr> m_patterns; + + bool matches( TestCaseInfo const& testCase ) const; + }; + + public: + bool hasFilters() const; + bool matches( TestCaseInfo const& testCase ) const; + + private: + std::vector<Filter> m_filters; + + friend class TestSpecParser; + }; +} + +#ifdef __clang__ +#pragma clang diagnostic pop +#endif + +// end catch_test_spec.h +// start catch_interfaces_tag_alias_registry.h + +#include <string> + +namespace Catch { + + struct TagAlias; + + struct ITagAliasRegistry { + virtual ~ITagAliasRegistry(); + // Nullptr if not present + virtual TagAlias const* find( std::string const& alias ) const = 0; + virtual std::string expandAliases( std::string const& unexpandedTestSpec ) const = 0; + + static ITagAliasRegistry const& get(); + }; + +} // end namespace Catch + +// end catch_interfaces_tag_alias_registry.h +namespace Catch { + + class TestSpecParser { + enum Mode{ None, Name, QuotedName, Tag, EscapedName }; + Mode m_mode = None; + bool m_exclusion = false; + std::size_t m_start = std::string::npos, m_pos = 0; + std::string m_arg; + std::vector<std::size_t> m_escapeChars; + TestSpec::Filter m_currentFilter; + TestSpec m_testSpec; + ITagAliasRegistry const* m_tagAliases = nullptr; + + public: + TestSpecParser( ITagAliasRegistry const& tagAliases ); + + TestSpecParser& parse( std::string const& arg ); + TestSpec testSpec(); + + private: + void visitChar( char c ); + void startNewMode( Mode mode, std::size_t start ); + void escape(); + std::string subString() const; + + template<typename T> + void addPattern() { + std::string token = subString(); + for( std::size_t i = 0; i < m_escapeChars.size(); ++i ) + token = token.substr( 0, m_escapeChars[i]-m_start-i ) + token.substr( m_escapeChars[i]-m_start-i+1 ); + m_escapeChars.clear(); + if( startsWith( token, "exclude:" ) ) { + m_exclusion = true; + token = token.substr( 8 ); + } + if( !token.empty() ) { + TestSpec::PatternPtr pattern = std::make_shared<T>( token ); + if( m_exclusion ) + pattern = std::make_shared<TestSpec::ExcludedPattern>( pattern ); + m_currentFilter.m_patterns.push_back( pattern ); + } + m_exclusion = false; + m_mode = None; + } + + void addFilter(); + }; + TestSpec parseTestSpec( std::string const& arg ); + +} // namespace Catch + +#ifdef __clang__ +#pragma clang diagnostic pop +#endif + +// end catch_test_spec_parser.h +// Libstdc++ doesn't like incomplete classes for unique_ptr + +#include <memory> +#include <vector> +#include <string> + +#ifndef CATCH_CONFIG_CONSOLE_WIDTH +#define CATCH_CONFIG_CONSOLE_WIDTH 80 +#endif + +namespace Catch { + + struct IStream; + + struct ConfigData { + bool listTests = false; + bool listTags = false; + bool listReporters = false; + bool listTestNamesOnly = false; + + bool showSuccessfulTests = false; + bool shouldDebugBreak = false; + bool noThrow = false; + bool showHelp = false; + bool showInvisibles = false; + bool filenamesAsTags = false; + bool libIdentify = false; + + int abortAfter = -1; + unsigned int rngSeed = 0; + + bool benchmarkNoAnalysis = false; + unsigned int benchmarkSamples = 100; + double benchmarkConfidenceInterval = 0.95; + unsigned int benchmarkResamples = 100000; + + Verbosity verbosity = Verbosity::Normal; + WarnAbout::What warnings = WarnAbout::Nothing; + ShowDurations::OrNot showDurations = ShowDurations::DefaultForReporter; + RunTests::InWhatOrder runOrder = RunTests::InDeclarationOrder; + UseColour::YesOrNo useColour = UseColour::Auto; + WaitForKeypress::When waitForKeypress = WaitForKeypress::Never; + + std::string outputFilename; + std::string name; + std::string processName; +#ifndef CATCH_CONFIG_DEFAULT_REPORTER +#define CATCH_CONFIG_DEFAULT_REPORTER "console" +#endif + std::string reporterName = CATCH_CONFIG_DEFAULT_REPORTER; +#undef CATCH_CONFIG_DEFAULT_REPORTER + + std::vector<std::string> testsOrTags; + std::vector<std::string> sectionsToRun; + }; + + class Config : public IConfig { + public: + + Config() = default; + Config( ConfigData const& data ); + virtual ~Config() = default; + + std::string const& getFilename() const; + + bool listTests() const; + bool listTestNamesOnly() const; + bool listTags() const; + bool listReporters() const; + + std::string getProcessName() const; + std::string const& getReporterName() const; + + std::vector<std::string> const& getTestsOrTags() const override; + std::vector<std::string> const& getSectionsToRun() const override; + + TestSpec const& testSpec() const override; + bool hasTestFilters() const override; + + bool showHelp() const; + + // IConfig interface + bool allowThrows() const override; + std::ostream& stream() const override; + std::string name() const override; + bool includeSuccessfulResults() const override; + bool warnAboutMissingAssertions() const override; + bool warnAboutNoTests() const override; + ShowDurations::OrNot showDurations() const override; + RunTests::InWhatOrder runOrder() const override; + unsigned int rngSeed() const override; + UseColour::YesOrNo useColour() const override; + bool shouldDebugBreak() const override; + int abortAfter() const override; + bool showInvisibles() const override; + Verbosity verbosity() const override; + bool benchmarkNoAnalysis() const override; + int benchmarkSamples() const override; + double benchmarkConfidenceInterval() const override; + unsigned int benchmarkResamples() const override; + + private: + + IStream const* openStream(); + ConfigData m_data; + + std::unique_ptr<IStream const> m_stream; + TestSpec m_testSpec; + bool m_hasTestFilters = false; + }; + +} // end namespace Catch + +// end catch_config.hpp +// start catch_assertionresult.h + +#include <string> + +namespace Catch { + + struct AssertionResultData + { + AssertionResultData() = delete; + + AssertionResultData( ResultWas::OfType _resultType, LazyExpression const& _lazyExpression ); + + std::string message; + mutable std::string reconstructedExpression; + LazyExpression lazyExpression; + ResultWas::OfType resultType; + + std::string reconstructExpression() const; + }; + + class AssertionResult { + public: + AssertionResult() = delete; + AssertionResult( AssertionInfo const& info, AssertionResultData const& data ); + + bool isOk() const; + bool succeeded() const; + ResultWas::OfType getResultType() const; + bool hasExpression() const; + bool hasMessage() const; + std::string getExpression() const; + std::string getExpressionInMacro() const; + bool hasExpandedExpression() const; + std::string getExpandedExpression() const; + std::string getMessage() const; + SourceLineInfo getSourceInfo() const; + StringRef getTestMacroName() const; + + //protected: + AssertionInfo m_info; + AssertionResultData m_resultData; + }; + +} // end namespace Catch + +// end catch_assertionresult.h +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) +// start catch_estimate.hpp + + // Statistics estimates + + +namespace Catch { + namespace Benchmark { + template <typename Duration> + struct Estimate { + Duration point; + Duration lower_bound; + Duration upper_bound; + double confidence_interval; + + template <typename Duration2> + operator Estimate<Duration2>() const { + return { point, lower_bound, upper_bound, confidence_interval }; + } + }; + } // namespace Benchmark +} // namespace Catch + +// end catch_estimate.hpp +// start catch_outlier_classification.hpp + +// Outlier information + +namespace Catch { + namespace Benchmark { + struct OutlierClassification { + int samples_seen = 0; + int low_severe = 0; // more than 3 times IQR below Q1 + int low_mild = 0; // 1.5 to 3 times IQR below Q1 + int high_mild = 0; // 1.5 to 3 times IQR above Q3 + int high_severe = 0; // more than 3 times IQR above Q3 + + int total() const { + return low_severe + low_mild + high_mild + high_severe; + } + }; + } // namespace Benchmark +} // namespace Catch + +// end catch_outlier_classification.hpp +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + +#include <string> +#include <iosfwd> +#include <map> +#include <set> +#include <memory> +#include <algorithm> + +namespace Catch { + + struct ReporterConfig { + explicit ReporterConfig( IConfigPtr const& _fullConfig ); + + ReporterConfig( IConfigPtr const& _fullConfig, std::ostream& _stream ); + + std::ostream& stream() const; + IConfigPtr fullConfig() const; + + private: + std::ostream* m_stream; + IConfigPtr m_fullConfig; + }; + + struct ReporterPreferences { + bool shouldRedirectStdOut = false; + bool shouldReportAllAssertions = false; + }; + + template<typename T> + struct LazyStat : Option<T> { + LazyStat& operator=( T const& _value ) { + Option<T>::operator=( _value ); + used = false; + return *this; + } + void reset() { + Option<T>::reset(); + used = false; + } + bool used = false; + }; + + struct TestRunInfo { + TestRunInfo( std::string const& _name ); + std::string name; + }; + struct GroupInfo { + GroupInfo( std::string const& _name, + std::size_t _groupIndex, + std::size_t _groupsCount ); + + std::string name; + std::size_t groupIndex; + std::size_t groupsCounts; + }; + + struct AssertionStats { + AssertionStats( AssertionResult const& _assertionResult, + std::vector<MessageInfo> const& _infoMessages, + Totals const& _totals ); + + AssertionStats( AssertionStats const& ) = default; + AssertionStats( AssertionStats && ) = default; + AssertionStats& operator = ( AssertionStats const& ) = delete; + AssertionStats& operator = ( AssertionStats && ) = delete; + virtual ~AssertionStats(); + + AssertionResult assertionResult; + std::vector<MessageInfo> infoMessages; + Totals totals; + }; + + struct SectionStats { + SectionStats( SectionInfo const& _sectionInfo, + Counts const& _assertions, + double _durationInSeconds, + bool _missingAssertions ); + SectionStats( SectionStats const& ) = default; + SectionStats( SectionStats && ) = default; + SectionStats& operator = ( SectionStats const& ) = default; + SectionStats& operator = ( SectionStats && ) = default; + virtual ~SectionStats(); + + SectionInfo sectionInfo; + Counts assertions; + double durationInSeconds; + bool missingAssertions; + }; + + struct TestCaseStats { + TestCaseStats( TestCaseInfo const& _testInfo, + Totals const& _totals, + std::string const& _stdOut, + std::string const& _stdErr, + bool _aborting ); + + TestCaseStats( TestCaseStats const& ) = default; + TestCaseStats( TestCaseStats && ) = default; + TestCaseStats& operator = ( TestCaseStats const& ) = default; + TestCaseStats& operator = ( TestCaseStats && ) = default; + virtual ~TestCaseStats(); + + TestCaseInfo testInfo; + Totals totals; + std::string stdOut; + std::string stdErr; + bool aborting; + }; + + struct TestGroupStats { + TestGroupStats( GroupInfo const& _groupInfo, + Totals const& _totals, + bool _aborting ); + TestGroupStats( GroupInfo const& _groupInfo ); + + TestGroupStats( TestGroupStats const& ) = default; + TestGroupStats( TestGroupStats && ) = default; + TestGroupStats& operator = ( TestGroupStats const& ) = default; + TestGroupStats& operator = ( TestGroupStats && ) = default; + virtual ~TestGroupStats(); + + GroupInfo groupInfo; + Totals totals; + bool aborting; + }; + + struct TestRunStats { + TestRunStats( TestRunInfo const& _runInfo, + Totals const& _totals, + bool _aborting ); + + TestRunStats( TestRunStats const& ) = default; + TestRunStats( TestRunStats && ) = default; + TestRunStats& operator = ( TestRunStats const& ) = default; + TestRunStats& operator = ( TestRunStats && ) = default; + virtual ~TestRunStats(); + + TestRunInfo runInfo; + Totals totals; + bool aborting; + }; + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + struct BenchmarkInfo { + std::string name; + double estimatedDuration; + int iterations; + int samples; + unsigned int resamples; + double clockResolution; + double clockCost; + }; + + template <class Duration> + struct BenchmarkStats { + BenchmarkInfo info; + + std::vector<Duration> samples; + Benchmark::Estimate<Duration> mean; + Benchmark::Estimate<Duration> standardDeviation; + Benchmark::OutlierClassification outliers; + double outlierVariance; + + template <typename Duration2> + operator BenchmarkStats<Duration2>() const { + std::vector<Duration2> samples2; + samples2.reserve(samples.size()); + std::transform(samples.begin(), samples.end(), std::back_inserter(samples2), [](Duration d) { return Duration2(d); }); + return { + info, + std::move(samples2), + mean, + standardDeviation, + outliers, + outlierVariance, + }; + } + }; +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + struct IStreamingReporter { + virtual ~IStreamingReporter() = default; + + // Implementing class must also provide the following static methods: + // static std::string getDescription(); + // static std::set<Verbosity> getSupportedVerbosities() + + virtual ReporterPreferences getPreferences() const = 0; + + virtual void noMatchingTestCases( std::string const& spec ) = 0; + + virtual void testRunStarting( TestRunInfo const& testRunInfo ) = 0; + virtual void testGroupStarting( GroupInfo const& groupInfo ) = 0; + + virtual void testCaseStarting( TestCaseInfo const& testInfo ) = 0; + virtual void sectionStarting( SectionInfo const& sectionInfo ) = 0; + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + virtual void benchmarkPreparing( std::string const& ) {} + virtual void benchmarkStarting( BenchmarkInfo const& ) {} + virtual void benchmarkEnded( BenchmarkStats<> const& ) {} + virtual void benchmarkFailed( std::string const& ) {} +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + virtual void assertionStarting( AssertionInfo const& assertionInfo ) = 0; + + // The return value indicates if the messages buffer should be cleared: + virtual bool assertionEnded( AssertionStats const& assertionStats ) = 0; + + virtual void sectionEnded( SectionStats const& sectionStats ) = 0; + virtual void testCaseEnded( TestCaseStats const& testCaseStats ) = 0; + virtual void testGroupEnded( TestGroupStats const& testGroupStats ) = 0; + virtual void testRunEnded( TestRunStats const& testRunStats ) = 0; + + virtual void skipTest( TestCaseInfo const& testInfo ) = 0; + + // Default empty implementation provided + virtual void fatalErrorEncountered( StringRef name ); + + virtual bool isMulti() const; + }; + using IStreamingReporterPtr = std::unique_ptr<IStreamingReporter>; + + struct IReporterFactory { + virtual ~IReporterFactory(); + virtual IStreamingReporterPtr create( ReporterConfig const& config ) const = 0; + virtual std::string getDescription() const = 0; + }; + using IReporterFactoryPtr = std::shared_ptr<IReporterFactory>; + + struct IReporterRegistry { + using FactoryMap = std::map<std::string, IReporterFactoryPtr>; + using Listeners = std::vector<IReporterFactoryPtr>; + + virtual ~IReporterRegistry(); + virtual IStreamingReporterPtr create( std::string const& name, IConfigPtr const& config ) const = 0; + virtual FactoryMap const& getFactories() const = 0; + virtual Listeners const& getListeners() const = 0; + }; + +} // end namespace Catch + +// end catch_interfaces_reporter.h +#include <algorithm> +#include <cstring> +#include <cfloat> +#include <cstdio> +#include <cassert> +#include <memory> +#include <ostream> + +namespace Catch { + void prepareExpandedExpression(AssertionResult& result); + + // Returns double formatted as %.3f (format expected on output) + std::string getFormattedDuration( double duration ); + + std::string serializeFilters( std::vector<std::string> const& container ); + + template<typename DerivedT> + struct StreamingReporterBase : IStreamingReporter { + + StreamingReporterBase( ReporterConfig const& _config ) + : m_config( _config.fullConfig() ), + stream( _config.stream() ) + { + m_reporterPrefs.shouldRedirectStdOut = false; + if( !DerivedT::getSupportedVerbosities().count( m_config->verbosity() ) ) + CATCH_ERROR( "Verbosity level not supported by this reporter" ); + } + + ReporterPreferences getPreferences() const override { + return m_reporterPrefs; + } + + static std::set<Verbosity> getSupportedVerbosities() { + return { Verbosity::Normal }; + } + + ~StreamingReporterBase() override = default; + + void noMatchingTestCases(std::string const&) override {} + + void testRunStarting(TestRunInfo const& _testRunInfo) override { + currentTestRunInfo = _testRunInfo; + } + + void testGroupStarting(GroupInfo const& _groupInfo) override { + currentGroupInfo = _groupInfo; + } + + void testCaseStarting(TestCaseInfo const& _testInfo) override { + currentTestCaseInfo = _testInfo; + } + void sectionStarting(SectionInfo const& _sectionInfo) override { + m_sectionStack.push_back(_sectionInfo); + } + + void sectionEnded(SectionStats const& /* _sectionStats */) override { + m_sectionStack.pop_back(); + } + void testCaseEnded(TestCaseStats const& /* _testCaseStats */) override { + currentTestCaseInfo.reset(); + } + void testGroupEnded(TestGroupStats const& /* _testGroupStats */) override { + currentGroupInfo.reset(); + } + void testRunEnded(TestRunStats const& /* _testRunStats */) override { + currentTestCaseInfo.reset(); + currentGroupInfo.reset(); + currentTestRunInfo.reset(); + } + + void skipTest(TestCaseInfo const&) override { + // Don't do anything with this by default. + // It can optionally be overridden in the derived class. + } + + IConfigPtr m_config; + std::ostream& stream; + + LazyStat<TestRunInfo> currentTestRunInfo; + LazyStat<GroupInfo> currentGroupInfo; + LazyStat<TestCaseInfo> currentTestCaseInfo; + + std::vector<SectionInfo> m_sectionStack; + ReporterPreferences m_reporterPrefs; + }; + + template<typename DerivedT> + struct CumulativeReporterBase : IStreamingReporter { + template<typename T, typename ChildNodeT> + struct Node { + explicit Node( T const& _value ) : value( _value ) {} + virtual ~Node() {} + + using ChildNodes = std::vector<std::shared_ptr<ChildNodeT>>; + T value; + ChildNodes children; + }; + struct SectionNode { + explicit SectionNode(SectionStats const& _stats) : stats(_stats) {} + virtual ~SectionNode() = default; + + bool operator == (SectionNode const& other) const { + return stats.sectionInfo.lineInfo == other.stats.sectionInfo.lineInfo; + } + bool operator == (std::shared_ptr<SectionNode> const& other) const { + return operator==(*other); + } + + SectionStats stats; + using ChildSections = std::vector<std::shared_ptr<SectionNode>>; + using Assertions = std::vector<AssertionStats>; + ChildSections childSections; + Assertions assertions; + std::string stdOut; + std::string stdErr; + }; + + struct BySectionInfo { + BySectionInfo( SectionInfo const& other ) : m_other( other ) {} + BySectionInfo( BySectionInfo const& other ) : m_other( other.m_other ) {} + bool operator() (std::shared_ptr<SectionNode> const& node) const { + return ((node->stats.sectionInfo.name == m_other.name) && + (node->stats.sectionInfo.lineInfo == m_other.lineInfo)); + } + void operator=(BySectionInfo const&) = delete; + + private: + SectionInfo const& m_other; + }; + + using TestCaseNode = Node<TestCaseStats, SectionNode>; + using TestGroupNode = Node<TestGroupStats, TestCaseNode>; + using TestRunNode = Node<TestRunStats, TestGroupNode>; + + CumulativeReporterBase( ReporterConfig const& _config ) + : m_config( _config.fullConfig() ), + stream( _config.stream() ) + { + m_reporterPrefs.shouldRedirectStdOut = false; + if( !DerivedT::getSupportedVerbosities().count( m_config->verbosity() ) ) + CATCH_ERROR( "Verbosity level not supported by this reporter" ); + } + ~CumulativeReporterBase() override = default; + + ReporterPreferences getPreferences() const override { + return m_reporterPrefs; + } + + static std::set<Verbosity> getSupportedVerbosities() { + return { Verbosity::Normal }; + } + + void testRunStarting( TestRunInfo const& ) override {} + void testGroupStarting( GroupInfo const& ) override {} + + void testCaseStarting( TestCaseInfo const& ) override {} + + void sectionStarting( SectionInfo const& sectionInfo ) override { + SectionStats incompleteStats( sectionInfo, Counts(), 0, false ); + std::shared_ptr<SectionNode> node; + if( m_sectionStack.empty() ) { + if( !m_rootSection ) + m_rootSection = std::make_shared<SectionNode>( incompleteStats ); + node = m_rootSection; + } + else { + SectionNode& parentNode = *m_sectionStack.back(); + auto it = + std::find_if( parentNode.childSections.begin(), + parentNode.childSections.end(), + BySectionInfo( sectionInfo ) ); + if( it == parentNode.childSections.end() ) { + node = std::make_shared<SectionNode>( incompleteStats ); + parentNode.childSections.push_back( node ); + } + else + node = *it; + } + m_sectionStack.push_back( node ); + m_deepestSection = std::move(node); + } + + void assertionStarting(AssertionInfo const&) override {} + + bool assertionEnded(AssertionStats const& assertionStats) override { + assert(!m_sectionStack.empty()); + // AssertionResult holds a pointer to a temporary DecomposedExpression, + // which getExpandedExpression() calls to build the expression string. + // Our section stack copy of the assertionResult will likely outlive the + // temporary, so it must be expanded or discarded now to avoid calling + // a destroyed object later. + prepareExpandedExpression(const_cast<AssertionResult&>( assertionStats.assertionResult ) ); + SectionNode& sectionNode = *m_sectionStack.back(); + sectionNode.assertions.push_back(assertionStats); + return true; + } + void sectionEnded(SectionStats const& sectionStats) override { + assert(!m_sectionStack.empty()); + SectionNode& node = *m_sectionStack.back(); + node.stats = sectionStats; + m_sectionStack.pop_back(); + } + void testCaseEnded(TestCaseStats const& testCaseStats) override { + auto node = std::make_shared<TestCaseNode>(testCaseStats); + assert(m_sectionStack.size() == 0); + node->children.push_back(m_rootSection); + m_testCases.push_back(node); + m_rootSection.reset(); + + assert(m_deepestSection); + m_deepestSection->stdOut = testCaseStats.stdOut; + m_deepestSection->stdErr = testCaseStats.stdErr; + } + void testGroupEnded(TestGroupStats const& testGroupStats) override { + auto node = std::make_shared<TestGroupNode>(testGroupStats); + node->children.swap(m_testCases); + m_testGroups.push_back(node); + } + void testRunEnded(TestRunStats const& testRunStats) override { + auto node = std::make_shared<TestRunNode>(testRunStats); + node->children.swap(m_testGroups); + m_testRuns.push_back(node); + testRunEndedCumulative(); + } + virtual void testRunEndedCumulative() = 0; + + void skipTest(TestCaseInfo const&) override {} + + IConfigPtr m_config; + std::ostream& stream; + std::vector<AssertionStats> m_assertions; + std::vector<std::vector<std::shared_ptr<SectionNode>>> m_sections; + std::vector<std::shared_ptr<TestCaseNode>> m_testCases; + std::vector<std::shared_ptr<TestGroupNode>> m_testGroups; + + std::vector<std::shared_ptr<TestRunNode>> m_testRuns; + + std::shared_ptr<SectionNode> m_rootSection; + std::shared_ptr<SectionNode> m_deepestSection; + std::vector<std::shared_ptr<SectionNode>> m_sectionStack; + ReporterPreferences m_reporterPrefs; + }; + + template<char C> + char const* getLineOfChars() { + static char line[CATCH_CONFIG_CONSOLE_WIDTH] = {0}; + if( !*line ) { + std::memset( line, C, CATCH_CONFIG_CONSOLE_WIDTH-1 ); + line[CATCH_CONFIG_CONSOLE_WIDTH-1] = 0; + } + return line; + } + + struct TestEventListenerBase : StreamingReporterBase<TestEventListenerBase> { + TestEventListenerBase( ReporterConfig const& _config ); + + static std::set<Verbosity> getSupportedVerbosities(); + + void assertionStarting(AssertionInfo const&) override; + bool assertionEnded(AssertionStats const&) override; + }; + +} // end namespace Catch + +// end catch_reporter_bases.hpp +// start catch_console_colour.h + +namespace Catch { + + struct Colour { + enum Code { + None = 0, + + White, + Red, + Green, + Blue, + Cyan, + Yellow, + Grey, + + Bright = 0x10, + + BrightRed = Bright | Red, + BrightGreen = Bright | Green, + LightGrey = Bright | Grey, + BrightWhite = Bright | White, + BrightYellow = Bright | Yellow, + + // By intention + FileName = LightGrey, + Warning = BrightYellow, + ResultError = BrightRed, + ResultSuccess = BrightGreen, + ResultExpectedFailure = Warning, + + Error = BrightRed, + Success = Green, + + OriginalExpression = Cyan, + ReconstructedExpression = BrightYellow, + + SecondaryText = LightGrey, + Headers = White + }; + + // Use constructed object for RAII guard + Colour( Code _colourCode ); + Colour( Colour&& other ) noexcept; + Colour& operator=( Colour&& other ) noexcept; + ~Colour(); + + // Use static method for one-shot changes + static void use( Code _colourCode ); + + private: + bool m_moved = false; + }; + + std::ostream& operator << ( std::ostream& os, Colour const& ); + +} // end namespace Catch + +// end catch_console_colour.h +// start catch_reporter_registrars.hpp + + +namespace Catch { + + template<typename T> + class ReporterRegistrar { + + class ReporterFactory : public IReporterFactory { + + IStreamingReporterPtr create( ReporterConfig const& config ) const override { + return std::unique_ptr<T>( new T( config ) ); + } + + std::string getDescription() const override { + return T::getDescription(); + } + }; + + public: + + explicit ReporterRegistrar( std::string const& name ) { + getMutableRegistryHub().registerReporter( name, std::make_shared<ReporterFactory>() ); + } + }; + + template<typename T> + class ListenerRegistrar { + + class ListenerFactory : public IReporterFactory { + + IStreamingReporterPtr create( ReporterConfig const& config ) const override { + return std::unique_ptr<T>( new T( config ) ); + } + std::string getDescription() const override { + return std::string(); + } + }; + + public: + + ListenerRegistrar() { + getMutableRegistryHub().registerListener( std::make_shared<ListenerFactory>() ); + } + }; +} + +#if !defined(CATCH_CONFIG_DISABLE) + +#define CATCH_REGISTER_REPORTER( name, reporterType ) \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + namespace{ Catch::ReporterRegistrar<reporterType> catch_internal_RegistrarFor##reporterType( name ); } \ + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS + +#define CATCH_REGISTER_LISTENER( listenerType ) \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \ + namespace{ Catch::ListenerRegistrar<listenerType> catch_internal_RegistrarFor##listenerType; } \ + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS +#else // CATCH_CONFIG_DISABLE + +#define CATCH_REGISTER_REPORTER(name, reporterType) +#define CATCH_REGISTER_LISTENER(listenerType) + +#endif // CATCH_CONFIG_DISABLE + +// end catch_reporter_registrars.hpp +// Allow users to base their work off existing reporters +// start catch_reporter_compact.h + +namespace Catch { + + struct CompactReporter : StreamingReporterBase<CompactReporter> { + + using StreamingReporterBase::StreamingReporterBase; + + ~CompactReporter() override; + + static std::string getDescription(); + + ReporterPreferences getPreferences() const override; + + void noMatchingTestCases(std::string const& spec) override; + + void assertionStarting(AssertionInfo const&) override; + + bool assertionEnded(AssertionStats const& _assertionStats) override; + + void sectionEnded(SectionStats const& _sectionStats) override; + + void testRunEnded(TestRunStats const& _testRunStats) override; + + }; + +} // end namespace Catch + +// end catch_reporter_compact.h +// start catch_reporter_console.h + +#if defined(_MSC_VER) +#pragma warning(push) +#pragma warning(disable:4061) // Not all labels are EXPLICITLY handled in switch + // Note that 4062 (not all labels are handled + // and default is missing) is enabled +#endif + +namespace Catch { + // Fwd decls + struct SummaryColumn; + class TablePrinter; + + struct ConsoleReporter : StreamingReporterBase<ConsoleReporter> { + std::unique_ptr<TablePrinter> m_tablePrinter; + + ConsoleReporter(ReporterConfig const& config); + ~ConsoleReporter() override; + static std::string getDescription(); + + void noMatchingTestCases(std::string const& spec) override; + + void assertionStarting(AssertionInfo const&) override; + + bool assertionEnded(AssertionStats const& _assertionStats) override; + + void sectionStarting(SectionInfo const& _sectionInfo) override; + void sectionEnded(SectionStats const& _sectionStats) override; + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + void benchmarkPreparing(std::string const& name) override; + void benchmarkStarting(BenchmarkInfo const& info) override; + void benchmarkEnded(BenchmarkStats<> const& stats) override; + void benchmarkFailed(std::string const& error) override; +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + void testCaseEnded(TestCaseStats const& _testCaseStats) override; + void testGroupEnded(TestGroupStats const& _testGroupStats) override; + void testRunEnded(TestRunStats const& _testRunStats) override; + void testRunStarting(TestRunInfo const& _testRunInfo) override; + private: + + void lazyPrint(); + + void lazyPrintWithoutClosingBenchmarkTable(); + void lazyPrintRunInfo(); + void lazyPrintGroupInfo(); + void printTestCaseAndSectionHeader(); + + void printClosedHeader(std::string const& _name); + void printOpenHeader(std::string const& _name); + + // if string has a : in first line will set indent to follow it on + // subsequent lines + void printHeaderString(std::string const& _string, std::size_t indent = 0); + + void printTotals(Totals const& totals); + void printSummaryRow(std::string const& label, std::vector<SummaryColumn> const& cols, std::size_t row); + + void printTotalsDivider(Totals const& totals); + void printSummaryDivider(); + void printTestFilters(); + + private: + bool m_headerPrinted = false; + }; + +} // end namespace Catch + +#if defined(_MSC_VER) +#pragma warning(pop) +#endif + +// end catch_reporter_console.h +// start catch_reporter_junit.h + +// start catch_xmlwriter.h + +#include <vector> + +namespace Catch { + + class XmlEncode { + public: + enum ForWhat { ForTextNodes, ForAttributes }; + + XmlEncode( std::string const& str, ForWhat forWhat = ForTextNodes ); + + void encodeTo( std::ostream& os ) const; + + friend std::ostream& operator << ( std::ostream& os, XmlEncode const& xmlEncode ); + + private: + std::string m_str; + ForWhat m_forWhat; + }; + + class XmlWriter { + public: + + class ScopedElement { + public: + ScopedElement( XmlWriter* writer ); + + ScopedElement( ScopedElement&& other ) noexcept; + ScopedElement& operator=( ScopedElement&& other ) noexcept; + + ~ScopedElement(); + + ScopedElement& writeText( std::string const& text, bool indent = true ); + + template<typename T> + ScopedElement& writeAttribute( std::string const& name, T const& attribute ) { + m_writer->writeAttribute( name, attribute ); + return *this; + } + + private: + mutable XmlWriter* m_writer = nullptr; + }; + + XmlWriter( std::ostream& os = Catch::cout() ); + ~XmlWriter(); + + XmlWriter( XmlWriter const& ) = delete; + XmlWriter& operator=( XmlWriter const& ) = delete; + + XmlWriter& startElement( std::string const& name ); + + ScopedElement scopedElement( std::string const& name ); + + XmlWriter& endElement(); + + XmlWriter& writeAttribute( std::string const& name, std::string const& attribute ); + + XmlWriter& writeAttribute( std::string const& name, bool attribute ); + + template<typename T> + XmlWriter& writeAttribute( std::string const& name, T const& attribute ) { + ReusableStringStream rss; + rss << attribute; + return writeAttribute( name, rss.str() ); + } + + XmlWriter& writeText( std::string const& text, bool indent = true ); + + XmlWriter& writeComment( std::string const& text ); + + void writeStylesheetRef( std::string const& url ); + + XmlWriter& writeBlankLine(); + + void ensureTagClosed(); + + private: + + void writeDeclaration(); + + void newlineIfNecessary(); + + bool m_tagIsOpen = false; + bool m_needsNewline = false; + std::vector<std::string> m_tags; + std::string m_indent; + std::ostream& m_os; + }; + +} + +// end catch_xmlwriter.h +namespace Catch { + + class JunitReporter : public CumulativeReporterBase<JunitReporter> { + public: + JunitReporter(ReporterConfig const& _config); + + ~JunitReporter() override; + + static std::string getDescription(); + + void noMatchingTestCases(std::string const& /*spec*/) override; + + void testRunStarting(TestRunInfo const& runInfo) override; + + void testGroupStarting(GroupInfo const& groupInfo) override; + + void testCaseStarting(TestCaseInfo const& testCaseInfo) override; + bool assertionEnded(AssertionStats const& assertionStats) override; + + void testCaseEnded(TestCaseStats const& testCaseStats) override; + + void testGroupEnded(TestGroupStats const& testGroupStats) override; + + void testRunEndedCumulative() override; + + void writeGroup(TestGroupNode const& groupNode, double suiteTime); + + void writeTestCase(TestCaseNode const& testCaseNode); + + void writeSection(std::string const& className, + std::string const& rootName, + SectionNode const& sectionNode); + + void writeAssertions(SectionNode const& sectionNode); + void writeAssertion(AssertionStats const& stats); + + XmlWriter xml; + Timer suiteTimer; + std::string stdOutForSuite; + std::string stdErrForSuite; + unsigned int unexpectedExceptions = 0; + bool m_okToFail = false; + }; + +} // end namespace Catch + +// end catch_reporter_junit.h +// start catch_reporter_xml.h + +namespace Catch { + class XmlReporter : public StreamingReporterBase<XmlReporter> { + public: + XmlReporter(ReporterConfig const& _config); + + ~XmlReporter() override; + + static std::string getDescription(); + + virtual std::string getStylesheetRef() const; + + void writeSourceInfo(SourceLineInfo const& sourceInfo); + + public: // StreamingReporterBase + + void noMatchingTestCases(std::string const& s) override; + + void testRunStarting(TestRunInfo const& testInfo) override; + + void testGroupStarting(GroupInfo const& groupInfo) override; + + void testCaseStarting(TestCaseInfo const& testInfo) override; + + void sectionStarting(SectionInfo const& sectionInfo) override; + + void assertionStarting(AssertionInfo const&) override; + + bool assertionEnded(AssertionStats const& assertionStats) override; + + void sectionEnded(SectionStats const& sectionStats) override; + + void testCaseEnded(TestCaseStats const& testCaseStats) override; + + void testGroupEnded(TestGroupStats const& testGroupStats) override; + + void testRunEnded(TestRunStats const& testRunStats) override; + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + void benchmarkStarting(BenchmarkInfo const&) override; + void benchmarkEnded(BenchmarkStats<> const&) override; + void benchmarkFailed(std::string const&) override; +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + private: + Timer m_testCaseTimer; + XmlWriter m_xml; + int m_sectionDepth = 0; + }; + +} // end namespace Catch + +// end catch_reporter_xml.h + +// end catch_external_interfaces.h +#endif + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) +// start catch_benchmark.hpp + + // Benchmark + +// start catch_chronometer.hpp + +// User-facing chronometer + + +// start catch_clock.hpp + +// Clocks + + +#include <chrono> +#include <ratio> + +namespace Catch { + namespace Benchmark { + template <typename Clock> + using ClockDuration = typename Clock::duration; + template <typename Clock> + using FloatDuration = std::chrono::duration<double, typename Clock::period>; + + template <typename Clock> + using TimePoint = typename Clock::time_point; + + using default_clock = std::chrono::steady_clock; + + template <typename Clock> + struct now { + TimePoint<Clock> operator()() const { + return Clock::now(); + } + }; + + using fp_seconds = std::chrono::duration<double, std::ratio<1>>; + } // namespace Benchmark +} // namespace Catch + +// end catch_clock.hpp +// start catch_optimizer.hpp + + // Hinting the optimizer + + +#if defined(_MSC_VER) +# include <atomic> // atomic_thread_fence +#endif + +namespace Catch { + namespace Benchmark { +#if defined(__GNUC__) || defined(__clang__) + template <typename T> + inline void keep_memory(T* p) { + asm volatile("" : : "g"(p) : "memory"); + } + inline void keep_memory() { + asm volatile("" : : : "memory"); + } + + namespace Detail { + inline void optimizer_barrier() { keep_memory(); } + } // namespace Detail +#elif defined(_MSC_VER) + +#pragma optimize("", off) + template <typename T> + inline void keep_memory(T* p) { + // thanks @milleniumbug + *reinterpret_cast<char volatile*>(p) = *reinterpret_cast<char const volatile*>(p); + } + // TODO equivalent keep_memory() +#pragma optimize("", on) + + namespace Detail { + inline void optimizer_barrier() { + std::atomic_thread_fence(std::memory_order_seq_cst); + } + } // namespace Detail + +#endif + + template <typename T> + inline void deoptimize_value(T&& x) { + keep_memory(&x); + } + + template <typename Fn, typename... Args> + inline auto invoke_deoptimized(Fn&& fn, Args&&... args) -> typename std::enable_if<!std::is_same<void, decltype(fn(args...))>::value>::type { + deoptimize_value(std::forward<Fn>(fn) (std::forward<Args...>(args...))); + } + + template <typename Fn, typename... Args> + inline auto invoke_deoptimized(Fn&& fn, Args&&... args) -> typename std::enable_if<std::is_same<void, decltype(fn(args...))>::value>::type { + std::forward<Fn>(fn) (std::forward<Args...>(args...)); + } + } // namespace Benchmark +} // namespace Catch + +// end catch_optimizer.hpp +// start catch_complete_invoke.hpp + +// Invoke with a special case for void + + +#include <type_traits> +#include <utility> + +namespace Catch { + namespace Benchmark { + namespace Detail { + template <typename T> + struct CompleteType { using type = T; }; + template <> + struct CompleteType<void> { struct type {}; }; + + template <typename T> + using CompleteType_t = typename CompleteType<T>::type; + + template <typename Result> + struct CompleteInvoker { + template <typename Fun, typename... Args> + static Result invoke(Fun&& fun, Args&&... args) { + return std::forward<Fun>(fun)(std::forward<Args>(args)...); + } + }; + template <> + struct CompleteInvoker<void> { + template <typename Fun, typename... Args> + static CompleteType_t<void> invoke(Fun&& fun, Args&&... args) { + std::forward<Fun>(fun)(std::forward<Args>(args)...); + return {}; + } + }; + template <typename Sig> + using ResultOf_t = typename std::result_of<Sig>::type; + + // invoke and not return void :( + template <typename Fun, typename... Args> + CompleteType_t<ResultOf_t<Fun(Args...)>> complete_invoke(Fun&& fun, Args&&... args) { + return CompleteInvoker<ResultOf_t<Fun(Args...)>>::invoke(std::forward<Fun>(fun), std::forward<Args>(args)...); + } + + const std::string benchmarkErrorMsg = "a benchmark failed to run successfully"; + } // namespace Detail + + template <typename Fun> + Detail::CompleteType_t<Detail::ResultOf_t<Fun()>> user_code(Fun&& fun) { + CATCH_TRY{ + return Detail::complete_invoke(std::forward<Fun>(fun)); + } CATCH_CATCH_ALL{ + getResultCapture().benchmarkFailed(translateActiveException()); + CATCH_RUNTIME_ERROR(Detail::benchmarkErrorMsg); + } + } + } // namespace Benchmark +} // namespace Catch + +// end catch_complete_invoke.hpp +namespace Catch { + namespace Benchmark { + namespace Detail { + struct ChronometerConcept { + virtual void start() = 0; + virtual void finish() = 0; + virtual ~ChronometerConcept() = default; + }; + template <typename Clock> + struct ChronometerModel final : public ChronometerConcept { + void start() override { started = Clock::now(); } + void finish() override { finished = Clock::now(); } + + ClockDuration<Clock> elapsed() const { return finished - started; } + + TimePoint<Clock> started; + TimePoint<Clock> finished; + }; + } // namespace Detail + + struct Chronometer { + public: + template <typename Fun> + void measure(Fun&& fun) { measure(std::forward<Fun>(fun), is_callable<Fun(int)>()); } + + int runs() const { return k; } + + Chronometer(Detail::ChronometerConcept& meter, int k) + : impl(&meter) + , k(k) {} + + private: + template <typename Fun> + void measure(Fun&& fun, std::false_type) { + measure([&fun](int) { return fun(); }, std::true_type()); + } + + template <typename Fun> + void measure(Fun&& fun, std::true_type) { + Detail::optimizer_barrier(); + impl->start(); + for (int i = 0; i < k; ++i) invoke_deoptimized(fun, i); + impl->finish(); + Detail::optimizer_barrier(); + } + + Detail::ChronometerConcept* impl; + int k; + }; + } // namespace Benchmark +} // namespace Catch + +// end catch_chronometer.hpp +// start catch_environment.hpp + +// Environment information + + +namespace Catch { + namespace Benchmark { + template <typename Duration> + struct EnvironmentEstimate { + Duration mean; + OutlierClassification outliers; + + template <typename Duration2> + operator EnvironmentEstimate<Duration2>() const { + return { mean, outliers }; + } + }; + template <typename Clock> + struct Environment { + using clock_type = Clock; + EnvironmentEstimate<FloatDuration<Clock>> clock_resolution; + EnvironmentEstimate<FloatDuration<Clock>> clock_cost; + }; + } // namespace Benchmark +} // namespace Catch + +// end catch_environment.hpp +// start catch_execution_plan.hpp + + // Execution plan + + +// start catch_benchmark_function.hpp + + // Dumb std::function implementation for consistent call overhead + + +#include <cassert> +#include <type_traits> +#include <utility> +#include <memory> + +namespace Catch { + namespace Benchmark { + namespace Detail { + template <typename T> + using Decay = typename std::decay<T>::type; + template <typename T, typename U> + struct is_related + : std::is_same<Decay<T>, Decay<U>> {}; + + /// We need to reinvent std::function because every piece of code that might add overhead + /// in a measurement context needs to have consistent performance characteristics so that we + /// can account for it in the measurement. + /// Implementations of std::function with optimizations that aren't always applicable, like + /// small buffer optimizations, are not uncommon. + /// This is effectively an implementation of std::function without any such optimizations; + /// it may be slow, but it is consistently slow. + struct BenchmarkFunction { + private: + struct callable { + virtual void call(Chronometer meter) const = 0; + virtual callable* clone() const = 0; + virtual ~callable() = default; + }; + template <typename Fun> + struct model : public callable { + model(Fun&& fun) : fun(std::move(fun)) {} + model(Fun const& fun) : fun(fun) {} + + model<Fun>* clone() const override { return new model<Fun>(*this); } + + void call(Chronometer meter) const override { + call(meter, is_callable<Fun(Chronometer)>()); + } + void call(Chronometer meter, std::true_type) const { + fun(meter); + } + void call(Chronometer meter, std::false_type) const { + meter.measure(fun); + } + + Fun fun; + }; + + struct do_nothing { void operator()() const {} }; + + template <typename T> + BenchmarkFunction(model<T>* c) : f(c) {} + + public: + BenchmarkFunction() + : f(new model<do_nothing>{ {} }) {} + + template <typename Fun, + typename std::enable_if<!is_related<Fun, BenchmarkFunction>::value, int>::type = 0> + BenchmarkFunction(Fun&& fun) + : f(new model<typename std::decay<Fun>::type>(std::forward<Fun>(fun))) {} + + BenchmarkFunction(BenchmarkFunction&& that) + : f(std::move(that.f)) {} + + BenchmarkFunction(BenchmarkFunction const& that) + : f(that.f->clone()) {} + + BenchmarkFunction& operator=(BenchmarkFunction&& that) { + f = std::move(that.f); + return *this; + } + + BenchmarkFunction& operator=(BenchmarkFunction const& that) { + f.reset(that.f->clone()); + return *this; + } + + void operator()(Chronometer meter) const { f->call(meter); } + + private: + std::unique_ptr<callable> f; + }; + } // namespace Detail + } // namespace Benchmark +} // namespace Catch + +// end catch_benchmark_function.hpp +// start catch_repeat.hpp + +// repeat algorithm + + +#include <type_traits> +#include <utility> + +namespace Catch { + namespace Benchmark { + namespace Detail { + template <typename Fun> + struct repeater { + void operator()(int k) const { + for (int i = 0; i < k; ++i) { + fun(); + } + } + Fun fun; + }; + template <typename Fun> + repeater<typename std::decay<Fun>::type> repeat(Fun&& fun) { + return { std::forward<Fun>(fun) }; + } + } // namespace Detail + } // namespace Benchmark +} // namespace Catch + +// end catch_repeat.hpp +// start catch_run_for_at_least.hpp + +// Run a function for a minimum amount of time + + +// start catch_measure.hpp + +// Measure + + +// start catch_timing.hpp + +// Timing + + +#include <tuple> +#include <type_traits> + +namespace Catch { + namespace Benchmark { + template <typename Duration, typename Result> + struct Timing { + Duration elapsed; + Result result; + int iterations; + }; + template <typename Clock, typename Sig> + using TimingOf = Timing<ClockDuration<Clock>, Detail::CompleteType_t<Detail::ResultOf_t<Sig>>>; + } // namespace Benchmark +} // namespace Catch + +// end catch_timing.hpp +#include <utility> + +namespace Catch { + namespace Benchmark { + namespace Detail { + template <typename Clock, typename Fun, typename... Args> + TimingOf<Clock, Fun(Args...)