diff --git a/.gitignore b/.gitignore
index 47f56b8b7fc6224580f4fb52377e8e3f60f76c41..e349c6824f116b86c2b319fe28b2efd2242044b2 100644
--- a/.gitignore
+++ b/.gitignore
@@ -47,6 +47,7 @@ install_manifest.txt
compile_commands.json
CTestTestfile.cmake
_deps
+build
### CMake Patch ###
# External projects
@@ -80,4 +81,8 @@ Network Trash Folder
Temporary Items
.apdisk
+# Documentation
+docs/html
+docs/latex
+
# End of https://www.gitignore.io/api/c++,cmake
diff --git a/CMakeLists.txt b/CMakeLists.txt
new file mode 100644
index 0000000000000000000000000000000000000000..09df4c0d9cf1bb7707804c58454756e87962c57d
--- /dev/null
+++ b/CMakeLists.txt
@@ -0,0 +1,21 @@
+# Specify the minimum version for CMake
+cmake_minimum_required(VERSION 3.0.0)
+
+# Project information
+project(factor-oracle CXX)
+
+# Source folder
+add_subdirectory(src)
+
+# Test folder
+option(BUILD_TESTS "Build Tests" ON)
+if(BUILD_TESTS)
+ enable_testing()
+ add_subdirectory(tests)
+endif(BUILD_TESTS)
+
+# Documentation folder
+option(BUILD_DOCS "Build Documentation")
+if(BUILD_DOCS)
+ add_subdirectory(docs)
+endif(BUILD_DOCS)
diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md
new file mode 100644
index 0000000000000000000000000000000000000000..9f439b82467a28538de05910717c4f222591a302
--- /dev/null
+++ b/CONTRIBUTING.md
@@ -0,0 +1,11 @@
+# Style Guide
+
+We use the Google C++ Style Guide that can be found at https://google.github.io/styleguide/cppguide.html
+
+# Testing
+
+We use the test framework [catch2](https://github.com/catchorg/Catch2) for writing and running the test cases.
+
+# Documentation
+
+We use [Doxygen](http://www.doxygen.org/) for writing and generating the documentation.
diff --git a/docs/CMakeLists.txt b/docs/CMakeLists.txt
new file mode 100644
index 0000000000000000000000000000000000000000..653d9e5999773be747b753af7bf6e94d3d9e193e
--- /dev/null
+++ b/docs/CMakeLists.txt
@@ -0,0 +1,26 @@
+# Specify the minimum version for CMake
+cmake_minimum_required(VERSION 3.0.0)
+
+# project information
+project(factor-oracle_docs)
+
+# check if Doxygen is installed
+find_package(Doxygen)
+
+if (DOXYGEN_FOUND)
+ # set input and output files
+ set(DOXYGEN_IN Doxyfile)
+ set(DOXYGEN_OUT ${CMAKE_CURRENT_BINARY_DIR}/Doxyfile)
+
+ # request to configure the file
+ configure_file(${DOXYGEN_IN} ${DOXYGEN_OUT} @ONLY)
+
+ # note the option ALL which allows to build the docs together with the application
+ add_custom_target(doxygen ALL
+ COMMAND ${DOXYGEN_EXECUTABLE} ${DOXYGEN_OUT}
+ WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}
+ COMMENT "Generating API documentation with Doxygen"
+ VERBATIM)
+else (DOXYGEN_FOUND)
+ message("Doxygen need to be installed to generate the doxygen documentation")
+endif (DOXYGEN_FOUND)
diff --git a/docs/Doxyfile b/docs/Doxyfile
new file mode 100644
index 0000000000000000000000000000000000000000..5891bf4c11ec109eb3dd3cb31646c80ab59761fe
--- /dev/null
+++ b/docs/Doxyfile
@@ -0,0 +1,2494 @@
+# Doxyfile 1.8.13
+
+# This file describes the settings to be used by the documentation system
+# doxygen (www.doxygen.org) for a project.
+#
+# All text after a double hash (##) is considered a comment and is placed in
+# front of the TAG it is preceding.
+#
+# All text after a single hash (#) is considered a comment and will be ignored.
+# The format is:
+# TAG = value [value, ...]
+# For lists, items can also be appended using:
+# TAG += value [value, ...]
+# Values that contain spaces should be placed between quotes (\" \").
+
+#---------------------------------------------------------------------------
+# Project related configuration options
+#---------------------------------------------------------------------------
+
+# This tag specifies the encoding used for all characters in the config file
+# that follow. The default is UTF-8 which is also the encoding used for all text
+# before the first occurrence of this tag. Doxygen uses libiconv (or the iconv
+# built into libc) for the transcoding. See http://www.gnu.org/software/libiconv
+# for the list of possible encodings.
+# The default value is: UTF-8.
+
+DOXYFILE_ENCODING = UTF-8
+
+# The PROJECT_NAME tag is a single word (or a sequence of words surrounded by
+# double-quotes, unless you are using Doxywizard) that should identify the
+# project for which the documentation is generated. This name is used in the
+# title of most generated pages and in a few other places.
+# The default value is: My Project.
+
+PROJECT_NAME = "Factor Oracle"
+
+# The PROJECT_NUMBER tag can be used to enter a project or revision number. This
+# could be handy for archiving the generated documentation or if some version
+# control system is used.
+
+PROJECT_NUMBER =
+
+# Using the PROJECT_BRIEF tag one can provide an optional one line description
+# for a project that appears at the top of each page and should give viewer a
+# quick idea about the purpose of the project. Keep the description short.
+
+PROJECT_BRIEF =
+
+# With the PROJECT_LOGO tag one can specify a logo or an icon that is included
+# in the documentation. The maximum height of the logo should not exceed 55
+# pixels and the maximum width should not exceed 200 pixels. Doxygen will copy
+# the logo to the output directory.
+
+PROJECT_LOGO =
+
+# The OUTPUT_DIRECTORY tag is used to specify the (relative or absolute) path
+# into which the generated documentation will be written. If a relative path is
+# entered, it will be relative to the location where doxygen was started. If
+# left blank the current directory will be used.
+
+OUTPUT_DIRECTORY = @CMAKE_CURRENT_SOURCE_DIR@/../build/docs
+
+# If the CREATE_SUBDIRS tag is set to YES then doxygen will create 4096 sub-
+# directories (in 2 levels) under the output directory of each output format and
+# will distribute the generated files over these directories. Enabling this
+# option can be useful when feeding doxygen a huge amount of source files, where
+# putting all generated files in the same directory would otherwise causes
+# performance problems for the file system.
+# The default value is: NO.
+
+CREATE_SUBDIRS = NO
+
+# If the ALLOW_UNICODE_NAMES tag is set to YES, doxygen will allow non-ASCII
+# characters to appear in the names of generated files. If set to NO, non-ASCII
+# characters will be escaped, for example _xE3_x81_x84 will be used for Unicode
+# U+3044.
+# The default value is: NO.
+
+ALLOW_UNICODE_NAMES = NO
+
+# The OUTPUT_LANGUAGE tag is used to specify the language in which all
+# documentation generated by doxygen is written. Doxygen will use this
+# information to generate all constant output in the proper language.
+# Possible values are: Afrikaans, Arabic, Armenian, Brazilian, Catalan, Chinese,
+# Chinese-Traditional, Croatian, Czech, Danish, Dutch, English (United States),
+# Esperanto, Farsi (Persian), Finnish, French, German, Greek, Hungarian,
+# Indonesian, Italian, Japanese, Japanese-en (Japanese with English messages),
+# Korean, Korean-en (Korean with English messages), Latvian, Lithuanian,
+# Macedonian, Norwegian, Persian (Farsi), Polish, Portuguese, Romanian, Russian,
+# Serbian, Serbian-Cyrillic, Slovak, Slovene, Spanish, Swedish, Turkish,
+# Ukrainian and Vietnamese.
+# The default value is: English.
+
+OUTPUT_LANGUAGE = English
+
+# If the BRIEF_MEMBER_DESC tag is set to YES, doxygen will include brief member
+# descriptions after the members that are listed in the file and class
+# documentation (similar to Javadoc). Set to NO to disable this.
+# The default value is: YES.
+
+BRIEF_MEMBER_DESC = YES
+
+# If the REPEAT_BRIEF tag is set to YES, doxygen will prepend the brief
+# description of a member or function before the detailed description
+#
+# Note: If both HIDE_UNDOC_MEMBERS and BRIEF_MEMBER_DESC are set to NO, the
+# brief descriptions will be completely suppressed.
+# The default value is: YES.
+
+REPEAT_BRIEF = YES
+
+# This tag implements a quasi-intelligent brief description abbreviator that is
+# used to form the text in various listings. Each string in this list, if found
+# as the leading text of the brief description, will be stripped from the text
+# and the result, after processing the whole list, is used as the annotated
+# text. Otherwise, the brief description is used as-is. If left blank, the
+# following values are used ($name is automatically replaced with the name of
+# the entity):The $name class, The $name widget, The $name file, is, provides,
+# specifies, contains, represents, a, an and the.
+
+ABBREVIATE_BRIEF = "The $name class" \
+ "The $name widget" \
+ "The $name file" \
+ is \
+ provides \
+ specifies \
+ contains \
+ represents \
+ a \
+ an \
+ the
+
+# If the ALWAYS_DETAILED_SEC and REPEAT_BRIEF tags are both set to YES then
+# doxygen will generate a detailed section even if there is only a brief
+# description.
+# The default value is: NO.
+
+ALWAYS_DETAILED_SEC = NO
+
+# If the INLINE_INHERITED_MEMB tag is set to YES, doxygen will show all
+# inherited members of a class in the documentation of that class as if those
+# members were ordinary class members. Constructors, destructors and assignment
+# operators of the base classes will not be shown.
+# The default value is: NO.
+
+INLINE_INHERITED_MEMB = NO
+
+# If the FULL_PATH_NAMES tag is set to YES, doxygen will prepend the full path
+# before files name in the file list and in the header files. If set to NO the
+# shortest path that makes the file name unique will be used
+# The default value is: YES.
+
+FULL_PATH_NAMES = YES
+
+# The STRIP_FROM_PATH tag can be used to strip a user-defined part of the path.
+# Stripping is only done if one of the specified strings matches the left-hand
+# part of the path. The tag can be used to show relative paths in the file list.
+# If left blank the directory from which doxygen is run is used as the path to
+# strip.
+#
+# Note that you can specify absolute paths here, but also relative paths, which
+# will be relative from the directory where doxygen is started.
+# This tag requires that the tag FULL_PATH_NAMES is set to YES.
+
+STRIP_FROM_PATH =
+
+# The STRIP_FROM_INC_PATH tag can be used to strip a user-defined part of the
+# path mentioned in the documentation of a class, which tells the reader which
+# header file to include in order to use a class. If left blank only the name of
+# the header file containing the class definition is used. Otherwise one should
+# specify the list of include paths that are normally passed to the compiler
+# using the -I flag.
+
+STRIP_FROM_INC_PATH =
+
+# If the SHORT_NAMES tag is set to YES, doxygen will generate much shorter (but
+# less readable) file names. This can be useful is your file systems doesn't
+# support long names like on DOS, Mac, or CD-ROM.
+# The default value is: NO.
+
+SHORT_NAMES = NO
+
+# If the JAVADOC_AUTOBRIEF tag is set to YES then doxygen will interpret the
+# first line (until the first dot) of a Javadoc-style comment as the brief
+# description. If set to NO, the Javadoc-style will behave just like regular Qt-
+# style comments (thus requiring an explicit @brief command for a brief
+# description.)
+# The default value is: NO.
+
+JAVADOC_AUTOBRIEF = NO
+
+# If the QT_AUTOBRIEF tag is set to YES then doxygen will interpret the first
+# line (until the first dot) of a Qt-style comment as the brief description. If
+# set to NO, the Qt-style will behave just like regular Qt-style comments (thus
+# requiring an explicit \brief command for a brief description.)
+# The default value is: NO.
+
+QT_AUTOBRIEF = NO
+
+# The MULTILINE_CPP_IS_BRIEF tag can be set to YES to make doxygen treat a
+# multi-line C++ special comment block (i.e. a block of //! or /// comments) as
+# a brief description. This used to be the default behavior. The new default is
+# to treat a multi-line C++ comment block as a detailed description. Set this
+# tag to YES if you prefer the old behavior instead.
+#
+# Note that setting this tag to YES also means that rational rose comments are
+# not recognized any more.
+# The default value is: NO.
+
+MULTILINE_CPP_IS_BRIEF = NO
+
+# If the INHERIT_DOCS tag is set to YES then an undocumented member inherits the
+# documentation from any documented member that it re-implements.
+# The default value is: YES.
+
+INHERIT_DOCS = YES
+
+# If the SEPARATE_MEMBER_PAGES tag is set to YES then doxygen will produce a new
+# page for each member. If set to NO, the documentation of a member will be part
+# of the file/class/namespace that contains it.
+# The default value is: NO.
+
+SEPARATE_MEMBER_PAGES = NO
+
+# The TAB_SIZE tag can be used to set the number of spaces in a tab. Doxygen
+# uses this value to replace tabs by spaces in code fragments.
+# Minimum value: 1, maximum value: 16, default value: 4.
+
+TAB_SIZE = 4
+
+# This tag can be used to specify a number of aliases that act as commands in
+# the documentation. An alias has the form:
+# name=value
+# For example adding
+# "sideeffect=@par Side Effects:\n"
+# will allow you to put the command \sideeffect (or @sideeffect) in the
+# documentation, which will result in a user-defined paragraph with heading
+# "Side Effects:". You can put \n's in the value part of an alias to insert
+# newlines.
+
+ALIASES =
+
+# This tag can be used to specify a number of word-keyword mappings (TCL only).
+# A mapping has the form "name=value". For example adding "class=itcl::class"
+# will allow you to use the command class in the itcl::class meaning.
+
+TCL_SUBST =
+
+# Set the OPTIMIZE_OUTPUT_FOR_C tag to YES if your project consists of C sources
+# only. Doxygen will then generate output that is more tailored for C. For
+# instance, some of the names that are used will be different. The list of all
+# members will be omitted, etc.
+# The default value is: NO.
+
+OPTIMIZE_OUTPUT_FOR_C = NO
+
+# Set the OPTIMIZE_OUTPUT_JAVA tag to YES if your project consists of Java or
+# Python sources only. Doxygen will then generate output that is more tailored
+# for that language. For instance, namespaces will be presented as packages,
+# qualified scopes will look different, etc.
+# The default value is: NO.
+
+OPTIMIZE_OUTPUT_JAVA = NO
+
+# Set the OPTIMIZE_FOR_FORTRAN tag to YES if your project consists of Fortran
+# sources. Doxygen will then generate output that is tailored for Fortran.
+# The default value is: NO.
+
+OPTIMIZE_FOR_FORTRAN = NO
+
+# Set the OPTIMIZE_OUTPUT_VHDL tag to YES if your project consists of VHDL
+# sources. Doxygen will then generate output that is tailored for VHDL.
+# The default value is: NO.
+
+OPTIMIZE_OUTPUT_VHDL = NO
+
+# Doxygen selects the parser to use depending on the extension of the files it
+# parses. With this tag you can assign which parser to use for a given
+# extension. Doxygen has a built-in mapping, but you can override or extend it
+# using this tag. The format is ext=language, where ext is a file extension, and
+# language is one of the parsers supported by doxygen: IDL, Java, Javascript,
+# C#, C, C++, D, PHP, Objective-C, Python, Fortran (fixed format Fortran:
+# FortranFixed, free formatted Fortran: FortranFree, unknown formatted Fortran:
+# Fortran. In the later case the parser tries to guess whether the code is fixed
+# or free formatted code, this is the default for Fortran type files), VHDL. For
+# instance to make doxygen treat .inc files as Fortran files (default is PHP),
+# and .f files as C (default is Fortran), use: inc=Fortran f=C.
+#
+# Note: For files without extension you can use no_extension as a placeholder.
+#
+# Note that for custom extensions you also need to set FILE_PATTERNS otherwise
+# the files are not read by doxygen.
+
+EXTENSION_MAPPING =
+
+# If the MARKDOWN_SUPPORT tag is enabled then doxygen pre-processes all comments
+# according to the Markdown format, which allows for more readable
+# documentation. See http://daringfireball.net/projects/markdown/ for details.
+# The output of markdown processing is further processed by doxygen, so you can
+# mix doxygen, HTML, and XML commands with Markdown formatting. Disable only in
+# case of backward compatibilities issues.
+# The default value is: YES.
+
+MARKDOWN_SUPPORT = YES
+
+# When the TOC_INCLUDE_HEADINGS tag is set to a non-zero value, all headings up
+# to that level are automatically included in the table of contents, even if
+# they do not have an id attribute.
+# Note: This feature currently applies only to Markdown headings.
+# Minimum value: 0, maximum value: 99, default value: 0.
+# This tag requires that the tag MARKDOWN_SUPPORT is set to YES.
+
+TOC_INCLUDE_HEADINGS = 0
+
+# When enabled doxygen tries to link words that correspond to documented
+# classes, or namespaces to their corresponding documentation. Such a link can
+# be prevented in individual cases by putting a % sign in front of the word or
+# globally by setting AUTOLINK_SUPPORT to NO.
+# The default value is: YES.
+
+AUTOLINK_SUPPORT = YES
+
+# If you use STL classes (i.e. std::string, std::vector, etc.) but do not want
+# to include (a tag file for) the STL sources as input, then you should set this
+# tag to YES in order to let doxygen match functions declarations and
+# definitions whose arguments contain STL classes (e.g. func(std::string);
+# versus func(std::string) {}). This also make the inheritance and collaboration
+# diagrams that involve STL classes more complete and accurate.
+# The default value is: NO.
+
+BUILTIN_STL_SUPPORT = NO
+
+# If you use Microsoft's C++/CLI language, you should set this option to YES to
+# enable parsing support.
+# The default value is: NO.
+
+CPP_CLI_SUPPORT = NO
+
+# Set the SIP_SUPPORT tag to YES if your project consists of sip (see:
+# http://www.riverbankcomputing.co.uk/software/sip/intro) sources only. Doxygen
+# will parse them like normal C++ but will assume all classes use public instead
+# of private inheritance when no explicit protection keyword is present.
+# The default value is: NO.
+
+SIP_SUPPORT = NO
+
+# For Microsoft's IDL there are propget and propput attributes to indicate
+# getter and setter methods for a property. Setting this option to YES will make
+# doxygen to replace the get and set methods by a property in the documentation.
+# This will only work if the methods are indeed getting or setting a simple
+# type. If this is not the case, or you want to show the methods anyway, you
+# should set this option to NO.
+# The default value is: YES.
+
+IDL_PROPERTY_SUPPORT = YES
+
+# If member grouping is used in the documentation and the DISTRIBUTE_GROUP_DOC
+# tag is set to YES then doxygen will reuse the documentation of the first
+# member in the group (if any) for the other members of the group. By default
+# all members of a group must be documented explicitly.
+# The default value is: NO.
+
+DISTRIBUTE_GROUP_DOC = NO
+
+# If one adds a struct or class to a group and this option is enabled, then also
+# any nested class or struct is added to the same group. By default this option
+# is disabled and one has to add nested compounds explicitly via \ingroup.
+# The default value is: NO.
+
+GROUP_NESTED_COMPOUNDS = NO
+
+# Set the SUBGROUPING tag to YES to allow class member groups of the same type
+# (for instance a group of public functions) to be put as a subgroup of that
+# type (e.g. under the Public Functions section). Set it to NO to prevent
+# subgrouping. Alternatively, this can be done per class using the
+# \nosubgrouping command.
+# The default value is: YES.
+
+SUBGROUPING = YES
+
+# When the INLINE_GROUPED_CLASSES tag is set to YES, classes, structs and unions
+# are shown inside the group in which they are included (e.g. using \ingroup)
+# instead of on a separate page (for HTML and Man pages) or section (for LaTeX
+# and RTF).
+#
+# Note that this feature does not work in combination with
+# SEPARATE_MEMBER_PAGES.
+# The default value is: NO.
+
+INLINE_GROUPED_CLASSES = NO
+
+# When the INLINE_SIMPLE_STRUCTS tag is set to YES, structs, classes, and unions
+# with only public data fields or simple typedef fields will be shown inline in
+# the documentation of the scope in which they are defined (i.e. file,
+# namespace, or group documentation), provided this scope is documented. If set
+# to NO, structs, classes, and unions are shown on a separate page (for HTML and
+# Man pages) or section (for LaTeX and RTF).
+# The default value is: NO.
+
+INLINE_SIMPLE_STRUCTS = NO
+
+# When TYPEDEF_HIDES_STRUCT tag is enabled, a typedef of a struct, union, or
+# enum is documented as struct, union, or enum with the name of the typedef. So
+# typedef struct TypeS {} TypeT, will appear in the documentation as a struct
+# with name TypeT. When disabled the typedef will appear as a member of a file,
+# namespace, or class. And the struct will be named TypeS. This can typically be
+# useful for C code in case the coding convention dictates that all compound
+# types are typedef'ed and only the typedef is referenced, never the tag name.
+# The default value is: NO.
+
+TYPEDEF_HIDES_STRUCT = NO
+
+# The size of the symbol lookup cache can be set using LOOKUP_CACHE_SIZE. This
+# cache is used to resolve symbols given their name and scope. Since this can be
+# an expensive process and often the same symbol appears multiple times in the
+# code, doxygen keeps a cache of pre-resolved symbols. If the cache is too small
+# doxygen will become slower. If the cache is too large, memory is wasted. The
+# cache size is given by this formula: 2^(16+LOOKUP_CACHE_SIZE). The valid range
+# is 0..9, the default is 0, corresponding to a cache size of 2^16=65536
+# symbols. At the end of a run doxygen will report the cache usage and suggest
+# the optimal cache size from a speed point of view.
+# Minimum value: 0, maximum value: 9, default value: 0.
+
+LOOKUP_CACHE_SIZE = 0
+
+#---------------------------------------------------------------------------
+# Build related configuration options
+#---------------------------------------------------------------------------
+
+# If the EXTRACT_ALL tag is set to YES, doxygen will assume all entities in
+# documentation are documented, even if no documentation was available. Private
+# class members and static file members will be hidden unless the
+# EXTRACT_PRIVATE respectively EXTRACT_STATIC tags are set to YES.
+# Note: This will also disable the warnings about undocumented members that are
+# normally produced when WARNINGS is set to YES.
+# The default value is: NO.
+
+EXTRACT_ALL = NO
+
+# If the EXTRACT_PRIVATE tag is set to YES, all private members of a class will
+# be included in the documentation.
+# The default value is: NO.
+
+EXTRACT_PRIVATE = NO
+
+# If the EXTRACT_PACKAGE tag is set to YES, all members with package or internal
+# scope will be included in the documentation.
+# The default value is: NO.
+
+EXTRACT_PACKAGE = NO
+
+# If the EXTRACT_STATIC tag is set to YES, all static members of a file will be
+# included in the documentation.
+# The default value is: NO.
+
+EXTRACT_STATIC = NO
+
+# If the EXTRACT_LOCAL_CLASSES tag is set to YES, classes (and structs) defined
+# locally in source files will be included in the documentation. If set to NO,
+# only classes defined in header files are included. Does not have any effect
+# for Java sources.
+# The default value is: YES.
+
+EXTRACT_LOCAL_CLASSES = YES
+
+# This flag is only useful for Objective-C code. If set to YES, local methods,
+# which are defined in the implementation section but not in the interface are
+# included in the documentation. If set to NO, only methods in the interface are
+# included.
+# The default value is: NO.
+
+EXTRACT_LOCAL_METHODS = NO
+
+# If this flag is set to YES, the members of anonymous namespaces will be
+# extracted and appear in the documentation as a namespace called
+# 'anonymous_namespace{file}', where file will be replaced with the base name of
+# the file that contains the anonymous namespace. By default anonymous namespace
+# are hidden.
+# The default value is: NO.
+
+EXTRACT_ANON_NSPACES = NO
+
+# If the HIDE_UNDOC_MEMBERS tag is set to YES, doxygen will hide all
+# undocumented members inside documented classes or files. If set to NO these
+# members will be included in the various overviews, but no documentation
+# section is generated. This option has no effect if EXTRACT_ALL is enabled.
+# The default value is: NO.
+
+HIDE_UNDOC_MEMBERS = NO
+
+# If the HIDE_UNDOC_CLASSES tag is set to YES, doxygen will hide all
+# undocumented classes that are normally visible in the class hierarchy. If set
+# to NO, these classes will be included in the various overviews. This option
+# has no effect if EXTRACT_ALL is enabled.
+# The default value is: NO.
+
+HIDE_UNDOC_CLASSES = NO
+
+# If the HIDE_FRIEND_COMPOUNDS tag is set to YES, doxygen will hide all friend
+# (class|struct|union) declarations. If set to NO, these declarations will be
+# included in the documentation.
+# The default value is: NO.
+
+HIDE_FRIEND_COMPOUNDS = NO
+
+# If the HIDE_IN_BODY_DOCS tag is set to YES, doxygen will hide any
+# documentation blocks found inside the body of a function. If set to NO, these
+# blocks will be appended to the function's detailed documentation block.
+# The default value is: NO.
+
+HIDE_IN_BODY_DOCS = NO
+
+# The INTERNAL_DOCS tag determines if documentation that is typed after a
+# \internal command is included. If the tag is set to NO then the documentation
+# will be excluded. Set it to YES to include the internal documentation.
+# The default value is: NO.
+
+INTERNAL_DOCS = NO
+
+# If the CASE_SENSE_NAMES tag is set to NO then doxygen will only generate file
+# names in lower-case letters. If set to YES, upper-case letters are also
+# allowed. This is useful if you have classes or files whose names only differ
+# in case and if your file system supports case sensitive file names. Windows
+# and Mac users are advised to set this option to NO.
+# The default value is: system dependent.
+
+CASE_SENSE_NAMES = YES
+
+# If the HIDE_SCOPE_NAMES tag is set to NO then doxygen will show members with
+# their full class and namespace scopes in the documentation. If set to YES, the
+# scope will be hidden.
+# The default value is: NO.
+
+HIDE_SCOPE_NAMES = NO
+
+# If the HIDE_COMPOUND_REFERENCE tag is set to NO (default) then doxygen will
+# append additional text to a page's title, such as Class Reference. If set to
+# YES the compound reference will be hidden.
+# The default value is: NO.
+
+HIDE_COMPOUND_REFERENCE= NO
+
+# If the SHOW_INCLUDE_FILES tag is set to YES then doxygen will put a list of
+# the files that are included by a file in the documentation of that file.
+# The default value is: YES.
+
+SHOW_INCLUDE_FILES = YES
+
+# If the SHOW_GROUPED_MEMB_INC tag is set to YES then Doxygen will add for each
+# grouped member an include statement to the documentation, telling the reader
+# which file to include in order to use the member.
+# The default value is: NO.
+
+SHOW_GROUPED_MEMB_INC = NO
+
+# If the FORCE_LOCAL_INCLUDES tag is set to YES then doxygen will list include
+# files with double quotes in the documentation rather than with sharp brackets.
+# The default value is: NO.
+
+FORCE_LOCAL_INCLUDES = NO
+
+# If the INLINE_INFO tag is set to YES then a tag [inline] is inserted in the
+# documentation for inline members.
+# The default value is: YES.
+
+INLINE_INFO = YES
+
+# If the SORT_MEMBER_DOCS tag is set to YES then doxygen will sort the
+# (detailed) documentation of file and class members alphabetically by member
+# name. If set to NO, the members will appear in declaration order.
+# The default value is: YES.
+
+SORT_MEMBER_DOCS = YES
+
+# If the SORT_BRIEF_DOCS tag is set to YES then doxygen will sort the brief
+# descriptions of file, namespace and class members alphabetically by member
+# name. If set to NO, the members will appear in declaration order. Note that
+# this will also influence the order of the classes in the class list.
+# The default value is: NO.
+
+SORT_BRIEF_DOCS = NO
+
+# If the SORT_MEMBERS_CTORS_1ST tag is set to YES then doxygen will sort the
+# (brief and detailed) documentation of class members so that constructors and
+# destructors are listed first. If set to NO the constructors will appear in the
+# respective orders defined by SORT_BRIEF_DOCS and SORT_MEMBER_DOCS.
+# Note: If SORT_BRIEF_DOCS is set to NO this option is ignored for sorting brief
+# member documentation.
+# Note: If SORT_MEMBER_DOCS is set to NO this option is ignored for sorting
+# detailed member documentation.
+# The default value is: NO.
+
+SORT_MEMBERS_CTORS_1ST = NO
+
+# If the SORT_GROUP_NAMES tag is set to YES then doxygen will sort the hierarchy
+# of group names into alphabetical order. If set to NO the group names will
+# appear in their defined order.
+# The default value is: NO.
+
+SORT_GROUP_NAMES = NO
+
+# If the SORT_BY_SCOPE_NAME tag is set to YES, the class list will be sorted by
+# fully-qualified names, including namespaces. If set to NO, the class list will
+# be sorted only by class name, not including the namespace part.
+# Note: This option is not very useful if HIDE_SCOPE_NAMES is set to YES.
+# Note: This option applies only to the class list, not to the alphabetical
+# list.
+# The default value is: NO.
+
+SORT_BY_SCOPE_NAME = NO
+
+# If the STRICT_PROTO_MATCHING option is enabled and doxygen fails to do proper
+# type resolution of all parameters of a function it will reject a match between
+# the prototype and the implementation of a member function even if there is
+# only one candidate or it is obvious which candidate to choose by doing a
+# simple string match. By disabling STRICT_PROTO_MATCHING doxygen will still
+# accept a match between prototype and implementation in such cases.
+# The default value is: NO.
+
+STRICT_PROTO_MATCHING = NO
+
+# The GENERATE_TODOLIST tag can be used to enable (YES) or disable (NO) the todo
+# list. This list is created by putting \todo commands in the documentation.
+# The default value is: YES.
+
+GENERATE_TODOLIST = YES
+
+# The GENERATE_TESTLIST tag can be used to enable (YES) or disable (NO) the test
+# list. This list is created by putting \test commands in the documentation.
+# The default value is: YES.
+
+GENERATE_TESTLIST = YES
+
+# The GENERATE_BUGLIST tag can be used to enable (YES) or disable (NO) the bug
+# list. This list is created by putting \bug commands in the documentation.
+# The default value is: YES.
+
+GENERATE_BUGLIST = YES
+
+# The GENERATE_DEPRECATEDLIST tag can be used to enable (YES) or disable (NO)
+# the deprecated list. This list is created by putting \deprecated commands in
+# the documentation.
+# The default value is: YES.
+
+GENERATE_DEPRECATEDLIST= YES
+
+# The ENABLED_SECTIONS tag can be used to enable conditional documentation
+# sections, marked by \if <section_label> ... \endif and \cond <section_label>
+# ... \endcond blocks.
+
+ENABLED_SECTIONS =
+
+# The MAX_INITIALIZER_LINES tag determines the maximum number of lines that the
+# initial value of a variable or macro / define can have for it to appear in the
+# documentation. If the initializer consists of more lines than specified here
+# it will be hidden. Use a value of 0 to hide initializers completely. The
+# appearance of the value of individual variables and macros / defines can be
+# controlled using \showinitializer or \hideinitializer command in the
+# documentation regardless of this setting.
+# Minimum value: 0, maximum value: 10000, default value: 30.
+
+MAX_INITIALIZER_LINES = 30
+
+# Set the SHOW_USED_FILES tag to NO to disable the list of files generated at
+# the bottom of the documentation of classes and structs. If set to YES, the
+# list will mention the files that were used to generate the documentation.
+# The default value is: YES.
+
+SHOW_USED_FILES = YES
+
+# Set the SHOW_FILES tag to NO to disable the generation of the Files page. This
+# will remove the Files entry from the Quick Index and from the Folder Tree View
+# (if specified).
+# The default value is: YES.
+
+SHOW_FILES = YES
+
+# Set the SHOW_NAMESPACES tag to NO to disable the generation of the Namespaces
+# page. This will remove the Namespaces entry from the Quick Index and from the
+# Folder Tree View (if specified).
+# The default value is: YES.
+
+SHOW_NAMESPACES = YES
+
+# The FILE_VERSION_FILTER tag can be used to specify a program or script that
+# doxygen should invoke to get the current version for each file (typically from
+# the version control system). Doxygen will invoke the program by executing (via
+# popen()) the command command input-file, where command is the value of the
+# FILE_VERSION_FILTER tag, and input-file is the name of an input file provided
+# by doxygen. Whatever the program writes to standard output is used as the file
+# version. For an example see the documentation.
+
+FILE_VERSION_FILTER =
+
+# The LAYOUT_FILE tag can be used to specify a layout file which will be parsed
+# by doxygen. The layout file controls the global structure of the generated
+# output files in an output format independent way. To create the layout file
+# that represents doxygen's defaults, run doxygen with the -l option. You can
+# optionally specify a file name after the option, if omitted DoxygenLayout.xml
+# will be used as the name of the layout file.
+#
+# Note that if you run doxygen from a directory containing a file called
+# DoxygenLayout.xml, doxygen will parse it automatically even if the LAYOUT_FILE
+# tag is left empty.
+
+LAYOUT_FILE =
+
+# The CITE_BIB_FILES tag can be used to specify one or more bib files containing
+# the reference definitions. This must be a list of .bib files. The .bib
+# extension is automatically appended if omitted. This requires the bibtex tool
+# to be installed. See also http://en.wikipedia.org/wiki/BibTeX for more info.
+# For LaTeX the style of the bibliography can be controlled using
+# LATEX_BIB_STYLE. To use this feature you need bibtex and perl available in the
+# search path. See also \cite for info how to create references.
+
+CITE_BIB_FILES =
+
+#---------------------------------------------------------------------------
+# Configuration options related to warning and progress messages
+#---------------------------------------------------------------------------
+
+# The QUIET tag can be used to turn on/off the messages that are generated to
+# standard output by doxygen. If QUIET is set to YES this implies that the
+# messages are off.
+# The default value is: NO.
+
+QUIET = NO
+
+# The WARNINGS tag can be used to turn on/off the warning messages that are
+# generated to standard error (stderr) by doxygen. If WARNINGS is set to YES
+# this implies that the warnings are on.
+#
+# Tip: Turn warnings on while writing the documentation.
+# The default value is: YES.
+
+WARNINGS = YES
+
+# If the WARN_IF_UNDOCUMENTED tag is set to YES then doxygen will generate
+# warnings for undocumented members. If EXTRACT_ALL is set to YES then this flag
+# will automatically be disabled.
+# The default value is: YES.
+
+WARN_IF_UNDOCUMENTED = YES
+
+# If the WARN_IF_DOC_ERROR tag is set to YES, doxygen will generate warnings for
+# potential errors in the documentation, such as not documenting some parameters
+# in a documented function, or documenting parameters that don't exist or using
+# markup commands wrongly.
+# The default value is: YES.
+
+WARN_IF_DOC_ERROR = YES
+
+# This WARN_NO_PARAMDOC option can be enabled to get warnings for functions that
+# are documented, but have no documentation for their parameters or return
+# value. If set to NO, doxygen will only warn about wrong or incomplete
+# parameter documentation, but not about the absence of documentation.
+# The default value is: NO.
+
+WARN_NO_PARAMDOC = NO
+
+# If the WARN_AS_ERROR tag is set to YES then doxygen will immediately stop when
+# a warning is encountered.
+# The default value is: NO.
+
+WARN_AS_ERROR = NO
+
+# The WARN_FORMAT tag determines the format of the warning messages that doxygen
+# can produce. The string should contain the $file, $line, and $text tags, which
+# will be replaced by the file and line number from which the warning originated
+# and the warning text. Optionally the format may contain $version, which will
+# be replaced by the version of the file (if it could be obtained via
+# FILE_VERSION_FILTER)
+# The default value is: $file:$line: $text.
+
+WARN_FORMAT = "$file:$line: $text"
+
+# The WARN_LOGFILE tag can be used to specify a file to which warning and error
+# messages should be written. If left blank the output is written to standard
+# error (stderr).
+
+WARN_LOGFILE =
+
+#---------------------------------------------------------------------------
+# Configuration options related to the input files
+#---------------------------------------------------------------------------
+
+# The INPUT tag is used to specify the files and/or directories that contain
+# documented source files. You may enter file names like myfile.cpp or
+# directories like /usr/src/myproject. Separate the files or directories with
+# spaces. See also FILE_PATTERNS and EXTENSION_MAPPING
+# Note: If this tag is empty the current directory is searched.
+
+INPUT = @CMAKE_CURRENT_SOURCE_DIR@/../src
+
+# This tag can be used to specify the character encoding of the source files
+# that doxygen parses. Internally doxygen uses the UTF-8 encoding. Doxygen uses
+# libiconv (or the iconv built into libc) for the transcoding. See the libiconv
+# documentation (see: http://www.gnu.org/software/libiconv) for the list of
+# possible encodings.
+# The default value is: UTF-8.
+
+INPUT_ENCODING = UTF-8
+
+# If the value of the INPUT tag contains directories, you can use the
+# FILE_PATTERNS tag to specify one or more wildcard patterns (like *.cpp and
+# *.h) to filter out the source-files in the directories.
+#
+# Note that for custom extensions or not directly supported extensions you also
+# need to set EXTENSION_MAPPING for the extension otherwise the files are not
+# read by doxygen.
+#
+# If left blank the following patterns are tested:*.c, *.cc, *.cxx, *.cpp,
+# *.c++, *.java, *.ii, *.ixx, *.ipp, *.i++, *.inl, *.idl, *.ddl, *.odl, *.h,
+# *.hh, *.hxx, *.hpp, *.h++, *.cs, *.d, *.php, *.php4, *.php5, *.phtml, *.inc,
+# *.m, *.markdown, *.md, *.mm, *.dox, *.py, *.pyw, *.f90, *.f95, *.f03, *.f08,
+# *.f, *.for, *.tcl, *.vhd, *.vhdl, *.ucf and *.qsf.
+
+FILE_PATTERNS = *.c \
+ *.cc \
+ *.cxx \
+ *.cpp \
+ *.c++ \
+ *.java \
+ *.ii \
+ *.ixx \
+ *.ipp \
+ *.i++ \
+ *.inl \
+ *.idl \
+ *.ddl \
+ *.odl \
+ *.h \
+ *.hh \
+ *.hxx \
+ *.hpp \
+ *.h++ \
+ *.cs \
+ *.d \
+ *.php \
+ *.php4 \
+ *.php5 \
+ *.phtml \
+ *.inc \
+ *.m \
+ *.markdown \
+ *.md \
+ *.mm \
+ *.dox \
+ *.py \
+ *.pyw \
+ *.f90 \
+ *.f95 \
+ *.f03 \
+ *.f08 \
+ *.f \
+ *.for \
+ *.tcl \
+ *.vhd \
+ *.vhdl \
+ *.ucf \
+ *.qsf
+
+# The RECURSIVE tag can be used to specify whether or not subdirectories should
+# be searched for input files as well.
+# The default value is: NO.
+
+RECURSIVE = NO
+
+# The EXCLUDE tag can be used to specify files and/or directories that should be
+# excluded from the INPUT source files. This way you can easily exclude a
+# subdirectory from a directory tree whose root is specified with the INPUT tag.
+#
+# Note that relative paths are relative to the directory from which doxygen is
+# run.
+
+EXCLUDE =
+
+# The EXCLUDE_SYMLINKS tag can be used to select whether or not files or
+# directories that are symbolic links (a Unix file system feature) are excluded
+# from the input.
+# The default value is: NO.
+
+EXCLUDE_SYMLINKS = NO
+
+# If the value of the INPUT tag contains directories, you can use the
+# EXCLUDE_PATTERNS tag to specify one or more wildcard patterns to exclude
+# certain files from those directories.
+#
+# Note that the wildcards are matched against the file with absolute path, so to
+# exclude all test directories for example use the pattern */test/*
+
+EXCLUDE_PATTERNS =
+
+# The EXCLUDE_SYMBOLS tag can be used to specify one or more symbol names
+# (namespaces, classes, functions, etc.) that should be excluded from the
+# output. The symbol name can be a fully qualified name, a word, or if the
+# wildcard * is used, a substring. Examples: ANamespace, AClass,
+# AClass::ANamespace, ANamespace::*Test
+#
+# Note that the wildcards are matched against the file with absolute path, so to
+# exclude all test directories use the pattern */test/*
+
+EXCLUDE_SYMBOLS =
+
+# The EXAMPLE_PATH tag can be used to specify one or more files or directories
+# that contain example code fragments that are included (see the \include
+# command).
+
+EXAMPLE_PATH =
+
+# If the value of the EXAMPLE_PATH tag contains directories, you can use the
+# EXAMPLE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp and
+# *.h) to filter out the source-files in the directories. If left blank all
+# files are included.
+
+EXAMPLE_PATTERNS = *
+
+# If the EXAMPLE_RECURSIVE tag is set to YES then subdirectories will be
+# searched for input files to be used with the \include or \dontinclude commands
+# irrespective of the value of the RECURSIVE tag.
+# The default value is: NO.
+
+EXAMPLE_RECURSIVE = NO
+
+# The IMAGE_PATH tag can be used to specify one or more files or directories
+# that contain images that are to be included in the documentation (see the
+# \image command).
+
+IMAGE_PATH =
+
+# The INPUT_FILTER tag can be used to specify a program that doxygen should
+# invoke to filter for each input file. Doxygen will invoke the filter program
+# by executing (via popen()) the command:
+#
+# <filter> <input-file>
+#
+# where <filter> is the value of the INPUT_FILTER tag, and <input-file> is the
+# name of an input file. Doxygen will then use the output that the filter
+# program writes to standard output. If FILTER_PATTERNS is specified, this tag
+# will be ignored.
+#
+# Note that the filter must not add or remove lines; it is applied before the
+# code is scanned, but not when the output code is generated. If lines are added
+# or removed, the anchors will not be placed correctly.
+#
+# Note that for custom extensions or not directly supported extensions you also
+# need to set EXTENSION_MAPPING for the extension otherwise the files are not
+# properly processed by doxygen.
+
+INPUT_FILTER =
+
+# The FILTER_PATTERNS tag can be used to specify filters on a per file pattern
+# basis. Doxygen will compare the file name with each pattern and apply the
+# filter if there is a match. The filters are a list of the form: pattern=filter
+# (like *.cpp=my_cpp_filter). See INPUT_FILTER for further information on how
+# filters are used. If the FILTER_PATTERNS tag is empty or if none of the
+# patterns match the file name, INPUT_FILTER is applied.
+#
+# Note that for custom extensions or not directly supported extensions you also
+# need to set EXTENSION_MAPPING for the extension otherwise the files are not
+# properly processed by doxygen.
+
+FILTER_PATTERNS =
+
+# If the FILTER_SOURCE_FILES tag is set to YES, the input filter (if set using
+# INPUT_FILTER) will also be used to filter the input files that are used for
+# producing the source files to browse (i.e. when SOURCE_BROWSER is set to YES).
+# The default value is: NO.
+
+FILTER_SOURCE_FILES = NO
+
+# The FILTER_SOURCE_PATTERNS tag can be used to specify source filters per file
+# pattern. A pattern will override the setting for FILTER_PATTERN (if any) and
+# it is also possible to disable source filtering for a specific pattern using
+# *.ext= (so without naming a filter).
+# This tag requires that the tag FILTER_SOURCE_FILES is set to YES.
+
+FILTER_SOURCE_PATTERNS =
+
+# If the USE_MDFILE_AS_MAINPAGE tag refers to the name of a markdown file that
+# is part of the input, its contents will be placed on the main page
+# (index.html). This can be useful if you have a project on for instance GitHub
+# and want to reuse the introduction page also for the doxygen output.
+
+USE_MDFILE_AS_MAINPAGE =
+
+#---------------------------------------------------------------------------
+# Configuration options related to source browsing
+#---------------------------------------------------------------------------
+
+# If the SOURCE_BROWSER tag is set to YES then a list of source files will be
+# generated. Documented entities will be cross-referenced with these sources.
+#
+# Note: To get rid of all source code in the generated output, make sure that
+# also VERBATIM_HEADERS is set to NO.
+# The default value is: NO.
+
+SOURCE_BROWSER = NO
+
+# Setting the INLINE_SOURCES tag to YES will include the body of functions,
+# classes and enums directly into the documentation.
+# The default value is: NO.
+
+INLINE_SOURCES = NO
+
+# Setting the STRIP_CODE_COMMENTS tag to YES will instruct doxygen to hide any
+# special comment blocks from generated source code fragments. Normal C, C++ and
+# Fortran comments will always remain visible.
+# The default value is: YES.
+
+STRIP_CODE_COMMENTS = YES
+
+# If the REFERENCED_BY_RELATION tag is set to YES then for each documented
+# function all documented functions referencing it will be listed.
+# The default value is: NO.