> measure(Fun&& fun, Args&&... args) { + auto start = Clock::now(); + auto&& r = Detail::complete_invoke(fun, std::forward<Args>(args)...); + auto end = Clock::now(); + auto delta = end - start; + return { delta, std::forward<decltype(r)>(r), 1 }; + } + } // namespace Detail + } // namespace Benchmark +} // namespace Catch + +// end catch_measure.hpp +#include <utility> +#include <type_traits> + +namespace Catch { + namespace Benchmark { + namespace Detail { + template <typename Clock, typename Fun> + TimingOf<Clock, Fun(int)> measure_one(Fun&& fun, int iters, std::false_type) { + return Detail::measure<Clock>(fun, iters); + } + template <typename Clock, typename Fun> + TimingOf<Clock, Fun(Chronometer)> measure_one(Fun&& fun, int iters, std::true_type) { + Detail::ChronometerModel<Clock> meter; + auto&& result = Detail::complete_invoke(fun, Chronometer(meter, iters)); + + return { meter.elapsed(), std::move(result), iters }; + } + + template <typename Clock, typename Fun> + using run_for_at_least_argument_t = typename std::conditional<is_callable<Fun(Chronometer)>::value, Chronometer, int>::type; + + struct optimized_away_error : std::exception { + const char* what() const noexcept override { + return "could not measure benchmark, maybe it was optimized away"; + } + }; + + template <typename Clock, typename Fun> + TimingOf<Clock, Fun(run_for_at_least_argument_t<Clock, Fun>)> run_for_at_least(ClockDuration<Clock> how_long, int seed, Fun&& fun) { + auto iters = seed; + while (iters < (1 << 30)) { + auto&& Timing = measure_one<Clock>(fun, iters, is_callable<Fun(Chronometer)>()); + + if (Timing.elapsed >= how_long) { + return { Timing.elapsed, std::move(Timing.result), iters }; + } + iters *= 2; + } + throw optimized_away_error{}; + } + } // namespace Detail + } // namespace Benchmark +} // namespace Catch + +// end catch_run_for_at_least.hpp +#include <algorithm> + +namespace Catch { + namespace Benchmark { + template <typename Duration> + struct ExecutionPlan { + int iterations_per_sample; + Duration estimated_duration; + Detail::BenchmarkFunction benchmark; + Duration warmup_time; + int warmup_iterations; + + template <typename Duration2> + operator ExecutionPlan<Duration2>() const { + return { iterations_per_sample, estimated_duration, benchmark, warmup_time, warmup_iterations }; + } + + template <typename Clock> + std::vector<FloatDuration<Clock>> run(const IConfig &cfg, Environment<FloatDuration<Clock>> env) const { + // warmup a bit + Detail::run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(warmup_time), warmup_iterations, Detail::repeat(now<Clock>{})); + + std::vector<FloatDuration<Clock>> times; + times.reserve(cfg.benchmarkSamples()); + std::generate_n(std::back_inserter(times), cfg.benchmarkSamples(), [this, env] { + Detail::ChronometerModel<Clock> model; + this->benchmark(Chronometer(model, iterations_per_sample)); + auto sample_time = model.elapsed() - env.clock_cost.mean; + if (sample_time < FloatDuration<Clock>::zero()) sample_time = FloatDuration<Clock>::zero(); + return sample_time / iterations_per_sample; + }); + return times; + } + }; + } // namespace Benchmark +} // namespace Catch + +// end catch_execution_plan.hpp +// start catch_estimate_clock.hpp + + // Environment measurement + + +// start catch_stats.hpp + +// Statistical analysis tools + + +#include <algorithm> +#include <functional> +#include <vector> +#include <numeric> +#include <tuple> +#include <cmath> +#include <utility> +#include <cstddef> + +namespace Catch { + namespace Benchmark { + namespace Detail { + using sample = std::vector<double>; + + double weighted_average_quantile(int k, int q, std::vector<double>::iterator first, std::vector<double>::iterator last); + + template <typename Iterator> + OutlierClassification classify_outliers(Iterator first, Iterator last) { + std::vector<double> copy(first, last); + + auto q1 = weighted_average_quantile(1, 4, copy.begin(), copy.end()); + auto q3 = weighted_average_quantile(3, 4, copy.begin(), copy.end()); + auto iqr = q3 - q1; + auto los = q1 - (iqr * 3.); + auto lom = q1 - (iqr * 1.5); + auto him = q3 + (iqr * 1.5); + auto his = q3 + (iqr * 3.); + + OutlierClassification o; + for (; first != last; ++first) { + auto&& t = *first; + if (t < los) ++o.low_severe; + else if (t < lom) ++o.low_mild; + else if (t > his) ++o.high_severe; + else if (t > him) ++o.high_mild; + ++o.samples_seen; + } + return o; + } + + template <typename Iterator> + double mean(Iterator first, Iterator last) { + auto count = last - first; + double sum = std::accumulate(first, last, 0.); + return sum / count; + } + + template <typename URng, typename Iterator, typename Estimator> + sample resample(URng& rng, int resamples, Iterator first, Iterator last, Estimator& estimator) { + auto n = last - first; + std::uniform_int_distribution<decltype(n)> dist(0, n - 1); + + sample out; + out.reserve(resamples); + std::generate_n(std::back_inserter(out), resamples, [n, first, &estimator, &dist, &rng] { + std::vector<double> resampled; + resampled.reserve(n); + std::generate_n(std::back_inserter(resampled), n, [first, &dist, &rng] { return first[dist(rng)]; }); + return estimator(resampled.begin(), resampled.end()); + }); + std::sort(out.begin(), out.end()); + return out; + } + + template <typename Estimator, typename Iterator> + sample jackknife(Estimator&& estimator, Iterator first, Iterator last) { + auto n = last - first; + auto second = std::next(first); + sample results; + results.reserve(n); + + for (auto it = first; it != last; ++it) { + std::iter_swap(it, first); + results.push_back(estimator(second, last)); + } + + return results; + } + + inline double normal_cdf(double x) { + return std::erfc(-x / std::sqrt(2.0)) / 2.0; + } + + double erfc_inv(double x); + + double normal_quantile(double p); + + template <typename Iterator, typename Estimator> + Estimate<double> bootstrap(double confidence_level, Iterator first, Iterator last, sample const& resample, Estimator&& estimator) { + auto n_samples = last - first; + + double point = estimator(first, last); + // Degenerate case with a single sample + if (n_samples == 1) return { point, point, point, confidence_level }; + + sample jack = jackknife(estimator, first, last); + double jack_mean = mean(jack.begin(), jack.end()); + double sum_squares, sum_cubes; + std::tie(sum_squares, sum_cubes) = std::accumulate(jack.begin(), jack.end(), std::make_pair(0., 0.), [jack_mean](std::pair<double, double> sqcb, double x) -> std::pair<double, double> { + auto d = jack_mean - x; + auto d2 = d * d; + auto d3 = d2 * d; + return { sqcb.first + d2, sqcb.second + d3 }; + }); + + double accel = sum_cubes / (6 * std::pow(sum_squares, 1.5)); + int n = static_cast<int>(resample.size()); + double prob_n = std::count_if(resample.begin(), resample.end(), [point](double x) { return x < point; }) / (double)n; + // degenerate case with uniform samples + if (prob_n == 0) return { point, point, point, confidence_level }; + + double bias = normal_quantile(prob_n); + double z1 = normal_quantile((1. - confidence_level) / 2.); + + auto cumn = [n](double x) -> int { + return std::lround(normal_cdf(x) * n); }; + auto a = [bias, accel](double b) { return bias + b / (1. - accel * b); }; + double b1 = bias + z1; + double b2 = bias - z1; + double a1 = a(b1); + double a2 = a(b2); + auto lo = std::max(cumn(a1), 0); + auto hi = std::min(cumn(a2), n - 1); + + return { point, resample[lo], resample[hi], confidence_level }; + } + + double outlier_variance(Estimate<double> mean, Estimate<double> stddev, int n); + + struct bootstrap_analysis { + Estimate<double> mean; + Estimate<double> standard_deviation; + double outlier_variance; + }; + + bootstrap_analysis analyse_samples(double confidence_level, int n_resamples, std::vector<double>::iterator first, std::vector<double>::iterator last); + } // namespace Detail + } // namespace Benchmark +} // namespace Catch + +// end catch_stats.hpp +#include <algorithm> +#include <iterator> +#include <tuple> +#include <vector> +#include <cmath> + +namespace Catch { + namespace Benchmark { + namespace Detail { + template <typename Clock> + std::vector<double> resolution(int k) { + std::vector<TimePoint<Clock>> times; + times.reserve(k + 1); + std::generate_n(std::back_inserter(times), k + 1, now<Clock>{}); + + std::vector<double> deltas; + deltas.reserve(k); + std::transform(std::next(times.begin()), times.end(), times.begin(), + std::back_inserter(deltas), + [](TimePoint<Clock> a, TimePoint<Clock> b) { return static_cast<double>((a - b).count()); }); + + return deltas; + } + + const auto warmup_iterations = 10000; + const auto warmup_time = std::chrono::milliseconds(100); + const auto minimum_ticks = 1000; + const auto warmup_seed = 10000; + const auto clock_resolution_estimation_time = std::chrono::milliseconds(500); + const auto clock_cost_estimation_time_limit = std::chrono::seconds(1); + const auto clock_cost_estimation_tick_limit = 100000; + const auto clock_cost_estimation_time = std::chrono::milliseconds(10); + const auto clock_cost_estimation_iterations = 10000; + + template <typename Clock> + int warmup() { + return run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(warmup_time), warmup_seed, &resolution<Clock>) + .iterations; + } + template <typename Clock> + EnvironmentEstimate<FloatDuration<Clock>> estimate_clock_resolution(int iterations) { + auto r = run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(clock_resolution_estimation_time), iterations, &resolution<Clock>) + .result; + return { + FloatDuration<Clock>(mean(r.begin(), r.end())), + classify_outliers(r.begin(), r.end()), + }; + } + template <typename Clock> + EnvironmentEstimate<FloatDuration<Clock>> estimate_clock_cost(FloatDuration<Clock> resolution) { + auto time_limit = std::min(resolution * clock_cost_estimation_tick_limit, FloatDuration<Clock>(clock_cost_estimation_time_limit)); + auto time_clock = [](int k) { + return Detail::measure<Clock>([k] { + for (int i = 0; i < k; ++i) { + volatile auto ignored = Clock::now(); + (void)ignored; + } + }).elapsed; + }; + time_clock(1); + int iters = clock_cost_estimation_iterations; + auto&& r = run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(clock_cost_estimation_time), iters, time_clock); + std::vector<double> times; + int nsamples = static_cast<int>(std::ceil(time_limit / r.elapsed)); + times.reserve(nsamples); + std::generate_n(std::back_inserter(times), nsamples, [time_clock, &r] { + return static_cast<double>((time_clock(r.iterations) / r.iterations).count()); + }); + return { + FloatDuration<Clock>(mean(times.begin(), times.end())), + classify_outliers(times.begin(), times.end()), + }; + } + + template <typename Clock> + Environment<FloatDuration<Clock>> measure_environment() { + static Environment<FloatDuration<Clock>>* env = nullptr; + if (env) { + return *env; + } + + auto iters = Detail::warmup<Clock>(); + auto resolution = Detail::estimate_clock_resolution<Clock>(iters); + auto cost = Detail::estimate_clock_cost<Clock>(resolution.mean); + + env = new Environment<FloatDuration<Clock>>{ resolution, cost }; + return *env; + } + } // namespace Detail + } // namespace Benchmark +} // namespace Catch + +// end catch_estimate_clock.hpp +// start catch_analyse.hpp + + // Run and analyse one benchmark + + +// start catch_sample_analysis.hpp + +// Benchmark results + + +#include <algorithm> +#include <vector> +#include <string> +#include <iterator> + +namespace Catch { + namespace Benchmark { + template <typename Duration> + struct SampleAnalysis { + std::vector<Duration> samples; + Estimate<Duration> mean; + Estimate<Duration> standard_deviation; + OutlierClassification outliers; + double outlier_variance; + + template <typename Duration2> + operator SampleAnalysis<Duration2>() const { + std::vector<Duration2> samples2; + samples2.reserve(samples.size()); + std::transform(samples.begin(), samples.end(), std::back_inserter(samples2), [](Duration d) { return Duration2(d); }); + return { + std::move(samples2), + mean, + standard_deviation, + outliers, + outlier_variance, + }; + } + }; + } // namespace Benchmark +} // namespace Catch + +// end catch_sample_analysis.hpp +#include <algorithm> +#include <iterator> +#include <vector> + +namespace Catch { + namespace Benchmark { + namespace Detail { + template <typename Duration, typename Iterator> + SampleAnalysis<Duration> analyse(const IConfig &cfg, Environment<Duration>, Iterator first, Iterator last) { + if (!cfg.benchmarkNoAnalysis()) { + std::vector<double> samples; + samples.reserve(last - first); + std::transform(first, last, std::back_inserter(samples), [](Duration d) { return d.count(); }); + + auto analysis = Catch::Benchmark::Detail::analyse_samples(cfg.benchmarkConfidenceInterval(), cfg.benchmarkResamples(), samples.begin(), samples.end()); + auto outliers = Catch::Benchmark::Detail::classify_outliers(samples.begin(), samples.end()); + + auto wrap_estimate = [](Estimate<double> e) { + return Estimate<Duration> { + Duration(e.point), + Duration(e.lower_bound), + Duration(e.upper_bound), + e.confidence_interval, + }; + }; + std::vector<Duration> samples2; + samples2.reserve(samples.size()); + std::transform(samples.begin(), samples.end(), std::back_inserter(samples2), [](double d) { return Duration(d); }); + return { + std::move(samples2), + wrap_estimate(analysis.mean), + wrap_estimate(analysis.standard_deviation), + outliers, + analysis.outlier_variance, + }; + } else { + std::vector<Duration> samples; + samples.reserve(last - first); + + Duration mean = Duration(0); + int i = 0; + for (auto it = first; it < last; ++it, ++i) { + samples.push_back(Duration(*it)); + mean += Duration(*it); + } + mean /= i; + + return { + std::move(samples), + Estimate<Duration>{mean, mean, mean, 0.0}, + Estimate<Duration>{Duration(0), Duration(0), Duration(0), 0.0}, + OutlierClassification{}, + 0.0 + }; + } + } + } // namespace Detail + } // namespace Benchmark +} // namespace Catch + +// end catch_analyse.hpp +#include <algorithm> +#include <functional> +#include <string> +#include <vector> +#include <cmath> + +namespace Catch { + namespace Benchmark { + struct Benchmark { + Benchmark(std::string &&name) + : name(std::move(name)) {} + + template <class FUN> + Benchmark(std::string &&name, FUN &&func) + : fun(std::move(func)), name(std::move(name)) {} + + template <typename Clock> + ExecutionPlan<FloatDuration<Clock>> prepare(const IConfig &cfg, Environment<FloatDuration<Clock>> env) const { + auto min_time = env.clock_resolution.mean * Detail::minimum_ticks; + auto run_time = std::max(min_time, std::chrono::duration_cast<decltype(min_time)>(Detail::warmup_time)); + auto&& test = Detail::run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(run_time), 1, fun); + int new_iters = static_cast<int>(std::ceil(min_time * test.iterations / test.elapsed)); + return { new_iters, test.elapsed / test.iterations * new_iters * cfg.benchmarkSamples(), fun, std::chrono::duration_cast<FloatDuration<Clock>>(Detail::warmup_time), Detail::warmup_iterations }; + } + + template <typename Clock = default_clock> + void run() { + IConfigPtr cfg = getCurrentContext().getConfig(); + + auto env = Detail::measure_environment<Clock>(); + + getResultCapture().benchmarkPreparing(name); + CATCH_TRY{ + auto plan = user_code([&] { + return prepare<Clock>(*cfg, env); + }); + + BenchmarkInfo info { + name, + plan.estimated_duration.count(), + plan.iterations_per_sample, + cfg->benchmarkSamples(), + cfg->benchmarkResamples(), + env.clock_resolution.mean.count(), + env.clock_cost.mean.count() + }; + + getResultCapture().benchmarkStarting(info); + + auto samples = user_code([&] { + return plan.template run<Clock>(*cfg, env); + }); + + auto analysis = Detail::analyse(*cfg, env, samples.begin(), samples.end()); + BenchmarkStats<std::chrono::duration<double, std::nano>> stats{ info, analysis.samples, analysis.mean, analysis.standard_deviation, analysis.outliers, analysis.outlier_variance }; + getResultCapture().benchmarkEnded(stats); + + } CATCH_CATCH_ALL{ + if (translateActiveException() != Detail::benchmarkErrorMsg) // benchmark errors have been reported, otherwise rethrow. + std::rethrow_exception(std::current_exception()); + } + } + + // sets lambda to be used in fun *and* executes benchmark! + template <typename Fun, + typename std::enable_if<!Detail::is_related<Fun, Benchmark>::value, int>::type = 0> + Benchmark & operator=(Fun func) { + fun = Detail::BenchmarkFunction(func); + run(); + return *this; + } + + explicit operator bool() { + return true; + } + + private: + Detail::BenchmarkFunction fun; + std::string name; + }; + } +} // namespace Catch + +#define INTERNAL_CATCH_GET_1_ARG(arg1, arg2, ...) arg1 +#define INTERNAL_CATCH_GET_2_ARG(arg1, arg2, ...) arg2 + +#define INTERNAL_CATCH_BENCHMARK(BenchmarkName, name, benchmarkIndex)\ + if( Catch::Benchmark::Benchmark BenchmarkName{name} ) \ + BenchmarkName = [&](int benchmarkIndex) + +#define INTERNAL_CATCH_BENCHMARK_ADVANCED(BenchmarkName, name)\ + if( Catch::Benchmark::Benchmark BenchmarkName{name} ) \ + BenchmarkName = [&] + +// end catch_benchmark.hpp +#endif + +#endif // ! CATCH_CONFIG_IMPL_ONLY + +#ifdef CATCH_IMPL +// start catch_impl.hpp + +#ifdef __clang__ +#pragma clang diagnostic push +#pragma clang diagnostic ignored "-Wweak-vtables" +#endif + +// Keep these here for external reporters +// start catch_test_case_tracker.h + +#include <string> +#include <vector> +#include <memory> + +namespace Catch { +namespace TestCaseTracking { + + struct NameAndLocation { + std::string name; + SourceLineInfo location; + + NameAndLocation( std::string const& _name, SourceLineInfo const& _location ); + }; + + struct ITracker; + + using ITrackerPtr = std::shared_ptr<ITracker>; + + struct ITracker { + virtual ~ITracker(); + + // static queries + virtual NameAndLocation const& nameAndLocation() const = 0; + + // dynamic queries + virtual bool isComplete() const = 0; // Successfully completed or failed + virtual bool isSuccessfullyCompleted() const = 0; + virtual bool isOpen() const = 0; // Started but not complete + virtual bool hasChildren() const = 0; + + virtual ITracker& parent() = 0; + + // actions + virtual void close() = 0; // Successfully complete + virtual void fail() = 0; + virtual void markAsNeedingAnotherRun() = 0; + + virtual void addChild( ITrackerPtr const& child ) = 0; + virtual ITrackerPtr findChild( NameAndLocation const& nameAndLocation ) = 0; + virtual void openChild() = 0; + + // Debug/ checking + virtual bool isSectionTracker() const = 0; + virtual bool isGeneratorTracker() const = 0; + }; + + class TrackerContext { + + enum RunState { + NotStarted, + Executing, + CompletedCycle + }; + + ITrackerPtr m_rootTracker; + ITracker* m_currentTracker = nullptr; + RunState m_runState = NotStarted; + + public: + + ITracker& startRun(); + void endRun(); + + void startCycle(); + void completeCycle(); + + bool completedCycle() const; + ITracker& currentTracker(); + void setCurrentTracker( ITracker* tracker ); + }; + + class TrackerBase : public ITracker { + protected: + enum CycleState { + NotStarted, + Executing, + ExecutingChildren, + NeedsAnotherRun, + CompletedSuccessfully, + Failed + }; + + using Children = std::vector<ITrackerPtr>; + NameAndLocation m_nameAndLocation; + TrackerContext& m_ctx; + ITracker* m_parent; + Children m_children; + CycleState m_runState = NotStarted; + + public: + TrackerBase( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent ); + + NameAndLocation const& nameAndLocation() const override; + bool isComplete() const override; + bool isSuccessfullyCompleted() const override; + bool isOpen() const override; + bool hasChildren() const override; + + void addChild( ITrackerPtr const& child ) override; + + ITrackerPtr findChild( NameAndLocation const& nameAndLocation ) override; + ITracker& parent() override; + + void openChild() override; + + bool isSectionTracker() const override; + bool isGeneratorTracker() const override; + + void open(); + + void close() override; + void fail() override; + void markAsNeedingAnotherRun() override; + + private: + void moveToParent(); + void moveToThis(); + }; + + class SectionTracker : public TrackerBase { + std::vector<std::string> m_filters; + public: + SectionTracker( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent ); + + bool isSectionTracker() const override; + + bool isComplete() const override; + + static SectionTracker& acquire( TrackerContext& ctx, NameAndLocation const& nameAndLocation ); + + void tryOpen(); + + void addInitialFilters( std::vector<std::string> const& filters ); + void addNextFilters( std::vector<std::string> const& filters ); + }; + +} // namespace TestCaseTracking + +using TestCaseTracking::ITracker; +using TestCaseTracking::TrackerContext; +using TestCaseTracking::SectionTracker; + +} // namespace Catch + +// end catch_test_case_tracker.h + +// start catch_leak_detector.h + +namespace Catch { + + struct LeakDetector { + LeakDetector(); + ~LeakDetector(); + }; + +} +// end catch_leak_detector.h +// Cpp files will be included in the single-header file here +// start catch_stats.cpp + +// Statistical analysis tools + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + +#include <cassert> +#include <random> + +#if defined(CATCH_CONFIG_USE_ASYNC) +#include <future> +#endif + +namespace { + double erf_inv(double x) { + // Code accompanying the article "Approximating the erfinv function" in GPU Computing Gems, Volume 2 + double w, p; + + w = -log((1.0 - x) * (1.0 + x)); + + if (w < 6.250000) { + w = w - 3.125000; + p = -3.6444120640178196996e-21; + p = -1.685059138182016589e-19 + p * w; + p = 1.2858480715256400167e-18 + p * w; + p = 1.115787767802518096e-17 + p * w; + p = -1.333171662854620906e-16 + p * w; + p = 2.0972767875968561637e-17 + p * w; + p = 6.6376381343583238325e-15 + p * w; + p = -4.0545662729752068639e-14 + p * w; + p = -8.1519341976054721522e-14 + p * w; + p = 2.6335093153082322977e-12 + p * w; + p = -1.2975133253453532498e-11 + p * w; + p = -5.4154120542946279317e-11 + p * w; + p = 1.051212273321532285e-09 + p * w; + p = -4.1126339803469836976e-09 + p * w; + p = -2.9070369957882005086e-08 + p * w; + p = 4.2347877827932403518e-07 + p * w; + p = -1.3654692000834678645e-06 + p * w; + p = -1.3882523362786468719e-05 + p * w; + p = 0.0001867342080340571352 + p * w; + p = -0.00074070253416626697512 + p * w; + p = -0.0060336708714301490533 + p * w; + p = 0.24015818242558961693 + p * w; + p = 1.6536545626831027356 + p * w; + } else if (w < 16.000000) { + w = sqrt(w) - 3.250000; + p = 2.2137376921775787049e-09; + p = 9.0756561938885390979e-08 + p * w; + p = -2.7517406297064545428e-07 + p * w; + p = 1.8239629214389227755e-08 + p * w; + p = 1.5027403968909827627e-06 + p * w; + p = -4.013867526981545969e-06 + p * w; + p = 2.9234449089955446044e-06 + p * w; + p = 1.2475304481671778723e-05 + p * w; + p = -4.7318229009055733981e-05 + p * w; + p = 6.8284851459573175448e-05 + p * w; + p = 2.4031110387097893999e-05 + p * w; + p = -0.0003550375203628474796 + p * w; + p = 0.00095328937973738049703 + p * w; + p = -0.0016882755560235047313 + p * w; + p = 0.0024914420961078508066 + p * w; + p = -0.0037512085075692412107 + p * w; + p = 0.005370914553590063617 + p * w; + p = 1.0052589676941592334 + p * w; + p = 3.0838856104922207635 + p * w; + } else { + w = sqrt(w) - 5.000000; + p = -2.7109920616438573243e-11; + p = -2.5556418169965252055e-10 + p * w; + p = 1.5076572693500548083e-09 + p * w; + p = -3.7894654401267369937e-09 + p * w; + p = 7.6157012080783393804e-09 + p * w; + p = -1.4960026627149240478e-08 + p * w; + p = 2.9147953450901080826e-08 + p * w; + p = -6.7711997758452339498e-08 + p * w; + p = 2.2900482228026654717e-07 + p * w; + p = -9.9298272942317002539e-07 + p * w; + p = 4.5260625972231537039e-06 + p * w; + p = -1.9681778105531670567e-05 + p * w; + p = 7.5995277030017761139e-05 + p * w; + p = -0.00021503011930044477347 + p * w; + p = -0.00013871931833623122026 + p * w; + p = 1.0103004648645343977 + p * w; + p = 4.8499064014085844221 + p * w; + } + return p * x; + } + + double standard_deviation(std::vector<double>::iterator first, std::vector<double>::iterator last) { + auto m = Catch::Benchmark::Detail::mean(first, last); + double variance = std::accumulate(first, last, 0., [m](double a, double b) { + double diff = b - m; + return a + diff * diff; + }) / (last - first); + return std::sqrt(variance); + } + +} + +namespace Catch { + namespace Benchmark { + namespace Detail { + + double weighted_average_quantile(int k, int q, std::vector<double>::iterator first, std::vector<double>::iterator last) { + auto count = last - first; + double idx = (count - 1) * k / static_cast<double>(q); + int j = static_cast<int>(idx); + double g = idx - j; + std::nth_element(first, first + j, last); + auto xj = first[j]; + if (g == 0) return xj; + + auto xj1 = *std::min_element(first + (j + 1), last); + return xj + g * (xj1 - xj); + } + + double erfc_inv(double x) { + return erf_inv(1.0 - x); + } + + double normal_quantile(double p) { + static const double ROOT_TWO = std::sqrt(2.0); + + double result = 0.0; + assert(p >= 0 && p <= 1); + if (p < 0 || p > 1) { + return result; + } + + result = -erfc_inv(2.0 * p); + // result *= normal distribution standard deviation (1.0) * sqrt(2) + result *= /*sd * */ ROOT_TWO; + // result += normal disttribution mean (0) + return result; + } + + double outlier_variance(Estimate<double> mean, Estimate<double> stddev, int n) { + double sb = stddev.point; + double mn = mean.point / n; + double mg_min = mn / 2.; + double sg = std::min(mg_min / 4., sb / std::sqrt(n)); + double sg2 = sg * sg; + double sb2 = sb * sb; + + auto c_max = [n, mn, sb2, sg2](double x) -> double { + double k = mn - x; + double d = k * k; + double nd = n * d; + double k0 = -n * nd; + double k1 = sb2 - n * sg2 + nd; + double det = k1 * k1 - 4 * sg2 * k0; + return (int)(-2. * k0 / (k1 + std::sqrt(det))); + }; + + auto var_out = [n, sb2, sg2](double c) { + double nc = n - c; + return (nc / n) * (sb2 - nc * sg2); + }; + + return std::min(var_out(1), var_out(std::min(c_max(0.), c_max(mg_min)))) / sb2; + } + + bootstrap_analysis analyse_samples(double confidence_level, int n_resamples, std::vector<double>::iterator first, std::vector<double>::iterator last) { + CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS + static std::random_device entropy; + CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS + + auto n = static_cast<int>(last - first); // seriously, one can't use integral types without hell in C++ + + auto mean = &Detail::mean<std::vector<double>::iterator>; + auto stddev = &standard_deviation; + +#if defined(CATCH_CONFIG_USE_ASYNC) + auto Estimate = [=](double(*f)(std::vector<double>::iterator, std::vector<double>::iterator)) { + auto seed = entropy(); + return std::async(std::launch::async, [=] { + std::mt19937 rng(seed); + auto resampled = resample(rng, n_resamples, first, last, f); + return bootstrap(confidence_level, first, last, resampled, f); + }); + }; + + auto mean_future = Estimate(mean); + auto stddev_future = Estimate(stddev); + + auto mean_estimate = mean_future.get(); + auto stddev_estimate = stddev_future.get(); +#else + auto Estimate = [=](double(*f)(std::vector<double>::iterator, std::vector<double>::iterator)) { + auto seed = entropy(); + std::mt19937 rng(seed); + auto resampled = resample(rng, n_resamples, first, last, f); + return bootstrap(confidence_level, first, last, resampled, f); + }; + + auto mean_estimate = Estimate(mean); + auto stddev_estimate = Estimate(stddev); +#endif // CATCH_USE_ASYNC + + double outlier_variance = Detail::outlier_variance(mean_estimate, stddev_estimate, n); + + return { mean_estimate, stddev_estimate, outlier_variance }; + } + } // namespace Detail + } // namespace Benchmark +} // namespace Catch + +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING +// end catch_stats.cpp +// start catch_approx.cpp + +#include <cmath> +#include <limits> + +namespace { + +// Performs equivalent check of std::fabs(lhs - rhs) <= margin +// But without the subtraction to allow for INFINITY in comparison +bool marginComparison(double lhs, double rhs, double margin) { + return (lhs + margin >= rhs) && (rhs + margin >= lhs); +} + +} + +namespace Catch { +namespace Detail { + + Approx::Approx ( double value ) + : m_epsilon( std::numeric_limits<float>::epsilon()*100 ), + m_margin( 0.0 ), + m_scale( 0.0 ), + m_value( value ) + {} + + Approx Approx::custom() { + return Approx( 0 ); + } + + Approx Approx::operator-() const { + auto temp(*this); + temp.m_value = -temp.m_value; + return temp; + } + + std::string Approx::toString() const { + ReusableStringStream rss; + rss << "Approx( " << ::Catch::Detail::stringify( m_value ) << " )"; + return rss.str(); + } + + bool Approx::equalityComparisonImpl(const double other) const { + // First try with fixed margin, then compute margin based on epsilon, scale and Approx's value + // Thanks to Richard Harris for his help refining the scaled margin value + return marginComparison(m_value, other, m_margin) || marginComparison(m_value, other, m_epsilon * (m_scale + std::fabs(m_value))); + } + + void Approx::setMargin(double newMargin) { + CATCH_ENFORCE(newMargin >= 0, + "Invalid Approx::margin: " << newMargin << '.' + << " Approx::Margin has to be non-negative."); + m_margin = newMargin; + } + + void Approx::setEpsilon(double newEpsilon) { + CATCH_ENFORCE(newEpsilon >= 0 && newEpsilon <= 1.0, + "Invalid Approx::epsilon: " << newEpsilon << '.' + << " Approx::epsilon has to be in [0, 1]"); + m_epsilon = newEpsilon; + } + +} // end namespace Detail + +namespace literals { + Detail::Approx operator "" _a(long double val) { + return Detail::Approx(val); + } + Detail::Approx operator "" _a(unsigned long long val) { + return Detail::Approx(val); + } +} // end namespace literals + +std::string StringMaker<Catch::Detail::Approx>::convert(Catch::Detail::Approx const& value) { + return value.toString(); +} + +} // end namespace Catch +// end catch_approx.cpp +// start catch_assertionhandler.cpp + +// start catch_debugger.h + +namespace Catch { + bool isDebuggerActive(); +} + +#ifdef CATCH_PLATFORM_MAC + + #define CATCH_TRAP() __asm__("int $3\n" : : ) /* NOLINT */ + +#elif defined(CATCH_PLATFORM_LINUX) + // If we can use inline assembler, do it because this allows us to break + // directly at the location of the failing check instead of breaking inside + // raise() called from it, i.e. one stack frame below. + #if defined(__GNUC__) && (defined(__i386) || defined(__x86_64)) + #define CATCH_TRAP() asm volatile ("int $3") /* NOLINT */ + #else // Fall back to the generic way. + #include <signal.h> + + #define CATCH_TRAP() raise(SIGTRAP) + #endif +#elif defined(_MSC_VER) + #define CATCH_TRAP() __debugbreak() +#elif defined(__MINGW32__) + extern "C" __declspec(dllimport) void __stdcall DebugBreak(); + #define CATCH_TRAP() DebugBreak() +#endif + +#ifdef CATCH_TRAP + #define CATCH_BREAK_INTO_DEBUGGER() []{ if( Catch::isDebuggerActive() ) { CATCH_TRAP(); } }() +#else + #define CATCH_BREAK_INTO_DEBUGGER() []{}() +#endif + +// end catch_debugger.h +// start catch_run_context.h + +// start catch_fatal_condition.h + +// start catch_windows_h_proxy.h + + +#if defined(CATCH_PLATFORM_WINDOWS) + +#if !defined(NOMINMAX) && !defined(CATCH_CONFIG_NO_NOMINMAX) +# define CATCH_DEFINED_NOMINMAX +# define NOMINMAX +#endif +#if !defined(WIN32_LEAN_AND_MEAN) && !defined(CATCH_CONFIG_NO_WIN32_LEAN_AND_MEAN) +# define CATCH_DEFINED_WIN32_LEAN_AND_MEAN +# define WIN32_LEAN_AND_MEAN +#endif + +#ifdef __AFXDLL +#include <AfxWin.h> +#else +#include <windows.h> +#endif + +#ifdef CATCH_DEFINED_NOMINMAX +# undef NOMINMAX +#endif +#ifdef CATCH_DEFINED_WIN32_LEAN_AND_MEAN +# undef WIN32_LEAN_AND_MEAN +#endif + +#endif // defined(CATCH_PLATFORM_WINDOWS) + +// end catch_windows_h_proxy.h +#if defined( CATCH_CONFIG_WINDOWS_SEH ) + +namespace Catch { + + struct FatalConditionHandler { + + static LONG CALLBACK handleVectoredException(PEXCEPTION_POINTERS ExceptionInfo); + FatalConditionHandler(); + static void reset(); + ~FatalConditionHandler(); + + private: + static bool isSet; + static ULONG guaranteeSize; + static PVOID exceptionHandlerHandle; + }; + +} // namespace Catch + +#elif defined ( CATCH_CONFIG_POSIX_SIGNALS ) + +#include <signal.h> + +namespace Catch { + + struct FatalConditionHandler { + + static bool isSet; + static struct sigaction oldSigActions[]; + static stack_t oldSigStack; + static char altStackMem[]; + + static void handleSignal( int sig ); + + FatalConditionHandler(); + ~FatalConditionHandler(); + static void reset(); + }; + +} // namespace Catch + +#else + +namespace Catch { + struct FatalConditionHandler { + void reset(); + }; +} + +#endif + +// end catch_fatal_condition.h +#include <string> + +namespace Catch { + + struct IMutableContext; + + /////////////////////////////////////////////////////////////////////////// + + class RunContext : public IResultCapture, public IRunner { + + public: + RunContext( RunContext const& ) = delete; + RunContext& operator =( RunContext const& ) = delete; + + explicit RunContext( IConfigPtr const& _config, IStreamingReporterPtr&& reporter ); + + ~RunContext() override; + + void testGroupStarting( std::string const& testSpec, std::size_t groupIndex, std::size_t groupsCount ); + void testGroupEnded( std::string const& testSpec, Totals const& totals, std::size_t groupIndex, std::size_t groupsCount ); + + Totals runTest(TestCase const& testCase); + + IConfigPtr config() const; + IStreamingReporter& reporter() const; + + public: // IResultCapture + + // Assertion handlers + void handleExpr + ( AssertionInfo const& info, + ITransientExpression const& expr, + AssertionReaction& reaction ) override; + void handleMessage + ( AssertionInfo const& info, + ResultWas::OfType resultType, + StringRef const& message, + AssertionReaction& reaction ) override; + void handleUnexpectedExceptionNotThrown + ( AssertionInfo const& info, + AssertionReaction& reaction ) override; + void handleUnexpectedInflightException + ( AssertionInfo const& info, + std::string const& message, + AssertionReaction& reaction ) override; + void handleIncomplete + ( AssertionInfo const& info ) override; + void handleNonExpr + ( AssertionInfo const &info, + ResultWas::OfType resultType, + AssertionReaction &reaction ) override; + + bool sectionStarted( SectionInfo const& sectionInfo, Counts& assertions ) override; + + void sectionEnded( SectionEndInfo const& endInfo ) override; + void sectionEndedEarly( SectionEndInfo const& endInfo ) override; + + auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& override; + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + void benchmarkPreparing( std::string const& name ) override; + void benchmarkStarting( BenchmarkInfo const& info ) override; + void benchmarkEnded( BenchmarkStats<> const& stats ) override; + void benchmarkFailed( std::string const& error ) override; +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + void pushScopedMessage( MessageInfo const& message ) override; + void popScopedMessage( MessageInfo const& message ) override; + + void emplaceUnscopedMessage( MessageBuilder const& builder ) override; + + std::string getCurrentTestName() const override; + + const AssertionResult* getLastResult() const override; + + void exceptionEarlyReported() override; + + void handleFatalErrorCondition( StringRef message ) override; + + bool lastAssertionPassed() override; + + void assertionPassed() override; + + public: + // !TBD We need to do this another way! + bool aborting() const final; + + private: + + void runCurrentTest( std::string& redirectedCout, std::string& redirectedCerr ); + void invokeActiveTestCase(); + + void resetAssertionInfo(); + bool testForMissingAssertions( Counts& assertions ); + + void assertionEnded( AssertionResult const& result ); + void reportExpr + ( AssertionInfo const &info, + ResultWas::OfType resultType, + ITransientExpression const *expr, + bool negated ); + + void populateReaction( AssertionReaction& reaction ); + + private: + + void handleUnfinishedSections(); + + TestRunInfo m_runInfo; + IMutableContext& m_context; + TestCase const* m_activeTestCase = nullptr; + ITracker* m_testCaseTracker = nullptr; + Option<AssertionResult> m_lastResult; + + IConfigPtr m_config; + Totals m_totals; + IStreamingReporterPtr m_reporter; + std::vector<MessageInfo> m_messages; + std::vector<ScopedMessage> m_messageScopes; /* Keeps owners of so-called unscoped messages. */ + AssertionInfo m_lastAssertionInfo; + std::vector<SectionEndInfo> m_unfinishedSections; + std::vector<ITracker*> m_activeSections; + TrackerContext m_trackerContext; + bool m_lastAssertionPassed = false; + bool m_shouldReportUnexpected = true; + bool m_includeSuccessfulResults; + }; + +} // end namespace Catch + +// end catch_run_context.h +namespace Catch { + + namespace { + auto operator <<( std::ostream& os, ITransientExpression const& expr ) -> std::ostream& { + expr.streamReconstructedExpression( os ); + return os; + } + } + + LazyExpression::LazyExpression( bool isNegated ) + : m_isNegated( isNegated ) + {} + + LazyExpression::LazyExpression( LazyExpression const& other ) : m_isNegated( other.m_isNegated ) {} + + LazyExpression::operator bool() const { + return m_transientExpression != nullptr; + } + + auto operator << ( std::ostream& os, LazyExpression const& lazyExpr ) -> std::ostream& { + if( lazyExpr.m_isNegated ) + os << "!"; + + if( lazyExpr ) { + if( lazyExpr.m_isNegated && lazyExpr.m_transientExpression->isBinaryExpression() ) + os << "(" << *lazyExpr.m_transientExpression << ")"; + else + os << *lazyExpr.m_transientExpression; + } + else { + os << "{** error - unchecked empty expression requested **}"; + } + return os; + } + + AssertionHandler::AssertionHandler + ( StringRef const& macroName, + SourceLineInfo const& lineInfo, + StringRef capturedExpression, + ResultDisposition::Flags resultDisposition ) + : m_assertionInfo{ macroName, lineInfo, capturedExpression, resultDisposition }, + m_resultCapture( getResultCapture() ) + {} + + void AssertionHandler::handleExpr( ITransientExpression const& expr ) { + m_resultCapture.handleExpr( m_assertionInfo, expr, m_reaction ); + } + void AssertionHandler::handleMessage(ResultWas::OfType resultType, StringRef const& message) { + m_resultCapture.handleMessage( m_assertionInfo, resultType, message, m_reaction ); + } + + auto AssertionHandler::allowThrows() const -> bool { + return getCurrentContext().getConfig()->allowThrows(); + } + + void AssertionHandler::complete() { + setCompleted(); + if( m_reaction.shouldDebugBreak ) { + + // If you find your debugger stopping you here then go one level up on the + // call-stack for the code that caused it (typically a failed assertion) + + // (To go back to the test and change execution, jump over the throw, next) + CATCH_BREAK_INTO_DEBUGGER(); + } + if (m_reaction.shouldThrow) { +#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) + throw Catch::TestFailureException(); +#else + CATCH_ERROR( "Test failure requires aborting test!" ); +#endif + } + } + void AssertionHandler::setCompleted() { + m_completed = true; + } + + void AssertionHandler::handleUnexpectedInflightException() { + m_resultCapture.handleUnexpectedInflightException( m_assertionInfo, Catch::translateActiveException(), m_reaction ); + } + + void AssertionHandler::handleExceptionThrownAsExpected() { + m_resultCapture.handleNonExpr(m_assertionInfo, ResultWas::Ok, m_reaction); + } + void AssertionHandler::handleExceptionNotThrownAsExpected() { + m_resultCapture.handleNonExpr(m_assertionInfo, ResultWas::Ok, m_reaction); + } + + void AssertionHandler::handleUnexpectedExceptionNotThrown() { + m_resultCapture.handleUnexpectedExceptionNotThrown( m_assertionInfo, m_reaction ); + } + + void AssertionHandler::handleThrowingCallSkipped() { + m_resultCapture.handleNonExpr(m_assertionInfo, ResultWas::Ok, m_reaction); + } + + // This is the overload that takes a string and infers the Equals matcher from it + // The more general overload, that takes any string matcher, is in catch_capture_matchers.cpp + void handleExceptionMatchExpr( AssertionHandler& handler, std::string const& str, StringRef const& matcherString ) { + handleExceptionMatchExpr( handler, Matchers::Equals( str ), matcherString ); + } + +} // namespace Catch +// end catch_assertionhandler.cpp +// start catch_assertionresult.cpp + +namespace Catch { + AssertionResultData::AssertionResultData(ResultWas::OfType _resultType, LazyExpression const & _lazyExpression): + lazyExpression(_lazyExpression), + resultType(_resultType) {} + + std::string AssertionResultData::reconstructExpression() const { + + if( reconstructedExpression.empty() ) { + if( lazyExpression ) { + ReusableStringStream rss; + rss << lazyExpression; + reconstructedExpression = rss.str(); + } + } + return reconstructedExpression; + } + + AssertionResult::AssertionResult( AssertionInfo const& info, AssertionResultData const& data ) + : m_info( info ), + m_resultData( data ) + {} + + // Result was a success + bool AssertionResult::succeeded() const { + return Catch::isOk( m_resultData.resultType ); + } + + // Result was a success, or failure is suppressed + bool AssertionResult::isOk() const { + return Catch::isOk( m_resultData.resultType ) || shouldSuppressFailure( m_info.resultDisposition ); + } + + ResultWas::OfType AssertionResult::getResultType() const { + return m_resultData.resultType; + } + + bool AssertionResult::hasExpression() const { + return m_info.capturedExpression[0] != 0; + } + + bool AssertionResult::hasMessage() const { + return !m_resultData.message.empty(); + } + + std::string AssertionResult::getExpression() const { + if( isFalseTest( m_info.resultDisposition ) ) + return "!(" + m_info.capturedExpression + ")"; + else + return m_info.capturedExpression; + } + + std::string AssertionResult::getExpressionInMacro() const { + std::string expr; + if( m_info.macroName[0] == 0 ) + expr = m_info.capturedExpression; + else { + expr.reserve( m_info.macroName.size() + m_info.capturedExpression.size() + 4 ); + expr += m_info.macroName; + expr += "( "; + expr += m_info.capturedExpression; + expr += " )"; + } + return expr; + } + + bool AssertionResult::hasExpandedExpression() const { + return hasExpression() && getExpandedExpression() != getExpression(); + } + + std::string AssertionResult::getExpandedExpression() const { + std::string expr = m_resultData.reconstructExpression(); + return expr.empty() + ? getExpression() + : expr; + } + + std::string AssertionResult::getMessage() const { + return m_resultData.message; + } + SourceLineInfo AssertionResult::getSourceInfo() const { + return m_info.lineInfo; + } + + StringRef AssertionResult::getTestMacroName() const { + return m_info.macroName; + } + +} // end namespace Catch +// end catch_assertionresult.cpp +// start catch_capture_matchers.cpp + +namespace Catch { + + using StringMatcher = Matchers::Impl::MatcherBase<std::string>; + + // This is the general overload that takes a any string matcher + // There is another overload, in catch_assertionhandler.h/.cpp, that only takes a string and infers + // the Equals matcher (so the header does not mention matchers) + void handleExceptionMatchExpr( AssertionHandler& handler, StringMatcher const& matcher, StringRef const& matcherString ) { + std::string exceptionMessage = Catch::translateActiveException(); + MatchExpr<std::string, StringMatcher const&> expr( exceptionMessage, matcher, matcherString ); + handler.handleExpr( expr ); + } + +} // namespace Catch +// end catch_capture_matchers.cpp +// start catch_commandline.cpp + +// start catch_commandline.h + +// start catch_clara.h + +// Use Catch's value for console width (store Clara's off to the side, if present) +#ifdef CLARA_CONFIG_CONSOLE_WIDTH +#define CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH +#undef CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH +#endif +#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH CATCH_CONFIG_CONSOLE_WIDTH-1 + +#ifdef __clang__ +#pragma clang diagnostic push +#pragma clang diagnostic ignored "-Wweak-vtables" +#pragma clang diagnostic ignored "-Wexit-time-destructors" +#pragma clang diagnostic ignored "-Wshadow" +#endif + +// start clara.hpp +// Copyright 2017 Two Blue Cubes Ltd. All rights reserved. +// +// Distributed under the Boost Software License, Version 1.0. (See accompanying +// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) +// +// See https://github.com/philsquared/Clara for more details + +// Clara v1.1.5 + + +#ifndef CATCH_CLARA_CONFIG_CONSOLE_WIDTH +#define CATCH_CLARA_CONFIG_CONSOLE_WIDTH 80 +#endif + +#ifndef CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH +#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH CATCH_CLARA_CONFIG_CONSOLE_WIDTH +#endif + +#ifndef CLARA_CONFIG_OPTIONAL_TYPE +#ifdef __has_include +#if __has_include(<optional>) && __cplusplus >= 201703L +#include <optional> +#define CLARA_CONFIG_OPTIONAL_TYPE std::optional +#endif +#endif +#endif + +// ----------- #included from clara_textflow.hpp ----------- + +// TextFlowCpp +// +// A single-header library for wrapping and laying out basic text, by Phil Nash +// +// Distributed under the Boost Software License, Version 1.0. (See accompanying +// file LICENSE.txt or copy at http://www.boost.org/LICENSE_1_0.txt) +// +// This project is hosted at https://github.com/philsquared/textflowcpp + + +#include <cassert> +#include <ostream> +#include <sstream> +#include <vector> + +#ifndef CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH +#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH 80 +#endif + +namespace Catch { +namespace clara { +namespace TextFlow { + +inline auto isWhitespace(char c) -> bool { + static std::string chars = " \t\n\r"; + return chars.find(c) != std::string::npos; +} +inline auto isBreakableBefore(char c) -> bool { + static std::string chars = "[({<|"; + return chars.find(c) != std::string::npos; +} +inline auto isBreakableAfter(char c) -> bool { + static std::string chars = "])}>.,:;*+-=&/\\"; + return chars.find(c) != std::string::npos; +} + +class Columns; + +class Column { + std::vector<std::string> m_strings; + size_t m_width = CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH; + size_t m_indent = 0; + size_t m_initialIndent = std::string::npos; + +public: + class iterator { + friend Column; + + Column const& m_column; + size_t m_stringIndex = 0; + size_t m_pos = 0; + + size_t m_len = 0; + size_t m_end = 0; + bool m_suffix = false; + + iterator(Column const& column, size_t stringIndex) + : m_column(column), + m_stringIndex(stringIndex) {} + + auto line() const -> std::string const& { return m_column.m_strings[m_stringIndex]; } + + auto isBoundary(size_t at) const -> bool { + assert(at > 0); + assert(at <= line().size()); + + return at == line().size() || + (isWhitespace(line()[at]) && !isWhitespace(line()[at - 1])) || + isBreakableBefore(line()[at]) || + isBreakableAfter(line()[at - 1]); + } + + void calcLength() { + assert(m_stringIndex < m_column.m_strings.size()); + + m_suffix = false; + auto width = m_column.m_width - indent(); + m_end = m_pos; + if (line()[m_pos] == '\n') { + ++m_end; + } + while (m_end < line().size() && line()[m_end] != '\n') + ++m_end; + + if (m_end < m_pos + width) { + m_len = m_end - m_pos; + } else { + size_t len = width; + while (len > 0 && !isBoundary(m_pos + len)) + --len; + while (len > 0 && isWhitespace(line()[m_pos + len - 1])) + --len; + + if (len > 0) { + m_len = len; + } else { + m_suffix = true; + m_len = width - 1; + } + } + } + + auto indent() const -> size_t { + auto initial = m_pos == 0 && m_stringIndex == 0 ? m_column.m_initialIndent : std::string::npos; + return initial == std::string::npos ? m_column.m_indent : initial; + } + + auto addIndentAndSuffix(std::string const &plain) const -> std::string { + return std::string(indent(), ' ') + (m_suffix ? plain + "-" : plain); + } + + public: + using difference_type = std::ptrdiff_t; + using value_type = std::string; + using pointer = value_type * ; + using reference = value_type & ; + using iterator_category = std::forward_iterator_tag; + + explicit iterator(Column const& column) : m_column(column) { + assert(m_column.m_width > m_column.m_indent); + assert(m_column.m_initialIndent == std::string::npos || m_column.m_width > m_column.m_initialIndent); + calcLength(); + if (m_len == 0) + m_stringIndex++; // Empty string + } + + auto operator *() const -> std::string { + assert(m_stringIndex < m_column.m_strings.size()); + assert(m_pos <= m_end); + return addIndentAndSuffix(line().substr(m_pos, m_len)); + } + + auto operator ++() -> iterator& { + m_pos += m_len; + if (m_pos < line().size() && line()[m_pos] == '\n') + m_pos += 1; + else + while (m_pos < line().size() && isWhitespace(line()[m_pos])) + ++m_pos; + + if (m_pos == line().size()) { + m_pos = 0; + ++m_stringIndex; + } + if (m_stringIndex < m_column.m_strings.size()) + calcLength(); + return *this; + } + auto operator ++(int) -> iterator { + iterator prev(*this); + operator++(); + return prev; + } + + auto operator ==(iterator const& other) const -> bool { + return + m_pos == other.m_pos && + m_stringIndex == other.m_stringIndex && + &m_column == &other.m_column; + } + auto operator !=(iterator const& other) const -> bool { + return !operator==(other); + } + }; + using const_iterator = iterator; + + explicit Column(std::string const& text) { m_strings.push_back(text); } + + auto width(size_t newWidth) -> Column& { + assert(newWidth > 0); + m_width = newWidth; + return *this; + } + auto indent(size_t newIndent) -> Column& { + m_indent = newIndent; + return *this; + } + auto initialIndent(size_t newIndent) -> Column& { + m_initialIndent = newIndent; + return *this; + } + + auto width() const -> size_t { return m_width; } + auto begin() const -> iterator { return iterator(*this); } + auto end() const -> iterator { return { *this, m_strings.size() }; } + + inline friend std::ostream& operator << (std::ostream& os, Column const& col) { + bool first = true; + for (auto line : col) { + if (first) + first = false; + else + os << "\n"; + os << line; + } + return os; + } + + auto operator + (Column const& other)->Columns; + + auto toString() const -> std::string { + std::ostringstream oss; + oss << *this; + return oss.str(); + } +}; + +class Spacer : public Column { + +public: + explicit Spacer(size_t spaceWidth) : Column("") { + width(spaceWidth); + } +}; + +class Columns { + std::vector<Column> m_columns; + +public: + + class iterator { + friend Columns; + struct EndTag {}; + + std::vector<Column> const& m_columns; + std::vector<Column::iterator> m_iterators; + size_t m_activeIterators; + + iterator(Columns const& columns, EndTag) + : m_columns(columns.m_columns), + m_activeIterators(0) { + m_iterators.reserve(m_columns.size()); + + for (auto const& col : m_columns) + m_iterators.push_back(col.end()); + } + + public: + using difference_type = std::ptrdiff_t; + using value_type = std::string; + using pointer = value_type * ; + using reference = value_type & ; + using iterator_category = std::forward_iterator_tag; + + explicit iterator(Columns const& columns) + : m_columns(columns.m_columns), + m_activeIterators(m_columns.size()) { + m_iterators.reserve(m_columns.size()); + + for (auto const& col : m_columns) + m_iterators.push_back(col.begin()); + } + + auto operator ==(iterator const& other) const -> bool { + return m_iterators == other.m_iterators; + } + auto operator !=(iterator const& other) const -> bool { + return m_iterators != other.m_iterators; + } + auto operator *() const -> std::string { + std::string row, padding; + + for (size_t i = 0; i < m_columns.size(); ++i) { + auto width = m_columns[i].width(); + if (m_iterators[i] != m_columns[i].end()) { + std::string col = *m_iterators[i]; + row += padding + col; + if (col.size() < width) + padding = std::string(width - col.size(), ' '); + else + padding = ""; + } else { + padding += std::string(width, ' '); + } + } + return row; + } + auto operator ++() -> iterator& { + for (size_t i = 0; i < m_columns.size(); ++i) { + if (m_iterators[i] != m_columns[i].end()) + ++m_iterators[i]; + } + return *this; + } + auto operator ++(int) -> iterator { + iterator prev(*this); + operator++(); + return prev; + } + }; + using const_iterator = iterator; + + auto begin() const -> iterator { return iterator(*this); } + auto end() const -> iterator { return { *this, iterator::EndTag() }; } + + auto operator += (Column const& col) -> Columns& { + m_columns.push_back(col); + return *this; + } + auto operator + (Column const& col) -> Columns { + Columns combined = *this; + combined += col; + return combined; + } + + inline friend std::ostream& operator << (std::ostream& os, Columns const& cols) { + + bool first = true; + for (auto line : cols) { + if (first) + first = false; + else + os << "\n"; + os << line; + } + return os; + } + + auto toString() const -> std::string { + std::ostringstream oss; + oss << *this; + return oss.str(); + } +}; + +inline auto Column::operator + (Column const& other) -> Columns { + Columns cols; + cols += *this; + cols += other; + return cols; +} +} + +} +} + +// ----------- end of #include from clara_textflow.hpp ----------- +// ........... back in clara.hpp + +#include <cctype> +#include <string> +#include <memory> +#include <set> +#include <algorithm> + +#if !defined(CATCH_PLATFORM_WINDOWS) && ( defined(WIN32) || defined(__WIN32__) || defined(_WIN32) || defined(_MSC_VER) ) +#define CATCH_PLATFORM_WINDOWS +#endif + +namespace Catch { namespace clara { +namespace detail { + + // Traits for extracting arg and return type of lambdas (for single argument lambdas) + template<typename L> + struct UnaryLambdaTraits : UnaryLambdaTraits<decltype( &L::operator() )> {}; + + template<typename ClassT, typename ReturnT, typename... Args> + struct UnaryLambdaTraits<ReturnT( ClassT::* )( Args... ) const> { + static const bool isValid = false; + }; + + template<typename ClassT, typename ReturnT, typename ArgT> + struct UnaryLambdaTraits<ReturnT( ClassT::* )( ArgT ) const> { + static const bool isValid = true; + using ArgType = typename std::remove_const<typename std::remove_reference<ArgT>::type>::type; + using ReturnType = ReturnT; + }; + + class TokenStream; + + // Transport for raw args (copied from main args, or supplied via init list for testing) + class Args { + friend TokenStream; + std::string m_exeName; + std::vector<std::string> m_args; + + public: + Args( int argc, char const* const* argv ) + : m_exeName(argv[0]), + m_args(argv + 1, argv + argc) {} + + Args( std::initializer_list<std::string> args ) + : m_exeName( *args.begin() ), + m_args( args.begin()+1, args.end() ) + {} + + auto exeName() const -> std::string { + return m_exeName; + } + }; + + // Wraps a token coming from a token stream. These may not directly correspond to strings as a single string + // may encode an option + its argument if the : or = form is used + enum class TokenType { + Option, Argument + }; + struct Token { + TokenType type; + std::string token; + }; + + inline auto isOptPrefix( char c ) -> bool { + return c == '-' +#ifdef CATCH_PLATFORM_WINDOWS + || c == '/' +#endif + ; + } + + // Abstracts iterators into args as a stream of tokens, with option arguments uniformly handled + class TokenStream { + using Iterator = std::vector<std::string>::const_iterator; + Iterator it; + Iterator itEnd; + std::vector<Token> m_tokenBuffer; + + void loadBuffer() { + m_tokenBuffer.resize( 0 ); + + // Skip any empty strings + while( it != itEnd && it->empty() ) + ++it; + + if( it != itEnd ) { + auto const &next = *it; + if( isOptPrefix( next[0] ) ) { + auto delimiterPos = next.find_first_of( " :=" ); + if( delimiterPos != std::string::npos ) { + m_tokenBuffer.push_back( { TokenType::Option, next.substr( 0, delimiterPos ) } ); + m_tokenBuffer.push_back( { TokenType::Argument, next.substr( delimiterPos + 1 ) } ); + } else { + if( next[1] != '-' && next.size() > 2 ) { + std::string opt = "- "; + for( size_t i = 1; i < next.size(); ++i ) { + opt[1] = next[i]; + m_tokenBuffer.push_back( { TokenType::Option, opt } ); + } + } else { + m_tokenBuffer.push_back( { TokenType::Option, next } ); + } + } + } else { + m_tokenBuffer.push_back( { TokenType::Argument, next } ); + } + } + } + + public: + explicit TokenStream( Args const &args ) : TokenStream( args.m_args.begin(), args.m_args.end() ) {} + + TokenStream( Iterator it, Iterator itEnd ) : it( it ), itEnd( itEnd ) { + loadBuffer(); + } + + explicit operator bool() const { + return !m_tokenBuffer.empty() || it != itEnd; + } + + auto count() const -> size_t { return m_tokenBuffer.size() + (itEnd - it); } + + auto operator*() const -> Token { + assert( !m_tokenBuffer.empty() ); + return m_tokenBuffer.front(); + } + + auto operator->() const -> Token const * { + assert( !m_tokenBuffer.empty() ); + return &m_tokenBuffer.front(); + } + + auto operator++() -> TokenStream & { + if( m_tokenBuffer.size() >= 2 ) { + m_tokenBuffer.erase( m_tokenBuffer.begin() ); + } else { + if( it != itEnd ) + ++it; + loadBuffer(); + } + return *this; + } + }; + + class ResultBase { + public: + enum Type { + Ok, LogicError, RuntimeError + }; + + protected: + ResultBase( Type type ) : m_type( type ) {} + virtual ~ResultBase() = default; + + virtual void enforceOk() const = 0; + + Type m_type; + }; + + template<typename T> + class ResultValueBase : public ResultBase { + public: + auto value() const -> T const & { + enforceOk(); + return m_value; + } + + protected: + ResultValueBase( Type type ) : ResultBase( type ) {} + + ResultValueBase( ResultValueBase const &other ) : ResultBase( other ) { + if( m_type == ResultBase::Ok ) + new( &m_value ) T( other.m_value ); + } + + ResultValueBase( Type, T const &value ) : ResultBase( Ok ) { + new( &m_value ) T( value ); + } + + auto operator=( ResultValueBase const &other ) -> ResultValueBase & { + if( m_type == ResultBase::Ok ) + m_value.~T(); + ResultBase::operator=(other); + if( m_type == ResultBase::Ok ) + new( &m_value ) T( other.m_value ); + return *this; + } + + ~ResultValueBase() override { + if( m_type == Ok ) + m_value.~T(); + } + + union { + T m_value; + }; + }; + + template<> + class ResultValueBase<void> : public ResultBase { + protected: + using ResultBase::ResultBase; + }; + + template<typename T = void> + class BasicResult : public ResultValueBase<T> { + public: + template<typename U> + explicit BasicResult( BasicResult<U> const &other ) + : ResultValueBase<T>( other.type() ), + m_errorMessage( other.errorMessage() ) + { + assert( type() != ResultBase::Ok ); + } + + template<typename U> + static auto ok( U const &value ) -> BasicResult { return { ResultBase::Ok, value }; } + static auto ok() -> BasicResult { return { ResultBase::Ok }; } + static auto logicError( std::string const &message ) -> BasicResult { return { ResultBase::LogicError, message }; } + static auto runtimeError( std::string const &message ) -> BasicResult { return { ResultBase::RuntimeError, message }; } + + explicit operator bool() const { return m_type == ResultBase::Ok; } + auto type() const -> ResultBase::Type { return m_type; } + auto errorMessage() const -> std::string { return m_errorMessage; } + + protected: + void enforceOk() const override { + + // Errors shouldn't reach this point, but if they do + // the actual error message will be in m_errorMessage + assert( m_type != ResultBase::LogicError ); + assert( m_type != ResultBase::RuntimeError ); + if( m_type != ResultBase::Ok ) + std::abort(); + } + + std::string m_errorMessage; // Only populated if resultType is an error + + BasicResult( ResultBase::Type type, std::string const &message ) + : ResultValueBase<T>(type), + m_errorMessage(message) + { + assert( m_type != ResultBase::Ok ); + } + + using ResultValueBase<T>::ResultValueBase; + using ResultBase::m_type; + }; + + enum class ParseResultType { + Matched, NoMatch, ShortCircuitAll, ShortCircuitSame + }; + + class ParseState { + public: + + ParseState( ParseResultType type, TokenStream const &remainingTokens ) + : m_type(type), + m_remainingTokens( remainingTokens ) + {} + + auto type() const -> ParseResultType { return m_type; } + auto remainingTokens() const -> TokenStream { return m_remainingTokens; } + + private: + ParseResultType m_type; + TokenStream m_remainingTokens; + }; + + using Result = BasicResult<void>; + using ParserResult = BasicResult<ParseResultType>; + using InternalParseResult = BasicResult<ParseState>; + + struct HelpColumns { + std::string left; + std::string right; + }; + + template<typename T> + inline auto convertInto( std::string const &source, T& target ) -> ParserResult { + std::stringstream ss; + ss << source; + ss >> target; + if( ss.fail() ) + return ParserResult::runtimeError( "Unable to convert '" + source + "' to destination type" ); + else + return ParserResult::ok( ParseResultType::Matched ); + } + inline auto convertInto( std::string const &source, std::string& target ) -> ParserResult { + target = source; + return ParserResult::ok( ParseResultType::Matched ); + } + inline auto convertInto( std::string const &source, bool &target ) -> ParserResult { + std::string srcLC = source; + std::transform( srcLC.begin(), srcLC.end(), srcLC.begin(), []( char c ) { return static_cast<char>( std::tolower(c) ); } ); + if (srcLC == "y" || srcLC == "1" || srcLC == "true" || srcLC == "yes" || srcLC == "on") + target = true; + else if (srcLC == "n" || srcLC == "0" || srcLC == "false" || srcLC == "no" || srcLC == "off") + target = false; + else + return ParserResult::runtimeError( "Expected a boolean value but did not recognise: '" + source + "'" ); + return ParserResult::ok( ParseResultType::Matched ); + } +#ifdef CLARA_CONFIG_OPTIONAL_TYPE + template<typename T> + inline auto convertInto( std::string const &source, CLARA_CONFIG_OPTIONAL_TYPE<T>& target ) -> ParserResult { + T temp; + auto result = convertInto( source, temp ); + if( result ) + target = std::move(temp); + return result; + } +#endif // CLARA_CONFIG_OPTIONAL_TYPE + + struct NonCopyable { + NonCopyable() = default; + NonCopyable( NonCopyable const & ) = delete; + NonCopyable( NonCopyable && ) = delete; + NonCopyable &operator=( NonCopyable const & ) = delete; + NonCopyable &operator=( NonCopyable && ) = delete; + }; + + struct BoundRef : NonCopyable { + virtual ~BoundRef() = default; + virtual auto isContainer() const -> bool { return false; } + virtual auto isFlag() const -> bool { return false; } + }; + struct BoundValueRefBase : BoundRef { + virtual auto setValue( std::string const &arg ) -> ParserResult = 0; + }; + struct BoundFlagRefBase : BoundRef { + virtual auto setFlag( bool flag ) -> ParserResult = 0; + virtual auto isFlag() const -> bool { return true; } + }; + + template<typename T> + struct BoundValueRef : BoundValueRefBase { + T &m_ref; + + explicit BoundValueRef( T &ref ) : m_ref( ref ) {} + + auto setValue( std::string const &arg ) -> ParserResult override { + return convertInto( arg, m_ref ); + } + }; + + template<typename T> + struct BoundValueRef<std::vector<T>> : BoundValueRefBase { + std::vector<T> &m_ref; + + explicit BoundValueRef( std::vector<T> &ref ) : m_ref( ref ) {} + + auto isContainer() const -> bool override { return true; } + + auto setValue( std::string const &arg ) -> ParserResult override { + T temp; + auto result = convertInto( arg, temp ); + if( result ) + m_ref.push_back( temp ); + return result; + } + }; + + struct BoundFlagRef : BoundFlagRefBase { + bool &m_ref; + + explicit BoundFlagRef( bool &ref ) : m_ref( ref ) {} + + auto setFlag( bool flag ) -> ParserResult override { + m_ref = flag; + return ParserResult::ok( ParseResultType::Matched ); + } + }; + + template<typename ReturnType> + struct LambdaInvoker { + static_assert( std::is_same<ReturnType, ParserResult>::value, "Lambda must return void or clara::ParserResult" ); + + template<typename L, typename ArgType> + static auto invoke( L const &lambda, ArgType const &arg ) -> ParserResult { + return lambda( arg ); + } + }; + + template<> + struct LambdaInvoker<void> { + template<typename L, typename ArgType> + static auto invoke( L const &lambda, ArgType const &arg ) -> ParserResult { + lambda( arg ); + return ParserResult::ok( ParseResultType::Matched ); + } + }; + + template<typename ArgType, typename L> + inline auto invokeLambda( L const &lambda, std::string const &arg ) -> ParserResult { + ArgType temp{}; + auto result = convertInto( arg, temp ); + return !result + ? result + : LambdaInvoker<typename UnaryLambdaTraits<L>::ReturnType>::invoke( lambda, temp ); + } + + template<typename L> + struct BoundLambda : BoundValueRefBase { + L m_lambda; + + static_assert( UnaryLambdaTraits<L>::isValid, "Supplied lambda must take exactly one argument" ); + explicit BoundLambda( L const &lambda ) : m_lambda( lambda ) {} + + auto setValue( std::string const &arg ) -> ParserResult override { + return invokeLambda<typename UnaryLambdaTraits<L>::ArgType>( m_lambda, arg ); + } + }; + + template<typename L> + struct BoundFlagLambda : BoundFlagRefBase { + L m_lambda; + + static_assert( UnaryLambdaTraits<L>::isValid, "Supplied lambda must take exactly one argument" ); + static_assert( std::is_same<typename UnaryLambdaTraits<L>::ArgType, bool>::value, "flags must be boolean" ); + + explicit BoundFlagLambda( L const &lambda ) : m_lambda( lambda ) {} + + auto setFlag( bool flag ) -> ParserResult override { + return LambdaInvoker<typename UnaryLambdaTraits<L>::ReturnType>::invoke( m_lambda, flag ); + } + }; + + enum class Optionality { Optional, Required }; + + struct Parser; + + class ParserBase { + public: + virtual ~ParserBase() = default; + virtual auto validate() const -> Result { return Result::ok(); } + virtual auto parse( std::string const& exeName, TokenStream const &tokens) const -> InternalParseResult = 0; + virtual auto cardinality() const -> size_t { return 1; } + + auto parse( Args const &args ) const -> InternalParseResult { + return parse( args.exeName(), TokenStream( args ) ); + } + }; + + template<typename DerivedT> + class ComposableParserImpl : public ParserBase { + public: + template<typename T> + auto operator|( T const &other ) const -> Parser; + + template<typename T> + auto operator+( T const &other ) const -> Parser; + }; + + // Common code and state for Args and Opts + template<typename DerivedT> + class ParserRefImpl : public ComposableParserImpl<DerivedT> { + protected: + Optionality m_optionality = Optionality::Optional; + std::shared_ptr<BoundRef> m_ref; + std::string m_hint; + std::string m_description; + + explicit ParserRefImpl( std::shared_ptr<BoundRef> const &ref ) : m_ref( ref ) {} + + public: + template<typename T> + ParserRefImpl( T &ref, std::string const &hint ) + : m_ref( std::make_shared<BoundValueRef<T>>( ref ) ), + m_hint( hint ) + {} + + template<typename LambdaT> + ParserRefImpl( LambdaT const &ref, std::string const &hint ) + : m_ref( std::make_shared<BoundLambda<LambdaT>>( ref ) ), + m_hint(hint) + {} + + auto operator()( std::string const &description ) -> DerivedT & { + m_description = description; + return static_cast<DerivedT &>( *this ); + } + + auto optional() -> DerivedT & { + m_optionality = Optionality::Optional; + return static_cast<DerivedT &>( *this ); + }; + + auto required() -> DerivedT & { + m_optionality = Optionality::Required; + return static_cast<DerivedT &>( *this ); + }; + + auto isOptional() const -> bool { + return m_optionality == Optionality::Optional; + } + + auto cardinality() const -> size_t override { + if( m_ref->isContainer() ) + return 0; + else + return 1; + } + + auto hint() const -> std::string { return m_hint; } + }; + + class ExeName : public ComposableParserImpl<ExeName> { + std::shared_ptr<std::string> m_name; + std::shared_ptr<BoundValueRefBase> m_ref; + + template<typename LambdaT> + static auto makeRef(LambdaT const &lambda) -> std::shared_ptr<BoundValueRefBase> { + return std::make_shared<BoundLambda<LambdaT>>( lambda) ; + } + + public: + ExeName() : m_name( std::make_shared<std::string>( "<executable>" ) ) {} + + explicit ExeName( std::string &ref ) : ExeName() { + m_ref = std::make_shared<BoundValueRef<std::string>>( ref ); + } + + template<typename LambdaT> + explicit ExeName( LambdaT const& lambda ) : ExeName() { + m_ref = std::make_shared<BoundLambda<LambdaT>>( lambda ); + } + + // The exe name is not parsed out of the normal tokens, but is handled specially + auto parse( std::string const&, TokenStream const &tokens ) const -> InternalParseResult override { + return InternalParseResult::ok( ParseState( ParseResultType::NoMatch, tokens ) ); + } + + auto name() const -> std::string { return *m_name; } + auto set( std::string const& newName ) -> ParserResult { + + auto lastSlash = newName.find_last_of( "\\/" ); + auto filename = ( lastSlash == std::string::npos ) + ? newName + : newName.substr( lastSlash+1 ); + + *m_name = filename; + if( m_ref ) + return m_ref->setValue( filename ); + else + return ParserResult::ok( ParseResultType::Matched ); + } + }; + + class Arg : public ParserRefImpl<Arg> { + public: + using ParserRefImpl::ParserRefImpl; + + auto parse( std::string const &, TokenStream const &tokens ) const -> InternalParseResult override { + auto validationResult = validate(); + if( !validationResult ) + return InternalParseResult( validationResult ); + + auto remainingTokens = tokens; + auto const &token = *remainingTokens; + if( token.type != TokenType::Argument ) + return InternalParseResult::ok( ParseState( ParseResultType::NoMatch, remainingTokens ) ); + + assert( !m_ref->isFlag() ); + auto valueRef = static_cast<detail::BoundValueRefBase*>( m_ref.get() ); + + auto result = valueRef->setValue( remainingTokens->token ); + if( !result ) + return InternalParseResult( result ); + else + return InternalParseResult::ok( ParseState( ParseResultType::Matched, ++remainingTokens ) ); + } + }; + + inline auto normaliseOpt( std::string const &optName ) -> std::string { +#ifdef CATCH_PLATFORM_WINDOWS + if( optName[0] == '/' ) + return "-" + optName.substr( 1 ); + else +#endif + return optName; + } + + class Opt : public ParserRefImpl<Opt> { + protected: + std::vector<std::string> m_optNames; + + public: + template<typename LambdaT> + explicit Opt( LambdaT const &ref ) : ParserRefImpl( std::make_shared<BoundFlagLambda<LambdaT>>( ref ) ) {} + + explicit Opt( bool &ref ) : ParserRefImpl( std::make_shared<BoundFlagRef>( ref ) ) {} + + template<typename LambdaT> + Opt( LambdaT const &ref, std::string const &hint ) : ParserRefImpl( ref, hint ) {} + + template<typename T> + Opt( T &ref, std::string const &hint ) : ParserRefImpl( ref, hint ) {} + + auto operator[]( std::string const &optName ) -> Opt & { + m_optNames.push_back( optName ); + return *this; + } + + auto getHelpColumns() const -> std::vector<HelpColumns> { + std::ostringstream oss; + bool first = true; + for( auto const &opt : m_optNames ) { + if (first) + first = false; + else + oss << ", "; + oss << opt; + } + if( !m_hint.empty() ) + oss << " <" << m_hint << ">"; + return { { oss.str(), m_description } }; + } + + auto isMatch( std::string const &optToken ) const -> bool { + auto normalisedToken = normaliseOpt( optToken ); + for( auto const &name : m_optNames ) { + if( normaliseOpt( name ) == normalisedToken ) + return true; + } + return false; + } + + using ParserBase::parse; + + auto parse( std::string const&, TokenStream const &tokens ) const -> InternalParseResult override { + auto validationResult = validate(); + if( !validationResult ) + return InternalParseResult( validationResult ); + + auto remainingTokens = tokens; + if( remainingTokens && remainingTokens->type == TokenType::Option ) { + auto const &token = *remainingTokens; + if( isMatch(token.token ) ) { + if( m_ref->isFlag() ) { + auto flagRef = static_cast<detail::BoundFlagRefBase*>( m_ref.get() ); + auto result = flagRef->setFlag( true ); + if( !result ) + return InternalParseResult( result ); + if( result.value() == ParseResultType::ShortCircuitAll ) + return InternalParseResult::ok( ParseState( result.value(), remainingTokens ) ); + } else { + auto valueRef = static_cast<detail::BoundValueRefBase*>( m_ref.get() ); + ++remainingTokens; + if( !remainingTokens ) + return InternalParseResult::runtimeError( "Expected argument following " + token.token ); + auto const &argToken = *remainingTokens; + if( argToken.type != TokenType::Argument ) + return InternalParseResult::runtimeError( "Expected argument following " + token.token ); + auto result = valueRef->setValue( argToken.token ); + if( !result ) + return InternalParseResult( result ); + if( result.value() == ParseResultType::ShortCircuitAll ) + return InternalParseResult::ok( ParseState( result.value(), remainingTokens ) ); + } + return InternalParseResult::ok( ParseState( ParseResultType::Matched, ++remainingTokens ) ); + } + } + return InternalParseResult::ok( ParseState( ParseResultType::NoMatch, remainingTokens ) ); + } + + auto validate() const -> Result override { + if( m_optNames.empty() ) + return Result::logicError( "No options supplied to Opt" ); + for( auto const &name : m_optNames ) { + if( name.empty() ) + return Result::logicError( "Option name cannot be empty" ); +#ifdef CATCH_PLATFORM_WINDOWS + if( name[0] != '-' && name[0] != '/' ) + return Result::logicError( "Option name must begin with '-' or '/'" ); +#else + if( name[0] != '-' ) + return Result::logicError( "Option name must begin with '-'" ); +#endif + } + return ParserRefImpl::validate(); + } + }; + + struct Help : Opt { + Help( bool &showHelpFlag ) + : Opt([&]( bool flag ) { + showHelpFlag = flag; + return ParserResult::ok( ParseResultType::ShortCircuitAll ); + }) + { + static_cast<Opt &>( *this ) + ("display usage information") + ["-?"]["-h"]["--help"] + .optional(); + } + }; + + struct Parser : ParserBase { + + mutable ExeName m_exeName; + std::vector<Opt> m_options; + std::vector<Arg> m_args; + + auto operator|=( ExeName const &exeName ) -> Parser & { + m_exeName = exeName; + return *this; + } + + auto operator|=( Arg const &arg ) -> Parser & { + m_args.push_back(arg); + return *this; + } + + auto operator|=( Opt const &opt ) -> Parser & { + m_options.push_back(opt); + return *this; + } + + auto operator|=( Parser const &other ) -> Parser & { + m_options.insert(m_options.end(), other.m_options.begin(), other.m_options.end()); + m_args.insert(m_args.end(), other.m_args.begin(), other.m_args.end()); + return *this; + } + + template<typename T> + auto operator|( T const &other ) const -> Parser { + return Parser( *this ) |= other; + } + + // Forward deprecated interface with '+' instead of '|' + template<typename T> + auto operator+=( T const &other ) -> Parser & { return operator|=( other ); } + template<typename T> + auto operator+( T const &other ) const -> Parser { return operator|( other ); } + + auto getHelpColumns() const -> std::vector<HelpColumns> { + std::vector<HelpColumns> cols; + for (auto const &o : m_options) { + auto childCols = o.getHelpColumns(); + cols.insert( cols.end(), childCols.begin(), childCols.end() ); + } + return cols; + } + + void writeToStream( std::ostream &os ) const { + if (!m_exeName.name().empty()) { + os << "usage:\n" << " " << m_exeName.name() << " "; + bool required = true, first = true; + for( auto const &arg : m_args ) { + if (first) + first = false; + else + os << " "; + if( arg.isOptional() && required ) { + os << "["; + required = false; + } + os << "<" << arg.hint() << ">"; + if( arg.cardinality() == 0 ) + os << " ... "; + } + if( !required ) + os << "]"; + if( !m_options.empty() ) + os << " options"; + os << "\n\nwhere options are:" << std::endl; + } + + auto rows = getHelpColumns(); + size_t consoleWidth = CATCH_CLARA_CONFIG_CONSOLE_WIDTH; + size_t optWidth = 0; + for( auto const &cols : rows ) + optWidth = (std::max)(optWidth, cols.left.size() + 2); + + optWidth = (std::min)(optWidth, consoleWidth/2); + + for( auto const &cols : rows ) { + auto row = + TextFlow::Column( cols.left ).width( optWidth ).indent( 2 ) + + TextFlow::Spacer(4) + + TextFlow::Column( cols.right ).width( consoleWidth - 7 - optWidth ); + os << row << std::endl; + } + } + + friend auto operator<<( std::ostream &os, Parser const &parser ) -> std::ostream& { + parser.writeToStream( os ); + return os; + } + + auto validate() const -> Result override { + for( auto const &opt : m_options ) { + auto result = opt.validate(); + if( !result ) + return result; + } + for( auto const &arg : m_args ) { + auto result = arg.validate(); + if( !result ) + return result; + } + return Result::ok(); + } + + using ParserBase::parse; + + auto parse( std::string const& exeName, TokenStream const &tokens ) const -> InternalParseResult override { + + struct ParserInfo { + ParserBase const* parser = nullptr; + size_t count = 0; + }; + const size_t totalParsers = m_options.size() + m_args.size(); + assert( totalParsers < 512 ); + // ParserInfo parseInfos[totalParsers]; // <-- this is what we really want to do + ParserInfo parseInfos[512]; + + { + size_t i = 0; + for (auto const &opt : m_options) parseInfos[i++].parser = &opt; + for (auto const &arg : m_args) parseInfos[i++].parser = &arg; + } + + m_exeName.set( exeName ); + + auto result = InternalParseResult::ok( ParseState( ParseResultType::NoMatch, tokens ) ); + while( result.value().remainingTokens() ) { + bool tokenParsed = false; + + for( size_t i = 0; i < totalParsers; ++i ) { + auto& parseInfo = parseInfos[i]; + if( parseInfo.parser->cardinality() == 0 || parseInfo.count < parseInfo.parser->cardinality() ) { + result = parseInfo.parser->parse(exeName, result.value().remainingTokens()); + if (!result) + return result; + if (result.value().type() != ParseResultType::NoMatch) { + tokenParsed = true; + ++parseInfo.count; + break; + } + } + } + + if( result.value().type() == ParseResultType::ShortCircuitAll ) + return result; + if( !tokenParsed ) + return InternalParseResult::runtimeError( "Unrecognised token: " + result.value().remainingTokens()->token ); + } + // !TBD Check missing required options + return result; + } + }; + + template<typename DerivedT> + template<typename T> + auto ComposableParserImpl<DerivedT>::operator|( T const &other ) const -> Parser { + return Parser() | static_cast<DerivedT const &>( *this ) | other; + } +} // namespace detail + +// A Combined parser +using detail::Parser; + +// A parser for options +using detail::Opt; + +// A parser for arguments +using detail::Arg; + +// Wrapper for argc, argv from main() +using detail::Args; + +// Specifies the name of the executable +using detail::ExeName; + +// Convenience wrapper for option parser that specifies the help option +using detail::Help; + +// enum of result types from a parse +using detail::ParseResultType; + +// Result type for parser operation +using detail::ParserResult; + +}} // namespace Catch::clara + +// end clara.hpp +#ifdef __clang__ +#pragma clang diagnostic pop +#endif + +// Restore Clara's value for console width, if present +#ifdef CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH +#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH +#undef CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH +#endif + +// end catch_clara.h +namespace Catch { + + clara::Parser makeCommandLineParser( ConfigData& config ); + +} // end namespace Catch + +// end catch_commandline.h +#include <fstream> +#include <ctime> + +namespace Catch { + + clara::Parser makeCommandLineParser( ConfigData& config ) { + + using namespace clara; + + auto const setWarning = [&]( std::string const& warning ) { + auto warningSet = [&]() { + if( warning == "NoAssertions" ) + return WarnAbout::NoAssertions; + + if ( warning == "NoTests" ) + return WarnAbout::NoTests; + + return WarnAbout::Nothing; + }(); + + if (warningSet == WarnAbout::Nothing) + return ParserResult::runtimeError( "Unrecognised warning: '" + warning + "'" ); + config.warnings = static_cast<WarnAbout::What>( config.warnings | warningSet ); + return ParserResult::ok( ParseResultType::Matched ); + }; + auto const loadTestNamesFromFile = [&]( std::string const& filename ) { + std::ifstream f( filename.c_str() ); + if( !f.is_open() ) + return ParserResult::runtimeError( "Unable to load input file: '" + filename + "'" ); + + std::string line; + while( std::getline( f, line ) ) { + line = trim(line); + if( !line.empty() && !startsWith( line, '#' ) ) { + if( !startsWith( line, '"' ) ) + line = '"' + line + '"'; + config.testsOrTags.push_back( line + ',' ); + } + } + return ParserResult::ok( ParseResultType::Matched ); + }; + auto const setTestOrder = [&]( std::string const& order ) { + if( startsWith( "declared", order ) ) + config.runOrder = RunTests::InDeclarationOrder; + else if( startsWith( "lexical", order ) ) + config.runOrder = RunTests::InLexicographicalOrder; + else if( startsWith( "random", order ) ) + config.runOrder = RunTests::InRandomOrder; + else + return clara::ParserResult::runtimeError( "Unrecognised ordering: '" + order + "'" ); + return ParserResult::ok( ParseResultType::Matched ); + }; + auto const setRngSeed = [&]( std::string const& seed ) { + if( seed != "time" ) + return clara::detail::convertInto( seed, config.rngSeed ); + config.rngSeed = static_cast<unsigned int>( std::time(nullptr) ); + return ParserResult::ok( ParseResultType::Matched ); + }; + auto const setColourUsage = [&]( std::string const& useColour ) { + auto mode = toLower( useColour ); + + if( mode == "yes" ) + config.useColour = UseColour::Yes; + else if( mode == "no" ) + config.useColour = UseColour::No; + else if( mode == "auto" ) + config.useColour = UseColour::Auto; + else + return ParserResult::runtimeError( "colour mode must be one of: auto, yes or no. '" + useColour + "' not recognised" ); + return ParserResult::ok( ParseResultType::Matched ); + }; + auto const setWaitForKeypress = [&]( std::string const& keypress ) { + auto keypressLc = toLower( keypress ); + if( keypressLc == "start" ) + config.waitForKeypress = WaitForKeypress::BeforeStart; + else if( keypressLc == "exit" ) + config.waitForKeypress = WaitForKeypress::BeforeExit; + else if( keypressLc == "both" ) + config.waitForKeypress = WaitForKeypress::BeforeStartAndExit; + else + return ParserResult::runtimeError( "keypress argument must be one of: start, exit or both. '" + keypress + "' not recognised" ); + return ParserResult::ok( ParseResultType::Matched ); + }; + auto const setVerbosity = [&]( std::string const& verbosity ) { + auto lcVerbosity = toLower( verbosity ); + if( lcVerbosity == "quiet" ) + config.verbosity = Verbosity::Quiet; + else if( lcVerbosity == "normal" ) + config.verbosity = Verbosity::Normal; + else if( lcVerbosity == "high" ) + config.verbosity = Verbosity::High; + else + return ParserResult::runtimeError( "Unrecognised verbosity, '" + verbosity + "'" ); + return ParserResult::ok( ParseResultType::Matched ); + }; + auto const setReporter = [&]( std::string const& reporter ) { + IReporterRegistry::FactoryMap const& factories = getRegistryHub().getReporterRegistry().getFactories(); + + auto lcReporter = toLower( reporter ); + auto result = factories.find( lcReporter ); + + if( factories.end() != result ) + config.reporterName = lcReporter; + else + return ParserResult::runtimeError( "Unrecognized reporter, '" + reporter + "'. Check available with --list-reporters" ); + return ParserResult::ok( ParseResultType::Matched ); + }; + + auto cli + = ExeName( config.processName ) + | Help( config.showHelp ) + | Opt( config.listTests ) + ["-l"]["--list-tests"] + ( "list all/matching test cases" ) + | Opt( config.listTags ) + ["-t"]["--list-tags"] + ( "list all/matching tags" ) + | Opt( config.showSuccessfulTests ) + ["-s"]["--success"] + ( "include successful tests in output" ) + | Opt( config.shouldDebugBreak ) + ["-b"]["--break"] + ( "break into debugger on failure" ) + | Opt( config.noThrow ) + ["-e"]["--nothrow"] + ( "skip exception tests" ) + | Opt( config.showInvisibles ) + ["-i"]["--invisibles"] + ( "show invisibles (tabs, newlines)" ) + | Opt( config.outputFilename, "filename" ) + ["-o"]["--out"] + ( "output filename" ) + | Opt( setReporter, "name" ) + ["-r"]["--reporter"] + ( "reporter to use (defaults to console)" ) + | Opt( config.name, "name" ) + ["-n"]["--name"] + ( "suite name" ) + | Opt( [&]( bool ){ config.abortAfter = 1; } ) + ["-a"]["--abort"] + ( "abort at first failure" ) + | Opt( [&]( int x ){ config.abortAfter = x; }, "no. failures" ) + ["-x"]["--abortx"] + ( "abort after x failures" ) + | Opt( setWarning, "warning name" ) + ["-w"]["--warn"] + ( "enable warnings" ) + | Opt( [&]( bool flag ) { config.showDurations = flag ? ShowDurations::Always : ShowDurations::Never; }, "yes|no" ) + ["-d"]["--durations"] + ( "show test durations" ) + | Opt( loadTestNamesFromFile, "filename" ) + ["-f"]["--input-file"] + ( "load test names to run from a file" ) + | Opt( config.filenamesAsTags ) + ["-#"]["--filenames-as-tags"] + ( "adds a tag for the filename" ) + | Opt( config.sectionsToRun, "section name" ) + ["-c"]["--section"] + ( "specify section to run" ) + | Opt( setVerbosity, "quiet|normal|high" ) + ["-v"]["--verbosity"] + ( "set output verbosity" ) + | Opt( config.listTestNamesOnly ) + ["--list-test-names-only"] + ( "list all/matching test cases names only" ) + | Opt( config.listReporters ) + ["--list-reporters"] + ( "list all reporters" ) + | Opt( setTestOrder, "decl|lex|rand" ) + ["--order"] + ( "test case order (defaults to decl)" ) + | Opt( setRngSeed, "'time'|number" ) + ["--rng-seed"] + ( "set a specific seed for random numbers" ) + | Opt( setColourUsage, "yes|no" ) + ["--use-colour"] + ( "should output be colourised" ) + | Opt( config.libIdentify ) + ["--libidentify"] + ( "report name and version according to libidentify standard" ) + | Opt( setWaitForKeypress, "start|exit|both" ) + ["--wait-for-keypress"] + ( "waits for a keypress before exiting" ) + | Opt( config.benchmarkSamples, "samples" ) + ["--benchmark-samples"] + ( "number of samples to collect (default: 100)" ) + | Opt( config.benchmarkResamples, "resamples" ) + ["--benchmark-resamples"] + ( "number of resamples for the bootstrap (default: 100000)" ) + | Opt( config.benchmarkConfidenceInterval, "confidence interval" ) + ["--benchmark-confidence-interval"] + ( "confidence interval for the bootstrap (between 0 and 1, default: 0.95)" ) + | Opt( config.benchmarkNoAnalysis ) + ["--benchmark-no-analysis"] + ( "perform only measurements; do not perform any analysis" ) + | Arg( config.testsOrTags, "test name|pattern|tags" ) + ( "which test or tests to use" ); + + return cli; + } + +} // end namespace Catch +// end catch_commandline.cpp +// start catch_common.cpp + +#include <cstring> +#include <ostream> + +namespace Catch { + + bool SourceLineInfo::empty() const noexcept { + return file[0] == '\0'; + } + bool SourceLineInfo::operator == ( SourceLineInfo const& other ) const noexcept { + return line == other.line && (file == other.file || std::strcmp(file, other.file) == 0); + } + bool SourceLineInfo::operator < ( SourceLineInfo const& other ) const noexcept { + // We can assume that the same file will usually have the same pointer. + // Thus, if the pointers are the same, there is no point in calling the strcmp + return line < other.line || ( line == other.line && file != other.file && (std::strcmp(file, other.file) < 0)); + } + + std::ostream& operator << ( std::ostream& os, SourceLineInfo const& info ) { +#ifndef __GNUG__ + os << info.file << '(' << info.line << ')'; +#else + os << info.file << ':' << info.line; +#endif + return os; + } + + std::string StreamEndStop::operator+() const { + return std::string(); + } + + NonCopyable::NonCopyable() = default; + NonCopyable::~NonCopyable() = default; + +} +// end catch_common.cpp +// start catch_config.cpp + +namespace Catch { + + Config::Config( ConfigData const& data ) + : m_data( data ), + m_stream( openStream() ) + { + TestSpecParser parser(ITagAliasRegistry::get()); + if (!data.testsOrTags.empty()) { + m_hasTestFilters = true; + for( auto const& testOrTags : data.testsOrTags ) + parser.parse( testOrTags ); + } + m_testSpec = parser.testSpec(); + } + + std::string const& Config::getFilename() const { + return m_data.outputFilename ; + } + + bool Config::listTests() const { return m_data.listTests; } + bool Config::listTestNamesOnly() const { return m_data.listTestNamesOnly; } + bool Config::listTags() const { return m_data.listTags; } + bool Config::listReporters() const { return m_data.listReporters; } + + std::string Config::getProcessName() const { return m_data.processName; } + std::string const& Config::getReporterName() const { return m_data.reporterName; } + + std::vector<std::string> const& Config::getTestsOrTags() const { return m_data.testsOrTags; } + std::vector<std::string> const& Config::getSectionsToRun() const { return m_data.sectionsToRun; } + + TestSpec const& Config::testSpec() const { return m_testSpec; } + bool Config::hasTestFilters() const { return m_hasTestFilters; } + + bool Config::showHelp() const { return m_data.showHelp; } + + // IConfig interface + bool Config::allowThrows() const { return !m_data.noThrow; } + std::ostream& Config::stream() const { return m_stream->stream(); } + std::string Config::name() const { return m_data.name.empty() ? m_data.processName : m_data.name; } + bool Config::includeSuccessfulResults() const { return m_data.showSuccessfulTests; } + bool Config::warnAboutMissingAssertions() const { return !!