+
+REFERENCED_BY_RELATION = NO
+
+# If the REFERENCES_RELATION tag is set to YES then for each documented function
+# all documented entities called/used by that function will be listed.
+# The default value is: NO.
+
+REFERENCES_RELATION = NO
+
+# If the REFERENCES_LINK_SOURCE tag is set to YES and SOURCE_BROWSER tag is set
+# to YES then the hyperlinks from functions in REFERENCES_RELATION and
+# REFERENCED_BY_RELATION lists will link to the source code. Otherwise they will
+# link to the documentation.
+# The default value is: YES.
+
+REFERENCES_LINK_SOURCE = YES
+
+# If SOURCE_TOOLTIPS is enabled (the default) then hovering a hyperlink in the
+# source code will show a tooltip with additional information such as prototype,
+# brief description and links to the definition and documentation. Since this
+# will make the HTML file larger and loading of large files a bit slower, you
+# can opt to disable this feature.
+# The default value is: YES.
+# This tag requires that the tag SOURCE_BROWSER is set to YES.
+
+SOURCE_TOOLTIPS = YES
+
+# If the USE_HTAGS tag is set to YES then the references to source code will
+# point to the HTML generated by the htags(1) tool instead of doxygen built-in
+# source browser. The htags tool is part of GNU's global source tagging system
+# (see http://www.gnu.org/software/global/global.html). You will need version
+# 4.8.6 or higher.
+#
+# To use it do the following:
+# - Install the latest version of global
+# - Enable SOURCE_BROWSER and USE_HTAGS in the config file
+# - Make sure the INPUT points to the root of the source tree
+# - Run doxygen as normal
+#
+# Doxygen will invoke htags (and that will in turn invoke gtags), so these
+# tools must be available from the command line (i.e. in the search path).
+#
+# The result: instead of the source browser generated by doxygen, the links to
+# source code will now point to the output of htags.
+# The default value is: NO.
+# This tag requires that the tag SOURCE_BROWSER is set to YES.
+
+USE_HTAGS = NO
+
+# If the VERBATIM_HEADERS tag is set the YES then doxygen will generate a
+# verbatim copy of the header file for each class for which an include is
+# specified. Set to NO to disable this.
+# See also: Section \class.
+# The default value is: YES.
+
+VERBATIM_HEADERS = YES
+
+# If the CLANG_ASSISTED_PARSING tag is set to YES then doxygen will use the
+# clang parser (see: http://clang.llvm.org/) for more accurate parsing at the
+# cost of reduced performance. This can be particularly helpful with template
+# rich C++ code for which doxygen's built-in parser lacks the necessary type
+# information.
+# Note: The availability of this option depends on whether or not doxygen was
+# generated with the -Duse-libclang=ON option for CMake.
+# The default value is: NO.
+
+CLANG_ASSISTED_PARSING = NO
+
+# If clang assisted parsing is enabled you can provide the compiler with command
+# line options that you would normally use when invoking the compiler. Note that
+# the include paths will already be set by doxygen for the files and directories
+# specified with INPUT and INCLUDE_PATH.
+# This tag requires that the tag CLANG_ASSISTED_PARSING is set to YES.
+
+CLANG_OPTIONS =
+
+#---------------------------------------------------------------------------
+# Configuration options related to the alphabetical class index
+#---------------------------------------------------------------------------
+
+# If the ALPHABETICAL_INDEX tag is set to YES, an alphabetical index of all
+# compounds will be generated. Enable this if the project contains a lot of
+# classes, structs, unions or interfaces.
+# The default value is: YES.
+
+ALPHABETICAL_INDEX = YES
+
+# The COLS_IN_ALPHA_INDEX tag can be used to specify the number of columns in
+# which the alphabetical index list will be split.
+# Minimum value: 1, maximum value: 20, default value: 5.
+# This tag requires that the tag ALPHABETICAL_INDEX is set to YES.
+
+COLS_IN_ALPHA_INDEX = 5
+
+# In case all classes in a project start with a common prefix, all classes will
+# be put under the same header in the alphabetical index. The IGNORE_PREFIX tag
+# can be used to specify a prefix (or a list of prefixes) that should be ignored
+# while generating the index headers.
+# This tag requires that the tag ALPHABETICAL_INDEX is set to YES.
+
+IGNORE_PREFIX =
+
+#---------------------------------------------------------------------------
+# Configuration options related to the HTML output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_HTML tag is set to YES, doxygen will generate HTML output
+# The default value is: YES.
+
+GENERATE_HTML = YES
+
+# The HTML_OUTPUT tag is used to specify where the HTML docs will be put. If a
+# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of
+# it.
+# The default directory is: html.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_OUTPUT = html
+
+# The HTML_FILE_EXTENSION tag can be used to specify the file extension for each
+# generated HTML page (for example: .htm, .php, .asp).
+# The default value is: .html.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_FILE_EXTENSION = .html
+
+# The HTML_HEADER tag can be used to specify a user-defined HTML header file for
+# each generated HTML page. If the tag is left blank doxygen will generate a
+# standard header.
+#
+# To get valid HTML the header file that includes any scripts and style sheets
+# that doxygen needs, which is dependent on the configuration options used (e.g.
+# the setting GENERATE_TREEVIEW). It is highly recommended to start with a
+# default header using
+# doxygen -w html new_header.html new_footer.html new_stylesheet.css
+# YourConfigFile
+# and then modify the file new_header.html. See also section "Doxygen usage"
+# for information on how to generate the default header that doxygen normally
+# uses.
+# Note: The header is subject to change so you typically have to regenerate the
+# default header when upgrading to a newer version of doxygen. For a description
+# of the possible markers and block names see the documentation.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_HEADER =
+
+# The HTML_FOOTER tag can be used to specify a user-defined HTML footer for each
+# generated HTML page. If the tag is left blank doxygen will generate a standard
+# footer. See HTML_HEADER for more information on how to generate a default
+# footer and what special commands can be used inside the footer. See also
+# section "Doxygen usage" for information on how to generate the default footer
+# that doxygen normally uses.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_FOOTER =
+
+# The HTML_STYLESHEET tag can be used to specify a user-defined cascading style
+# sheet that is used by each HTML page. It can be used to fine-tune the look of
+# the HTML output. If left blank doxygen will generate a default style sheet.
+# See also section "Doxygen usage" for information on how to generate the style
+# sheet that doxygen normally uses.
+# Note: It is recommended to use HTML_EXTRA_STYLESHEET instead of this tag, as
+# it is more robust and this tag (HTML_STYLESHEET) will in the future become
+# obsolete.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_STYLESHEET =
+
+# The HTML_EXTRA_STYLESHEET tag can be used to specify additional user-defined
+# cascading style sheets that are included after the standard style sheets
+# created by doxygen. Using this option one can overrule certain style aspects.
+# This is preferred over using HTML_STYLESHEET since it does not replace the
+# standard style sheet and is therefore more robust against future updates.
+# Doxygen will copy the style sheet files to the output directory.
+# Note: The order of the extra style sheet files is of importance (e.g. the last
+# style sheet in the list overrules the setting of the previous ones in the
+# list). For an example see the documentation.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_EXTRA_STYLESHEET =
+
+# The HTML_EXTRA_FILES tag can be used to specify one or more extra images or
+# other source files which should be copied to the HTML output directory. Note
+# that these files will be copied to the base HTML output directory. Use the
+# $relpath^ marker in the HTML_HEADER and/or HTML_FOOTER files to load these
+# files. In the HTML_STYLESHEET file, use the file name only. Also note that the
+# files will be copied as-is; there are no commands or markers available.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_EXTRA_FILES =
+
+# The HTML_COLORSTYLE_HUE tag controls the color of the HTML output. Doxygen
+# will adjust the colors in the style sheet and background images according to
+# this color. Hue is specified as an angle on a colorwheel, see
+# http://en.wikipedia.org/wiki/Hue for more information. For instance the value
+# 0 represents red, 60 is yellow, 120 is green, 180 is cyan, 240 is blue, 300
+# purple, and 360 is red again.
+# Minimum value: 0, maximum value: 359, default value: 220.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_COLORSTYLE_HUE = 220
+
+# The HTML_COLORSTYLE_SAT tag controls the purity (or saturation) of the colors
+# in the HTML output. For a value of 0 the output will use grayscales only. A
+# value of 255 will produce the most vivid colors.
+# Minimum value: 0, maximum value: 255, default value: 100.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_COLORSTYLE_SAT = 100
+
+# The HTML_COLORSTYLE_GAMMA tag controls the gamma correction applied to the
+# luminance component of the colors in the HTML output. Values below 100
+# gradually make the output lighter, whereas values above 100 make the output
+# darker. The value divided by 100 is the actual gamma applied, so 80 represents
+# a gamma of 0.8, The value 220 represents a gamma of 2.2, and 100 does not
+# change the gamma.
+# Minimum value: 40, maximum value: 240, default value: 80.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_COLORSTYLE_GAMMA = 80
+
+# If the HTML_TIMESTAMP tag is set to YES then the footer of each generated HTML
+# page will contain the date and time when the page was generated. Setting this
+# to YES can help to show when doxygen was last run and thus if the
+# documentation is up to date.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_TIMESTAMP = NO
+
+# If the HTML_DYNAMIC_SECTIONS tag is set to YES then the generated HTML
+# documentation will contain sections that can be hidden and shown after the
+# page has loaded.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_DYNAMIC_SECTIONS = NO
+
+# With HTML_INDEX_NUM_ENTRIES one can control the preferred number of entries
+# shown in the various tree structured indices initially; the user can expand
+# and collapse entries dynamically later on. Doxygen will expand the tree to
+# such a level that at most the specified number of entries are visible (unless
+# a fully collapsed tree already exceeds this amount). So setting the number of
+# entries 1 will produce a full collapsed tree by default. 0 is a special value
+# representing an infinite number of entries and will result in a full expanded
+# tree by default.
+# Minimum value: 0, maximum value: 9999, default value: 100.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+HTML_INDEX_NUM_ENTRIES = 100
+
+# If the GENERATE_DOCSET tag is set to YES, additional index files will be
+# generated that can be used as input for Apple's Xcode 3 integrated development
+# environment (see: http://developer.apple.com/tools/xcode/), introduced with
+# OSX 10.5 (Leopard). To create a documentation set, doxygen will generate a
+# Makefile in the HTML output directory. Running make will produce the docset in
+# that directory and running make install will install the docset in
+# ~/Library/Developer/Shared/Documentation/DocSets so that Xcode will find it at
+# startup. See http://developer.apple.com/tools/creatingdocsetswithdoxygen.html
+# for more information.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+GENERATE_DOCSET = NO
+
+# This tag determines the name of the docset feed. A documentation feed provides
+# an umbrella under which multiple documentation sets from a single provider
+# (such as a company or product suite) can be grouped.
+# The default value is: Doxygen generated docs.
+# This tag requires that the tag GENERATE_DOCSET is set to YES.
+
+DOCSET_FEEDNAME = "Doxygen generated docs"
+
+# This tag specifies a string that should uniquely identify the documentation
+# set bundle. This should be a reverse domain-name style string, e.g.
+# com.mycompany.MyDocSet. Doxygen will append .docset to the name.
+# The default value is: org.doxygen.Project.
+# This tag requires that the tag GENERATE_DOCSET is set to YES.
+
+DOCSET_BUNDLE_ID = org.doxygen.Project
+
+# The DOCSET_PUBLISHER_ID tag specifies a string that should uniquely identify
+# the documentation publisher. This should be a reverse domain-name style
+# string, e.g. com.mycompany.MyDocSet.documentation.
+# The default value is: org.doxygen.Publisher.
+# This tag requires that the tag GENERATE_DOCSET is set to YES.
+
+DOCSET_PUBLISHER_ID = org.doxygen.Publisher
+
+# The DOCSET_PUBLISHER_NAME tag identifies the documentation publisher.
+# The default value is: Publisher.
+# This tag requires that the tag GENERATE_DOCSET is set to YES.
+
+DOCSET_PUBLISHER_NAME = Publisher
+
+# If the GENERATE_HTMLHELP tag is set to YES then doxygen generates three
+# additional HTML index files: index.hhp, index.hhc, and index.hhk. The
+# index.hhp is a project file that can be read by Microsoft's HTML Help Workshop
+# (see: http://www.microsoft.com/en-us/download/details.aspx?id=21138) on
+# Windows.
+#
+# The HTML Help Workshop contains a compiler that can convert all HTML output
+# generated by doxygen into a single compiled HTML file (.chm). Compiled HTML
+# files are now used as the Windows 98 help format, and will replace the old
+# Windows help format (.hlp) on all Windows platforms in the future. Compressed
+# HTML files also contain an index, a table of contents, and you can search for
+# words in the documentation. The HTML workshop also contains a viewer for
+# compressed HTML files.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+GENERATE_HTMLHELP = NO
+
+# The CHM_FILE tag can be used to specify the file name of the resulting .chm
+# file. You can add a path in front of the file if the result should not be
+# written to the html output directory.
+# This tag requires that the tag GENERATE_HTMLHELP is set to YES.
+
+CHM_FILE =
+
+# The HHC_LOCATION tag can be used to specify the location (absolute path
+# including file name) of the HTML help compiler (hhc.exe). If non-empty,
+# doxygen will try to run the HTML help compiler on the generated index.hhp.
+# The file has to be specified with full path.
+# This tag requires that the tag GENERATE_HTMLHELP is set to YES.
+
+HHC_LOCATION =
+
+# The GENERATE_CHI flag controls if a separate .chi index file is generated
+# (YES) or that it should be included in the master .chm file (NO).
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTMLHELP is set to YES.
+
+GENERATE_CHI = NO
+
+# The CHM_INDEX_ENCODING is used to encode HtmlHelp index (hhk), content (hhc)
+# and project file content.
+# This tag requires that the tag GENERATE_HTMLHELP is set to YES.
+
+CHM_INDEX_ENCODING =
+
+# The BINARY_TOC flag controls whether a binary table of contents is generated
+# (YES) or a normal table of contents (NO) in the .chm file. Furthermore it
+# enables the Previous and Next buttons.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTMLHELP is set to YES.
+
+BINARY_TOC = NO
+
+# The TOC_EXPAND flag can be set to YES to add extra items for group members to
+# the table of contents of the HTML help documentation and to the tree view.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTMLHELP is set to YES.
+
+TOC_EXPAND = NO
+
+# If the GENERATE_QHP tag is set to YES and both QHP_NAMESPACE and
+# QHP_VIRTUAL_FOLDER are set, an additional index file will be generated that
+# can be used as input for Qt's qhelpgenerator to generate a Qt Compressed Help
+# (.qch) of the generated HTML documentation.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+GENERATE_QHP = NO
+
+# If the QHG_LOCATION tag is specified, the QCH_FILE tag can be used to specify
+# the file name of the resulting .qch file. The path specified is relative to
+# the HTML output folder.
+# This tag requires that the tag GENERATE_QHP is set to YES.
+
+QCH_FILE =
+
+# The QHP_NAMESPACE tag specifies the namespace to use when generating Qt Help
+# Project output. For more information please see Qt Help Project / Namespace
+# (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#namespace).
+# The default value is: org.doxygen.Project.
+# This tag requires that the tag GENERATE_QHP is set to YES.
+
+QHP_NAMESPACE = org.doxygen.Project
+
+# The QHP_VIRTUAL_FOLDER tag specifies the namespace to use when generating Qt
+# Help Project output. For more information please see Qt Help Project / Virtual
+# Folders (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#virtual-
+# folders).
+# The default value is: doc.
+# This tag requires that the tag GENERATE_QHP is set to YES.
+
+QHP_VIRTUAL_FOLDER = doc
+
+# If the QHP_CUST_FILTER_NAME tag is set, it specifies the name of a custom
+# filter to add. For more information please see Qt Help Project / Custom
+# Filters (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#custom-
+# filters).
+# This tag requires that the tag GENERATE_QHP is set to YES.
+
+QHP_CUST_FILTER_NAME =
+
+# The QHP_CUST_FILTER_ATTRS tag specifies the list of the attributes of the
+# custom filter to add. For more information please see Qt Help Project / Custom
+# Filters (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#custom-
+# filters).
+# This tag requires that the tag GENERATE_QHP is set to YES.
+
+QHP_CUST_FILTER_ATTRS =
+
+# The QHP_SECT_FILTER_ATTRS tag specifies the list of the attributes this
+# project's filter section matches. Qt Help Project / Filter Attributes (see:
+# http://qt-project.org/doc/qt-4.8/qthelpproject.html#filter-attributes).
+# This tag requires that the tag GENERATE_QHP is set to YES.
+
+QHP_SECT_FILTER_ATTRS =
+
+# The QHG_LOCATION tag can be used to specify the location of Qt's
+# qhelpgenerator. If non-empty doxygen will try to run qhelpgenerator on the
+# generated .qhp file.
+# This tag requires that the tag GENERATE_QHP is set to YES.
+
+QHG_LOCATION =
+
+# If the GENERATE_ECLIPSEHELP tag is set to YES, additional index files will be
+# generated, together with the HTML files, they form an Eclipse help plugin. To
+# install this plugin and make it available under the help contents menu in
+# Eclipse, the contents of the directory containing the HTML and XML files needs
+# to be copied into the plugins directory of eclipse. The name of the directory
+# within the plugins directory should be the same as the ECLIPSE_DOC_ID value.
+# After copying Eclipse needs to be restarted before the help appears.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+GENERATE_ECLIPSEHELP = NO
+
+# A unique identifier for the Eclipse help plugin. When installing the plugin
+# the directory name containing the HTML and XML files should also have this
+# name. Each documentation set should have its own identifier.
+# The default value is: org.doxygen.Project.
+# This tag requires that the tag GENERATE_ECLIPSEHELP is set to YES.
+
+ECLIPSE_DOC_ID = org.doxygen.Project
+
+# If you want full control over the layout of the generated HTML pages it might
+# be necessary to disable the index and replace it with your own. The
+# DISABLE_INDEX tag can be used to turn on/off the condensed index (tabs) at top
+# of each HTML page. A value of NO enables the index and the value YES disables
+# it. Since the tabs in the index contain the same information as the navigation
+# tree, you can set this option to YES if you also set GENERATE_TREEVIEW to YES.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+DISABLE_INDEX = NO
+
+# The GENERATE_TREEVIEW tag is used to specify whether a tree-like index
+# structure should be generated to display hierarchical information. If the tag
+# value is set to YES, a side panel will be generated containing a tree-like
+# index structure (just like the one that is generated for HTML Help). For this
+# to work a browser that supports JavaScript, DHTML, CSS and frames is required
+# (i.e. any modern browser). Windows users are probably better off using the
+# HTML help feature. Via custom style sheets (see HTML_EXTRA_STYLESHEET) one can
+# further fine-tune the look of the index. As an example, the default style
+# sheet generated by doxygen has an example that shows how to put an image at
+# the root of the tree instead of the PROJECT_NAME. Since the tree basically has
+# the same information as the tab index, you could consider setting
+# DISABLE_INDEX to YES when enabling this option.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+GENERATE_TREEVIEW = NO
+
+# The ENUM_VALUES_PER_LINE tag can be used to set the number of enum values that
+# doxygen will group on one line in the generated HTML documentation.
+#
+# Note that a value of 0 will completely suppress the enum values from appearing
+# in the overview section.
+# Minimum value: 0, maximum value: 20, default value: 4.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+ENUM_VALUES_PER_LINE = 4
+
+# If the treeview is enabled (see GENERATE_TREEVIEW) then this tag can be used
+# to set the initial width (in pixels) of the frame in which the tree is shown.
+# Minimum value: 0, maximum value: 1500, default value: 250.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+TREEVIEW_WIDTH = 250
+
+# If the EXT_LINKS_IN_WINDOW option is set to YES, doxygen will open links to
+# external symbols imported via tag files in a separate window.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+EXT_LINKS_IN_WINDOW = NO
+
+# Use this tag to change the font size of LaTeX formulas included as images in
+# the HTML documentation. When you change the font size after a successful
+# doxygen run you need to manually remove any form_*.png images from the HTML
+# output directory to force them to be regenerated.
+# Minimum value: 8, maximum value: 50, default value: 10.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+FORMULA_FONTSIZE = 10
+
+# Use the FORMULA_TRANPARENT tag to determine whether or not the images
+# generated for formulas are transparent PNGs. Transparent PNGs are not
+# supported properly for IE 6.0, but are supported on all modern browsers.
+#
+# Note that when changing this option you need to delete any form_*.png files in
+# the HTML output directory before the changes have effect.
+# The default value is: YES.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+FORMULA_TRANSPARENT = YES
+
+# Enable the USE_MATHJAX option to render LaTeX formulas using MathJax (see
+# http://www.mathjax.org) which uses client side Javascript for the rendering
+# instead of using pre-rendered bitmaps. Use this if you do not have LaTeX
+# installed or if you want to formulas look prettier in the HTML output. When
+# enabled you may also need to install MathJax separately and configure the path
+# to it using the MATHJAX_RELPATH option.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+USE_MATHJAX = NO
+
+# When MathJax is enabled you can set the default output format to be used for
+# the MathJax output. See the MathJax site (see:
+# http://docs.mathjax.org/en/latest/output.html) for more details.
+# Possible values are: HTML-CSS (which is slower, but has the best
+# compatibility), NativeMML (i.e. MathML) and SVG.
+# The default value is: HTML-CSS.
+# This tag requires that the tag USE_MATHJAX is set to YES.
+
+MATHJAX_FORMAT = HTML-CSS
+
+# When MathJax is enabled you need to specify the location relative to the HTML
+# output directory using the MATHJAX_RELPATH option. The destination directory
+# should contain the MathJax.js script. For instance, if the mathjax directory
+# is located at the same level as the HTML output directory, then
+# MATHJAX_RELPATH should be ../mathjax. The default value points to the MathJax
+# Content Delivery Network so you can quickly see the result without installing
+# MathJax. However, it is strongly recommended to install a local copy of
+# MathJax from http://www.mathjax.org before deployment.
+# The default value is: http://cdn.mathjax.org/mathjax/latest.
+# This tag requires that the tag USE_MATHJAX is set to YES.
+
+MATHJAX_RELPATH = http://cdn.mathjax.org/mathjax/latest
+
+# The MATHJAX_EXTENSIONS tag can be used to specify one or more MathJax
+# extension names that should be enabled during MathJax rendering. For example
+# MATHJAX_EXTENSIONS = TeX/AMSmath TeX/AMSsymbols
+# This tag requires that the tag USE_MATHJAX is set to YES.
+
+MATHJAX_EXTENSIONS =
+
+# The MATHJAX_CODEFILE tag can be used to specify a file with javascript pieces
+# of code that will be used on startup of the MathJax code. See the MathJax site
+# (see: http://docs.mathjax.org/en/latest/output.html) for more details. For an
+# example see the documentation.
+# This tag requires that the tag USE_MATHJAX is set to YES.
+
+MATHJAX_CODEFILE =
+
+# When the SEARCHENGINE tag is enabled doxygen will generate a search box for
+# the HTML output. The underlying search engine uses javascript and DHTML and
+# should work on any modern browser. Note that when using HTML help
+# (GENERATE_HTMLHELP), Qt help (GENERATE_QHP), or docsets (GENERATE_DOCSET)
+# there is already a search function so this one should typically be disabled.
+# For large projects the javascript based search engine can be slow, then
+# enabling SERVER_BASED_SEARCH may provide a better solution. It is possible to
+# search using the keyboard; to jump to the search box use <access key> + S
+# (what the <access key> is depends on the OS and browser, but it is typically
+# <CTRL>, <ALT>/<option>, or both). Inside the search box use the <cursor down
+# key> to jump into the search results window, the results can be navigated
+# using the <cursor keys>. Press <Enter> to select an item or <escape> to cancel
+# the search. The filter options can be selected when the cursor is inside the
+# search box by pressing <Shift>+<cursor down>. Also here use the <cursor keys>
+# to select a filter and <Enter> or <escape> to activate or cancel the filter
+# option.
+# The default value is: YES.
+# This tag requires that the tag GENERATE_HTML is set to YES.
+
+SEARCHENGINE = YES
+
+# When the SERVER_BASED_SEARCH tag is enabled the search engine will be
+# implemented using a web server instead of a web client using Javascript. There
+# are two flavors of web server based searching depending on the EXTERNAL_SEARCH
+# setting. When disabled, doxygen will generate a PHP script for searching and
+# an index file used by the script. When EXTERNAL_SEARCH is enabled the indexing
+# and searching needs to be provided by external tools. See the section
+# "External Indexing and Searching" for details.
+# The default value is: NO.
+# This tag requires that the tag SEARCHENGINE is set to YES.
+
+SERVER_BASED_SEARCH = NO
+
+# When EXTERNAL_SEARCH tag is enabled doxygen will no longer generate the PHP
+# script for searching. Instead the search results are written to an XML file
+# which needs to be processed by an external indexer. Doxygen will invoke an
+# external search engine pointed to by the SEARCHENGINE_URL option to obtain the
+# search results.
+#
+# Doxygen ships with an example indexer (doxyindexer) and search engine
+# (doxysearch.cgi) which are based on the open source search engine library
+# Xapian (see: http://xapian.org/).
+#
+# See the section "External Indexing and Searching" for details.
+# The default value is: NO.
+# This tag requires that the tag SEARCHENGINE is set to YES.
+
+EXTERNAL_SEARCH = NO
+
+# The SEARCHENGINE_URL should point to a search engine hosted by a web server
+# which will return the search results when EXTERNAL_SEARCH is enabled.
+#
+# Doxygen ships with an example indexer (doxyindexer) and search engine
+# (doxysearch.cgi) which are based on the open source search engine library
+# Xapian (see: http://xapian.org/). See the section "External Indexing and
+# Searching" for details.
+# This tag requires that the tag SEARCHENGINE is set to YES.
+
+SEARCHENGINE_URL =
+
+# When SERVER_BASED_SEARCH and EXTERNAL_SEARCH are both enabled the unindexed
+# search data is written to a file for indexing by an external tool. With the
+# SEARCHDATA_FILE tag the name of this file can be specified.
+# The default file is: searchdata.xml.
+# This tag requires that the tag SEARCHENGINE is set to YES.
+
+SEARCHDATA_FILE = searchdata.xml
+
+# When SERVER_BASED_SEARCH and EXTERNAL_SEARCH are both enabled the
+# EXTERNAL_SEARCH_ID tag can be used as an identifier for the project. This is
+# useful in combination with EXTRA_SEARCH_MAPPINGS to search through multiple
+# projects and redirect the results back to the right project.
+# This tag requires that the tag SEARCHENGINE is set to YES.
+
+EXTERNAL_SEARCH_ID =
+
+# The EXTRA_SEARCH_MAPPINGS tag can be used to enable searching through doxygen
+# projects other than the one defined by this configuration file, but that are
+# all added to the same external search index. Each project needs to have a
+# unique id set via EXTERNAL_SEARCH_ID. The search mapping then maps the id of
+# to a relative location where the documentation can be found. The format is:
+# EXTRA_SEARCH_MAPPINGS = tagname1=loc1 tagname2=loc2 ...
+# This tag requires that the tag SEARCHENGINE is set to YES.
+
+EXTRA_SEARCH_MAPPINGS =
+
+#---------------------------------------------------------------------------
+# Configuration options related to the LaTeX output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_LATEX tag is set to YES, doxygen will generate LaTeX output.
+# The default value is: YES.
+
+GENERATE_LATEX = YES
+
+# The LATEX_OUTPUT tag is used to specify where the LaTeX docs will be put. If a
+# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of
+# it.
+# The default directory is: latex.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_OUTPUT = latex
+
+# The LATEX_CMD_NAME tag can be used to specify the LaTeX command name to be
+# invoked.
+#
+# Note that when enabling USE_PDFLATEX this option is only used for generating
+# bitmaps for formulas in the HTML output, but not in the Makefile that is
+# written to the output directory.
+# The default file is: latex.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_CMD_NAME = latex
+
+# The MAKEINDEX_CMD_NAME tag can be used to specify the command name to generate
+# index for LaTeX.
+# The default file is: makeindex.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+MAKEINDEX_CMD_NAME = makeindex
+
+# If the COMPACT_LATEX tag is set to YES, doxygen generates more compact LaTeX
+# documents. This may be useful for small projects and may help to save some
+# trees in general.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+COMPACT_LATEX = NO
+
+# The PAPER_TYPE tag can be used to set the paper type that is used by the
+# printer.
+# Possible values are: a4 (210 x 297 mm), letter (8.5 x 11 inches), legal (8.5 x
+# 14 inches) and executive (7.25 x 10.5 inches).
+# The default value is: a4.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+PAPER_TYPE = a4
+
+# The EXTRA_PACKAGES tag can be used to specify one or more LaTeX package names
+# that should be included in the LaTeX output. The package can be specified just
+# by its name or with the correct syntax as to be used with the LaTeX
+# \usepackage command. To get the times font for instance you can specify :
+# EXTRA_PACKAGES=times or EXTRA_PACKAGES={times}
+# To use the option intlimits with the amsmath package you can specify:
+# EXTRA_PACKAGES=[intlimits]{amsmath}
+# If left blank no extra packages will be included.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+EXTRA_PACKAGES =
+
+# The LATEX_HEADER tag can be used to specify a personal LaTeX header for the
+# generated LaTeX document. The header should contain everything until the first
+# chapter. If it is left blank doxygen will generate a standard header. See
+# section "Doxygen usage" for information on how to let doxygen write the
+# default header to a separate file.
+#
+# Note: Only use a user-defined header if you know what you are doing! The
+# following commands have a special meaning inside the header: $title,
+# $datetime, $date, $doxygenversion, $projectname, $projectnumber,
+# $projectbrief, $projectlogo. Doxygen will replace $title with the empty
+# string, for the replacement values of the other commands the user is referred
+# to HTML_HEADER.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_HEADER =
+
+# The LATEX_FOOTER tag can be used to specify a personal LaTeX footer for the
+# generated LaTeX document. The footer should contain everything after the last
+# chapter. If it is left blank doxygen will generate a standard footer. See
+# LATEX_HEADER for more information on how to generate a default footer and what
+# special commands can be used inside the footer.
+#
+# Note: Only use a user-defined footer if you know what you are doing!
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_FOOTER =
+
+# The LATEX_EXTRA_STYLESHEET tag can be used to specify additional user-defined
+# LaTeX style sheets that are included after the standard style sheets created
+# by doxygen. Using this option one can overrule certain style aspects. Doxygen
+# will copy the style sheet files to the output directory.
+# Note: The order of the extra style sheet files is of importance (e.g. the last
+# style sheet in the list overrules the setting of the previous ones in the
+# list).
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_EXTRA_STYLESHEET =
+
+# The LATEX_EXTRA_FILES tag can be used to specify one or more extra images or
+# other source files which should be copied to the LATEX_OUTPUT output
+# directory. Note that the files will be copied as-is; there are no commands or
+# markers available.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_EXTRA_FILES =
+
+# If the PDF_HYPERLINKS tag is set to YES, the LaTeX that is generated is
+# prepared for conversion to PDF (using ps2pdf or pdflatex). The PDF file will
+# contain links (just like the HTML output) instead of page references. This
+# makes the output suitable for online browsing using a PDF viewer.
+# The default value is: YES.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+PDF_HYPERLINKS = YES
+
+# If the USE_PDFLATEX tag is set to YES, doxygen will use pdflatex to generate
+# the PDF file directly from the LaTeX files. Set this option to YES, to get a
+# higher quality PDF documentation.
+# The default value is: YES.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+USE_PDFLATEX = YES
+
+# If the LATEX_BATCHMODE tag is set to YES, doxygen will add the \batchmode
+# command to the generated LaTeX files. This will instruct LaTeX to keep running
+# if errors occur, instead of asking the user for help. This option is also used
+# when generating formulas in HTML.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_BATCHMODE = NO
+
+# If the LATEX_HIDE_INDICES tag is set to YES then doxygen will not include the
+# index chapters (such as File Index, Compound Index, etc.) in the output.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_HIDE_INDICES = NO
+
+# If the LATEX_SOURCE_CODE tag is set to YES then doxygen will include source
+# code with syntax highlighting in the LaTeX output.
+#
+# Note that which sources are shown also depends on other settings such as
+# SOURCE_BROWSER.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_SOURCE_CODE = NO
+
+# The LATEX_BIB_STYLE tag can be used to specify the style to use for the
+# bibliography, e.g. plainnat, or ieeetr. See
+# http://en.wikipedia.org/wiki/BibTeX and \cite for more info.
+# The default value is: plain.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_BIB_STYLE = plain
+
+# If the LATEX_TIMESTAMP tag is set to YES then the footer of each generated
+# page will contain the date and time when the page was generated. Setting this
+# to NO can help when comparing the output of multiple runs.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_LATEX is set to YES.
+
+LATEX_TIMESTAMP = NO
+
+#---------------------------------------------------------------------------
+# Configuration options related to the RTF output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_RTF tag is set to YES, doxygen will generate RTF output. The
+# RTF output is optimized for Word 97 and may not look too pretty with other RTF
+# readers/editors.
+# The default value is: NO.
+
+GENERATE_RTF = NO
+
+# The RTF_OUTPUT tag is used to specify where the RTF docs will be put. If a
+# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of
+# it.
+# The default directory is: rtf.
+# This tag requires that the tag GENERATE_RTF is set to YES.
+
+RTF_OUTPUT = rtf
+
+# If the COMPACT_RTF tag is set to YES, doxygen generates more compact RTF
+# documents. This may be useful for small projects and may help to save some
+# trees in general.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_RTF is set to YES.
+
+COMPACT_RTF = NO
+
+# If the RTF_HYPERLINKS tag is set to YES, the RTF that is generated will
+# contain hyperlink fields. The RTF file will contain links (just like the HTML
+# output) instead of page references. This makes the output suitable for online
+# browsing using Word or some other Word compatible readers that support those
+# fields.
+#
+# Note: WordPad (write) and others do not support links.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_RTF is set to YES.
+
+RTF_HYPERLINKS = NO
+
+# Load stylesheet definitions from file. Syntax is similar to doxygen's config
+# file, i.e. a series of assignments. You only have to provide replacements,
+# missing definitions are set to their default value.
+#
+# See also section "Doxygen usage" for information on how to generate the
+# default style sheet that doxygen normally uses.
+# This tag requires that the tag GENERATE_RTF is set to YES.
+
+RTF_STYLESHEET_FILE =
+
+# Set optional variables used in the generation of an RTF document. Syntax is
+# similar to doxygen's config file. A template extensions file can be generated
+# using doxygen -e rtf extensionFile.
+# This tag requires that the tag GENERATE_RTF is set to YES.
+
+RTF_EXTENSIONS_FILE =
+
+# If the RTF_SOURCE_CODE tag is set to YES then doxygen will include source code
+# with syntax highlighting in the RTF output.
+#
+# Note that which sources are shown also depends on other settings such as
+# SOURCE_BROWSER.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_RTF is set to YES.
+
+RTF_SOURCE_CODE = NO
+
+#---------------------------------------------------------------------------
+# Configuration options related to the man page output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_MAN tag is set to YES, doxygen will generate man pages for
+# classes and files.
+# The default value is: NO.
+
+GENERATE_MAN = NO
+
+# The MAN_OUTPUT tag is used to specify where the man pages will be put. If a
+# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of
+# it. A directory man3 will be created inside the directory specified by
+# MAN_OUTPUT.
+# The default directory is: man.
+# This tag requires that the tag GENERATE_MAN is set to YES.
+
+MAN_OUTPUT = man
+
+# The MAN_EXTENSION tag determines the extension that is added to the generated
+# man pages. In case the manual section does not start with a number, the number
+# 3 is prepended. The dot (.) at the beginning of the MAN_EXTENSION tag is
+# optional.
+# The default value is: .3.
+# This tag requires that the tag GENERATE_MAN is set to YES.
+
+MAN_EXTENSION = .3
+
+# The MAN_SUBDIR tag determines the name of the directory created within
+# MAN_OUTPUT in which the man pages are placed. If defaults to man followed by
+# MAN_EXTENSION with the initial . removed.
+# This tag requires that the tag GENERATE_MAN is set to YES.
+
+MAN_SUBDIR =
+
+# If the MAN_LINKS tag is set to YES and doxygen generates man output, then it
+# will generate one additional man file for each entity documented in the real
+# man page(s). These additional files only source the real man page, but without
+# them the man command would be unable to find the correct page.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_MAN is set to YES.
+
+MAN_LINKS = NO
+
+#---------------------------------------------------------------------------
+# Configuration options related to the XML output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_XML tag is set to YES, doxygen will generate an XML file that
+# captures the structure of the code including all documentation.
+# The default value is: NO.
+
+GENERATE_XML = NO
+
+# The XML_OUTPUT tag is used to specify where the XML pages will be put. If a
+# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of
+# it.
+# The default directory is: xml.
+# This tag requires that the tag GENERATE_XML is set to YES.
+
+XML_OUTPUT = xml
+
+# If the XML_PROGRAMLISTING tag is set to YES, doxygen will dump the program
+# listings (including syntax highlighting and cross-referencing information) to
+# the XML output. Note that enabling this will significantly increase the size
+# of the XML output.
+# The default value is: YES.
+# This tag requires that the tag GENERATE_XML is set to YES.
+
+XML_PROGRAMLISTING = YES
+
+#---------------------------------------------------------------------------
+# Configuration options related to the DOCBOOK output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_DOCBOOK tag is set to YES, doxygen will generate Docbook files
+# that can be used to generate PDF.
+# The default value is: NO.
+
+GENERATE_DOCBOOK = NO
+
+# The DOCBOOK_OUTPUT tag is used to specify where the Docbook pages will be put.
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be put in
+# front of it.
+# The default directory is: docbook.
+# This tag requires that the tag GENERATE_DOCBOOK is set to YES.
+
+DOCBOOK_OUTPUT = docbook
+
+# If the DOCBOOK_PROGRAMLISTING tag is set to YES, doxygen will include the
+# program listings (including syntax highlighting and cross-referencing
+# information) to the DOCBOOK output. Note that enabling this will significantly
+# increase the size of the DOCBOOK output.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_DOCBOOK is set to YES.
+
+DOCBOOK_PROGRAMLISTING = NO
+
+#---------------------------------------------------------------------------
+# Configuration options for the AutoGen Definitions output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_AUTOGEN_DEF tag is set to YES, doxygen will generate an
+# AutoGen Definitions (see http://autogen.sf.net) file that captures the
+# structure of the code including all documentation. Note that this feature is
+# still experimental and incomplete at the moment.
+# The default value is: NO.
+
+GENERATE_AUTOGEN_DEF = NO
+
+#---------------------------------------------------------------------------
+# Configuration options related to the Perl module output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_PERLMOD tag is set to YES, doxygen will generate a Perl module
+# file that captures the structure of the code including all documentation.
+#
+# Note that this feature is still experimental and incomplete at the moment.
+# The default value is: NO.
+
+GENERATE_PERLMOD = NO
+
+# If the PERLMOD_LATEX tag is set to YES, doxygen will generate the necessary
+# Makefile rules, Perl scripts and LaTeX code to be able to generate PDF and DVI
+# output from the Perl module output.
+# The default value is: NO.
+# This tag requires that the tag GENERATE_PERLMOD is set to YES.
+
+PERLMOD_LATEX = NO
+
+# If the PERLMOD_PRETTY tag is set to YES, the Perl module output will be nicely
+# formatted so it can be parsed by a human reader. This is useful if you want to
+# understand what is going on. On the other hand, if this tag is set to NO, the
+# size of the Perl module output will be much smaller and Perl will parse it
+# just the same.
+# The default value is: YES.
+# This tag requires that the tag GENERATE_PERLMOD is set to YES.
+
+PERLMOD_PRETTY = YES
+
+# The names of the make variables in the generated doxyrules.make file are
+# prefixed with the string contained in PERLMOD_MAKEVAR_PREFIX. This is useful
+# so different doxyrules.make files included by the same Makefile don't
+# overwrite each other's variables.
+# This tag requires that the tag GENERATE_PERLMOD is set to YES.
+
+PERLMOD_MAKEVAR_PREFIX =
+
+#---------------------------------------------------------------------------
+# Configuration options related to the preprocessor
+#---------------------------------------------------------------------------
+
+# If the ENABLE_PREPROCESSING tag is set to YES, doxygen will evaluate all
+# C-preprocessor directives found in the sources and include files.
+# The default value is: YES.
+
+ENABLE_PREPROCESSING = YES
+
+# If the MACRO_EXPANSION tag is set to YES, doxygen will expand all macro names
+# in the source code. If set to NO, only conditional compilation will be
+# performed. Macro expansion can be done in a controlled way by setting
+# EXPAND_ONLY_PREDEF to YES.
+# The default value is: NO.
+# This tag requires that the tag ENABLE_PREPROCESSING is set to YES.
+
+MACRO_EXPANSION = NO
+
+# If the EXPAND_ONLY_PREDEF and MACRO_EXPANSION tags are both set to YES then
+# the macro expansion is limited to the macros specified with the PREDEFINED and
+# EXPAND_AS_DEFINED tags.
+# The default value is: NO.
+# This tag requires that the tag ENABLE_PREPROCESSING is set to YES.
+
+EXPAND_ONLY_PREDEF = NO
+
+# If the SEARCH_INCLUDES tag is set to YES, the include files in the
+# INCLUDE_PATH will be searched if a #include is found.
+# The default value is: YES.
+# This tag requires that the tag ENABLE_PREPROCESSING is set to YES.
+
+SEARCH_INCLUDES = YES
+
+# The INCLUDE_PATH tag can be used to specify one or more directories that
+# contain include files that are not input files but should be processed by the
+# preprocessor.
+# This tag requires that the tag SEARCH_INCLUDES is set to YES.
+
+INCLUDE_PATH =
+
+# You can use the INCLUDE_FILE_PATTERNS tag to specify one or more wildcard
+# patterns (like *.h and *.hpp) to filter out the header-files in the
+# directories. If left blank, the patterns specified with FILE_PATTERNS will be
+# used.
+# This tag requires that the tag ENABLE_PREPROCESSING is set to YES.
+
+INCLUDE_FILE_PATTERNS =
+
+# The PREDEFINED tag can be used to specify one or more macro names that are
+# defined before the preprocessor is started (similar to the -D option of e.g.
+# gcc). The argument of the tag is a list of macros of the form: name or
+# name=definition (no spaces). If the definition and the "=" are omitted, "=1"
+# is assumed. To prevent a macro definition from being undefined via #undef or
+# recursively expanded use the := operator instead of the = operator.
+# This tag requires that the tag ENABLE_PREPROCESSING is set to YES.
+
+PREDEFINED =
+
+# If the MACRO_EXPANSION and EXPAND_ONLY_PREDEF tags are set to YES then this
+# tag can be used to specify a list of macro names that should be expanded. The
+# macro definition that is found in the sources will be used. Use the PREDEFINED
+# tag if you want to use a different macro definition that overrules the
+# definition found in the source code.
+# This tag requires that the tag ENABLE_PREPROCESSING is set to YES.
+
+EXPAND_AS_DEFINED =
+
+# If the SKIP_FUNCTION_MACROS tag is set to YES then doxygen's preprocessor will
+# remove all references to function-like macros that are alone on a line, have
+# an all uppercase name, and do not end with a semicolon. Such function macros
+# are typically used for boiler-plate code, and will confuse the parser if not
+# removed.
+# The default value is: YES.
+# This tag requires that the tag ENABLE_PREPROCESSING is set to YES.
+
+SKIP_FUNCTION_MACROS = YES
+
+#---------------------------------------------------------------------------
+# Configuration options related to external references
+#---------------------------------------------------------------------------
+
+# The TAGFILES tag can be used to specify one or more tag files. For each tag
+# file the location of the external documentation should be added. The format of
+# a tag file without this location is as follows:
+# TAGFILES = file1 file2 ...
+# Adding location for the tag files is done as follows:
+# TAGFILES = file1=loc1 "file2 = loc2" ...
+# where loc1 and loc2 can be relative or absolute paths or URLs. See the
+# section "Linking to external documentation" for more information about the use
+# of tag files.
+# Note: Each tag file must have a unique name (where the name does NOT include
+# the path). If a tag file is not located in the directory in which doxygen is
+# run, you must also specify the path to the tagfile here.
+
+TAGFILES =
+
+# When a file name is specified after GENERATE_TAGFILE, doxygen will create a
+# tag file that is based on the input files it reads. See section "Linking to
+# external documentation" for more information about the usage of tag files.
+
+GENERATE_TAGFILE =
+
+# If the ALLEXTERNALS tag is set to YES, all external class will be listed in
+# the class index. If set to NO, only the inherited external classes will be
+# listed.
+# The default value is: NO.
+
+ALLEXTERNALS = NO
+
+# If the EXTERNAL_GROUPS tag is set to YES, all external groups will be listed
+# in the modules index. If set to NO, only the current project's groups will be
+# listed.