(m_data.warnings & WarnAbout::NoAssertions); } + bool Config::warnAboutNoTests() const { return !!(m_data.warnings & WarnAbout::NoTests); } + ShowDurations::OrNot Config::showDurations() const { return m_data.showDurations; } + RunTests::InWhatOrder Config::runOrder() const { return m_data.runOrder; } + unsigned int Config::rngSeed() const { return m_data.rngSeed; } + UseColour::YesOrNo Config::useColour() const { return m_data.useColour; } + bool Config::shouldDebugBreak() const { return m_data.shouldDebugBreak; } + int Config::abortAfter() const { return m_data.abortAfter; } + bool Config::showInvisibles() const { return m_data.showInvisibles; } + Verbosity Config::verbosity() const { return m_data.verbosity; } + + bool Config::benchmarkNoAnalysis() const { return m_data.benchmarkNoAnalysis; } + int Config::benchmarkSamples() const { return m_data.benchmarkSamples; } + double Config::benchmarkConfidenceInterval() const { return m_data.benchmarkConfidenceInterval; } + unsigned int Config::benchmarkResamples() const { return m_data.benchmarkResamples; } + + IStream const* Config::openStream() { + return Catch::makeStream(m_data.outputFilename); + } + +} // end namespace Catch +// end catch_config.cpp +// start catch_console_colour.cpp + +#if defined(__clang__) +# pragma clang diagnostic push +# pragma clang diagnostic ignored "-Wexit-time-destructors" +#endif + +// start catch_errno_guard.h + +namespace Catch { + + class ErrnoGuard { + public: + ErrnoGuard(); + ~ErrnoGuard(); + private: + int m_oldErrno; + }; + +} + +// end catch_errno_guard.h +#include <sstream> + +namespace Catch { + namespace { + + struct IColourImpl { + virtual ~IColourImpl() = default; + virtual void use( Colour::Code _colourCode ) = 0; + }; + + struct NoColourImpl : IColourImpl { + void use( Colour::Code ) {} + + static IColourImpl* instance() { + static NoColourImpl s_instance; + return &s_instance; + } + }; + + } // anon namespace +} // namespace Catch + +#if !defined( CATCH_CONFIG_COLOUR_NONE ) && !defined( CATCH_CONFIG_COLOUR_WINDOWS ) && !defined( CATCH_CONFIG_COLOUR_ANSI ) +# ifdef CATCH_PLATFORM_WINDOWS +# define CATCH_CONFIG_COLOUR_WINDOWS +# else +# define CATCH_CONFIG_COLOUR_ANSI +# endif +#endif + +#if defined ( CATCH_CONFIG_COLOUR_WINDOWS ) ///////////////////////////////////////// + +namespace Catch { +namespace { + + class Win32ColourImpl : public IColourImpl { + public: + Win32ColourImpl() : stdoutHandle( GetStdHandle(STD_OUTPUT_HANDLE) ) + { + CONSOLE_SCREEN_BUFFER_INFO csbiInfo; + GetConsoleScreenBufferInfo( stdoutHandle, &csbiInfo ); + originalForegroundAttributes = csbiInfo.wAttributes & ~( BACKGROUND_GREEN | BACKGROUND_RED | BACKGROUND_BLUE | BACKGROUND_INTENSITY ); + originalBackgroundAttributes = csbiInfo.wAttributes & ~( FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_BLUE | FOREGROUND_INTENSITY ); + } + + void use( Colour::Code _colourCode ) override { + switch( _colourCode ) { + case Colour::None: return setTextAttribute( originalForegroundAttributes ); + case Colour::White: return setTextAttribute( FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_BLUE ); + case Colour::Red: return setTextAttribute( FOREGROUND_RED ); + case Colour::Green: return setTextAttribute( FOREGROUND_GREEN ); + case Colour::Blue: return setTextAttribute( FOREGROUND_BLUE ); + case Colour::Cyan: return setTextAttribute( FOREGROUND_BLUE | FOREGROUND_GREEN ); + case Colour::Yellow: return setTextAttribute( FOREGROUND_RED | FOREGROUND_GREEN ); + case Colour::Grey: return setTextAttribute( 0 ); + + case Colour::LightGrey: return setTextAttribute( FOREGROUND_INTENSITY ); + case Colour::BrightRed: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_RED ); + case Colour::BrightGreen: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_GREEN ); + case Colour::BrightWhite: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_BLUE ); + case Colour::BrightYellow: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_RED | FOREGROUND_GREEN ); + + case Colour::Bright: CATCH_INTERNAL_ERROR( "not a colour" ); + + default: + CATCH_ERROR( "Unknown colour requested" ); + } + } + + private: + void setTextAttribute( WORD _textAttribute ) { + SetConsoleTextAttribute( stdoutHandle, _textAttribute | originalBackgroundAttributes ); + } + HANDLE stdoutHandle; + WORD originalForegroundAttributes; + WORD originalBackgroundAttributes; + }; + + IColourImpl* platformColourInstance() { + static Win32ColourImpl s_instance; + + IConfigPtr config = getCurrentContext().getConfig(); + UseColour::YesOrNo colourMode = config + ? config->useColour() + : UseColour::Auto; + if( colourMode == UseColour::Auto ) + colourMode = UseColour::Yes; + return colourMode == UseColour::Yes + ? &s_instance + : NoColourImpl::instance(); + } + +} // end anon namespace +} // end namespace Catch + +#elif defined( CATCH_CONFIG_COLOUR_ANSI ) ////////////////////////////////////// + +#include <unistd.h> + +namespace Catch { +namespace { + + // use POSIX/ ANSI console terminal codes + // Thanks to Adam Strzelecki for original contribution + // (http://github.com/nanoant) + // https://github.com/philsquared/Catch/pull/131 + class PosixColourImpl : public IColourImpl { + public: + void use( Colour::Code _colourCode ) override { + switch( _colourCode ) { + case Colour::None: + case Colour::White: return setColour( "[0m" ); + case Colour::Red: return setColour( "[0;31m" ); + case Colour::Green: return setColour( "[0;32m" ); + case Colour::Blue: return setColour( "[0;34m" ); + case Colour::Cyan: return setColour( "[0;36m" ); + case Colour::Yellow: return setColour( "[0;33m" ); + case Colour::Grey: return setColour( "[1;30m" ); + + case Colour::LightGrey: return setColour( "[0;37m" ); + case Colour::BrightRed: return setColour( "[1;31m" ); + case Colour::BrightGreen: return setColour( "[1;32m" ); + case Colour::BrightWhite: return setColour( "[1;37m" ); + case Colour::BrightYellow: return setColour( "[1;33m" ); + + case Colour::Bright: CATCH_INTERNAL_ERROR( "not a colour" ); + default: CATCH_INTERNAL_ERROR( "Unknown colour requested" ); + } + } + static IColourImpl* instance() { + static PosixColourImpl s_instance; + return &s_instance; + } + + private: + void setColour( const char* _escapeCode ) { + getCurrentContext().getConfig()->stream() + << '\033' << _escapeCode; + } + }; + + bool useColourOnPlatform() { + return +#ifdef CATCH_PLATFORM_MAC + !isDebuggerActive() && +#endif +#if !(defined(__DJGPP__) && defined(__STRICT_ANSI__)) + isatty(STDOUT_FILENO) +#else + false +#endif + ; + } + IColourImpl* platformColourInstance() { + ErrnoGuard guard; + IConfigPtr config = getCurrentContext().getConfig(); + UseColour::YesOrNo colourMode = config + ? config->useColour() + : UseColour::Auto; + if( colourMode == UseColour::Auto ) + colourMode = useColourOnPlatform() + ? UseColour::Yes + : UseColour::No; + return colourMode == UseColour::Yes + ? PosixColourImpl::instance() + : NoColourImpl::instance(); + } + +} // end anon namespace +} // end namespace Catch + +#else // not Windows or ANSI /////////////////////////////////////////////// + +namespace Catch { + + static IColourImpl* platformColourInstance() { return NoColourImpl::instance(); } + +} // end namespace Catch + +#endif // Windows/ ANSI/ None + +namespace Catch { + + Colour::Colour( Code _colourCode ) { use( _colourCode ); } + Colour::Colour( Colour&& rhs ) noexcept { + m_moved = rhs.m_moved; + rhs.m_moved = true; + } + Colour& Colour::operator=( Colour&& rhs ) noexcept { + m_moved = rhs.m_moved; + rhs.m_moved = true; + return *this; + } + + Colour::~Colour(){ if( !m_moved ) use( None ); } + + void Colour::use( Code _colourCode ) { + static IColourImpl* impl = platformColourInstance(); + // Strictly speaking, this cannot possibly happen. + // However, under some conditions it does happen (see #1626), + // and this change is small enough that we can let practicality + // triumph over purity in this case. + if (impl != NULL) { + impl->use( _colourCode ); + } + } + + std::ostream& operator << ( std::ostream& os, Colour const& ) { + return os; + } + +} // end namespace Catch + +#if defined(__clang__) +# pragma clang diagnostic pop +#endif + +// end catch_console_colour.cpp +// start catch_context.cpp + +namespace Catch { + + class Context : public IMutableContext, NonCopyable { + + public: // IContext + IResultCapture* getResultCapture() override { + return m_resultCapture; + } + IRunner* getRunner() override { + return m_runner; + } + + IConfigPtr const& getConfig() const override { + return m_config; + } + + ~Context() override; + + public: // IMutableContext + void setResultCapture( IResultCapture* resultCapture ) override { + m_resultCapture = resultCapture; + } + void setRunner( IRunner* runner ) override { + m_runner = runner; + } + void setConfig( IConfigPtr const& config ) override { + m_config = config; + } + + friend IMutableContext& getCurrentMutableContext(); + + private: + IConfigPtr m_config; + IRunner* m_runner = nullptr; + IResultCapture* m_resultCapture = nullptr; + }; + + IMutableContext *IMutableContext::currentContext = nullptr; + + void IMutableContext::createContext() + { + currentContext = new Context(); + } + + void cleanUpContext() { + delete IMutableContext::currentContext; + IMutableContext::currentContext = nullptr; + } + IContext::~IContext() = default; + IMutableContext::~IMutableContext() = default; + Context::~Context() = default; +} +// end catch_context.cpp +// start catch_debug_console.cpp + +// start catch_debug_console.h + +#include <string> + +namespace Catch { + void writeToDebugConsole( std::string const& text ); +} + +// end catch_debug_console.h +#ifdef CATCH_PLATFORM_WINDOWS + + namespace Catch { + void writeToDebugConsole( std::string const& text ) { + ::OutputDebugStringA( text.c_str() ); + } + } + +#else + + namespace Catch { + void writeToDebugConsole( std::string const& text ) { + // !TBD: Need a version for Mac/ XCode and other IDEs + Catch::cout() << text; + } + } + +#endif // Platform +// end catch_debug_console.cpp +// start catch_debugger.cpp + +#ifdef CATCH_PLATFORM_MAC + +# include <assert.h> +# include <stdbool.h> +# include <sys/types.h> +# include <unistd.h> +# include <cstddef> +# include <ostream> + +#ifdef __apple_build_version__ + // These headers will only compile with AppleClang (XCode) + // For other compilers (Clang, GCC, ... ) we need to exclude them +# include <sys/sysctl.h> +#endif + + namespace Catch { + #ifdef __apple_build_version__ + // The following function is taken directly from the following technical note: + // https://developer.apple.com/library/archive/qa/qa1361/_index.html + + // Returns true if the current process is being debugged (either + // running under the debugger or has a debugger attached post facto). + bool isDebuggerActive(){ + int mib[4]; + struct kinfo_proc info; + std::size_t size; + + // Initialize the flags so that, if sysctl fails for some bizarre + // reason, we get a predictable result. + + info.kp_proc.p_flag = 0; + + // Initialize mib, which tells sysctl the info we want, in this case + // we're looking for information about a specific process ID. + + mib[0] = CTL_KERN; + mib[1] = KERN_PROC; + mib[2] = KERN_PROC_PID; + mib[3] = getpid(); + + // Call sysctl. + + size = sizeof(info); + if( sysctl(mib, sizeof(mib) / sizeof(*mib), &info, &size, nullptr, 0) != 0 ) { + Catch::cerr() << "\n** Call to sysctl failed - unable to determine if debugger is active **\n" << std::endl; + return false; + } + + // We're being debugged if the P_TRACED flag is set. + + return ( (info.kp_proc.p_flag & P_TRACED) != 0 ); + } + #else + bool isDebuggerActive() { + // We need to find another way to determine this for non-appleclang compilers on macOS + return false; + } + #endif + } // namespace Catch + +#elif defined(CATCH_PLATFORM_LINUX) + #include <fstream> + #include <string> + + namespace Catch{ + // The standard POSIX way of detecting a debugger is to attempt to + // ptrace() the process, but this needs to be done from a child and not + // this process itself to still allow attaching to this process later + // if wanted, so is rather heavy. Under Linux we have the PID of the + // "debugger" (which doesn't need to be gdb, of course, it could also + // be strace, for example) in /proc/$PID/status, so just get it from + // there instead. + bool isDebuggerActive(){ + // Libstdc++ has a bug, where std::ifstream sets errno to 0 + // This way our users can properly assert over errno values + ErrnoGuard guard; + std::ifstream in("/proc/self/status"); + for( std::string line; std::getline(in, line); ) { + static const int PREFIX_LEN = 11; + if( line.compare(0, PREFIX_LEN, "TracerPid:\t") == 0 ) { + // We're traced if the PID is not 0 and no other PID starts + // with 0 digit, so it's enough to check for just a single + // character. + return line.length() > PREFIX_LEN && line[PREFIX_LEN] != '0'; + } + } + + return false; + } + } // namespace Catch +#elif defined(_MSC_VER) + extern "C" __declspec(dllimport) int __stdcall IsDebuggerPresent(); + namespace Catch { + bool isDebuggerActive() { + return IsDebuggerPresent() != 0; + } + } +#elif defined(__MINGW32__) + extern "C" __declspec(dllimport) int __stdcall IsDebuggerPresent(); + namespace Catch { + bool isDebuggerActive() { + return IsDebuggerPresent() != 0; + } + } +#else + namespace Catch { + bool isDebuggerActive() { return false; } + } +#endif // Platform +// end catch_debugger.cpp +// start catch_decomposer.cpp + +namespace Catch { + + ITransientExpression::~ITransientExpression() = default; + + void formatReconstructedExpression( std::ostream &os, std::string const& lhs, StringRef op, std::string const& rhs ) { + if( lhs.size() + rhs.size() < 40 && + lhs.find('\n') == std::string::npos && + rhs.find('\n') == std::string::npos ) + os << lhs << " " << op << " " << rhs; + else + os << lhs << "\n" << op << "\n" << rhs; + } +} +// end catch_decomposer.cpp +// start catch_enforce.cpp + +#include <stdexcept> + +namespace Catch { +#if defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) && !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS_CUSTOM_HANDLER) + [[noreturn]] + void throw_exception(std::exception const& e) { + Catch::cerr() << "Catch will terminate because it needed to throw an exception.\n" + << "The message was: " << e.what() << '\n'; + std::terminate(); + } +#endif + + [[noreturn]] + void throw_logic_error(std::string const& msg) { + throw_exception(std::logic_error(msg)); + } + + [[noreturn]] + void throw_domain_error(std::string const& msg) { + throw_exception(std::domain_error(msg)); + } + + [[noreturn]] + void throw_runtime_error(std::string const& msg) { + throw_exception(std::runtime_error(msg)); + } + +} // namespace Catch; +// end catch_enforce.cpp +// start catch_enum_values_registry.cpp +// start catch_enum_values_registry.h + +#include <vector> +#include <memory> + +namespace Catch { + + namespace Detail { + + std::unique_ptr<EnumInfo> makeEnumInfo( StringRef enumName, StringRef allValueNames, std::vector<int> const& values ); + + class EnumValuesRegistry : public IMutableEnumValuesRegistry { + + std::vector<std::unique_ptr<EnumInfo>> m_enumInfos; + + EnumInfo const& registerEnum( StringRef enumName, StringRef allEnums, std::vector<int> const& values) override; + }; + + std::vector<std::string> parseEnums( StringRef enums ); + + } // Detail + +} // Catch + +// end catch_enum_values_registry.h + +#include <map> +#include <cassert> + +namespace Catch { + + IMutableEnumValuesRegistry::~IMutableEnumValuesRegistry() {} + + namespace Detail { + + std::vector<std::string> parseEnums( StringRef enums ) { + auto enumValues = splitStringRef( enums, ',' ); + std::vector<std::string> parsed; + parsed.reserve( enumValues.size() ); + for( auto const& enumValue : enumValues ) { + auto identifiers = splitStringRef( enumValue, ':' ); + parsed.push_back( Catch::trim( identifiers.back() ) ); + } + return parsed; + } + + EnumInfo::~EnumInfo() {} + + StringRef EnumInfo::lookup( int value ) const { + for( auto const& valueToName : m_values ) { + if( valueToName.first == value ) + return valueToName.second; + } + return "{** unexpected enum value **}"; + } + + std::unique_ptr<EnumInfo> makeEnumInfo( StringRef enumName, StringRef allValueNames, std::vector<int> const& values ) { + std::unique_ptr<EnumInfo> enumInfo( new EnumInfo ); + enumInfo->m_name = enumName; + enumInfo->m_values.reserve( values.size() ); + + const auto valueNames = Catch::Detail::parseEnums( allValueNames ); + assert( valueNames.size() == values.size() ); + std::size_t i = 0; + for( auto value : values ) + enumInfo->m_values.push_back({ value, valueNames[i++] }); + + return enumInfo; + } + + EnumInfo const& EnumValuesRegistry::registerEnum( StringRef enumName, StringRef allValueNames, std::vector<int> const& values ) { + auto enumInfo = makeEnumInfo( enumName, allValueNames, values ); + EnumInfo* raw = enumInfo.get(); + m_enumInfos.push_back( std::move( enumInfo ) ); + return *raw; + } + + } // Detail +} // Catch + +// end catch_enum_values_registry.cpp +// start catch_errno_guard.cpp + +#include <cerrno> + +namespace Catch { + ErrnoGuard::ErrnoGuard():m_oldErrno(errno){} + ErrnoGuard::~ErrnoGuard() { errno = m_oldErrno; } +} +// end catch_errno_guard.cpp +// start catch_exception_translator_registry.cpp + +// start catch_exception_translator_registry.h + +#include <vector> +#include <string> +#include <memory> + +namespace Catch { + + class ExceptionTranslatorRegistry : public IExceptionTranslatorRegistry { + public: + ~ExceptionTranslatorRegistry(); + virtual void registerTranslator( const IExceptionTranslator* translator ); + std::string translateActiveException() const override; + std::string tryTranslators() const; + + private: + std::vector<std::unique_ptr<IExceptionTranslator const>> m_translators; + }; +} + +// end catch_exception_translator_registry.h +#ifdef __OBJC__ +#import "Foundation/Foundation.h" +#endif + +namespace Catch { + + ExceptionTranslatorRegistry::~ExceptionTranslatorRegistry() { + } + + void ExceptionTranslatorRegistry::registerTranslator( const IExceptionTranslator* translator ) { + m_translators.push_back( std::unique_ptr<const IExceptionTranslator>( translator ) ); + } + +#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) + std::string ExceptionTranslatorRegistry::translateActiveException() const { + try { +#ifdef __OBJC__ + // In Objective-C try objective-c exceptions first + @try { + return tryTranslators(); + } + @catch (NSException *exception) { + return Catch::Detail::stringify( [exception description] ); + } +#else + // Compiling a mixed mode project with MSVC means that CLR + // exceptions will be caught in (...) as well. However, these + // do not fill-in std::current_exception and thus lead to crash + // when attempting rethrow. + // /EHa switch also causes structured exceptions to be caught + // here, but they fill-in current_exception properly, so + // at worst the output should be a little weird, instead of + // causing a crash. + if (std::current_exception() == nullptr) { + return "Non C++ exception. Possibly a CLR exception."; + } + return tryTranslators(); +#endif + } + catch( TestFailureException& ) { + std::rethrow_exception(std::current_exception()); + } + catch( std::exception& ex ) { + return ex.what(); + } + catch( std::string& msg ) { + return msg; + } + catch( const char* msg ) { + return msg; + } + catch(...) { + return "Unknown exception"; + } + } + + std::string ExceptionTranslatorRegistry::tryTranslators() const { + if (m_translators.empty()) { + std::rethrow_exception(std::current_exception()); + } else { + return m_translators[0]->translate(m_translators.begin() + 1, m_translators.end()); + } + } + +#else // ^^ Exceptions are enabled // Exceptions are disabled vv + std::string ExceptionTranslatorRegistry::translateActiveException() const { + CATCH_INTERNAL_ERROR("Attempted to translate active exception under CATCH_CONFIG_DISABLE_EXCEPTIONS!"); + } + + std::string ExceptionTranslatorRegistry::tryTranslators() const { + CATCH_INTERNAL_ERROR("Attempted to use exception translators under CATCH_CONFIG_DISABLE_EXCEPTIONS!"); + } +#endif + +} +// end catch_exception_translator_registry.cpp +// start catch_fatal_condition.cpp + +#if defined(__GNUC__) +# pragma GCC diagnostic push +# pragma GCC diagnostic ignored "-Wmissing-field-initializers" +#endif + +#if defined( CATCH_CONFIG_WINDOWS_SEH ) || defined( CATCH_CONFIG_POSIX_SIGNALS ) + +namespace { + // Report the error condition + void reportFatal( char const * const message ) { + Catch::getCurrentContext().getResultCapture()->handleFatalErrorCondition( message ); + } +} + +#endif // signals/SEH handling + +#if defined( CATCH_CONFIG_WINDOWS_SEH ) + +namespace Catch { + struct SignalDefs { DWORD id; const char* name; }; + + // There is no 1-1 mapping between signals and windows exceptions. + // Windows can easily distinguish between SO and SigSegV, + // but SigInt, SigTerm, etc are handled differently. + static SignalDefs signalDefs[] = { + { static_cast<DWORD>(EXCEPTION_ILLEGAL_INSTRUCTION), "SIGILL - Illegal instruction signal" }, + { static_cast<DWORD>(EXCEPTION_STACK_OVERFLOW), "SIGSEGV - Stack overflow" }, + { static_cast<DWORD>(EXCEPTION_ACCESS_VIOLATION), "SIGSEGV - Segmentation violation signal" }, + { static_cast<DWORD>(EXCEPTION_INT_DIVIDE_BY_ZERO), "Divide by zero error" }, + }; + + LONG CALLBACK FatalConditionHandler::handleVectoredException(PEXCEPTION_POINTERS ExceptionInfo) { + for (auto const& def : signalDefs) { + if (ExceptionInfo->ExceptionRecord->ExceptionCode == def.id) { + reportFatal(def.name); + } + } + // If its not an exception we care about, pass it along. + // This stops us from eating debugger breaks etc. + return EXCEPTION_CONTINUE_SEARCH; + } + + FatalConditionHandler::FatalConditionHandler() { + isSet = true; + // 32k seems enough for Catch to handle stack overflow, + // but the value was found experimentally, so there is no strong guarantee + guaranteeSize = 32 * 1024; + exceptionHandlerHandle = nullptr; + // Register as first handler in current chain + exceptionHandlerHandle = AddVectoredExceptionHandler(1, handleVectoredException); + // Pass in guarantee size to be filled + SetThreadStackGuarantee(&guaranteeSize); + } + + void FatalConditionHandler::reset() { + if (isSet) { + RemoveVectoredExceptionHandler(exceptionHandlerHandle); + SetThreadStackGuarantee(&guaranteeSize); + exceptionHandlerHandle = nullptr; + isSet = false; + } + } + + FatalConditionHandler::~FatalConditionHandler() { + reset(); + } + +bool FatalConditionHandler::isSet = false; +ULONG FatalConditionHandler::guaranteeSize = 0; +PVOID FatalConditionHandler::exceptionHandlerHandle = nullptr; + +} // namespace Catch + +#elif defined( CATCH_CONFIG_POSIX_SIGNALS ) + +namespace Catch { + + struct SignalDefs { + int id; + const char* name; + }; + + // 32kb for the alternate stack seems to be sufficient. However, this value + // is experimentally determined, so that's not guaranteed. + constexpr static std::size_t sigStackSize = 32768 >= MINSIGSTKSZ ? 32768 : MINSIGSTKSZ; + + static SignalDefs signalDefs[] = { + { SIGINT, "SIGINT - Terminal interrupt signal" }, + { SIGILL, "SIGILL - Illegal instruction signal" }, + { SIGFPE, "SIGFPE - Floating point error signal" }, + { SIGSEGV, "SIGSEGV - Segmentation violation signal" }, + { SIGTERM, "SIGTERM - Termination request signal" }, + { SIGABRT, "SIGABRT - Abort (abnormal termination) signal" } + }; + + void FatalConditionHandler::handleSignal( int sig ) { + char const * name = "<unknown signal>"; + for (auto const& def : signalDefs) { + if (sig == def.id) { + name = def.name; + break; + } + } + reset(); + reportFatal(name); + raise( sig ); + } + + FatalConditionHandler::FatalConditionHandler() { + isSet = true; + stack_t sigStack; + sigStack.ss_sp = altStackMem; + sigStack.ss_size = sigStackSize; + sigStack.ss_flags = 0; + sigaltstack(&sigStack, &oldSigStack); + struct sigaction sa = { }; + + sa.sa_handler = handleSignal; + sa.sa_flags = SA_ONSTACK; + for (std::size_t i = 0; i < sizeof(signalDefs)/sizeof(SignalDefs); ++i) { + sigaction(signalDefs[i].id, &sa, &oldSigActions[i]); + } + } + + FatalConditionHandler::~FatalConditionHandler() { + reset(); + } + + void FatalConditionHandler::reset() { + if( isSet ) { + // Set signals back to previous values -- hopefully nobody overwrote them in the meantime + for( std::size_t i = 0; i < sizeof(signalDefs)/sizeof(SignalDefs); ++i ) { + sigaction(signalDefs[i].id, &oldSigActions[i], nullptr); + } + // Return the old stack + sigaltstack(&oldSigStack, nullptr); + isSet = false; + } + } + + bool FatalConditionHandler::isSet = false; + struct sigaction FatalConditionHandler::oldSigActions[sizeof(signalDefs)/sizeof(SignalDefs)] = {}; + stack_t FatalConditionHandler::oldSigStack = {}; + char FatalConditionHandler::altStackMem[sigStackSize] = {}; + +} // namespace Catch + +#else + +namespace Catch { + void FatalConditionHandler::reset() {} +} + +#endif // signals/SEH handling + +#if defined(__GNUC__) +# pragma GCC diagnostic pop +#endif +// end catch_fatal_condition.cpp +// start catch_generators.cpp + +// start catch_random_number_generator.h + +#include <algorithm> +#include <random> + +namespace Catch { + + struct IConfig; + + std::mt19937& rng(); + void seedRng( IConfig const& config ); + unsigned int rngSeed(); + +} + +// end catch_random_number_generator.h +#include <limits> +#include <set> + +namespace Catch { + +IGeneratorTracker::~IGeneratorTracker() {} + +const char* GeneratorException::what() const noexcept { + return m_msg; +} + +namespace Generators { + + GeneratorUntypedBase::~GeneratorUntypedBase() {} + + auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& { + return getResultCapture().acquireGeneratorTracker( lineInfo ); + } + +} // namespace Generators +} // namespace Catch +// end catch_generators.cpp +// start catch_interfaces_capture.cpp + +namespace Catch { + IResultCapture::~IResultCapture() = default; +} +// end catch_interfaces_capture.cpp +// start catch_interfaces_config.cpp + +namespace Catch { + IConfig::~IConfig() = default; +} +// end catch_interfaces_config.cpp +// start catch_interfaces_exception.cpp + +namespace Catch { + IExceptionTranslator::~IExceptionTranslator() = default; + IExceptionTranslatorRegistry::~IExceptionTranslatorRegistry() = default; +} +// end catch_interfaces_exception.cpp +// start catch_interfaces_registry_hub.cpp + +namespace Catch { + IRegistryHub::~IRegistryHub() = default; + IMutableRegistryHub::~IMutableRegistryHub() = default; +} +// end catch_interfaces_registry_hub.cpp +// start catch_interfaces_reporter.cpp + +// start catch_reporter_listening.h + +namespace Catch { + + class ListeningReporter : public IStreamingReporter { + using Reporters = std::vector<IStreamingReporterPtr>; + Reporters m_listeners; + IStreamingReporterPtr m_reporter = nullptr; + ReporterPreferences m_preferences; + + public: + ListeningReporter(); + + void addListener( IStreamingReporterPtr&& listener ); + void addReporter( IStreamingReporterPtr&& reporter ); + + public: // IStreamingReporter + + ReporterPreferences getPreferences() const override; + + void noMatchingTestCases( std::string const& spec ) override; + + static std::set<Verbosity> getSupportedVerbosities(); + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + void benchmarkPreparing(std::string const& name) override; + void benchmarkStarting( BenchmarkInfo const& benchmarkInfo ) override; + void benchmarkEnded( BenchmarkStats<> const& benchmarkStats ) override; + void benchmarkFailed(std::string const&) override; +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + void testRunStarting( TestRunInfo const& testRunInfo ) override; + void testGroupStarting( GroupInfo const& groupInfo ) override; + void testCaseStarting( TestCaseInfo const& testInfo ) override; + void sectionStarting( SectionInfo const& sectionInfo ) override; + void assertionStarting( AssertionInfo const& assertionInfo ) override; + + // The return value indicates if the messages buffer should be cleared: + bool assertionEnded( AssertionStats const& assertionStats ) override; + void sectionEnded( SectionStats const& sectionStats ) override; + void testCaseEnded( TestCaseStats const& testCaseStats ) override; + void testGroupEnded( TestGroupStats const& testGroupStats ) override; + void testRunEnded( TestRunStats const& testRunStats ) override; + + void skipTest( TestCaseInfo const& testInfo ) override; + bool isMulti() const override; + + }; + +} // end namespace Catch + +// end catch_reporter_listening.h +namespace Catch { + + ReporterConfig::ReporterConfig( IConfigPtr const& _fullConfig ) + : m_stream( &_fullConfig->stream() ), m_fullConfig( _fullConfig ) {} + + ReporterConfig::ReporterConfig( IConfigPtr const& _fullConfig, std::ostream& _stream ) + : m_stream( &_stream ), m_fullConfig( _fullConfig ) {} + + std::ostream& ReporterConfig::stream() const { return *m_stream; } + IConfigPtr ReporterConfig::fullConfig() const { return m_fullConfig; } + + TestRunInfo::TestRunInfo( std::string const& _name ) : name( _name ) {} + + GroupInfo::GroupInfo( std::string const& _name, + std::size_t _groupIndex, + std::size_t _groupsCount ) + : name( _name ), + groupIndex( _groupIndex ), + groupsCounts( _groupsCount ) + {} + + AssertionStats::AssertionStats( AssertionResult const& _assertionResult, + std::vector<MessageInfo> const& _infoMessages, + Totals const& _totals ) + : assertionResult( _assertionResult ), + infoMessages( _infoMessages ), + totals( _totals ) + { + assertionResult.m_resultData.lazyExpression.m_transientExpression = _assertionResult.m_resultData.lazyExpression.m_transientExpression; + + if( assertionResult.hasMessage() ) { + // Copy message into messages list. + // !TBD This should have been done earlier, somewhere + MessageBuilder builder( assertionResult.getTestMacroName(), assertionResult.getSourceInfo(), assertionResult.getResultType() ); + builder << assertionResult.getMessage(); + builder.m_info.message = builder.m_stream.str(); + + infoMessages.push_back( builder.m_info ); + } + } + + AssertionStats::~AssertionStats() = default; + + SectionStats::SectionStats( SectionInfo const& _sectionInfo, + Counts const& _assertions, + double _durationInSeconds, + bool _missingAssertions ) + : sectionInfo( _sectionInfo ), + assertions( _assertions ), + durationInSeconds( _durationInSeconds ), + missingAssertions( _missingAssertions ) + {} + + SectionStats::~SectionStats() = default; + + TestCaseStats::TestCaseStats( TestCaseInfo const& _testInfo, + Totals const& _totals, + std::string const& _stdOut, + std::string const& _stdErr, + bool _aborting ) + : testInfo( _testInfo ), + totals( _totals ), + stdOut( _stdOut ), + stdErr( _stdErr ), + aborting( _aborting ) + {} + + TestCaseStats::~TestCaseStats() = default; + + TestGroupStats::TestGroupStats( GroupInfo const& _groupInfo, + Totals const& _totals, + bool _aborting ) + : groupInfo( _groupInfo ), + totals( _totals ), + aborting( _aborting ) + {} + + TestGroupStats::TestGroupStats( GroupInfo const& _groupInfo ) + : groupInfo( _groupInfo ), + aborting( false ) + {} + + TestGroupStats::~TestGroupStats() = default; + + TestRunStats::TestRunStats( TestRunInfo const& _runInfo, + Totals const& _totals, + bool _aborting ) + : runInfo( _runInfo ), + totals( _totals ), + aborting( _aborting ) + {} + + TestRunStats::~TestRunStats() = default; + + void IStreamingReporter::fatalErrorEncountered( StringRef ) {} + bool IStreamingReporter::isMulti() const { return false; } + + IReporterFactory::~IReporterFactory() = default; + IReporterRegistry::~IReporterRegistry() = default; + +} // end namespace Catch +// end catch_interfaces_reporter.cpp +// start catch_interfaces_runner.cpp + +namespace Catch { + IRunner::~IRunner() = default; +} +// end catch_interfaces_runner.cpp +// start catch_interfaces_testcase.cpp + +namespace Catch { + ITestInvoker::~ITestInvoker() = default; + ITestCaseRegistry::~ITestCaseRegistry() = default; +} +// end catch_interfaces_testcase.cpp +// start catch_leak_detector.cpp + +#ifdef CATCH_CONFIG_WINDOWS_CRTDBG +#include <crtdbg.h> + +namespace Catch { + + LeakDetector::LeakDetector() { + int flag = _CrtSetDbgFlag(_CRTDBG_REPORT_FLAG); + flag |= _CRTDBG_LEAK_CHECK_DF; + flag |= _CRTDBG_ALLOC_MEM_DF; + _CrtSetDbgFlag(flag); + _CrtSetReportMode(_CRT_WARN, _CRTDBG_MODE_FILE | _CRTDBG_MODE_DEBUG); + _CrtSetReportFile(_CRT_WARN, _CRTDBG_FILE_STDERR); + // Change this to leaking allocation's number to break there + _CrtSetBreakAlloc(-1); + } +} + +#else + + Catch::LeakDetector::LeakDetector() {} + +#endif + +Catch::LeakDetector::~LeakDetector() { + Catch::cleanUp(); +} +// end catch_leak_detector.cpp +// start catch_list.cpp + +// start catch_list.h + +#include <set> + +namespace Catch { + + std::size_t listTests( Config const& config ); + + std::size_t listTestsNamesOnly( Config const& config ); + + struct TagInfo { + void add( std::string const& spelling ); + std::string all() const; + + std::set<std::string> spellings; + std::size_t count = 0; + }; + + std::size_t listTags( Config const& config ); + + std::size_t listReporters(); + + Option<std::size_t> list( std::shared_ptr<Config> const& config ); + +} // end namespace Catch + +// end catch_list.h +// start catch_text.h + +namespace Catch { + using namespace clara::TextFlow; +} + +// end catch_text.h +#include <limits> +#include <algorithm> +#include <iomanip> + +namespace Catch { + + std::size_t listTests( Config const& config ) { + TestSpec testSpec = config.testSpec(); + if( config.hasTestFilters() ) + Catch::cout() << "Matching test cases:\n"; + else { + Catch::cout() << "All available test cases:\n"; + } + + auto matchedTestCases = filterTests( getAllTestCasesSorted( config ), testSpec, config ); + for( auto const& testCaseInfo : matchedTestCases ) { + Colour::Code colour = testCaseInfo.isHidden() + ? Colour::SecondaryText + : Colour::None; + Colour colourGuard( colour ); + + Catch::cout() << Column( testCaseInfo.name ).initialIndent( 2 ).indent( 4 ) << "\n"; + if( config.verbosity() >= Verbosity::High ) { + Catch::cout() << Column( Catch::Detail::stringify( testCaseInfo.lineInfo ) ).indent(4) << std::endl; + std::string description = testCaseInfo.description; + if( description.empty() ) + description = "(NO DESCRIPTION)"; + Catch::cout() << Column( description ).indent(4) << std::endl; + } + if( !testCaseInfo.tags.empty() ) + Catch::cout() << Column( testCaseInfo.tagsAsString() ).indent( 6 ) << "\n"; + } + + if( !config.hasTestFilters() ) + Catch::cout() << pluralise( matchedTestCases.size(), "test case" ) << '\n' << std::endl; + else + Catch::cout() << pluralise( matchedTestCases.size(), "matching test case" ) << '\n' << std::endl; + return matchedTestCases.size(); + } + + std::size_t listTestsNamesOnly( Config const& config ) { + TestSpec testSpec = config.testSpec(); + std::size_t matchedTests = 0; + std::vector<TestCase> matchedTestCases = filterTests( getAllTestCasesSorted( config ), testSpec, config ); + for( auto const& testCaseInfo : matchedTestCases ) { + matchedTests++; + if( startsWith( testCaseInfo.name, '#' ) ) + Catch::cout() << '"' << testCaseInfo.name << '"'; + else + Catch::cout() << testCaseInfo.name; + if ( config.verbosity() >= Verbosity::High ) + Catch::cout() << "\t@" << testCaseInfo.lineInfo; + Catch::cout() << std::endl; + } + return matchedTests; + } + + void TagInfo::add( std::string const& spelling ) { + ++count; + spellings.insert( spelling ); + } + + std::string TagInfo::all() const { + std::string out; + for( auto const& spelling : spellings ) + out += "[" + spelling + "]"; + return out; + } + + std::size_t listTags( Config const& config ) { + TestSpec testSpec = config.testSpec(); + if( config.hasTestFilters() ) + Catch::cout() << "Tags for matching test cases:\n"; + else { + Catch::cout() << "All available tags:\n"; + } + + std::map<std::string, TagInfo> tagCounts; + + std::vector<TestCase> matchedTestCases = filterTests( getAllTestCasesSorted( config ), testSpec, config ); + for( auto const& testCase : matchedTestCases ) { + for( auto const& tagName : testCase.getTestCaseInfo().tags ) { + std::string lcaseTagName = toLower( tagName ); + auto countIt = tagCounts.find( lcaseTagName ); + if( countIt == tagCounts.end() ) + countIt = tagCounts.insert( std::make_pair( lcaseTagName, TagInfo() ) ).first; + countIt->second.add( tagName ); + } + } + + for( auto const& tagCount : tagCounts ) { + ReusableStringStream rss; + rss << " " << std::setw(2) << tagCount.second.count << " "; + auto str = rss.str(); + auto wrapper = Column( tagCount.second.all() ) + .initialIndent( 0 ) + .indent( str.size() ) + .width( CATCH_CONFIG_CONSOLE_WIDTH-10 ); + Catch::cout() << str << wrapper << '\n'; + } + Catch::cout() << pluralise( tagCounts.size(), "tag" ) << '\n' << std::endl; + return tagCounts.size(); + } + + std::size_t listReporters() { + Catch::cout() << "Available reporters:\n"; + IReporterRegistry::FactoryMap const& factories = getRegistryHub().getReporterRegistry().getFactories(); + std::size_t maxNameLen = 0; + for( auto const& factoryKvp : factories ) + maxNameLen = (std::max)( maxNameLen, factoryKvp.first.size() ); + + for( auto const& factoryKvp : factories ) { + Catch::cout() + << Column( factoryKvp.first + ":" ) + .indent(2) + .width( 5+maxNameLen ) + + Column( factoryKvp.second->getDescription() ) + .initialIndent(0) + .indent(2) + .width( CATCH_CONFIG_CONSOLE_WIDTH - maxNameLen-8 ) + << "\n"; + } + Catch::cout() << std::endl; + return factories.size(); + } + + Option<std::size_t> list( std::shared_ptr<Config> const& config ) { + Option<std::size_t> listedCount; + getCurrentMutableContext().setConfig( config ); + if( config->listTests() ) + listedCount = listedCount.valueOr(0) + listTests( *config ); + if( config->listTestNamesOnly() ) + listedCount = listedCount.valueOr(0) + listTestsNamesOnly( *config ); + if( config->listTags() ) + listedCount = listedCount.valueOr(0) + listTags( *config ); + if( config->listReporters() ) + listedCount = listedCount.valueOr(0) + listReporters(); + return listedCount; + } + +} // end namespace Catch +// end catch_list.cpp +// start catch_matchers.cpp + +namespace Catch { +namespace Matchers { + namespace Impl { + + std::string MatcherUntypedBase::toString() const { + if( m_cachedToString.empty() ) + m_cachedToString = describe(); + return m_cachedToString; + } + + MatcherUntypedBase::~MatcherUntypedBase() = default; + + } // namespace Impl +} // namespace Matchers + +using namespace Matchers; +using Matchers::Impl::MatcherBase; + +} // namespace Catch +// end catch_matchers.cpp +// start catch_matchers_floating.cpp + +// start catch_polyfills.hpp + +namespace Catch { + bool isnan(float f); + bool isnan(double d); +} + +// end catch_polyfills.hpp +// start catch_to_string.hpp + +#include <string> + +namespace Catch { + template <typename T> + std::string to_string(T const& t) { +#if defined(CATCH_CONFIG_CPP11_TO_STRING) + return std::to_string(t); +#else + ReusableStringStream rss; + rss << t; + return rss.str(); +#endif + } +} // end namespace Catch + +// end catch_to_string.hpp +#include <cstdlib> +#include <cstdint> +#include <cstring> +#include <sstream> +#include <iomanip> +#include <limits> + +namespace Catch { +namespace Matchers { +namespace Floating { +enum class FloatingPointKind : uint8_t { + Float, + Double +}; +} +} +} + +namespace { + +template <typename T> +struct Converter; + +template <> +struct Converter<float> { + static_assert(sizeof(float) == sizeof(int32_t), "Important ULP matcher assumption violated"); + Converter(float f) { + std::memcpy(&i, &f, sizeof(f)); + } + int32_t i; +}; + +template <> +struct Converter<double> { + static_assert(sizeof(double) == sizeof(int64_t), "Important ULP matcher assumption violated"); + Converter(double d) { + std::memcpy(&i, &d, sizeof(d)); + } + int64_t i; +}; + +template <typename T> +auto convert(T t) -> Converter<T> { + return Converter<T>(t); +} + +template <typename FP> +bool almostEqualUlps(FP lhs, FP rhs, int maxUlpDiff) { + // Comparison with NaN should always be false. + // This way we can rule it out before getting into the ugly details + if (Catch::isnan(lhs) || Catch::isnan(rhs)) { + return false; + } + + auto lc = convert(lhs); + auto rc = convert(rhs); + + if ((lc.i < 0) != (rc.i < 0)) { + // Potentially we can have +0 and -0 + return lhs == rhs; + } + + auto ulpDiff = std::abs(lc.i - rc.i); + return ulpDiff <= maxUlpDiff; +} + +template <typename FP> +FP step(FP start, FP direction, int steps) { + for (int i = 0; i < steps; ++i) { + start = std::nextafter(start, direction); + } + return start; +} + +} // end anonymous namespace + +namespace Catch { +namespace Matchers { +namespace Floating { + WithinAbsMatcher::WithinAbsMatcher(double target, double margin) + :m_target{ target }, m_margin{ margin } { + CATCH_ENFORCE(margin >= 0, "Invalid margin: " << margin << '.' + << " Margin has to be non-negative."); + } + + // Performs equivalent check of std::fabs(lhs - rhs) <= margin + // But without the subtraction to allow for INFINITY in comparison + bool WithinAbsMatcher::match(double const& matchee) const { + return (matchee + m_margin >= m_target) && (m_target + m_margin >= matchee); + } + + std::string WithinAbsMatcher::describe() const { + return "is within " + ::Catch::Detail::stringify(m_margin) + " of " + ::Catch::Detail::stringify(m_target); + } + + WithinUlpsMatcher::WithinUlpsMatcher(double target, int ulps, FloatingPointKind baseType) + :m_target{ target }, m_ulps{ ulps }, m_type{ baseType } { + CATCH_ENFORCE(ulps >= 0, "Invalid ULP setting: " << ulps << '.' + << " ULPs have to be non-negative."); + } + +#if defined(__clang__) +#pragma clang diagnostic push +// Clang <3.5 reports on the default branch in the switch below +#pragma clang diagnostic ignored "-Wunreachable-code" +#endif + + bool WithinUlpsMatcher::match(double const& matchee) const { + switch (m_type) { + case FloatingPointKind::Float: + return almostEqualUlps<float>(static_cast<float>(matchee), static_cast<float>(m_target), m_ulps); + case FloatingPointKind::Double: + return almostEqualUlps<double>(matchee, m_target, m_ulps); + default: + CATCH_INTERNAL_ERROR( "Unknown FloatingPointKind value" ); + } + } + +#if defined(__clang__) +#pragma clang diagnostic pop +#endif + + std::string WithinUlpsMatcher::describe() const { + std::stringstream ret; + + ret << "is within " << m_ulps << " ULPs of " << ::Catch::Detail::stringify(m_target); + + if (m_type == FloatingPointKind::Float) { + ret << 'f'; + } + + ret << " (["; + ret << std::fixed << std::setprecision(std::numeric_limits<double>::max_digits10); + if (m_type == FloatingPointKind::Double) { + ret << step(m_target, static_cast<double>(-INFINITY), m_ulps) + << ", " + << step(m_target, static_cast<double>(INFINITY), m_ulps); + } else { + ret << step<float>(static_cast<float>(m_target), -INFINITY, m_ulps) + << ", " + << step<float>(static_cast<float>(m_target), INFINITY, m_ulps); + } + ret << "])"; + + return ret.str(); + //return "is within " + Catch::to_string(m_ulps) + " ULPs of " + ::Catch::Detail::stringify(m_target) + ((m_type == FloatingPointKind::Float)? "f" : ""); + } + +}// namespace Floating + +Floating::WithinUlpsMatcher WithinULP(double target, int maxUlpDiff) { + return Floating::WithinUlpsMatcher(target, maxUlpDiff, Floating::FloatingPointKind::Double); +} + +Floating::WithinUlpsMatcher WithinULP(float target, int maxUlpDiff) { + return Floating::WithinUlpsMatcher(target, maxUlpDiff, Floating::FloatingPointKind::Float); +} + +Floating::WithinAbsMatcher WithinAbs(double target, double margin) { + return Floating::WithinAbsMatcher(target, margin); +} + +} // namespace Matchers +} // namespace Catch + +// end catch_matchers_floating.cpp +// start catch_matchers_generic.cpp + +std::string Catch::Matchers::Generic::Detail::finalizeDescription(const std::string& desc) { + if (desc.empty()) { + return "matches undescribed predicate"; + } else { + return "matches predicate: \"" + desc + '"'; + } +} +// end catch_matchers_generic.cpp +// start catch_matchers_string.cpp + +#include <regex> + +namespace Catch { +namespace Matchers { + + namespace StdString { + + CasedString::CasedString( std::string const& str, CaseSensitive::Choice caseSensitivity ) + : m_caseSensitivity( caseSensitivity ), + m_str( adjustString( str ) ) + {} + std::string CasedString::adjustString( std::string const& str ) const { + return m_caseSensitivity == CaseSensitive::No + ? toLower( str ) + : str; + } + std::string CasedString::caseSensitivitySuffix() const { + return m_caseSensitivity == CaseSensitive::No + ? " (case insensitive)" + : std::string(); + } + + StringMatcherBase::StringMatcherBase( std::string const& operation, CasedString const& comparator ) + : m_comparator( comparator ), + m_operation( operation ) { + } + + std::string StringMatcherBase::describe() const { + std::string description; + description.reserve(5 + m_operation.size() + m_comparator.m_str.size() + + m_comparator.caseSensitivitySuffix().size()); + description += m_operation; + description += ": \""; + description += m_comparator.m_str; + description += "\""; + description += m_comparator.caseSensitivitySuffix(); + return description; + } + + EqualsMatcher::EqualsMatcher( CasedString const& comparator ) : StringMatcherBase( "equals", comparator ) {} + + bool EqualsMatcher::match( std::string const& source ) const { + return m_comparator.adjustString( source ) == m_comparator.m_str; + } + + ContainsMatcher::ContainsMatcher( CasedString const& comparator ) : StringMatcherBase( "contains", comparator ) {} + + bool ContainsMatcher::match( std::string const& source ) const { + return contains( m_comparator.adjustString( source ), m_comparator.m_str ); + } + + StartsWithMatcher::StartsWithMatcher( CasedString const& comparator ) : StringMatcherBase( "starts with", comparator ) {} + + bool StartsWithMatcher::match( std::string const& source ) const { + return startsWith( m_comparator.adjustString( source ), m_comparator.m_str ); + } + + EndsWithMatcher::EndsWithMatcher( CasedString const& comparator ) : StringMatcherBase( "ends with", comparator ) {} + + bool EndsWithMatcher::match( std::string const& source ) const { + return endsWith( m_comparator.adjustString( source ), m_comparator.m_str ); + } + + RegexMatcher::RegexMatcher(std::string regex, CaseSensitive::Choice caseSensitivity): m_regex(std::move(regex)), m_caseSensitivity(caseSensitivity) {} + + bool RegexMatcher::match(std::string const& matchee) const { + auto flags = std::regex::ECMAScript; // ECMAScript is the default syntax option anyway + if (m_caseSensitivity == CaseSensitive::Choice::No) { + flags |= std::regex::icase; + } + auto reg = std::regex(m_regex, flags); + return std::regex_match(matchee, reg); + } + + std::string RegexMatcher::describe() const { + return "matches " + ::Catch::Detail::stringify(m_regex) + ((m_caseSensitivity == CaseSensitive::Choice::Yes)? " case sensitively" : " case insensitively"); + } + + } // namespace StdString + + StdString::EqualsMatcher Equals( std::string const& str, CaseSensitive::Choice caseSensitivity ) { + return StdString::EqualsMatcher( StdString::CasedString( str, caseSensitivity) ); + } + StdString::ContainsMatcher Contains( std::string const& str, CaseSensitive::Choice caseSensitivity ) { + return StdString::ContainsMatcher( StdString::CasedString( str, caseSensitivity) ); + } + StdString::EndsWithMatcher EndsWith( std::string const& str, CaseSensitive::Choice caseSensitivity ) { + return StdString::EndsWithMatcher( StdString::CasedString( str, caseSensitivity) ); + } + StdString::StartsWithMatcher StartsWith( std::string const& str, CaseSensitive::Choice caseSensitivity ) { + return StdString::StartsWithMatcher( StdString::CasedString( str, caseSensitivity) ); + } + + StdString::RegexMatcher Matches(std::string const& regex, CaseSensitive::Choice caseSensitivity) { + return StdString::RegexMatcher(regex, caseSensitivity); + } + +} // namespace Matchers +} // namespace Catch +// end catch_matchers_string.cpp +// start catch_message.cpp + +// start catch_uncaught_exceptions.h + +namespace Catch { + bool uncaught_exceptions(); +} // end namespace Catch + +// end catch_uncaught_exceptions.h +#include <cassert> +#include <stack> + +namespace Catch { + + MessageInfo::MessageInfo( StringRef const& _macroName, + SourceLineInfo const& _lineInfo, + ResultWas::OfType _type ) + : macroName( _macroName ), + lineInfo( _lineInfo ), + type( _type ), + sequence( ++globalCount ) + {} + + bool MessageInfo::operator==( MessageInfo const& other ) const { + return sequence == other.sequence; + } + + bool MessageInfo::operator<( MessageInfo const& other ) const { + return sequence < other.sequence; + } + + // This may need protecting if threading support is added + unsigned int MessageInfo::globalCount = 0; + + //////////////////////////////////////////////////////////////////////////// + + Catch::MessageBuilder::MessageBuilder( StringRef const& macroName, + SourceLineInfo const& lineInfo, + ResultWas::OfType type ) + :m_info(macroName, lineInfo, type) {} + + //////////////////////////////////////////////////////////////////////////// + + ScopedMessage::ScopedMessage( MessageBuilder const& builder ) + : m_info( builder.m_info ), m_moved() + { + m_info.message = builder.m_stream.str(); + getResultCapture().pushScopedMessage( m_info ); + } + + ScopedMessage::ScopedMessage( ScopedMessage&& old ) + : m_info( old.m_info ), m_moved() + { + old.m_moved = true; + } + + ScopedMessage::~ScopedMessage() { + if ( !uncaught_exceptions() && !m_moved ){ + getResultCapture().popScopedMessage(m_info); + } + } + + Capturer::Capturer( StringRef macroName, SourceLineInfo const& lineInfo, ResultWas::OfType resultType, StringRef names ) { + auto trimmed = [&] (size_t start, size_t end) { + while (names[start] == ',' || isspace(names[start])) { + ++start; + } + while (names[end] == ',' || isspace(names[end])) { + --end; + } + return names.substr(start, end - start + 1); + }; + auto skipq = [&] (size_t start, char quote) { + for (auto i = start + 1; i < names.size() ; ++i) { + if (names[i] == quote) + return i; + if (names[i] == '\\') + ++i; + } + CATCH_INTERNAL_ERROR("CAPTURE parsing encountered unmatched quote"); + }; + + size_t start = 0; + std::stack<char> openings; + for (size_t pos = 0; pos < names.size(); ++pos) { + char c = names[pos]; + switch (c) { + case '[': + case '{': + case '(': + // It is basically impossible to disambiguate between + // comparison and start of template args in this context +// case '<': + openings.push(c); + break; + case ']': + case '}': + case ')': +// case '>': + openings.pop(); + break; + case '"': + case '\'': + pos = skipq(pos, c); + break; + case ',': + if (start != pos && openings.size() == 0) { + m_messages.emplace_back(macroName, lineInfo, resultType); + m_messages.back().message = trimmed(start, pos); + m_messages.back().message += " := "; + start = pos; + } + } + } + assert(openings.size() == 0 && "Mismatched openings"); + m_messages.emplace_back(macroName, lineInfo, resultType); + m_messages.back().message = trimmed(start, names.size() - 1); + m_messages.back().message += " := "; + } + Capturer::~Capturer() { + if ( !uncaught_exceptions() ){ + assert( m_captured == m_messages.size() ); + for( size_t i = 0; i < m_captured; ++i ) + m_resultCapture.popScopedMessage( m_messages[i] ); + } + } + + void Capturer::captureValue( size_t index, std::string const& value ) { + assert( index < m_messages.size() ); + m_messages[index].message += value; + m_resultCapture.pushScopedMessage( m_messages[index] ); + m_captured++; + } + +} // end namespace Catch +// end catch_message.cpp +// start catch_output_redirect.cpp + +// start catch_output_redirect.h +#ifndef TWOBLUECUBES_CATCH_OUTPUT_REDIRECT_H +#define TWOBLUECUBES_CATCH_OUTPUT_REDIRECT_H + +#include <cstdio> +#include <iosfwd> +#include <string> + +namespace Catch { + + class RedirectedStream { + std::ostream& m_originalStream; + std::ostream& m_redirectionStream; + std::streambuf* m_prevBuf; + + public: + RedirectedStream( std::ostream& originalStream, std::ostream& redirectionStream ); + ~RedirectedStream(); + }; + + class RedirectedStdOut { + ReusableStringStream m_rss; + RedirectedStream m_cout; + public: + RedirectedStdOut(); + auto str() const -> std::string; + }; + + // StdErr has two constituent streams in C++, std::cerr and std::clog + // This means that we need to redirect 2 streams into 1 to keep proper + // order of writes + class RedirectedStdErr { + ReusableStringStream m_rss; + RedirectedStream m_cerr; + RedirectedStream m_clog; + public: + RedirectedStdErr(); + auto str() const -> std::string; + }; + + class RedirectedStreams { + public: + RedirectedStreams(RedirectedStreams const&) = delete; + RedirectedStreams& operator=(RedirectedStreams const&) = delete; + RedirectedStreams(RedirectedStreams&&) = delete; + RedirectedStreams& operator=(RedirectedStreams&&) = delete; + + RedirectedStreams(std::string& redirectedCout, std::string& redirectedCerr); + ~RedirectedStreams(); + private: + std::string& m_redirectedCout; + std::string& m_redirectedCerr; + RedirectedStdOut m_redirectedStdOut; + RedirectedStdErr m_redirectedStdErr; + }; + +#if defined(CATCH_CONFIG_NEW_CAPTURE) + + // Windows's implementation of std::tmpfile is terrible (it tries + // to create a file inside system folder, thus requiring elevated + // privileges for the binary), so we have to use tmpnam(_s) and + // create the file ourselves there. + class TempFile { + public: + TempFile(TempFile const&) = delete; + TempFile& operator=(TempFile const&) = delete; + TempFile(TempFile&&) = delete; + TempFile& operator=(TempFile&&) = delete; + + TempFile(); + ~TempFile(); + + std::FILE* getFile(); + std::string getContents(); + + private: + std::FILE* m_file = nullptr; + #if defined(_MSC_VER) + char m_buffer[L_tmpnam] = { 0 }; + #endif + }; + + class OutputRedirect { + public: + OutputRedirect(OutputRedirect const&) = delete; + OutputRedirect& operator=(OutputRedirect const&) = delete; + OutputRedirect(OutputRedirect&&) = delete; + OutputRedirect& operator=(OutputRedirect&&) = delete; + + OutputRedirect(std::string& stdout_dest, std::string& stderr_dest); + ~OutputRedirect(); + + private: + int m_originalStdout = -1; + int m_originalStderr = -1; + TempFile m_stdoutFile; + TempFile m_stderrFile; + std::string& m_stdoutDest; + std::string& m_stderrDest; + }; + +#endif + +} // end namespace Catch + +#endif // TWOBLUECUBES_CATCH_OUTPUT_REDIRECT_H +// end catch_output_redirect.h +#include <cstdio> +#include <cstring> +#include <fstream> +#include <sstream> +#include <stdexcept> + +#if defined(CATCH_CONFIG_NEW_CAPTURE) + #if defined(_MSC_VER) + #include <io.h> //_dup and _dup2 + #define dup _dup + #define dup2 _dup2 + #define fileno _fileno + #else + #include <unistd.h> // dup and dup2 + #endif +#endif + +namespace Catch { + + RedirectedStream::RedirectedStream( std::ostream& originalStream, std::ostream& redirectionStream ) + : m_originalStream( originalStream ), + m_redirectionStream( redirectionStream ), + m_prevBuf( m_originalStream.rdbuf() ) + { + m_originalStream.rdbuf( m_redirectionStream.rdbuf() ); + } + + RedirectedStream::~RedirectedStream() { + m_originalStream.rdbuf( m_prevBuf ); + } + + RedirectedStdOut::RedirectedStdOut() : m_cout( Catch::cout(), m_rss.get() ) {} + auto RedirectedStdOut::str() const -> std::string { return m_rss.str(); } + + RedirectedStdErr::RedirectedStdErr() + : m_cerr( Catch::cerr(), m_rss.get() ), + m_clog( Catch::clog(), m_rss.get() ) + {} + auto RedirectedStdErr::str() const -> std::string { return m_rss.str(); } + + RedirectedStreams::RedirectedStreams(std::string& redirectedCout, std::string& redirectedCerr) + : m_redirectedCout(redirectedCout), + m_redirectedCerr(redirectedCerr) + {} + + RedirectedStreams::~RedirectedStreams() { + m_redirectedCout += m_redirectedStdOut.str(); + m_redirectedCerr += m_redirectedStdErr.str(); + } + +#if defined(CATCH_CONFIG_NEW_CAPTURE) + +#if defined(_MSC_VER) + TempFile::TempFile() { + if (tmpnam_s(m_buffer)) { + CATCH_RUNTIME_ERROR("Could not get a temp filename"); + } + if (fopen_s(&m_file, m_buffer, "w")) { + char buffer[100]; + if (strerror_s(buffer, errno)) { + CATCH_RUNTIME_ERROR("Could not translate errno to a string"); + } + CATCH_RUNTIME_ERROR("Could not open the temp file: '" << m_buffer << "' because: " << buffer); + } + } +#else + TempFile::TempFile() { + m_file = std::tmpfile(); + if (!m_file) { + CATCH_RUNTIME_ERROR("Could not create a temp file."); + } + } + +#endif + + TempFile::~TempFile() { + // TBD: What to do about errors here? + std::fclose(m_file); + // We manually create the file on Windows only, on Linux + // it will be autodeleted +#if defined(_MSC_VER) + std::remove(m_buffer); +#endif + } + + FILE* TempFile::getFile() { + return m_file; + } + + std::string TempFile::getContents() { + std::stringstream sstr; + char buffer[100] = {}; + std::rewind(m_file); + while (std::fgets(buffer, sizeof(buffer), m_file)) { + sstr << buffer; + } + return sstr.str(); + } + + OutputRedirect::OutputRedirect(std::string& stdout_dest, std::string& stderr_dest) : + m_originalStdout(dup(1)), + m_originalStderr(dup(2)), + m_stdoutDest(stdout_dest), + m_stderrDest(stderr_dest) { + dup2(fileno(m_stdoutFile.getFile()), 1); + dup2(fileno(m_stderrFile.getFile()), 2); + } + + OutputRedirect::~OutputRedirect() { + Catch::cout() << std::flush; + fflush(stdout); + // Since we support overriding these streams, we flush cerr + // even though std::cerr is unbuffered + Catch::cerr() << std::flush; + Catch::clog() << std::flush; + fflush(stderr); + + dup2(m_originalStdout, 1); + dup2(m_originalStderr, 2); + + m_stdoutDest += m_stdoutFile.getContents(); + m_stderrDest += m_stderrFile.getContents(); + } + +#endif // CATCH_CONFIG_NEW_CAPTURE + +} // namespace Catch + +#if defined(CATCH_CONFIG_NEW_CAPTURE) + #if defined(_MSC_VER) + #undef dup + #undef dup2 + #undef fileno + #endif +#endif +// end catch_output_redirect.cpp +// start catch_polyfills.cpp + +#include <cmath> + +namespace Catch { + +#if !defined(CATCH_CONFIG_POLYFILL_ISNAN) + bool isnan(float f) { + return std::isnan(f); + } + bool isnan(double d) { + return std::isnan(d); + } +#else + // For now we only use this for embarcadero + bool isnan(float f) { + return std::_isnan(f); + } + bool isnan(double d) { + return std::_isnan(d); + } +#endif + +} // end namespace Catch +// end catch_polyfills.cpp +// start catch_random_number_generator.cpp + +namespace Catch { + + std::mt19937& rng() { + static std::mt19937 s_rng; + return s_rng; + } + + void seedRng( IConfig const& config ) { + if( config.rngSeed() != 0 ) { + std::srand( config.rngSeed() ); + rng().seed( config.rngSeed() ); + } + } + + unsigned int rngSeed() { + return getCurrentContext().getConfig()->rngSeed(); + } +} +// end catch_random_number_generator.cpp +// start catch_registry_hub.cpp + +// start catch_test_case_registry_impl.h + +#include <vector> +#include <set> +#include <algorithm> +#include <ios> + +namespace Catch { + + class TestCase; + struct IConfig; + + std::vector<TestCase> sortTests( IConfig const& config, std::vector<TestCase> const& unsortedTestCases ); + bool matchTest( TestCase const& testCase, TestSpec const& testSpec, IConfig const& config ); + + void enforceNoDuplicateTestCases( std::vector<TestCase> const& functions ); + + std::vector<TestCase> filterTests( std::vector<TestCase> const& testCases, TestSpec const& testSpec, IConfig const& config ); + std::vector<TestCase> const& getAllTestCasesSorted( IConfig const& config ); + + class TestRegistry : public ITestCaseRegistry { + public: + virtual ~TestRegistry() = default; + + virtual void registerTest( TestCase const& testCase ); + + std::vector<TestCase> const& getAllTests() const override; + std::vector<TestCase> const& getAllTestsSorted( IConfig const& config ) const override; + + private: + std::vector<TestCase> m_functions; + mutable RunTests::InWhatOrder m_currentSortOrder = RunTests::InDeclarationOrder; + mutable std::vector<TestCase> m_sortedFunctions; + std::size_t m_unnamedCount = 0; + std::ios_base::Init m_ostreamInit; // Forces cout/ cerr to be initialised + }; + + /////////////////////////////////////////////////////////////////////////// + + class TestInvokerAsFunction : public ITestInvoker { + void(*m_testAsFunction)(); + public: + TestInvokerAsFunction( void(*testAsFunction)() ) noexcept; + + void invoke() const override; + }; + + std::string extractClassName( StringRef const& classOrQualifiedMethodName ); + + /////////////////////////////////////////////////////////////////////////// + +} // end namespace Catch + +// end catch_test_case_registry_impl.h +// start catch_reporter_registry.h + +#include <map> + +namespace Catch { + + class ReporterRegistry : public IReporterRegistry { + + public: + + ~ReporterRegistry() override; + + IStreamingReporterPtr create( std::string const& name, IConfigPtr const& config ) const override; + + void registerReporter( std::string const& name, IReporterFactoryPtr const& factory ); + void registerListener( IReporterFactoryPtr const& factory ); + + FactoryMap const& getFactories() const override; + Listeners const& getListeners() const override; + + private: + FactoryMap m_factories; + Listeners m_listeners; + }; +} + +// end catch_reporter_registry.h +// start catch_tag_alias_registry.h + +// start catch_tag_alias.h + +#include <string> + +namespace Catch { + + struct TagAlias { + TagAlias(std::string const& _tag, SourceLineInfo _lineInfo); + + std::string tag; + SourceLineInfo lineInfo; + }; + +} // end namespace Catch + +// end catch_tag_alias.h +#include <map> + +namespace Catch { + + class TagAliasRegistry : public ITagAliasRegistry { + public: + ~TagAliasRegistry() override; + TagAlias const* find( std::string const& alias ) const override; + std::string expandAliases( std::string const& unexpandedTestSpec ) const override; + void add( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ); + + private: + std::map<std::string, TagAlias> m_registry; + }; + +} // end namespace Catch + +// end catch_tag_alias_registry.h +// start catch_startup_exception_registry.h + +#include <vector> +#include <exception> + +namespace Catch { + + class StartupExceptionRegistry { + public: + void add(std::exception_ptr const& exception) noexcept; + std::vector<std::exception_ptr> const& getExceptions() const noexcept; + private: + std::vector<std::exception_ptr> m_exceptions; + }; + +} // end namespace Catch + +// end catch_startup_exception_registry.h +// start catch_singletons.hpp + +namespace Catch { + + struct ISingleton { + virtual ~ISingleton(); + }; + + void addSingleton( ISingleton* singleton ); + void cleanupSingletons(); + + template<typename SingletonImplT, typename InterfaceT = SingletonImplT, typename MutableInterfaceT = InterfaceT> + class Singleton : SingletonImplT, public ISingleton { + + static auto getInternal() -> Singleton* { + static Singleton* s_instance = nullptr; + if( !s_instance ) { + s_instance = new Singleton; + addSingleton( s_instance ); + } + return s_instance; + } + + public: + static auto get() -> InterfaceT const& { + return *getInternal(); + } + static auto getMutable() -> MutableInterfaceT& { + return *getInternal(); + } + }; + +} // namespace Catch + +// end catch_singletons.hpp +namespace Catch { + + namespace { + + class RegistryHub : public IRegistryHub, public IMutableRegistryHub, + private NonCopyable { + + public: // IRegistryHub + RegistryHub() = default; + IReporterRegistry const& getReporterRegistry() const override { + return m_reporterRegistry; + } + ITestCaseRegistry const& getTestCaseRegistry() const override { + return m_testCaseRegistry; + } + IExceptionTranslatorRegistry const& getExceptionTranslatorRegistry() const override { + return m_exceptionTranslatorRegistry; + } + ITagAliasRegistry const& getTagAliasRegistry() const override { + return m_tagAliasRegistry; + } + StartupExceptionRegistry const& getStartupExceptionRegistry() const override { + return m_exceptionRegistry; + } + + public: // IMutableRegistryHub + void registerReporter( std::string const& name, IReporterFactoryPtr const& factory ) override { + m_reporterRegistry.registerReporter( name, factory ); + } + void registerListener( IReporterFactoryPtr const& factory ) override { + m_reporterRegistry.registerListener( factory ); + } + void registerTest( TestCase const& testInfo ) override { + m_testCaseRegistry.registerTest( testInfo ); + } + void registerTranslator( const IExceptionTranslator* translator ) override { + m_exceptionTranslatorRegistry.registerTranslator( translator ); + } + void registerTagAlias( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ) override { + m_tagAliasRegistry.add( alias, tag, lineInfo ); + } + void registerStartupException() noexcept override { + m_exceptionRegistry.add(std::current_exception()); + } + IMutableEnumValuesRegistry& getMutableEnumValuesRegistry() override { + return m_enumValuesRegistry; + } + + private: + TestRegistry m_testCaseRegistry; + ReporterRegistry m_reporterRegistry; + ExceptionTranslatorRegistry m_exceptionTranslatorRegistry; + TagAliasRegistry m_tagAliasRegistry; + StartupExceptionRegistry m_exceptionRegistry; + Detail::EnumValuesRegistry m_enumValuesRegistry; + }; + } + + using RegistryHubSingleton = Singleton<RegistryHub, IRegistryHub, IMutableRegistryHub>; + + IRegistryHub const& getRegistryHub() { + return RegistryHubSingleton::get(); + } + IMutableRegistryHub& getMutableRegistryHub() { + return RegistryHubSingleton::getMutable(); + } + void cleanUp() { + cleanupSingletons(); + cleanUpContext(); + } + std::string translateActiveException() { + return getRegistryHub().getExceptionTranslatorRegistry().translateActiveException(); + } + +} // end namespace Catch +// end catch_registry_hub.cpp +// start catch_reporter_registry.cpp + +namespace Catch { + + ReporterRegistry::~ReporterRegistry() = default; + + IStreamingReporterPtr ReporterRegistry::create( std::string const& name, IConfigPtr const& config ) const { + auto it = m_factories.find( name ); + if( it == m_factories.end() ) + return nullptr; + return it->second->create( ReporterConfig( config ) ); + } + + void ReporterRegistry::registerReporter( std::string const& name, IReporterFactoryPtr const& factory ) { + m_factories.emplace(name, factory); + } + void ReporterRegistry::registerListener( IReporterFactoryPtr const& factory ) { + m_listeners.push_back( factory ); + } + + IReporterRegistry::FactoryMap const& ReporterRegistry::getFactories() const { + return m_factories; + } + IReporterRegistry::Listeners const& ReporterRegistry::getListeners() const { + return m_listeners; + } + +} +// end catch_reporter_registry.cpp +// start catch_result_type.cpp + +namespace Catch { + + bool isOk( ResultWas::OfType resultType ) { + return ( resultType & ResultWas::FailureBit ) == 0; + } + bool isJustInfo( int flags ) { + return flags == ResultWas::Info; + } + + ResultDisposition::Flags operator | ( ResultDisposition::Flags lhs, ResultDisposition::Flags rhs ) { + return static_cast<ResultDisposition::Flags>( static_cast<int>( lhs ) | static_cast<int>( rhs ) ); + } + + bool shouldContinueOnFailure( int flags ) { return ( flags & ResultDisposition::ContinueOnFailure ) != 0; } + bool shouldSuppressFailure( int flags ) { return ( flags & ResultDisposition::SuppressFail ) != 0; } + +} // end namespace Catch +// end catch_result_type.cpp +// start catch_run_context.cpp + +#include <cassert> +#include <algorithm> +#include <sstream> + +namespace Catch { + + namespace Generators { + struct GeneratorTracker : TestCaseTracking::TrackerBase, IGeneratorTracker { + GeneratorBasePtr m_generator; + + GeneratorTracker( TestCaseTracking::NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent ) + : TrackerBase( nameAndLocation, ctx, parent ) + {} + ~GeneratorTracker(); + + static GeneratorTracker& acquire( TrackerContext& ctx, TestCaseTracking::NameAndLocation const& nameAndLocation ) { + std::shared_ptr<GeneratorTracker> tracker; + + ITracker& currentTracker = ctx.currentTracker(); + if( TestCaseTracking::ITrackerPtr childTracker = currentTracker.findChild( nameAndLocation ) ) { + assert( childTracker ); + assert( childTracker->isGeneratorTracker() ); + tracker = std::static_pointer_cast<GeneratorTracker>( childTracker ); + } + else { + tracker = std::make_shared<GeneratorTracker>( nameAndLocation, ctx, ¤tTracker ); + currentTracker.addChild( tracker ); + } + + if( !ctx.completedCycle() && !tracker->isComplete() ) { + tracker->open(); + } + + return *tracker; + } + + // TrackerBase interface + bool isGeneratorTracker() const override { return true; } + auto hasGenerator() const -> bool override { + return !!m_generator; + } + void close() override { + TrackerBase::close(); + // Generator interface only finds out if it has another item on atual move + if (m_runState == CompletedSuccessfully && m_generator->next()) { + m_children.clear(); + m_runState = Executing; + } + } + + // IGeneratorTracker interface + auto getGenerator() const -> GeneratorBasePtr const& override { + return m_generator; + } + void setGenerator( GeneratorBasePtr&& generator ) override { + m_generator = std::move( generator ); + } + }; + GeneratorTracker::~GeneratorTracker() {} + } + + RunContext::RunContext(IConfigPtr const& _config, IStreamingReporterPtr&& reporter) + : m_runInfo(_config->name()), + m_context(getCurrentMutableContext()), + m_config(_config), + m_reporter(std::move(reporter)), + m_lastAssertionInfo{ StringRef(), SourceLineInfo("",0), StringRef(), ResultDisposition::Normal }, + m_includeSuccessfulResults( m_config->includeSuccessfulResults() || m_reporter->getPreferences().shouldReportAllAssertions ) + { + m_context.setRunner(this); + m_context.setConfig(m_config); + m_context.setResultCapture(this); + m_reporter->testRunStarting(m_runInfo); + } + + RunContext::~RunContext() { + m_reporter->testRunEnded(TestRunStats(m_runInfo, m_totals, aborting())); + } + + void RunContext::testGroupStarting(std::string const& testSpec, std::size_t groupIndex, std::size_t groupsCount) { + m_reporter->testGroupStarting(GroupInfo(testSpec, groupIndex, groupsCount)); + } + + void RunContext::testGroupEnded(std::string const& testSpec, Totals const& totals, std::size_t groupIndex, std::size_t groupsCount) { + m_reporter->testGroupEnded(TestGroupStats(GroupInfo(testSpec, groupIndex, groupsCount), totals, aborting())); + } + + Totals RunContext::runTest(TestCase const& testCase) { + Totals prevTotals = m_totals; + + std::string redirectedCout; + std::string redirectedCerr; + + auto const& testInfo = testCase.getTestCaseInfo(); + + m_reporter->testCaseStarting(testInfo); + + m_activeTestCase = &testCase; + + ITracker& rootTracker = m_trackerContext.startRun(); + assert(rootTracker.isSectionTracker()); + static_cast<SectionTracker&>(rootTracker).addInitialFilters(m_config->getSectionsToRun()); + do { + m_trackerContext.startCycle(); + m_testCaseTracker = &SectionTracker::acquire(m_trackerContext, TestCaseTracking::NameAndLocation(testInfo.name, testInfo.lineInfo)); + runCurrentTest(redirectedCout, redirectedCerr); + } while (!m_testCaseTracker->isSuccessfullyCompleted() && !aborting()); + + Totals deltaTotals = m_totals.delta(prevTotals); + if (testInfo.expectedToFail() && deltaTotals.testCases.passed > 0) { + deltaTotals.assertions.failed++; + deltaTotals.testCases.passed--; + deltaTotals.testCases.failed++; + } + m_totals.testCases += deltaTotals.testCases; + m_reporter->testCaseEnded(TestCaseStats(testInfo, + deltaTotals, + redirectedCout, + redirectedCerr, + aborting())); + + m_activeTestCase = nullptr; + m_testCaseTracker = nullptr; + + return deltaTotals; + } + + IConfigPtr RunContext::config() const { + return m_config; + } + + IStreamingReporter& RunContext::reporter() const { + return *m_reporter; + } + + void RunContext::assertionEnded(AssertionResult const & result) { + if (result.getResultType() == ResultWas::Ok) { + m_totals.assertions.passed++; + m_lastAssertionPassed = true; + } else if (!result.isOk()) { + m_lastAssertionPassed = false; + if( m_activeTestCase->getTestCaseInfo().okToFail() ) + m_totals.assertions.failedButOk++; + else + m_totals.assertions.failed++; + } + else { + m_lastAssertionPassed = true; + } + + // We have no use for the return value (whether messages should be cleared), because messages were made scoped + // and should be let to clear themselves out. + static_cast<void>(m_reporter->assertionEnded(AssertionStats(result, m_messages, m_totals))); + + if (result.getResultType() != ResultWas::Warning) + m_messageScopes.clear(); + + // Reset working state + resetAssertionInfo(); + m_lastResult = result; + } + void RunContext::resetAssertionInfo() { + m_lastAssertionInfo.macroName = StringRef(); + m_lastAssertionInfo.capturedExpression = "{Unknown expression after the reported line}"_sr; + } + + bool RunContext::sectionStarted(SectionInfo const & sectionInfo, Counts & assertions) { + ITracker& sectionTracker = SectionTracker::acquire(m_trackerContext, TestCaseTracking::NameAndLocation(sectionInfo.name, sectionInfo.lineInfo)); + if (!sectionTracker.isOpen()) + return false; + m_activeSections.push_back(§ionTracker); + + m_lastAssertionInfo.lineInfo = sectionInfo.lineInfo; + + m_reporter->sectionStarting(sectionInfo); + + assertions = m_totals.assertions; + + return true; + } + auto RunContext::acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& { + using namespace Generators; + GeneratorTracker& tracker = GeneratorTracker::acquire( m_trackerContext, TestCaseTracking::NameAndLocation( "generator", lineInfo ) ); + assert( tracker.isOpen() ); + m_lastAssertionInfo.lineInfo = lineInfo; + return tracker; + } + + bool RunContext::testForMissingAssertions(Counts& assertions) { + if (assertions.total() != 0) + return false; + if (!m_config->warnAboutMissingAssertions()) + return false; + if (m_trackerContext.currentTracker().hasChildren()) + return false; + m_totals.assertions.failed++; + assertions.failed++; + return true; + } + + void RunContext::sectionEnded(SectionEndInfo const & endInfo) { + Counts assertions = m_totals.assertions - endInfo.prevAssertions; + bool missingAssertions = testForMissingAssertions(assertions); + + if (!m_activeSections.empty()) { + m_activeSections.back()->close(); + m_activeSections.pop_back(); + } + + m_reporter->sectionEnded(SectionStats(endInfo.sectionInfo, assertions, endInfo.durationInSeconds, missingAssertions)); + m_messages.clear(); + m_messageScopes.clear(); + } + + void RunContext::sectionEndedEarly(SectionEndInfo const & endInfo) { + if (m_unfinishedSections.empty()) + m_activeSections.back()->fail(); + else + m_activeSections.back()->close(); + m_activeSections.pop_back(); + + m_unfinishedSections.push_back(endInfo); + } + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + void RunContext::benchmarkPreparing(std::string const& name) { + m_reporter->benchmarkPreparing(name); + } + void RunContext::benchmarkStarting( BenchmarkInfo const& info ) { + m_reporter->benchmarkStarting( info ); + } + void RunContext::benchmarkEnded( BenchmarkStats<> const& stats ) { + m_reporter->benchmarkEnded( stats ); + } + void RunContext::benchmarkFailed(std::string const & error) { + m_reporter->benchmarkFailed(error); + } +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + void RunContext::pushScopedMessage(MessageInfo const & message) { + m_messages.push_back(message); + } + + void RunContext::popScopedMessage(MessageInfo const & message) { + m_messages.erase(std::remove(m_messages.begin(), m_messages.end(), message), m_messages.end()); + } + + void RunContext::emplaceUnscopedMessage( MessageBuilder const& builder ) { + m_messageScopes.emplace_back( builder ); + } + + std::string RunContext::getCurrentTestName() const { + return m_activeTestCase + ? m_activeTestCase->getTestCaseInfo().name + : std::string(); + } + + const AssertionResult * RunContext::getLastResult() const { + return &(*m_lastResult); + } + + void RunContext::exceptionEarlyReported() { + m_shouldReportUnexpected = false; + } + + void RunContext::handleFatalErrorCondition( StringRef message ) { + // First notify reporter that bad things happened + m_reporter->fatalErrorEncountered(message); + + // Don't rebuild the result -- the stringification itself can cause more fatal errors + // Instead, fake a result data. + AssertionResultData tempResult( ResultWas::FatalErrorCondition, { false } ); + tempResult.message = message; + AssertionResult result(m_lastAssertionInfo, tempResult); + + assertionEnded(result); + + handleUnfinishedSections(); + + // Recreate section for test case (as we will lose the one that was in scope) + auto const& testCaseInfo = m_activeTestCase->getTestCaseInfo(); + SectionInfo testCaseSection(testCaseInfo.lineInfo, testCaseInfo.name); + + Counts assertions; + assertions.failed = 1; + SectionStats testCaseSectionStats(testCaseSection, assertions, 0, false); + m_reporter->sectionEnded(testCaseSectionStats); + + auto const& testInfo = m_activeTestCase->getTestCaseInfo(); + + Totals deltaTotals; + deltaTotals.testCases.failed = 1; + deltaTotals.assertions.failed = 1; + m_reporter->testCaseEnded(TestCaseStats(testInfo, + deltaTotals, + std::string(), + std::string(), + false)); + m_totals.testCases.failed++; + testGroupEnded(std::string(), m_totals, 1, 1); + m_reporter->testRunEnded(TestRunStats(m_runInfo, m_totals, false)); + } + + bool RunContext::lastAssertionPassed() { + return m_lastAssertionPassed; + } + + void RunContext::assertionPassed() { + m_lastAssertionPassed = true; + ++m_totals.assertions.passed; + resetAssertionInfo(); + m_messageScopes.clear(); + } + + bool RunContext::aborting() const { + return m_totals.assertions.failed >= static_cast<std::size_t>(m_config->abortAfter()); + } + + void RunContext::runCurrentTest(std::string & redirectedCout, std::string & redirectedCerr) { + auto const& testCaseInfo = m_activeTestCase->getTestCaseInfo(); + SectionInfo testCaseSection(testCaseInfo.lineInfo, testCaseInfo.name); + m_reporter->sectionStarting(testCaseSection); + Counts prevAssertions = m_totals.assertions; + double duration = 0; + m_shouldReportUnexpected = true; + m_lastAssertionInfo = { "TEST_CASE"_sr, testCaseInfo.lineInfo, StringRef(), ResultDisposition::Normal }; + + seedRng(*m_config); + + Timer timer; + CATCH_TRY { + if (m_reporter->getPreferences().shouldRedirectStdOut) { +#if !defined(CATCH_CONFIG_EXPERIMENTAL_REDIRECT) + RedirectedStreams redirectedStreams(redirectedCout, redirectedCerr); + + timer.start(); + invokeActiveTestCase(); +#else + OutputRedirect r(redirectedCout, redirectedCerr); + timer.start(); + invokeActiveTestCase(); +#endif + } else { + timer.start(); + invokeActiveTestCase(); + } + duration = timer.getElapsedSeconds(); + } CATCH_CATCH_ANON (TestFailureException&) { + // This just means the test was aborted due to failure + } CATCH_CATCH_ALL { + // Under CATCH_CONFIG_FAST_COMPILE, unexpected exceptions under REQUIRE assertions + // are reported without translation at the point of origin. + if( m_shouldReportUnexpected ) { + AssertionReaction dummyReaction; + handleUnexpectedInflightException( m_lastAssertionInfo, translateActiveException(), dummyReaction ); + } + } + Counts assertions = m_totals.assertions - prevAssertions; + bool missingAssertions = testForMissingAssertions(assertions); + + m_testCaseTracker->close(); + handleUnfinishedSections(); + m_messages.clear(); + m_messageScopes.clear(); + + SectionStats testCaseSectionStats(testCaseSection, assertions, duration, missingAssertions); + m_reporter->sectionEnded(testCaseSectionStats); + } + + void RunContext::invokeActiveTestCase() { + FatalConditionHandler fatalConditionHandler; // Handle signals + m_activeTestCase->invoke(); + fatalConditionHandler.reset(); + } + + void RunContext::handleUnfinishedSections() { + // If sections ended prematurely due to an exception we stored their + // infos here so we can tear them down outside the unwind process. + for (auto it = m_unfinishedSections.rbegin(), + itEnd = m_unfinishedSections.rend(); + it != itEnd; + ++it) + sectionEnded(*it); + m_unfinishedSections.clear(); + } + + void RunContext::handleExpr( + AssertionInfo const& info, + ITransientExpression const& expr, + AssertionReaction& reaction + ) { + m_reporter->assertionStarting( info ); + + bool negated = isFalseTest( info.resultDisposition ); + bool result = expr.getResult() != negated; + + if( result ) { + if (!m_includeSuccessfulResults) { + assertionPassed(); + } + else { + reportExpr(info, ResultWas::Ok, &expr, negated); + } + } + else { + reportExpr(info, ResultWas::ExpressionFailed, &expr, negated ); + populateReaction( reaction ); + } + } + void RunContext::reportExpr( + AssertionInfo const &info, + ResultWas::OfType resultType, + ITransientExpression const *expr, + bool negated ) { + + m_lastAssertionInfo = info; + AssertionResultData data( resultType, LazyExpression( negated ) ); + + AssertionResult assertionResult{ info, data }; + assertionResult.m_resultData.lazyExpression.m_transientExpression = expr; + + assertionEnded( assertionResult ); + } + + void RunContext::handleMessage( + AssertionInfo const& info, + ResultWas::OfType resultType, + StringRef const& message, + AssertionReaction& reaction + ) { + m_reporter->assertionStarting( info ); + + m_lastAssertionInfo = info; + + AssertionResultData data( resultType, LazyExpression( false ) ); + data.message = message; + AssertionResult assertionResult{ m_lastAssertionInfo, data }; + assertionEnded( assertionResult ); + if( !assertionResult.isOk() ) + populateReaction( reaction ); + } + void RunContext::handleUnexpectedExceptionNotThrown( + AssertionInfo const& info, + AssertionReaction& reaction + ) { + handleNonExpr(info, Catch::ResultWas::DidntThrowException, reaction); + } + + void RunContext::handleUnexpectedInflightException( + AssertionInfo const& info, + std::string const& message, + AssertionReaction& reaction + ) { + m_lastAssertionInfo = info; + + AssertionResultData data( ResultWas::ThrewException, LazyExpression( false ) ); + data.message = message; + AssertionResult assertionResult{ info, data }; + assertionEnded( assertionResult ); + populateReaction( reaction ); + } + + void RunContext::populateReaction( AssertionReaction& reaction ) { + reaction.shouldDebugBreak = m_config->shouldDebugBreak(); + reaction.shouldThrow = aborting() || (m_lastAssertionInfo.resultDisposition & ResultDisposition::Normal); + } + + void RunContext::handleIncomplete( + AssertionInfo const& info + ) { + m_lastAssertionInfo = info; + + AssertionResultData data( ResultWas::ThrewException, LazyExpression( false ) ); + data.message = "Exception translation was disabled by CATCH_CONFIG_FAST_COMPILE"; + AssertionResult assertionResult{ info, data }; + assertionEnded( assertionResult ); + } + void RunContext::handleNonExpr( + AssertionInfo const &info, + ResultWas::OfType resultType, + AssertionReaction &reaction + ) { + m_lastAssertionInfo = info; + + AssertionResultData data( resultType, LazyExpression( false ) ); + AssertionResult assertionResult{ info, data }; + assertionEnded( assertionResult ); + + if( !assertionResult.isOk() ) + populateReaction( reaction ); + } + + IResultCapture& getResultCapture() { + if (auto* capture = getCurrentContext().getResultCapture()) + return *capture; + else + CATCH_INTERNAL_ERROR("No result capture instance"); + } +} +// end catch_run_context.cpp +// start catch_section.cpp + +namespace Catch { + + Section::Section( SectionInfo const& info ) + : m_info( info ), + m_sectionIncluded( getResultCapture().sectionStarted( m_info, m_assertions ) ) + { + m_timer.start(); + } + + Section::~Section() { + if( m_sectionIncluded ) { + SectionEndInfo endInfo{ m_info, m_assertions, m_timer.getElapsedSeconds() }; + if( uncaught_exceptions() ) + getResultCapture().sectionEndedEarly( endInfo ); + else + getResultCapture().sectionEnded( endInfo ); + } + } + + // This indicates whether the section should be executed or not + Section::operator bool() const { + return m_sectionIncluded; + } + +} // end namespace Catch +// end catch_section.cpp +// start catch_section_info.cpp + +namespace Catch { + + SectionInfo::SectionInfo + ( SourceLineInfo const& _lineInfo, + std::string const& _name ) + : name( _name ), + lineInfo( _lineInfo ) + {} + +} // end namespace Catch +// end catch_section_info.cpp +// start catch_session.cpp + +// start catch_session.h + +#include <memory> + +namespace Catch { + + class Session : NonCopyable { + public: + + Session(); + ~Session() override; + + void showHelp() const; + void libIdentify(); + + int applyCommandLine( int argc, char const * const * argv ); + #if defined(CATCH_CONFIG_WCHAR) && defined(WIN32) && defined(UNICODE) + int applyCommandLine( int argc, wchar_t const * const * argv ); + #endif + + void useConfigData( ConfigData const& configData ); + + template<typename CharT> + int run(int argc, CharT const * const argv[]) { + if (m_startupExceptions) + return 1; + int returnCode = applyCommandLine(argc, argv); + if (returnCode == 0) + returnCode = run(); + return returnCode; + } + + int run(); + + clara::Parser const& cli() const; + void cli( clara::Parser const& newParser ); + ConfigData& configData(); + Config& config(); + private: + int runInternal(); + + clara::Parser m_cli; + ConfigData m_configData; + std::shared_ptr<Config> m_config; + bool m_startupExceptions = false; + }; + +} // end namespace Catch + +// end catch_session.h +// start catch_version.h + +#include <iosfwd> + +namespace Catch { + + // Versioning information + struct Version { + Version( Version const& ) = delete; + Version& operator=( Version const& ) = delete; + Version( unsigned int _majorVersion, + unsigned int _minorVersion, + unsigned int _patchNumber, + char const * const _branchName, + unsigned int _buildNumber ); + + unsigned int const majorVersion; + unsigned int const minorVersion; + unsigned int const patchNumber; + + // buildNumber is only used if branchName is not null + char const * const branchName; + unsigned int const buildNumber; + + friend std::ostream& operator << ( std::ostream& os, Version const& version ); + }; + + Version const& libraryVersion(); +} + +// end catch_version.h +#include <cstdlib> +#include <iomanip> + +namespace Catch { + + namespace { + const int MaxExitCode = 255; + + IStreamingReporterPtr createReporter(std::string const& reporterName, IConfigPtr const& config) { + auto reporter = Catch::getRegistryHub().getReporterRegistry().create(reporterName, config); + CATCH_ENFORCE(reporter, "No reporter registered with name: '" << reporterName << "'"); + + return reporter; + } + + IStreamingReporterPtr makeReporter(std::shared_ptr<Config> const& config) { + if (Catch::getRegistryHub().getReporterRegistry().getListeners().empty()) { + return createReporter(config->getReporterName(), config); + } + + // On older platforms, returning std::unique_ptr<ListeningReporter> + // when the return type is std::unique_ptr<IStreamingReporter> + // doesn't compile without a std::move call. However, this causes + // a warning on newer platforms. Thus, we have to work around + // it a bit and downcast the pointer manually. + auto