+# The default value is: YES.
+
+EXTERNAL_GROUPS = YES
+
+# If the EXTERNAL_PAGES tag is set to YES, all external pages will be listed in
+# the related pages index. If set to NO, only the current project's pages will
+# be listed.
+# The default value is: YES.
+
+EXTERNAL_PAGES = YES
+
+# The PERL_PATH should be the absolute path and name of the perl script
+# interpreter (i.e. the result of 'which perl').
+# The default file (with absolute path) is: /usr/bin/perl.
+
+PERL_PATH = /usr/bin/perl
+
+#---------------------------------------------------------------------------
+# Configuration options related to the dot tool
+#---------------------------------------------------------------------------
+
+# If the CLASS_DIAGRAMS tag is set to YES, doxygen will generate a class diagram
+# (in HTML and LaTeX) for classes with base or super classes. Setting the tag to
+# NO turns the diagrams off. Note that this option also works with HAVE_DOT
+# disabled, but it is recommended to install and use dot, since it yields more
+# powerful graphs.
+# The default value is: YES.
+
+CLASS_DIAGRAMS = YES
+
+# You can define message sequence charts within doxygen comments using the \msc
+# command. Doxygen will then run the mscgen tool (see:
+# http://www.mcternan.me.uk/mscgen/)) to produce the chart and insert it in the
+# documentation. The MSCGEN_PATH tag allows you to specify the directory where
+# the mscgen tool resides. If left empty the tool is assumed to be found in the
+# default search path.
+
+MSCGEN_PATH =
+
+# You can include diagrams made with dia in doxygen documentation. Doxygen will
+# then run dia to produce the diagram and insert it in the documentation. The
+# DIA_PATH tag allows you to specify the directory where the dia binary resides.
+# If left empty dia is assumed to be found in the default search path.
+
+DIA_PATH =
+
+# If set to YES the inheritance and collaboration graphs will hide inheritance
+# and usage relations if the target is undocumented or is not a class.
+# The default value is: YES.
+
+HIDE_UNDOC_RELATIONS = YES
+
+# If you set the HAVE_DOT tag to YES then doxygen will assume the dot tool is
+# available from the path. This tool is part of Graphviz (see:
+# http://www.graphviz.org/), a graph visualization toolkit from AT&T and Lucent
+# Bell Labs. The other options in this section have no effect if this option is
+# set to NO
+# The default value is: YES.
+
+HAVE_DOT = YES
+
+# The DOT_NUM_THREADS specifies the number of dot invocations doxygen is allowed
+# to run in parallel. When set to 0 doxygen will base this on the number of
+# processors available in the system. You can set it explicitly to a value
+# larger than 0 to get control over the balance between CPU load and processing
+# speed.
+# Minimum value: 0, maximum value: 32, default value: 0.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_NUM_THREADS = 0
+
+# When you want a differently looking font in the dot files that doxygen
+# generates you can specify the font name using DOT_FONTNAME. You need to make
+# sure dot is able to find the font, which can be done by putting it in a
+# standard location or by setting the DOTFONTPATH environment variable or by
+# setting DOT_FONTPATH to the directory containing the font.
+# The default value is: Helvetica.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_FONTNAME = Helvetica
+
+# The DOT_FONTSIZE tag can be used to set the size (in points) of the font of
+# dot graphs.
+# Minimum value: 4, maximum value: 24, default value: 10.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_FONTSIZE = 10
+
+# By default doxygen will tell dot to use the default font as specified with
+# DOT_FONTNAME. If you specify a different font using DOT_FONTNAME you can set
+# the path where dot can find it using this tag.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_FONTPATH =
+
+# If the CLASS_GRAPH tag is set to YES then doxygen will generate a graph for
+# each documented class showing the direct and indirect inheritance relations.
+# Setting this tag to YES will force the CLASS_DIAGRAMS tag to NO.
+# The default value is: YES.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+CLASS_GRAPH = YES
+
+# If the COLLABORATION_GRAPH tag is set to YES then doxygen will generate a
+# graph for each documented class showing the direct and indirect implementation
+# dependencies (inheritance, containment, and class references variables) of the
+# class with other documented classes.
+# The default value is: YES.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+COLLABORATION_GRAPH = YES
+
+# If the GROUP_GRAPHS tag is set to YES then doxygen will generate a graph for
+# groups, showing the direct groups dependencies.
+# The default value is: YES.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+GROUP_GRAPHS = YES
+
+# If the UML_LOOK tag is set to YES, doxygen will generate inheritance and
+# collaboration diagrams in a style similar to the OMG's Unified Modeling
+# Language.
+# The default value is: NO.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+UML_LOOK = NO
+
+# If the UML_LOOK tag is enabled, the fields and methods are shown inside the
+# class node. If there are many fields or methods and many nodes the graph may
+# become too big to be useful. The UML_LIMIT_NUM_FIELDS threshold limits the
+# number of items for each type to make the size more manageable. Set this to 0
+# for no limit. Note that the threshold may be exceeded by 50% before the limit
+# is enforced. So when you set the threshold to 10, up to 15 fields may appear,
+# but if the number exceeds 15, the total amount of fields shown is limited to
+# 10.
+# Minimum value: 0, maximum value: 100, default value: 10.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+UML_LIMIT_NUM_FIELDS = 10
+
+# If the TEMPLATE_RELATIONS tag is set to YES then the inheritance and
+# collaboration graphs will show the relations between templates and their
+# instances.
+# The default value is: NO.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+TEMPLATE_RELATIONS = NO
+
+# If the INCLUDE_GRAPH, ENABLE_PREPROCESSING and SEARCH_INCLUDES tags are set to
+# YES then doxygen will generate a graph for each documented file showing the
+# direct and indirect include dependencies of the file with other documented
+# files.
+# The default value is: YES.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+INCLUDE_GRAPH = YES
+
+# If the INCLUDED_BY_GRAPH, ENABLE_PREPROCESSING and SEARCH_INCLUDES tags are
+# set to YES then doxygen will generate a graph for each documented file showing
+# the direct and indirect include dependencies of the file with other documented
+# files.
+# The default value is: YES.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+INCLUDED_BY_GRAPH = YES
+
+# If the CALL_GRAPH tag is set to YES then doxygen will generate a call
+# dependency graph for every global function or class method.
+#
+# Note that enabling this option will significantly increase the time of a run.
+# So in most cases it will be better to enable call graphs for selected
+# functions only using the \callgraph command. Disabling a call graph can be
+# accomplished by means of the command \hidecallgraph.
+# The default value is: NO.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+CALL_GRAPH = NO
+
+# If the CALLER_GRAPH tag is set to YES then doxygen will generate a caller
+# dependency graph for every global function or class method.
+#
+# Note that enabling this option will significantly increase the time of a run.
+# So in most cases it will be better to enable caller graphs for selected
+# functions only using the \callergraph command. Disabling a caller graph can be
+# accomplished by means of the command \hidecallergraph.
+# The default value is: NO.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+CALLER_GRAPH = NO
+
+# If the GRAPHICAL_HIERARCHY tag is set to YES then doxygen will graphical
+# hierarchy of all classes instead of a textual one.
+# The default value is: YES.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+GRAPHICAL_HIERARCHY = YES
+
+# If the DIRECTORY_GRAPH tag is set to YES then doxygen will show the
+# dependencies a directory has on other directories in a graphical way. The
+# dependency relations are determined by the #include relations between the
+# files in the directories.
+# The default value is: YES.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DIRECTORY_GRAPH = YES
+
+# The DOT_IMAGE_FORMAT tag can be used to set the image format of the images
+# generated by dot. For an explanation of the image formats see the section
+# output formats in the documentation of the dot tool (Graphviz (see:
+# http://www.graphviz.org/)).
+# Note: If you choose svg you need to set HTML_FILE_EXTENSION to xhtml in order
+# to make the SVG files visible in IE 9+ (other browsers do not have this
+# requirement).
+# Possible values are: png, png:cairo, png:cairo:cairo, png:cairo:gd, png:gd,
+# png:gd:gd, jpg, jpg:cairo, jpg:cairo:gd, jpg:gd, jpg:gd:gd, gif, gif:cairo,
+# gif:cairo:gd, gif:gd, gif:gd:gd, svg, png:gd, png:gd:gd, png:cairo,
+# png:cairo:gd, png:cairo:cairo, png:cairo:gdiplus, png:gdiplus and
+# png:gdiplus:gdiplus.
+# The default value is: png.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_IMAGE_FORMAT = png
+
+# If DOT_IMAGE_FORMAT is set to svg, then this option can be set to YES to
+# enable generation of interactive SVG images that allow zooming and panning.
+#
+# Note that this requires a modern browser other than Internet Explorer. Tested
+# and working are Firefox, Chrome, Safari, and Opera.
+# Note: For IE 9+ you need to set HTML_FILE_EXTENSION to xhtml in order to make
+# the SVG files visible. Older versions of IE do not have SVG support.
+# The default value is: NO.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+INTERACTIVE_SVG = NO
+
+# The DOT_PATH tag can be used to specify the path where the dot tool can be
+# found. If left blank, it is assumed the dot tool can be found in the path.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_PATH =
+
+# The DOTFILE_DIRS tag can be used to specify one or more directories that
+# contain dot files that are included in the documentation (see the \dotfile
+# command).
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOTFILE_DIRS =
+
+# The MSCFILE_DIRS tag can be used to specify one or more directories that
+# contain msc files that are included in the documentation (see the \mscfile
+# command).
+
+MSCFILE_DIRS =
+
+# The DIAFILE_DIRS tag can be used to specify one or more directories that
+# contain dia files that are included in the documentation (see the \diafile
+# command).
+
+DIAFILE_DIRS =
+
+# When using plantuml, the PLANTUML_JAR_PATH tag should be used to specify the
+# path where java can find the plantuml.jar file. If left blank, it is assumed
+# PlantUML is not used or called during a preprocessing step. Doxygen will
+# generate a warning when it encounters a \startuml command in this case and
+# will not generate output for the diagram.
+
+PLANTUML_JAR_PATH =
+
+# When using plantuml, the PLANTUML_CFG_FILE tag can be used to specify a
+# configuration file for plantuml.
+
+PLANTUML_CFG_FILE =
+
+# When using plantuml, the specified paths are searched for files specified by
+# the !include statement in a plantuml block.
+
+PLANTUML_INCLUDE_PATH =
+
+# The DOT_GRAPH_MAX_NODES tag can be used to set the maximum number of nodes
+# that will be shown in the graph. If the number of nodes in a graph becomes
+# larger than this value, doxygen will truncate the graph, which is visualized
+# by representing a node as a red box. Note that doxygen if the number of direct
+# children of the root node in a graph is already larger than
+# DOT_GRAPH_MAX_NODES then the graph will not be shown at all. Also note that
+# the size of a graph can be further restricted by MAX_DOT_GRAPH_DEPTH.
+# Minimum value: 0, maximum value: 10000, default value: 50.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_GRAPH_MAX_NODES = 50
+
+# The MAX_DOT_GRAPH_DEPTH tag can be used to set the maximum depth of the graphs
+# generated by dot. A depth value of 3 means that only nodes reachable from the
+# root by following a path via at most 3 edges will be shown. Nodes that lay
+# further from the root node will be omitted. Note that setting this option to 1
+# or 2 may greatly reduce the computation time needed for large code bases. Also
+# note that the size of a graph can be further restricted by
+# DOT_GRAPH_MAX_NODES. Using a depth of 0 means no depth restriction.
+# Minimum value: 0, maximum value: 1000, default value: 0.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+MAX_DOT_GRAPH_DEPTH = 0
+
+# Set the DOT_TRANSPARENT tag to YES to generate images with a transparent
+# background. This is disabled by default, because dot on Windows does not seem
+# to support this out of the box.
+#
+# Warning: Depending on the platform used, enabling this option may lead to
+# badly anti-aliased labels on the edges of a graph (i.e. they become hard to
+# read).
+# The default value is: NO.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_TRANSPARENT = NO
+
+# Set the DOT_MULTI_TARGETS tag to YES to allow dot to generate multiple output
+# files in one run (i.e. multiple -o and -T options on the command line). This
+# makes dot run faster, but since only newer versions of dot (>1.8.10) support
+# this, this feature is disabled by default.
+# The default value is: NO.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_MULTI_TARGETS = NO
+
+# If the GENERATE_LEGEND tag is set to YES doxygen will generate a legend page
+# explaining the meaning of the various boxes and arrows in the dot generated
+# graphs.
+# The default value is: YES.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+GENERATE_LEGEND = YES
+
+# If the DOT_CLEANUP tag is set to YES, doxygen will remove the intermediate dot
+# files that are used to generate the various graphs.
+# The default value is: YES.
+# This tag requires that the tag HAVE_DOT is set to YES.
+
+DOT_CLEANUP = YES
diff --git a/docs/html/.gitkeep b/docs/html/.gitkeep
deleted file mode 100755
index e69de29bb2d1d6434b8b29ae775ad8c2e48c5391..0000000000000000000000000000000000000000
diff --git a/docs/html/_factor_oracle_8cpp.html b/docs/html/_factor_oracle_8cpp.html
deleted file mode 100644
index 99c21a0a7eb122169b51c4ab10d3c43346f7e65d..0000000000000000000000000000000000000000
--- a/docs/html/_factor_oracle_8cpp.html
+++ /dev/null
@@ -1,98 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: FactorOracle.cpp File Reference</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-</div><!-- top -->
-<div class="header">
- <div class="summary">
-<a href="#var-members">Variables</a> </div>
- <div class="headertitle">
-<div class="title">FactorOracle.cpp File Reference</div> </div>
-</div><!--header-->
-<div class="contents">
-
-<p>A file that contains the functions needed for the creation of a Factor Oracle.
-<a href="#details">More...</a></p>
-<div class="textblock"><code>#include "<a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a>"</code><br />
-</div><table class="memberdecls">
-<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="var-members"></a>
-Variables</h2></td></tr>
-<tr class="memitem:a5eb6eb3bacab6fd40c8df6d435e06209"><td class="memItemLeft" align="right" valign="top"><a id="a5eb6eb3bacab6fd40c8df6d435e06209"></a>
-int </td><td class="memItemRight" valign="bottom"><b>phi</b></td></tr>
-<tr class="separator:a5eb6eb3bacab6fd40c8df6d435e06209"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:ab66ed8e0098c0a86b458672a55a9cca9"><td class="memItemLeft" align="right" valign="top"><a id="ab66ed8e0098c0a86b458672a55a9cca9"></a>
-int </td><td class="memItemRight" valign="bottom"><b>k</b></td></tr>
-<tr class="separator:ab66ed8e0098c0a86b458672a55a9cca9"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:aa2fc876c0cc6ed51259586d7bea34f0f"><td class="memItemLeft" align="right" valign="top"><a id="aa2fc876c0cc6ed51259586d7bea34f0f"></a>
-int </td><td class="memItemRight" valign="bottom"><b>fo_iter</b></td></tr>
-<tr class="separator:aa2fc876c0cc6ed51259586d7bea34f0f"><td class="memSeparator" colspan="2"> </td></tr>
-</table>
-<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2>
-<div class="textblock"><p>A file that contains the functions needed for the creation of a Factor Oracle. </p>
-<p>Five main functions: FactorOracleStart, AddLetter, LengthCommonSuffix, FindBetter and FOGenerate. </p>
-</div></div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/_factor_oracle_8h.html b/docs/html/_factor_oracle_8h.html
deleted file mode 100644
index fa87e4b998931145be0b9f6cf5a4d82850a79df1..0000000000000000000000000000000000000000
--- a/docs/html/_factor_oracle_8h.html
+++ /dev/null
@@ -1,113 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: FactorOracle.h File Reference</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-</div><!-- top -->
-<div class="header">
- <div class="summary">
-<a href="#nested-classes">Classes</a> |
-<a href="#define-members">Macros</a> </div>
- <div class="headertitle">
-<div class="title">FactorOracle.h File Reference</div> </div>
-</div><!--header-->
-<div class="contents">
-
-<p>A file that contains the definitions of the classes needed for the creation of a Factor Oracle.
-<a href="#details">More...</a></p>
-<div class="textblock"><code>#include <iostream></code><br />
-<code>#include <new></code><br />
-<code>#include <string></code><br />
-<code>#include <vector></code><br />
-<code>#include <variant></code><br />
-<code>#include <random></code><br />
-<code>#include <algorithm></code><br />
-</div>
-<p><a href="_factor_oracle_8h_source.html">Go to the source code of this file.</a></p>
-<table class="memberdecls">
-<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="nested-classes"></a>
-Classes</h2></td></tr>
-<tr class="memitem:"><td class="memItemLeft" align="right" valign="top">class  </td><td class="memItemRight" valign="bottom"><a class="el" href="class_single_transition.html">SingleTransition</a></td></tr>
-<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:"><td class="memItemLeft" align="right" valign="top">class  </td><td class="memItemRight" valign="bottom"><a class="el" href="class_state.html">State</a></td></tr>
-<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:"><td class="memItemLeft" align="right" valign="top">class  </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td></tr>
-<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr>
-</table><table class="memberdecls">
-<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="define-members"></a>
-Macros</h2></td></tr>
-<tr class="memitem:a5c71a5e59a53413cd6c270266d63b031"><td class="memItemLeft" align="right" valign="top"><a id="a5c71a5e59a53413cd6c270266d63b031"></a>
-#define </td><td class="memItemRight" valign="bottom"><b>R</b>   10</td></tr>
-<tr class="separator:a5c71a5e59a53413cd6c270266d63b031"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:a690f251553b39fd4f31894826141b61a"><td class="memItemLeft" align="right" valign="top"><a id="a690f251553b39fd4f31894826141b61a"></a>
-#define </td><td class="memItemRight" valign="bottom"><b>RAND_MAX</b>   0x7fffffff</td></tr>
-<tr class="separator:a690f251553b39fd4f31894826141b61a"><td class="memSeparator" colspan="2"> </td></tr>
-</table>
-<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2>
-<div class="textblock"><p>A file that contains the definitions of the classes needed for the creation of a Factor Oracle. </p>
-<p>Three main classes: <a class="el" href="class_factor_oracle.html">FactorOracle</a>, <a class="el" href="class_state.html">State</a> and <a class="el" href="class_single_transition.html">SingleTransition</a>. </p>
-</div></div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/_factor_oracle_8h_source.html b/docs/html/_factor_oracle_8h_source.html
deleted file mode 100644
index b9b200b1299962b94205fe2890ce79622f407174..0000000000000000000000000000000000000000
--- a/docs/html/_factor_oracle_8h_source.html
+++ /dev/null
@@ -1,85 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: FactorOracle.h Source File</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-</div><!-- top -->
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-<div class="header">
- <div class="headertitle">
-<div class="title">FactorOracle.h</div> </div>
-</div><!--header-->
-<div class="contents">
-<a href="_factor_oracle_8h.html">Go to the documentation of this file.</a><div class="fragment"><div class="line"><a name="l00001"></a><span class="lineno"> 1</span> <span class="comment">//</span></div><div class="line"><a name="l00002"></a><span class="lineno"> 2</span> <span class="comment">// Created by MARIA PAULA CARRERO on 7/16/19.</span></div><div class="line"><a name="l00003"></a><span class="lineno"> 3</span> <span class="comment">//</span></div><div class="line"><a name="l00004"></a><span class="lineno"> 4</span> <span class="preprocessor">#include <iostream></span></div><div class="line"><a name="l00005"></a><span class="lineno"> 5</span> <span class="preprocessor">#include <new></span></div><div class="line"><a name="l00006"></a><span class="lineno"> 6</span> <span class="preprocessor">#include <string></span></div><div class="line"><a name="l00007"></a><span class="lineno"> 7</span> <span class="preprocessor">#include <vector></span></div><div class="line"><a name="l00008"></a><span class="lineno"> 8</span> <span class="preprocessor">#include <variant></span></div><div class="line"><a name="l00009"></a><span class="lineno"> 9</span> <span class="preprocessor">#include <random></span></div><div class="line"><a name="l00010"></a><span class="lineno"> 10</span> <span class="preprocessor">#include <algorithm></span></div><div class="line"><a name="l00011"></a><span class="lineno"> 11</span> </div><div class="line"><a name="l00012"></a><span class="lineno"> 12</span> </div><div class="line"><a name="l00013"></a><span class="lineno"> 13</span> <span class="preprocessor">#ifndef FACTORORACLESTRING_FACTORORACLE_H</span></div><div class="line"><a name="l00014"></a><span class="lineno"> 14</span> <span class="preprocessor">#define FACTORORACLESTRING_FACTORORACLE_H</span></div><div class="line"><a name="l00015"></a><span class="lineno"> 15</span> </div><div class="line"><a name="l00016"></a><span class="lineno"> 16</span> <span class="preprocessor">#define R 10</span></div><div class="line"><a name="l00017"></a><span class="lineno"> 17</span> <span class="preprocessor">#define RAND_MAX 0x7fffffff</span></div><div class="line"><a name="l00018"></a><span class="lineno"> 18</span> </div><div class="line"><a name="l00064"></a><span class="lineno"> 64</span> <span class="keyword">using namespace </span>std;</div><div class="line"><a name="l00067"></a><span class="lineno"><a class="line" href="class_single_transition.html"> 67</a></span> <span class="keyword">class </span><a class="code" href="class_single_transition.html">SingleTransition</a></div><div class="line"><a name="l00068"></a><span class="lineno"> 68</span> {</div><div class="line"><a name="l00069"></a><span class="lineno"> 69</span> <span class="keyword">public</span>:</div><div class="line"><a name="l00070"></a><span class="lineno"><a class="line" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6"> 70</a></span>  <span class="keywordtype">int</span> <a class="code" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">first_state_</a>; </div><div class="line"><a name="l00071"></a><span class="lineno"><a class="line" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69"> 71</a></span>  <span class="keywordtype">int</span> <a class="code" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">last_state_</a>; </div><div class="line"><a name="l00072"></a><span class="lineno"><a class="line" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9"> 72</a></span>  <span class="keywordtype">char</span> <a class="code" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">symbol_</a>; </div><div class="line"><a name="l00073"></a><span class="lineno"> 73</span> };</div><div class="line"><a name="l00074"></a><span class="lineno"> 74</span> </div><div class="line"><a name="l00081"></a><span class="lineno"><a class="line" href="class_state.html"> 81</a></span> <span class="keyword">class </span><a class="code" href="class_state.html">State</a></div><div class="line"><a name="l00082"></a><span class="lineno"> 82</span> {</div><div class="line"><a name="l00083"></a><span class="lineno"> 83</span> <span class="keyword">public</span>:</div><div class="line"><a name="l00084"></a><span class="lineno"><a class="line" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724"> 84</a></span>  <span class="keywordtype">int</span> <a class="code" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">state_</a>; </div><div class="line"><a name="l00085"></a><span class="lineno"><a class="line" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8"> 85</a></span>  vector <SingleTransition> <a class="code" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">transition_</a>; </div><div class="line"><a name="l00086"></a><span class="lineno"> 86</span>  <span class="keywordtype">int</span> suffix_transition_;</div><div class="line"><a name="l00087"></a><span class="lineno"> 87</span>  <span class="keywordtype">int</span> lrs_ = 0;</div><div class="line"><a name="l00088"></a><span class="lineno"> 88</span>  <span class="keywordtype">void</span> singleTransitionResize(){</div><div class="line"><a name="l00089"></a><span class="lineno"> 89</span>  transition_.resize(R);</div><div class="line"><a name="l00090"></a><span class="lineno"> 90</span>  }</div><div class="line"><a name="l00091"></a><span class="lineno"> 91</span> };</div><div class="line"><a name="l00092"></a><span class="lineno"> 92</span> </div><div class="line"><a name="l00093"></a><span class="lineno"> 93</span> </div><div class="line"><a name="l00094"></a><span class="lineno"><a class="line" href="class_factor_oracle.html"> 94</a></span> <span class="keyword">class </span><a class="code" href="class_factor_oracle.html">FactorOracle</a></div><div class="line"><a name="l00095"></a><span class="lineno"> 95</span> {</div><div class="line"><a name="l00096"></a><span class="lineno"> 96</span> <span class="keyword">public</span>:</div><div class="line"><a name="l00097"></a><span class="lineno"><a class="line" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d"> 97</a></span>  vector <State> <a class="code" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">states_</a>; </div><div class="line"><a name="l00098"></a><span class="lineno"> 98</span>  <span class="keywordtype">void</span> AddLetter(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& States, vector <vector<int>> &T, <span class="keywordtype">int</span> i, <span class="keywordtype">string</span> word);</div><div class="line"><a name="l00099"></a><span class="lineno"> 99</span>  <span class="keywordtype">int</span> LengthCommonSuffix(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& States, <span class="keywordtype">int</span> phi_one, <span class="keywordtype">int</span> phi_two);</div><div class="line"><a name="l00100"></a><span class="lineno"> 100</span>  <span class="keywordtype">int</span> FindBetter(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& States, vector <vector<int>> &T, <span class="keywordtype">int</span> i, <span class="keywordtype">char</span> alpha, <span class="keywordtype">string</span> word);</div><div class="line"><a name="l00101"></a><span class="lineno"> 101</span>  <span class="keywordtype">string</span> FOGenerate(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& States, <span class="keywordtype">int</span> i, <span class="keywordtype">string</span> v, <span class="keywordtype">float</span> q);</div><div class="line"><a name="l00102"></a><span class="lineno"> 102</span>  <span class="keywordtype">void</span> FactorOracleStart(<a class="code" href="class_factor_oracle.html">FactorOracle</a>& OracleRelations,<span class="keywordtype">string</span> word);</div><div class="line"><a name="l00103"></a><span class="lineno"> 103</span> </div><div class="line"><a name="l00104"></a><span class="lineno"> 104</span> };</div><div class="line"><a name="l00105"></a><span class="lineno"> 105</span> </div><div class="line"><a name="l00106"></a><span class="lineno"> 106</span> </div><div class="line"><a name="l00107"></a><span class="lineno"> 107</span> </div><div class="line"><a name="l00108"></a><span class="lineno"> 108</span> <span class="preprocessor">#endif //FACTORORACLESTRING_FACTORORACLE_H</span></div><div class="ttc" id="class_single_transition_html_ae632ebd30fd4818e999fd1009cb2a8f9"><div class="ttname"><a href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">SingleTransition::symbol_</a></div><div class="ttdeci">char symbol_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:72</div></div>
-<div class="ttc" id="class_factor_oracle_html_a6e8dacf834f9ee820818c3655d77d56d"><div class="ttname"><a href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">FactorOracle::states_</a></div><div class="ttdeci">vector< State > states_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:97</div></div>
-<div class="ttc" id="class_state_html"><div class="ttname"><a href="class_state.html">State</a></div><div class="ttdef"><b>Definition:</b> FactorOracle.h:81</div></div>
-<div class="ttc" id="class_state_html_a2dcf672a1560830a8f93b0e9863c6724"><div class="ttname"><a href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">State::state_</a></div><div class="ttdeci">int state_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:84</div></div>
-<div class="ttc" id="class_factor_oracle_html"><div class="ttname"><a href="class_factor_oracle.html">FactorOracle</a></div><div class="ttdef"><b>Definition:</b> FactorOracle.h:94</div></div>
-<div class="ttc" id="class_single_transition_html_a88f7e002e072ffe7bb5eeb168cf0fea6"><div class="ttname"><a href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">SingleTransition::first_state_</a></div><div class="ttdeci">int first_state_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:70</div></div>
-<div class="ttc" id="class_state_html_afd5b3d2afbba2fc03583f76a7cb08fe8"><div class="ttname"><a href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">State::transition_</a></div><div class="ttdeci">vector< SingleTransition > transition_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:85</div></div>
-<div class="ttc" id="class_single_transition_html"><div class="ttname"><a href="class_single_transition.html">SingleTransition</a></div><div class="ttdef"><b>Definition:</b> FactorOracle.h:67</div></div>
-<div class="ttc" id="class_single_transition_html_a9d07ad3e0f9d7728919a372111313c69"><div class="ttname"><a href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">SingleTransition::last_state_</a></div><div class="ttdeci">int last_state_</div><div class="ttdef"><b>Definition:</b> FactorOracle.h:71</div></div>
-</div><!-- fragment --></div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/annotated.html b/docs/html/annotated.html
deleted file mode 100644
index e0d3bb04a89af56b4e24eeac0c651522fd7ed898..0000000000000000000000000000000000000000
--- a/docs/html/annotated.html
+++ /dev/null
@@ -1,83 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: Class List</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-</div><!-- top -->
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-<div class="header">
- <div class="headertitle">
-<div class="title">Class List</div> </div>
-</div><!--header-->
-<div class="contents">
-<div class="textblock">Here are the classes, structs, unions and interfaces with brief descriptions:</div><div class="directory">
-<table class="directory">
-<tr id="row_0_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icona"><span class="icon">C</span></span><a class="el" href="class_factor_oracle.html" target="_self">FactorOracle</a></td><td class="desc"></td></tr>
-<tr id="row_1_"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icona"><span class="icon">C</span></span><a class="el" href="class_single_transition.html" target="_self">SingleTransition</a></td><td class="desc"></td></tr>
-<tr id="row_2_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icona"><span class="icon">C</span></span><a class="el" href="class_state.html" target="_self">State</a></td><td class="desc"></td></tr>
-</table>
-</div><!-- directory -->
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/bc_s.png b/docs/html/bc_s.png
deleted file mode 100644
index 224b29aa9847d5a4b3902efd602b7ddf7d33e6c2..0000000000000000000000000000000000000000
Binary files a/docs/html/bc_s.png and /dev/null differ
diff --git a/docs/html/bdwn.png b/docs/html/bdwn.png
deleted file mode 100644
index 940a0b950443a0bb1b216ac03c45b8a16c955452..0000000000000000000000000000000000000000
Binary files a/docs/html/bdwn.png and /dev/null differ
diff --git a/docs/html/class_factor_oracle-members.html b/docs/html/class_factor_oracle-members.html
deleted file mode 100644
index a04080b39c93097a16460975056c5258410efe3c..0000000000000000000000000000000000000000
--- a/docs/html/class_factor_oracle-members.html
+++ /dev/null
@@ -1,85 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: Member List</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-</div><!-- top -->
-<div class="header">
- <div class="headertitle">
-<div class="title">FactorOracle Member List</div> </div>
-</div><!--header-->
-<div class="contents">
-
-<p>This is the complete list of members for <a class="el" href="class_factor_oracle.html">FactorOracle</a>, including all inherited members.</p>
-<table class="directory">
- <tr class="even"><td class="entry"><a class="el" href="class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db">AddLetter</a>(FactorOracle &States, vector< vector< int >> &T, int i, string word)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr>
- <tr><td class="entry"><a class="el" href="class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f">FactorOracleStart</a>(FactorOracle &OracleRelations, string word)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr>
- <tr class="even"><td class="entry"><a class="el" href="class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50">FindBetter</a>(FactorOracle &States, vector< vector< int >> &T, int i, char alpha, string word)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr>
- <tr><td class="entry"><a class="el" href="class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390">FOGenerate</a>(FactorOracle &States, int i, string v, float q)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr>
- <tr bgcolor="#f0f0f0" class="even"><td class="entry"><b>LengthCommonSuffix</b>(FactorOracle &States, int phi_one, int phi_two) (defined in <a class="el" href="class_factor_oracle.html">FactorOracle</a>)</td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr>
- <tr><td class="entry"><a class="el" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">states_</a></td><td class="entry"><a class="el" href="class_factor_oracle.html">FactorOracle</a></td><td class="entry"></td></tr>
-</table></div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/class_factor_oracle.html b/docs/html/class_factor_oracle.html
deleted file mode 100644
index 29859c6e62d5fd0ac1787f4cfb41735902115ed3..0000000000000000000000000000000000000000
--- a/docs/html/class_factor_oracle.html
+++ /dev/null
@@ -1,327 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: FactorOracle Class Reference</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-</div><!-- top -->
-<div class="header">
- <div class="summary">
-<a href="#pub-methods">Public Member Functions</a> |
-<a href="#pub-attribs">Public Attributes</a> |
-<a href="class_factor_oracle-members.html">List of all members</a> </div>
- <div class="headertitle">
-<div class="title">FactorOracle Class Reference</div> </div>
-</div><!--header-->
-<div class="contents">
-<table class="memberdecls">
-<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-methods"></a>
-Public Member Functions</h2></td></tr>
-<tr class="memitem:ae10b4d001c338a73f0f44079e842e7db"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db">AddLetter</a> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &States, vector< vector< int >> &T, int i, string word)</td></tr>
-<tr class="separator:ae10b4d001c338a73f0f44079e842e7db"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:a9511ac49e53ccf3a1907db4591e1ad0b"><td class="memItemLeft" align="right" valign="top"><a id="a9511ac49e53ccf3a1907db4591e1ad0b"></a>
-int </td><td class="memItemRight" valign="bottom"><b>LengthCommonSuffix</b> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &States, int phi_one, int phi_two)</td></tr>
-<tr class="separator:a9511ac49e53ccf3a1907db4591e1ad0b"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:a28d2e85676712f983b1dcba83ae07d50"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50">FindBetter</a> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &States, vector< vector< int >> &T, int i, char alpha, string word)</td></tr>
-<tr class="separator:a28d2e85676712f983b1dcba83ae07d50"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:abe8c4c194b309aeeff1bc05c25563390"><td class="memItemLeft" align="right" valign="top">string </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390">FOGenerate</a> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &States, int i, string v, float q)</td></tr>
-<tr class="separator:abe8c4c194b309aeeff1bc05c25563390"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:a070d7b00cfcb658c5d13ff275ceae01f"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f">FactorOracleStart</a> (<a class="el" href="class_factor_oracle.html">FactorOracle</a> &OracleRelations, string word)</td></tr>
-<tr class="separator:a070d7b00cfcb658c5d13ff275ceae01f"><td class="memSeparator" colspan="2"> </td></tr>
-</table><table class="memberdecls">
-<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a>
-Public Attributes</h2></td></tr>
-<tr class="memitem:a6e8dacf834f9ee820818c3655d77d56d"><td class="memItemLeft" align="right" valign="top">vector< <a class="el" href="class_state.html">State</a> > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">states_</a></td></tr>
-<tr class="separator:a6e8dacf834f9ee820818c3655d77d56d"><td class="memSeparator" colspan="2"> </td></tr>
-</table>
-<h2 class="groupheader">Member Function Documentation</h2>
-<a id="ae10b4d001c338a73f0f44079e842e7db"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#ae10b4d001c338a73f0f44079e842e7db">◆ </a></span>AddLetter()</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">void FactorOracle::AddLetter </td>
- <td>(</td>
- <td class="paramtype"><a class="el" href="class_factor_oracle.html">FactorOracle</a> & </td>
- <td class="paramname"><em>States</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">vector< vector< int >> & </td>
- <td class="paramname"><em>T</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">int </td>
- <td class="paramname"><em>i</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">string </td>
- <td class="paramname"><em>word</em> </td>
- </tr>
- <tr>
- <td></td>
- <td>)</td>
- <td></td><td></td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>A normal member taking four arguments and returning no value.</p>
-<dl class="params"><dt>Parameters</dt><dd>
- <table class="params">
- <tr><td class="paramname">all_states_</td><td>a reference to a <a class="el" href="class_factor_oracle.html">FactorOracle</a> class. </td></tr>
- <tr><td class="paramname">T</td><td>a reference to a vector of vector of integers. </td></tr>
- <tr><td class="paramname">i</td><td>an integer argument. </td></tr>
- <tr><td class="paramname">word</td><td>a string argument.</td></tr>
- </table>
- </dd>
-</dl>
-<p>< delta(i-1, p[i]) <- i</p>
-<p>< k = S[i-1]</p>
-<p>< phi_one = i-1</p>
-<p>while k > -1 and delta(k,p[i]) is undefined do delta(k, p[i]) <- i phi_one = k k = S[k]</p>
-
-</div>
-</div>
-<a id="a070d7b00cfcb658c5d13ff275ceae01f"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#a070d7b00cfcb658c5d13ff275ceae01f">◆ </a></span>FactorOracleStart()</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">void FactorOracle::FactorOracleStart </td>
- <td>(</td>
- <td class="paramtype"><a class="el" href="class_factor_oracle.html">FactorOracle</a> & </td>
- <td class="paramname"><em>OracleRelations</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">string </td>
- <td class="paramname"><em>word</em> </td>
- </tr>
- <tr>
- <td></td>
- <td>)</td>
- <td></td><td></td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>A normal member taking one argument and returning no value.</p>
-<dl class="params"><dt>Parameters</dt><dd>
- <table class="params">
- <tr><td class="paramname">oracle_relations</td><td>a reference to a <a class="el" href="class_factor_oracle.html">FactorOracle</a> class. </td></tr>
- <tr><td class="paramname">word</td><td>a string argument.</td></tr>
- </table>
- </dd>
-</dl>
-<p>< S[0] = -1</p>
-<p>< for i <- 1 to m do AddLetter(i)</p>
-
-</div>
-</div>
-<a id="a28d2e85676712f983b1dcba83ae07d50"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#a28d2e85676712f983b1dcba83ae07d50">◆ </a></span>FindBetter()</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">int FactorOracle::FindBetter </td>
- <td>(</td>
- <td class="paramtype"><a class="el" href="class_factor_oracle.html">FactorOracle</a> & </td>
- <td class="paramname"><em>States</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">vector< vector< int >> & </td>
- <td class="paramname"><em>T</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">int </td>
- <td class="paramname"><em>i</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">char </td>
- <td class="paramname"><em>alpha</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">string </td>
- <td class="paramname"><em>word</em> </td>
- </tr>
- <tr>
- <td></td>
- <td>)</td>
- <td></td><td></td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>A normal member taking five arguments and returning an integer value.</p>
-<dl class="params"><dt>Parameters</dt><dd>
- <table class="params">
- <tr><td class="paramname">all_states_</td><td>a reference to a <a class="el" href="class_factor_oracle.html">FactorOracle</a> class. </td></tr>
- <tr><td class="paramname">T</td><td>a reference to a vector of vector of integers. </td></tr>
- <tr><td class="paramname">i</td><td>an integer argument. </td></tr>
- <tr><td class="paramname">alpha</td><td>a char argument. </td></tr>
- <tr><td class="paramname">word</td><td>a string argument. </td></tr>
- </table>
- </dd>
-</dl>
-<dl class="section return"><dt>Returns</dt><dd>A better state</dd></dl>
-
-</div>
-</div>
-<a id="abe8c4c194b309aeeff1bc05c25563390"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#abe8c4c194b309aeeff1bc05c25563390">◆ </a></span>FOGenerate()</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">string FactorOracle::FOGenerate </td>
- <td>(</td>
- <td class="paramtype"><a class="el" href="class_factor_oracle.html">FactorOracle</a> & </td>
- <td class="paramname"><em>States</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">int </td>
- <td class="paramname"><em>i</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">string </td>
- <td class="paramname"><em>v</em>, </td>
- </tr>
- <tr>
- <td class="paramkey"></td>
- <td></td>
- <td class="paramtype">float </td>
- <td class="paramname"><em>q</em> </td>
- </tr>
- <tr>
- <td></td>
- <td>)</td>
- <td></td><td></td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>A normal member taking four arguments and returning a string value.</p>
-<dl class="params"><dt>Parameters</dt><dd>
- <table class="params">
- <tr><td class="paramname">all_states_</td><td>a reference to a <a class="el" href="class_factor_oracle.html">FactorOracle</a> class. </td></tr>
- <tr><td class="paramname">i</td><td>an integer argument. </td></tr>
- <tr><td class="paramname">v</td><td>a string argument. </td></tr>
- <tr><td class="paramname">q</td><td>a float argument. </td></tr>
- </table>
- </dd>
-</dl>
-<dl class="section return"><dt>Returns</dt><dd>The factor oracle improvisation</dd></dl>
-<p>Will be used to obtain a seed for the random number engine</p>
-<p>Standard mersenne_twister_engine seeded with rd()</p>
-<p>float u = (float)rand() / RAND_MAX;</p>
-<p>Will be used to obtain a seed for the random number engine</p>
-<p>Standard mersenne_twister_engine seeded with rd() </p>
-
-</div>
-</div>
-<h2 class="groupheader">Member Data Documentation</h2>