ret = std::unique_ptr<IStreamingReporter>(new ListeningReporter); + auto& multi = static_cast<ListeningReporter&>(*ret); + auto const& listeners = Catch::getRegistryHub().getReporterRegistry().getListeners(); + for (auto const& listener : listeners) { + multi.addListener(listener->create(Catch::ReporterConfig(config))); + } + multi.addReporter(createReporter(config->getReporterName(), config)); + return ret; + } + + Catch::Totals runTests(std::shared_ptr<Config> const& config) { + auto reporter = makeReporter(config); + + RunContext context(config, std::move(reporter)); + + Totals totals; + + context.testGroupStarting(config->name(), 1, 1); + + TestSpec testSpec = config->testSpec(); + + auto const& allTestCases = getAllTestCasesSorted(*config); + for (auto const& testCase : allTestCases) { + bool matching = (!testSpec.hasFilters() && !testCase.isHidden()) || + (testSpec.hasFilters() && matchTest(testCase, testSpec, *config)); + + if (!context.aborting() && matching) + totals += context.runTest(testCase); + else + context.reporter().skipTest(testCase); + } + + if (config->warnAboutNoTests() && totals.testCases.total() == 0) { + ReusableStringStream testConfig; + + bool first = true; + for (const auto& input : config->getTestsOrTags()) { + if (!first) { testConfig << ' '; } + first = false; + testConfig << input; + } + + context.reporter().noMatchingTestCases(testConfig.str()); + totals.error = -1; + } + + context.testGroupEnded(config->name(), totals, 1, 1); + return totals; + } + + void applyFilenamesAsTags(Catch::IConfig const& config) { + auto& tests = const_cast<std::vector<TestCase>&>(getAllTestCasesSorted(config)); + for (auto& testCase : tests) { + auto tags = testCase.tags; + + std::string filename = testCase.lineInfo.file; + auto lastSlash = filename.find_last_of("\\/"); + if (lastSlash != std::string::npos) { + filename.erase(0, lastSlash); + filename[0] = '#'; + } + + auto lastDot = filename.find_last_of('.'); + if (lastDot != std::string::npos) { + filename.erase(lastDot); + } + + tags.push_back(std::move(filename)); + setTags(testCase, tags); + } + } + + } // anon namespace + + Session::Session() { + static bool alreadyInstantiated = false; + if( alreadyInstantiated ) { + CATCH_TRY { CATCH_INTERNAL_ERROR( "Only one instance of Catch::Session can ever be used" ); } + CATCH_CATCH_ALL { getMutableRegistryHub().registerStartupException(); } + } + + // There cannot be exceptions at startup in no-exception mode. +#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) + const auto& exceptions = getRegistryHub().getStartupExceptionRegistry().getExceptions(); + if ( !exceptions.empty() ) { + config(); + getCurrentMutableContext().setConfig(m_config); + + m_startupExceptions = true; + Colour colourGuard( Colour::Red ); + Catch::cerr() << "Errors occurred during startup!" << '\n'; + // iterate over all exceptions and notify user + for ( const auto& ex_ptr : exceptions ) { + try { + std::rethrow_exception(ex_ptr); + } catch ( std::exception const& ex ) { + Catch::cerr() << Column( ex.what() ).indent(2) << '\n'; + } + } + } +#endif + + alreadyInstantiated = true; + m_cli = makeCommandLineParser( m_configData ); + } + Session::~Session() { + Catch::cleanUp(); + } + + void Session::showHelp() const { + Catch::cout() + << "\nCatch v" << libraryVersion() << "\n" + << m_cli << std::endl + << "For more detailed usage please see the project docs\n" << std::endl; + } + void Session::libIdentify() { + Catch::cout() + << std::left << std::setw(16) << "description: " << "A Catch test executable\n" + << std::left << std::setw(16) << "category: " << "testframework\n" + << std::left << std::setw(16) << "framework: " << "Catch Test\n" + << std::left << std::setw(16) << "version: " << libraryVersion() << std::endl; + } + + int Session::applyCommandLine( int argc, char const * const * argv ) { + if( m_startupExceptions ) + return 1; + + auto result = m_cli.parse( clara::Args( argc, argv ) ); + if( !result ) { + config(); + getCurrentMutableContext().setConfig(m_config); + Catch::cerr() + << Colour( Colour::Red ) + << "\nError(s) in input:\n" + << Column( result.errorMessage() ).indent( 2 ) + << "\n\n"; + Catch::cerr() << "Run with -? for usage\n" << std::endl; + return MaxExitCode; + } + + if( m_configData.showHelp ) + showHelp(); + if( m_configData.libIdentify ) + libIdentify(); + m_config.reset(); + return 0; + } + +#if defined(CATCH_CONFIG_WCHAR) && defined(WIN32) && defined(UNICODE) + int Session::applyCommandLine( int argc, wchar_t const * const * argv ) { + + char **utf8Argv = new char *[ argc ]; + + for ( int i = 0; i < argc; ++i ) { + int bufSize = WideCharToMultiByte( CP_UTF8, 0, argv[i], -1, NULL, 0, NULL, NULL ); + + utf8Argv[ i ] = new char[ bufSize ]; + + WideCharToMultiByte( CP_UTF8, 0, argv[i], -1, utf8Argv[i], bufSize, NULL, NULL ); + } + + int returnCode = applyCommandLine( argc, utf8Argv ); + + for ( int i = 0; i < argc; ++i ) + delete [] utf8Argv[ i ]; + + delete [] utf8Argv; + + return returnCode; + } +#endif + + void Session::useConfigData( ConfigData const& configData ) { + m_configData = configData; + m_config.reset(); + } + + int Session::run() { + if( ( m_configData.waitForKeypress & WaitForKeypress::BeforeStart ) != 0 ) { + Catch::cout() << "...waiting for enter/ return before starting" << std::endl; + static_cast<void>(std::getchar()); + } + int exitCode = runInternal(); + if( ( m_configData.waitForKeypress & WaitForKeypress::BeforeExit ) != 0 ) { + Catch::cout() << "...waiting for enter/ return before exiting, with code: " << exitCode << std::endl; + static_cast<void>(std::getchar()); + } + return exitCode; + } + + clara::Parser const& Session::cli() const { + return m_cli; + } + void Session::cli( clara::Parser const& newParser ) { + m_cli = newParser; + } + ConfigData& Session::configData() { + return m_configData; + } + Config& Session::config() { + if( !m_config ) + m_config = std::make_shared<Config>( m_configData ); + return *m_config; + } + + int Session::runInternal() { + if( m_startupExceptions ) + return 1; + + if (m_configData.showHelp || m_configData.libIdentify) { + return 0; + } + + CATCH_TRY { + config(); // Force config to be constructed + + seedRng( *m_config ); + + if( m_configData.filenamesAsTags ) + applyFilenamesAsTags( *m_config ); + + // Handle list request + if( Option<std::size_t> listed = list( m_config ) ) + return static_cast<int>( *listed ); + + auto totals = runTests( m_config ); + // Note that on unices only the lower 8 bits are usually used, clamping + // the return value to 255 prevents false negative when some multiple + // of 256 tests has failed + return (std::min) (MaxExitCode, (std::max) (totals.error, static_cast<int>(totals.assertions.failed))); + } +#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) + catch( std::exception& ex ) { + Catch::cerr() << ex.what() << std::endl; + return MaxExitCode; + } +#endif + } + +} // end namespace Catch +// end catch_session.cpp +// start catch_singletons.cpp + +#include <vector> + +namespace Catch { + + namespace { + static auto getSingletons() -> std::vector<ISingleton*>*& { + static std::vector<ISingleton*>* g_singletons = nullptr; + if( !g_singletons ) + g_singletons = new std::vector<ISingleton*>(); + return g_singletons; + } + } + + ISingleton::~ISingleton() {} + + void addSingleton(ISingleton* singleton ) { + getSingletons()->push_back( singleton ); + } + void cleanupSingletons() { + auto& singletons = getSingletons(); + for( auto singleton : *singletons ) + delete singleton; + delete singletons; + singletons = nullptr; + } + +} // namespace Catch +// end catch_singletons.cpp +// start catch_startup_exception_registry.cpp + +namespace Catch { +void StartupExceptionRegistry::add( std::exception_ptr const& exception ) noexcept { + CATCH_TRY { + m_exceptions.push_back(exception); + } CATCH_CATCH_ALL { + // If we run out of memory during start-up there's really not a lot more we can do about it + std::terminate(); + } + } + + std::vector<std::exception_ptr> const& StartupExceptionRegistry::getExceptions() const noexcept { + return m_exceptions; + } + +} // end namespace Catch +// end catch_startup_exception_registry.cpp +// start catch_stream.cpp + +#include <cstdio> +#include <iostream> +#include <fstream> +#include <sstream> +#include <vector> +#include <memory> + +namespace Catch { + + Catch::IStream::~IStream() = default; + + namespace Detail { namespace { + template<typename WriterF, std::size_t bufferSize=256> + class StreamBufImpl : public std::streambuf { + char data[bufferSize]; + WriterF m_writer; + + public: + StreamBufImpl() { + setp( data, data + sizeof(data) ); + } + + ~StreamBufImpl() noexcept { + StreamBufImpl::sync(); + } + + private: + int overflow( int c ) override { + sync(); + + if( c != EOF ) { + if( pbase() == epptr() ) + m_writer( std::string( 1, static_cast<char>( c ) ) ); + else + sputc( static_cast<char>( c ) ); + } + return 0; + } + + int sync() override { + if( pbase() != pptr() ) { + m_writer( std::string( pbase(), static_cast<std::string::size_type>( pptr() - pbase() ) ) ); + setp( pbase(), epptr() ); + } + return 0; + } + }; + + /////////////////////////////////////////////////////////////////////////// + + struct OutputDebugWriter { + + void operator()( std::string const&str ) { + writeToDebugConsole( str ); + } + }; + + /////////////////////////////////////////////////////////////////////////// + + class FileStream : public IStream { + mutable std::ofstream m_ofs; + public: + FileStream( StringRef filename ) { + m_ofs.open( filename.c_str() ); + CATCH_ENFORCE( !m_ofs.fail(), "Unable to open file: '" << filename << "'" ); + } + ~FileStream() override = default; + public: // IStream + std::ostream& stream() const override { + return m_ofs; + } + }; + + /////////////////////////////////////////////////////////////////////////// + + class CoutStream : public IStream { + mutable std::ostream m_os; + public: + // Store the streambuf from cout up-front because + // cout may get redirected when running tests + CoutStream() : m_os( Catch::cout().rdbuf() ) {} + ~CoutStream() override = default; + + public: // IStream + std::ostream& stream() const override { return m_os; } + }; + + /////////////////////////////////////////////////////////////////////////// + + class DebugOutStream : public IStream { + std::unique_ptr<StreamBufImpl<OutputDebugWriter>> m_streamBuf; + mutable std::ostream m_os; + public: + DebugOutStream() + : m_streamBuf( new StreamBufImpl<OutputDebugWriter>() ), + m_os( m_streamBuf.get() ) + {} + + ~DebugOutStream() override = default; + + public: // IStream + std::ostream& stream() const override { return m_os; } + }; + + }} // namespace anon::detail + + /////////////////////////////////////////////////////////////////////////// + + auto makeStream( StringRef const &filename ) -> IStream const* { + if( filename.empty() ) + return new Detail::CoutStream(); + else if( filename[0] == '%' ) { + if( filename == "%debug" ) + return new Detail::DebugOutStream(); + else + CATCH_ERROR( "Unrecognised stream: '" << filename << "'" ); + } + else + return new Detail::FileStream( filename ); + } + + // This class encapsulates the idea of a pool of ostringstreams that can be reused. + struct StringStreams { + std::vector<std::unique_ptr<std::ostringstream>> m_streams; + std::vector<std::size_t> m_unused; + std::ostringstream m_referenceStream; // Used for copy state/ flags from + + auto add() -> std::size_t { + if( m_unused.empty() ) { + m_streams.push_back( std::unique_ptr<std::ostringstream>( new std::ostringstream ) ); + return m_streams.size()-1; + } + else { + auto index = m_unused.back(); + m_unused.pop_back(); + return index; + } + } + + void release( std::size_t index ) { + m_streams[index]->copyfmt( m_referenceStream ); // Restore initial flags and other state + m_unused.push_back(index); + } + }; + + ReusableStringStream::ReusableStringStream() + : m_index( Singleton<StringStreams>::getMutable().add() ), + m_oss( Singleton<StringStreams>::getMutable().m_streams[m_index].get() ) + {} + + ReusableStringStream::~ReusableStringStream() { + static_cast<std::ostringstream*>( m_oss )->str(""); + m_oss->clear(); + Singleton<StringStreams>::getMutable().release( m_index ); + } + + auto ReusableStringStream::str() const -> std::string { + return static_cast<std::ostringstream*>( m_oss )->str(); + } + + /////////////////////////////////////////////////////////////////////////// + +#ifndef CATCH_CONFIG_NOSTDOUT // If you #define this you must implement these functions + std::ostream& cout() { return std::cout; } + std::ostream& cerr() { return std::cerr; } + std::ostream& clog() { return std::clog; } +#endif +} +// end catch_stream.cpp +// start catch_string_manip.cpp + +#include <algorithm> +#include <ostream> +#include <cstring> +#include <cctype> +#include <vector> + +namespace Catch { + + namespace { + char toLowerCh(char c) { + return static_cast<char>( std::tolower( c ) ); + } + } + + bool startsWith( std::string const& s, std::string const& prefix ) { + return s.size() >= prefix.size() && std::equal(prefix.begin(), prefix.end(), s.begin()); + } + bool startsWith( std::string const& s, char prefix ) { + return !s.empty() && s[0] == prefix; + } + bool endsWith( std::string const& s, std::string const& suffix ) { + return s.size() >= suffix.size() && std::equal(suffix.rbegin(), suffix.rend(), s.rbegin()); + } + bool endsWith( std::string const& s, char suffix ) { + return !s.empty() && s[s.size()-1] == suffix; + } + bool contains( std::string const& s, std::string const& infix ) { + return s.find( infix ) != std::string::npos; + } + void toLowerInPlace( std::string& s ) { + std::transform( s.begin(), s.end(), s.begin(), toLowerCh ); + } + std::string toLower( std::string const& s ) { + std::string lc = s; + toLowerInPlace( lc ); + return lc; + } + std::string trim( std::string const& str ) { + static char const* whitespaceChars = "\n\r\t "; + std::string::size_type start = str.find_first_not_of( whitespaceChars ); + std::string::size_type end = str.find_last_not_of( whitespaceChars ); + + return start != std::string::npos ? str.substr( start, 1+end-start ) : std::string(); + } + + bool replaceInPlace( std::string& str, std::string const& replaceThis, std::string const& withThis ) { + bool replaced = false; + std::size_t i = str.find( replaceThis ); + while( i != std::string::npos ) { + replaced = true; + str = str.substr( 0, i ) + withThis + str.substr( i+replaceThis.size() ); + if( i < str.size()-withThis.size() ) + i = str.find( replaceThis, i+withThis.size() ); + else + i = std::string::npos; + } + return replaced; + } + + std::vector<StringRef> splitStringRef( StringRef str, char delimiter ) { + std::vector<StringRef> subStrings; + std::size_t start = 0; + for(std::size_t pos = 0; pos < str.size(); ++pos ) { + if( str[pos] == delimiter ) { + if( pos - start > 1 ) + subStrings.push_back( str.substr( start, pos-start ) ); + start = pos+1; + } + } + if( start < str.size() ) + subStrings.push_back( str.substr( start, str.size()-start ) ); + return subStrings; + } + + pluralise::pluralise( std::size_t count, std::string const& label ) + : m_count( count ), + m_label( label ) + {} + + std::ostream& operator << ( std::ostream& os, pluralise const& pluraliser ) { + os << pluraliser.m_count << ' ' << pluraliser.m_label; + if( pluraliser.m_count != 1 ) + os << 's'; + return os; + } + +} +// end catch_string_manip.cpp +// start catch_stringref.cpp + +#if defined(__clang__) +# pragma clang diagnostic push +# pragma clang diagnostic ignored "-Wexit-time-destructors" +#endif + +#include <ostream> +#include <cstring> +#include <cstdint> + +namespace { + const uint32_t byte_2_lead = 0xC0; + const uint32_t byte_3_lead = 0xE0; + const uint32_t byte_4_lead = 0xF0; +} + +namespace Catch { + StringRef::StringRef( char const* rawChars ) noexcept + : StringRef( rawChars, static_cast<StringRef::size_type>(std::strlen(rawChars) ) ) + {} + + StringRef::operator std::string() const { + return std::string( m_start, m_size ); + } + + void StringRef::swap( StringRef& other ) noexcept { + std::swap( m_start, other.m_start ); + std::swap( m_size, other.m_size ); + std::swap( m_data, other.m_data ); + } + + auto StringRef::c_str() const -> char const* { + if( !isSubstring() ) + return m_start; + + const_cast<StringRef *>( this )->takeOwnership(); + return m_data; + } + auto StringRef::currentData() const noexcept -> char const* { + return m_start; + } + + auto StringRef::isOwned() const noexcept -> bool { + return m_data != nullptr; + } + auto StringRef::isSubstring() const noexcept -> bool { + return m_start[m_size] != '\0'; + } + + void StringRef::takeOwnership() { + if( !isOwned() ) { + m_data = new char[m_size+1]; + memcpy( m_data, m_start, m_size ); + m_data[m_size] = '\0'; + } + } + auto StringRef::substr( size_type start, size_type size ) const noexcept -> StringRef { + if( start < m_size ) + return StringRef( m_start+start, size ); + else + return StringRef(); + } + auto StringRef::operator == ( StringRef const& other ) const noexcept -> bool { + return + size() == other.size() && + (std::strncmp( m_start, other.m_start, size() ) == 0); + } + auto StringRef::operator != ( StringRef const& other ) const noexcept -> bool { + return !operator==( other ); + } + + auto StringRef::operator[](size_type index) const noexcept -> char { + return m_start[index]; + } + + auto StringRef::numberOfCharacters() const noexcept -> size_type { + size_type noChars = m_size; + // Make adjustments for uft encodings + for( size_type i=0; i < m_size; ++i ) { + char c = m_start[i]; + if( ( c & byte_2_lead ) == byte_2_lead ) { + noChars--; + if (( c & byte_3_lead ) == byte_3_lead ) + noChars--; + if( ( c & byte_4_lead ) == byte_4_lead ) + noChars--; + } + } + return noChars; + } + + auto operator + ( StringRef const& lhs, StringRef const& rhs ) -> std::string { + std::string str; + str.reserve( lhs.size() + rhs.size() ); + str += lhs; + str += rhs; + return str; + } + auto operator + ( StringRef const& lhs, const char* rhs ) -> std::string { + return std::string( lhs ) + std::string( rhs ); + } + auto operator + ( char const* lhs, StringRef const& rhs ) -> std::string { + return std::string( lhs ) + std::string( rhs ); + } + + auto operator << ( std::ostream& os, StringRef const& str ) -> std::ostream& { + return os.write(str.currentData(), str.size()); + } + + auto operator+=( std::string& lhs, StringRef const& rhs ) -> std::string& { + lhs.append(rhs.currentData(), rhs.size()); + return lhs; + } + +} // namespace Catch + +#if defined(__clang__) +# pragma clang diagnostic pop +#endif +// end catch_stringref.cpp +// start catch_tag_alias.cpp + +namespace Catch { + TagAlias::TagAlias(std::string const & _tag, SourceLineInfo _lineInfo): tag(_tag), lineInfo(_lineInfo) {} +} +// end catch_tag_alias.cpp +// start catch_tag_alias_autoregistrar.cpp + +namespace Catch { + + RegistrarForTagAliases::RegistrarForTagAliases(char const* alias, char const* tag, SourceLineInfo const& lineInfo) { + CATCH_TRY { + getMutableRegistryHub().registerTagAlias(alias, tag, lineInfo); + } CATCH_CATCH_ALL { + // Do not throw when constructing global objects, instead register the exception to be processed later + getMutableRegistryHub().registerStartupException(); + } + } + +} +// end catch_tag_alias_autoregistrar.cpp +// start catch_tag_alias_registry.cpp + +#include <sstream> + +namespace Catch { + + TagAliasRegistry::~TagAliasRegistry() {} + + TagAlias const* TagAliasRegistry::find( std::string const& alias ) const { + auto it = m_registry.find( alias ); + if( it != m_registry.end() ) + return &(it->second); + else + return nullptr; + } + + std::string TagAliasRegistry::expandAliases( std::string const& unexpandedTestSpec ) const { + std::string expandedTestSpec = unexpandedTestSpec; + for( auto const& registryKvp : m_registry ) { + std::size_t pos = expandedTestSpec.find( registryKvp.first ); + if( pos != std::string::npos ) { + expandedTestSpec = expandedTestSpec.substr( 0, pos ) + + registryKvp.second.tag + + expandedTestSpec.substr( pos + registryKvp.first.size() ); + } + } + return expandedTestSpec; + } + + void TagAliasRegistry::add( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ) { + CATCH_ENFORCE( startsWith(alias, "[@") && endsWith(alias, ']'), + "error: tag alias, '" << alias << "' is not of the form [@alias name].\n" << lineInfo ); + + CATCH_ENFORCE( m_registry.insert(std::make_pair(alias, TagAlias(tag, lineInfo))).second, + "error: tag alias, '" << alias << "' already registered.\n" + << "\tFirst seen at: " << find(alias)->lineInfo << "\n" + << "\tRedefined at: " << lineInfo ); + } + + ITagAliasRegistry::~ITagAliasRegistry() {} + + ITagAliasRegistry const& ITagAliasRegistry::get() { + return getRegistryHub().getTagAliasRegistry(); + } + +} // end namespace Catch +// end catch_tag_alias_registry.cpp +// start catch_test_case_info.cpp + +#include <cctype> +#include <exception> +#include <algorithm> +#include <sstream> + +namespace Catch { + + namespace { + TestCaseInfo::SpecialProperties parseSpecialTag( std::string const& tag ) { + if( startsWith( tag, '.' ) || + tag == "!hide" ) + return TestCaseInfo::IsHidden; + else if( tag == "!throws" ) + return TestCaseInfo::Throws; + else if( tag == "!shouldfail" ) + return TestCaseInfo::ShouldFail; + else if( tag == "!mayfail" ) + return TestCaseInfo::MayFail; + else if( tag == "!nonportable" ) + return TestCaseInfo::NonPortable; + else if( tag == "!benchmark" ) + return static_cast<TestCaseInfo::SpecialProperties>( TestCaseInfo::Benchmark | TestCaseInfo::IsHidden ); + else + return TestCaseInfo::None; + } + bool isReservedTag( std::string const& tag ) { + return parseSpecialTag( tag ) == TestCaseInfo::None && tag.size() > 0 && !std::isalnum( static_cast<unsigned char>(tag[0]) ); + } + void enforceNotReservedTag( std::string const& tag, SourceLineInfo const& _lineInfo ) { + CATCH_ENFORCE( !isReservedTag(tag), + "Tag name: [" << tag << "] is not allowed.\n" + << "Tag names starting with non alphanumeric characters are reserved\n" + << _lineInfo ); + } + } + + TestCase makeTestCase( ITestInvoker* _testCase, + std::string const& _className, + NameAndTags const& nameAndTags, + SourceLineInfo const& _lineInfo ) + { + bool isHidden = false; + + // Parse out tags + std::vector<std::string> tags; + std::string desc, tag; + bool inTag = false; + std::string _descOrTags = nameAndTags.tags; + for (char c : _descOrTags) { + if( !inTag ) { + if( c == '[' ) + inTag = true; + else + desc += c; + } + else { + if( c == ']' ) { + TestCaseInfo::SpecialProperties prop = parseSpecialTag( tag ); + if( ( prop & TestCaseInfo::IsHidden ) != 0 ) + isHidden = true; + else if( prop == TestCaseInfo::None ) + enforceNotReservedTag( tag, _lineInfo ); + + // Merged hide tags like `[.approvals]` should be added as + // `[.][approvals]`. The `[.]` is added at later point, so + // we only strip the prefix + if (startsWith(tag, '.') && tag.size() > 1) { + tag.erase(0, 1); + } + tags.push_back( tag ); + tag.clear(); + inTag = false; + } + else + tag += c; + } + } + if( isHidden ) { + tags.push_back( "." ); + } + + TestCaseInfo info( nameAndTags.name, _className, desc, tags, _lineInfo ); + return TestCase( _testCase, std::move(info) ); + } + + void setTags( TestCaseInfo& testCaseInfo, std::vector<std::string> tags ) { + std::sort(begin(tags), end(tags)); + tags.erase(std::unique(begin(tags), end(tags)), end(tags)); + testCaseInfo.lcaseTags.clear(); + + for( auto const& tag : tags ) { + std::string lcaseTag = toLower( tag ); + testCaseInfo.properties = static_cast<TestCaseInfo::SpecialProperties>( testCaseInfo.properties | parseSpecialTag( lcaseTag ) ); + testCaseInfo.lcaseTags.push_back( lcaseTag ); + } + testCaseInfo.tags = std::move(tags); + } + + TestCaseInfo::TestCaseInfo( std::string const& _name, + std::string const& _className, + std::string const& _description, + std::vector<std::string> const& _tags, + SourceLineInfo const& _lineInfo ) + : name( _name ), + className( _className ), + description( _description ), + lineInfo( _lineInfo ), + properties( None ) + { + setTags( *this, _tags ); + } + + bool TestCaseInfo::isHidden() const { + return ( properties & IsHidden ) != 0; + } + bool TestCaseInfo::throws() const { + return ( properties & Throws ) != 0; + } + bool TestCaseInfo::okToFail() const { + return ( properties & (ShouldFail | MayFail ) ) != 0; + } + bool TestCaseInfo::expectedToFail() const { + return ( properties & (ShouldFail ) ) != 0; + } + + std::string TestCaseInfo::tagsAsString() const { + std::string ret; + // '[' and ']' per tag + std::size_t full_size = 2 * tags.size(); + for (const auto& tag : tags) { + full_size += tag.size(); + } + ret.reserve(full_size); + for (const auto& tag : tags) { + ret.push_back('['); + ret.append(tag); + ret.push_back(']'); + } + + return ret; + } + + TestCase::TestCase( ITestInvoker* testCase, TestCaseInfo&& info ) : TestCaseInfo( std::move(info) ), test( testCase ) {} + + TestCase TestCase::withName( std::string const& _newName ) const { + TestCase other( *this ); + other.name = _newName; + return other; + } + + void TestCase::invoke() const { + test->invoke(); + } + + bool TestCase::operator == ( TestCase const& other ) const { + return test.get() == other.test.get() && + name == other.name && + className == other.className; + } + + bool TestCase::operator < ( TestCase const& other ) const { + return name < other.name; + } + + TestCaseInfo const& TestCase::getTestCaseInfo() const + { + return *this; + } + +} // end namespace Catch +// end catch_test_case_info.cpp +// start catch_test_case_registry_impl.cpp + +#include <sstream> + +namespace Catch { + + std::vector<TestCase> sortTests( IConfig const& config, std::vector<TestCase> const& unsortedTestCases ) { + + std::vector<TestCase> sorted = unsortedTestCases; + + switch( config.runOrder() ) { + case RunTests::InLexicographicalOrder: + std::sort( sorted.begin(), sorted.end() ); + break; + case RunTests::InRandomOrder: + seedRng( config ); + std::shuffle( sorted.begin(), sorted.end(), rng() ); + break; + case RunTests::InDeclarationOrder: + // already in declaration order + break; + } + return sorted; + } + bool matchTest( TestCase const& testCase, TestSpec const& testSpec, IConfig const& config ) { + return testSpec.matches( testCase ) && ( config.allowThrows() || !testCase.throws() ); + } + + void enforceNoDuplicateTestCases( std::vector<TestCase> const& functions ) { + std::set<TestCase> seenFunctions; + for( auto const& function : functions ) { + auto prev = seenFunctions.insert( function ); + CATCH_ENFORCE( prev.second, + "error: TEST_CASE( \"" << function.name << "\" ) already defined.\n" + << "\tFirst seen at " << prev.first->getTestCaseInfo().lineInfo << "\n" + << "\tRedefined at " << function.getTestCaseInfo().lineInfo ); + } + } + + std::vector<TestCase> filterTests( std::vector<TestCase> const& testCases, TestSpec const& testSpec, IConfig const& config ) { + std::vector<TestCase> filtered; + filtered.reserve( testCases.size() ); + for (auto const& testCase : testCases) { + if ((!testSpec.hasFilters() && !testCase.isHidden()) || + (testSpec.hasFilters() && matchTest(testCase, testSpec, config))) { + filtered.push_back(testCase); + } + } + return filtered; + } + std::vector<TestCase> const& getAllTestCasesSorted( IConfig const& config ) { + return getRegistryHub().getTestCaseRegistry().getAllTestsSorted( config ); + } + + void TestRegistry::registerTest( TestCase const& testCase ) { + std::string name = testCase.getTestCaseInfo().name; + if( name.empty() ) { + ReusableStringStream rss; + rss << "Anonymous test case " << ++m_unnamedCount; + return registerTest( testCase.withName( rss.str() ) ); + } + m_functions.push_back( testCase ); + } + + std::vector<TestCase> const& TestRegistry::getAllTests() const { + return m_functions; + } + std::vector<TestCase> const& TestRegistry::getAllTestsSorted( IConfig const& config ) const { + if( m_sortedFunctions.empty() ) + enforceNoDuplicateTestCases( m_functions ); + + if( m_currentSortOrder != config.runOrder() || m_sortedFunctions.empty() ) { + m_sortedFunctions = sortTests( config, m_functions ); + m_currentSortOrder = config.runOrder(); + } + return m_sortedFunctions; + } + + /////////////////////////////////////////////////////////////////////////// + TestInvokerAsFunction::TestInvokerAsFunction( void(*testAsFunction)() ) noexcept : m_testAsFunction( testAsFunction ) {} + + void TestInvokerAsFunction::invoke() const { + m_testAsFunction(); + } + + std::string extractClassName( StringRef const& classOrQualifiedMethodName ) { + std::string className = classOrQualifiedMethodName; + if( startsWith( className, '&' ) ) + { + std::size_t lastColons = className.rfind( "::" ); + std::size_t penultimateColons = className.rfind( "::", lastColons-1 ); + if( penultimateColons == std::string::npos ) + penultimateColons = 1; + className = className.substr( penultimateColons, lastColons-penultimateColons ); + } + return className; + } + +} // end namespace Catch +// end catch_test_case_registry_impl.cpp +// start catch_test_case_tracker.cpp + +#include <algorithm> +#include <cassert> +#include <stdexcept> +#include <memory> +#include <sstream> + +#if defined(__clang__) +# pragma clang diagnostic push +# pragma clang diagnostic ignored "-Wexit-time-destructors" +#endif + +namespace Catch { +namespace TestCaseTracking { + + NameAndLocation::NameAndLocation( std::string const& _name, SourceLineInfo const& _location ) + : name( _name ), + location( _location ) + {} + + ITracker::~ITracker() = default; + + ITracker& TrackerContext::startRun() { + m_rootTracker = std::make_shared<SectionTracker>( NameAndLocation( "{root}", CATCH_INTERNAL_LINEINFO ), *this, nullptr ); + m_currentTracker = nullptr; + m_runState = Executing; + return *m_rootTracker; + } + + void TrackerContext::endRun() { + m_rootTracker.reset(); + m_currentTracker = nullptr; + m_runState = NotStarted; + } + + void TrackerContext::startCycle() { + m_currentTracker = m_rootTracker.get(); + m_runState = Executing; + } + void TrackerContext::completeCycle() { + m_runState = CompletedCycle; + } + + bool TrackerContext::completedCycle() const { + return m_runState == CompletedCycle; + } + ITracker& TrackerContext::currentTracker() { + return *m_currentTracker; + } + void TrackerContext::setCurrentTracker( ITracker* tracker ) { + m_currentTracker = tracker; + } + + TrackerBase::TrackerBase( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent ) + : m_nameAndLocation( nameAndLocation ), + m_ctx( ctx ), + m_parent( parent ) + {} + + NameAndLocation const& TrackerBase::nameAndLocation() const { + return m_nameAndLocation; + } + bool TrackerBase::isComplete() const { + return m_runState == CompletedSuccessfully || m_runState == Failed; + } + bool TrackerBase::isSuccessfullyCompleted() const { + return m_runState == CompletedSuccessfully; + } + bool TrackerBase::isOpen() const { + return m_runState != NotStarted && !isComplete(); + } + bool TrackerBase::hasChildren() const { + return !m_children.empty(); + } + + void TrackerBase::addChild( ITrackerPtr const& child ) { + m_children.push_back( child ); + } + + ITrackerPtr TrackerBase::findChild( NameAndLocation const& nameAndLocation ) { + auto it = std::find_if( m_children.begin(), m_children.end(), + [&nameAndLocation]( ITrackerPtr const& tracker ){ + return + tracker->nameAndLocation().location == nameAndLocation.location && + tracker->nameAndLocation().name == nameAndLocation.name; + } ); + return( it != m_children.end() ) + ? *it + : nullptr; + } + ITracker& TrackerBase::parent() { + assert( m_parent ); // Should always be non-null except for root + return *m_parent; + } + + void TrackerBase::openChild() { + if( m_runState != ExecutingChildren ) { + m_runState = ExecutingChildren; + if( m_parent ) + m_parent->openChild(); + } + } + + bool TrackerBase::isSectionTracker() const { return false; } + bool TrackerBase::isGeneratorTracker() const { return false; } + + void TrackerBase::open() { + m_runState = Executing; + moveToThis(); + if( m_parent ) + m_parent->openChild(); + } + + void TrackerBase::close() { + + // Close any still open children (e.g. generators) + while( &m_ctx.currentTracker() != this ) + m_ctx.currentTracker().close(); + + switch( m_runState ) { + case NeedsAnotherRun: + break; + + case Executing: + m_runState = CompletedSuccessfully; + break; + case ExecutingChildren: + if( m_children.empty() || m_children.back()->isComplete() ) + m_runState = CompletedSuccessfully; + break; + + case NotStarted: + case CompletedSuccessfully: + case Failed: + CATCH_INTERNAL_ERROR( "Illogical state: " << m_runState ); + + default: + CATCH_INTERNAL_ERROR( "Unknown state: " << m_runState ); + } + moveToParent(); + m_ctx.completeCycle(); + } + void TrackerBase::fail() { + m_runState = Failed; + if( m_parent ) + m_parent->markAsNeedingAnotherRun(); + moveToParent(); + m_ctx.completeCycle(); + } + void TrackerBase::markAsNeedingAnotherRun() { + m_runState = NeedsAnotherRun; + } + + void TrackerBase::moveToParent() { + assert( m_parent ); + m_ctx.setCurrentTracker( m_parent ); + } + void TrackerBase::moveToThis() { + m_ctx.setCurrentTracker( this ); + } + + SectionTracker::SectionTracker( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent ) + : TrackerBase( nameAndLocation, ctx, parent ) + { + if( parent ) { + while( !parent->isSectionTracker() ) + parent = &parent->parent(); + + SectionTracker& parentSection = static_cast<SectionTracker&>( *parent ); + addNextFilters( parentSection.m_filters ); + } + } + + bool SectionTracker::isComplete() const { + bool complete = true; + + if ((m_filters.empty() || m_filters[0] == "") || + std::find(m_filters.begin(), m_filters.end(), + m_nameAndLocation.name) != m_filters.end()) + complete = TrackerBase::isComplete(); + return complete; + + } + + bool SectionTracker::isSectionTracker() const { return true; } + + SectionTracker& SectionTracker::acquire( TrackerContext& ctx, NameAndLocation const& nameAndLocation ) { + std::shared_ptr<SectionTracker> section; + + ITracker& currentTracker = ctx.currentTracker(); + if( ITrackerPtr childTracker = currentTracker.findChild( nameAndLocation ) ) { + assert( childTracker ); + assert( childTracker->isSectionTracker() ); + section = std::static_pointer_cast<SectionTracker>( childTracker ); + } + else { + section = std::make_shared<SectionTracker>( nameAndLocation, ctx, ¤tTracker ); + currentTracker.addChild( section ); + } + if( !ctx.completedCycle() ) + section->tryOpen(); + return *section; + } + + void SectionTracker::tryOpen() { + if( !isComplete() && (m_filters.empty() || m_filters[0].empty() || m_filters[0] == m_nameAndLocation.name ) ) + open(); + } + + void SectionTracker::addInitialFilters( std::vector<std::string> const& filters ) { + if( !filters.empty() ) { + m_filters.push_back(""); // Root - should never be consulted + m_filters.push_back(""); // Test Case - not a section filter + m_filters.insert( m_filters.end(), filters.begin(), filters.end() ); + } + } + void SectionTracker::addNextFilters( std::vector<std::string> const& filters ) { + if( filters.size() > 1 ) + m_filters.insert( m_filters.end(), ++filters.begin(), filters.end() ); + } + +} // namespace TestCaseTracking + +using TestCaseTracking::ITracker; +using TestCaseTracking::TrackerContext; +using TestCaseTracking::SectionTracker; + +} // namespace Catch + +#if defined(__clang__) +# pragma clang diagnostic pop +#endif +// end catch_test_case_tracker.cpp +// start catch_test_registry.cpp + +namespace Catch { + + auto makeTestInvoker( void(*testAsFunction)() ) noexcept -> ITestInvoker* { + return new(std::nothrow) TestInvokerAsFunction( testAsFunction ); + } + + NameAndTags::NameAndTags( StringRef const& name_ , StringRef const& tags_ ) noexcept : name( name_ ), tags( tags_ ) {} + + AutoReg::AutoReg( ITestInvoker* invoker, SourceLineInfo const& lineInfo, StringRef const& classOrMethod, NameAndTags const& nameAndTags ) noexcept { + CATCH_TRY { + getMutableRegistryHub() + .registerTest( + makeTestCase( + invoker, + extractClassName( classOrMethod ), + nameAndTags, + lineInfo)); + } CATCH_CATCH_ALL { + // Do not throw when constructing global objects, instead register the exception to be processed later + getMutableRegistryHub().registerStartupException(); + } + } + + AutoReg::~AutoReg() = default; +} +// end catch_test_registry.cpp +// start catch_test_spec.cpp + +#include <algorithm> +#include <string> +#include <vector> +#include <memory> + +namespace Catch { + + TestSpec::Pattern::~Pattern() = default; + TestSpec::NamePattern::~NamePattern() = default; + TestSpec::TagPattern::~TagPattern() = default; + TestSpec::ExcludedPattern::~ExcludedPattern() = default; + + TestSpec::NamePattern::NamePattern( std::string const& name ) + : m_wildcardPattern( toLower( name ), CaseSensitive::No ) + {} + bool TestSpec::NamePattern::matches( TestCaseInfo const& testCase ) const { + return m_wildcardPattern.matches( toLower( testCase.name ) ); + } + + TestSpec::TagPattern::TagPattern( std::string const& tag ) : m_tag( toLower( tag ) ) {} + bool TestSpec::TagPattern::matches( TestCaseInfo const& testCase ) const { + return std::find(begin(testCase.lcaseTags), + end(testCase.lcaseTags), + m_tag) != end(testCase.lcaseTags); + } + + TestSpec::ExcludedPattern::ExcludedPattern( PatternPtr const& underlyingPattern ) : m_underlyingPattern( underlyingPattern ) {} + bool TestSpec::ExcludedPattern::matches( TestCaseInfo const& testCase ) const { return !m_underlyingPattern->matches( testCase ); } + + bool TestSpec::Filter::matches( TestCaseInfo const& testCase ) const { + // All patterns in a filter must match for the filter to be a match + for( auto const& pattern : m_patterns ) { + if( !pattern->matches( testCase ) ) + return false; + } + return true; + } + + bool TestSpec::hasFilters() const { + return !m_filters.empty(); + } + bool TestSpec::matches( TestCaseInfo const& testCase ) const { + // A TestSpec matches if any filter matches + for( auto const& filter : m_filters ) + if( filter.matches( testCase ) ) + return true; + return false; + } +} +// end catch_test_spec.cpp +// start catch_test_spec_parser.cpp + +namespace Catch { + + TestSpecParser::TestSpecParser( ITagAliasRegistry const& tagAliases ) : m_tagAliases( &tagAliases ) {} + + TestSpecParser& TestSpecParser::parse( std::string const& arg ) { + m_mode = None; + m_exclusion = false; + m_start = std::string::npos; + m_arg = m_tagAliases->expandAliases( arg ); + m_escapeChars.clear(); + for( m_pos = 0; m_pos < m_arg.size(); ++m_pos ) + visitChar( m_arg[m_pos] ); + if( m_mode == Name ) + addPattern<TestSpec::NamePattern>(); + return *this; + } + TestSpec TestSpecParser::testSpec() { + addFilter(); + return m_testSpec; + } + + void TestSpecParser::visitChar( char c ) { + if( m_mode == None ) { + switch( c ) { + case ' ': return; + case '~': m_exclusion = true; return; + case '[': return startNewMode( Tag, ++m_pos ); + case '"': return startNewMode( QuotedName, ++m_pos ); + case '\\': return escape(); + default: startNewMode( Name, m_pos ); break; + } + } + if( m_mode == Name ) { + if( c == ',' ) { + addPattern<TestSpec::NamePattern>(); + addFilter(); + } + else if( c == '[' ) { + if( subString() == "exclude:" ) + m_exclusion = true; + else + addPattern<TestSpec::NamePattern>(); + startNewMode( Tag, ++m_pos ); + } + else if( c == '\\' ) + escape(); + } + else if( m_mode == EscapedName ) + m_mode = Name; + else if( m_mode == QuotedName && c == '"' ) + addPattern<TestSpec::NamePattern>(); + else if( m_mode == Tag && c == ']' ) + addPattern<TestSpec::TagPattern>(); + } + void TestSpecParser::startNewMode( Mode mode, std::size_t start ) { + m_mode = mode; + m_start = start; + } + void TestSpecParser::escape() { + if( m_mode == None ) + m_start = m_pos; + m_mode = EscapedName; + m_escapeChars.push_back( m_pos ); + } + std::string TestSpecParser::subString() const { return m_arg.substr( m_start, m_pos - m_start ); } + + void TestSpecParser::addFilter() { + if( !m_currentFilter.m_patterns.empty() ) { + m_testSpec.m_filters.push_back( m_currentFilter ); + m_currentFilter = TestSpec::Filter(); + } + } + + TestSpec parseTestSpec( std::string const& arg ) { + return TestSpecParser( ITagAliasRegistry::get() ).parse( arg ).testSpec(); + } + +} // namespace Catch +// end catch_test_spec_parser.cpp +// start catch_timer.cpp + +#include <chrono> + +static const uint64_t nanosecondsInSecond = 1000000000; + +namespace Catch { + + auto getCurrentNanosecondsSinceEpoch() -> uint64_t { + return std::chrono::duration_cast<std::chrono::nanoseconds>( std::chrono::high_resolution_clock::now().time_since_epoch() ).count(); + } + + namespace { + auto estimateClockResolution() -> uint64_t { + uint64_t sum = 0; + static const uint64_t iterations = 1000000; + + auto startTime = getCurrentNanosecondsSinceEpoch(); + + for( std::size_t i = 0; i < iterations; ++i ) { + + uint64_t ticks; + uint64_t baseTicks = getCurrentNanosecondsSinceEpoch(); + do { + ticks = getCurrentNanosecondsSinceEpoch(); + } while( ticks == baseTicks ); + + auto delta = ticks - baseTicks; + sum += delta; + + // If we have been calibrating for over 3 seconds -- the clock + // is terrible and we should move on. + // TBD: How to signal that the measured resolution is probably wrong? + if (ticks > startTime + 3 * nanosecondsInSecond) { + return sum / ( i + 1u ); + } + } + + // We're just taking the mean, here. To do better we could take the std. dev and exclude outliers + // - and potentially do more iterations if there's a high variance. + return sum/iterations; + } + } + auto getEstimatedClockResolution() -> uint64_t { + static auto s_resolution = estimateClockResolution(); + return s_resolution; + } + + void Timer::start() { + m_nanoseconds = getCurrentNanosecondsSinceEpoch(); + } + auto Timer::getElapsedNanoseconds() const -> uint64_t { + return getCurrentNanosecondsSinceEpoch() - m_nanoseconds; + } + auto Timer::getElapsedMicroseconds() const -> uint64_t { + return getElapsedNanoseconds()/1000; + } + auto Timer::getElapsedMilliseconds() const -> unsigned int { + return static_cast<unsigned int>(getElapsedMicroseconds()/1000); + } + auto Timer::getElapsedSeconds() const -> double { + return getElapsedMicroseconds()/1000000.0; + } + +} // namespace Catch +// end catch_timer.cpp +// start catch_tostring.cpp + +#if defined(__clang__) +# pragma clang diagnostic push +# pragma clang diagnostic ignored "-Wexit-time-destructors" +# pragma clang diagnostic ignored "-Wglobal-constructors" +#endif + +// Enable specific decls locally +#if !defined(CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER) +#define CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER +#endif + +#include <cmath> +#include <iomanip> + +namespace Catch { + +namespace Detail { + + const std::string unprintableString = "{?