-<a id="a6e8dacf834f9ee820818c3655d77d56d"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#a6e8dacf834f9ee820818c3655d77d56d">◆ </a></span>states_</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">vector<<a class="el" href="class_state.html">State</a>> FactorOracle::states_</td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>vector of all the states </p>
-
-</div>
-</div>
-<hr/>The documentation for this class was generated from the following files:<ul>
-<li><a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a></li>
-<li><a class="el" href="_factor_oracle_8cpp.html">FactorOracle.cpp</a></li>
-</ul>
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/class_single_transition-members.html b/docs/html/class_single_transition-members.html
deleted file mode 100644
index da091be3d790a0ab604069058dcd824bbdb720a6..0000000000000000000000000000000000000000
--- a/docs/html/class_single_transition-members.html
+++ /dev/null
@@ -1,82 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: Member List</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-</div><!-- top -->
-<div class="header">
- <div class="headertitle">
-<div class="title">SingleTransition Member List</div> </div>
-</div><!--header-->
-<div class="contents">
-
-<p>This is the complete list of members for <a class="el" href="class_single_transition.html">SingleTransition</a>, including all inherited members.</p>
-<table class="directory">
- <tr class="even"><td class="entry"><a class="el" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">first_state_</a></td><td class="entry"><a class="el" href="class_single_transition.html">SingleTransition</a></td><td class="entry"></td></tr>
- <tr><td class="entry"><a class="el" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">last_state_</a></td><td class="entry"><a class="el" href="class_single_transition.html">SingleTransition</a></td><td class="entry"></td></tr>
- <tr class="even"><td class="entry"><a class="el" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">symbol_</a></td><td class="entry"><a class="el" href="class_single_transition.html">SingleTransition</a></td><td class="entry"></td></tr>
-</table></div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/class_single_transition.html b/docs/html/class_single_transition.html
deleted file mode 100644
index fe31c7fb8c7a7c1ed326f222163f7e19791d7440..0000000000000000000000000000000000000000
--- a/docs/html/class_single_transition.html
+++ /dev/null
@@ -1,142 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: SingleTransition Class Reference</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-</div><!-- top -->
-<div class="header">
- <div class="summary">
-<a href="#pub-attribs">Public Attributes</a> |
-<a href="class_single_transition-members.html">List of all members</a> </div>
- <div class="headertitle">
-<div class="title">SingleTransition Class Reference</div> </div>
-</div><!--header-->
-<div class="contents">
-
-<p><code>#include <<a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a>></code></p>
-<table class="memberdecls">
-<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a>
-Public Attributes</h2></td></tr>
-<tr class="memitem:a88f7e002e072ffe7bb5eeb168cf0fea6"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">first_state_</a></td></tr>
-<tr class="separator:a88f7e002e072ffe7bb5eeb168cf0fea6"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:a9d07ad3e0f9d7728919a372111313c69"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">last_state_</a></td></tr>
-<tr class="separator:a9d07ad3e0f9d7728919a372111313c69"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:ae632ebd30fd4818e999fd1009cb2a8f9"><td class="memItemLeft" align="right" valign="top">char </td><td class="memItemRight" valign="bottom"><a class="el" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">symbol_</a></td></tr>
-<tr class="separator:ae632ebd30fd4818e999fd1009cb2a8f9"><td class="memSeparator" colspan="2"> </td></tr>
-</table>
-<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2>
-<div class="textblock"><p>The class <a class="el" href="class_single_transition.html">SingleTransition</a> denotes the elements that belong to each transition </p>
-</div><h2 class="groupheader">Member Data Documentation</h2>
-<a id="a88f7e002e072ffe7bb5eeb168cf0fea6"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#a88f7e002e072ffe7bb5eeb168cf0fea6">◆ </a></span>first_state_</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">int SingleTransition::first_state_</td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>denotes the first state of the transition </p>
-
-</div>
-</div>
-<a id="a9d07ad3e0f9d7728919a372111313c69"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#a9d07ad3e0f9d7728919a372111313c69">◆ </a></span>last_state_</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">int SingleTransition::last_state_</td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>denotes the last state of the transition </p>
-
-</div>
-</div>
-<a id="ae632ebd30fd4818e999fd1009cb2a8f9"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#ae632ebd30fd4818e999fd1009cb2a8f9">◆ </a></span>symbol_</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">char SingleTransition::symbol_</td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>denotes the symbol (letter) of the transition </p>
-
-</div>
-</div>
-<hr/>The documentation for this class was generated from the following file:<ul>
-<li><a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a></li>
-</ul>
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/class_state-members.html b/docs/html/class_state-members.html
deleted file mode 100644
index 1823d2ba16c709e3b5a9164d9e1cdc34e611323a..0000000000000000000000000000000000000000
--- a/docs/html/class_state-members.html
+++ /dev/null
@@ -1,84 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: Member List</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-</div><!-- top -->
-<div class="header">
- <div class="headertitle">
-<div class="title">State Member List</div> </div>
-</div><!--header-->
-<div class="contents">
-
-<p>This is the complete list of members for <a class="el" href="class_state.html">State</a>, including all inherited members.</p>
-<table class="directory">
- <tr bgcolor="#f0f0f0" class="even"><td class="entry"><b>lrs_</b> (defined in <a class="el" href="class_state.html">State</a>)</td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"></td></tr>
- <tr bgcolor="#f0f0f0"><td class="entry"><b>singleTransitionResize</b>() (defined in <a class="el" href="class_state.html">State</a>)</td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"><span class="mlabel">inline</span></td></tr>
- <tr class="even"><td class="entry"><a class="el" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">state_</a></td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"></td></tr>
- <tr bgcolor="#f0f0f0"><td class="entry"><b>suffix_transition_</b> (defined in <a class="el" href="class_state.html">State</a>)</td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"></td></tr>
- <tr class="even"><td class="entry"><a class="el" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">transition_</a></td><td class="entry"><a class="el" href="class_state.html">State</a></td><td class="entry"></td></tr>
-</table></div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/class_state.html b/docs/html/class_state.html
deleted file mode 100644
index ac2bffca3aad28c84960abbcc0d2e061f1225264..0000000000000000000000000000000000000000
--- a/docs/html/class_state.html
+++ /dev/null
@@ -1,138 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: State Class Reference</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-</div><!-- top -->
-<div class="header">
- <div class="summary">
-<a href="#pub-methods">Public Member Functions</a> |
-<a href="#pub-attribs">Public Attributes</a> |
-<a href="class_state-members.html">List of all members</a> </div>
- <div class="headertitle">
-<div class="title">State Class Reference</div> </div>
-</div><!--header-->
-<div class="contents">
-
-<p><code>#include <<a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a>></code></p>
-<table class="memberdecls">
-<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-methods"></a>
-Public Member Functions</h2></td></tr>
-<tr class="memitem:a472cf58ec39b9f2158560f8aae3b89c8"><td class="memItemLeft" align="right" valign="top"><a id="a472cf58ec39b9f2158560f8aae3b89c8"></a>
-void </td><td class="memItemRight" valign="bottom"><b>singleTransitionResize</b> ()</td></tr>
-<tr class="separator:a472cf58ec39b9f2158560f8aae3b89c8"><td class="memSeparator" colspan="2"> </td></tr>
-</table><table class="memberdecls">
-<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a>
-Public Attributes</h2></td></tr>
-<tr class="memitem:a2dcf672a1560830a8f93b0e9863c6724"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">state_</a></td></tr>
-<tr class="separator:a2dcf672a1560830a8f93b0e9863c6724"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:afd5b3d2afbba2fc03583f76a7cb08fe8"><td class="memItemLeft" align="right" valign="top">vector< <a class="el" href="class_single_transition.html">SingleTransition</a> > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">transition_</a></td></tr>
-<tr class="separator:afd5b3d2afbba2fc03583f76a7cb08fe8"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:ae1daff1d8cfaf403f5f81b74a32d18cf"><td class="memItemLeft" align="right" valign="top"><a id="ae1daff1d8cfaf403f5f81b74a32d18cf"></a>
-int </td><td class="memItemRight" valign="bottom"><b>suffix_transition_</b></td></tr>
-<tr class="separator:ae1daff1d8cfaf403f5f81b74a32d18cf"><td class="memSeparator" colspan="2"> </td></tr>
-<tr class="memitem:a232fd4e8e92e228c5ad8542c8d45e9b6"><td class="memItemLeft" align="right" valign="top"><a id="a232fd4e8e92e228c5ad8542c8d45e9b6"></a>
-int </td><td class="memItemRight" valign="bottom"><b>lrs_</b> = 0</td></tr>
-<tr class="separator:a232fd4e8e92e228c5ad8542c8d45e9b6"><td class="memSeparator" colspan="2"> </td></tr>
-</table>
-<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2>
-<div class="textblock"><p>The class <a class="el" href="class_state.html">State</a> denotes the elements that belong to each state state denotes de number of the state vector <SingleTransition> transition is the vector where all forward links of the state are defined suffix_transition denotes which is the suffix link of this state lrs is the longest repeated subsequence of this state </p>
-</div><h2 class="groupheader">Member Data Documentation</h2>
-<a id="a2dcf672a1560830a8f93b0e9863c6724"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#a2dcf672a1560830a8f93b0e9863c6724">◆ </a></span>state_</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">int State::state_</td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>denotes the number of the state </p>
-
-</div>
-</div>
-<a id="afd5b3d2afbba2fc03583f76a7cb08fe8"></a>
-<h2 class="memtitle"><span class="permalink"><a href="#afd5b3d2afbba2fc03583f76a7cb08fe8">◆ </a></span>transition_</h2>
-
-<div class="memitem">
-<div class="memproto">
- <table class="memname">
- <tr>
- <td class="memname">vector<<a class="el" href="class_single_transition.html">SingleTransition</a>> State::transition_</td>
- </tr>
- </table>
-</div><div class="memdoc">
-<p>denotes the number of the state </p>
-
-</div>
-</div>
-<hr/>The documentation for this class was generated from the following file:<ul>
-<li><a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a></li>
-</ul>
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/classes.html b/docs/html/classes.html
deleted file mode 100644
index b217b92d21547d797fb83e7bd825cd1f3b453932..0000000000000000000000000000000000000000
--- a/docs/html/classes.html
+++ /dev/null
@@ -1,86 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: Class Index</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-</div><!-- top -->
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-<div class="header">
- <div class="headertitle">
-<div class="title">Class Index</div> </div>
-</div><!--header-->
-<div class="contents">
-<div class="qindex"><a class="qindex" href="#letter_f">f</a> | <a class="qindex" href="#letter_s">s</a></div>
-<table class="classindex">
-<tr><td rowspan="2" valign="bottom"><a name="letter_f"></a><table border="0" cellspacing="0" cellpadding="0"><tr><td><div class="ah">  f  </div></td></tr></table>
-</td><td rowspan="2" valign="bottom"><a name="letter_s"></a><table border="0" cellspacing="0" cellpadding="0"><tr><td><div class="ah">  s  </div></td></tr></table>
-</td><td valign="top"><a class="el" href="class_state.html">State</a>   </td></tr>
-<tr><td></td><td></td><td></td></tr>
-<tr><td valign="top"><a class="el" href="class_factor_oracle.html">FactorOracle</a>   </td><td valign="top"><a class="el" href="class_single_transition.html">SingleTransition</a>   </td><td></td></tr>
-<tr><td></td><td></td><td></td></tr>
-</table>
-<div class="qindex"><a class="qindex" href="#letter_f">f</a> | <a class="qindex" href="#letter_s">s</a></div>
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/closed.png b/docs/html/closed.png
deleted file mode 100644
index 98cc2c909da37a6df914fbf67780eebd99c597f5..0000000000000000000000000000000000000000
Binary files a/docs/html/closed.png and /dev/null differ
diff --git a/docs/html/doc.png b/docs/html/doc.png
deleted file mode 100644
index 17edabff95f7b8da13c9516a04efe05493c29501..0000000000000000000000000000000000000000
Binary files a/docs/html/doc.png and /dev/null differ
diff --git a/docs/html/doxygen.css b/docs/html/doxygen.css
deleted file mode 100644
index e2515926c80d5d948bee1e24a4f8ca334efa0ad5..0000000000000000000000000000000000000000
--- a/docs/html/doxygen.css
+++ /dev/null
@@ -1,1764 +0,0 @@
-/* The standard CSS for doxygen 1.8.15 */
-
-body, table, div, p, dl {
- font: 400 14px/22px Roboto,sans-serif;
-}
-
-p.reference, p.definition {
- font: 400 14px/22px Roboto,sans-serif;
-}
-
-/* @group Heading Levels */
-
-h1.groupheader {
- font-size: 150%;
-}
-
-.title {
- font: 400 14px/28px Roboto,sans-serif;
- font-size: 150%;
- font-weight: bold;
- margin: 10px 2px;
-}
-
-h2.groupheader {
- border-bottom: 1px solid #879ECB;
- color: #354C7B;
- font-size: 150%;
- font-weight: normal;
- margin-top: 1.75em;
- padding-top: 8px;
- padding-bottom: 4px;
- width: 100%;
-}
-
-h3.groupheader {
- font-size: 100%;
-}
-
-h1, h2, h3, h4, h5, h6 {
- -webkit-transition: text-shadow 0.5s linear;
- -moz-transition: text-shadow 0.5s linear;
- -ms-transition: text-shadow 0.5s linear;
- -o-transition: text-shadow 0.5s linear;
- transition: text-shadow 0.5s linear;
- margin-right: 15px;
-}
-
-h1.glow, h2.glow, h3.glow, h4.glow, h5.glow, h6.glow {
- text-shadow: 0 0 15px cyan;
-}
-
-dt {
- font-weight: bold;
-}
-
-div.multicol {
- -moz-column-gap: 1em;
- -webkit-column-gap: 1em;
- -moz-column-count: 3;
- -webkit-column-count: 3;
-}
-
-p.startli, p.startdd {
- margin-top: 2px;
-}
-
-p.starttd {
- margin-top: 0px;
-}
-
-p.endli {
- margin-bottom: 0px;
-}
-
-p.enddd {
- margin-bottom: 4px;
-}
-
-p.endtd {
- margin-bottom: 2px;
-}
-
-p.interli {
-}
-
-p.interdd {
-}
-
-p.intertd {
-}
-
-/* @end */
-
-caption {
- font-weight: bold;
-}
-
-span.legend {
- font-size: 70%;
- text-align: center;
-}
-
-h3.version {
- font-size: 90%;
- text-align: center;
-}
-
-div.qindex, div.navtab{
- background-color: #EBEFF6;
- border: 1px solid #A3B4D7;
- text-align: center;
-}
-
-div.qindex, div.navpath {
- width: 100%;
- line-height: 140%;
-}
-
-div.navtab {
- margin-right: 15px;
-}
-
-/* @group Link Styling */
-
-a {
- color: #3D578C;
- font-weight: normal;
- text-decoration: none;
-}
-
-.contents a:visited {
- color: #4665A2;
-}
-
-a:hover {
- text-decoration: underline;
-}
-
-a.qindex {
- font-weight: bold;
-}
-
-a.qindexHL {
- font-weight: bold;
- background-color: #9CAFD4;
- color: #FFFFFF;
- border: 1px double #869DCA;
-}
-
-.contents a.qindexHL:visited {
- color: #FFFFFF;
-}
-
-a.el {
- font-weight: bold;
-}
-
-a.elRef {
-}
-
-a.code, a.code:visited, a.line, a.line:visited {
- color: #4665A2;
-}
-
-a.codeRef, a.codeRef:visited, a.lineRef, a.lineRef:visited {
- color: #4665A2;
-}
-
-/* @end */
-
-dl.el {
- margin-left: -1cm;
-}
-
-ul {
- overflow: hidden; /*Fixed: list item bullets overlap floating elements*/
-}
-
-#side-nav ul {
- overflow: visible; /* reset ul rule for scroll bar in GENERATE_TREEVIEW window */
-}
-
-#main-nav ul {
- overflow: visible; /* reset ul rule for the navigation bar drop down lists */
-}
-
-.fragment {
- text-align: left;
- direction: ltr;
- overflow-x: auto; /*Fixed: fragment lines overlap floating elements*/
- overflow-y: hidden;
-}
-
-pre.fragment {
- border: 1px solid #C4CFE5;
- background-color: #FBFCFD;
- padding: 4px 6px;
- margin: 4px 8px 4px 2px;
- overflow: auto;
- word-wrap: break-word;
- font-size: 9pt;
- line-height: 125%;
- font-family: monospace, fixed;
- font-size: 105%;
-}
-
-div.fragment {
- padding: 0 0 1px 0; /*Fixed: last line underline overlap border*/
- margin: 4px 8px 4px 2px;
- background-color: #FBFCFD;
- border: 1px solid #C4CFE5;
-}
-
-div.line {
- font-family: monospace, fixed;
- font-size: 13px;
- min-height: 13px;
- line-height: 1.0;
- text-wrap: unrestricted;
- white-space: -moz-pre-wrap; /* Moz */
- white-space: -pre-wrap; /* Opera 4-6 */
- white-space: -o-pre-wrap; /* Opera 7 */
- white-space: pre-wrap; /* CSS3 */
- word-wrap: break-word; /* IE 5.5+ */
- text-indent: -53px;
- padding-left: 53px;
- padding-bottom: 0px;
- margin: 0px;
- -webkit-transition-property: background-color, box-shadow;
- -webkit-transition-duration: 0.5s;
- -moz-transition-property: background-color, box-shadow;
- -moz-transition-duration: 0.5s;
- -ms-transition-property: background-color, box-shadow;
- -ms-transition-duration: 0.5s;
- -o-transition-property: background-color, box-shadow;
- -o-transition-duration: 0.5s;
- transition-property: background-color, box-shadow;
- transition-duration: 0.5s;
-}
-
-div.line:after {
- content:"\000A";
- white-space: pre;
-}
-
-div.line.glow {
- background-color: cyan;
- box-shadow: 0 0 10px cyan;
-}
-
-
-span.lineno {
- padding-right: 4px;
- text-align: right;
- border-right: 2px solid #0F0;
- background-color: #E8E8E8;
- white-space: pre;
-}
-span.lineno a {
- background-color: #D8D8D8;
-}
-
-span.lineno a:hover {
- background-color: #C8C8C8;
-}
-
-.lineno {
- -webkit-touch-callout: none;
- -webkit-user-select: none;
- -khtml-user-select: none;
- -moz-user-select: none;
- -ms-user-select: none;
- user-select: none;
-}
-
-div.ah, span.ah {
- background-color: black;
- font-weight: bold;
- color: #FFFFFF;
- margin-bottom: 3px;
- margin-top: 3px;
- padding: 0.2em;
- border: solid thin #333;
- border-radius: 0.5em;
- -webkit-border-radius: .5em;
- -moz-border-radius: .5em;
- box-shadow: 2px 2px 3px #999;
- -webkit-box-shadow: 2px 2px 3px #999;
- -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px;
- background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#000),color-stop(0.3, #444));
- background-image: -moz-linear-gradient(center top, #eee 0%, #444 40%, #000 110%);
-}
-
-div.classindex ul {
- list-style: none;
- padding-left: 0;
-}
-
-div.classindex span.ai {
- display: inline-block;
-}
-
-div.groupHeader {
- margin-left: 16px;
- margin-top: 12px;
- font-weight: bold;
-}
-
-div.groupText {
- margin-left: 16px;
- font-style: italic;
-}
-
-body {
- background-color: white;
- color: black;
- margin: 0;
-}
-
-div.contents {
- margin-top: 10px;
- margin-left: 12px;
- margin-right: 8px;
-}
-
-td.indexkey {
- background-color: #EBEFF6;
- font-weight: bold;
- border: 1px solid #C4CFE5;
- margin: 2px 0px 2px 0;
- padding: 2px 10px;
- white-space: nowrap;
- vertical-align: top;
-}
-
-td.indexvalue {
- background-color: #EBEFF6;
- border: 1px solid #C4CFE5;
- padding: 2px 10px;
- margin: 2px 0px;
-}
-
-tr.memlist {
- background-color: #EEF1F7;
-}
-
-p.formulaDsp {
- text-align: center;
-}
-
-img.formulaDsp {
-
-}
-
-img.formulaInl, img.inline {
- vertical-align: middle;
-}
-
-div.center {
- text-align: center;
- margin-top: 0px;
- margin-bottom: 0px;
- padding: 0px;
-}
-
-div.center img {
- border: 0px;
-}
-
-address.footer {
- text-align: right;
- padding-right: 12px;
-}
-
-img.footer {
- border: 0px;
- vertical-align: middle;
-}
-
-/* @group Code Colorization */
-
-span.keyword {
- color: #008000
-}
-
-span.keywordtype {
- color: #604020
-}
-
-span.keywordflow {
- color: #e08000
-}
-
-span.comment {
- color: #800000
-}
-
-span.preprocessor {
- color: #806020
-}
-
-span.stringliteral {
- color: #002080
-}
-
-span.charliteral {
- color: #008080
-}
-
-span.vhdldigit {
- color: #ff00ff
-}
-
-span.vhdlchar {
- color: #000000
-}
-
-span.vhdlkeyword {
- color: #700070
-}
-
-span.vhdllogic {
- color: #ff0000
-}
-
-blockquote {
- background-color: #F7F8FB;
- border-left: 2px solid #9CAFD4;
- margin: 0 24px 0 4px;
- padding: 0 12px 0 16px;
-}
-
-blockquote.DocNodeRTL {
- border-left: 0;
- border-right: 2px solid #9CAFD4;
- margin: 0 4px 0 24px;
- padding: 0 16px 0 12px;
-}
-
-/* @end */
-
-/*
-.search {
- color: #003399;
- font-weight: bold;
-}
-
-form.search {
- margin-bottom: 0px;
- margin-top: 0px;
-}
-
-input.search {
- font-size: 75%;
- color: #000080;
- font-weight: normal;
- background-color: #e8eef2;
-}
-*/
-
-td.tiny {
- font-size: 75%;
-}
-
-.dirtab {
- padding: 4px;
- border-collapse: collapse;
- border: 1px solid #A3B4D7;
-}
-
-th.dirtab {
- background: #EBEFF6;
- font-weight: bold;
-}
-
-hr {
- height: 0px;
- border: none;
- border-top: 1px solid #4A6AAA;
-}
-
-hr.footer {
- height: 1px;
-}
-
-/* @group Member Descriptions */
-
-table.memberdecls {
- border-spacing: 0px;
- padding: 0px;
-}
-
-.memberdecls td, .fieldtable tr {
- -webkit-transition-property: background-color, box-shadow;
- -webkit-transition-duration: 0.5s;
- -moz-transition-property: background-color, box-shadow;
- -moz-transition-duration: 0.5s;
- -ms-transition-property: background-color, box-shadow;
- -ms-transition-duration: 0.5s;
- -o-transition-property: background-color, box-shadow;
- -o-transition-duration: 0.5s;
- transition-property: background-color, box-shadow;
- transition-duration: 0.5s;
-}
-
-.memberdecls td.glow, .fieldtable tr.glow {
- background-color: cyan;
- box-shadow: 0 0 15px cyan;
-}
-
-.mdescLeft, .mdescRight,
-.memItemLeft, .memItemRight,
-.memTemplItemLeft, .memTemplItemRight, .memTemplParams {
- background-color: #F9FAFC;
- border: none;
- margin: 4px;
- padding: 1px 0 0 8px;
-}
-
-.mdescLeft, .mdescRight {
- padding: 0px 8px 4px 8px;
- color: #555;
-}
-
-.memSeparator {
- border-bottom: 1px solid #DEE4F0;
- line-height: 1px;
- margin: 0px;
- padding: 0px;
-}
-
-.memItemLeft, .memTemplItemLeft {
- white-space: nowrap;
-}
-
-.memItemRight {
- width: 100%;
-}
-
-.memTemplParams {
- color: #4665A2;
- white-space: nowrap;
- font-size: 80%;
-}
-
-/* @end */
-
-/* @group Member Details */
-
-/* Styles for detailed member documentation */
-
-.memtitle {
- padding: 8px;
- border-top: 1px solid #A8B8D9;
- border-left: 1px solid #A8B8D9;
- border-right: 1px solid #A8B8D9;
- border-top-right-radius: 4px;
- border-top-left-radius: 4px;
- margin-bottom: -1px;
- background-image: url('nav_f.png');
- background-repeat: repeat-x;
- background-color: #E2E8F2;
- line-height: 1.25;
- font-weight: 300;
- float:left;
-}
-
-.permalink
-{
- font-size: 65%;
- display: inline-block;
- vertical-align: middle;
-}
-
-.memtemplate {
- font-size: 80%;
- color: #4665A2;
- font-weight: normal;
- margin-left: 9px;
-}
-
-.memnav {
- background-color: #EBEFF6;
- border: 1px solid #A3B4D7;
- text-align: center;
- margin: 2px;
- margin-right: 15px;
- padding: 2px;
-}
-
-.mempage {
- width: 100%;
-}
-
-.memitem {
- padding: 0;
- margin-bottom: 10px;
- margin-right: 5px;
- -webkit-transition: box-shadow 0.5s linear;
- -moz-transition: box-shadow 0.5s linear;
- -ms-transition: box-shadow 0.5s linear;
- -o-transition: box-shadow 0.5s linear;
- transition: box-shadow 0.5s linear;
- display: table !important;
- width: 100%;
-}
-
-.memitem.glow {
- box-shadow: 0 0 15px cyan;
-}
-
-.memname {
- font-weight: 400;
- margin-left: 6px;
-}
-
-.memname td {
- vertical-align: bottom;
-}
-
-.memproto, dl.reflist dt {
- border-top: 1px solid #A8B8D9;
- border-left: 1px solid #A8B8D9;
- border-right: 1px solid #A8B8D9;
- padding: 6px 0px 6px 0px;
- color: #253555;
- font-weight: bold;
- text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9);
- background-color: #DFE5F1;
- /* opera specific markup */
- box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
- border-top-right-radius: 4px;
- /* firefox specific markup */
- -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px;
- -moz-border-radius-topright: 4px;
- /* webkit specific markup */
- -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
- -webkit-border-top-right-radius: 4px;
-
-}
-
-.overload {
- font-family: "courier new",courier,monospace;
- font-size: 65%;
-}
-
-.memdoc, dl.reflist dd {
- border-bottom: 1px solid #A8B8D9;
- border-left: 1px solid #A8B8D9;
- border-right: 1px solid #A8B8D9;
- padding: 6px 10px 2px 10px;
- background-color: #FBFCFD;
- border-top-width: 0;
- background-image:url('nav_g.png');
- background-repeat:repeat-x;
- background-color: #FFFFFF;
- /* opera specific markup */
- border-bottom-left-radius: 4px;
- border-bottom-right-radius: 4px;
- box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
- /* firefox specific markup */
- -moz-border-radius-bottomleft: 4px;
- -moz-border-radius-bottomright: 4px;
- -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px;
- /* webkit specific markup */
- -webkit-border-bottom-left-radius: 4px;
- -webkit-border-bottom-right-radius: 4px;
- -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
-}
-
-dl.reflist dt {
- padding: 5px;
-}
-
-dl.reflist dd {
- margin: 0px 0px 10px 0px;
- padding: 5px;
-}
-
-.paramkey {
- text-align: right;
-}
-
-.paramtype {
- white-space: nowrap;
-}
-
-.paramname {
- color: #602020;
- white-space: nowrap;
-}
-.paramname em {
- font-style: normal;
-}
-.paramname code {
- line-height: 14px;
-}
-
-.params, .retval, .exception, .tparams {
- margin-left: 0px;
- padding-left: 0px;
-}
-
-.params .paramname, .retval .paramname, .tparams .paramname {
- font-weight: bold;
- vertical-align: top;
-}
-
-.params .paramtype, .tparams .paramtype {
- font-style: italic;
- vertical-align: top;
-}
-
-.params .paramdir, .tparams .paramdir {
- font-family: "courier new",courier,monospace;
- vertical-align: top;
-}
-
-table.mlabels {
- border-spacing: 0px;
-}
-
-td.mlabels-left {
- width: 100%;
- padding: 0px;
-}
-
-td.mlabels-right {
- vertical-align: bottom;
- padding: 0px;
- white-space: nowrap;
-}
-
-span.mlabels {
- margin-left: 8px;
-}
-
-span.mlabel {
- background-color: #728DC1;
- border-top:1px solid #5373B4;
- border-left:1px solid #5373B4;
- border-right:1px solid #C4CFE5;
- border-bottom:1px solid #C4CFE5;
- text-shadow: none;
- color: white;
- margin-right: 4px;
- padding: 2px 3px;
- border-radius: 3px;
- font-size: 7pt;
- white-space: nowrap;
- vertical-align: middle;
-}
-
-
-
-/* @end */
-
-/* these are for tree view inside a (index) page */
-
-div.directory {
- margin: 10px 0px;
- border-top: 1px solid #9CAFD4;
- border-bottom: 1px solid #9CAFD4;
- width: 100%;
-}
-
-.directory table {
- border-collapse:collapse;
-}
-
-.directory td {
- margin: 0px;
- padding: 0px;
- vertical-align: top;
-}
-
-.directory td.entry {
- white-space: nowrap;
- padding-right: 6px;
- padding-top: 3px;
-}
-
-.directory td.entry a {
- outline:none;
-}
-
-.directory td.entry a img {
- border: none;
-}
-
-.directory td.desc {
- width: 100%;
- padding-left: 6px;
- padding-right: 6px;
- padding-top: 3px;
- border-left: 1px solid rgba(0,0,0,0.05);
-}
-
-.directory tr.even {
- padding-left: 6px;
- background-color: #F7F8FB;
-}
-
-.directory img {
- vertical-align: -30%;
-}
-
-.directory .levels {
- white-space: nowrap;
- width: 100%;
- text-align: right;
- font-size: 9pt;
-}
-
-.directory .levels span {
- cursor: pointer;
- padding-left: 2px;
- padding-right: 2px;
- color: #3D578C;
-}
-
-.arrow {
- color: #9CAFD4;
- -webkit-user-select: none;
- -khtml-user-select: none;
- -moz-user-select: none;
- -ms-user-select: none;
- user-select: none;
- cursor: pointer;
- font-size: 80%;
- display: inline-block;
- width: 16px;
- height: 22px;
-}
-
-.icon {
- font-family: Arial, Helvetica;
- font-weight: bold;
- font-size: 12px;
- height: 14px;
- width: 16px;
- display: inline-block;
- background-color: #728DC1;
- color: white;
- text-align: center;
- border-radius: 4px;
- margin-left: 2px;
- margin-right: 2px;
-}
-
-.icona {
- width: 24px;
- height: 22px;
- display: inline-block;
-}
-
-.iconfopen {
- width: 24px;
- height: 18px;
- margin-bottom: 4px;
- background-image:url('folderopen.png');
- background-position: 0px -4px;
- background-repeat: repeat-y;
- vertical-align:top;
- display: inline-block;
-}
-
-.iconfclosed {
- width: 24px;
- height: 18px;
- margin-bottom: 4px;
- background-image:url('folderclosed.png');
- background-position: 0px -4px;
- background-repeat: repeat-y;
- vertical-align:top;
- display: inline-block;
-}
-
-.icondoc {
- width: 24px;
- height: 18px;
- margin-bottom: 4px;
- background-image:url('doc.png');
- background-position: 0px -4px;
- background-repeat: repeat-y;
- vertical-align:top;
- display: inline-block;
-}
-
-table.directory {
- font: 400 14px Roboto,sans-serif;
-}
-
-/* @end */
-
-div.dynheader {
- margin-top: 8px;
- -webkit-touch-callout: none;
- -webkit-user-select: none;
- -khtml-user-select: none;
- -moz-user-select: none;
- -ms-user-select: none;
- user-select: none;
-}
-
-address {
- font-style: normal;
- color: #2A3D61;
-}
-
-table.doxtable caption {
- caption-side: top;
-}
-
-table.doxtable {
- border-collapse:collapse;
- margin-top: 4px;
- margin-bottom: 4px;
-}
-
-table.doxtable td, table.doxtable th {
- border: 1px solid #2D4068;
- padding: 3px 7px 2px;
-}
-
-table.doxtable th {
- background-color: #374F7F;
- color: #FFFFFF;
- font-size: 110%;
- padding-bottom: 4px;
- padding-top: 5px;
-}
-
-table.fieldtable {
- /*width: 100%;*/
- margin-bottom: 10px;
- border: 1px solid #A8B8D9;
- border-spacing: 0px;
- -moz-border-radius: 4px;
- -webkit-border-radius: 4px;
- border-radius: 4px;
- -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px;
- -webkit-box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15);
- box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15);
-}
-
-.fieldtable td, .fieldtable th {
- padding: 3px 7px 2px;
-}
-
-.fieldtable td.fieldtype, .fieldtable td.fieldname {
- white-space: nowrap;
- border-right: 1px solid #A8B8D9;
- border-bottom: 1px solid #A8B8D9;
- vertical-align: top;
-}
-
-.fieldtable td.fieldname {
- padding-top: 3px;
-}
-
-.fieldtable td.fielddoc {
- border-bottom: 1px solid #A8B8D9;
- /*width: 100%;*/
-}
-
-.fieldtable td.fielddoc p:first-child {
- margin-top: 0px;
-}
-
-.fieldtable td.fielddoc p:last-child {
- margin-bottom: 2px;
-}
-
-.fieldtable tr:last-child td {
- border-bottom: none;
-}
-
-.fieldtable th {
- background-image:url('nav_f.png');
- background-repeat:repeat-x;
- background-color: #E2E8F2;
- font-size: 90%;
- color: #253555;
- padding-bottom: 4px;
- padding-top: 5px;
- text-align:left;
- font-weight: 400;
- -moz-border-radius-topleft: 4px;
- -moz-border-radius-topright: 4px;
- -webkit-border-top-left-radius: 4px;
- -webkit-border-top-right-radius: 4px;
- border-top-left-radius: 4px;
- border-top-right-radius: 4px;
- border-bottom: 1px solid #A8B8D9;
-}
-
-
-.tabsearch {
- top: 0px;
- left: 10px;
- height: 36px;
- background-image: url('tab_b.png');
- z-index: 101;
- overflow: hidden;
- font-size: 13px;
-}
-
-.navpath ul
-{
- font-size: 11px;
- background-image:url('tab_b.png');
- background-repeat:repeat-x;
- background-position: 0 -5px;
- height:30px;
- line-height:30px;
- color:#8AA0CC;
- border:solid 1px #C2CDE4;
- overflow:hidden;
- margin:0px;
- padding:0px;
-}
-
-.navpath li
-{
- list-style-type:none;
- float:left;
- padding-left:10px;
- padding-right:15px;
- background-image:url('bc_s.png');
- background-repeat:no-repeat;
- background-position:right;
- color:#364D7C;
-}
-
-.navpath li.navelem a
-{
- height:32px;
- display:block;
- text-decoration: none;
- outline: none;
- color: #283A5D;
- font-family: 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif;
- text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9);
- text-decoration: none;
-}
-
-.navpath li.navelem a:hover
-{
- color:#6884BD;
-}
-
-.navpath li.footer
-{
- list-style-type:none;
- float:right;
- padding-left:10px;
- padding-right:15px;
- background-image:none;
- background-repeat:no-repeat;
- background-position:right;
- color:#364D7C;
- font-size: 8pt;
-}
-
-
-div.summary
-{
- float: right;
- font-size: 8pt;
- padding-right: 5px;
- width: 50%;
- text-align: right;
-}
-
-div.summary a
-{
- white-space: nowrap;
-}
-
-table.classindex
-{
- margin: 10px;
- white-space: nowrap;
- margin-left: 3%;
- margin-right: 3%;
- width: 94%;
- border: 0;
- border-spacing: 0;
- padding: 0;
-}
-
-div.ingroups
-{
- font-size: 8pt;
- width: 50%;
- text-align: left;
-}
-
-div.ingroups a
-{
- white-space: nowrap;
-}
-
-div.header
-{
- background-image:url('nav_h.png');
- background-repeat:repeat-x;
- background-color: #F9FAFC;
- margin: 0px;
- border-bottom: 1px solid #C4CFE5;
-}
-
-div.headertitle
-{
- padding: 5px 5px 5px 10px;
-}
-
-.PageDocRTL-title div.headertitle {
- text-align: right;
- direction: rtl;
-}
-
-dl {
- padding: 0 0 0 0;
-}
-
-/* dl.note, dl.warning, dl.attention, dl.pre, dl.post, dl.invariant, dl.deprecated, dl.todo, dl.test, dl.bug, dl.examples */
-dl.section {
- margin-left: 0px;
- padding-left: 0px;
-}
-
-dl.section.DocNodeRTL {
- margin-right: 0px;
- padding-right: 0px;
-}
-
-dl.note {
- margin-left: -7px;
- padding-left: 3px;
- border-left: 4px solid;
- border-color: #D0C000;
-}
-
-dl.note.DocNodeRTL {
- margin-left: 0;
- padding-left: 0;
- border-left: 0;
- margin-right: -7px;
- padding-right: 3px;
- border-right: 4px solid;
- border-color: #D0C000;
-}
-
-dl.warning, dl.attention {
- margin-left: -7px;
- padding-left: 3px;
- border-left: 4px solid;
- border-color: #FF0000;
-}
-
-dl.warning.DocNodeRTL, dl.attention.DocNodeRTL {
- margin-left: 0;
- padding-left: 0;
- border-left: 0;
- margin-right: -7px;
- padding-right: 3px;
- border-right: 4px solid;
- border-color: #FF0000;
-}
-
-dl.pre, dl.post, dl.invariant {
- margin-left: -7px;
- padding-left: 3px;
- border-left: 4px solid;
- border-color: #00D000;
-}
-
-dl.pre.DocNodeRTL, dl.post.DocNodeRTL, dl.invariant.DocNodeRTL {
- margin-left: 0;
- padding-left: 0;
- border-left: 0;
- margin-right: -7px;
- padding-right: 3px;
- border-right: 4px solid;
- border-color: #00D000;
-}
-
-dl.deprecated {
- margin-left: -7px;
- padding-left: 3px;
- border-left: 4px solid;
- border-color: #505050;
-}
-
-dl.deprecated.DocNodeRTL {
- margin-left: 0;
- padding-left: 0;
- border-left: 0;
- margin-right: -7px;
- padding-right: 3px;
- border-right: 4px solid;
- border-color: #505050;
-}
-
-dl.todo {
- margin-left: -7px;
- padding-left: 3px;
- border-left: 4px solid;
- border-color: #00C0E0;
-}
-
-dl.todo.DocNodeRTL {
- margin-left: 0;
- padding-left: 0;
- border-left: 0;
- margin-right: -7px;
- padding-right: 3px;
- border-right: 4px solid;
- border-color: #00C0E0;
-}
-
-dl.test {
- margin-left: -7px;
- padding-left: 3px;
- border-left: 4px solid;
- border-color: #3030E0;
-}
-
-dl.test.DocNodeRTL {
- margin-left: 0;
- padding-left: 0;
- border-left: 0;
- margin-right: -7px;
- padding-right: 3px;
- border-right: 4px solid;
- border-color: #3030E0;
-}
-
-dl.bug {
- margin-left: -7px;
- padding-left: 3px;
- border-left: 4px solid;
- border-color: #C08050;
-}
-
-dl.bug.DocNodeRTL {
- margin-left: 0;
- padding-left: 0;
- border-left: 0;
- margin-right: -7px;
- padding-right: 3px;
- border-right: 4px solid;
- border-color: #C08050;
-}
-
-dl.section dd {
- margin-bottom: 6px;
-}
-
-
-#projectlogo
-{
- text-align: center;
- vertical-align: bottom;
- border-collapse: separate;
-}
-
-#projectlogo img
-{
- border: 0px none;
-}
-
-#projectalign
-{
- vertical-align: middle;
-}
-
-#projectname
-{
- font: 300% Tahoma, Arial,sans-serif;
- margin: 0px;
- padding: 2px 0px;
-}
-
-#projectbrief
-{
- font: 120% Tahoma, Arial,sans-serif;
- margin: 0px;
- padding: 0px;
-}
-
-#projectnumber
-{
- font: 50% Tahoma, Arial,sans-serif;
- margin: 0px;
- padding: 0px;
-}
-
-#titlearea
-{
- padding: 0px;
- margin: 0px;
- width: 100%;
- border-bottom: 1px solid #5373B4;
-}
-
-.image
-{
- text-align: center;
-}
-
-.dotgraph
-{
- text-align: center;
-}
-
-.mscgraph
-{
- text-align: center;
-}
-
-.plantumlgraph
-{
- text-align: center;
-}
-
-.diagraph
-{
- text-align: center;
-}
-
-.caption
-{
- font-weight: bold;
-}
-
-div.zoom
-{
- border: 1px solid #90A5CE;
-}
-
-dl.citelist {
- margin-bottom:50px;
-}
-
-dl.citelist dt {
- color:#334975;
- float:left;
- font-weight:bold;
- margin-right:10px;
- padding:5px;
-}
-
-dl.citelist dd {
- margin:2px 0;
- padding:5px 0;
-}
-
-div.toc {
- padding: 14px 25px;
- background-color: #F4F6FA;
- border: 1px solid #D8DFEE;
- border-radius: 7px 7px 7px 7px;
- float: right;
- height: auto;
- margin: 0 8px 10px 10px;
- width: 200px;
-}
-
-.PageDocRTL-title div.toc {
- float: left !important;
- text-align: right;
-}
-
-div.toc li {
- background: url("bdwn.png") no-repeat scroll 0 5px transparent;
- font: 10px/1.2 Verdana,DejaVu Sans,Geneva,sans-serif;
- margin-top: 5px;
- padding-left: 10px;
- padding-top: 2px;
-}
-
-.PageDocRTL-title div.toc li {
- background-position-x: right !important;
- padding-left: 0 !important;
- padding-right: 10px;
-}
-
-div.toc h3 {
- font: bold 12px/1.2 Arial,FreeSans,sans-serif;
- color: #4665A2;
- border-bottom: 0 none;
- margin: 0;
-}
-
-div.toc ul {
- list-style: none outside none;
- border: medium none;
- padding: 0px;
-}
-
-div.toc li.level1 {
- margin-left: 0px;
-}
-
-div.toc li.level2 {
- margin-left: 15px;
-}
-
-div.toc li.level3 {
- margin-left: 30px;
-}
-
-div.toc li.level4 {
- margin-left: 45px;
-}
-
-.PageDocRTL-title div.toc li.level1 {
- margin-left: 0 !important;
- margin-right: 0;
-}
-
-.PageDocRTL-title div.toc li.level2 {
- margin-left: 0 !important;
- margin-right: 15px;
-}
-
-.PageDocRTL-title div.toc li.level3 {
- margin-left: 0 !important;
- margin-right: 30px;
-}
-
-.PageDocRTL-title div.toc li.level4 {
- margin-left: 0 !important;
- margin-right: 45px;
-}
-
-.inherit_header {
- font-weight: bold;
- color: gray;
- cursor: pointer;
- -webkit-touch-callout: none;
- -webkit-user-select: none;
- -khtml-user-select: none;
- -moz-user-select: none;
- -ms-user-select: none;
- user-select: none;
-}
-
-.inherit_header td {
- padding: 6px 0px 2px 5px;
-}
-
-.inherit {
- display: none;
-}
-
-tr.heading h2 {
- margin-top: 12px;
- margin-bottom: 4px;
-}
-
-/* tooltip related style info */
-
-.ttc {
- position: absolute;
- display: none;
-}
-
-#powerTip {
- cursor: default;
- white-space: nowrap;
- background-color: white;
- border: 1px solid gray;
- border-radius: 4px 4px 4px 4px;
- box-shadow: 1px 1px 7px gray;
- display: none;
- font-size: smaller;
- max-width: 80%;
- opacity: 0.9;
- padding: 1ex 1em 1em;
- position: absolute;
- z-index: 2147483647;
-}
-
-#powerTip div.ttdoc {
- color: grey;
- font-style: italic;
-}
-
-#powerTip div.ttname a {
- font-weight: bold;
-}
-
-#powerTip div.ttname {
- font-weight: bold;
-}
-
-#powerTip div.ttdeci {
- color: #006318;
-}
-
-#powerTip div {
- margin: 0px;
- padding: 0px;
- font: 12px/16px Roboto,sans-serif;
-}
-
-#powerTip:before, #powerTip:after {
- content: "";
- position: absolute;
- margin: 0px;
-}
-
-#powerTip.n:after, #powerTip.n:before,
-#powerTip.s:after, #powerTip.s:before,
-#powerTip.w:after, #powerTip.w:before,
-#powerTip.e:after, #powerTip.e:before,
-#powerTip.ne:after, #powerTip.ne:before,
-#powerTip.se:after, #powerTip.se:before,
-#powerTip.nw:after, #powerTip.nw:before,
-#powerTip.sw:after, #powerTip.sw:before {
- border: solid transparent;
- content: " ";
- height: 0;
- width: 0;
- position: absolute;
-}
-
-#powerTip.n:after, #powerTip.s:after,
-#powerTip.w:after, #powerTip.e:after,
-#powerTip.nw:after, #powerTip.ne:after,
-#powerTip.sw:after, #powerTip.se:after {
- border-color: rgba(255, 255, 255, 0);
-}
-
-#powerTip.n:before, #powerTip.s:before,
-#powerTip.w:before, #powerTip.e:before,
-#powerTip.nw:before, #powerTip.ne:before,
-#powerTip.sw:before, #powerTip.se:before {
- border-color: rgba(128, 128, 128, 0);
-}
-
-#powerTip.n:after, #powerTip.n:before,
-#powerTip.ne:after, #powerTip.ne:before,
-#powerTip.nw:after, #powerTip.nw:before {
- top: 100%;
-}
-
-#powerTip.n:after, #powerTip.ne:after, #powerTip.nw:after {
- border-top-color: #FFFFFF;
- border-width: 10px;
- margin: 0px -10px;
-}
-#powerTip.n:before {
- border-top-color: #808080;
- border-width: 11px;
- margin: 0px -11px;
-}
-#powerTip.n:after, #powerTip.n:before {
- left: 50%;
-}
-
-#powerTip.nw:after, #powerTip.nw:before {
- right: 14px;
-}
-
-#powerTip.ne:after, #powerTip.ne:before {
- left: 14px;
-}
-
-#powerTip.s:after, #powerTip.s:before,
-#powerTip.se:after, #powerTip.se:before,
-#powerTip.sw:after, #powerTip.sw:before {
- bottom: 100%;
-}
-
-#powerTip.s:after, #powerTip.se:after, #powerTip.sw:after {
- border-bottom-color: #FFFFFF;
- border-width: 10px;
- margin: 0px -10px;
-}
-
-#powerTip.s:before, #powerTip.se:before, #powerTip.sw:before {
- border-bottom-color: #808080;
- border-width: 11px;
- margin: 0px -11px;
-}
-
-#powerTip.s:after, #powerTip.s:before {
- left: 50%;
-}
-
-#powerTip.sw:after, #powerTip.sw:before {
- right: 14px;
-}
-
-#powerTip.se:after, #powerTip.se:before {
- left: 14px;
-}
-
-#powerTip.e:after, #powerTip.e:before {
- left: 100%;
-}
-#powerTip.e:after {
- border-left-color: #FFFFFF;
- border-width: 10px;
- top: 50%;
- margin-top: -10px;
-}
-#powerTip.e:before {
- border-left-color: #808080;
- border-width: 11px;
- top: 50%;
- margin-top: -11px;
-}
-
-#powerTip.w:after, #powerTip.w:before {
- right: 100%;
-}
-#powerTip.w:after {
- border-right-color: #FFFFFF;
- border-width: 10px;
- top: 50%;
- margin-top: -10px;
-}
-#powerTip.w:before {
- border-right-color: #808080;
- border-width: 11px;
- top: 50%;
- margin-top: -11px;
-}
-
-@media print
-{
- #top { display: none; }
- #side-nav { display: none; }
- #nav-path { display: none; }
- body { overflow:visible; }
- h1, h2, h3, h4, h5, h6 { page-break-after: avoid; }
- .summary { display: none; }
- .memitem { page-break-inside: avoid; }
- #doc-content
- {
- margin-left:0 !important;
- height:auto !important;
- width:auto !important;
- overflow:inherit;
- display:inline;
- }
-}
-
-/* @group Markdown */
-
-/*
-table.markdownTable {
- border-collapse:collapse;
- margin-top: 4px;
- margin-bottom: 4px;
-}
-
-table.markdownTable td, table.markdownTable th {
- border: 1px solid #2D4068;
- padding: 3px 7px 2px;
-}
-
-table.markdownTableHead tr {
-}
-
-table.markdownTableBodyLeft td, table.markdownTable th {
- border: 1px solid #2D4068;
- padding: 3px 7px 2px;
-}
-
-th.markdownTableHeadLeft th.markdownTableHeadRight th.markdownTableHeadCenter th.markdownTableHeadNone {
- background-color: #374F7F;
- color: #FFFFFF;
- font-size: 110%;
- padding-bottom: 4px;
- padding-top: 5px;
-}
-
-th.markdownTableHeadLeft {
- text-align: left
-}
-
-th.markdownTableHeadRight {
- text-align: right
-}
-
-th.markdownTableHeadCenter {
- text-align: center
-}
-*/
-
-table.markdownTable {
- border-collapse:collapse;
- margin-top: 4px;
- margin-bottom: 4px;
-}
-
-table.markdownTable td, table.markdownTable th {
- border: 1px solid #2D4068;
- padding: 3px 7px 2px;
-}
-
-table.markdownTable tr {
-}
-
-th.markdownTableHeadLeft, th.markdownTableHeadRight, th.markdownTableHeadCenter, th.markdownTableHeadNone {
- background-color: #374F7F;
- color: #FFFFFF;
- font-size: 110%;
- padding-bottom: 4px;
- padding-top: 5px;
-}
-
-th.markdownTableHeadLeft, td.markdownTableBodyLeft {
- text-align: left
-}
-
-th.markdownTableHeadRight, td.markdownTableBodyRight {
- text-align: right
-}
-
-th.markdownTableHeadCenter, td.markdownTableBodyCenter {
- text-align: center
-}
-
-.DocNodeRTL {
- text-align: right;
- direction: rtl;
-}
-
-.DocNodeLTR {
- text-align: left;
- direction: ltr;
-}
-
-table.DocNodeRTL {
- width: auto;
- margin-right: 0;
- margin-left: auto;
-}
-
-table.DocNodeLTR {
- width: auto;
- margin-right: auto;
- margin-left: 0;
-}
-
-tt, code, kbd, samp
-{
- display: inline-block;
- direction:ltr;
-}
-/* @end */
-
-u {
- text-decoration: underline;
-}
-
diff --git a/docs/html/doxygen.png b/docs/html/doxygen.png
deleted file mode 100644
index 3ff17d807fd8aa003bed8bb2a69e8f0909592fd1..0000000000000000000000000000000000000000
Binary files a/docs/html/doxygen.png and /dev/null differ
diff --git a/docs/html/dynsections.js b/docs/html/dynsections.js
deleted file mode 100644
index ea0a7b39a1bb1d393cdf0b7060d323dad27564f2..0000000000000000000000000000000000000000
--- a/docs/html/dynsections.js
+++ /dev/null
@@ -1,120 +0,0 @@
-/*
- @licstart The following is the entire license notice for the
- JavaScript code in this file.
-
- Copyright (C) 1997-2017 by Dimitri van Heesch
-
- This program is free software; you can redistribute it and/or modify
- it under the terms of the GNU General Public License as published by
- the Free Software Foundation; either version 2 of the License, or
- (at your option) any later version.
-
- This program is distributed in the hope that it will be useful,
- but WITHOUT ANY WARRANTY; without even the implied warranty of
- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
- GNU General Public License for more details.
-
- You should have received a copy of the GNU General Public License along
- with this program; if not, write to the Free Software Foundation, Inc.,
- 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
- @licend The above is the entire license notice
- for the JavaScript code in this file
- */
-function toggleVisibility(linkObj)
-{
- var base = $(linkObj).attr('id');
- var summary = $('#'+base+'-summary');
- var content = $('#'+base+'-content');
- var trigger = $('#'+base+'-trigger');
- var src=$(trigger).attr('src');
- if (content.is(':visible')===true) {
- content.hide();
- summary.show();
- $(linkObj).addClass('closed').removeClass('opened');
- $(trigger).attr('src',src.substring(0,src.length-8)+'closed.png');
- } else {
- content.show();
- summary.hide();
- $(linkObj).removeClass('closed').addClass('opened');
- $(trigger).attr('src',src.substring(0,src.length-10)+'open.png');
- }
- return false;
-}
-
-function updateStripes()
-{
- $('table.directory tr').
- removeClass('even').filter(':visible:even').addClass('even');
-}
-
-function toggleLevel(level)
-{
- $('table.directory tr').each(function() {
- var l = this.id.split('_').length-1;
- var i = $('#img'+this.id.substring(3));
- var a = $('#arr'+this.id.substring(3));
- if (l<level+1) {
- i.removeClass('iconfopen iconfclosed').addClass('iconfopen');
- a.html('▼');
- $(this).show();
- } else if (l==level+1) {
- i.removeClass('iconfclosed iconfopen').addClass('iconfclosed');
- a.html('►');
- $(this).show();
- } else {
- $(this).hide();
- }
- });
- updateStripes();
-}
-
-function toggleFolder(id)
-{
- // the clicked row
- var currentRow = $('#row_'+id);
-
- // all rows after the clicked row
- var rows = currentRow.nextAll("tr");
-
- var re = new RegExp('^row_'+id+'\\d+_$', "i"); //only one sub
-
- // only match elements AFTER this one (can't hide elements before)
- var childRows = rows.filter(function() { return this.id.match(re); });
-
- // first row is visible we are HIDING
- if (childRows.filter(':first').is(':visible')===true) {
- // replace down arrow by right arrow for current row
- var currentRowSpans = currentRow.find("span");
- currentRowSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed");
- currentRowSpans.filter(".arrow").html('►');
- rows.filter("[id^=row_"+id+"]").hide(); // hide all children
- } else { // we are SHOWING
- // replace right arrow by down arrow for current row
- var currentRowSpans = currentRow.find("span");
- currentRowSpans.filter(".iconfclosed").removeClass("iconfclosed").addClass("iconfopen");
- currentRowSpans.filter(".arrow").html('▼');
- // replace down arrows by right arrows for child rows
- var childRowsSpans = childRows.find("span");
- childRowsSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed");
- childRowsSpans.filter(".arrow").html('►');
- childRows.show(); //show all children
- }
- updateStripes();
-}
-
-
-function toggleInherit(id)
-{
- var rows = $('tr.inherit.'+id);
- var img = $('tr.inherit_header.'+id+' img');
- var src = $(img).attr('src');
- if (rows.filter(':first').is(':visible')===true) {
- rows.css('display','none');
- $(img).attr('src',src.substring(0,src.length-8)+'closed.png');
- } else {
- rows.css('display','table-row'); // using show() causes jump in firefox
- $(img).attr('src',src.substring(0,src.length-10)+'open.png');
- }
-}
-/* @license-end */
diff --git a/docs/html/files.html b/docs/html/files.html
deleted file mode 100644
index 760ec802306a965fdce472381fc00855a1d36be3..0000000000000000000000000000000000000000
--- a/docs/html/files.html
+++ /dev/null
@@ -1,83 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: File List</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-</div><!-- top -->
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-<div class="header">
- <div class="headertitle">
-<div class="title">File List</div> </div>
-</div><!--header-->
-<div class="contents">
-<div class="textblock">Here is a list of all documented files with brief descriptions:</div><div class="directory">
-<table class="directory">
-<tr id="row_0_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icondoc"></span><a class="el" href="_factor_oracle_8cpp.html" target="_self">FactorOracle.cpp</a></td><td class="desc">A file that contains the functions needed for the creation of a Factor Oracle </td></tr>
-<tr id="row_1_"><td class="entry"><span style="width:16px;display:inline-block;"> </span><a href="_factor_oracle_8h_source.html"><span class="icondoc"></span></a><a class="el" href="_factor_oracle_8h.html" target="_self">FactorOracle.h</a></td><td class="desc">A file that contains the definitions of the classes needed for the creation of a Factor Oracle </td></tr>
-<tr id="row_2_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icondoc"></span><a class="el" href="main_8cpp.html" target="_self">main.cpp</a></td><td class="desc">A file that contains the main functions, which starts all the algorithm </td></tr>
-</table>
-</div><!-- directory -->
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/folderclosed.png b/docs/html/folderclosed.png
deleted file mode 100644
index bb8ab35edce8e97554e360005ee9fc5bffb36e66..0000000000000000000000000000000000000000
Binary files a/docs/html/folderclosed.png and /dev/null differ
diff --git a/docs/html/folderopen.png b/docs/html/folderopen.png
deleted file mode 100644
index d6c7f676a3b3ef8c2c307d319dff3c6a604eb227..0000000000000000000000000000000000000000
Binary files a/docs/html/folderopen.png and /dev/null differ
diff --git a/docs/html/functions.html b/docs/html/functions.html
deleted file mode 100644
index e1749a3d9224816a8adce072c71c26894210d11e..0000000000000000000000000000000000000000
--- a/docs/html/functions.html
+++ /dev/null
@@ -1,104 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: Class Members</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-</div><!-- top -->
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-<div class="contents">
-<div class="textblock">Here is a list of all documented class members with links to the class documentation for each member:</div><ul>
-<li>AddLetter()
-: <a class="el" href="class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db">FactorOracle</a>
-</li>
-<li>FactorOracleStart()
-: <a class="el" href="class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f">FactorOracle</a>
-</li>
-<li>FindBetter()
-: <a class="el" href="class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50">FactorOracle</a>
-</li>
-<li>first_state_
-: <a class="el" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">SingleTransition</a>
-</li>
-<li>FOGenerate()
-: <a class="el" href="class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390">FactorOracle</a>
-</li>
-<li>last_state_
-: <a class="el" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">SingleTransition</a>
-</li>
-<li>state_
-: <a class="el" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">State</a>
-</li>
-<li>states_
-: <a class="el" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">FactorOracle</a>
-</li>
-<li>symbol_
-: <a class="el" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">SingleTransition</a>
-</li>
-<li>transition_
-: <a class="el" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">State</a>
-</li>
-</ul>
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/functions_func.html b/docs/html/functions_func.html
deleted file mode 100644
index 6c257e06fabf8d07af8502063de2857951936966..0000000000000000000000000000000000000000
--- a/docs/html/functions_func.html
+++ /dev/null
@@ -1,86 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: Class Members - Functions</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-</div><!-- top -->
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-<div class="contents">
- <ul>
-<li>AddLetter()
-: <a class="el" href="class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db">FactorOracle</a>
-</li>
-<li>FactorOracleStart()
-: <a class="el" href="class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f">FactorOracle</a>
-</li>
-<li>FindBetter()
-: <a class="el" href="class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50">FactorOracle</a>
-</li>
-<li>FOGenerate()
-: <a class="el" href="class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390">FactorOracle</a>
-</li>
-</ul>
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/functions_vars.html b/docs/html/functions_vars.html
deleted file mode 100644
index cfd8c17ec941e228ebd0c2bb4bb917af8ac9844e..0000000000000000000000000000000000000000
--- a/docs/html/functions_vars.html
+++ /dev/null
@@ -1,92 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: Class Members - Variables</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-</div><!-- top -->
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-<div class="contents">
- <ul>
-<li>first_state_
-: <a class="el" href="class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6">SingleTransition</a>
-</li>
-<li>last_state_
-: <a class="el" href="class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69">SingleTransition</a>
-</li>
-<li>state_
-: <a class="el" href="class_state.html#a2dcf672a1560830a8f93b0e9863c6724">State</a>
-</li>
-<li>states_
-: <a class="el" href="class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d">FactorOracle</a>
-</li>
-<li>symbol_
-: <a class="el" href="class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9">SingleTransition</a>
-</li>
-<li>transition_
-: <a class="el" href="class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8">State</a>
-</li>
-</ul>
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/index.html b/docs/html/index.html
deleted file mode 100644
index 106d560ba653c51fb39490b1168996429a3388c0..0000000000000000000000000000000000000000
--- a/docs/html/index.html
+++ /dev/null
@@ -1,76 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: Main Page</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-</div><!-- top -->
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-<div class="header">
- <div class="headertitle">
-<div class="title">My Project Documentation</div> </div>
-</div><!--header-->
-<div class="contents">
-</div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/jquery.js b/docs/html/jquery.js
deleted file mode 100644
index 1ee895ca3201fb9627f704a0bb8ad45fe9408412..0000000000000000000000000000000000000000
--- a/docs/html/jquery.js
+++ /dev/null
@@ -1,87 +0,0 @@
-/*!
- * jQuery JavaScript Library v1.7.2
- * http://jquery.com/
- *
- * Copyright 2011, John Resig
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * Includes Sizzle.js
- * http://sizzlejs.com/
- * Copyright 2011, The Dojo Foundation
- * Released under the MIT, BSD, and GPL Licenses.
- *
- * Date: Wed Mar 21 12:46:34 2012 -0700
- */
-(function(bd,L){var av=bd.document,bu=bd.navigator,bm=bd.location;var b=(function(){var bF=function(b0,b1){return new bF.fn.init(b0,b1,bD)},bU=bd.jQuery,bH=bd.$,bD,bY=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bM=/\S/,bI=/^\s+/,bE=/\s+$/,bA=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bN=/^[\],:{}\s]*$/,bW=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bP=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bJ=/(?:^|:|,)(?:\s*\[)+/g,by=/(webkit)[ \/]([\w.]+)/,bR=/(opera)(?:.*version)?[ \/]([\w.]+)/,bQ=/(msie) ([\w.]+)/,bS=/(mozilla)(?:.*? rv:([\w.]+))?/,bB=/-([a-z]|[0-9])/ig,bZ=/^-ms-/,bT=function(b0,b1){return(b1+"").toUpperCase()},bX=bu.userAgent,bV,bC,e,bL=Object.prototype.toString,bG=Object.prototype.hasOwnProperty,bz=Array.prototype.push,bK=Array.prototype.slice,bO=String.prototype.trim,bv=Array.prototype.indexOf,bx={};bF.fn=bF.prototype={constructor:bF,init:function(b0,b4,b3){var b2,b5,b1,b6;if(!b0){return this}if(b0.nodeType){this.context=this[0]=b0;this.length=1;return this}if(b0==="body"&&!b4&&av.body){this.context=av;this[0]=av.body;this.selector=b0;this.length=1;return this}if(typeof b0==="string"){if(b0.charAt(0)==="<"&&b0.charAt(b0.length-1)===">"&&b0.length>=3){b2=[null,b0,null]}else{b2=bY.exec(b0)}if(b2&&(b2[1]||!b4)){if(b2[1]){b4=b4 instanceof bF?b4[0]:b4;b6=(b4?b4.ownerDocument||b4:av);b1=bA.exec(b0);if(b1){if(bF.isPlainObject(b4)){b0=[av.createElement(b1[1])];bF.fn.attr.call(b0,b4,true)}else{b0=[b6.createElement(b1[1])]}}else{b1=bF.buildFragment([b2[1]],[b6]);b0=(b1.cacheable?bF.clone(b1.fragment):b1.fragment).childNodes}return bF.merge(this,b0)}else{b5=av.getElementById(b2[2]);if(b5&&b5.parentNode){if(b5.id!==b2[2]){return b3.find(b0)}this.length=1;this[0]=b5}this.context=av;this.selector=b0;return this}}else{if(!b4||b4.jquery){return(b4||b3).find(b0)}else{return this.constructor(b4).find(b0)}}}else{if(bF.isFunction(b0)){return b3.ready(b0)}}if(b0.selector!==L){this.selector=b0.selector;this.context=b0.context}return bF.makeArray(b0,this)},selector:"",jquery:"1.7.2",length:0,size:function(){return this.length},toArray:function(){return bK.call(this,0)},get:function(b0){return b0==null?this.toArray():(b0<0?this[this.length+b0]:this[b0])},pushStack:function(b1,b3,b0){var b2=this.constructor();if(bF.isArray(b1)){bz.apply(b2,b1)}else{bF.merge(b2,b1)}b2.prevObject=this;b2.context=this.context;if(b3==="find"){b2.selector=this.selector+(this.selector?" ":"")+b0}else{if(b3){b2.selector=this.selector+"."+b3+"("+b0+")"}}return b2},each:function(b1,b0){return bF.each(this,b1,b0)},ready:function(b0){bF.bindReady();bC.add(b0);return this},eq:function(b0){b0=+b0;return b0===-1?this.slice(b0):this.slice(b0,b0+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bK.apply(this,arguments),"slice",bK.call(arguments).join(","))},map:function(b0){return this.pushStack(bF.map(this,function(b2,b1){return b0.call(b2,b1,b2)}))},end:function(){return this.prevObject||this.constructor(null)},push:bz,sort:[].sort,splice:[].splice};bF.fn.init.prototype=bF.fn;bF.extend=bF.fn.extend=function(){var b9,b2,b0,b1,b6,b7,b5=arguments[0]||{},b4=1,b3=arguments.length,b8=false;if(typeof b5==="boolean"){b8=b5;b5=arguments[1]||{};b4=2}if(typeof b5!=="object"&&!bF.isFunction(b5)){b5={}}if(b3===b4){b5=this;--b4}for(;b4<b3;b4++){if((b9=arguments[b4])!=null){for(b2 in b9){b0=b5[b2];b1=b9[b2];if(b5===b1){continue}if(b8&&b1&&(bF.isPlainObject(b1)||(b6=bF.isArray(b1)))){if(b6){b6=false;b7=b0&&bF.isArray(b0)?b0:[]}else{b7=b0&&bF.isPlainObject(b0)?b0:{}}b5[b2]=bF.extend(b8,b7,b1)}else{if(b1!==L){b5[b2]=b1}}}}}return b5};bF.extend({noConflict:function(b0){if(bd.$===bF){bd.$=bH}if(b0&&bd.jQuery===bF){bd.jQuery=bU}return bF},isReady:false,readyWait:1,holdReady:function(b0){if(b0){bF.readyWait++}else{bF.ready(true)}},ready:function(b0){if((b0===true&&!--bF.readyWait)||(b0!==true&&!bF.isReady)){if(!av.body){return setTimeout(bF.ready,1)}bF.isReady=true;if(b0!==true&&--bF.readyWait>0){return}bC.fireWith(av,[bF]);if(bF.fn.trigger){bF(av).trigger("ready").off("ready")}}},bindReady:function(){if(bC){return}bC=bF.Callbacks("once memory");if(av.readyState==="complete"){return setTimeout(bF.ready,1)}if(av.addEventListener){av.addEventListener("DOMContentLoaded",e,false);bd.addEventListener("load",bF.ready,false)}else{if(av.attachEvent){av.attachEvent("onreadystatechange",e);bd.attachEvent("onload",bF.ready);var b0=false;try{b0=bd.frameElement==null}catch(b1){}if(av.documentElement.doScroll&&b0){bw()}}}},isFunction:function(b0){return bF.type(b0)==="function"},isArray:Array.isArray||function(b0){return bF.type(b0)==="array"},isWindow:function(b0){return b0!=null&&b0==b0.window},isNumeric:function(b0){return !isNaN(parseFloat(b0))&&isFinite(b0)},type:function(b0){return b0==null?String(b0):bx[bL.call(b0)]||"object"},isPlainObject:function(b2){if(!b2||bF.type(b2)!=="object"||b2.nodeType||bF.isWindow(b2)){return false}try{if(b2.constructor&&!bG.call(b2,"constructor")&&!bG.call(b2.constructor.prototype,"isPrototypeOf")){return false}}catch(b1){return false}var b0;for(b0 in b2){}return b0===L||bG.call(b2,b0)},isEmptyObject:function(b1){for(var b0 in b1){return false}return true},error:function(b0){throw new Error(b0)},parseJSON:function(b0){if(typeof b0!=="string"||!b0){return null}b0=bF.trim(b0);if(bd.JSON&&bd.JSON.parse){return bd.JSON.parse(b0)}if(bN.test(b0.replace(bW,"@").replace(bP,"]").replace(bJ,""))){return(new Function("return "+b0))()}bF.error("Invalid JSON: "+b0)},parseXML:function(b2){if(typeof b2!=="string"||!b2){return null}var b0,b1;try{if(bd.DOMParser){b1=new DOMParser();b0=b1.parseFromString(b2,"text/xml")}else{b0=new ActiveXObject("Microsoft.XMLDOM");b0.async="false";b0.loadXML(b2)}}catch(b3){b0=L}if(!b0||!b0.documentElement||b0.getElementsByTagName("parsererror").length){bF.error("Invalid XML: "+b2)}return b0},noop:function(){},globalEval:function(b0){if(b0&&bM.test(b0)){(bd.execScript||function(b1){bd["eval"].call(bd,b1)})(b0)}},camelCase:function(b0){return b0.replace(bZ,"ms-").replace(bB,bT)},nodeName:function(b1,b0){return b1.nodeName&&b1.nodeName.toUpperCase()===b0.toUpperCase()},each:function(b3,b6,b2){var b1,b4=0,b5=b3.length,b0=b5===L||bF.isFunction(b3);if(b2){if(b0){for(b1 in b3){if(b6.apply(b3[b1],b2)===false){break}}}else{for(;b4<b5;){if(b6.apply(b3[b4++],b2)===false){break}}}}else{if(b0){for(b1 in b3){if(b6.call(b3[b1],b1,b3[b1])===false){break}}}else{for(;b4<b5;){if(b6.call(b3[b4],b4,b3[b4++])===false){break}}}}return b3},trim:bO?function(b0){return b0==null?"":bO.call(b0)}:function(b0){return b0==null?"":b0.toString().replace(bI,"").replace(bE,"")},makeArray:function(b3,b1){var b0=b1||[];if(b3!=null){var b2=bF.type(b3);if(b3.length==null||b2==="string"||b2==="function"||b2==="regexp"||bF.isWindow(b3)){bz.call(b0,b3)}else{bF.merge(b0,b3)}}return b0},inArray:function(b2,b3,b1){var b0;if(b3){if(bv){return bv.call(b3,b2,b1)}b0=b3.length;b1=b1?b1<0?Math.max(0,b0+b1):b1:0;for(;b1<b0;b1++){if(b1 in b3&&b3[b1]===b2){return b1}}}return -1},merge:function(b4,b2){var b3=b4.length,b1=0;if(typeof b2.length==="number"){for(var b0=b2.length;b1<b0;b1++){b4[b3++]=b2[b1]}}else{while(b2[b1]!==L){b4[b3++]=b2[b1++]}}b4.length=b3;return b4},grep:function(b1,b6,b0){var b2=[],b5;b0=!!b0;for(var b3=0,b4=b1.length;b3<b4;b3++){b5=!!b6(b1[b3],b3);if(b0!==b5){b2.push(b1[b3])}}return b2},map:function(b0,b7,b8){var b5,b6,b4=[],b2=0,b1=b0.length,b3=b0 instanceof bF||b1!==L&&typeof b1==="number"&&((b1>0&&b0[0]&&b0[b1-1])||b1===0||bF.isArray(b0));if(b3){for(;b2<b1;b2++){b5=b7(b0[b2],b2,b8);if(b5!=null){b4[b4.length]=b5}}}else{for(b6 in b0){b5=b7(b0[b6],b6,b8);if(b5!=null){b4[b4.length]=b5}}}return b4.concat.apply([],b4)},guid:1,proxy:function(b4,b3){if(typeof b3==="string"){var b2=b4[b3];b3=b4;b4=b2}if(!bF.isFunction(b4)){return L}var b0=bK.call(arguments,2),b1=function(){return b4.apply(b3,b0.concat(bK.call(arguments)))};b1.guid=b4.guid=b4.guid||b1.guid||bF.guid++;return b1},access:function(b0,b6,b9,b7,b4,ca,b8){var b2,b5=b9==null,b3=0,b1=b0.length;if(b9&&typeof b9==="object"){for(b3 in b9){bF.access(b0,b6,b3,b9[b3],1,ca,b7)}b4=1}else{if(b7!==L){b2=b8===L&&bF.isFunction(b7);if(b5){if(b2){b2=b6;b6=function(cc,cb,cd){return b2.call(bF(cc),cd)}}else{b6.call(b0,b7);b6=null}}if(b6){for(;b3<b1;b3++){b6(b0[b3],b9,b2?b7.call(b0[b3],b3,b6(b0[b3],b9)):b7,b8)}}b4=1}}return b4?b0:b5?b6.call(b0):b1?b6(b0[0],b9):ca},now:function(){return(new Date()).getTime()},uaMatch:function(b1){b1=b1.toLowerCase();var b0=by.exec(b1)||bR.exec(b1)||bQ.exec(b1)||b1.indexOf("compatible")<0&&bS.exec(b1)||[];return{browser:b0[1]||"",version:b0[2]||"0"}},sub:function(){function b0(b3,b4){return new b0.fn.init(b3,b4)}bF.extend(true,b0,this);b0.superclass=this;b0.fn=b0.prototype=this();b0.fn.constructor=b0;b0.sub=this.sub;b0.fn.init=function b2(b3,b4){if(b4&&b4 instanceof bF&&!(b4 instanceof b0)){b4=b0(b4)}return bF.fn.init.call(this,b3,b4,b1)};b0.fn.init.prototype=b0.fn;var b1=b0(av);return b0},browser:{}});bF.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(b1,b0){bx["[object "+b0+"]"]=b0.toLowerCase()});bV=bF.uaMatch(bX);if(bV.browser){bF.browser[bV.browser]=true;bF.browser.version=bV.version}if(bF.browser.webkit){bF.browser.safari=true}if(bM.test("\xA0")){bI=/^[\s\xA0]+/;bE=/[\s\xA0]+$/}bD=bF(av);if(av.addEventListener){e=function(){av.removeEventListener("DOMContentLoaded",e,false);bF.ready()}}else{if(av.attachEvent){e=function(){if(av.readyState==="complete"){av.detachEvent("onreadystatechange",e);bF.ready()}}}}function bw(){if(bF.isReady){return}try{av.documentElement.doScroll("left")}catch(b0){setTimeout(bw,1);return}bF.ready()}return bF})();var a3={};function X(e){var bv=a3[e]={},bw,bx;e=e.split(/\s+/);for(bw=0,bx=e.length;bw<bx;bw++){bv[e[bw]]=true}return bv}b.Callbacks=function(bx){bx=bx?(a3[bx]||X(bx)):{};var bC=[],bD=[],by,e,bz,bw,bA,bB,bF=function(bG){var bH,bK,bJ,bI,bL;for(bH=0,bK=bG.length;bH<bK;bH++){bJ=bG[bH];bI=b.type(bJ);if(bI==="array"){bF(bJ)}else{if(bI==="function"){if(!bx.unique||!bE.has(bJ)){bC.push(bJ)}}}}},bv=function(bH,bG){bG=bG||[];by=!bx.memory||[bH,bG];e=true;bz=true;bB=bw||0;bw=0;bA=bC.length;for(;bC&&bB<bA;bB++){if(bC[bB].apply(bH,bG)===false&&bx.stopOnFalse){by=true;break}}bz=false;if(bC){if(!bx.once){if(bD&&bD.length){by=bD.shift();bE.fireWith(by[0],by[1])}}else{if(by===true){bE.disable()}else{bC=[]}}}},bE={add:function(){if(bC){var bG=bC.length;bF(arguments);if(bz){bA=bC.length}else{if(by&&by!==true){bw=bG;bv(by[0],by[1])}}}return this},remove:function(){if(bC){var bG=arguments,bI=0,bJ=bG.length;for(;bI<bJ;bI++){for(var bH=0;bH<bC.length;bH++){if(bG[bI]===bC[bH]){if(bz){if(bH<=bA){bA--;if(bH<=bB){bB--}}}bC.splice(bH--,1);if(bx.unique){break}}}}}return this},has:function(bH){if(bC){var bG=0,bI=bC.length;for(;bG<bI;bG++){if(bH===bC[bG]){return true}}}return false},empty:function(){bC=[];return this},disable:function(){bC=bD=by=L;return this},disabled:function(){return !bC},lock:function(){bD=L;if(!by||by===true){bE.disable()}return this},locked:function(){return !bD},fireWith:function(bH,bG){if(bD){if(bz){if(!bx.once){bD.push([bH,bG])}}else{if(!(bx.once&&by)){bv(bH,bG)}}}return this},fire:function(){bE.fireWith(this,arguments);return this},fired:function(){return !!e}};return bE};var aK=[].slice;b.extend({Deferred:function(by){var bx=b.Callbacks("once memory"),bw=b.Callbacks("once memory"),bv=b.Callbacks("memory"),e="pending",bA={resolve:bx,reject:bw,notify:bv},bC={done:bx.add,fail:bw.add,progress:bv.add,state:function(){return e},isResolved:bx.fired,isRejected:bw.fired,then:function(bE,bD,bF){bB.done(bE).fail(bD).progress(bF);return this},always:function(){bB.done.apply(bB,arguments).fail.apply(bB,arguments);return this},pipe:function(bF,bE,bD){return b.Deferred(function(bG){b.each({done:[bF,"resolve"],fail:[bE,"reject"],progress:[bD,"notify"]},function(bI,bL){var bH=bL[0],bK=bL[1],bJ;if(b.isFunction(bH)){bB[bI](function(){bJ=bH.apply(this,arguments);if(bJ&&b.isFunction(bJ.promise)){bJ.promise().then(bG.resolve,bG.reject,bG.notify)}else{bG[bK+"With"](this===bB?bG:this,[bJ])}})}else{bB[bI](bG[bK])}})}).promise()},promise:function(bE){if(bE==null){bE=bC}else{for(var bD in bC){bE[bD]=bC[bD]}}return bE}},bB=bC.promise({}),bz;for(bz in bA){bB[bz]=bA[bz].fire;bB[bz+"With"]=bA[bz].fireWith}bB.done(function(){e="resolved"},bw.disable,bv.lock).fail(function(){e="rejected"},bx.disable,bv.lock);if(by){by.call(bB,bB)}return bB},when:function(bA){var bx=aK.call(arguments,0),bv=0,e=bx.length,bB=new Array(e),bw=e,by=e,bC=e<=1&&bA&&b.isFunction(bA.promise)?bA:b.Deferred(),bE=bC.promise();function bD(bF){return function(bG){bx[bF]=arguments.length>1?aK.call(arguments,0):bG;if(!(--bw)){bC.resolveWith(bC,bx)}}}function bz(bF){return function(bG){bB[bF]=arguments.length>1?aK.call(arguments,0):bG;bC.notifyWith(bE,bB)}}if(e>1){for(;bv<e;bv++){if(bx[bv]&&bx[bv].promise&&b.isFunction(bx[bv].promise)){bx[bv].promise().then(bD(bv),bC.reject,bz(bv))}else{--bw}}if(!bw){bC.resolveWith(bC,bx)}}else{if(bC!==bA){bC.resolveWith(bC,e?[bA]:[])}}return bE}});b.support=(function(){var bI,bH,bE,bF,bx,bD,bC,bz,bJ,bA,by,bw,bv=av.createElement("div"),bG=av.documentElement;bv.setAttribute("className","t");bv.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";bH=bv.getElementsByTagName("*");bE=bv.getElementsByTagName("a")[0];if(!bH||!bH.length||!bE){return{}}bF=av.createElement("select");bx=bF.appendChild(av.createElement("option"));bD=bv.getElementsByTagName("input")[0];bI={leadingWhitespace:(bv.firstChild.nodeType===3),tbody:!bv.getElementsByTagName("tbody").length,htmlSerialize:!!bv.getElementsByTagName("link").length,style:/top/.test(bE.getAttribute("style")),hrefNormalized:(bE.getAttribute("href")==="/a"),opacity:/^0.55/.test(bE.style.opacity),cssFloat:!!bE.style.cssFloat,checkOn:(bD.value==="on"),optSelected:bx.selected,getSetAttribute:bv.className!=="t",enctype:!!av.createElement("form").enctype,html5Clone:av.createElement("nav").cloneNode(true).outerHTML!=="<:nav></:nav>",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true,pixelMargin:true};b.boxModel=bI.boxModel=(av.compatMode==="CSS1Compat");bD.checked=true;bI.noCloneChecked=bD.cloneNode(true).checked;bF.disabled=true;bI.optDisabled=!bx.disabled;try{delete bv.test}catch(bB){bI.deleteExpando=false}if(!bv.addEventListener&&bv.attachEvent&&bv.fireEvent){bv.attachEvent("onclick",function(){bI.noCloneEvent=false});bv.cloneNode(true).fireEvent("onclick")}bD=av.createElement("input");bD.value="t";bD.setAttribute("type","radio");bI.radioValue=bD.value==="t";bD.setAttribute("checked","checked");bD.setAttribute("name","t");bv.appendChild(bD);bC=av.createDocumentFragment();bC.appendChild(bv.lastChild);bI.checkClone=bC.cloneNode(true).cloneNode(true).lastChild.checked;bI.appendChecked=bD.checked;bC.removeChild(bD);bC.appendChild(bv);if(bv.attachEvent){for(by in {submit:1,change:1,focusin:1}){bA="on"+by;bw=(bA in bv);if(!bw){bv.setAttribute(bA,"return;");bw=(typeof bv[bA]==="function")}bI[by+"Bubbles"]=bw}}bC.removeChild(bv);bC=bF=bx=bv=bD=null;b(function(){var bM,bV,bW,bU,bO,bP,bR,bL,bK,bQ,bN,e,bT,bS=av.getElementsByTagName("body")[0];if(!bS){return}bL=1;bT="padding:0;margin:0;border:";bN="position:absolute;top:0;left:0;width:1px;height:1px;";e=bT+"0;visibility:hidden;";bK="style='"+bN+bT+"5px solid #000;";bQ="<div "+bK+"display:block;'><div style='"+bT+"0;display:block;overflow:hidden;'></div></div><table "+bK+"' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";bM=av.createElement("div");bM.style.cssText=e+"width:0;height:0;position:static;top:0;margin-top:"+bL+"px";bS.insertBefore(bM,bS.firstChild);bv=av.createElement("div");bM.appendChild(bv);bv.innerHTML="<table><tr><td style='"+bT+"0;display:none'></td><td>t</td></tr></table>";bz=bv.getElementsByTagName("td");bw=(bz[0].offsetHeight===0);bz[0].style.display="";bz[1].style.display="none";bI.reliableHiddenOffsets=bw&&(bz[0].offsetHeight===0);if(bd.getComputedStyle){bv.innerHTML="";bR=av.createElement("div");bR.style.width="0";bR.style.marginRight="0";bv.style.width="2px";bv.appendChild(bR);bI.reliableMarginRight=(parseInt((bd.getComputedStyle(bR,null)||{marginRight:0}).marginRight,10)||0)===0}if(typeof bv.style.zoom!=="undefined"){bv.innerHTML="";bv.style.width=bv.style.padding="1px";bv.style.border=0;bv.style.overflow="hidden";bv.style.display="inline";bv.style.zoom=1;bI.inlineBlockNeedsLayout=(bv.offsetWidth===3);bv.style.display="block";bv.style.overflow="visible";bv.innerHTML="<div style='width:5px;'></div>";bI.shrinkWrapBlocks=(bv.offsetWidth!==3)}bv.style.cssText=bN+e;bv.innerHTML=bQ;bV=bv.firstChild;bW=bV.firstChild;bO=bV.nextSibling.firstChild.firstChild;bP={doesNotAddBorder:(bW.offsetTop!==5),doesAddBorderForTableAndCells:(bO.offsetTop===5)};bW.style.position="fixed";bW.style.top="20px";bP.fixedPosition=(bW.offsetTop===20||bW.offsetTop===15);bW.style.position=bW.style.top="";bV.style.overflow="hidden";bV.style.position="relative";bP.subtractsBorderForOverflowNotVisible=(bW.offsetTop===-5);bP.doesNotIncludeMarginInBodyOffset=(bS.offsetTop!==bL);if(bd.getComputedStyle){bv.style.marginTop="1%";bI.pixelMargin=(bd.getComputedStyle(bv,null)||{marginTop:0}).marginTop!=="1%"}if(typeof bM.style.zoom!=="undefined"){bM.style.zoom=1}bS.removeChild(bM);bR=bv=bM=null;b.extend(bI,bP)});return bI})();var aT=/^(?:\{.*\}|\[.*\])$/,aA=/([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!S(e)},data:function(bx,bv,bz,by){if(!b.acceptData(bx)){return}var bG,bA,bD,bE=b.expando,bC=typeof bv==="string",bF=bx.nodeType,e=bF?b.cache:bx,bw=bF?bx[bE]:bx[bE]&&bE,bB=bv==="events";if((!bw||!e[bw]||(!bB&&!by&&!e[bw].data))&&bC&&bz===L){return}if(!bw){if(bF){bx[bE]=bw=++b.uuid}else{bw=bE}}if(!e[bw]){e[bw]={};if(!bF){e[bw].toJSON=b.noop}}if(typeof bv==="object"||typeof bv==="function"){if(by){e[bw]=b.extend(e[bw],bv)}else{e[bw].data=b.extend(e[bw].data,bv)}}bG=bA=e[bw];if(!by){if(!bA.data){bA.data={}}bA=bA.data}if(bz!==L){bA[b.camelCase(bv)]=bz}if(bB&&!bA[bv]){return bG.events}if(bC){bD=bA[bv];if(bD==null){bD=bA[b.camelCase(bv)]}}else{bD=bA}return bD},removeData:function(bx,bv,by){if(!b.acceptData(bx)){return}var bB,bA,bz,bC=b.expando,bD=bx.nodeType,e=bD?b.cache:bx,bw=bD?bx[bC]:bC;if(!e[bw]){return}if(bv){bB=by?e[bw]:e[bw].data;if(bB){if(!b.isArray(bv)){if(bv in bB){bv=[bv]}else{bv=b.camelCase(bv);if(bv in bB){bv=[bv]}else{bv=bv.split(" ")}}}for(bA=0,bz=bv.length;bA<bz;bA++){delete bB[bv[bA]]}if(!(by?S:b.isEmptyObject)(bB)){return}}}if(!by){delete e[bw].data;if(!S(e[bw])){return}}if(b.support.deleteExpando||!e.setInterval){delete e[bw]}else{e[bw]=null}if(bD){if(b.support.deleteExpando){delete bx[bC]}else{if(bx.removeAttribute){bx.removeAttribute(bC)}else{bx[bC]=null}}}},_data:function(bv,e,bw){return b.data(bv,e,bw,true)},acceptData:function(bv){if(bv.nodeName){var e=b.noData[bv.nodeName.toLowerCase()];if(e){return !(e===true||bv.getAttribute("classid")!==e)}}return true}});b.fn.extend({data:function(bD,bC){var by,bv,bB,e,bx,bw=this[0],bA=0,bz=null;if(bD===L){if(this.length){bz=b.data(bw);if(bw.nodeType===1&&!b._data(bw,"parsedAttrs")){bB=bw.attributes;for(bx=bB.length;bA<bx;bA++){e=bB[bA].name;if(e.indexOf("data-")===0){e=b.camelCase(e.substring(5));a6(bw,e,bz[e])}}b._data(bw,"parsedAttrs",true)}}return bz}if(typeof bD==="object"){return this.each(function(){b.data(this,bD)})}by=bD.split(".",2);by[1]=by[1]?"."+by[1]:"";bv=by[1]+"!";return b.access(this,function(bE){if(bE===L){bz=this.triggerHandler("getData"+bv,[by[0]]);if(bz===L&&bw){bz=b.data(bw,bD);bz=a6(bw,bD,bz)}return bz===L&&by[1]?this.data(by[0]):bz}by[1]=bE;this.each(function(){var bF=b(this);bF.triggerHandler("setData"+bv,by);b.data(this,bD,bE);bF.triggerHandler("changeData"+bv,by)})},null,bC,arguments.length>1,null,false)},removeData:function(e){return this.each(function(){b.removeData(this,e)})}});function a6(bx,bw,by){if(by===L&&bx.nodeType===1){var bv="data-"+bw.replace(aA,"-$1").toLowerCase();by=bx.getAttribute(bv);if(typeof by==="string"){try{by=by==="true"?true:by==="false"?false:by==="null"?null:b.isNumeric(by)?+by:aT.test(by)?b.parseJSON(by):by}catch(bz){}b.data(bx,bw,by)}else{by=L}}return by}function S(bv){for(var e in bv){if(e==="data"&&b.isEmptyObject(bv[e])){continue}if(e!=="toJSON"){return false}}return true}function bj(by,bx,bA){var bw=bx+"defer",bv=bx+"queue",e=bx+"mark",bz=b._data(by,bw);if(bz&&(bA==="queue"||!b._data(by,bv))&&(bA==="mark"||!b._data(by,e))){setTimeout(function(){if(!b._data(by,bv)&&!b._data(by,e)){b.removeData(by,bw,true);bz.fire()}},0)}}b.extend({_mark:function(bv,e){if(bv){e=(e||"fx")+"mark";b._data(bv,e,(b._data(bv,e)||0)+1)}},_unmark:function(by,bx,bv){if(by!==true){bv=bx;bx=by;by=false}if(bx){bv=bv||"fx";var e=bv+"mark",bw=by?0:((b._data(bx,e)||1)-1);if(bw){b._data(bx,e,bw)}else{b.removeData(bx,e,true);bj(bx,bv,"mark")}}},queue:function(bv,e,bx){var bw;if(bv){e=(e||"fx")+"queue";bw=b._data(bv,e);if(bx){if(!bw||b.isArray(bx)){bw=b._data(bv,e,b.makeArray(bx))}else{bw.push(bx)}}return bw||[]}},dequeue:function(by,bx){bx=bx||"fx";var bv=b.queue(by,bx),bw=bv.shift(),e={};if(bw==="inprogress"){bw=bv.shift()}if(bw){if(bx==="fx"){bv.unshift("inprogress")}b._data(by,bx+".run",e);bw.call(by,function(){b.dequeue(by,bx)},e)}if(!bv.length){b.removeData(by,bx+"queue "+bx+".run",true);bj(by,bx,"queue")}}});b.fn.extend({queue:function(e,bv){var bw=2;if(typeof e!=="string"){bv=e;e="fx";bw--}if(arguments.length<bw){return b.queue(this[0],e)}return bv===L?this:this.each(function(){var bx=b.queue(this,e,bv);if(e==="fx"&&bx[0]!=="inprogress"){b.dequeue(this,e)}})},dequeue:function(e){return this.each(function(){b.dequeue(this,e)})},delay:function(bv,e){bv=b.fx?b.fx.speeds[bv]||bv:bv;e=e||"fx";return this.queue(e,function(bx,bw){var by=setTimeout(bx,bv);bw.stop=function(){clearTimeout(by)}})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(bD,bw){if(typeof bD!=="string"){bw=bD;bD=L}bD=bD||"fx";var e=b.Deferred(),bv=this,by=bv.length,bB=1,bz=bD+"defer",bA=bD+"queue",bC=bD+"mark",bx;function bE(){if(!(--bB)){e.resolveWith(bv,[bv])}}while(by--){if((bx=b.data(bv[by],bz,L,true)||(b.data(bv[by],bA,L,true)||b.data(bv[by],bC,L,true))&&b.data(bv[by],bz,b.Callbacks("once memory"),true))){bB++;bx.add(bE)}}bE();return e.promise(bw)}});var aQ=/[\n\t\r]/g,ag=/\s+/,aV=/\r/g,g=/^(?:button|input)$/i,C=/^(?:button|input|object|select|textarea)$/i,l=/^a(?:rea)?$/i,ao=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,E=b.support.getSetAttribute,bf,aZ,aG;b.fn.extend({attr:function(e,bv){return b.access(this,b.attr,e,bv,arguments.length>1)},removeAttr:function(e){return this.each(function(){b.removeAttr(this,e)})},prop:function(e,bv){return b.access(this,b.prop,e,bv,arguments.length>1)},removeProp:function(e){e=b.propFix[e]||e;return this.each(function(){try{this[e]=L;delete this[e]}catch(bv){}})},addClass:function(by){var bA,bw,bv,bx,bz,bB,e;if(b.isFunction(by)){return this.each(function(bC){b(this).addClass(by.call(this,bC,this.className))})}if(by&&typeof by==="string"){bA=by.split(ag);for(bw=0,bv=this.length;bw<bv;bw++){bx=this[bw];if(bx.nodeType===1){if(!bx.className&&bA.length===1){bx.className=by}else{bz=" "+bx.className+" ";for(bB=0,e=bA.length;bB<e;bB++){if(!~bz.indexOf(" "+bA[bB]+" ")){bz+=bA[bB]+" "}}bx.className=b.trim(bz)}}}}return this},removeClass:function(bz){var bA,bw,bv,by,bx,bB,e;if(b.isFunction(bz)){return this.each(function(bC){b(this).removeClass(bz.call(this,bC,this.className))})}if((bz&&typeof bz==="string")||bz===L){bA=(bz||"").split(ag);for(bw=0,bv=this.length;bw<bv;bw++){by=this[bw];if(by.nodeType===1&&by.className){if(bz){bx=(" "+by.className+" ").replace(aQ," ");for(bB=0,e=bA.length;bB<e;bB++){bx=bx.replace(" "+bA[bB]+" "," ")}by.className=b.trim(bx)}else{by.className=""}}}}return this},toggleClass:function(bx,bv){var bw=typeof bx,e=typeof bv==="boolean";if(b.isFunction(bx)){return this.each(function(by){b(this).toggleClass(bx.call(this,by,this.className,bv),bv)})}return this.each(function(){if(bw==="string"){var bA,bz=0,by=b(this),bB=bv,bC=bx.split(ag);while((bA=bC[bz++])){bB=e?bB:!by.hasClass(bA);by[bB?"addClass":"removeClass"](bA)}}else{if(bw==="undefined"||bw==="boolean"){if(this.className){b._data(this,"__className__",this.className)}this.className=this.className||bx===false?"":b._data(this,"__className__")||""}}})},hasClass:function(e){var bx=" "+e+" ",bw=0,bv=this.length;for(;bw<bv;bw++){if(this[bw].nodeType===1&&(" "+this[bw].className+" ").replace(aQ," ").indexOf(bx)>-1){return true}}return false},val:function(bx){var e,bv,by,bw=this[0];if(!arguments.length){if(bw){e=b.valHooks[bw.type]||b.valHooks[bw.nodeName.toLowerCase()];if(e&&"get" in e&&(bv=e.get(bw,"value"))!==L){return bv}bv=bw.value;return typeof bv==="string"?bv.replace(aV,""):bv==null?"":bv}return}by=b.isFunction(bx);return this.each(function(bA){var bz=b(this),bB;if(this.nodeType!==1){return}if(by){bB=bx.call(this,bA,bz.val())}else{bB=bx}if(bB==null){bB=""}else{if(typeof bB==="number"){bB+=""}else{if(b.isArray(bB)){bB=b.map(bB,function(bC){return bC==null?"":bC+""})}}}e=b.valHooks[this.type]||b.valHooks[this.nodeName.toLowerCase()];if(!e||!