}"; + + namespace { + const int hexThreshold = 255; + + struct Endianness { + enum Arch { Big, Little }; + + static Arch which() { + union _{ + int asInt; + char asChar[sizeof (int)]; + } u; + + u.asInt = 1; + return ( u.asChar[sizeof(int)-1] == 1 ) ? Big : Little; + } + }; + } + + std::string rawMemoryToString( const void *object, std::size_t size ) { + // Reverse order for little endian architectures + int i = 0, end = static_cast<int>( size ), inc = 1; + if( Endianness::which() == Endianness::Little ) { + i = end-1; + end = inc = -1; + } + + unsigned char const *bytes = static_cast<unsigned char const *>(object); + ReusableStringStream rss; + rss << "0x" << std::setfill('0') << std::hex; + for( ; i != end; i += inc ) + rss << std::setw(2) << static_cast<unsigned>(bytes[i]); + return rss.str(); + } +} + +template<typename T> +std::string fpToString( T value, int precision ) { + if (Catch::isnan(value)) { + return "nan"; + } + + ReusableStringStream rss; + rss << std::setprecision( precision ) + << std::fixed + << value; + std::string d = rss.str(); + std::size_t i = d.find_last_not_of( '0' ); + if( i != std::string::npos && i != d.size()-1 ) { + if( d[i] == '.' ) + i++; + d = d.substr( 0, i+1 ); + } + return d; +} + +//// ======================================================= //// +// +// Out-of-line defs for full specialization of StringMaker +// +//// ======================================================= //// + +std::string StringMaker<std::string>::convert(const std::string& str) { + if (!getCurrentContext().getConfig()->showInvisibles()) { + return '"' + str + '"'; + } + + std::string s("\""); + for (char c : str) { + switch (c) { + case '\n': + s.append("\\n"); + break; + case '\t': + s.append("\\t"); + break; + default: + s.push_back(c); + break; + } + } + s.append("\""); + return s; +} + +#ifdef CATCH_CONFIG_CPP17_STRING_VIEW +std::string StringMaker<std::string_view>::convert(std::string_view str) { + return ::Catch::Detail::stringify(std::string{ str }); +} +#endif + +std::string StringMaker<char const*>::convert(char const* str) { + if (str) { + return ::Catch::Detail::stringify(std::string{ str }); + } else { + return{ "{null string}" }; + } +} +std::string StringMaker<char*>::convert(char* str) { + if (str) { + return ::Catch::Detail::stringify(std::string{ str }); + } else { + return{ "{null string}" }; + } +} + +#ifdef CATCH_CONFIG_WCHAR +std::string StringMaker<std::wstring>::convert(const std::wstring& wstr) { + std::string s; + s.reserve(wstr.size()); + for (auto c : wstr) { + s += (c <= 0xff) ? static_cast<char>(c) : '?'; + } + return ::Catch::Detail::stringify(s); +} + +# ifdef CATCH_CONFIG_CPP17_STRING_VIEW +std::string StringMaker<std::wstring_view>::convert(std::wstring_view str) { + return StringMaker<std::wstring>::convert(std::wstring(str)); +} +# endif + +std::string StringMaker<wchar_t const*>::convert(wchar_t const * str) { + if (str) { + return ::Catch::Detail::stringify(std::wstring{ str }); + } else { + return{ "{null string}" }; + } +} +std::string StringMaker<wchar_t *>::convert(wchar_t * str) { + if (str) { + return ::Catch::Detail::stringify(std::wstring{ str }); + } else { + return{ "{null string}" }; + } +} +#endif + +std::string StringMaker<int>::convert(int value) { + return ::Catch::Detail::stringify(static_cast<long long>(value)); +} +std::string StringMaker<long>::convert(long value) { + return ::Catch::Detail::stringify(static_cast<long long>(value)); +} +std::string StringMaker<long long>::convert(long long value) { + ReusableStringStream rss; + rss << value; + if (value > Detail::hexThreshold) { + rss << " (0x" << std::hex << value << ')'; + } + return rss.str(); +} + +std::string StringMaker<unsigned int>::convert(unsigned int value) { + return ::Catch::Detail::stringify(static_cast<unsigned long long>(value)); +} +std::string StringMaker<unsigned long>::convert(unsigned long value) { + return ::Catch::Detail::stringify(static_cast<unsigned long long>(value)); +} +std::string StringMaker<unsigned long long>::convert(unsigned long long value) { + ReusableStringStream rss; + rss << value; + if (value > Detail::hexThreshold) { + rss << " (0x" << std::hex << value << ')'; + } + return rss.str(); +} + +std::string StringMaker<bool>::convert(bool b) { + return b ? "true" : "false"; +} + +std::string StringMaker<signed char>::convert(signed char value) { + if (value == '\r') { + return "'\\r'"; + } else if (value == '\f') { + return "'\\f'"; + } else if (value == '\n') { + return "'\\n'"; + } else if (value == '\t') { + return "'\\t'"; + } else if ('\0' <= value && value < ' ') { + return ::Catch::Detail::stringify(static_cast<unsigned int>(value)); + } else { + char chstr[] = "' '"; + chstr[1] = value; + return chstr; + } +} +std::string StringMaker<char>::convert(char c) { + return ::Catch::Detail::stringify(static_cast<signed char>(c)); +} +std::string StringMaker<unsigned char>::convert(unsigned char c) { + return ::Catch::Detail::stringify(static_cast<char>(c)); +} + +std::string StringMaker<std::nullptr_t>::convert(std::nullptr_t) { + return "nullptr"; +} + +int StringMaker<float>::precision = 5; + +std::string StringMaker<float>::convert(float value) { + return fpToString(value, precision) + 'f'; +} + +int StringMaker<double>::precision = 10; + +std::string StringMaker<double>::convert(double value) { + return fpToString(value, precision); +} + +std::string ratio_string<std::atto>::symbol() { return "a"; } +std::string ratio_string<std::femto>::symbol() { return "f"; } +std::string ratio_string<std::pico>::symbol() { return "p"; } +std::string ratio_string<std::nano>::symbol() { return "n"; } +std::string ratio_string<std::micro>::symbol() { return "u"; } +std::string ratio_string<std::milli>::symbol() { return "m"; } + +} // end namespace Catch + +#if defined(__clang__) +# pragma clang diagnostic pop +#endif + +// end catch_tostring.cpp +// start catch_totals.cpp + +namespace Catch { + + Counts Counts::operator - ( Counts const& other ) const { + Counts diff; + diff.passed = passed - other.passed; + diff.failed = failed - other.failed; + diff.failedButOk = failedButOk - other.failedButOk; + return diff; + } + + Counts& Counts::operator += ( Counts const& other ) { + passed += other.passed; + failed += other.failed; + failedButOk += other.failedButOk; + return *this; + } + + std::size_t Counts::total() const { + return passed + failed + failedButOk; + } + bool Counts::allPassed() const { + return failed == 0 && failedButOk == 0; + } + bool Counts::allOk() const { + return failed == 0; + } + + Totals Totals::operator - ( Totals const& other ) const { + Totals diff; + diff.assertions = assertions - other.assertions; + diff.testCases = testCases - other.testCases; + return diff; + } + + Totals& Totals::operator += ( Totals const& other ) { + assertions += other.assertions; + testCases += other.testCases; + return *this; + } + + Totals Totals::delta( Totals const& prevTotals ) const { + Totals diff = *this - prevTotals; + if( diff.assertions.failed > 0 ) + ++diff.testCases.failed; + else if( diff.assertions.failedButOk > 0 ) + ++diff.testCases.failedButOk; + else + ++diff.testCases.passed; + return diff; + } + +} +// end catch_totals.cpp +// start catch_uncaught_exceptions.cpp + +#include <exception> + +namespace Catch { + bool uncaught_exceptions() { +#if defined(CATCH_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS) + return std::uncaught_exceptions() > 0; +#else + return std::uncaught_exception(); +#endif + } +} // end namespace Catch +// end catch_uncaught_exceptions.cpp +// start catch_version.cpp + +#include <ostream> + +namespace Catch { + + Version::Version + ( unsigned int _majorVersion, + unsigned int _minorVersion, + unsigned int _patchNumber, + char const * const _branchName, + unsigned int _buildNumber ) + : majorVersion( _majorVersion ), + minorVersion( _minorVersion ), + patchNumber( _patchNumber ), + branchName( _branchName ), + buildNumber( _buildNumber ) + {} + + std::ostream& operator << ( std::ostream& os, Version const& version ) { + os << version.majorVersion << '.' + << version.minorVersion << '.' + << version.patchNumber; + // branchName is never null -> 0th char is \0 if it is empty + if (version.branchName[0]) { + os << '-' << version.branchName + << '.' << version.buildNumber; + } + return os; + } + + Version const& libraryVersion() { + static Version version( 2, 9, 1, "", 0 ); + return version; + } + +} +// end catch_version.cpp +// start catch_wildcard_pattern.cpp + +#include <sstream> + +namespace Catch { + + WildcardPattern::WildcardPattern( std::string const& pattern, + CaseSensitive::Choice caseSensitivity ) + : m_caseSensitivity( caseSensitivity ), + m_pattern( adjustCase( pattern ) ) + { + if( startsWith( m_pattern, '*' ) ) { + m_pattern = m_pattern.substr( 1 ); + m_wildcard = WildcardAtStart; + } + if( endsWith( m_pattern, '*' ) ) { + m_pattern = m_pattern.substr( 0, m_pattern.size()-1 ); + m_wildcard = static_cast<WildcardPosition>( m_wildcard | WildcardAtEnd ); + } + } + + bool WildcardPattern::matches( std::string const& str ) const { + switch( m_wildcard ) { + case NoWildcard: + return m_pattern == adjustCase( str ); + case WildcardAtStart: + return endsWith( adjustCase( str ), m_pattern ); + case WildcardAtEnd: + return startsWith( adjustCase( str ), m_pattern ); + case WildcardAtBothEnds: + return contains( adjustCase( str ), m_pattern ); + default: + CATCH_INTERNAL_ERROR( "Unknown enum" ); + } + } + + std::string WildcardPattern::adjustCase( std::string const& str ) const { + return m_caseSensitivity == CaseSensitive::No ? toLower( str ) : str; + } +} +// end catch_wildcard_pattern.cpp +// start catch_xmlwriter.cpp + +#include <iomanip> + +using uchar = unsigned char; + +namespace Catch { + +namespace { + + size_t trailingBytes(unsigned char c) { + if ((c & 0xE0) == 0xC0) { + return 2; + } + if ((c & 0xF0) == 0xE0) { + return 3; + } + if ((c & 0xF8) == 0xF0) { + return 4; + } + CATCH_INTERNAL_ERROR("Invalid multibyte utf-8 start byte encountered"); + } + + uint32_t headerValue(unsigned char c) { + if ((c & 0xE0) == 0xC0) { + return c & 0x1F; + } + if ((c & 0xF0) == 0xE0) { + return c & 0x0F; + } + if ((c & 0xF8) == 0xF0) { + return c & 0x07; + } + CATCH_INTERNAL_ERROR("Invalid multibyte utf-8 start byte encountered"); + } + + void hexEscapeChar(std::ostream& os, unsigned char c) { + std::ios_base::fmtflags f(os.flags()); + os << "\\x" + << std::uppercase << std::hex << std::setfill('0') << std::setw(2) + << static_cast<int>(c); + os.flags(f); + } + +} // anonymous namespace + + XmlEncode::XmlEncode( std::string const& str, ForWhat forWhat ) + : m_str( str ), + m_forWhat( forWhat ) + {} + + void XmlEncode::encodeTo( std::ostream& os ) const { + // Apostrophe escaping not necessary if we always use " to write attributes + // (see: http://www.w3.org/TR/xml/#syntax) + + for( std::size_t idx = 0; idx < m_str.size(); ++ idx ) { + uchar c = m_str[idx]; + switch (c) { + case '<': os << "<"; break; + case '&': os << "&"; break; + + case '>': + // See: http://www.w3.org/TR/xml/#syntax + if (idx > 2 && m_str[idx - 1] == ']' && m_str[idx - 2] == ']') + os << ">"; + else + os << c; + break; + + case '\"': + if (m_forWhat == ForAttributes) + os << """; + else + os << c; + break; + + default: + // Check for control characters and invalid utf-8 + + // Escape control characters in standard ascii + // see http://stackoverflow.com/questions/404107/why-are-control-characters-illegal-in-xml-1-0 + if (c < 0x09 || (c > 0x0D && c < 0x20) || c == 0x7F) { + hexEscapeChar(os, c); + break; + } + + // Plain ASCII: Write it to stream + if (c < 0x7F) { + os << c; + break; + } + + // UTF-8 territory + // Check if the encoding is valid and if it is not, hex escape bytes. + // Important: We do not check the exact decoded values for validity, only the encoding format + // First check that this bytes is a valid lead byte: + // This means that it is not encoded as 1111 1XXX + // Or as 10XX XXXX + if (c < 0xC0 || + c >= 0xF8) { + hexEscapeChar(os, c); + break; + } + + auto encBytes = trailingBytes(c); + // Are there enough bytes left to avoid accessing out-of-bounds memory? + if (idx + encBytes - 1 >= m_str.size()) { + hexEscapeChar(os, c); + break; + } + // The header is valid, check data + // The next encBytes bytes must together be a valid utf-8 + // This means: bitpattern 10XX XXXX and the extracted value is sane (ish) + bool valid = true; + uint32_t value = headerValue(c); + for (std::size_t n = 1; n < encBytes; ++n) { + uchar nc = m_str[idx + n]; + valid &= ((nc & 0xC0) == 0x80); + value = (value << 6) | (nc & 0x3F); + } + + if ( + // Wrong bit pattern of following bytes + (!valid) || + // Overlong encodings + (value < 0x80) || + (0x80 <= value && value < 0x800 && encBytes > 2) || + (0x800 < value && value < 0x10000 && encBytes > 3) || + // Encoded value out of range + (value >= 0x110000) + ) { + hexEscapeChar(os, c); + break; + } + + // If we got here, this is in fact a valid(ish) utf-8 sequence + for (std::size_t n = 0; n < encBytes; ++n) { + os << m_str[idx + n]; + } + idx += encBytes - 1; + break; + } + } + } + + std::ostream& operator << ( std::ostream& os, XmlEncode const& xmlEncode ) { + xmlEncode.encodeTo( os ); + return os; + } + + XmlWriter::ScopedElement::ScopedElement( XmlWriter* writer ) + : m_writer( writer ) + {} + + XmlWriter::ScopedElement::ScopedElement( ScopedElement&& other ) noexcept + : m_writer( other.m_writer ){ + other.m_writer = nullptr; + } + XmlWriter::ScopedElement& XmlWriter::ScopedElement::operator=( ScopedElement&& other ) noexcept { + if ( m_writer ) { + m_writer->endElement(); + } + m_writer = other.m_writer; + other.m_writer = nullptr; + return *this; + } + + XmlWriter::ScopedElement::~ScopedElement() { + if( m_writer ) + m_writer->endElement(); + } + + XmlWriter::ScopedElement& XmlWriter::ScopedElement::writeText( std::string const& text, bool indent ) { + m_writer->writeText( text, indent ); + return *this; + } + + XmlWriter::XmlWriter( std::ostream& os ) : m_os( os ) + { + writeDeclaration(); + } + + XmlWriter::~XmlWriter() { + while( !m_tags.empty() ) + endElement(); + } + + XmlWriter& XmlWriter::startElement( std::string const& name ) { + ensureTagClosed(); + newlineIfNecessary(); + m_os << m_indent << '<' << name; + m_tags.push_back( name ); + m_indent += " "; + m_tagIsOpen = true; + return *this; + } + + XmlWriter::ScopedElement XmlWriter::scopedElement( std::string const& name ) { + ScopedElement scoped( this ); + startElement( name ); + return scoped; + } + + XmlWriter& XmlWriter::endElement() { + newlineIfNecessary(); + m_indent = m_indent.substr( 0, m_indent.size()-2 ); + if( m_tagIsOpen ) { + m_os << "/>"; + m_tagIsOpen = false; + } + else { + m_os << m_indent << "</" << m_tags.back() << ">"; + } + m_os << std::endl; + m_tags.pop_back(); + return *this; + } + + XmlWriter& XmlWriter::writeAttribute( std::string const& name, std::string const& attribute ) { + if( !name.empty() && !attribute.empty() ) + m_os << ' ' << name << "=\"" << XmlEncode( attribute, XmlEncode::ForAttributes ) << '"'; + return *this; + } + + XmlWriter& XmlWriter::writeAttribute( std::string const& name, bool attribute ) { + m_os << ' ' << name << "=\"" << ( attribute ? "true" : "false" ) << '"'; + return *this; + } + + XmlWriter& XmlWriter::writeText( std::string const& text, bool indent ) { + if( !text.empty() ){ + bool tagWasOpen = m_tagIsOpen; + ensureTagClosed(); + if( tagWasOpen && indent ) + m_os << m_indent; + m_os << XmlEncode( text ); + m_needsNewline = true; + } + return *this; + } + + XmlWriter& XmlWriter::writeComment( std::string const& text ) { + ensureTagClosed(); + m_os << m_indent << "<!--" << text << "-->"; + m_needsNewline = true; + return *this; + } + + void XmlWriter::writeStylesheetRef( std::string const& url ) { + m_os << "<?xml-stylesheet type=\"text/xsl\" href=\"" << url << "\"?>\n"; + } + + XmlWriter& XmlWriter::writeBlankLine() { + ensureTagClosed(); + m_os << '\n'; + return *this; + } + + void XmlWriter::ensureTagClosed() { + if( m_tagIsOpen ) { + m_os << ">" << std::endl; + m_tagIsOpen = false; + } + } + + void XmlWriter::writeDeclaration() { + m_os << "<?xml version=\"1.0\" encoding=\"UTF-8\"?>\n"; + } + + void XmlWriter::newlineIfNecessary() { + if( m_needsNewline ) { + m_os << std::endl; + m_needsNewline = false; + } + } +} +// end catch_xmlwriter.cpp +// start catch_reporter_bases.cpp + +#include <cstring> +#include <cfloat> +#include <cstdio> +#include <cassert> +#include <memory> + +namespace Catch { + void prepareExpandedExpression(AssertionResult& result) { + result.getExpandedExpression(); + } + + // Because formatting using c++ streams is stateful, drop down to C is required + // Alternatively we could use stringstream, but its performance is... not good. + std::string getFormattedDuration( double duration ) { + // Max exponent + 1 is required to represent the whole part + // + 1 for decimal point + // + 3 for the 3 decimal places + // + 1 for null terminator + const std::size_t maxDoubleSize = DBL_MAX_10_EXP + 1 + 1 + 3 + 1; + char buffer[maxDoubleSize]; + + // Save previous errno, to prevent sprintf from overwriting it + ErrnoGuard guard; +#ifdef _MSC_VER + sprintf_s(buffer, "%.3f", duration); +#else + std::sprintf(buffer, "%.3f", duration); +#endif + return std::string(buffer); + } + + std::string serializeFilters( std::vector<std::string> const& container ) { + ReusableStringStream oss; + bool first = true; + for (auto&& filter : container) + { + if (!first) + oss << ' '; + else + first = false; + + oss << filter; + } + return oss.str(); + } + + TestEventListenerBase::TestEventListenerBase(ReporterConfig const & _config) + :StreamingReporterBase(_config) {} + + std::set<Verbosity> TestEventListenerBase::getSupportedVerbosities() { + return { Verbosity::Quiet, Verbosity::Normal, Verbosity::High }; + } + + void TestEventListenerBase::assertionStarting(AssertionInfo const &) {} + + bool TestEventListenerBase::assertionEnded(AssertionStats const &) { + return false; + } + +} // end namespace Catch +// end catch_reporter_bases.cpp +// start catch_reporter_compact.cpp + +namespace { + +#ifdef CATCH_PLATFORM_MAC + const char* failedString() { return "FAILED"; } + const char* passedString() { return "PASSED"; } +#else + const char* failedString() { return "failed"; } + const char* passedString() { return "passed"; } +#endif + + // Colour::LightGrey + Catch::Colour::Code dimColour() { return Catch::Colour::FileName; } + + std::string bothOrAll( std::size_t count ) { + return count == 1 ? std::string() : + count == 2 ? "both " : "all " ; + } + +} // anon namespace + +namespace Catch { +namespace { +// Colour, message variants: +// - white: No tests ran. +// - red: Failed [both/all] N test cases, failed [both/all] M assertions. +// - white: Passed [both/all] N test cases (no assertions). +// - red: Failed N tests cases, failed M assertions. +// - green: Passed [both/all] N tests cases with M assertions. +void printTotals(std::ostream& out, const Totals& totals) { + if (totals.testCases.total() == 0) { + out << "No tests ran."; + } else if (totals.testCases.failed == totals.testCases.total()) { + Colour colour(Colour::ResultError); + const std::string qualify_assertions_failed = + totals.assertions.failed == totals.assertions.total() ? + bothOrAll(totals.assertions.failed) : std::string(); + out << + "Failed " << bothOrAll(totals.testCases.failed) + << pluralise(totals.testCases.failed, "test case") << ", " + "failed " << qualify_assertions_failed << + pluralise(totals.assertions.failed, "assertion") << '.'; + } else if (totals.assertions.total() == 0) { + out << + "Passed " << bothOrAll(totals.testCases.total()) + << pluralise(totals.testCases.total(), "test case") + << " (no assertions)."; + } else if (totals.assertions.failed) { + Colour colour(Colour::ResultError); + out << + "Failed " << pluralise(totals.testCases.failed, "test case") << ", " + "failed " << pluralise(totals.assertions.failed, "assertion") << '.'; + } else { + Colour colour(Colour::ResultSuccess); + out << + "Passed " << bothOrAll(totals.testCases.passed) + << pluralise(totals.testCases.passed, "test case") << + " with " << pluralise(totals.assertions.passed, "assertion") << '.'; + } +} + +// Implementation of CompactReporter formatting +class AssertionPrinter { +public: + AssertionPrinter& operator= (AssertionPrinter const&) = delete; + AssertionPrinter(AssertionPrinter const&) = delete; + AssertionPrinter(std::ostream& _stream, AssertionStats const& _stats, bool _printInfoMessages) + : stream(_stream) + , result(_stats.assertionResult) + , messages(_stats.infoMessages) + , itMessage(_stats.infoMessages.begin()) + , printInfoMessages(_printInfoMessages) {} + + void print() { + printSourceInfo(); + + itMessage = messages.begin(); + + switch (result.getResultType()) { + case ResultWas::Ok: + printResultType(Colour::ResultSuccess, passedString()); + printOriginalExpression(); + printReconstructedExpression(); + if (!result.hasExpression()) + printRemainingMessages(Colour::None); + else + printRemainingMessages(); + break; + case ResultWas::ExpressionFailed: + if (result.isOk()) + printResultType(Colour::ResultSuccess, failedString() + std::string(" - but was ok")); + else + printResultType(Colour::Error, failedString()); + printOriginalExpression(); + printReconstructedExpression(); + printRemainingMessages(); + break; + case ResultWas::ThrewException: + printResultType(Colour::Error, failedString()); + printIssue("unexpected exception with message:"); + printMessage(); + printExpressionWas(); + printRemainingMessages(); + break; + case ResultWas::FatalErrorCondition: + printResultType(Colour::Error, failedString()); + printIssue("fatal error condition with message:"); + printMessage(); + printExpressionWas(); + printRemainingMessages(); + break; + case ResultWas::DidntThrowException: + printResultType(Colour::Error, failedString()); + printIssue("expected exception, got none"); + printExpressionWas(); + printRemainingMessages(); + break; + case ResultWas::Info: + printResultType(Colour::None, "info"); + printMessage(); + printRemainingMessages(); + break; + case ResultWas::Warning: + printResultType(Colour::None, "warning"); + printMessage(); + printRemainingMessages(); + break; + case ResultWas::ExplicitFailure: + printResultType(Colour::Error, failedString()); + printIssue("explicitly"); + printRemainingMessages(Colour::None); + break; + // These cases are here to prevent compiler warnings + case ResultWas::Unknown: + case ResultWas::FailureBit: + case ResultWas::Exception: + printResultType(Colour::Error, "** internal error **"); + break; + } + } + +private: + void printSourceInfo() const { + Colour colourGuard(Colour::FileName); + stream << result.getSourceInfo() << ':'; + } + + void printResultType(Colour::Code colour, std::string const& passOrFail) const { + if (!passOrFail.empty()) { + { + Colour colourGuard(colour); + stream << ' ' << passOrFail; + } + stream << ':'; + } + } + + void printIssue(std::string const& issue) const { + stream << ' ' << issue; + } + + void printExpressionWas() { + if (result.hasExpression()) { + stream << ';'; + { + Colour colour(dimColour()); + stream << " expression was:"; + } + printOriginalExpression(); + } + } + + void printOriginalExpression() const { + if (result.hasExpression()) { + stream << ' ' << result.getExpression(); + } + } + + void printReconstructedExpression() const { + if (result.hasExpandedExpression()) { + { + Colour colour(dimColour()); + stream << " for: "; + } + stream << result.getExpandedExpression(); + } + } + + void printMessage() { + if (itMessage != messages.end()) { + stream << " '" << itMessage->message << '\''; + ++itMessage; + } + } + + void printRemainingMessages(Colour::Code colour = dimColour()) { + if (itMessage == messages.end()) + return; + + // using messages.end() directly yields (or auto) compilation error: + std::vector<MessageInfo>::const_iterator itEnd = messages.end(); + const std::size_t N = static_cast<std::size_t>(std::distance(itMessage, itEnd)); + + { + Colour colourGuard(colour); + stream << " with " << pluralise(N, "message") << ':'; + } + + for (; itMessage != itEnd; ) { + // If this assertion is a warning ignore any INFO messages + if (printInfoMessages || itMessage->type != ResultWas::Info) { + stream << " '" << itMessage->message << '\''; + if (++itMessage != itEnd) { + Colour colourGuard(dimColour()); + stream << " and"; + } + } + } + } + +private: + std::ostream& stream; + AssertionResult const& result; + std::vector<MessageInfo> messages; + std::vector<MessageInfo>::const_iterator itMessage; + bool printInfoMessages; +}; + +} // anon namespace + + std::string CompactReporter::getDescription() { + return "Reports test results on a single line, suitable for IDEs"; + } + + ReporterPreferences CompactReporter::getPreferences() const { + return m_reporterPrefs; + } + + void CompactReporter::noMatchingTestCases( std::string const& spec ) { + stream << "No test cases matched '" << spec << '\'' << std::endl; + } + + void CompactReporter::assertionStarting( AssertionInfo const& ) {} + + bool CompactReporter::assertionEnded( AssertionStats const& _assertionStats ) { + AssertionResult const& result = _assertionStats.assertionResult; + + bool printInfoMessages = true; + + // Drop out if result was successful and we're not printing those + if( !m_config->includeSuccessfulResults() && result.isOk() ) { + if( result.getResultType() != ResultWas::Warning ) + return false; + printInfoMessages = false; + } + + AssertionPrinter printer( stream, _assertionStats, printInfoMessages ); + printer.print(); + + stream << std::endl; + return true; + } + + void CompactReporter::sectionEnded(SectionStats const& _sectionStats) { + if (m_config->showDurations() == ShowDurations::Always) { + stream << getFormattedDuration(_sectionStats.durationInSeconds) << " s: " << _sectionStats.sectionInfo.name << std::endl; + } + } + + void CompactReporter::testRunEnded( TestRunStats const& _testRunStats ) { + printTotals( stream, _testRunStats.totals ); + stream << '\n' << std::endl; + StreamingReporterBase::testRunEnded( _testRunStats ); + } + + CompactReporter::~CompactReporter() {} + + CATCH_REGISTER_REPORTER( "compact", CompactReporter ) + +} // end namespace Catch +// end catch_reporter_compact.cpp +// start catch_reporter_console.cpp + +#include <cfloat> +#include <cstdio> + +#if defined(_MSC_VER) +#pragma warning(push) +#pragma warning(disable:4061) // Not all labels are EXPLICITLY handled in switch + // Note that 4062 (not all labels are handled and default is missing) is enabled +#endif + +#if defined(__clang__) +# pragma clang diagnostic push +// For simplicity, benchmarking-only helpers are always enabled +# pragma clang diagnostic ignored "-Wunused-function" +#endif + +namespace Catch { + +namespace { + +// Formatter impl for ConsoleReporter +class ConsoleAssertionPrinter { +public: + ConsoleAssertionPrinter& operator= (ConsoleAssertionPrinter const&) = delete; + ConsoleAssertionPrinter(ConsoleAssertionPrinter const&) = delete; + ConsoleAssertionPrinter(std::ostream& _stream, AssertionStats const& _stats, bool _printInfoMessages) + : stream(_stream), + stats(_stats), + result(_stats.assertionResult), + colour(Colour::None), + message(result.getMessage()), + messages(_stats.infoMessages), + printInfoMessages(_printInfoMessages) { + switch (result.getResultType()) { + case ResultWas::Ok: + colour = Colour::Success; + passOrFail = "PASSED"; + //if( result.hasMessage() ) + if (_stats.infoMessages.size() == 1) + messageLabel = "with message"; + if (_stats.infoMessages.size() > 1) + messageLabel = "with messages"; + break; + case ResultWas::ExpressionFailed: + if (result.isOk()) { + colour = Colour::Success; + passOrFail = "FAILED - but was ok"; + } else { + colour = Colour::Error; + passOrFail = "FAILED"; + } + if (_stats.infoMessages.size() == 1) + messageLabel = "with message"; + if (_stats.infoMessages.size() > 1) + messageLabel = "with messages"; + break; + case ResultWas::ThrewException: + colour = Colour::Error; + passOrFail = "FAILED"; + messageLabel = "due to unexpected exception with "; + if (_stats.infoMessages.size() == 1) + messageLabel += "message"; + if (_stats.infoMessages.size() > 1) + messageLabel += "messages"; + break; + case ResultWas::FatalErrorCondition: + colour = Colour::Error; + passOrFail = "FAILED"; + messageLabel = "due to a fatal error condition"; + break; + case ResultWas::DidntThrowException: + colour = Colour::Error; + passOrFail = "FAILED"; + messageLabel = "because no exception was thrown where one was expected"; + break; + case ResultWas::Info: + messageLabel = "info"; + break; + case ResultWas::Warning: + messageLabel = "warning"; + break; + case ResultWas::ExplicitFailure: + passOrFail = "FAILED"; + colour = Colour::Error; + if (_stats.infoMessages.size() == 1) + messageLabel = "explicitly with message"; + if (_stats.infoMessages.size() > 1) + messageLabel = "explicitly with messages"; + break; + // These cases are here to prevent compiler warnings + case ResultWas::Unknown: + case ResultWas::FailureBit: + case ResultWas::Exception: + passOrFail = "** internal error **"; + colour = Colour::Error; + break; + } + } + + void print() const { + printSourceInfo(); + if (stats.totals.assertions.total() > 0) { + printResultType(); + printOriginalExpression(); + printReconstructedExpression(); + } else { + stream << '\n'; + } + printMessage(); + } + +private: + void printResultType() const { + if (!passOrFail.empty()) { + Colour colourGuard(colour); + stream << passOrFail << ":\n"; + } + } + void printOriginalExpression() const { + if (result.hasExpression()) { + Colour colourGuard(Colour::OriginalExpression); + stream << " "; + stream << result.getExpressionInMacro(); + stream << '\n'; + } + } + void printReconstructedExpression() const { + if (result.hasExpandedExpression()) { + stream << "with expansion:\n"; + Colour colourGuard(Colour::ReconstructedExpression); + stream << Column(result.getExpandedExpression()).indent(2) << '\n'; + } + } + void printMessage() const { + if (!messageLabel.empty()) + stream << messageLabel << ':' << '\n'; + for (auto const& msg : messages) { + // If this assertion is a warning ignore any INFO messages + if (printInfoMessages || msg.type != ResultWas::Info) + stream << Column(msg.message).indent(2) << '\n'; + } + } + void printSourceInfo() const { + Colour colourGuard(Colour::FileName); + stream << result.getSourceInfo() << ": "; + } + + std::ostream& stream; + AssertionStats const& stats; + AssertionResult const& result; + Colour::Code colour; + std::string passOrFail; + std::string messageLabel; + std::string message; + std::vector<MessageInfo> messages; + bool printInfoMessages; +}; + +std::size_t makeRatio(std::size_t number, std::size_t total) { + std::size_t ratio = total > 0 ? CATCH_CONFIG_CONSOLE_WIDTH * number / total : 0; + return (ratio == 0 && number > 0) ? 1 : ratio; +} + +std::size_t& findMax(std::size_t& i, std::size_t& j, std::size_t& k) { + if (i > j && i > k) + return i; + else if (j > k) + return j; + else + return k; +} + +struct ColumnInfo { + enum Justification { Left, Right }; + std::string name; + int width; + Justification justification; +}; +struct ColumnBreak {}; +struct RowBreak {}; + +class Duration { + enum class Unit { + Auto, + Nanoseconds, + Microseconds, + Milliseconds, + Seconds, + Minutes + }; + static const uint64_t s_nanosecondsInAMicrosecond = 1000; + static const uint64_t s_nanosecondsInAMillisecond = 1000 * s_nanosecondsInAMicrosecond; + static const uint64_t s_nanosecondsInASecond = 1000 * s_nanosecondsInAMillisecond; + static const uint64_t s_nanosecondsInAMinute = 60 * s_nanosecondsInASecond; + + uint64_t m_inNanoseconds; + Unit m_units; + +public: + explicit Duration(double inNanoseconds, Unit units = Unit::Auto) + : Duration(static_cast<uint64_t>(inNanoseconds), units) { + } + + explicit Duration(uint64_t inNanoseconds, Unit units = Unit::Auto) + : m_inNanoseconds(inNanoseconds), + m_units(units) { + if (m_units == Unit::Auto) { + if (m_inNanoseconds < s_nanosecondsInAMicrosecond) + m_units = Unit::Nanoseconds; + else if (m_inNanoseconds < s_nanosecondsInAMillisecond) + m_units = Unit::Microseconds; + else if (m_inNanoseconds < s_nanosecondsInASecond) + m_units = Unit::Milliseconds; + else if (m_inNanoseconds < s_nanosecondsInAMinute) + m_units = Unit::Seconds; + else + m_units = Unit::Minutes; + } + + } + + auto value() const -> double { + switch (m_units) { + case Unit::Microseconds: + return m_inNanoseconds / static_cast<double>(s_nanosecondsInAMicrosecond); + case Unit::Milliseconds: + return m_inNanoseconds / static_cast<double>(s_nanosecondsInAMillisecond); + case Unit::Seconds: + return m_inNanoseconds / static_cast<double>(s_nanosecondsInASecond); + case Unit::Minutes: + return m_inNanoseconds / static_cast<double>(s_nanosecondsInAMinute); + default: + return static_cast<double>(m_inNanoseconds); + } + } + auto unitsAsString() const -> std::string { + switch (m_units) { + case Unit::Nanoseconds: + return "ns"; + case Unit::Microseconds: + return "us"; + case Unit::Milliseconds: + return "ms"; + case Unit::Seconds: + return "s"; + case Unit::Minutes: + return "m"; + default: + return "** internal error **"; + } + + } + friend auto operator << (std::ostream& os, Duration const& duration) -> std::ostream& { + return os << duration.value() << " " << duration.unitsAsString(); + } +}; +} // end anon namespace + +class TablePrinter { + std::ostream& m_os; + std::vector<ColumnInfo> m_columnInfos; + std::ostringstream m_oss; + int m_currentColumn = -1; + bool m_isOpen = false; + +public: + TablePrinter( std::ostream& os, std::vector<ColumnInfo> columnInfos ) + : m_os( os ), + m_columnInfos( std::move( columnInfos ) ) {} + + auto columnInfos() const -> std::vector<ColumnInfo> const& { + return m_columnInfos; + } + + void open() { + if (!m_isOpen) { + m_isOpen = true; + *this << RowBreak(); + + Columns headerCols; + Spacer spacer(2); + for (auto const& info : m_columnInfos) { + headerCols += Column(info.name).width(static_cast<std::size_t>(info.width - 2)); + headerCols += spacer; + } + m_os << headerCols << "\n"; + + m_os << Catch::getLineOfChars<'-'>() << "\n"; + } + } + void close() { + if (m_isOpen) { + *this << RowBreak(); + m_os << std::endl; + m_isOpen = false; + } + } + + template<typename T> + friend TablePrinter& operator << (TablePrinter& tp, T const& value) { + tp.m_oss << value; + return tp; + } + + friend TablePrinter& operator << (TablePrinter& tp, ColumnBreak) { + auto colStr = tp.m_oss.str(); + // This takes account of utf8 encodings + auto strSize = Catch::StringRef(colStr).numberOfCharacters(); + tp.m_oss.str(""); + tp.open(); + if (tp.m_currentColumn == static_cast<int>(tp.m_columnInfos.size() - 1)) { + tp.m_currentColumn = -1; + tp.m_os << "\n"; + } + tp.m_currentColumn++; + + auto colInfo = tp.m_columnInfos[tp.m_currentColumn]; + auto padding = (strSize + 2 < static_cast<std::size_t>(colInfo.width)) + ? std::string(colInfo.width - (strSize + 2), ' ') + : std::string(); + if (colInfo.justification == ColumnInfo::Left) + tp.m_os << colStr << padding << " "; + else + tp.m_os << padding << colStr << " "; + return tp; + } + + friend TablePrinter& operator << (TablePrinter& tp, RowBreak) { + if (tp.m_currentColumn > 0) { + tp.m_os << "\n"; + tp.m_currentColumn = -1; + } + return tp; + } +}; + +ConsoleReporter::ConsoleReporter(ReporterConfig const& config) + : StreamingReporterBase(config), + m_tablePrinter(new TablePrinter(config.stream(), + { + { "benchmark name", CATCH_CONFIG_CONSOLE_WIDTH - 32, ColumnInfo::Left }, + { "samples mean std dev", 14, ColumnInfo::Right }, + { "iterations low mean low std dev", 14, ColumnInfo::Right }, + { "estimated high mean high std dev", 14, ColumnInfo::Right } + })) {} +ConsoleReporter::~ConsoleReporter() = default; + +std::string ConsoleReporter::getDescription() { + return "Reports test results as plain lines of text"; +} + +void ConsoleReporter::noMatchingTestCases(std::string const& spec) { + stream << "No test cases matched '" << spec << '\'' << std::endl; +} + +void ConsoleReporter::assertionStarting(AssertionInfo const&) {} + +bool ConsoleReporter::assertionEnded(AssertionStats const& _assertionStats) { + AssertionResult const& result = _assertionStats.assertionResult; + + bool includeResults = m_config->includeSuccessfulResults() || !result.isOk(); + + // Drop out if result was successful but we're not printing them. + if (!includeResults && result.getResultType() != ResultWas::Warning) + return false; + + lazyPrint(); + + ConsoleAssertionPrinter printer(stream, _assertionStats, includeResults); + printer.print(); + stream << std::endl; + return true; +} + +void ConsoleReporter::sectionStarting(SectionInfo const& _sectionInfo) { + m_tablePrinter->close(); + m_headerPrinted = false; + StreamingReporterBase::sectionStarting(_sectionInfo); +} +void ConsoleReporter::sectionEnded(SectionStats const& _sectionStats) { + m_tablePrinter->close(); + if (_sectionStats.missingAssertions) { + lazyPrint(); + Colour colour(Colour::ResultError); + if (m_sectionStack.size() > 1) + stream << "\nNo assertions in section"; + else + stream << "\nNo assertions in test case"; + stream << " '" << _sectionStats.sectionInfo.name << "'\n" << std::endl; + } + if (m_config->showDurations() == ShowDurations::Always) { + stream << getFormattedDuration(_sectionStats.durationInSeconds) << " s: " << _sectionStats.sectionInfo.name << std::endl; + } + if (m_headerPrinted) { + m_headerPrinted = false; + } + StreamingReporterBase::sectionEnded(_sectionStats); +} + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) +void ConsoleReporter::benchmarkPreparing(std::string const& name) { + lazyPrintWithoutClosingBenchmarkTable(); + + auto nameCol = Column(name).width(static_cast<std::size_t>(m_tablePrinter->columnInfos()[0].width - 2)); + + bool firstLine = true; + for (auto line : nameCol) { + if (!firstLine) + (*m_tablePrinter) << ColumnBreak() << ColumnBreak() << ColumnBreak(); + else + firstLine = false; + + (*m_tablePrinter) << line << ColumnBreak(); + } +} + +void ConsoleReporter::benchmarkStarting(BenchmarkInfo const& info) { + (*m_tablePrinter) << info.samples << ColumnBreak() + << info.iterations << ColumnBreak() + << Duration(info.estimatedDuration) << ColumnBreak(); +} +void ConsoleReporter::benchmarkEnded(BenchmarkStats<> const& stats) { + (*m_tablePrinter) << ColumnBreak() + << Duration(stats.mean.point.count()) << ColumnBreak() + << Duration(stats.mean.lower_bound.count()) << ColumnBreak() + << Duration(stats.mean.upper_bound.count()) << ColumnBreak() << ColumnBreak() + << Duration(stats.standardDeviation.point.count()) << ColumnBreak() + << Duration(stats.standardDeviation.lower_bound.count()) << ColumnBreak() + << Duration(stats.standardDeviation.upper_bound.count()) << ColumnBreak() << ColumnBreak() << ColumnBreak() << ColumnBreak() << ColumnBreak(); +} + +void ConsoleReporter::benchmarkFailed(std::string const& error) { + Colour colour(Colour::Red); + (*m_tablePrinter) + << "Benchmark failed (" << error << ")" + << ColumnBreak() << RowBreak(); +} +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + +void ConsoleReporter::testCaseEnded(TestCaseStats const& _testCaseStats) { + m_tablePrinter->close(); + StreamingReporterBase::testCaseEnded(_testCaseStats); + m_headerPrinted = false; +} +void ConsoleReporter::testGroupEnded(TestGroupStats const& _testGroupStats) { + if (currentGroupInfo.used) { + printSummaryDivider(); + stream << "Summary for group '" << _testGroupStats.groupInfo.name << "':\n"; + printTotals(_testGroupStats.totals); + stream << '\n' << std::endl; + } + StreamingReporterBase::testGroupEnded(_testGroupStats); +} +void ConsoleReporter::testRunEnded(TestRunStats const& _testRunStats) { + printTotalsDivider(_testRunStats.totals); + printTotals(_testRunStats.totals); + stream << std::endl; + StreamingReporterBase::testRunEnded(_testRunStats); +} +void ConsoleReporter::testRunStarting(TestRunInfo const& _testInfo) { + StreamingReporterBase::testRunStarting(_testInfo); + printTestFilters(); +} + +void ConsoleReporter::lazyPrint() { + + m_tablePrinter->close(); + lazyPrintWithoutClosingBenchmarkTable(); +} + +void ConsoleReporter::lazyPrintWithoutClosingBenchmarkTable() { + + if (!currentTestRunInfo.used) + lazyPrintRunInfo(); + if (!currentGroupInfo.used) + lazyPrintGroupInfo(); + + if (!m_headerPrinted) { + printTestCaseAndSectionHeader(); + m_headerPrinted = true; + } +} +void ConsoleReporter::lazyPrintRunInfo() { + stream << '\n' << getLineOfChars<'~'>() << '\n'; + Colour colour(Colour::SecondaryText); + stream << currentTestRunInfo->name + << " is a Catch v" << libraryVersion() << " host application.\n" + << "Run with -? for options\n\n"; + + if (m_config->rngSeed() != 0) + stream << "Randomness seeded to: " << m_config->rngSeed() << "\n\n"; + + currentTestRunInfo.used = true; +} +void ConsoleReporter::lazyPrintGroupInfo() { + if (!currentGroupInfo->name.empty() && currentGroupInfo->groupsCounts > 1) { + printClosedHeader("Group: " + currentGroupInfo->name); + currentGroupInfo.used = true; + } +} +void ConsoleReporter::printTestCaseAndSectionHeader() { + assert(!m_sectionStack.empty()); + printOpenHeader(currentTestCaseInfo->name); + + if (m_sectionStack.size() > 1) { + Colour colourGuard(Colour::Headers); + + auto + it = m_sectionStack.begin() + 1, // Skip first section (test case) + itEnd = m_sectionStack.end(); + for (; it != itEnd; ++it) + printHeaderString(it->name, 2); + } + + SourceLineInfo lineInfo = m_sectionStack.back().lineInfo; + + if (!lineInfo.empty()) { + stream << getLineOfChars<'-'>() << '\n'; + Colour colourGuard(Colour::FileName); + stream << lineInfo << '\n'; + } + stream << getLineOfChars<'.'>() << '\n' << std::endl; +} + +void ConsoleReporter::printClosedHeader(std::string const& _name) { + printOpenHeader(_name); + stream << getLineOfChars<'.'