("set" in e)||e.set(this,bB,"value")===L){this.value=bB}})}});b.extend({valHooks:{option:{get:function(e){var bv=e.attributes.value;return !bv||bv.specified?e.value:e.text}},select:{get:function(e){var bA,bv,bz,bx,by=e.selectedIndex,bB=[],bC=e.options,bw=e.type==="select-one";if(by<0){return null}bv=bw?by:0;bz=bw?by+1:bC.length;for(;bv<bz;bv++){bx=bC[bv];if(bx.selected&&(b.support.optDisabled?!bx.disabled:bx.getAttribute("disabled")===null)&&(!bx.parentNode.disabled||!b.nodeName(bx.parentNode,"optgroup"))){bA=b(bx).val();if(bw){return bA}bB.push(bA)}}if(bw&&!bB.length&&bC.length){return b(bC[by]).val()}return bB},set:function(bv,bw){var e=b.makeArray(bw);b(bv).find("option").each(function(){this.selected=b.inArray(b(this).val(),e)>=0});if(!e.length){bv.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(bA,bx,bB,bz){var bw,e,by,bv=bA.nodeType;if(!bA||bv===3||bv===8||bv===2){return}if(bz&&bx in b.attrFn){return b(bA)[bx](bB)}if(typeof bA.getAttribute==="undefined"){return b.prop(bA,bx,bB)}by=bv!==1||!b.isXMLDoc(bA);if(by){bx=bx.toLowerCase();e=b.attrHooks[bx]||(ao.test(bx)?aZ:bf)}if(bB!==L){if(bB===null){b.removeAttr(bA,bx);return}else{if(e&&"set" in e&&by&&(bw=e.set(bA,bB,bx))!==L){return bw}else{bA.setAttribute(bx,""+bB);return bB}}}else{if(e&&"get" in e&&by&&(bw=e.get(bA,bx))!==null){return bw}else{bw=bA.getAttribute(bx);return bw===null?L:bw}}},removeAttr:function(by,bA){var bz,bB,bw,e,bv,bx=0;if(bA&&by.nodeType===1){bB=bA.toLowerCase().split(ag);e=bB.length;for(;bx<e;bx++){bw=bB[bx];if(bw){bz=b.propFix[bw]||bw;bv=ao.test(bw);if(!bv){b.attr(by,bw,"")}by.removeAttribute(E?bw:bz);if(bv&&bz in by){by[bz]=false}}}}},attrHooks:{type:{set:function(e,bv){if(g.test(e.nodeName)&&e.parentNode){b.error("type property can't be changed")}else{if(!b.support.radioValue&&bv==="radio"&&b.nodeName(e,"input")){var bw=e.value;e.setAttribute("type",bv);if(bw){e.value=bw}return bv}}}},value:{get:function(bv,e){if(bf&&b.nodeName(bv,"button")){return bf.get(bv,e)}return e in bv?bv.value:null},set:function(bv,bw,e){if(bf&&b.nodeName(bv,"button")){return bf.set(bv,bw,e)}bv.value=bw}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(bz,bx,bA){var bw,e,by,bv=bz.nodeType;if(!bz||bv===3||bv===8||bv===2){return}by=bv!==1||!b.isXMLDoc(bz);if(by){bx=b.propFix[bx]||bx;e=b.propHooks[bx]}if(bA!==L){if(e&&"set" in e&&(bw=e.set(bz,bA,bx))!==L){return bw}else{return(bz[bx]=bA)}}else{if(e&&"get" in e&&(bw=e.get(bz,bx))!==null){return bw}else{return bz[bx]}}},propHooks:{tabIndex:{get:function(bv){var e=bv.getAttributeNode("tabindex");return e&&e.specified?parseInt(e.value,10):C.test(bv.nodeName)||l.test(bv.nodeName)&&bv.href?0:L}}}});b.attrHooks.tabindex=b.propHooks.tabIndex;aZ={get:function(bv,e){var bx,bw=b.prop(bv,e);return bw===true||typeof bw!=="boolean"&&(bx=bv.getAttributeNode(e))&&bx.nodeValue!==false?e.toLowerCase():L},set:function(bv,bx,e){var bw;if(bx===false){b.removeAttr(bv,e)}else{bw=b.propFix[e]||e;if(bw in bv){bv[bw]=true}bv.setAttribute(e,e.toLowerCase())}return e}};if(!E){aG={name:true,id:true,coords:true};bf=b.valHooks.button={get:function(bw,bv){var e;e=bw.getAttributeNode(bv);return e&&(aG[bv]?e.nodeValue!=="":e.specified)?e.nodeValue:L},set:function(bw,bx,bv){var e=bw.getAttributeNode(bv);if(!e){e=av.createAttribute(bv);bw.setAttributeNode(e)}return(e.nodeValue=bx+"")}};b.attrHooks.tabindex.set=bf.set;b.each(["width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{set:function(bw,bx){if(bx===""){bw.setAttribute(e,"auto");return bx}}})});b.attrHooks.contenteditable={get:bf.get,set:function(bv,bw,e){if(bw===""){bw="false"}bf.set(bv,bw,e)}}}if(!b.support.hrefNormalized){b.each(["href","src","width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{get:function(bx){var bw=bx.getAttribute(e,2);return bw===null?L:bw}})})}if(!b.support.style){b.attrHooks.style={get:function(e){return e.style.cssText.toLowerCase()||L},set:function(e,bv){return(e.style.cssText=""+bv)}}}if(!b.support.optSelected){b.propHooks.selected=b.extend(b.propHooks.selected,{get:function(bv){var e=bv.parentNode;if(e){e.selectedIndex;if(e.parentNode){e.parentNode.selectedIndex}}return null}})}if(!b.support.enctype){b.propFix.enctype="encoding"}if(!b.support.checkOn){b.each(["radio","checkbox"],function(){b.valHooks[this]={get:function(e){return e.getAttribute("value")===null?"on":e.value}}})}b.each(["radio","checkbox"],function(){b.valHooks[this]=b.extend(b.valHooks[this],{set:function(e,bv){if(b.isArray(bv)){return(e.checked=b.inArray(b(e).val(),bv)>=0)}}})});var be=/^(?:textarea|input|select)$/i,n=/^([^\.]*)?(?:\.(.+))?$/,J=/(?:^|\s)hover(\.\S+)?\b/,aP=/^key/,bg=/^(?:mouse|contextmenu)|click/,T=/^(?:focusinfocus|focusoutblur)$/,U=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,Y=function(e){var bv=U.exec(e);if(bv){bv[1]=(bv[1]||"").toLowerCase();bv[3]=bv[3]&&new RegExp("(?:^|\\s)"+bv[3]+"(?:\\s|$)")}return bv},j=function(bw,e){var bv=bw.attributes||{};return((!e[1]||bw.nodeName.toLowerCase()===e[1])&&(!e[2]||(bv.id||{}).value===e[2])&&(!e[3]||e[3].test((bv["class"]||{}).value)))},bt=function(e){return b.event.special.hover?e:e.replace(J,"mouseenter$1 mouseleave$1")};b.event={add:function(bx,bC,bJ,bA,by){var bD,bB,bK,bI,bH,bF,e,bG,bv,bz,bw,bE;if(bx.nodeType===3||bx.nodeType===8||!bC||!bJ||!(bD=b._data(bx))){return}if(bJ.handler){bv=bJ;bJ=bv.handler;by=bv.selector}if(!bJ.guid){bJ.guid=b.guid++}bK=bD.events;if(!bK){bD.events=bK={}}bB=bD.handle;if(!bB){bD.handle=bB=function(bL){return typeof b!=="undefined"&&(!bL||b.event.triggered!==bL.type)?b.event.dispatch.apply(bB.elem,arguments):L};bB.elem=bx}bC=b.trim(bt(bC)).split(" ");for(bI=0;bI<bC.length;bI++){bH=n.exec(bC[bI])||[];bF=bH[1];e=(bH[2]||"").split(".").sort();bE=b.event.special[bF]||{};bF=(by?bE.delegateType:bE.bindType)||bF;bE=b.event.special[bF]||{};bG=b.extend({type:bF,origType:bH[1],data:bA,handler:bJ,guid:bJ.guid,selector:by,quick:by&&Y(by),namespace:e.join(".")},bv);bw=bK[bF];if(!bw){bw=bK[bF]=[];bw.delegateCount=0;if(!bE.setup||bE.setup.call(bx,bA,e,bB)===false){if(bx.addEventListener){bx.addEventListener(bF,bB,false)}else{if(bx.attachEvent){bx.attachEvent("on"+bF,bB)}}}}if(bE.add){bE.add.call(bx,bG);if(!bG.handler.guid){bG.handler.guid=bJ.guid}}if(by){bw.splice(bw.delegateCount++,0,bG)}else{bw.push(bG)}b.event.global[bF]=true}bx=null},global:{},remove:function(bJ,bE,bv,bH,bB){var bI=b.hasData(bJ)&&b._data(bJ),bF,bx,bz,bL,bC,bA,bG,bw,by,bK,bD,e;if(!bI||!(bw=bI.events)){return}bE=b.trim(bt(bE||"")).split(" ");for(bF=0;bF<bE.length;bF++){bx=n.exec(bE[bF])||[];bz=bL=bx[1];bC=bx[2];if(!bz){for(bz in bw){b.event.remove(bJ,bz+bE[bF],bv,bH,true)}continue}by=b.event.special[bz]||{};bz=(bH?by.delegateType:by.bindType)||bz;bD=bw[bz]||[];bA=bD.length;bC=bC?new RegExp("(^|\\.)"+bC.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(bG=0;bG<bD.length;bG++){e=bD[bG];if((bB||bL===e.origType)&&(!bv||bv.guid===e.guid)&&(!bC||bC.test(e.namespace))&&(!bH||bH===e.selector||bH==="**"&&e.selector)){bD.splice(bG--,1);if(e.selector){bD.delegateCount--}if(by.remove){by.remove.call(bJ,e)}}}if(bD.length===0&&bA!==bD.length){if(!by.teardown||by.teardown.call(bJ,bC)===false){b.removeEvent(bJ,bz,bI.handle)}delete bw[bz]}}if(b.isEmptyObject(bw)){bK=bI.handle;if(bK){bK.elem=null}b.removeData(bJ,["events","handle"],true)}},customEvent:{getData:true,setData:true,changeData:true},trigger:function(bv,bD,bA,bJ){if(bA&&(bA.nodeType===3||bA.nodeType===8)){return}var bG=bv.type||bv,bx=[],e,bw,bC,bH,bz,by,bF,bE,bB,bI;if(T.test(bG+b.event.triggered)){return}if(bG.indexOf("!")>=0){bG=bG.slice(0,-1);bw=true}if(bG.indexOf(".")>=0){bx=bG.split(".");bG=bx.shift();bx.sort()}if((!bA||b.event.customEvent[bG])&&!b.event.global[bG]){return}bv=typeof bv==="object"?bv[b.expando]?bv:new b.Event(bG,bv):new b.Event(bG);bv.type=bG;bv.isTrigger=true;bv.exclusive=bw;bv.namespace=bx.join(".");bv.namespace_re=bv.namespace?new RegExp("(^|\\.)"+bx.join("\\.(?:.*\\.)?")+"(\\.|$)"):null;by=bG.indexOf(":")<0?"on"+bG:"";if(!bA){e=b.cache;for(bC in e){if(e[bC].events&&e[bC].events[bG]){b.event.trigger(bv,bD,e[bC].handle.elem,true)}}return}bv.result=L;if(!bv.target){bv.target=bA}bD=bD!=null?b.makeArray(bD):[];bD.unshift(bv);bF=b.event.special[bG]||{};if(bF.trigger&&bF.trigger.apply(bA,bD)===false){return}bB=[[bA,bF.bindType||bG]];if(!bJ&&!bF.noBubble&&!b.isWindow(bA)){bI=bF.delegateType||bG;bH=T.test(bI+bG)?bA:bA.parentNode;bz=null;for(;bH;bH=bH.parentNode){bB.push([bH,bI]);bz=bH}if(bz&&bz===bA.ownerDocument){bB.push([bz.defaultView||bz.parentWindow||bd,bI])}}for(bC=0;bC<bB.length&&!bv.isPropagationStopped();bC++){bH=bB[bC][0];bv.type=bB[bC][1];bE=(b._data(bH,"events")||{})[bv.type]&&b._data(bH,"handle");if(bE){bE.apply(bH,bD)}bE=by&&bH[by];if(bE&&b.acceptData(bH)&&bE.apply(bH,bD)===false){bv.preventDefault()}}bv.type=bG;if(!bJ&&!bv.isDefaultPrevented()){if((!bF._default||bF._default.apply(bA.ownerDocument,bD)===false)&&!(bG==="click"&&b.nodeName(bA,"a"))&&b.acceptData(bA)){if(by&&bA[bG]&&((bG!=="focus"&&bG!=="blur")||bv.target.offsetWidth!==0)&&!b.isWindow(bA)){bz=bA[by];if(bz){bA[by]=null}b.event.triggered=bG;bA[bG]();b.event.triggered=L;if(bz){bA[by]=bz}}}}return bv.result},dispatch:function(bH){bH=b.event.fix(bH||bd.event);var bD=((b._data(this,"events")||{})[bH.type]||[]),bC=bD.delegateCount,bx=[].slice.call(arguments,0),bE=!bH.exclusive&&!bH.namespace,bz=b.event.special[bH.type]||{},bv=[],bJ,bG,by,bA,bK,bI,bB,bw,e,bF,bL;bx[0]=bH;bH.delegateTarget=this;if(bz.preDispatch&&bz.preDispatch.call(this,bH)===false){return}if(bC&&!(bH.button&&bH.type==="click")){bA=b(this);bA.context=this.ownerDocument||this;for(by=bH.target;by!=this;by=by.parentNode||this){if(by.disabled!==true){bI={};bw=[];bA[0]=by;for(bJ=0;bJ<bC;bJ++){e=bD[bJ];bF=e.selector;if(bI[bF]===L){bI[bF]=(e.quick?j(by,e.quick):bA.is(bF))}if(bI[bF]){bw.push(e)}}if(bw.length){bv.push({elem:by,matches:bw})}}}}if(bD.length>bC){bv.push({elem:this,matches:bD.slice(bC)})}for(bJ=0;bJ<bv.length&&!bH.isPropagationStopped();bJ++){bB=bv[bJ];bH.currentTarget=bB.elem;for(bG=0;bG<bB.matches.length&&!bH.isImmediatePropagationStopped();bG++){e=bB.matches[bG];if(bE||(!bH.namespace&&!e.namespace)||bH.namespace_re&&bH.namespace_re.test(e.namespace)){bH.data=e.data;bH.handleObj=e;bK=((b.event.special[e.origType]||{}).handle||e.handler).apply(bB.elem,bx);if(bK!==L){bH.result=bK;if(bK===false){bH.preventDefault();bH.stopPropagation()}}}}}if(bz.postDispatch){bz.postDispatch.call(this,bH)}return bH.result},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(bv,e){if(bv.which==null){bv.which=e.charCode!=null?e.charCode:e.keyCode}return bv}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(bx,bw){var by,bz,e,bv=bw.button,bA=bw.fromElement;if(bx.pageX==null&&bw.clientX!=null){by=bx.target.ownerDocument||av;bz=by.documentElement;e=by.body;bx.pageX=bw.clientX+(bz&&bz.scrollLeft||e&&e.scrollLeft||0)-(bz&&bz.clientLeft||e&&e.clientLeft||0);bx.pageY=bw.clientY+(bz&&bz.scrollTop||e&&e.scrollTop||0)-(bz&&bz.clientTop||e&&e.clientTop||0)}if(!bx.relatedTarget&&bA){bx.relatedTarget=bA===bx.target?bw.toElement:bA}if(!bx.which&&bv!==L){bx.which=(bv&1?1:(bv&2?3:(bv&4?2:0)))}return bx}},fix:function(bw){if(bw[b.expando]){return bw}var bv,bz,e=bw,bx=b.event.fixHooks[bw.type]||{},by=bx.props?this.props.concat(bx.props):this.props;bw=b.Event(e);for(bv=by.length;bv;){bz=by[--bv];bw[bz]=e[bz]}if(!bw.target){bw.target=e.srcElement||av}if(bw.target.nodeType===3){bw.target=bw.target.parentNode}if(bw.metaKey===L){bw.metaKey=bw.ctrlKey}return bx.filter?bx.filter(bw,e):bw},special:{ready:{setup:b.bindReady},load:{noBubble:true},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(bw,bv,e){if(b.isWindow(this)){this.onbeforeunload=e}},teardown:function(bv,e){if(this.onbeforeunload===e){this.onbeforeunload=null}}}},simulate:function(bw,by,bx,bv){var bz=b.extend(new b.Event(),bx,{type:bw,isSimulated:true,originalEvent:{}});if(bv){b.event.trigger(bz,null,by)}else{b.event.dispatch.call(by,bz)}if(bz.isDefaultPrevented()){bx.preventDefault()}}};b.event.handle=b.event.dispatch;b.removeEvent=av.removeEventListener?function(bv,e,bw){if(bv.removeEventListener){bv.removeEventListener(e,bw,false)}}:function(bv,e,bw){if(bv.detachEvent){bv.detachEvent("on"+e,bw)}};b.Event=function(bv,e){if(!(this instanceof b.Event)){return new b.Event(bv,e)}if(bv&&bv.type){this.originalEvent=bv;this.type=bv.type;this.isDefaultPrevented=(bv.defaultPrevented||bv.returnValue===false||bv.getPreventDefault&&bv.getPreventDefault())?i:bl}else{this.type=bv}if(e){b.extend(this,e)}this.timeStamp=bv&&bv.timeStamp||b.now();this[b.expando]=true};function bl(){return false}function i(){return true}b.Event.prototype={preventDefault:function(){this.isDefaultPrevented=i;var bv=this.originalEvent;if(!bv){return}if(bv.preventDefault){bv.preventDefault()}else{bv.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=i;var bv=this.originalEvent;if(!bv){return}if(bv.stopPropagation){bv.stopPropagation()}bv.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=i;this.stopPropagation()},isDefaultPrevented:bl,isPropagationStopped:bl,isImmediatePropagationStopped:bl};b.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(bv,e){b.event.special[bv]={delegateType:e,bindType:e,handle:function(bz){var bB=this,bA=bz.relatedTarget,by=bz.handleObj,bw=by.selector,bx;if(!bA||(bA!==bB&&!b.contains(bB,bA))){bz.type=by.origType;bx=by.handler.apply(this,arguments);bz.type=e}return bx}}});if(!b.support.submitBubbles){b.event.special.submit={setup:function(){if(b.nodeName(this,"form")){return false}b.event.add(this,"click._submit keypress._submit",function(bx){var bw=bx.target,bv=b.nodeName(bw,"input")||b.nodeName(bw,"button")?bw.form:L;if(bv&&!bv._submit_attached){b.event.add(bv,"submit._submit",function(e){e._submit_bubble=true});bv._submit_attached=true}})},postDispatch:function(e){if(e._submit_bubble){delete e._submit_bubble;if(this.parentNode&&!e.isTrigger){b.event.simulate("submit",this.parentNode,e,true)}}},teardown:function(){if(b.nodeName(this,"form")){return false}b.event.remove(this,"._submit")}}}if(!b.support.changeBubbles){b.event.special.change={setup:function(){if(be.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio"){b.event.add(this,"propertychange._change",function(e){if(e.originalEvent.propertyName==="checked"){this._just_changed=true}});b.event.add(this,"click._change",function(e){if(this._just_changed&&!e.isTrigger){this._just_changed=false;b.event.simulate("change",this,e,true)}})}return false}b.event.add(this,"beforeactivate._change",function(bw){var bv=bw.target;if(be.test(bv.nodeName)&&!bv._change_attached){b.event.add(bv,"change._change",function(e){if(this.parentNode&&!e.isSimulated&&!e.isTrigger){b.event.simulate("change",this.parentNode,e,true)}});bv._change_attached=true}})},handle:function(bv){var e=bv.target;if(this!==e||bv.isSimulated||bv.isTrigger||(e.type!=="radio"&&e.type!=="checkbox")){return bv.handleObj.handler.apply(this,arguments)}},teardown:function(){b.event.remove(this,"._change");return be.test(this.nodeName)}}}if(!b.support.focusinBubbles){b.each({focus:"focusin",blur:"focusout"},function(bx,e){var bv=0,bw=function(by){b.event.simulate(e,by.target,b.event.fix(by),true)};b.event.special[e]={setup:function(){if(bv++===0){av.addEventListener(bx,bw,true)}},teardown:function(){if(--bv===0){av.removeEventListener(bx,bw,true)}}}})}b.fn.extend({on:function(bw,e,bz,by,bv){var bA,bx;if(typeof bw==="object"){if(typeof e!=="string"){bz=bz||e;e=L}for(bx in bw){this.on(bx,e,bz,bw[bx],bv)}return this}if(bz==null&&by==null){by=e;bz=e=L}else{if(by==null){if(typeof e==="string"){by=bz;bz=L}else{by=bz;bz=e;e=L}}}if(by===false){by=bl}else{if(!by){return this}}if(bv===1){bA=by;by=function(bB){b().off(bB);return bA.apply(this,arguments)};by.guid=bA.guid||(bA.guid=b.guid++)}return this.each(function(){b.event.add(this,bw,by,bz,e)})},one:function(bv,e,bx,bw){return this.on(bv,e,bx,bw,1)},off:function(bw,e,by){if(bw&&bw.preventDefault&&bw.handleObj){var bv=bw.handleObj;b(bw.delegateTarget).off(bv.namespace?bv.origType+"."+bv.namespace:bv.origType,bv.selector,bv.handler);return this}if(typeof bw==="object"){for(var bx in bw){this.off(bx,e,bw[bx])}return this}if(e===false||typeof e==="function"){by=e;e=L}if(by===false){by=bl}return this.each(function(){b.event.remove(this,bw,by,e)})},bind:function(e,bw,bv){return this.on(e,null,bw,bv)},unbind:function(e,bv){return this.off(e,null,bv)},live:function(e,bw,bv){b(this.context).on(e,this.selector,bw,bv);return this},die:function(e,bv){b(this.context).off(e,this.selector||"**",bv);return this},delegate:function(e,bv,bx,bw){return this.on(bv,e,bx,bw)},undelegate:function(e,bv,bw){return arguments.length==1?this.off(e,"**"):this.off(bv,e,bw)},trigger:function(e,bv){return this.each(function(){b.event.trigger(e,bv,this)})},triggerHandler:function(e,bv){if(this[0]){return b.event.trigger(e,bv,this[0],true)}},toggle:function(bx){var bv=arguments,e=bx.guid||b.guid++,bw=0,by=function(bz){var bA=(b._data(this,"lastToggle"+bx.guid)||0)%bw;b._data(this,"lastToggle"+bx.guid,bA+1);bz.preventDefault();return bv[bA].apply(this,arguments)||false};by.guid=e;while(bw<bv.length){bv[bw++].guid=e}return this.click(by)},hover:function(e,bv){return this.mouseenter(e).mouseleave(bv||e)}});b.each(("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu").split(" "),function(bv,e){b.fn[e]=function(bx,bw){if(bw==null){bw=bx;bx=null}return arguments.length>0?this.on(e,null,bx,bw):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}if(aP.test(e)){b.event.fixHooks[e]=b.event.keyHooks}if(bg.test(e)){b.event.fixHooks[e]=b.event.mouseHooks}});
-/*!
- * Sizzle CSS Selector Engine
- * Copyright 2011, The Dojo Foundation
- * Released under the MIT, BSD, and GPL Licenses.
- * More information: http://sizzlejs.com/
- */
-(function(){var bH=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bC="sizcache"+(Math.random()+"").replace(".",""),bI=0,bL=Object.prototype.toString,bB=false,bA=true,bK=/\\/g,bO=/\r\n/g,bQ=/\W/;[0,0].sort(function(){bA=false;return 0});var by=function(bV,e,bY,bZ){bY=bY||[];e=e||av;var b1=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bV||typeof bV!=="string"){return bY}var bS,b3,b6,bR,b2,b5,b4,bX,bU=true,bT=by.isXML(e),bW=[],b0=bV;do{bH.exec("");bS=bH.exec(b0);if(bS){b0=bS[3];bW.push(bS[1]);if(bS[2]){bR=bS[3];break}}}while(bS);if(bW.length>1&&bD.exec(bV)){if(bW.length===2&&bE.relative[bW[0]]){b3=bM(bW[0]+bW[1],e,bZ)}else{b3=bE.relative[bW[0]]?[e]:by(bW.shift(),e);while(bW.length){bV=bW.shift();if(bE.relative[bV]){bV+=bW.shift()}b3=bM(bV,b3,bZ)}}}else{if(!bZ&&bW.length>1&&e.nodeType===9&&!bT&&bE.match.ID.test(bW[0])&&!bE.match.ID.test(bW[bW.length-1])){b2=by.find(bW.shift(),e,bT);e=b2.expr?by.filter(b2.expr,b2.set)[0]:b2.set[0]}if(e){b2=bZ?{expr:bW.pop(),set:bF(bZ)}:by.find(bW.pop(),bW.length===1&&(bW[0]==="~"||bW[0]==="+")&&e.parentNode?e.parentNode:e,bT);b3=b2.expr?by.filter(b2.expr,b2.set):b2.set;if(bW.length>0){b6=bF(b3)}else{bU=false}while(bW.length){b5=bW.pop();b4=b5;if(!bE.relative[b5]){b5=""}else{b4=bW.pop()}if(b4==null){b4=e}bE.relative[b5](b6,b4,bT)}}else{b6=bW=[]}}if(!b6){b6=b3}if(!b6){by.error(b5||bV)}if(bL.call(b6)==="[object Array]"){if(!bU){bY.push.apply(bY,b6)}else{if(e&&e.nodeType===1){for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&(b6[bX]===true||b6[bX].nodeType===1&&by.contains(e,b6[bX]))){bY.push(b3[bX])}}}else{for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&b6[bX].nodeType===1){bY.push(b3[bX])}}}}}else{bF(b6,bY)}if(bR){by(bR,b1,bY,bZ);by.uniqueSort(bY)}return bY};by.uniqueSort=function(bR){if(bJ){bB=bA;bR.sort(bJ);if(bB){for(var e=1;e<bR.length;e++){if(bR[e]===bR[e-1]){bR.splice(e--,1)}}}}return bR};by.matches=function(e,bR){return by(e,null,null,bR)};by.matchesSelector=function(e,bR){return by(bR,null,null,[e]).length>0};by.find=function(bX,e,bY){var bW,bS,bU,bT,bV,bR;if(!bX){return[]}for(bS=0,bU=bE.order.length;bS<bU;bS++){bV=bE.order[bS];if((bT=bE.leftMatch[bV].exec(bX))){bR=bT[1];bT.splice(1,1);if(bR.substr(bR.length-1)!=="\\"){bT[1]=(bT[1]||"").replace(bK,"");bW=bE.find[bV](bT,e,bY);if(bW!=null){bX=bX.replace(bE.match[bV],"");break}}}}if(!bW){bW=typeof e.getElementsByTagName!=="undefined"?e.getElementsByTagName("*"):[]}return{set:bW,expr:bX}};by.filter=function(b1,b0,b4,bU){var bW,e,bZ,b6,b3,bR,bT,bV,b2,bS=b1,b5=[],bY=b0,bX=b0&&b0[0]&&by.isXML(b0[0]);while(b1&&b0.length){for(bZ in bE.filter){if((bW=bE.leftMatch[bZ].exec(b1))!=null&&bW[2]){bR=bE.filter[bZ];bT=bW[1];e=false;bW.splice(1,1);if(bT.substr(bT.length-1)==="\\"){continue}if(bY===b5){b5=[]}if(bE.preFilter[bZ]){bW=bE.preFilter[bZ](bW,bY,b4,b5,bU,bX);if(!bW){e=b6=true}else{if(bW===true){continue}}}if(bW){for(bV=0;(b3=bY[bV])!=null;bV++){if(b3){b6=bR(b3,bW,bV,bY);b2=bU^b6;if(b4&&b6!=null){if(b2){e=true}else{bY[bV]=false}}else{if(b2){b5.push(b3);e=true}}}}}if(b6!==L){if(!b4){bY=b5}b1=b1.replace(bE.match[bZ],"");if(!e){return[]}break}}}if(b1===bS){if(e==null){by.error(b1)}else{break}}bS=b1}return bY};by.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)};var bw=by.getText=function(bU){var bS,bT,e=bU.nodeType,bR="";if(e){if(e===1||e===9||e===11){if(typeof bU.textContent==="string"){return bU.textContent}else{if(typeof bU.innerText==="string"){return bU.innerText.replace(bO,"")}else{for(bU=bU.firstChild;bU;bU=bU.nextSibling){bR+=bw(bU)}}}}else{if(e===3||e===4){return bU.nodeValue}}}else{for(bS=0;(bT=bU[bS]);bS++){if(bT.nodeType!==8){bR+=bw(bT)}}}return bR};var bE=by.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")},type:function(e){return e.getAttribute("type")}},relative:{"+":function(bW,bR){var bT=typeof bR==="string",bV=bT&&!bQ.test(bR),bX=bT&&!bV;if(bV){bR=bR.toLowerCase()}for(var bS=0,e=bW.length,bU;bS<e;bS++){if((bU=bW[bS])){while((bU=bU.previousSibling)&&bU.nodeType!==1){}bW[bS]=bX||bU&&bU.nodeName.toLowerCase()===bR?bU||false:bU===bR}}if(bX){by.filter(bR,bW,true)}},">":function(bW,bR){var bV,bU=typeof bR==="string",bS=0,e=bW.length;if(bU&&!bQ.test(bR)){bR=bR.toLowerCase();for(;bS<e;bS++){bV=bW[bS];if(bV){var bT=bV.parentNode;bW[bS]=bT.nodeName.toLowerCase()===bR?bT:false}}}else{for(;bS<e;bS++){bV=bW[bS];if(bV){bW[bS]=bU?bV.parentNode:bV.parentNode===bR}}if(bU){by.filter(bR,bW,true)}}},"":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("parentNode",bR,bS,bT,bU,bV)},"~":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("previousSibling",bR,bS,bT,bU,bV)}},find:{ID:function(bR,bS,bT){if(typeof bS.getElementById!=="undefined"&&!bT){var e=bS.getElementById(bR[1]);return e&&e.parentNode?[e]:[]}},NAME:function(bS,bV){if(typeof bV.getElementsByName!=="undefined"){var bR=[],bU=bV.getElementsByName(bS[1]);for(var bT=0,e=bU.length;bT<e;bT++){if(bU[bT].getAttribute("name")===bS[1]){bR.push(bU[bT])}}return bR.length===0?null:bR}},TAG:function(e,bR){if(typeof bR.getElementsByTagName!=="undefined"){return bR.getElementsByTagName(e[1])}}},preFilter:{CLASS:function(bT,bR,bS,e,bW,bX){bT=" "+bT[1].replace(bK,"")+" ";if(bX){return bT}for(var bU=0,bV;(bV=bR[bU])!=null;bU++){if(bV){if(bW^(bV.className&&(" "+bV.className+" ").replace(/[\t\n\r]/g," ").indexOf(bT)>=0)){if(!bS){e.push(bV)}}else{if(bS){bR[bU]=false}}}}return false},ID:function(e){return e[1].replace(bK,"")},TAG:function(bR,e){return bR[1].replace(bK,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){by.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bR=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bR[1]+(bR[2]||1))-0;e[3]=bR[3]-0}else{if(e[2]){by.error(e[0])}}e[0]=bI++;return e},ATTR:function(bU,bR,bS,e,bV,bW){var bT=bU[1]=bU[1].replace(bK,"");if(!bW&&bE.attrMap[bT]){bU[1]=bE.attrMap[bT]}bU[4]=(bU[4]||bU[5]||"").replace(bK,"");if(bU[2]==="~="){bU[4]=" "+bU[4]+" "}return bU},PSEUDO:function(bU,bR,bS,e,bV){if(bU[1]==="not"){if((bH.exec(bU[3])||"").length>1||/^\w/.test(bU[3])){bU[3]=by(bU[3],null,null,bR)}else{var bT=by.filter(bU[3],bR,bS,true^bV);if(!bS){e.push.apply(e,bT)}return false}}else{if(bE.match.POS.test(bU[0])||bE.match.CHILD.test(bU[0])){return true}}return bU},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bS,bR,e){return !!by(e[3],bS).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bS){var e=bS.getAttribute("type"),bR=bS.type;return bS.nodeName.toLowerCase()==="input"&&"text"===bR&&(e===bR||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bR.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bR.type},button:function(bR){var e=bR.nodeName.toLowerCase();return e==="input"&&"button"===bR.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bR,e){return e===0},last:function(bS,bR,e,bT){return bR===bT.length-1},even:function(bR,e){return e%2===0},odd:function(bR,e){return e%2===1},lt:function(bS,bR,e){return bR<e[3]-0},gt:function(bS,bR,e){return bR>e[3]-0},nth:function(bS,bR,e){return e[3]-0===bR},eq:function(bS,bR,e){return e[3]-0===bR}},filter:{PSEUDO:function(bS,bX,bW,bY){var e=bX[1],bR=bE.filters[e];if(bR){return bR(bS,bW,bX,bY)}else{if(e==="contains"){return(bS.textContent||bS.innerText||bw([bS])||"").indexOf(bX[3])>=0}else{if(e==="not"){var bT=bX[3];for(var bV=0,bU=bT.length;bV<bU;bV++){if(bT[bV]===bS){return false}}return true}else{by.error(e)}}}},CHILD:function(bS,bU){var bT,b0,bW,bZ,e,bV,bY,bX=bU[1],bR=bS;switch(bX){case"only":case"first":while((bR=bR.previousSibling)){if(bR.nodeType===1){return false}}if(bX==="first"){return true}bR=bS;case"last":while((bR=bR.nextSibling)){if(bR.nodeType===1){return false}}return true;case"nth":bT=bU[2];b0=bU[3];if(bT===1&&b0===0){return true}bW=bU[0];bZ=bS.parentNode;if(bZ&&(bZ[bC]!==bW||!bS.nodeIndex)){bV=0;for(bR=bZ.firstChild;bR;bR=bR.nextSibling){if(bR.nodeType===1){bR.nodeIndex=++bV}}bZ[bC]=bW}bY=bS.nodeIndex-b0;if(bT===0){return bY===0}else{return(bY%bT===0&&bY/bT>=0)}}},ID:function(bR,e){return bR.nodeType===1&&bR.getAttribute("id")===e},TAG:function(bR,e){return(e==="*"&&bR.nodeType===1)||!!bR.nodeName&&bR.nodeName.toLowerCase()===e},CLASS:function(bR,e){return(" "+(bR.className||bR.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bV,bT){var bS=bT[1],e=by.attr?by.attr(bV,bS):bE.attrHandle[bS]?bE.attrHandle[bS](bV):bV[bS]!=null?bV[bS]:bV.getAttribute(bS),bW=e+"",bU=bT[2],bR=bT[4];return e==null?bU==="!=":!bU&&by.attr?e!=null:bU==="="?bW===bR:bU==="*="?bW.indexOf(bR)>=0:bU==="~="?(" "+bW+" ").indexOf(bR)>=0:!bR?bW&&e!==false:bU==="!="?bW!==bR:bU==="^="?bW.indexOf(bR)===0:bU==="$="?bW.substr(bW.length-bR.length)===bR:bU==="|="?bW===bR||bW.substr(0,bR.length+1)===bR+"-":false},POS:function(bU,bR,bS,bV){var e=bR[2],bT=bE.setFilters[e];if(bT){return bT(bU,bS,bR,bV)}}}};var bD=bE.match.POS,bx=function(bR,e){return"\\"+(e-0+1)};for(var bz in bE.match){bE.match[bz]=new RegExp(bE.match[bz].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bE.leftMatch[bz]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bE.match[bz].source.replace(/\\(\d+)/g,bx))}bE.match.globalPOS=bD;var bF=function(bR,e){bR=Array.prototype.slice.call(bR,0);if(e){e.push.apply(e,bR);return e}return bR};try{Array.prototype.slice.call(av.documentElement.childNodes,0)[0].nodeType}catch(bP){bF=function(bU,bT){var bS=0,bR=bT||[];if(bL.call(bU)==="[object Array]"){Array.prototype.push.apply(bR,bU)}else{if(typeof bU.length==="number"){for(var e=bU.length;bS<e;bS++){bR.push(bU[bS])}}else{for(;bU[bS];bS++){bR.push(bU[bS])}}}return bR}}var bJ,bG;if(av.documentElement.compareDocumentPosition){bJ=function(bR,e){if(bR===e){bB=true;return 0}if(!bR.compareDocumentPosition||!e.compareDocumentPosition){return bR.compareDocumentPosition?-1:1}return bR.compareDocumentPosition(e)&4?-1:1}}else{bJ=function(bY,bX){if(bY===bX){bB=true;return 0}else{if(bY.sourceIndex&&bX.sourceIndex){return bY.sourceIndex-bX.sourceIndex}}var bV,bR,bS=[],e=[],bU=bY.parentNode,bW=bX.parentNode,bZ=bU;if(bU===bW){return bG(bY,bX)}else{if(!bU){return -1}else{if(!bW){return 1}}}while(bZ){bS.unshift(bZ);bZ=bZ.parentNode}bZ=bW;while(bZ){e.unshift(bZ);bZ=bZ.parentNode}bV=bS.length;bR=e.length;for(var bT=0;bT<bV&&bT<bR;bT++){if(bS[bT]!==e[bT]){return bG(bS[bT],e[bT])}}return bT===bV?bG(bY,e[bT],-1):bG(bS[bT],bX,1)};bG=function(bR,e,bS){if(bR===e){return bS}var bT=bR.nextSibling;while(bT){if(bT===e){return -1}bT=bT.nextSibling}return 1}}(function(){var bR=av.createElement("div"),bS="script"+(new Date()).getTime(),e=av.documentElement;bR.innerHTML="<a name='"+bS+"'/>";e.insertBefore(bR,e.firstChild);if(av.getElementById(bS)){bE.find.ID=function(bU,bV,bW){if(typeof bV.getElementById!=="undefined"&&!bW){var bT=bV.getElementById(bU[1]);return bT?bT.id===bU[1]||typeof bT.getAttributeNode!=="undefined"&&bT.getAttributeNode("id").nodeValue===bU[1]?[bT]:L:[]}};bE.filter.ID=function(bV,bT){var bU=typeof bV.getAttributeNode!=="undefined"&&bV.getAttributeNode("id");return bV.nodeType===1&&bU&&bU.nodeValue===bT}}e.removeChild(bR);e=bR=null})();(function(){var e=av.createElement("div");e.appendChild(av.createComment(""));if(e.getElementsByTagName("*").length>0){bE.find.TAG=function(bR,bV){var bU=bV.getElementsByTagName(bR[1]);if(bR[1]==="*"){var bT=[];for(var bS=0;bU[bS];bS++){if(bU[bS].nodeType===1){bT.push(bU[bS])}}bU=bT}return bU}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bE.attrHandle.href=function(bR){return bR.getAttribute("href",2)}}e=null})();if(av.querySelectorAll){(function(){var e=by,bT=av.createElement("div"),bS="__sizzle__";bT.innerHTML="<p class='TEST'></p>";if(bT.querySelectorAll&&bT.querySelectorAll(".TEST").length===0){return}by=function(b4,bV,bZ,b3){bV=bV||av;if(!b3&&!by.isXML(bV)){var b2=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b4);if(b2&&(bV.nodeType===1||bV.nodeType===9)){if(b2[1]){return bF(bV.getElementsByTagName(b4),bZ)}else{if(b2[2]&&bE.find.CLASS&&bV.getElementsByClassName){return bF(bV.getElementsByClassName(b2[2]),bZ)}}}if(bV.nodeType===9){if(b4==="body"&&bV.body){return bF([bV.body],bZ)}else{if(b2&&b2[3]){var bY=bV.getElementById(b2[3]);if(bY&&bY.parentNode){if(bY.id===b2[3]){return bF([bY],bZ)}}else{return bF([],bZ)}}}try{return bF(bV.querySelectorAll(b4),bZ)}catch(b0){}}else{if(bV.nodeType===1&&bV.nodeName.toLowerCase()!=="object"){var bW=bV,bX=bV.getAttribute("id"),bU=bX||bS,b6=bV.parentNode,b5=/^\s*[+~]/.test(b4);if(!bX){bV.setAttribute("id",bU)}else{bU=bU.replace(/'/g,"\\$&")}if(b5&&b6){bV=bV.parentNode}try{if(!b5||b6){return bF(bV.querySelectorAll("[id='"+bU+"'] "+b4),bZ)}}catch(b1){}finally{if(!bX){bW.removeAttribute("id")}}}}}return e(b4,bV,bZ,b3)};for(var bR in e){by[bR]=e[bR]}bT=null})()}(function(){var e=av.documentElement,bS=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bS){var bU=!bS.call(av.createElement("div"),"div"),bR=false;try{bS.call(av.documentElement,"[test!='']:sizzle")}catch(bT){bR=true}by.matchesSelector=function(bW,bY){bY=bY.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!by.isXML(bW)){try{if(bR||!bE.match.PSEUDO.test(bY)&&!/!=/.test(bY)){var bV=bS.call(bW,bY);if(bV||!bU||bW.document&&bW.document.nodeType!==11){return bV}}}catch(bX){}}return by(bY,null,null,[bW]).length>0}}})();(function(){var e=av.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bE.order.splice(1,0,"CLASS");bE.find.CLASS=function(bR,bS,bT){if(typeof bS.getElementsByClassName!=="undefined"&&!bT){return bS.getElementsByClassName(bR[1])}};e=null})();function bv(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1&&!bY){e[bC]=bV;e.sizset=bT}if(e.nodeName.toLowerCase()===bW){bU=e;break}e=e[bR]}bZ[bT]=bU}}}function bN(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1){if(!bY){e[bC]=bV;e.sizset=bT}if(typeof bW!=="string"){if(e===bW){bU=true;break}}else{if(by.filter(bW,[e]).length>0){bU=e;break}}}e=e[bR]}bZ[bT]=bU}}}if(av.documentElement.contains){by.contains=function(bR,e){return bR!==e&&(bR.contains?bR.contains(e):true)}}else{if(av.documentElement.compareDocumentPosition){by.contains=function(bR,e){return !!(bR.compareDocumentPosition(e)&16)}}else{by.contains=function(){return false}}}by.isXML=function(e){var bR=(e?e.ownerDocument||e:0).documentElement;return bR?bR.nodeName!=="HTML":false};var bM=function(bS,e,bW){var bV,bX=[],bU="",bY=e.nodeType?[e]:e;while((bV=bE.match.PSEUDO.exec(bS))){bU+=bV[0];bS=bS.replace(bE.match.PSEUDO,"")}bS=bE.relative[bS]?bS+"*":bS;for(var bT=0,bR=bY.length;bT<bR;bT++){by(bS,bY[bT],bX,bW)}return by.filter(bU,bX)};by.attr=b.attr;by.selectors.attrMap={};b.find=by;b.expr=by.selectors;b.expr[":"]=b.expr.filters;b.unique=by.uniqueSort;b.text=by.getText;b.isXMLDoc=by.isXML;b.contains=by.contains})();var ab=/Until$/,aq=/^(?:parents|prevUntil|prevAll)/,bb=/,/,bp=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,H=b.expr.match.globalPOS,ay={children:true,contents:true,next:true,prev:true};b.fn.extend({find:function(e){var bw=this,by,bv;if(typeof e!=="string"){return b(e).filter(function(){for(by=0,bv=bw.length;by<bv;by++){if(b.contains(bw[by],this)){return true}}})}var bx=this.pushStack("","find",e),bA,bB,bz;for(by=0,bv=this.length;by<bv;by++){bA=bx.length;b.find(e,this[by],bx);if(by>0){for(bB=bA;bB<bx.length;bB++){for(bz=0;bz<bA;bz++){if(bx[bz]===bx[bB]){bx.splice(bB--,1);break}}}}}return bx},has:function(bv){var e=b(bv);return this.filter(function(){for(var bx=0,bw=e.length;bx<bw;bx++){if(b.contains(this,e[bx])){return true}}})},not:function(e){return this.pushStack(aH(this,e,false),"not",e)},filter:function(e){return this.pushStack(aH(this,e,true),"filter",e)},is:function(e){return !!e&&(typeof e==="string"?H.test(e)?b(e,this.context).index(this[0])>=0:b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(by,bx){var bv=[],bw,e,bz=this[0];if(b.isArray(by)){var bB=1;while(bz&&bz.ownerDocument&&bz!==bx){for(bw=0;bw<by.length;bw++){if(b(bz).is(by[bw])){bv.push({selector:by[bw],elem:bz,level:bB})}}bz=bz.parentNode;bB++}return bv}var bA=H.test(by)||typeof by!=="string"?b(by,bx||this.context):0;for(bw=0,e=this.length;bw<e;bw++){bz=this[bw];while(bz){if(bA?bA.index(bz)>-1:b.find.matchesSelector(bz,by)){bv.push(bz);break}else{bz=bz.parentNode;if(!bz||!bz.ownerDocument||bz===bx||bz.nodeType===11){break}}}}bv=bv.length>1?b.unique(bv):bv;return this.pushStack(bv,"closest",by)},index:function(e){if(!e){return(this[0]&&this[0].parentNode)?this.prevAll().length:-1}if(typeof e==="string"){return b.inArray(this[0],b(e))}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bv){var bx=typeof e==="string"?b(e,bv):b.makeArray(e&&e.nodeType?[e]:e),bw=b.merge(this.get(),bx);return this.pushStack(B(bx[0])||B(bw[0])?bw:b.unique(bw))},andSelf:function(){return this.add(this.prevObject)}});function B(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bv){var e=bv.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bv,e,bw){return b.dir(bv,"parentNode",bw)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bv,e,bw){return b.dir(bv,"nextSibling",bw)},prevUntil:function(bv,e,bw){return b.dir(bv,"previousSibling",bw)},siblings:function(e){return b.sibling((e.parentNode||{}).firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bv){b.fn[e]=function(by,bw){var bx=b.map(this,bv,by);if(!ab.test(e)){bw=by}if(bw&&typeof bw==="string"){bx=b.filter(bw,bx)}bx=this.length>1&&!ay[e]?b.unique(bx):bx;if((this.length>1||bb.test(bw))&&aq.test(e)){bx=bx.reverse()}return this.pushStack(bx,e,P.call(arguments).join(","))}});b.extend({filter:function(bw,e,bv){if(bv){bw=":not("+bw+")"}return e.length===1?b.find.matchesSelector(e[0],bw)?[e[0]]:[]:b.find.matches(bw,e)},dir:function(bw,bv,by){var e=[],bx=bw[bv];while(bx&&bx.nodeType!==9&&(by===L||bx.nodeType!==1||!b(bx).is(by))){if(bx.nodeType===1){e.push(bx)}bx=bx[bv]}return e},nth:function(by,e,bw,bx){e=e||1;var bv=0;for(;by;by=by[bw]){if(by.nodeType===1&&++bv===e){break}}return by},sibling:function(bw,bv){var e=[];for(;bw;bw=bw.nextSibling){if(bw.nodeType===1&&bw!==bv){e.push(bw)}}return e}});function aH(bx,bw,e){bw=bw||0;if(b.isFunction(bw)){return b.grep(bx,function(bz,by){var bA=!!bw.call(bz,by,bz);return bA===e})}else{if(bw.nodeType){return b.grep(bx,function(bz,by){return(bz===bw)===e})}else{if(typeof bw==="string"){var bv=b.grep(bx,function(by){return by.nodeType===1});if(bp.test(bw)){return b.filter(bw,bv,!e)}else{bw=b.filter(bw,bv)}}}}return b.grep(bx,function(bz,by){return(b.inArray(bz,bw)>=0)===e})}function a(e){var bw=aS.split("|"),bv=e.createDocumentFragment();if(bv.createElement){while(bw.length){bv.createElement(bw.pop())}}return bv}var aS="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",ah=/ jQuery\d+="(?:\d+|null)"/g,ar=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,v=/<tbody/i,W=/<|&#?\w+;/,ae=/<(?:script|style)/i,O=/<(?:script|object|embed|option|style)/i,ai=new RegExp("<(?:"+aS+")[\\s/>]","i"),o=/checked\s*(?:[^=]|=\s*.checked.)/i,bn=/\/(java|ecma)script/i,aO=/^\s*<!(?:\[CDATA\[|\-\-)/,ax={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},ac=a(av);ax.optgroup=ax.option;ax.tbody=ax.tfoot=ax.colgroup=ax.caption=ax.thead;ax.th=ax.td;if(!b.support.htmlSerialize){ax._default=[1,"div<div>","</div>"]}b.fn.extend({text:function(e){return b.access(this,function(bv){return bv===L?b.text(this):this.empty().append((this[0]&&this[0].ownerDocument||av).createTextNode(bv))},null,e,arguments.length)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bw){b(this).wrapAll(e.call(this,bw))})}if(this[0]){var bv=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bv.insertBefore(this[0])}bv.map(function(){var bw=this;while(bw.firstChild&&bw.firstChild.nodeType===1){bw=bw.firstChild}return bw}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bv){b(this).wrapInner(e.call(this,bv))})}return this.each(function(){var bv=b(this),bw=bv.contents();if(bw.length){bw.wrapAll(e)}else{bv.append(e)}})},wrap:function(e){var bv=b.isFunction(e);return this.each(function(bw){b(this).wrapAll(bv?e.call(this,bw):e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this)})}else{if(arguments.length){var e=b.clean(arguments);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b.clean(arguments));return e}}},remove:function(e,bx){for(var bv=0,bw;(bw=this[bv])!=null;bv++){if(!e||b.filter(e,[bw]).length){if(!bx&&bw.nodeType===1){b.cleanData(bw.getElementsByTagName("*"));b.cleanData([bw])}if(bw.parentNode){bw.parentNode.removeChild(bw)}}}return this},empty:function(){for(var e=0,bv;(bv=this[e])!=null;e++){if(bv.nodeType===1){b.cleanData(bv.getElementsByTagName("*"))}while(bv.firstChild){bv.removeChild(bv.firstChild)}}return this},clone:function(bv,e){bv=bv==null?false:bv;e=e==null?bv:e;return this.map(function(){return b.clone(this,bv,e)})},html:function(e){return b.access(this,function(by){var bx=this[0]||{},bw=0,bv=this.length;if(by===L){return bx.nodeType===1?bx.innerHTML.replace(ah,""):null}if(typeof by==="string"&&!ae.test(by)&&(b.support.leadingWhitespace||!ar.test(by))&&!ax[(d.exec(by)||["",""])[1].toLowerCase()]){by=by.replace(R,"<$1></$2>");try{for(;bw<bv;bw++){bx=this[bw]||{};if(bx.nodeType===1){b.cleanData(bx.getElementsByTagName("*"));bx.innerHTML=by}}bx=0}catch(bz){}}if(bx){this.empty().append(by)}},null,e,arguments.length)},replaceWith:function(e){if(this[0]&&this[0].parentNode){if(b.isFunction(e)){return this.each(function(bx){var bw=b(this),bv=bw.html();bw.replaceWith(e.call(this,bx,bv))})}if(typeof e!=="string"){e=b(e).detach()}return this.each(function(){var bw=this.nextSibling,bv=this.parentNode;b(this).remove();if(bw){b(bw).before(e)}else{b(bv).append(e)}})}else{return this.length?this.pushStack(b(b.isFunction(e)?e():e),"replaceWith",e):this}},detach:function(e){return this.remove(e,true)},domManip:function(bB,bF,bE){var bx,by,bA,bD,bC=bB[0],bv=[];if(!b.support.checkClone&&arguments.length===3&&typeof bC==="string"&&o.test(bC)){return this.each(function(){b(this).domManip(bB,bF,bE,true)})}if(b.isFunction(bC)){return this.each(function(bH){var bG=b(this);bB[0]=bC.call(this,bH,bF?bG.html():L);bG.domManip(bB,bF,bE)})}if(this[0]){bD=bC&&bC.parentNode;if(b.support.parentNode&&bD&&bD.nodeType===11&&bD.childNodes.length===this.length){bx={fragment:bD}}else{bx=b.buildFragment(bB,this,bv)}bA=bx.fragment;if(bA.childNodes.length===1){by=bA=bA.firstChild}else{by=bA.firstChild}if(by){bF=bF&&b.nodeName(by,"tr");for(var bw=0,e=this.length,bz=e-1;bw<e;bw++){bE.call(bF?bc(this[bw],by):this[bw],bx.cacheable||(e>1&&bw<bz)?b.clone(bA,true,true):bA)}}if(bv.length){b.each(bv,function(bG,bH){if(bH.src){b.ajax({type:"GET",global:false,url:bH.src,async:false,dataType:"script"})}else{b.globalEval((bH.text||bH.textContent||bH.innerHTML||"").replace(aO,"/*$0*/"))}if(bH.parentNode){bH.parentNode.removeChild(bH)}})}}return this}});function bc(e,bv){return b.nodeName(e,"table")?(e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody"))):e}function s(bB,bv){if(bv.nodeType!==1||!b.hasData(bB)){return}var by,bx,e,bA=b._data(bB),bz=b._data(bv,bA),bw=bA.events;if(bw){delete bz.handle;bz.events={};for(by in bw){for(bx=0,e=bw[by].length;bx<e;bx++){b.event.add(bv,by,bw[by][bx])}}}if(bz.data){bz.data=b.extend({},bz.data)}}function aj(bv,e){var bw;if(e.nodeType!==1){return}if(e.clearAttributes){e.clearAttributes()}if(e.mergeAttributes){e.mergeAttributes(bv)}bw=e.nodeName.toLowerCase();if(bw==="object"){e.outerHTML=bv.outerHTML}else{if(bw==="input"&&(bv.type==="checkbox"||bv.type==="radio")){if(bv.checked){e.defaultChecked=e.checked=bv.checked}if(e.value!==bv.value){e.value=bv.value}}else{if(bw==="option"){e.selected=bv.defaultSelected}else{if(bw==="input"||bw==="textarea"){e.defaultValue=bv.defaultValue}else{if(bw==="script"&&e.text!==bv.text){e.text=bv.text}}}}}e.removeAttribute(b.expando);e.removeAttribute("_submit_attached");e.removeAttribute("_change_attached")}b.buildFragment=function(bz,bx,bv){var by,e,bw,bA,bB=bz[0];if(bx&&bx[0]){bA=bx[0].ownerDocument||bx[0]}if(!bA.createDocumentFragment){bA=av}if(bz.length===1&&typeof bB==="string"&&bB.length<512&&bA===av&&bB.charAt(0)==="<"&&!O.test(bB)&&(b.support.checkClone||!o.test(bB))&&(b.support.html5Clone||!ai.test(bB))){e=true;bw=b.fragments[bB];if(bw&&bw!==1){by=bw}}if(!by){by=bA.createDocumentFragment();b.clean(bz,bA,by,bv)}if(e){b.fragments[bB]=bw?by:1}return{fragment:by,cacheable:e}};b.fragments={};b.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,bv){b.fn[e]=function(bw){var bz=[],bC=b(bw),bB=this.length===1&&this[0].parentNode;if(bB&&bB.nodeType===11&&bB.childNodes.length===1&&bC.length===1){bC[bv](this[0]);return this}else{for(var bA=0,bx=bC.length;bA<bx;bA++){var by=(bA>0?this.clone(true):this).get();b(bC[bA])[bv](by);bz=bz.concat(by)}return this.pushStack(bz,e,bC.selector)}}});function bh(e){if(typeof e.getElementsByTagName!=="undefined"){return e.getElementsByTagName("*")}else{if(typeof e.querySelectorAll!=="undefined"){return e.querySelectorAll("*")}else{return[]}}}function az(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function D(e){var bv=(e.nodeName||"").toLowerCase();if(bv==="input"){az(e)}else{if(bv!=="script"&&typeof e.getElementsByTagName!=="undefined"){b.grep(e.getElementsByTagName("input"),az)}}}function am(e){var bv=av.createElement("div");ac.appendChild(bv);bv.innerHTML=e.outerHTML;return bv.firstChild}b.extend({clone:function(by,bA,bw){var e,bv,bx,bz=b.support.html5Clone||b.isXMLDoc(by)||!ai.test("<"+by.nodeName+">")?by.cloneNode(true):am(by);if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(by.nodeType===1||by.nodeType===11)&&!b.isXMLDoc(by)){aj(by,bz);e=bh(by);bv=bh(bz);for(bx=0;e[bx];++bx){if(bv[bx]){aj(e[bx],bv[bx])}}}if(bA){s(by,bz);if(bw){e=bh(by);bv=bh(bz);for(bx=0;e[bx];++bx){s(e[bx],bv[bx])}}}e=bv=null;return bz},clean:function(bI,bw,bv,bx){var bA,bH,bD,bJ=[];bw=bw||av;if(typeof bw.createElement==="undefined"){bw=bw.ownerDocument||bw[0]&&bw[0].ownerDocument||av}for(var bE=0,bG;(bG=bI[bE])!=null;bE++){if(typeof bG==="number"){bG+=""}if(!bG){continue}if(typeof bG==="string"){if(!W.test(bG)){bG=bw.createTextNode(bG)}else{bG=bG.replace(R,"<$1></$2>");var bN=(d.exec(bG)||["",""])[1].toLowerCase(),bz=ax[bN]||ax._default,bK=bz[0],bB=bw.createElement("div"),bL=ac.childNodes,bM;if(bw===av){ac.appendChild(bB)}else{a(bw).appendChild(bB)}bB.innerHTML=bz[1]+bG+bz[2];while(bK--){bB=bB.lastChild}if(!b.support.tbody){var by=v.test(bG),e=bN==="table"&&!by?bB.firstChild&&bB.firstChild.childNodes:bz[1]==="<table>"&&!by?bB.childNodes:[];for(bD=e.length-1;bD>=0;--bD){if(b.nodeName(e[bD],"tbody")&&!e[bD].childNodes.length){e[bD].parentNode.removeChild(e[bD])}}}if(!b.support.leadingWhitespace&&ar.test(bG)){bB.insertBefore(bw.createTextNode(ar.exec(bG)[0]),bB.firstChild)}bG=bB.childNodes;if(bB){bB.parentNode.removeChild(bB);if(bL.length>0){bM=bL[bL.length-1];if(bM&&bM.parentNode){bM.parentNode.removeChild(bM)}}}}}var bF;if(!b.support.appendChecked){if(bG[0]&&typeof(bF=bG.length)==="number"){for(bD=0;bD<bF;bD++){D(bG[bD])}}else{D(bG)}}if(bG.nodeType){bJ.push(bG)}else{bJ=b.merge(bJ,bG)}}if(bv){bA=function(bO){return !bO.type||bn.test(bO.type)};for(bE=0;bJ[bE];bE++){bH=bJ[bE];if(bx&&b.nodeName(bH,"script")&&(!bH.type||bn.test(bH.type))){bx.push(bH.parentNode?bH.parentNode.removeChild(bH):bH)}else{if(bH.nodeType===1){var bC=b.grep(bH.getElementsByTagName("script"),bA);bJ.splice.apply(bJ,[bE+1,0].concat(bC))}bv.appendChild(bH)}}}return bJ},cleanData:function(bv){var by,bw,e=b.cache,bB=b.event.special,bA=b.support.deleteExpando;for(var bz=0,bx;(bx=bv[bz])!=null;bz++){if(bx.nodeName&&b.noData[bx.nodeName.toLowerCase()]){continue}bw=bx[b.expando];if(bw){by=e[bw];if(by&&by.events){for(var bC in by.events){if(bB[bC]){b.event.remove(bx,bC)}else{b.removeEvent(bx,bC,by.handle)}}if(by.handle){by.handle.elem=null}}if(bA){delete bx[b.expando]}else{if(bx.removeAttribute){bx.removeAttribute(b.expando)}}delete e[bw]}}}});var al=/alpha\([^)]*\)/i,au=/opacity=([^)]*)/,y=/([A-Z]|^ms)/g,bo=/^[\-+]?(?:\d*\.)?\d+$/i,a1=/^-?(?:\d*\.)?\d+(?!px)[^\d\s]+$/i,I=/^([\-+])=([\-+.\de]+)/,aE=/^margin/,a9={position:"absolute",visibility:"hidden",display:"block"},G=["Top","Right","Bottom","Left"],Z,aJ,aY;b.fn.css=function(e,bv){return b.access(this,function(bx,bw,by){return by!==L?b.style(bx,bw,by):b.css(bx,bw)},e,bv,arguments.length>1)};b.extend({cssHooks:{opacity:{get:function(bw,bv){if(bv){var e=Z(bw,"opacity");return e===""?"1":e}else{return bw.style.opacity}}}},cssNumber:{fillOpacity:true,fontWeight:true,lineHeight:true,opacity:true,orphans:true,widows:true,zIndex:true,zoom:true},cssProps:{"float":b.support.cssFloat?"cssFloat":"styleFloat"},style:function(bx,bw,bD,by){if(!bx||bx.nodeType===3||bx.nodeType===8||!bx.style){return}var bB,bC,bz=b.camelCase(bw),bv=bx.style,bE=b.cssHooks[bz];bw=b.cssProps[bz]||bz;if(bD!==L){bC=typeof bD;if(bC==="string"&&(bB=I.exec(bD))){bD=(+(bB[1]+1)*+bB[2])+parseFloat(b.css(bx,bw));bC="number"}if(bD==null||bC==="number"&&isNaN(bD)){return}if(bC==="number"&&!b.cssNumber[bz]){bD+="px"}if(!bE||!("set" in bE)||(bD=bE.set(bx,bD))!==L){try{bv[bw]=bD}catch(bA){}}}else{if(bE&&"get" in bE&&(bB=bE.get(bx,false,by))!==L){return bB}return bv[bw]}},css:function(by,bx,bv){var bw,e;bx=b.camelCase(bx);e=b.cssHooks[bx];bx=b.cssProps[bx]||bx;if(bx==="cssFloat"){bx="float"}if(e&&"get" in e&&(bw=e.get(by,true,bv))!==L){return bw}else{if(Z){return Z(by,bx)}}},swap:function(by,bx,bz){var e={},bw,bv;for(bv in bx){e[bv]=by.style[bv];by.style[bv]=bx[bv]}bw=bz.call(by);for(bv in bx){by.style[bv]=e[bv]}return bw}});b.curCSS=b.css;if(av.defaultView&&av.defaultView.getComputedStyle){aJ=function(bA,bw){var bv,bz,e,by,bx=bA.style;bw=bw.replace(y,"-$1").toLowerCase();if((bz=bA.ownerDocument.defaultView)&&(e=bz.getComputedStyle(bA,null))){bv=e.getPropertyValue(bw);if(bv===""&&!b.contains(bA.ownerDocument.documentElement,bA)){bv=b.style(bA,bw)}}if(!b.support.pixelMargin&&e&&aE.test(bw)&&a1.test(bv)){by=bx.width;bx.width=bv;bv=e.width;bx.width=by}return bv}}if(av.documentElement.currentStyle){aY=function(bz,bw){var bA,e,by,bv=bz.currentStyle&&bz.currentStyle[bw],bx=bz.style;if(bv==null&&bx&&(by=bx[bw])){bv=by}if(a1.test(bv)){bA=bx.left;e=bz.runtimeStyle&&bz.runtimeStyle.left;if(e){bz.runtimeStyle.left=bz.currentStyle.left}bx.left=bw==="fontSize"?"1em":bv;bv=bx.pixelLeft+"px";bx.left=bA;if(e){bz.runtimeStyle.left=e}}return bv===""?"auto":bv}}Z=aJ||aY;function af(by,bw,bv){var bz=bw==="width"?by.offsetWidth:by.offsetHeight,bx=bw==="width"?1:0,e=4;if(bz>0){if(bv!=="border"){for(;bx<e;bx+=2){if(!bv){bz-=parseFloat(b.css(by,"padding"+G[bx]))||0}if(bv==="margin"){bz+=parseFloat(b.css(by,bv+G[bx]))||0}else{bz-=parseFloat(b.css(by,"border"+G[bx]+"Width"))||0}}}return bz+"px"}bz=Z(by,bw);if(bz<0||bz==null){bz=by.style[bw]}if(a1.test(bz)){return bz}bz=parseFloat(bz)||0;if(bv){for(;bx<e;bx+=2){bz+=parseFloat(b.css(by,"padding"+G[bx]))||0;if(bv!=="padding"){bz+=parseFloat(b.css(by,"border"+G[bx]+"Width"))||0}if(bv==="margin"){bz+=parseFloat(b.css(by,bv+G[bx]))||0}}}return bz+"px"}b.each(["height","width"],function(bv,e){b.cssHooks[e]={get:function(by,bx,bw){if(bx){if(by.offsetWidth!==0){return af(by,e,bw)}else{return b.swap(by,a9,function(){return af(by,e,bw)})}}},set:function(bw,bx){return bo.test(bx)?bx+"px":bx}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bv,e){return au.test((e&&bv.currentStyle?bv.currentStyle.filter:bv.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(by,bz){var bx=by.style,bv=by.currentStyle,e=b.isNumeric(bz)?"alpha(opacity="+bz*100+")":"",bw=bv&&bv.filter||bx.filter||"";bx.zoom=1;if(bz>=1&&b.trim(bw.replace(al,""))===""){bx.removeAttribute("filter");if(bv&&!bv.filter){return}}bx.filter=al.test(bw)?bw.replace(al,e):bw+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bv,e){return b.swap(bv,{display:"inline-block"},function(){if(e){return Z(bv,"margin-right")}else{return bv.style.marginRight}})}}}});if(b.expr&&b.expr.filters){b.expr.filters.hidden=function(bw){var bv=bw.offsetWidth,e=bw.offsetHeight;return(bv===0&&e===0)||(!b.support.reliableHiddenOffsets&&((bw.style&&bw.style.display)||b.css(bw,"display"))==="none")};b.expr.filters.visible=function(e){return !b.expr.filters.hidden(e)}}b.each({margin:"",padding:"",border:"Width"},function(e,bv){b.cssHooks[e+bv]={expand:function(by){var bx,bz=typeof by==="string"?by.split(" "):[by],bw={};for(bx=0;bx<4;bx++){bw[e+G[bx]+bv]=bz[bx]||bz[bx-2]||bz[0]}return bw}}});var k=/%20/g,ap=/\[\]$/,bs=/\r?\n/g,bq=/#.*$/,aD=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,a0=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,aN=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,aR=/^(?:GET|HEAD)$/,c=/^\/\//,M=/\?/,a7=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,p=/^(?:select|textarea)/i,h=/\s+/,br=/([?&])_=[^&]*/,K=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,z=b.fn.load,aa={},q={},aF,r,aW=["*/"]+["*"];try{aF=bm.href}catch(aw){aF=av.createElement("a");aF.href="";aF=aF.href}r=K.exec(aF.toLowerCase())||[];function f(e){return function(by,bA){if(typeof by!=="string"){bA=by;by="*"}if(b.isFunction(bA)){var bx=by.toLowerCase().split(h),bw=0,bz=bx.length,bv,bB,bC;for(;bw<bz;bw++){bv=bx[bw];bC=/^\+/.test(bv);if(bC){bv=bv.substr(1)||"*"}bB=e[bv]=e[bv]||[];bB[bC?"unshift":"push"](bA)}}}}function aX(bv,bE,bz,bD,bB,bx){bB=bB||bE.dataTypes[0];bx=bx||{};bx[bB]=true;var bA=bv[bB],bw=0,e=bA?bA.length:0,by=(bv===aa),bC;for(;bw<e&&(by||!bC);bw++){bC=bA[bw](bE,bz,bD);if(typeof bC==="string"){if(!by||bx[bC]){bC=L}else{bE.dataTypes.unshift(bC);bC=aX(bv,bE,bz,bD,bC,bx)}}}if((by||!bC)&&!bx["*"]){bC=aX(bv,bE,bz,bD,"*",bx)}return bC}function an(bw,bx){var bv,e,by=b.ajaxSettings.flatOptions||{};for(bv in bx){if(bx[bv]!==L){(by[bv]?bw:(e||(e={})))[bv]=bx[bv]}}if(e){b.extend(true,bw,e)}}b.fn.extend({load:function(bw,bz,bA){if(typeof bw!=="string"&&z){return z.apply(this,arguments)}else{if(!this.length){return this}}var by=bw.indexOf(" ");if(by>=0){var e=bw.slice(by,bw.length);bw=bw.slice(0,by)}var bx="GET";if(bz){if(b.isFunction(bz)){bA=bz;bz=L}else{if(typeof bz==="object"){bz=b.param(bz,b.ajaxSettings.traditional);bx="POST"}}}var bv=this;b.ajax({url:bw,type:bx,dataType:"html",data:bz,complete:function(bC,bB,bD){bD=bC.responseText;if(bC.isResolved()){bC.done(function(bE){bD=bE});bv.html(e?b("<div>").append(bD.replace(a7,"")).find(e):bD)}if(bA){bv.each(bA,[bD,bB,bC])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||p.test(this.nodeName)||a0.test(this.type))}).map(function(e,bv){var bw=b(this).val();return bw==null?null:b.isArray(bw)?b.map(bw,function(by,bx){return{name:bv.name,value:by.replace(bs,"\r\n")}}):{name:bv.name,value:bw.replace(bs,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bv){b.fn[bv]=function(bw){return this.on(bv,bw)}});b.each(["get","post"],function(e,bv){b[bv]=function(bw,by,bz,bx){if(b.isFunction(by)){bx=bx||bz;bz=by;by=L}return b.ajax({type:bv,url:bw,data:by,success:bz,dataType:bx})}});b.extend({getScript:function(e,bv){return b.get(e,L,bv,"script")},getJSON:function(e,bv,bw){return b.get(e,bv,bw,"json")},ajaxSetup:function(bv,e){if(e){an(bv,b.ajaxSettings)}else{e=bv;bv=b.ajaxSettings}an(bv,e);return bv},ajaxSettings:{url:aF,isLocal:aN.test(r[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":aW},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":bd.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML},flatOptions:{context:true,url:true}},ajaxPrefilter:f(aa),ajaxTransport:f(q),ajax:function(bz,bx){if(typeof bz==="object"){bx=bz;bz=L}bx=bx||{};var bD=b.ajaxSetup({},bx),bS=bD.context||bD,bG=bS!==bD&&(bS.nodeType||bS instanceof b)?b(bS):b.event,bR=b.Deferred(),bN=b.Callbacks("once memory"),bB=bD.statusCode||{},bC,bH={},bO={},bQ,by,bL,bE,bI,bA=0,bw,bK,bJ={readyState:0,setRequestHeader:function(bT,bU){if(!bA){var e=bT.toLowerCase();bT=bO[e]=bO[e]||bT;bH[bT]=bU}return this},getAllResponseHeaders:function(){return bA===2?bQ:null},getResponseHeader:function(bT){var e;if(bA===2){if(!by){by={};while((e=aD.exec(bQ))){by[e[1].toLowerCase()]=e[2]}}e=by[bT.toLowerCase()]}return e===L?null:e},overrideMimeType:function(e){if(!bA){bD.mimeType=e}return this},abort:function(e){e=e||"abort";if(bL){bL.abort(e)}bF(0,e);return this}};function bF(bZ,bU,b0,bW){if(bA===2){return}bA=2;if(bE){clearTimeout(bE)}bL=L;bQ=bW||"";bJ.readyState=bZ>0?4:0;var bT,b4,b3,bX=bU,bY=b0?bk(bD,bJ,b0):L,bV,b2;if(bZ>=200&&bZ<300||bZ===304){if(bD.ifModified){if((bV=bJ.getResponseHeader("Last-Modified"))){b.lastModified[bC]=bV}if((b2=bJ.getResponseHeader("Etag"))){b.etag[bC]=b2}}if(bZ===304){bX="notmodified";bT=true}else{try{b4=F(bD,bY);bX="success";bT=true}catch(b1){bX="parsererror";b3=b1}}}else{b3=bX;if(!bX||bZ){bX="error";if(bZ<0){bZ=0}}}bJ.status=bZ;bJ.statusText=""+(bU||bX);if(bT){bR.resolveWith(bS,[b4,bX,bJ])}else{bR.rejectWith(bS,[bJ,bX,b3])}bJ.statusCode(bB);bB=L;if(bw){bG.trigger("ajax"+(bT?"Success":"Error"),[bJ,bD,bT?b4:b3])}bN.fireWith(bS,[bJ,bX]);if(bw){bG.trigger("ajaxComplete",[bJ,bD]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bR.promise(bJ);bJ.success=bJ.done;bJ.error=bJ.fail;bJ.complete=bN.add;bJ.statusCode=function(bT){if(bT){var e;if(bA<2){for(e in bT){bB[e]=[bB[e],bT[e]]}}else{e=bT[bJ.status];bJ.then(e,e)}}return this};bD.url=((bz||bD.url)+"").replace(bq,"").replace(c,r[1]+"//");bD.dataTypes=b.trim(bD.dataType||"*").toLowerCase().split(h);if(bD.crossDomain==null){bI=K.exec(bD.url.toLowerCase());bD.crossDomain=!!(bI&&(bI[1]!=r[1]||bI[2]!=r[2]||(bI[3]||(bI[1]==="http:"?80:443))!=(r[3]||(r[1]==="http:"?80:443))))}if(bD.data&&bD.processData&&typeof bD.data!=="string"){bD.data=b.param(bD.data,bD.traditional)}aX(aa,bD,bx,bJ);if(bA===2){return false}bw=bD.global;bD.type=bD.type.toUpperCase();bD.hasContent=!aR.test(bD.type);if(bw&&b.active++===0){b.event.trigger("ajaxStart")}if(!bD.hasContent){if(bD.data){bD.url+=(M.test(bD.url)?"&":"?")+bD.data;delete bD.data}bC=bD.url;if(bD.cache===false){var bv=b.now(),bP=bD.url.replace(br,"$1_="+bv);bD.url=bP+((bP===bD.url)?(M.test(bD.url)?"&":"?")+"_="+bv:"")}}if(bD.data&&bD.hasContent&&bD.contentType!==false||bx.contentType){bJ.setRequestHeader("Content-Type",bD.contentType)}if(bD.ifModified){bC=bC||bD.url;if(b.lastModified[bC]){bJ.setRequestHeader("If-Modified-Since",b.lastModified[bC])}if(b.etag[bC]){bJ.setRequestHeader("If-None-Match",b.etag[bC])}}bJ.setRequestHeader("Accept",bD.dataTypes[0]&&bD.accepts[bD.dataTypes[0]]?bD.accepts[bD.dataTypes[0]]+(bD.dataTypes[0]!=="*"?", "+aW+"; q=0.01":""):bD.accepts["*"]);for(bK in bD.headers){bJ.setRequestHeader(bK,bD.headers[bK])}if(bD.beforeSend&&(bD.beforeSend.call(bS,bJ,bD)===false||bA===2)){bJ.abort();return false}for(bK in {success:1,error:1,complete:1}){bJ[bK](bD[bK])}bL=aX(q,bD,bx,bJ);if(!bL){bF(-1,"No Transport")}else{bJ.readyState=1;if(bw){bG.trigger("ajaxSend",[bJ,bD])}if(bD.async&&bD.timeout>0){bE=setTimeout(function(){bJ.abort("timeout")},bD.timeout)}try{bA=1;bL.send(bH,bF)}catch(bM){if(bA<2){bF(-1,bM)}else{throw bM}}}return bJ},param:function(e,bw){var bv=[],by=function(bz,bA){bA=b.isFunction(bA)?bA():bA;bv[bv.length]=encodeURIComponent(bz)+"="+encodeURIComponent(bA)};if(bw===L){bw=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){by(this.name,this.value)})}else{for(var bx in e){u(bx,e[bx],bw,by)}}return bv.join("&").replace(k,"+")}});function u(bw,by,bv,bx){if(b.isArray(by)){b.each(by,function(bA,bz){if(bv||ap.test(bw)){bx(bw,bz)}else{u(bw+"["+(typeof bz==="object"?bA:"")+"]",bz,bv,bx)}})}else{if(!bv&&b.type(by)==="object"){for(var e in by){u(bw+"["+e+"]",by[e],bv,bx)}}else{bx(bw,by)}}}b.extend({active:0,lastModified:{},etag:{}});function bk(bD,bC,bz){var bv=bD.contents,bB=bD.dataTypes,bw=bD.responseFields,by,bA,bx,e;for(bA in bw){if(bA in bz){bC[bw[bA]]=bz[bA]}}while(bB[0]==="*"){bB.shift();if(by===L){by=bD.mimeType||bC.getResponseHeader("content-type")}}if(by){for(bA in bv){if(bv[bA]&&bv[bA].test(by)){bB.unshift(bA);break}}}if(bB[0] in bz){bx=bB[0]}else{for(bA in bz){if(!bB[0]||bD.converters[bA+" "+bB[0]]){bx=bA;break}if(!e){e=bA}}bx=bx||e}if(bx){if(bx!==bB[0]){bB.unshift(bx)}return bz[bx]}}function F(bH,bz){if(bH.dataFilter){bz=bH.dataFilter(bz,bH.dataType)}var bD=bH.dataTypes,bG={},bA,bE,bw=bD.length,bB,bC=bD[0],bx,by,bF,bv,e;for(bA=1;bA<bw;bA++){if(bA===1){for(bE in bH.converters){if(typeof bE==="string"){bG[bE.toLowerCase()]=bH.converters[bE]}}}bx=bC;bC=bD[bA];if(bC==="*"){bC=bx}else{if(bx!=="*"&&bx!==bC){by=bx+" "+bC;bF=bG[by]||bG["* "+bC];if(!bF){e=L;for(bv in bG){bB=bv.split(" ");if(bB[0]===bx||bB[0]==="*"){e=bG[bB[1]+" "+bC];if(e){bv=bG[bv];if(bv===true){bF=e}else{if(e===true){bF=bv}}break}}}}if(!(bF||e)){b.error("No conversion from "+by.replace(" "," to "))}if(bF!==true){bz=bF?bF(bz):e(bv(bz))}}}}return bz}var aC=b.now(),t=/(\=)\?(&|$)|\?\?/i;b.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return b.expando+"_"+(aC++)}});b.ajaxPrefilter("json jsonp",function(bD,bA,bC){var bx=(typeof bD.data==="string")&&/^application\/x\-www\-form\-urlencoded/.test(bD.contentType);if(bD.dataTypes[0]==="jsonp"||bD.jsonp!==false&&(t.test(bD.url)||bx&&t.test(bD.data))){var bB,bw=bD.jsonpCallback=b.isFunction(bD.jsonpCallback)?bD.jsonpCallback():bD.jsonpCallback,bz=bd[bw],e=bD.url,by=bD.data,bv="$1"+bw+"$2";if(bD.jsonp!==false){e=e.replace(t,bv);if(bD.url===e){if(bx){by=by.replace(t,bv)}if(bD.data===by){e+=(/\?/.test(e)?"&":"?")+bD.jsonp+"="+bw}}}bD.url=e;bD.data=by;bd[bw]=function(bE){bB=[bE]};bC.always(function(){bd[bw]=bz;if(bB&&b.isFunction(bz)){bd[bw](bB[0])}});bD.converters["script json"]=function(){if(!bB){b.error(bw+" was not called")}return bB[0]};bD.dataTypes[0]="json";return"script"}});b.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){b.globalEval(e);return e}}});b.ajaxPrefilter("script",function(e){if(e.cache===L){e.cache=false}if(e.crossDomain){e.type="GET";e.global=false}});b.ajaxTransport("script",function(bw){if(bw.crossDomain){var e,bv=av.head||av.getElementsByTagName("head")[0]||av.documentElement;return{send:function(bx,by){e=av.createElement("script");e.async="async";if(bw.scriptCharset){e.charset=bw.scriptCharset}e.src=bw.url;e.onload=e.onreadystatechange=function(bA,bz){if(bz||!e.readyState||/loaded|complete/.test(e.readyState)){e.onload=e.onreadystatechange=null;if(bv&&e.parentNode){bv.removeChild(e)}e=L;if(!bz){by(200,"success")}}};bv.insertBefore(e,bv.firstChild)},abort:function(){if(e){e.onload(0,1)}}}}});var A=bd.ActiveXObject?function(){for(var e in N){N[e](0,1)}}:false,x=0,N;function aM(){try{return new bd.XMLHttpRequest()}catch(bv){}}function ak(){try{return new bd.ActiveXObject("Microsoft.XMLHTTP")}catch(bv){}}b.ajaxSettings.xhr=bd.ActiveXObject?function(){return !this.isLocal&&aM()||ak()}:aM;(function(e){b.extend(b.support,{ajax:!!e,cors:!!e&&("withCredentials" in e)})})(b.ajaxSettings.xhr());if(b.support.ajax){b.ajaxTransport(function(e){if(!e.crossDomain||b.support.cors){var bv;return{send:function(bB,bw){var bA=e.xhr(),bz,by;if(e.username){bA.open(e.type,e.url,e.async,e.username,e.password)}else{bA.open(e.type,e.url,e.async)}if(e.xhrFields){for(by in e.xhrFields){bA[by]=e.xhrFields[by]}}if(e.mimeType&&bA.overrideMimeType){bA.overrideMimeType(e.mimeType)}if(!e.crossDomain&&!bB["X-Requested-With"]){bB["X-Requested-With"]="XMLHttpRequest"}try{for(by in bB){bA.setRequestHeader(by,bB[by])}}catch(bx){}bA.send((e.hasContent&&e.data)||null);bv=function(bK,bE){var bF,bD,bC,bI,bH;try{if(bv&&(bE||bA.readyState===4)){bv=L;if(bz){bA.onreadystatechange=b.noop;if(A){delete N[bz]}}if(bE){if(bA.readyState!==4){bA.abort()}}else{bF=bA.status;bC=bA.getAllResponseHeaders();bI={};bH=bA.responseXML;if(bH&&bH.documentElement){bI.xml=bH}try{bI.text=bA.responseText}catch(bK){}try{bD=bA.statusText}catch(bJ){bD=""}if(!bF&&e.isLocal&&!e.crossDomain){bF=bI.text?200:404}else{if(bF===1223){bF=204}}}}}catch(bG){if(!bE){bw(-1,bG)}}if(bI){bw(bF,bD,bI,bC)}};if(!e.async||bA.readyState===4){bv()}else{bz=++x;if(A){if(!N){N={};b(bd).unload(A)}N[bz]=bv}bA.onreadystatechange=bv}},abort:function(){if(bv){bv(0,1)}}}}})}var Q={},ba,m,aB=/^(?:toggle|show|hide)$/,aU=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,a4,aI=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],a5;b.fn.extend({show:function(bx,bA,bz){var bw,by;if(bx||bx===0){return this.animate(a2("show",3),bx,bA,bz)}else{for(var bv=0,e=this.length;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(!b._data(bw,"olddisplay")&&by==="none"){by=bw.style.display=""}if((by===""&&b.css(bw,"display")==="none")||!b.contains(bw.ownerDocument.documentElement,bw)){b._data(bw,"olddisplay",w(bw.nodeName))}}}for(bv=0;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(by===""||by==="none"){bw.style.display=b._data(bw,"olddisplay")||""}}}return this}},hide:function(bx,bA,bz){if(bx||bx===0){return this.animate(a2("hide",3),bx,bA,bz)}else{var bw,by,bv=0,e=this.length;for(;bv<e;bv++){bw=this[bv];if(bw.style){by=b.css(bw,"display");if(by!=="none"&&!b._data(bw,"olddisplay")){b._data(bw,"olddisplay",by)}}}for(bv=0;bv<e;bv++){if(this[bv].style){this[bv].style.display="none"}}return this}},_toggle:b.fn.toggle,toggle:function(bw,bv,bx){var e=typeof bw==="boolean";if(b.isFunction(bw)&&b.isFunction(bv)){this._toggle.apply(this,arguments)}else{if(bw==null||e){this.each(function(){var by=e?bw:b(this).is(":hidden");b(this)[by?"show":"hide"]()})}else{this.animate(a2("toggle",3),bw,bv,bx)}}return this},fadeTo:function(e,bx,bw,bv){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:bx},e,bw,bv)},animate:function(bz,bw,by,bx){var e=b.speed(bw,by,bx);if(b.isEmptyObject(bz)){return this.each(e.complete,[false])}bz=b.extend({},bz);function bv(){if(e.queue===false){b._mark(this)}var bE=b.extend({},e),bL=this.nodeType===1,bJ=bL&&b(this).is(":hidden"),bB,bG,bD,bK,bN,bF,bI,bC,bH,bM,bA;bE.animatedProperties={};for(bD in bz){bB=b.camelCase(bD);if(bD!==bB){bz[bB]=bz[bD];delete bz[bD]}if((bN=b.cssHooks[bB])&&"expand" in bN){bF=bN.expand(bz[bB]);delete bz[bB];for(bD in bF){if(!(bD in bz)){bz[bD]=bF[bD]}}}}for(bB in bz){bG=bz[bB];if(b.isArray(bG)){bE.animatedProperties[bB]=bG[1];bG=bz[bB]=bG[0]}else{bE.animatedProperties[bB]=bE.specialEasing&&bE.specialEasing[bB]||bE.easing||"swing"}if(bG==="hide"&&bJ||bG==="show"&&!bJ){return bE.complete.call(this)}if(bL&&(bB==="height"||bB==="width")){bE.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(b.css(this,"display")==="inline"&&b.css(this,"float")==="none"){if(!b.support.inlineBlockNeedsLayout||w(this.nodeName)==="inline"){this.style.display="inline-block"}else{this.style.zoom=1}}}}if(bE.overflow!=null){this.style.overflow="hidden"}for(bD in bz){bK=new b.fx(this,bE,bD);bG=bz[bD];if(aB.test(bG)){bA=b._data(this,"toggle"+bD)||(bG==="toggle"?bJ?"show":"hide":0);if(bA){b._data(this,"toggle"+bD,bA==="show"?"hide":"show");bK[bA]()}else{bK[bG]()}}else{bI=aU.exec(bG);bC=bK.cur();if(bI){bH=parseFloat(bI[2]);bM=bI[3]||(b.cssNumber[bD]?"":"px");if(bM!=="px"){b.style(this,bD,(bH||1)+bM);bC=((bH||1)/bK.cur())*bC;b.style(this,bD,bC+bM)}if(bI[1]){bH=((bI[1]==="-="?-1:1)*bH)+bC}bK.custom(bC,bH,bM)}else{bK.custom(bC,bG,"")}}}return true}return e.queue===false?this.each(bv):this.queue(e.queue,bv)},stop:function(bw,bv,e){if(typeof bw!=="string"){e=bv;bv=bw;bw=L}if(bv&&bw!==false){this.queue(bw||"fx",[])}return this.each(function(){var bx,by=false,bA=b.timers,bz=b._data(this);if(!e){b._unmark(true,this)}function bB(bE,bF,bD){var bC=bF[bD];b.removeData(bE,bD,true);bC.stop(e)}if(bw==null){for(bx in bz){if(bz[bx]&&bz[bx].stop&&bx.indexOf(".run")===bx.length-4){bB(this,bz,bx)}}}else{if(bz[bx=bw+".run"]&&bz[bx].stop){bB(this,bz,bx)}}for(bx=bA.length;bx--;){if(bA[bx].elem===this&&(bw==null||bA[bx].queue===bw)){if(e){bA[bx](true)}else{bA[bx].saveState()}by=true;bA.splice(bx,1)}}if(!(e&&by)){b.dequeue(this,bw)}})}});function bi(){setTimeout(at,0);return(a5=b.now())}function at(){a5=L}function a2(bv,e){var bw={};b.each(aI.concat.apply([],aI.slice(0,e)),function(){bw[this]=bv});return bw}b.each({slideDown:a2("show",1),slideUp:a2("hide",1),slideToggle:a2("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,bv){b.fn[e]=function(bw,by,bx){return this.animate(bv,bw,by,bx)}});b.extend({speed:function(bw,bx,bv){var e=bw&&typeof bw==="object"?b.extend({},bw):{complete:bv||!bv&&bx||b.isFunction(bw)&&bw,duration:bw,easing:bv&&bx||bx&&!b.isFunction(bx)&&bx};e.duration=b.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in b.fx.speeds?b.fx.speeds[e.duration]:b.fx.speeds._default;if(e.queue==null||e.queue===true){e.queue="fx"}e.old=e.complete;e.complete=function(by){if(b.isFunction(e.old)){e.old.call(this)}if(e.queue){b.dequeue(this,e.queue)}else{if(by!==false){b._unmark(this)}}};return e},easing:{linear:function(e){return e},swing:function(e){return(-Math.cos(e*Math.PI)/2)+0.5}},timers:[],fx:function(bv,e,bw){this.options=e;this.elem=bv;this.prop=bw;e.orig=e.orig||{}}});b.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(b.fx.step[this.prop]||b.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var e,bv=b.css(this.elem,this.prop);return isNaN(e=parseFloat(bv))?!bv||bv==="auto"?0:bv:e},custom:function(bz,by,bx){var e=this,bw=b.fx;this.startTime=a5||bi();this.end=by;this.now=this.start=bz;this.pos=this.state=0;this.unit=bx||this.unit||(b.cssNumber[this.prop]?"":"px");function bv(bA){return e.step(bA)}bv.queue=this.options.queue;bv.elem=this.elem;bv.saveState=function(){if(b._data(e.elem,"fxshow"+e.prop)===L){if(e.options.hide){b._data(e.elem,"fxshow"+e.prop,e.start)}else{if(e.options.show){b._data(e.elem,"fxshow"+e.prop,e.end)}}}};if(bv()&&b.timers.push(bv)&&!a4){a4=setInterval(bw.tick,bw.interval)}},show:function(){var e=b._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=e||b.style(this.elem,this.prop);this.options.show=true;if(e!==L){this.custom(this.cur(),e)}else{this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur())}b(this.elem).show()},hide:function(){this.options.orig[this.prop]=b._data(this.elem,"fxshow"+this.prop)||b.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(by){var bA,bB,bv,bx=a5||bi(),e=true,bz=this.elem,bw=this.options;if(by||bx>=bw.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bw.animatedProperties[this.prop]=true;for(bA in bw.animatedProperties){if(bw.animatedProperties[bA]!==true){e=false}}if(e){if(bw.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bC,bD){bz.style["overflow"+bD]=bw.overflow[bC]})}if(bw.hide){b(bz).hide()}if(bw.hide||bw.show){for(bA in bw.animatedProperties){b.style(bz,bA,bw.orig[bA]);b.removeData(bz,"fxshow"+bA,true);b.removeData(bz,"toggle"+bA,true)}}bv=bw.complete;if(bv){bw.complete=false;bv.call(bz)}}return false}else{if(bw.duration==Infinity){this.now=bx}else{bB=bx-this.startTime;this.state=bB/bw.duration;this.pos=b.easing[bw.animatedProperties[this.prop]](this.state,bB,0,1,bw.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){var bw,bv=b.timers,e=0;for(;e<bv.length;e++){bw=bv[e];if(!bw()&&bv[e]===bw){bv.splice(e--,1)}}if(!bv.length){b.fx.stop()}},interval:13,stop:function(){clearInterval(a4);a4=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(e){b.style(e.elem,"opacity",e.now)},_default:function(e){if(e.elem.style&&e.elem.style[e.prop]!=null){e.elem.style[e.prop]=e.now+e.unit}else{e.elem[e.prop]=e.now}}}});b.each(aI.concat.apply([],aI),function(e,bv){if(bv.indexOf("margin")){b.fx.step[bv]=function(bw){b.style(bw.elem,bv,Math.max(0,bw.now)+bw.unit)}}});if(b.expr&&b.expr.filters){b.expr.filters.animated=function(e){return b.grep(b.timers,function(bv){return e===bv.elem}).length}}function w(bx){if(!Q[bx]){var e=av.body,bv=b("<"+bx+">").appendTo(e),bw=bv.css("display");bv.remove();if(bw==="none"||bw===""){if(!ba){ba=av.createElement("iframe");ba.frameBorder=ba.width=ba.height=0}e.appendChild(ba);if(!m||!ba.createElement){m=(ba.contentWindow||ba.contentDocument).document;m.write((b.support.boxModel?"<!doctype html>":"")+"<html><body>");m.close()}bv=m.createElement(bx);m.body.appendChild(bv);bw=b.css(bv,"display");e.removeChild(ba)}Q[bx]=bw}return Q[bx]}var a8,V=/^t(?:able|d|h)$/i,ad=/^(?:body|html)$/i;if("getBoundingClientRect" in av.documentElement){a8=function(by,bH,bw,bB){try{bB=by.getBoundingClientRect()}catch(bF){}if(!bB||!b.contains(bw,by)){return bB?{top:bB.top,left:bB.left}:{top:0,left:0}}var bC=bH.body,bD=aL(bH),bA=bw.clientTop||bC.clientTop||0,bE=bw.clientLeft||bC.clientLeft||0,bv=bD.pageYOffset||b.support.boxModel&&bw.scrollTop||bC.scrollTop,bz=bD.pageXOffset||b.support.boxModel&&bw.scrollLeft||bC.scrollLeft,bG=bB.top+bv-bA,bx=bB.left+bz-bE;return{top:bG,left:bx}}}else{a8=function(bz,bE,bx){var bC,bw=bz.offsetParent,bv=bz,bA=bE.body,bB=bE.defaultView,e=bB?bB.getComputedStyle(bz,null):bz.currentStyle,bD=bz.offsetTop,by=bz.offsetLeft;while((bz=bz.parentNode)&&bz!==bA&&bz!==bx){if(b.support.fixedPosition&&e.position==="fixed"){break}bC=bB?bB.getComputedStyle(bz,null):bz.currentStyle;bD-=bz.scrollTop;by-=bz.scrollLeft;if(bz===bw){bD+=bz.offsetTop;by+=bz.offsetLeft;if(b.support.doesNotAddBorder&&!(b.support.doesAddBorderForTableAndCells&&V.test(bz.nodeName))){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}bv=bw;bw=bz.offsetParent}if(b.support.subtractsBorderForOverflowNotVisible&&bC.overflow!=="visible"){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}e=bC}if(e.position==="relative"||e.position==="static"){bD+=bA.offsetTop;by+=bA.offsetLeft}if(b.support.fixedPosition&&e.position==="fixed"){bD+=Math.max(bx.scrollTop,bA.scrollTop);by+=Math.max(bx.scrollLeft,bA.scrollLeft)}return{top:bD,left:by}}}b.fn.offset=function(e){if(arguments.length){return e===L?this:this.each(function(bx){b.offset.setOffset(this,e,bx)})}var bv=this[0],bw=bv&&bv.ownerDocument;if(!bw){return null}if(bv===bw.body){return b.offset.bodyOffset(bv)}return a8(bv,bw,bw.documentElement)};b.offset={bodyOffset:function(e){var bw=e.offsetTop,bv=e.offsetLeft;if(b.support.doesNotIncludeMarginInBodyOffset){bw+=parseFloat(b.css(e,"marginTop"))||0;bv+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bw,left:bv}},setOffset:function(bx,bG,bA){var bB=b.css(bx,"position");if(bB==="static"){bx.style.position="relative"}var bz=b(bx),bv=bz.offset(),e=b.css(bx,"top"),bE=b.css(bx,"left"),bF=(bB==="absolute"||bB==="fixed")&&b.inArray("auto",[e,bE])>-1,bD={},bC={},bw,by;if(bF){bC=bz.position();bw=bC.top;by=bC.left}else{bw=parseFloat(e)||0;by=parseFloat(bE)||0}if(b.isFunction(bG)){bG=bG.call(bx,bA,bv)}if(bG.top!=null){bD.top=(bG.top-bv.top)+bw}if(bG.left!=null){bD.left=(bG.left-bv.left)+by}if("using" in bG){bG.using.call(bx,bD)}else{bz.css(bD)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bw=this[0],bv=this.offsetParent(),bx=this.offset(),e=ad.test(bv[0].nodeName)?{top:0,left:0}:bv.offset();bx.top-=parseFloat(b.css(bw,"marginTop"))||0;bx.left-=parseFloat(b.css(bw,"marginLeft"))||0;e.top+=parseFloat(b.css(bv[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bv[0],"borderLeftWidth"))||0;return{top:bx.top-e.top,left:bx.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||av.body;while(e&&(!ad.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(bw,bv){var e=/Y/.test(bv);b.fn[bw]=function(bx){return b.access(this,function(by,bB,bA){var bz=aL(by);if(bA===L){return bz?(bv in bz)?bz[bv]:b.support.boxModel&&bz.document.documentElement[bB]||bz.document.body[bB]:by[bB]}if(bz){bz.scrollTo(!e?bA:b(bz).scrollLeft(),e?bA:b(bz).scrollTop())}else{by[bB]=bA}},bw,bx,arguments.length,null)}});function aL(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each({Height:"height",Width:"width"},function(bw,bx){var bv="client"+bw,e="scroll"+bw,by="offset"+bw;b.fn["inner"+bw]=function(){var bz=this[0];return bz?bz.style?parseFloat(b.css(bz,bx,"padding")):this[bx]():null};b.fn["outer"+bw]=function(bA){var bz=this[0];return bz?bz.style?parseFloat(b.css(bz,bx,bA?"margin":"border")):this[bx]():null};b.fn[bx]=function(bz){return b.access(this,function(bC,bB,bD){var bF,bE,bG,bA;if(b.isWindow(bC)){bF=bC.document;bE=bF.documentElement[bv];return b.support.boxModel&&bE||bF.body&&bF.body[bv]||bE}if(bC.nodeType===9){bF=bC.documentElement;if(bF[bv]>=bF[e]){return bF[bv]}return Math.max(bC.body[e],bF[e],bC.body[by],bF[by])}if(bD===L){bG=b.css(bC,bB);bA=parseFloat(bG);return b.isNumeric(bA)?bA:bG}b(bC).css(bB,bD)},bx,bz,arguments.length,null)}});bd.jQuery=bd.$=b;if(typeof define==="function"&&define.amd&&define.amd.jQuery){define("jquery",[],function(){return b})}})(window);/*!