>() << '\n'; +} +void ConsoleReporter::printOpenHeader(std::string const& _name) { + stream << getLineOfChars<'-'>() << '\n'; + { + Colour colourGuard(Colour::Headers); + printHeaderString(_name); + } +} + +// if string has a : in first line will set indent to follow it on +// subsequent lines +void ConsoleReporter::printHeaderString(std::string const& _string, std::size_t indent) { + std::size_t i = _string.find(": "); + if (i != std::string::npos) + i += 2; + else + i = 0; + stream << Column(_string).indent(indent + i).initialIndent(indent) << '\n'; +} + +struct SummaryColumn { + + SummaryColumn( std::string _label, Colour::Code _colour ) + : label( std::move( _label ) ), + colour( _colour ) {} + SummaryColumn addRow( std::size_t count ) { + ReusableStringStream rss; + rss << count; + std::string row = rss.str(); + for (auto& oldRow : rows) { + while (oldRow.size() < row.size()) + oldRow = ' ' + oldRow; + while (oldRow.size() > row.size()) + row = ' ' + row; + } + rows.push_back(row); + return *this; + } + + std::string label; + Colour::Code colour; + std::vector<std::string> rows; + +}; + +void ConsoleReporter::printTotals( Totals const& totals ) { + if (totals.testCases.total() == 0) { + stream << Colour(Colour::Warning) << "No tests ran\n"; + } else if (totals.assertions.total() > 0 && totals.testCases.allPassed()) { + stream << Colour(Colour::ResultSuccess) << "All tests passed"; + stream << " (" + << pluralise(totals.assertions.passed, "assertion") << " in " + << pluralise(totals.testCases.passed, "test case") << ')' + << '\n'; + } else { + + std::vector<SummaryColumn> columns; + columns.push_back(SummaryColumn("", Colour::None) + .addRow(totals.testCases.total()) + .addRow(totals.assertions.total())); + columns.push_back(SummaryColumn("passed", Colour::Success) + .addRow(totals.testCases.passed) + .addRow(totals.assertions.passed)); + columns.push_back(SummaryColumn("failed", Colour::ResultError) + .addRow(totals.testCases.failed) + .addRow(totals.assertions.failed)); + columns.push_back(SummaryColumn("failed as expected", Colour::ResultExpectedFailure) + .addRow(totals.testCases.failedButOk) + .addRow(totals.assertions.failedButOk)); + + printSummaryRow("test cases", columns, 0); + printSummaryRow("assertions", columns, 1); + } +} +void ConsoleReporter::printSummaryRow(std::string const& label, std::vector<SummaryColumn> const& cols, std::size_t row) { + for (auto col : cols) { + std::string value = col.rows[row]; + if (col.label.empty()) { + stream << label << ": "; + if (value != "0") + stream << value; + else + stream << Colour(Colour::Warning) << "- none -"; + } else if (value != "0") { + stream << Colour(Colour::LightGrey) << " | "; + stream << Colour(col.colour) + << value << ' ' << col.label; + } + } + stream << '\n'; +} + +void ConsoleReporter::printTotalsDivider(Totals const& totals) { + if (totals.testCases.total() > 0) { + std::size_t failedRatio = makeRatio(totals.testCases.failed, totals.testCases.total()); + std::size_t failedButOkRatio = makeRatio(totals.testCases.failedButOk, totals.testCases.total()); + std::size_t passedRatio = makeRatio(totals.testCases.passed, totals.testCases.total()); + while (failedRatio + failedButOkRatio + passedRatio < CATCH_CONFIG_CONSOLE_WIDTH - 1) + findMax(failedRatio, failedButOkRatio, passedRatio)++; + while (failedRatio + failedButOkRatio + passedRatio > CATCH_CONFIG_CONSOLE_WIDTH - 1) + findMax(failedRatio, failedButOkRatio, passedRatio)--; + + stream << Colour(Colour::Error) << std::string(failedRatio, '='); + stream << Colour(Colour::ResultExpectedFailure) << std::string(failedButOkRatio, '='); + if (totals.testCases.allPassed()) + stream << Colour(Colour::ResultSuccess) << std::string(passedRatio, '='); + else + stream << Colour(Colour::Success) << std::string(passedRatio, '='); + } else { + stream << Colour(Colour::Warning) << std::string(CATCH_CONFIG_CONSOLE_WIDTH - 1, '='); + } + stream << '\n'; +} +void ConsoleReporter::printSummaryDivider() { + stream << getLineOfChars<'-'>() << '\n'; +} + +void ConsoleReporter::printTestFilters() { + if (m_config->testSpec().hasFilters()) + stream << Colour(Colour::BrightYellow) << "Filters: " << serializeFilters( m_config->getTestsOrTags() ) << '\n'; +} + +CATCH_REGISTER_REPORTER("console", ConsoleReporter) + +} // end namespace Catch + +#if defined(_MSC_VER) +#pragma warning(pop) +#endif + +#if defined(__clang__) +# pragma clang diagnostic pop +#endif +// end catch_reporter_console.cpp +// start catch_reporter_junit.cpp + +#include <cassert> +#include <sstream> +#include <ctime> +#include <algorithm> + +namespace Catch { + + namespace { + std::string getCurrentTimestamp() { + // Beware, this is not reentrant because of backward compatibility issues + // Also, UTC only, again because of backward compatibility (%z is C++11) + time_t rawtime; + std::time(&rawtime); + auto const timeStampSize = sizeof("2017-01-16T17:06:45Z"); + +#ifdef _MSC_VER + std::tm timeInfo = {}; + gmtime_s(&timeInfo, &rawtime); +#else + std::tm* timeInfo; + timeInfo = std::gmtime(&rawtime); +#endif + + char timeStamp[timeStampSize]; + const char * const fmt = "%Y-%m-%dT%H:%M:%SZ"; + +#ifdef _MSC_VER + std::strftime(timeStamp, timeStampSize, fmt, &timeInfo); +#else + std::strftime(timeStamp, timeStampSize, fmt, timeInfo); +#endif + return std::string(timeStamp); + } + + std::string fileNameTag(const std::vector<std::string> &tags) { + auto it = std::find_if(begin(tags), + end(tags), + [] (std::string const& tag) {return tag.front() == '#'; }); + if (it != tags.end()) + return it->substr(1); + return std::string(); + } + } // anonymous namespace + + JunitReporter::JunitReporter( ReporterConfig const& _config ) + : CumulativeReporterBase( _config ), + xml( _config.stream() ) + { + m_reporterPrefs.shouldRedirectStdOut = true; + m_reporterPrefs.shouldReportAllAssertions = true; + } + + JunitReporter::~JunitReporter() {} + + std::string JunitReporter::getDescription() { + return "Reports test results in an XML format that looks like Ant's junitreport target"; + } + + void JunitReporter::noMatchingTestCases( std::string const& /*spec*/ ) {} + + void JunitReporter::testRunStarting( TestRunInfo const& runInfo ) { + CumulativeReporterBase::testRunStarting( runInfo ); + xml.startElement( "testsuites" ); + } + + void JunitReporter::testGroupStarting( GroupInfo const& groupInfo ) { + suiteTimer.start(); + stdOutForSuite.clear(); + stdErrForSuite.clear(); + unexpectedExceptions = 0; + CumulativeReporterBase::testGroupStarting( groupInfo ); + } + + void JunitReporter::testCaseStarting( TestCaseInfo const& testCaseInfo ) { + m_okToFail = testCaseInfo.okToFail(); + } + + bool JunitReporter::assertionEnded( AssertionStats const& assertionStats ) { + if( assertionStats.assertionResult.getResultType() == ResultWas::ThrewException && !m_okToFail ) + unexpectedExceptions++; + return CumulativeReporterBase::assertionEnded( assertionStats ); + } + + void JunitReporter::testCaseEnded( TestCaseStats const& testCaseStats ) { + stdOutForSuite += testCaseStats.stdOut; + stdErrForSuite += testCaseStats.stdErr; + CumulativeReporterBase::testCaseEnded( testCaseStats ); + } + + void JunitReporter::testGroupEnded( TestGroupStats const& testGroupStats ) { + double suiteTime = suiteTimer.getElapsedSeconds(); + CumulativeReporterBase::testGroupEnded( testGroupStats ); + writeGroup( *m_testGroups.back(), suiteTime ); + } + + void JunitReporter::testRunEndedCumulative() { + xml.endElement(); + } + + void JunitReporter::writeGroup( TestGroupNode const& groupNode, double suiteTime ) { + XmlWriter::ScopedElement e = xml.scopedElement( "testsuite" ); + + TestGroupStats const& stats = groupNode.value; + xml.writeAttribute( "name", stats.groupInfo.name ); + xml.writeAttribute( "errors", unexpectedExceptions ); + xml.writeAttribute( "failures", stats.totals.assertions.failed-unexpectedExceptions ); + xml.writeAttribute( "tests", stats.totals.assertions.total() ); + xml.writeAttribute( "hostname", "tbd" ); // !TBD + if( m_config->showDurations() == ShowDurations::Never ) + xml.writeAttribute( "time", "" ); + else + xml.writeAttribute( "time", suiteTime ); + xml.writeAttribute( "timestamp", getCurrentTimestamp() ); + + // Write properties if there are any + if (m_config->hasTestFilters() || m_config->rngSeed() != 0) { + auto properties = xml.scopedElement("properties"); + if (m_config->hasTestFilters()) { + xml.scopedElement("property") + .writeAttribute("name", "filters") + .writeAttribute("value", serializeFilters(m_config->getTestsOrTags())); + } + if (m_config->rngSeed() != 0) { + xml.scopedElement("property") + .writeAttribute("name", "random-seed") + .writeAttribute("value", m_config->rngSeed()); + } + } + + // Write test cases + for( auto const& child : groupNode.children ) + writeTestCase( *child ); + + xml.scopedElement( "system-out" ).writeText( trim( stdOutForSuite ), false ); + xml.scopedElement( "system-err" ).writeText( trim( stdErrForSuite ), false ); + } + + void JunitReporter::writeTestCase( TestCaseNode const& testCaseNode ) { + TestCaseStats const& stats = testCaseNode.value; + + // All test cases have exactly one section - which represents the + // test case itself. That section may have 0-n nested sections + assert( testCaseNode.children.size() == 1 ); + SectionNode const& rootSection = *testCaseNode.children.front(); + + std::string className = stats.testInfo.className; + + if( className.empty() ) { + className = fileNameTag(stats.testInfo.tags); + if ( className.empty() ) + className = "global"; + } + + if ( !m_config->name().empty() ) + className = m_config->name() + "." + className; + + writeSection( className, "", rootSection ); + } + + void JunitReporter::writeSection( std::string const& className, + std::string const& rootName, + SectionNode const& sectionNode ) { + std::string name = trim( sectionNode.stats.sectionInfo.name ); + if( !rootName.empty() ) + name = rootName + '/' + name; + + if( !sectionNode.assertions.empty() || + !sectionNode.stdOut.empty() || + !sectionNode.stdErr.empty() ) { + XmlWriter::ScopedElement e = xml.scopedElement( "testcase" ); + if( className.empty() ) { + xml.writeAttribute( "classname", name ); + xml.writeAttribute( "name", "root" ); + } + else { + xml.writeAttribute( "classname", className ); + xml.writeAttribute( "name", name ); + } + xml.writeAttribute( "time", ::Catch::Detail::stringify( sectionNode.stats.durationInSeconds ) ); + + writeAssertions( sectionNode ); + + if( !sectionNode.stdOut.empty() ) + xml.scopedElement( "system-out" ).writeText( trim( sectionNode.stdOut ), false ); + if( !sectionNode.stdErr.empty() ) + xml.scopedElement( "system-err" ).writeText( trim( sectionNode.stdErr ), false ); + } + for( auto const& childNode : sectionNode.childSections ) + if( className.empty() ) + writeSection( name, "", *childNode ); + else + writeSection( className, name, *childNode ); + } + + void JunitReporter::writeAssertions( SectionNode const& sectionNode ) { + for( auto const& assertion : sectionNode.assertions ) + writeAssertion( assertion ); + } + + void JunitReporter::writeAssertion( AssertionStats const& stats ) { + AssertionResult const& result = stats.assertionResult; + if( !result.isOk() ) { + std::string elementName; + switch( result.getResultType() ) { + case ResultWas::ThrewException: + case ResultWas::FatalErrorCondition: + elementName = "error"; + break; + case ResultWas::ExplicitFailure: + elementName = "failure"; + break; + case ResultWas::ExpressionFailed: + elementName = "failure"; + break; + case ResultWas::DidntThrowException: + elementName = "failure"; + break; + + // We should never see these here: + case ResultWas::Info: + case ResultWas::Warning: + case ResultWas::Ok: + case ResultWas::Unknown: + case ResultWas::FailureBit: + case ResultWas::Exception: + elementName = "internalError"; + break; + } + + XmlWriter::ScopedElement e = xml.scopedElement( elementName ); + + xml.writeAttribute( "message", result.getExpandedExpression() ); + xml.writeAttribute( "type", result.getTestMacroName() ); + + ReusableStringStream rss; + if( !result.getMessage().empty() ) + rss << result.getMessage() << '\n'; + for( auto const& msg : stats.infoMessages ) + if( msg.type == ResultWas::Info ) + rss << msg.message << '\n'; + + rss << "at " << result.getSourceInfo(); + xml.writeText( rss.str(), false ); + } + } + + CATCH_REGISTER_REPORTER( "junit", JunitReporter ) + +} // end namespace Catch +// end catch_reporter_junit.cpp +// start catch_reporter_listening.cpp + +#include <cassert> + +namespace Catch { + + ListeningReporter::ListeningReporter() { + // We will assume that listeners will always want all assertions + m_preferences.shouldReportAllAssertions = true; + } + + void ListeningReporter::addListener( IStreamingReporterPtr&& listener ) { + m_listeners.push_back( std::move( listener ) ); + } + + void ListeningReporter::addReporter(IStreamingReporterPtr&& reporter) { + assert(!m_reporter && "Listening reporter can wrap only 1 real reporter"); + m_reporter = std::move( reporter ); + m_preferences.shouldRedirectStdOut = m_reporter->getPreferences().shouldRedirectStdOut; + } + + ReporterPreferences ListeningReporter::getPreferences() const { + return m_preferences; + } + + std::set<Verbosity> ListeningReporter::getSupportedVerbosities() { + return std::set<Verbosity>{ }; + } + + void ListeningReporter::noMatchingTestCases( std::string const& spec ) { + for ( auto const& listener : m_listeners ) { + listener->noMatchingTestCases( spec ); + } + m_reporter->noMatchingTestCases( spec ); + } + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + void ListeningReporter::benchmarkPreparing( std::string const& name ) { + for (auto const& listener : m_listeners) { + listener->benchmarkPreparing(name); + } + m_reporter->benchmarkPreparing(name); + } + void ListeningReporter::benchmarkStarting( BenchmarkInfo const& benchmarkInfo ) { + for ( auto const& listener : m_listeners ) { + listener->benchmarkStarting( benchmarkInfo ); + } + m_reporter->benchmarkStarting( benchmarkInfo ); + } + void ListeningReporter::benchmarkEnded( BenchmarkStats<> const& benchmarkStats ) { + for ( auto const& listener : m_listeners ) { + listener->benchmarkEnded( benchmarkStats ); + } + m_reporter->benchmarkEnded( benchmarkStats ); + } + + void ListeningReporter::benchmarkFailed( std::string const& error ) { + for (auto const& listener : m_listeners) { + listener->benchmarkFailed(error); + } + m_reporter->benchmarkFailed(error); + } +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + void ListeningReporter::testRunStarting( TestRunInfo const& testRunInfo ) { + for ( auto const& listener : m_listeners ) { + listener->testRunStarting( testRunInfo ); + } + m_reporter->testRunStarting( testRunInfo ); + } + + void ListeningReporter::testGroupStarting( GroupInfo const& groupInfo ) { + for ( auto const& listener : m_listeners ) { + listener->testGroupStarting( groupInfo ); + } + m_reporter->testGroupStarting( groupInfo ); + } + + void ListeningReporter::testCaseStarting( TestCaseInfo const& testInfo ) { + for ( auto const& listener : m_listeners ) { + listener->testCaseStarting( testInfo ); + } + m_reporter->testCaseStarting( testInfo ); + } + + void ListeningReporter::sectionStarting( SectionInfo const& sectionInfo ) { + for ( auto const& listener : m_listeners ) { + listener->sectionStarting( sectionInfo ); + } + m_reporter->sectionStarting( sectionInfo ); + } + + void ListeningReporter::assertionStarting( AssertionInfo const& assertionInfo ) { + for ( auto const& listener : m_listeners ) { + listener->assertionStarting( assertionInfo ); + } + m_reporter->assertionStarting( assertionInfo ); + } + + // The return value indicates if the messages buffer should be cleared: + bool ListeningReporter::assertionEnded( AssertionStats const& assertionStats ) { + for( auto const& listener : m_listeners ) { + static_cast<void>( listener->assertionEnded( assertionStats ) ); + } + return m_reporter->assertionEnded( assertionStats ); + } + + void ListeningReporter::sectionEnded( SectionStats const& sectionStats ) { + for ( auto const& listener : m_listeners ) { + listener->sectionEnded( sectionStats ); + } + m_reporter->sectionEnded( sectionStats ); + } + + void ListeningReporter::testCaseEnded( TestCaseStats const& testCaseStats ) { + for ( auto const& listener : m_listeners ) { + listener->testCaseEnded( testCaseStats ); + } + m_reporter->testCaseEnded( testCaseStats ); + } + + void ListeningReporter::testGroupEnded( TestGroupStats const& testGroupStats ) { + for ( auto const& listener : m_listeners ) { + listener->testGroupEnded( testGroupStats ); + } + m_reporter->testGroupEnded( testGroupStats ); + } + + void ListeningReporter::testRunEnded( TestRunStats const& testRunStats ) { + for ( auto const& listener : m_listeners ) { + listener->testRunEnded( testRunStats ); + } + m_reporter->testRunEnded( testRunStats ); + } + + void ListeningReporter::skipTest( TestCaseInfo const& testInfo ) { + for ( auto const& listener : m_listeners ) { + listener->skipTest( testInfo ); + } + m_reporter->skipTest( testInfo ); + } + + bool ListeningReporter::isMulti() const { + return true; + } + +} // end namespace Catch +// end catch_reporter_listening.cpp +// start catch_reporter_xml.cpp + +#if defined(_MSC_VER) +#pragma warning(push) +#pragma warning(disable:4061) // Not all labels are EXPLICITLY handled in switch + // Note that 4062 (not all labels are handled + // and default is missing) is enabled +#endif + +namespace Catch { + XmlReporter::XmlReporter( ReporterConfig const& _config ) + : StreamingReporterBase( _config ), + m_xml(_config.stream()) + { + m_reporterPrefs.shouldRedirectStdOut = true; + m_reporterPrefs.shouldReportAllAssertions = true; + } + + XmlReporter::~XmlReporter() = default; + + std::string XmlReporter::getDescription() { + return "Reports test results as an XML document"; + } + + std::string XmlReporter::getStylesheetRef() const { + return std::string(); + } + + void XmlReporter::writeSourceInfo( SourceLineInfo const& sourceInfo ) { + m_xml + .writeAttribute( "filename", sourceInfo.file ) + .writeAttribute( "line", sourceInfo.line ); + } + + void XmlReporter::noMatchingTestCases( std::string const& s ) { + StreamingReporterBase::noMatchingTestCases( s ); + } + + void XmlReporter::testRunStarting( TestRunInfo const& testInfo ) { + StreamingReporterBase::testRunStarting( testInfo ); + std::string stylesheetRef = getStylesheetRef(); + if( !stylesheetRef.empty() ) + m_xml.writeStylesheetRef( stylesheetRef ); + m_xml.startElement( "Catch" ); + if( !m_config->name().empty() ) + m_xml.writeAttribute( "name", m_config->name() ); + if (m_config->testSpec().hasFilters()) + m_xml.writeAttribute( "filters", serializeFilters( m_config->getTestsOrTags() ) ); + if( m_config->rngSeed() != 0 ) + m_xml.scopedElement( "Randomness" ) + .writeAttribute( "seed", m_config->rngSeed() ); + } + + void XmlReporter::testGroupStarting( GroupInfo const& groupInfo ) { + StreamingReporterBase::testGroupStarting( groupInfo ); + m_xml.startElement( "Group" ) + .writeAttribute( "name", groupInfo.name ); + } + + void XmlReporter::testCaseStarting( TestCaseInfo const& testInfo ) { + StreamingReporterBase::testCaseStarting(testInfo); + m_xml.startElement( "TestCase" ) + .writeAttribute( "name", trim( testInfo.name ) ) + .writeAttribute( "description", testInfo.description ) + .writeAttribute( "tags", testInfo.tagsAsString() ); + + writeSourceInfo( testInfo.lineInfo ); + + if ( m_config->showDurations() == ShowDurations::Always ) + m_testCaseTimer.start(); + m_xml.ensureTagClosed(); + } + + void XmlReporter::sectionStarting( SectionInfo const& sectionInfo ) { + StreamingReporterBase::sectionStarting( sectionInfo ); + if( m_sectionDepth++ > 0 ) { + m_xml.startElement( "Section" ) + .writeAttribute( "name", trim( sectionInfo.name ) ); + writeSourceInfo( sectionInfo.lineInfo ); + m_xml.ensureTagClosed(); + } + } + + void XmlReporter::assertionStarting( AssertionInfo const& ) { } + + bool XmlReporter::assertionEnded( AssertionStats const& assertionStats ) { + + AssertionResult const& result = assertionStats.assertionResult; + + bool includeResults = m_config->includeSuccessfulResults() || !result.isOk(); + + if( includeResults || result.getResultType() == ResultWas::Warning ) { + // Print any info messages in <Info> tags. + for( auto const& msg : assertionStats.infoMessages ) { + if( msg.type == ResultWas::Info && includeResults ) { + m_xml.scopedElement( "Info" ) + .writeText( msg.message ); + } else if ( msg.type == ResultWas::Warning ) { + m_xml.scopedElement( "Warning" ) + .writeText( msg.message ); + } + } + } + + // Drop out if result was successful but we're not printing them. + if( !includeResults && result.getResultType() != ResultWas::Warning ) + return true; + + // Print the expression if there is one. + if( result.hasExpression() ) { + m_xml.startElement( "Expression" ) + .writeAttribute( "success", result.succeeded() ) + .writeAttribute( "type", result.getTestMacroName() ); + + writeSourceInfo( result.getSourceInfo() ); + + m_xml.scopedElement( "Original" ) + .writeText( result.getExpression() ); + m_xml.scopedElement( "Expanded" ) + .writeText( result.getExpandedExpression() ); + } + + // And... Print a result applicable to each result type. + switch( result.getResultType() ) { + case ResultWas::ThrewException: + m_xml.startElement( "Exception" ); + writeSourceInfo( result.getSourceInfo() ); + m_xml.writeText( result.getMessage() ); + m_xml.endElement(); + break; + case ResultWas::FatalErrorCondition: + m_xml.startElement( "FatalErrorCondition" ); + writeSourceInfo( result.getSourceInfo() ); + m_xml.writeText( result.getMessage() ); + m_xml.endElement(); + break; + case ResultWas::Info: + m_xml.scopedElement( "Info" ) + .writeText( result.getMessage() ); + break; + case ResultWas::Warning: + // Warning will already have been written + break; + case ResultWas::ExplicitFailure: + m_xml.startElement( "Failure" ); + writeSourceInfo( result.getSourceInfo() ); + m_xml.writeText( result.getMessage() ); + m_xml.endElement(); + break; + default: + break; + } + + if( result.hasExpression() ) + m_xml.endElement(); + + return true; + } + + void XmlReporter::sectionEnded( SectionStats const& sectionStats ) { + StreamingReporterBase::sectionEnded( sectionStats ); + if( --m_sectionDepth > 0 ) { + XmlWriter::ScopedElement e = m_xml.scopedElement( "OverallResults" ); + e.writeAttribute( "successes", sectionStats.assertions.passed ); + e.writeAttribute( "failures", sectionStats.assertions.failed ); + e.writeAttribute( "expectedFailures", sectionStats.assertions.failedButOk ); + + if ( m_config->showDurations() == ShowDurations::Always ) + e.writeAttribute( "durationInSeconds", sectionStats.durationInSeconds ); + + m_xml.endElement(); + } + } + + void XmlReporter::testCaseEnded( TestCaseStats const& testCaseStats ) { + StreamingReporterBase::testCaseEnded( testCaseStats ); + XmlWriter::ScopedElement e = m_xml.scopedElement( "OverallResult" ); + e.writeAttribute( "success", testCaseStats.totals.assertions.allOk() ); + + if ( m_config->showDurations() == ShowDurations::Always ) + e.writeAttribute( "durationInSeconds", m_testCaseTimer.getElapsedSeconds() ); + + if( !testCaseStats.stdOut.empty() ) + m_xml.scopedElement( "StdOut" ).writeText( trim( testCaseStats.stdOut ), false ); + if( !testCaseStats.stdErr.empty() ) + m_xml.scopedElement( "StdErr" ).writeText( trim( testCaseStats.stdErr ), false ); + + m_xml.endElement(); + } + + void XmlReporter::testGroupEnded( TestGroupStats const& testGroupStats ) { + StreamingReporterBase::testGroupEnded( testGroupStats ); + // TODO: Check testGroupStats.aborting and act accordingly. + m_xml.scopedElement( "OverallResults" ) + .writeAttribute( "successes", testGroupStats.totals.assertions.passed ) + .writeAttribute( "failures", testGroupStats.totals.assertions.failed ) + .writeAttribute( "expectedFailures", testGroupStats.totals.assertions.failedButOk ); + m_xml.endElement(); + } + + void XmlReporter::testRunEnded( TestRunStats const& testRunStats ) { + StreamingReporterBase::testRunEnded( testRunStats ); + m_xml.scopedElement( "OverallResults" ) + .writeAttribute( "successes", testRunStats.totals.assertions.passed ) + .writeAttribute( "failures", testRunStats.totals.assertions.failed ) + .writeAttribute( "expectedFailures", testRunStats.totals.assertions.failedButOk ); + m_xml.endElement(); + } + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) + void XmlReporter::benchmarkStarting(BenchmarkInfo const &info) { + m_xml.startElement("BenchmarkResults") + .writeAttribute("name", info.name) + .writeAttribute("samples", info.samples) + .writeAttribute("resamples", info.resamples) + .writeAttribute("iterations", info.iterations) + .writeAttribute("clockResolution", static_cast<uint64_t>(info.clockResolution)) + .writeAttribute("estimatedDuration", static_cast<uint64_t>(info.estimatedDuration)) + .writeComment("All values in nano seconds"); + } + + void XmlReporter::benchmarkEnded(BenchmarkStats<> const& benchmarkStats) { + m_xml.startElement("mean") + .writeAttribute("value", static_cast<uint64_t>(benchmarkStats.mean.point.count())) + .writeAttribute("lowerBound", static_cast<uint64_t>(benchmarkStats.mean.lower_bound.count())) + .writeAttribute("upperBound", static_cast<uint64_t>(benchmarkStats.mean.upper_bound.count())) + .writeAttribute("ci", benchmarkStats.mean.confidence_interval); + m_xml.endElement(); + m_xml.startElement("standardDeviation") + .writeAttribute("value", benchmarkStats.standardDeviation.point.count()) + .writeAttribute("lowerBound", benchmarkStats.standardDeviation.lower_bound.count()) + .writeAttribute("upperBound", benchmarkStats.standardDeviation.upper_bound.count()) + .writeAttribute("ci", benchmarkStats.standardDeviation.confidence_interval); + m_xml.endElement(); + m_xml.startElement("outliers") + .writeAttribute("variance", benchmarkStats.outlierVariance) + .writeAttribute("lowMild", benchmarkStats.outliers.low_mild) + .writeAttribute("lowSevere", benchmarkStats.outliers.low_severe) + .writeAttribute("highMild", benchmarkStats.outliers.high_mild) + .writeAttribute("highSevere", benchmarkStats.outliers.high_severe); + m_xml.endElement(); + m_xml.endElement(); + } + + void XmlReporter::benchmarkFailed(std::string const &error) { + m_xml.scopedElement("failed"). + writeAttribute("message", error); + m_xml.endElement(); + } +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + + CATCH_REGISTER_REPORTER( "xml", XmlReporter ) + +} // end namespace Catch + +#if defined(_MSC_VER) +#pragma warning(pop) +#endif +// end catch_reporter_xml.cpp + +namespace Catch { + LeakDetector leakDetector; +} + +#ifdef __clang__ +#pragma clang diagnostic pop +#endif + +// end catch_impl.hpp +#endif + +#ifdef CATCH_CONFIG_MAIN +// start catch_default_main.hpp + +#ifndef __OBJC__ + +#if defined(CATCH_CONFIG_WCHAR) && defined(WIN32) && defined(_UNICODE) && !defined(DO_NOT_USE_WMAIN) +// Standard C/C++ Win32 Unicode wmain entry point +extern "C" int wmain (int argc, wchar_t * argv[], wchar_t * []) { +#else +// Standard C/C++ main entry point +int main (int argc, char * argv[]) { +#endif + + return Catch::Session().run( argc, argv ); +} + +#else // __OBJC__ + +// Objective-C entry point +int main (int argc, char * const argv[]) { +#if !CATCH_ARC_ENABLED + NSAutoreleasePool * pool = [[NSAutoreleasePool alloc] init]; +#endif + + Catch::registerTestMethods(); + int result = Catch::Session().run( argc, (char**)argv ); + +#if !CATCH_ARC_ENABLED + [pool drain]; +#endif + + return result; +} + +#endif // __OBJC__ + +// end catch_default_main.hpp +#endif + +#if !defined(CATCH_CONFIG_IMPL_ONLY) + +#ifdef CLARA_CONFIG_MAIN_NOT_DEFINED +# undef CLARA_CONFIG_MAIN +#endif + +#if !defined(CATCH_CONFIG_DISABLE) +////// +// If this config identifier is defined then all CATCH macros are prefixed with CATCH_ +#ifdef CATCH_CONFIG_PREFIX_ALL + +#define CATCH_REQUIRE( ... ) INTERNAL_CATCH_TEST( "CATCH_REQUIRE", Catch::ResultDisposition::Normal, __VA_ARGS__ ) +#define CATCH_REQUIRE_FALSE( ... ) INTERNAL_CATCH_TEST( "CATCH_REQUIRE_FALSE", Catch::ResultDisposition::Normal | Catch::ResultDisposition::FalseTest, __VA_ARGS__ ) + +#define CATCH_REQUIRE_THROWS( ... ) INTERNAL_CATCH_THROWS( "CATCH_REQUIRE_THROWS", Catch::ResultDisposition::Normal, __VA_ARGS__ ) +#define CATCH_REQUIRE_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "CATCH_REQUIRE_THROWS_AS", exceptionType, Catch::ResultDisposition::Normal, expr ) +#define CATCH_REQUIRE_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "CATCH_REQUIRE_THROWS_WITH", Catch::ResultDisposition::Normal, matcher, expr ) +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CATCH_REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "CATCH_REQUIRE_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::Normal, matcher, expr ) +#endif// CATCH_CONFIG_DISABLE_MATCHERS +#define CATCH_REQUIRE_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "CATCH_REQUIRE_NOTHROW", Catch::ResultDisposition::Normal, __VA_ARGS__ ) + +#define CATCH_CHECK( ... ) INTERNAL_CATCH_TEST( "CATCH_CHECK", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define CATCH_CHECK_FALSE( ... ) INTERNAL_CATCH_TEST( "CATCH_CHECK_FALSE", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::FalseTest, __VA_ARGS__ ) +#define CATCH_CHECKED_IF( ... ) INTERNAL_CATCH_IF( "CATCH_CHECKED_IF", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define CATCH_CHECKED_ELSE( ... ) INTERNAL_CATCH_ELSE( "CATCH_CHECKED_ELSE", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define CATCH_CHECK_NOFAIL( ... ) INTERNAL_CATCH_TEST( "CATCH_CHECK_NOFAIL", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::SuppressFail, __VA_ARGS__ ) + +#define CATCH_CHECK_THROWS( ... ) INTERNAL_CATCH_THROWS( "CATCH_CHECK_THROWS", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define CATCH_CHECK_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "CATCH_CHECK_THROWS_AS", exceptionType, Catch::ResultDisposition::ContinueOnFailure, expr ) +#define CATCH_CHECK_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "CATCH_CHECK_THROWS_WITH", Catch::ResultDisposition::ContinueOnFailure, matcher, expr ) +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CATCH_CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "CATCH_CHECK_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::ContinueOnFailure, matcher, expr ) +#endif // CATCH_CONFIG_DISABLE_MATCHERS +#define CATCH_CHECK_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "CATCH_CHECK_NOTHROW", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) + +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CATCH_CHECK_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "CATCH_CHECK_THAT", matcher, Catch::ResultDisposition::ContinueOnFailure, arg ) + +#define CATCH_REQUIRE_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "CATCH_REQUIRE_THAT", matcher, Catch::ResultDisposition::Normal, arg ) +#endif // CATCH_CONFIG_DISABLE_MATCHERS + +#define CATCH_INFO( msg ) INTERNAL_CATCH_INFO( "CATCH_INFO", msg ) +#define CATCH_UNSCOPED_INFO( msg ) INTERNAL_CATCH_UNSCOPED_INFO( "CATCH_UNSCOPED_INFO", msg ) +#define CATCH_WARN( msg ) INTERNAL_CATCH_MSG( "CATCH_WARN", Catch::ResultWas::Warning, Catch::ResultDisposition::ContinueOnFailure, msg ) +#define CATCH_CAPTURE( ... ) INTERNAL_CATCH_CAPTURE( INTERNAL_CATCH_UNIQUE_NAME(capturer), "CATCH_CAPTURE",__VA_ARGS__ ) + +#define CATCH_TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE( __VA_ARGS__ ) +#define CATCH_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define CATCH_METHOD_AS_TEST_CASE( method, ... ) INTERNAL_CATCH_METHOD_AS_TEST_CASE( method, __VA_ARGS__ ) +#define CATCH_REGISTER_TEST_CASE( Function, ... ) INTERNAL_CATCH_REGISTER_TESTCASE( Function, __VA_ARGS__ ) +#define CATCH_SECTION( ... ) INTERNAL_CATCH_SECTION( __VA_ARGS__ ) +#define CATCH_DYNAMIC_SECTION( ... ) INTERNAL_CATCH_DYNAMIC_SECTION( __VA_ARGS__ ) +#define CATCH_FAIL( ... ) INTERNAL_CATCH_MSG( "CATCH_FAIL", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::Normal, __VA_ARGS__ ) +#define CATCH_FAIL_CHECK( ... ) INTERNAL_CATCH_MSG( "CATCH_FAIL_CHECK", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define CATCH_SUCCEED( ... ) INTERNAL_CATCH_MSG( "CATCH_SUCCEED", Catch::ResultWas::Ok, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) + +#define CATCH_ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE() + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ ) +#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) +#else +#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) ) +#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ ) ) +#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) ) +#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ ) ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ ) ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ ) ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) ) +#endif + +#if !defined(CATCH_CONFIG_RUNTIME_STATIC_REQUIRE) +#define CATCH_STATIC_REQUIRE( ... ) static_assert( __VA_ARGS__ , #__VA_ARGS__ ); CATCH_SUCCEED( #__VA_ARGS__ ) +#define CATCH_STATIC_REQUIRE_FALSE( ... ) static_assert( !(__VA_ARGS__), "!(" #__VA_ARGS__ ")" ); CATCH_SUCCEED( #__VA_ARGS__ ) +#else +#define CATCH_STATIC_REQUIRE( ... ) CATCH_REQUIRE( __VA_ARGS__ ) +#define CATCH_STATIC_REQUIRE_FALSE( ... ) CATCH_REQUIRE_FALSE( __VA_ARGS__ ) +#endif + +// "BDD-style" convenience wrappers +#define CATCH_SCENARIO( ... ) CATCH_TEST_CASE( "Scenario: " __VA_ARGS__ ) +#define CATCH_SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, "Scenario: " __VA_ARGS__ ) +#define CATCH_GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Given: " << desc ) +#define CATCH_AND_GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( "And given: " << desc ) +#define CATCH_WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " When: " << desc ) +#define CATCH_AND_WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And when: " << desc ) +#define CATCH_THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Then: " << desc ) +#define CATCH_AND_THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And: " << desc ) + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) +#define CATCH_BENCHMARK(...) \ + INTERNAL_CATCH_BENCHMARK(INTERNAL_CATCH_UNIQUE_NAME(____C_A_T_C_H____B_E_N_C_H____), INTERNAL_CATCH_GET_1_ARG(__VA_ARGS__,,), INTERNAL_CATCH_GET_2_ARG(__VA_ARGS__,,)) +#define CATCH_BENCHMARK_ADVANCED(name) \ + INTERNAL_CATCH_BENCHMARK_ADVANCED(INTERNAL_CATCH_UNIQUE_NAME(____C_A_T_C_H____B_E_N_C_H____), name) +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + +// If CATCH_CONFIG_PREFIX_ALL is not defined then the CATCH_ prefix is not required +#else + +#define REQUIRE( ... ) INTERNAL_CATCH_TEST( "REQUIRE", Catch::ResultDisposition::Normal, __VA_ARGS__ ) +#define REQUIRE_FALSE( ... ) INTERNAL_CATCH_TEST( "REQUIRE_FALSE", Catch::ResultDisposition::Normal | Catch::ResultDisposition::FalseTest, __VA_ARGS__ ) + +#define REQUIRE_THROWS( ... ) INTERNAL_CATCH_THROWS( "REQUIRE_THROWS", Catch::ResultDisposition::Normal, __VA_ARGS__ ) +#define REQUIRE_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "REQUIRE_THROWS_AS", exceptionType, Catch::ResultDisposition::Normal, expr ) +#define REQUIRE_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "REQUIRE_THROWS_WITH", Catch::ResultDisposition::Normal, matcher, expr ) +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "REQUIRE_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::Normal, matcher, expr ) +#endif // CATCH_CONFIG_DISABLE_MATCHERS +#define REQUIRE_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "REQUIRE_NOTHROW", Catch::ResultDisposition::Normal, __VA_ARGS__ ) + +#define CHECK( ... ) INTERNAL_CATCH_TEST( "CHECK", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define CHECK_FALSE( ... ) INTERNAL_CATCH_TEST( "CHECK_FALSE", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::FalseTest, __VA_ARGS__ ) +#define CHECKED_IF( ... ) INTERNAL_CATCH_IF( "CHECKED_IF", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define CHECKED_ELSE( ... ) INTERNAL_CATCH_ELSE( "CHECKED_ELSE", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define CHECK_NOFAIL( ... ) INTERNAL_CATCH_TEST( "CHECK_NOFAIL", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::SuppressFail, __VA_ARGS__ ) + +#define CHECK_THROWS( ... ) INTERNAL_CATCH_THROWS( "CHECK_THROWS", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define CHECK_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "CHECK_THROWS_AS", exceptionType, Catch::ResultDisposition::ContinueOnFailure, expr ) +#define CHECK_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "CHECK_THROWS_WITH", Catch::ResultDisposition::ContinueOnFailure, matcher, expr ) +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "CHECK_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::ContinueOnFailure, matcher, expr ) +#endif // CATCH_CONFIG_DISABLE_MATCHERS +#define CHECK_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "CHECK_NOTHROW", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) + +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CHECK_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "CHECK_THAT", matcher, Catch::ResultDisposition::ContinueOnFailure, arg ) + +#define REQUIRE_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "REQUIRE_THAT", matcher, Catch::ResultDisposition::Normal, arg ) +#endif // CATCH_CONFIG_DISABLE_MATCHERS + +#define INFO( msg ) INTERNAL_CATCH_INFO( "INFO", msg ) +#define UNSCOPED_INFO( msg ) INTERNAL_CATCH_UNSCOPED_INFO( "UNSCOPED_INFO", msg ) +#define WARN( msg ) INTERNAL_CATCH_MSG( "WARN", Catch::ResultWas::Warning, Catch::ResultDisposition::ContinueOnFailure, msg ) +#define CAPTURE( ... ) INTERNAL_CATCH_CAPTURE( INTERNAL_CATCH_UNIQUE_NAME(capturer), "CAPTURE",__VA_ARGS__ ) + +#define TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE( __VA_ARGS__ ) +#define TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define METHOD_AS_TEST_CASE( method, ... ) INTERNAL_CATCH_METHOD_AS_TEST_CASE( method, __VA_ARGS__ ) +#define REGISTER_TEST_CASE( Function, ... ) INTERNAL_CATCH_REGISTER_TESTCASE( Function, __VA_ARGS__ ) +#define SECTION( ... ) INTERNAL_CATCH_SECTION( __VA_ARGS__ ) +#define DYNAMIC_SECTION( ... ) INTERNAL_CATCH_DYNAMIC_SECTION( __VA_ARGS__ ) +#define FAIL( ... ) INTERNAL_CATCH_MSG( "FAIL", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::Normal, __VA_ARGS__ ) +#define FAIL_CHECK( ... ) INTERNAL_CATCH_MSG( "FAIL_CHECK", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define SUCCEED( ... ) INTERNAL_CATCH_MSG( "SUCCEED", Catch::ResultWas::Ok, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ ) +#define ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE() + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ ) +#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) +#define TEMPLATE_LIST_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE(__VA_ARGS__) +#define TEMPLATE_LIST_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#else +#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) ) +#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ ) ) +#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) ) +#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) ) +#define TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ ) ) +#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ ) ) +#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ ) ) +#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) ) +#define TEMPLATE_LIST_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE( __VA_ARGS__ ) ) +#define TEMPLATE_LIST_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD( className, __VA_ARGS__ ) ) +#endif + +#if !defined(CATCH_CONFIG_RUNTIME_STATIC_REQUIRE) +#define STATIC_REQUIRE( ... ) static_assert( __VA_ARGS__, #__VA_ARGS__ ); SUCCEED( #__VA_ARGS__ ) +#define STATIC_REQUIRE_FALSE( ... ) static_assert( !(__VA_ARGS__), "!(" #__VA_ARGS__ ")" ); SUCCEED( "!(" #__VA_ARGS__ ")" ) +#else +#define STATIC_REQUIRE( ... ) REQUIRE( __VA_ARGS__ ) +#define STATIC_REQUIRE_FALSE( ... ) REQUIRE_FALSE( __VA_ARGS__ ) +#endif + +#endif + +#define CATCH_TRANSLATE_EXCEPTION( signature ) INTERNAL_CATCH_TRANSLATE_EXCEPTION( signature ) + +// "BDD-style" convenience wrappers +#define SCENARIO( ... ) TEST_CASE( "Scenario: " __VA_ARGS__ ) +#define SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, "Scenario: " __VA_ARGS__ ) + +#define GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Given: " << desc ) +#define AND_GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( "And given: " << desc ) +#define WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " When: " << desc ) +#define AND_WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And when: " << desc ) +#define THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Then: " << desc ) +#define AND_THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And: " << desc ) + +#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING) +#define BENCHMARK(...) \ + INTERNAL_CATCH_BENCHMARK(INTERNAL_CATCH_UNIQUE_NAME(____C_A_T_C_H____B_E_N_C_H____), INTERNAL_CATCH_GET_1_ARG(__VA_ARGS__,,), INTERNAL_CATCH_GET_2_ARG(__VA_ARGS__,,)) +#define BENCHMARK_ADVANCED(name) \ + INTERNAL_CATCH_BENCHMARK_ADVANCED(INTERNAL_CATCH_UNIQUE_NAME(____C_A_T_C_H____B_E_N_C_H____), name) +#endif // CATCH_CONFIG_ENABLE_BENCHMARKING + +using Catch::Detail::Approx; + +#else // CATCH_CONFIG_DISABLE + +////// +// If this config identifier is defined then all CATCH macros are prefixed with CATCH_ +#ifdef CATCH_CONFIG_PREFIX_ALL + +#define CATCH_REQUIRE( ... ) (void)(0) +#define CATCH_REQUIRE_FALSE( ... ) (void)(0) + +#define CATCH_REQUIRE_THROWS( ... ) (void)(0) +#define CATCH_REQUIRE_THROWS_AS( expr, exceptionType ) (void)(0) +#define CATCH_REQUIRE_THROWS_WITH( expr, matcher ) (void)(0) +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CATCH_REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0) +#endif// CATCH_CONFIG_DISABLE_MATCHERS +#define CATCH_REQUIRE_NOTHROW( ... ) (void)(0) + +#define CATCH_CHECK( ... ) (void)(0) +#define CATCH_CHECK_FALSE( ... ) (void)(0) +#define CATCH_CHECKED_IF( ... ) if (__VA_ARGS__) +#define CATCH_CHECKED_ELSE( ... ) if (!(__VA_ARGS__)) +#define CATCH_CHECK_NOFAIL( ... ) (void)(0) + +#define CATCH_CHECK_THROWS( ... ) (void)(0) +#define CATCH_CHECK_THROWS_AS( expr, exceptionType ) (void)(0) +#define CATCH_CHECK_THROWS_WITH( expr, matcher ) (void)(0) +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CATCH_CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0) +#endif // CATCH_CONFIG_DISABLE_MATCHERS +#define CATCH_CHECK_NOTHROW( ... ) (void)(0) + +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CATCH_CHECK_THAT( arg, matcher ) (void)(0) + +#define CATCH_REQUIRE_THAT( arg, matcher ) (void)(0) +#endif // CATCH_CONFIG_DISABLE_MATCHERS + +#define CATCH_INFO( msg ) (void)(0) +#define CATCH_UNSCOPED_INFO( msg ) (void)(0) +#define CATCH_WARN( msg ) (void)(0) +#define CATCH_CAPTURE( msg ) (void)(0) + +#define CATCH_TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ )) +#define CATCH_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ )) +#define CATCH_METHOD_AS_TEST_CASE( method, ... ) +#define CATCH_REGISTER_TEST_CASE( Function, ... ) (void)(0) +#define CATCH_SECTION( ... ) +#define CATCH_DYNAMIC_SECTION( ... ) +#define CATCH_FAIL( ... ) (void)(0) +#define CATCH_FAIL_CHECK( ... ) (void)(0) +#define CATCH_SUCCEED( ... ) (void)(0) + +#define CATCH_ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ )) + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__) +#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__) +#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__) +#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#else +#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__) ) +#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__) ) +#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__ ) ) +#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ ) ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#endif + +// "BDD-style" convenience wrappers +#define CATCH_SCENARIO( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ )) +#define CATCH_SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_METHOD_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), className ) +#define CATCH_GIVEN( desc ) +#define CATCH_AND_GIVEN( desc ) +#define CATCH_WHEN( desc ) +#define CATCH_AND_WHEN( desc ) +#define CATCH_THEN( desc ) +#define CATCH_AND_THEN( desc ) + +#define CATCH_STATIC_REQUIRE( ... ) (void)(0) +#define CATCH_STATIC_REQUIRE_FALSE( ... ) (void)(0) + +// If CATCH_CONFIG_PREFIX_ALL is not defined then the CATCH_ prefix is not required +#else + +#define REQUIRE( ... ) (void)(0) +#define REQUIRE_FALSE( ... ) (void)(0) + +#define REQUIRE_THROWS( ... ) (void)(0) +#define REQUIRE_THROWS_AS( expr, exceptionType ) (void)(0) +#define REQUIRE_THROWS_WITH( expr, matcher ) (void)(0) +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0) +#endif // CATCH_CONFIG_DISABLE_MATCHERS +#define REQUIRE_NOTHROW( ... ) (void)(0) + +#define CHECK( ... ) (void)(0) +#define CHECK_FALSE( ... ) (void)(0) +#define CHECKED_IF( ... ) if (__VA_ARGS__) +#define CHECKED_ELSE( ... ) if (!(__VA_ARGS__)) +#define CHECK_NOFAIL( ... ) (void)(0) + +#define CHECK_THROWS( ... ) (void)(0) +#define CHECK_THROWS_AS( expr, exceptionType ) (void)(0) +#define CHECK_THROWS_WITH( expr, matcher ) (void)(0) +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0) +#endif // CATCH_CONFIG_DISABLE_MATCHERS +#define CHECK_NOTHROW( ... ) (void)(0) + +#if !defined(CATCH_CONFIG_DISABLE_MATCHERS) +#define CHECK_THAT( arg, matcher ) (void)(0) + +#define REQUIRE_THAT( arg, matcher ) (void)(0) +#endif // CATCH_CONFIG_DISABLE_MATCHERS + +#define INFO( msg ) (void)(0) +#define UNSCOPED_INFO( msg ) (void)(0) +#define WARN( msg ) (void)(0) +#define CAPTURE( msg ) (void)(0) + +#define TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ )) +#define TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ )) +#define METHOD_AS_TEST_CASE( method, ... ) +#define REGISTER_TEST_CASE( Function, ... ) (void)(0) +#define SECTION( ... ) +#define DYNAMIC_SECTION( ... ) +#define FAIL( ... ) (void)(0) +#define FAIL_CHECK( ... ) (void)(0) +#define SUCCEED( ... ) (void)(0) +#define ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ )) + +#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR +#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__) +#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__) +#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__) +#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#else +#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__) ) +#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__) ) +#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__ ) ) +#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ ) ) +#define TEMPLATE_PRODUCT_TEST_CASE( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) +#endif + +#define STATIC_REQUIRE( ... ) (void)(0) +#define STATIC_REQUIRE_FALSE( ... ) (void)(0) + +#endif + +#define CATCH_TRANSLATE_EXCEPTION( signature ) INTERNAL_CATCH_TRANSLATE_EXCEPTION_NO_REG( INTERNAL_CATCH_UNIQUE_NAME( catch_internal_ExceptionTranslator ), signature ) + +// "BDD-style" convenience wrappers +#define SCENARIO( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ) ) +#define SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_METHOD_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), className ) + +#define GIVEN( desc ) +#define AND_GIVEN( desc ) +#define WHEN( desc ) +#define AND_WHEN( desc ) +#define THEN( desc ) +#define AND_THEN( desc ) + +using Catch::Detail::Approx; + +#endif + +#endif // ! CATCH_CONFIG_IMPL_ONLY + +// start catch_reenable_warnings.h + + +#ifdef __clang__ +# ifdef __ICC // icpc defines the __clang__ macro +# pragma warning(pop) +# else +# pragma clang diagnostic pop +# endif +#elif defined __GNUC__ +# pragma GCC diagnostic pop +#endif + +// end catch_reenable_warnings.h +// end catch.hpp +#endif // TWOBLUECUBES_SINGLE_INCLUDE_CATCH_HPP_INCLUDED +