- * jQuery UI 1.8.18
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI
- */
-(function(a,d){a.ui=a.ui||{};if(a.ui.version){return}a.extend(a.ui,{version:"1.8.18",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(e,f){return typeof e==="number"?this.each(function(){var g=this;setTimeout(function(){a(g).focus();if(f){f.call(g)}},e)}):this._focus.apply(this,arguments)},scrollParent:function(){var e;if((a.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){e=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(a.curCSS(this,"position",1))&&(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}else{e=this.parents().filter(function(){return(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!e.length?a(document):e},zIndex:function(h){if(h!==d){return this.css("zIndex",h)}if(this.length){var f=a(this[0]),e,g;while(f.length&&f[0]!==document){e=f.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){g=parseInt(f.css("zIndex"),10);if(!isNaN(g)&&g!==0){return g}}f=f.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(g,e){var f=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),k={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function j(m,l,i,n){a.each(f,function(){l-=parseFloat(a.curCSS(m,"padding"+this,true))||0;if(i){l-=parseFloat(a.curCSS(m,"border"+this+"Width",true))||0}if(n){l-=parseFloat(a.curCSS(m,"margin"+this,true))||0}});return l}a.fn["inner"+e]=function(i){if(i===d){return k["inner"+e].call(this)}return this.each(function(){a(this).css(h,j(this,i)+"px")})};a.fn["outer"+e]=function(i,l){if(typeof i!=="number"){return k["outer"+e].call(this,i)}return this.each(function(){a(this).css(h,j(this,i,true,l)+"px")})}});function c(g,e){var j=g.nodeName.toLowerCase();if("area"===j){var i=g.parentNode,h=i.name,f;if(!g.href||!h||i.nodeName.toLowerCase()!=="map"){return false}f=a("img[usemap=#"+h+"]")[0];return !!f&&b(f)}return(/input|select|textarea|button|object/.test(j)?!g.disabled:"a"==j?g.href||e:e)&&b(g)}function b(e){return !a(e).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.extend(a.expr[":"],{data:function(g,f,e){return !!a.data(g,e[3])},focusable:function(e){return c(e,!isNaN(a.attr(e,"tabindex")))},tabbable:function(g){var e=a.attr(g,"tabindex"),f=isNaN(e);return(f||e>=0)&&c(g,!f)}});a(function(){var e=document.body,f=e.appendChild(f=document.createElement("div"));f.offsetHeight;a.extend(f.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=f.offsetHeight===100;a.support.selectstart="onselectstart" in f;e.removeChild(f).style.display="none"});a.extend(a.ui,{plugin:{add:function(f,g,j){var h=a.ui[f].prototype;for(var e in j){h.plugins[e]=h.plugins[e]||[];h.plugins[e].push([g,j[e]])}},call:function(e,g,f){var j=e.plugins[g];if(!j||!e.element[0].parentNode){return}for(var h=0;h<j.length;h++){if(e.options[j[h][0]]){j[h][1].apply(e.element,f)}}}},contains:function(f,e){return document.compareDocumentPosition?f.compareDocumentPosition(e)&16:f!==e&&f.contains(e)},hasScroll:function(h,f){if(a(h).css("overflow")==="hidden"){return false}var e=(f&&f==="left")?"scrollLeft":"scrollTop",g=false;if(h[e]>0){return true}h[e]=1;g=(h[e]>0);h[e]=0;return g},isOverAxis:function(f,e,g){return(f>e)&&(f<(e+g))},isOver:function(j,f,i,h,e,g){return a.ui.isOverAxis(j,i,e)&&a.ui.isOverAxis(f,h,g)}})})(jQuery);/*!
- * jQuery UI Widget 1.8.18
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Widget
- */
-(function(b,d){if(b.cleanData){var c=b.cleanData;b.cleanData=function(f){for(var g=0,h;(h=f[g])!=null;g++){try{b(h).triggerHandler("remove")}catch(j){}}c(f)}}else{var a=b.fn.remove;b.fn.remove=function(e,f){return this.each(function(){if(!f){if(!e||b.filter(e,[this]).length){b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(g){}})}}return a.call(b(this),e,f)})}}b.widget=function(f,h,e){var g=f.split(".")[0],j;f=f.split(".")[1];j=g+"-"+f;if(!e){e=h;h=b.Widget}b.expr[":"][j]=function(k){return !!b.data(k,f)};b[g]=b[g]||{};b[g][f]=function(k,l){if(arguments.length){this._createWidget(k,l)}};var i=new h();i.options=b.extend(true,{},i.options);b[g][f].prototype=b.extend(true,i,{namespace:g,widgetName:f,widgetEventPrefix:b[g][f].prototype.widgetEventPrefix||f,widgetBaseClass:j},e);b.widget.bridge(f,b[g][f])};b.widget.bridge=function(f,e){b.fn[f]=function(i){var g=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!g&&h.length?b.extend.apply(null,[true,i].concat(h)):i;if(g&&i.charAt(0)==="_"){return j}if(g){this.each(function(){var k=b.data(this,f),l=k&&b.isFunction(k[i])?k[i].apply(k,h):k;if(l!==k&&l!==d){j=l;return false}})}else{this.each(function(){var k=b.data(this,f);if(k){k.option(i||{})._init()}else{b.data(this,f,new e(i,this))}})}return j}};b.Widget=function(e,f){if(arguments.length){this._createWidget(e,f)}};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(f,g){b.data(g,this.widgetName,this);this.element=b(g);this.options=b.extend(true,{},this.options,this._getCreateOptions(),f);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(f,g){var e=f;if(arguments.length===0){return b.extend({},this.options)}if(typeof f==="string"){if(g===d){return this.options[f]}e={};e[f]=g}this._setOptions(e);return this},_setOptions:function(f){var e=this;b.each(f,function(g,h){e._setOption(g,h)});return this},_setOption:function(e,f){this.options[e]=f;if(e==="disabled"){this.widget()[f?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",f)}return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,f,g){var j,i,h=this.options[e];g=g||{};f=b.Event(f);f.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();f.target=this.element[0];i=f.originalEvent;if(i){for(j in i){if(!(j in f)){f[j]=i[j]}}}this.element.trigger(f,g);return !(b.isFunction(h)&&h.call(this.element[0],f,g)===false||f.isDefaultPrevented())}}})(jQuery);/*!
- * jQuery UI Mouse 1.8.18
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Mouse
- *
- * Depends:
- * jquery.ui.widget.js
- */
-(function(b,c){var a=false;b(document).mouseup(function(d){a=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var d=this;this.element.bind("mousedown."+this.widgetName,function(e){return d._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===b.data(e.target,d.widgetName+".preventClickEvent")){b.removeData(e.target,d.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(f){if(a){return}(this._mouseStarted&&this._mouseUp(f));this._mouseDownEvent=f;var e=this,g=(f.which==1),d=(typeof this.options.cancel=="string"&&f.target.nodeName?b(f.target).closest(this.options.cancel).length:false);if(!g||d||!this._mouseCapture(f)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(f)&&this._mouseDelayMet(f)){this._mouseStarted=(this._mouseStart(f)!==false);if(!this._mouseStarted){f.preventDefault();return true}}if(true===b.data(f.target,this.widgetName+".preventClickEvent")){b.removeData(f.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(h){return e._mouseMove(h)};this._mouseUpDelegate=function(h){return e._mouseUp(h)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);f.preventDefault();a=true;return true},_mouseMove:function(d){if(b.browser.msie&&!(document.documentMode>=9)&&!d.button){return this._mouseUp(d)}if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,d)!==false);(this._mouseStarted?this._mouseDrag(d):this._mouseUp(d))}return !this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(d.target==this._mouseDownEvent.target){b.data(d.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return(Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance)},_mouseDelayMet:function(d){return this.mouseDelayMet},_mouseStart:function(d){},_mouseDrag:function(d){},_mouseStop:function(d){},_mouseCapture:function(d){return true}})})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){this.element.wrap(c('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g<l.length;g++){var j=c.trim(l[g]),e="ui-resizable-"+j;var h=c('<div class="ui-resizable-handle '+e+'"></div>');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){if(k.disabled){return}c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(k.disabled){return}if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateVirtualBoundaries:function(g){var j=this.options,i,h,f,k,e;e={minWidth:a(j.minWidth)?j.minWidth:0,maxWidth:a(j.maxWidth)?j.maxWidth:Infinity,minHeight:a(j.minHeight)?j.minHeight:0,maxHeight:a(j.maxHeight)?j.maxHeight:Infinity};if(this._aspectRatio||g){i=e.minHeight*this.aspectRatio;f=e.minWidth/this.aspectRatio;h=e.maxHeight*this.aspectRatio;k=e.maxWidth/this.aspectRatio;if(i>e.minWidth){e.minWidth=i}if(f>e.minHeight){e.minHeight=f}if(h<e.maxWidth){e.maxWidth=h}if(k<e.maxHeight){e.maxHeight=k}}this._vBoundaries=e},_updateCache:function(e){var f=this.options;this.offset=this.helper.offset();if(a(e.left)){this.position.left=e.left}if(a(e.top)){this.position.top=e.top}if(a(e.height)){this.size.height=e.height}if(a(e.width)){this.size.width=e.width}},_updateRatio:function(h,g){var i=this.options,j=this.position,f=this.size,e=this.axis;if(a(h.height)){h.width=(h.height*this.aspectRatio)}else{if(a(h.width)){h.height=(h.width/this.aspectRatio)}}if(e=="sw"){h.left=j.left+(f.width-h.width);h.top=null}if(e=="nw"){h.top=j.top+(f.height-h.height);h.left=j.left+(f.width-h.width)}return h},_respectSize:function(l,g){var j=this.helper,i=this._vBoundaries,r=this._aspectRatio||g.shiftKey,q=this.axis,t=a(l.width)&&i.maxWidth&&(i.maxWidth<l.width),m=a(l.height)&&i.maxHeight&&(i.maxHeight<l.height),h=a(l.width)&&i.minWidth&&(i.minWidth>l.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(t){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(t&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f<this._proportionallyResizeElements.length;f++){var h=this._proportionallyResizeElements[f];if(!this.borderDif){var e=[h.css("borderTopWidth"),h.css("borderRightWidth"),h.css("borderBottomWidth"),h.css("borderLeftWidth")],j=[h.css("paddingTop"),h.css("paddingRight"),h.css("paddingBottom"),h.css("paddingLeft")];this.borderDif=c.map(e,function(l,n){var m=parseInt(l,10)||0,o=parseInt(j[n],10)||0;return m+o})}if(c.browser.msie&&!(!(c(g).is(":hidden")||c(g).parents(":hidden").length))){continue}h.css({height:(g.height()-this.borderDif[0]-this.borderDif[2])||0,width:(g.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var f=this.element,i=this.options;this.elementOffset=f.offset();if(this._helper){this.helper=this.helper||c('<div style="overflow:hidden;"></div>');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.18"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10)})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,u){var t=(r[u]||0)+(k[u]||0);if(t&&t>=0){p[u]=t||null}});q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(e,f){c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null;p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var t=c(this).data("resizable"),j=t.options,l=t.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}t.containerElement=c(k);if(/document/.test(g)||g==document){t.containerOffset={left:0,top:0};t.containerPosition={left:0,top:0};t.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});t.containerOffset=n.offset();t.containerPosition=n.position();t.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=t.containerOffset,e=t.containerSize.height,m=t.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);t.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var t=c(this).data("resizable"),i=t.options,f=t.containerSize,p=t.containerOffset,m=t.size,n=t.position,r=t._aspectRatio||g.shiftKey,e={top:0,left:0},h=t.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(t._helper?p.left:0)){t.size.width=t.size.width+(t._helper?(t.position.left-p.left):(t.position.left-e.left));if(r){t.size.height=t.size.width/i.aspectRatio}t.position.left=i.helper?p.left:0}if(n.top<(t._helper?p.top:0)){t.size.height=t.size.height+(t._helper?(t.position.top-p.top):t.position.top);if(r){t.size.width=t.size.height*i.aspectRatio}t.position.top=t._helper?p.top:0}t.offset.left=t.parentData.left+t.position.left;t.offset.top=t.parentData.top+t.position.top;var l=Math.abs((t._helper?t.offset.left-e.left:(t.offset.left-e.left))+t.sizeDiff.width),s=Math.abs((t._helper?t.offset.top-e.top:(t.offset.top-p.top))+t.sizeDiff.height);var k=t.containerElement.get(0)==t.element.parent().get(0),j=/relative|absolute/.test(t.containerElement.css("position"));if(k&&j){l-=t.parentData.left}if(l+t.size.width>=t.parentData.width){t.size.width=t.parentData.width-l;if(r){t.size.height=t.size.width/t.aspectRatio}}if(s+t.size.height>=t.parentData.height){t.size.height=t.parentData.height-s;if(r){t.size.width=t.size.height*t.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);/*!
- * jQuery hashchange event - v1.3 - 7/21/2010
- * http://benalman.com/projects/jquery-hashchange-plugin/
- *
- * Copyright (c) 2010 "Cowboy" Ben Alman
- * Dual licensed under the MIT and GPL licenses.
- * http://benalman.com/about/license/
- */
-(function($,e,b){var c="hashchange",h=document,f,g=$.event.special,i=h.documentMode,d="on"+c in e&&(i===b||i>7);function a(j){j=j||location.href;return"#"+j.replace(/^[^#]*#?(.*)$/,"$1")}$.fn[c]=function(j){return j?this.bind(c,j):this.trigger(c)};$.fn[c].delay=50;g[c]=$.extend(g[c],{setup:function(){if(d){return false}$(f.start)},teardown:function(){if(d){return false}$(f.stop)}});f=(function(){var j={},p,m=a(),k=function(q){return q},l=k,o=k;j.start=function(){p||n()};j.stop=function(){p&&clearTimeout(p);p=b};function n(){var r=a(),q=o(m);if(r!==m){l(m=r,q);$(e).trigger(c)}else{if(q!==m){location.href=location.href.replace(/#.*/,"")+q}}p=setTimeout(n,$.fn[c].delay)}$.browser.msie&&!d&&(function(){var q,r;j.start=function(){if(!q){r=$.fn[c].src;r=r&&r+a();q=$('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){r||l(a());n()}).attr("src",r||"javascript:0").insertAfter("body")[0].contentWindow;h.onpropertychange=function(){try{if(event.propertyName==="title"){q.document.title=h.title}}catch(s){}}}};j.stop=k;o=function(){return a(q.location.href)};l=function(v,s){var u=q.document,t=$.fn[c].domain;if(v!==s){u.title=h.title;u.open();t&&u.write('<script>document.domain="'+t+'"<\/script>');u.close();q.location.hash=v}}})();return j})()})(jQuery,this);(function(c){var a=c.scrollTo=function(f,e,d){c(window).scrollTo(f,e,d)};a.defaults={axis:"xy",duration:parseFloat(c.fn.jquery)>=1.3?0:1};a.window=function(d){return c(window)._scrollable()};c.fn._scrollable=function(){return this.map(function(){var e=this,d=!e.nodeName||c.inArray(e.nodeName.toLowerCase(),["iframe","#document","html","body"])!=-1;if(!d){return e}var f=(e.contentWindow||e).document||e.ownerDocument||e;return c.browser.safari||f.compatMode=="BackCompat"?f.body:f.documentElement})};c.fn.scrollTo=function(f,e,d){if(typeof e=="object"){d=e;e=0}if(typeof d=="function"){d={onAfter:d}}if(f=="max"){f=9000000000}d=c.extend({},a.defaults,d);e=e||d.speed||d.duration;d.queue=d.queue&&d.axis.length>1;if(d.queue){e/=2}d.offset=b(d.offset);d.over=b(d.over);return this._scrollable().each(function(){var l=this,j=c(l),k=f,i,g={},m=j.is("html,body");switch(typeof k){case"number":case"string":if(/^([+-]=)?\d+(\.\d+)?(px|%)?$/.test(k)){k=b(k);break}k=c(k,this);case"object":if(k.is||k.style){i=(k=c(k)).offset()}}c.each(d.axis.split(""),function(q,r){var s=r=="x"?"Left":"Top",u=s.toLowerCase(),p="scroll"+s,o=l[p],n=a.max(l,r);if(i){g[p]=i[u]+(m?0:o-j.offset()[u]);if(d.margin){g[p]-=parseInt(k.css("margin"+s))||0;g[p]-=parseInt(k.css("border"+s+"Width"))||0}g[p]+=d.offset[u]||0;if(d.over[u]){g[p]+=k[r=="x"?"width":"height"]()*d.over[u]}}else{var t=k[u];g[p]=t.slice&&t.slice(-1)=="%"?parseFloat(t)/100*n:t}if(/^\d+$/.test(g[p])){g[p]=g[p]<=0?0:Math.min(g[p],n)}if(!q&&d.queue){if(o!=g[p]){h(d.onAfterFirst)}delete g[p]}});h(d.onAfter);function h(n){j.animate(g,e,d.easing,n&&function(){n.call(this,f,d)})}}).end()};a.max=function(j,i){var h=i=="x"?"Width":"Height",e="scroll"+h;if(!c(j).is("html,body")){return j[e]-c(j)[h.toLowerCase()]()}var g="client"+h,f=j.ownerDocument.documentElement,d=j.ownerDocument.body;return Math.max(f[e],d[e])-Math.min(f[g],d[g])};function b(d){return typeof d=="object"?d:{top:d,left:d}}})(jQuery);/*!
- PowerTip - v1.2.0 - 2013-04-03
- http://stevenbenner.github.com/jquery-powertip/
- Copyright (c) 2013 Steven Benner (http://stevenbenner.com/).
- Released under MIT license.
- https://raw.github.com/stevenbenner/jquery-powertip/master/LICENSE.txt
-*/
-(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{a(jQuery)}}(function(k){var A=k(document),s=k(window),w=k("body");var n="displayController",e="hasActiveHover",d="forcedOpen",u="hasMouseMove",f="mouseOnToPopup",g="originalTitle",y="powertip",o="powertipjq",l="powertiptarget",E=180/Math.PI;var c={isTipOpen:false,isFixedTipOpen:false,isClosing:false,tipOpenImminent:false,activeHover:null,currentX:0,currentY:0,previousX:0,previousY:0,desyncTimeout:null,mouseTrackingActive:false,delayInProgress:false,windowWidth:0,windowHeight:0,scrollTop:0,scrollLeft:0};var p={none:0,top:1,bottom:2,left:4,right:8};k.fn.powerTip=function(F,N){if(!this.length){return this}if(k.type(F)==="string"&&k.powerTip[F]){return k.powerTip[F].call(this,this,N)}var O=k.extend({},k.fn.powerTip.defaults,F),G=new x(O);h();this.each(function M(){var R=k(this),Q=R.data(y),P=R.data(o),T=R.data(l),S;if(R.data(n)){k.powerTip.destroy(R)}S=R.attr("title");if(!Q&&!T&&!P&&S){R.data(y,S);R.data(g,S);R.removeAttr("title")}R.data(n,new t(R,O,G))});if(!O.manual){this.on({"mouseenter.powertip":function J(P){k.powerTip.show(this,P)},"mouseleave.powertip":function L(){k.powerTip.hide(this)},"focus.powertip":function K(){k.powerTip.show(this)},"blur.powertip":function H(){k.powerTip.hide(this,true)},"keydown.powertip":function I(P){if(P.keyCode===27){k.powerTip.hide(this,true)}}})}return this};k.fn.powerTip.defaults={fadeInTime:200,fadeOutTime:100,followMouse:false,popupId:"powerTip",intentSensitivity:7,intentPollInterval:100,closeDelay:100,placement:"n",smartPlacement:false,offset:10,mouseOnToPopup:false,manual:false};k.fn.powerTip.smartPlacementLists={n:["n","ne","nw","s"],e:["e","ne","se","w","nw","sw","n","s","e"],s:["s","se","sw","n"],w:["w","nw","sw","e","ne","se","n","s","w"],nw:["nw","w","sw","n","s","se","nw"],ne:["ne","e","se","n","s","sw","ne"],sw:["sw","w","nw","s","n","ne","sw"],se:["se","e","ne","s","n","nw","se"],"nw-alt":["nw-alt","n","ne-alt","sw-alt","s","se-alt","w","e"],"ne-alt":["ne-alt","n","nw-alt","se-alt","s","sw-alt","e","w"],"sw-alt":["sw-alt","s","se-alt","nw-alt","n","ne-alt","w","e"],"se-alt":["se-alt","s","sw-alt","ne-alt","n","nw-alt","e","w"]};k.powerTip={show:function z(F,G){if(G){i(G);c.previousX=G.pageX;c.previousY=G.pageY;k(F).data(n).show()}else{k(F).first().data(n).show(true,true)}return F},reposition:function r(F){k(F).first().data(n).resetPosition();return F},hide:function D(G,F){if(G){k(G).first().data(n).hide(F)}else{if(c.activeHover){c.activeHover.data(n).hide(true)}}return G},destroy:function C(G){k(G).off(".powertip").each(function F(){var I=k(this),H=[g,n,e,d];if(I.data(g)){I.attr("title",I.data(g));H.push(y)}I.removeData(H)});return G}};k.powerTip.showTip=k.powerTip.show;k.powerTip.closeTip=k.powerTip.hide;function b(){var F=this;F.top="auto";F.left="auto";F.right="auto";F.bottom="auto";F.set=function(H,G){if(k.isNumeric(G)){F[H]=Math.round(G)}}}function t(K,N,F){var J=null;function L(P,Q){M();if(!K.data(e)){if(!P){c.tipOpenImminent=true;J=setTimeout(function O(){J=null;I()},N.intentPollInterval)}else{if(Q){K.data(d,true)}F.showTip(K)}}}function G(P){M();c.tipOpenImminent=false;if(K.data(e)){K.data(d,false);if(!P){c.delayInProgress=true;J=setTimeout(function O(){J=null;F.hideTip(K);c.delayInProgress=false},N.closeDelay)}else{F.hideTip(K)}}}function I(){var Q=Math.abs(c.previousX-c.currentX),O=Math.abs(c.previousY-c.currentY),P=Q+O;if(P<N.intentSensitivity){F.showTip(K)}else{c.previousX=c.currentX;c.previousY=c.currentY;L()}}function M(){J=clearTimeout(J);c.delayInProgress=false}function H(){F.resetPosition(K)}this.show=L;this.hide=G;this.cancel=M;this.resetPosition=H}function j(){function G(M,L,J,O,P){var K=L.split("-")[0],N=new b(),I;if(q(M)){I=H(M,K)}else{I=F(M,K)}switch(L){case"n":N.set("left",I.left-(J/2));N.set("bottom",c.windowHeight-I.top+P);break;case"e":N.set("left",I.left+P);N.set("top",I.top-(O/2));break;case"s":N.set("left",I.left-(J/2));N.set("top",I.top+P);break;case"w":N.set("top",I.top-(O/2));N.set("right",c.windowWidth-I.left+P);break;case"nw":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"nw-alt":N.set("left",I.left);N.set("bottom",c.windowHeight-I.top+P);break;case"ne":N.set("left",I.left-20);N.set("bottom",c.windowHeight-I.top+P);break;case"ne-alt":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left);break;case"sw":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"sw-alt":N.set("left",I.left);N.set("top",I.top+P);break;case"se":N.set("left",I.left-20);N.set("top",I.top+P);break;case"se-alt":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left);break}return N}function F(K,J){var O=K.offset(),N=K.outerWidth(),I=K.outerHeight(),M,L;switch(J){case"n":M=O.left+N/2;L=O.top;break;case"e":M=O.left+N;L=O.top+I/2;break;case"s":M=O.left+N/2;L=O.top+I;break;case"w":M=O.left;L=O.top+I/2;break;case"nw":M=O.left;L=O.top;break;case"ne":M=O.left+N;L=O.top;break;case"sw":M=O.left;L=O.top+I;break;case"se":M=O.left+N;L=O.top+I;break}return{top:L,left:M}}function H(O,K){var S=O.closest("svg")[0],N=O[0],W=S.createSVGPoint(),L=N.getBBox(),V=N.getScreenCTM(),M=L.width/2,Q=L.height/2,P=[],I=["nw","n","ne","e","se","s","sw","w"],U,X,R,T;function J(){P.push(W.matrixTransform(V))}W.x=L.x;W.y=L.y;J();W.x+=M;J();W.x+=M;J();W.y+=Q;J();W.y+=Q;J();W.x-=M;J();W.x-=M;J();W.y-=Q;J();if(P[0].y!==P[1].y||P[0].x!==P[7].x){X=Math.atan2(V.b,V.a)*E;R=Math.ceil(((X%360)-22.5)/45);if(R<1){R+=8}while(R--){I.push(I.shift())}}for(T=0;T<P.length;T++){if(I[T]===K){U=P[T];break}}return{top:U.y+c.scrollTop,left:U.x+c.scrollLeft}}this.compute=G}function x(Q){var P=new j(),O=k("#"+Q.popupId);if(O.length===0){O=k("<div/>",{id:Q.popupId});if(w.length===0){w=k("body")}w.append(O)}if(Q.followMouse){if(!O.data(u)){A.on("mousemove",M);s.on("scroll",M);O.data(u,true)}}if(Q.mouseOnToPopup){O.on({mouseenter:function L(){if(O.data(f)){if(c.activeHover){c.activeHover.data(n).cancel()}}},mouseleave:function N(){if(c.activeHover){c.activeHover.data(n).hide()}}})}function I(S){S.data(e,true);O.queue(function R(T){H(S);T()})}function H(S){var U;if(!S.data(e)){return}if(c.isTipOpen){if(!c.isClosing){K(c.activeHover)}O.delay(100).queue(function R(V){H(S);V()});return}S.trigger("powerTipPreRender");U=B(S);if(U){O.empty().append(U)}else{return}S.trigger("powerTipRender");c.activeHover=S;c.isTipOpen=true;O.data(f,Q.mouseOnToPopup);if(!Q.followMouse){G(S);c.isFixedTipOpen=true}else{M()}O.fadeIn(Q.fadeInTime,function T(){if(!c.desyncTimeout){c.desyncTimeout=setInterval(J,500)}S.trigger("powerTipOpen")})}function K(R){c.isClosing=true;c.activeHover=null;c.isTipOpen=false;c.desyncTimeout=clearInterval(c.desyncTimeout);R.data(e,false);R.data(d,false);O.fadeOut(Q.fadeOutTime,function S(){var T=new b();c.isClosing=false;c.isFixedTipOpen=false;O.removeClass();T.set("top",c.currentY+Q.offset);T.set("left",c.currentX+Q.offset);O.css(T);R.trigger("powerTipClose")})}function M(){if(!c.isFixedTipOpen&&(c.isTipOpen||(c.tipOpenImminent&&O.data(u)))){var R=O.outerWidth(),V=O.outerHeight(),U=new b(),S,T;U.set("top",c.currentY+Q.offset);U.set("left",c.currentX+Q.offset);S=m(U,R,V);if(S!==p.none){T=a(S);if(T===1){if(S===p.right){U.set("left",c.windowWidth-R)}else{if(S===p.bottom){U.set("top",c.scrollTop+c.windowHeight-V)}}}else{U.set("left",c.currentX-R-Q.offset);U.set("top",c.currentY-V-Q.offset)}}O.css(U)}}function G(S){var R,T;if(Q.smartPlacement){R=k.fn.powerTip.smartPlacementLists[Q.placement];k.each(R,function(U,W){var V=m(F(S,W),O.outerWidth(),O.outerHeight());T=W;if(V===p.none){return false}})}else{F(S,Q.placement);T=Q.placement}O.addClass(T)}function F(U,T){var R=0,S,W,V=new b();V.set("top",0);V.set("left",0);O.css(V);do{S=O.outerWidth();W=O.outerHeight();V=P.compute(U,T,S,W,Q.offset);O.css(V)}while(++R<=5&&(S!==O.outerWidth()||W!==O.outerHeight()));return V}function J(){var R=false;if(c.isTipOpen&&!c.isClosing&&!c.delayInProgress){if(c.activeHover.data(e)===false||c.activeHover.is(":disabled")){R=true}else{if(!v(c.activeHover)&&!c.activeHover.is(":focus")&&!c.activeHover.data(d)){if(O.data(f)){if(!v(O)){R=true}}else{R=true}}}if(R){K(c.activeHover)}}}this.showTip=I;this.hideTip=K;this.resetPosition=G}function q(F){return window.SVGElement&&F[0] instanceof SVGElement}function h(){if(!c.mouseTrackingActive){c.mouseTrackingActive=true;k(function H(){c.scrollLeft=s.scrollLeft();c.scrollTop=s.scrollTop();c.windowWidth=s.width();c.windowHeight=s.height()});A.on("mousemove",i);s.on({resize:function G(){c.windowWidth=s.width();c.windowHeight=s.height()},scroll:function F(){var I=s.scrollLeft(),J=s.scrollTop();if(I!==c.scrollLeft){c.currentX+=I-c.scrollLeft;c.scrollLeft=I}if(J!==c.scrollTop){c.currentY+=J-c.scrollTop;c.scrollTop=J}}})}}function i(F){c.currentX=F.pageX;c.currentY=F.pageY}function v(F){var H=F.offset(),J=F[0].getBoundingClientRect(),I=J.right-J.left,G=J.bottom-J.top;return c.currentX>=H.left&&c.currentX<=H.left+I&&c.currentY>=H.top&&c.currentY<=H.top+G}function B(I){var G=I.data(y),F=I.data(o),K=I.data(l),H,J;if(G){if(k.isFunction(G)){G=G.call(I[0])}J=G}else{if(F){if(k.isFunction(F)){F=F.call(I[0])}if(F.length>0){J=F.clone(true,true)}}else{if(K){H=k("#"+K);if(H.length>0){J=H.html()}}}}return J}function m(M,L,K){var G=c.scrollTop,J=c.scrollLeft,I=G+c.windowHeight,F=J+c.windowWidth,H=p.none;if(M.top<G||Math.abs(M.bottom-c.windowHeight)-K<G){H|=p.top}if(M.top+K>I||Math.abs(M.bottom-c.windowHeight)>I){H|=p.bottom}if(M.left<J||M.right+L>F){H|=p.left}if(M.left+L>F||M.right<J){H|=p.right}return H}function a(G){var F=0;while(G){G&=G-1;F++}return F}}));/*!
- * jQuery UI Touch Punch 0.2.3
- *
- * Copyright 2011–2014, Dave Furfero
- * Dual licensed under the MIT or GPL Version 2 licenses.
- *
- * Depends:
- * jquery.ui.widget.js
- * jquery.ui.mouse.js
- */
-(function(b){b.support.touch="ontouchend" in document;if(!b.support.touch){return}var d=b.ui.mouse.prototype,f=d._mouseInit,c=d._mouseDestroy,a;function e(h,i){if(h.originalEvent.touches.length>1){return}h.preventDefault();var j=h.originalEvent.changedTouches[0],g=document.createEvent("MouseEvents");g.initMouseEvent(i,true,true,window,1,j.screenX,j.screenY,j.clientX,j.clientY,false,false,false,false,0,null);h.target.dispatchEvent(g)}d._touchStart=function(h){var g=this;if(a||!g._mouseCapture(h.originalEvent.changedTouches[0])){return}a=true;g._touchMoved=false;e(h,"mouseover");e(h,"mousemove");e(h,"mousedown")};d._touchMove=function(g){if(!a){return}this._touchMoved=true;e(g,"mousemove")};d._touchEnd=function(g){if(!a){return}e(g,"mouseup");e(g,"mouseout");if(!this._touchMoved){e(g,"click")}a=false};d._mouseInit=function(){var g=this;g.element.bind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});f.call(g)};d._mouseDestroy=function(){var g=this;g.element.unbind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});c.call(g)}})(jQuery);/*!
- * SmartMenus jQuery Plugin - v1.0.0 - January 27, 2016
- * http://www.smartmenus.org/
- *
- * Copyright Vasil Dinkov, Vadikom Web Ltd.
- * http://vadikom.com
- *
- * Licensed MIT
- */
-(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{if(typeof module==="object"&&typeof module.exports==="object"){module.exports=a(require("jquery"))}else{a(jQuery)}}}(function(a){var b=[],e=!!window.createPopup,f=false,d="ontouchstart" in window,h=false,g=window.requestAnimationFrame||function(l){return setTimeout(l,1000/60)},c=window.cancelAnimationFrame||function(l){clearTimeout(l)};function k(m){var n=".smartmenus_mouse";if(!h&&!m){var o=true,l=null;a(document).bind(i([["mousemove",function(s){var t={x:s.pageX,y:s.pageY,timeStamp:new Date().getTime()};if(l){var q=Math.abs(l.x-t.x),p=Math.abs(l.y-t.y);if((q>0||p>0)&&q<=2&&p<=2&&t.timeStamp-l.timeStamp<=300){f=true;if(o){var r=a(s.target).closest("a");if(r.is("a")){a.each(b,function(){if(a.contains(this.$root[0],r[0])){this.itemEnter({currentTarget:r[0]});return false}})}o=false}}}l=t}],[d?"touchstart":"pointerover pointermove pointerout MSPointerOver MSPointerMove MSPointerOut",function(p){if(j(p.originalEvent)){f=false}}]],n));h=true}else{if(h&&m){a(document).unbind(n);h=false}}}function j(l){return !/^(4|mouse)$/.test(l.pointerType)}function i(l,n){if(!n){n=""}var m={};a.each(l,function(o,p){m[p[0].split(" ").join(n+" ")+n]=p[1]});return m}a.SmartMenus=function(m,l){this.$root=a(m);this.opts=l;this.rootId="";this.accessIdPrefix="";this.$subArrow=null;this.activatedItems=[];this.visibleSubMenus=[];this.showTimeout=0;this.hideTimeout=0;this.scrollTimeout=0;this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.idInc=0;this.$firstLink=null;this.$firstSub=null;this.disabled=false;this.$disableOverlay=null;this.$touchScrollingSub=null;this.cssTransforms3d="perspective" in m.style||"webkitPerspective" in m.style;this.wasCollapsible=false;this.init()};a.extend(a.SmartMenus,{hideAll:function(){a.each(b,function(){this.menuHideAll()})},destroy:function(){while(b.length){b[0].destroy()}k(true)},prototype:{init:function(n){var l=this;if(!n){b.push(this);this.rootId=(new Date().getTime()+Math.random()+"").replace(/\D/g,"");this.accessIdPrefix="sm-"+this.rootId+"-";if(this.$root.hasClass("sm-rtl")){this.opts.rightToLeftSubMenus=true}var r=".smartmenus";this.$root.data("smartmenus",this).attr("data-smartmenus-id",this.rootId).dataSM("level",1).bind(i([["mouseover focusin",a.proxy(this.rootOver,this)],["mouseout focusout",a.proxy(this.rootOut,this)],["keydown",a.proxy(this.rootKeyDown,this)]],r)).delegate("a",i([["mouseenter",a.proxy(this.itemEnter,this)],["mouseleave",a.proxy(this.itemLeave,this)],["mousedown",a.proxy(this.itemDown,this)],["focus",a.proxy(this.itemFocus,this)],["blur",a.proxy(this.itemBlur,this)],["click",a.proxy(this.itemClick,this)]],r));r+=this.rootId;if(this.opts.hideOnClick){a(document).bind(i([["touchstart",a.proxy(this.docTouchStart,this)],["touchmove",a.proxy(this.docTouchMove,this)],["touchend",a.proxy(this.docTouchEnd,this)],["click",a.proxy(this.docClick,this)]],r))}a(window).bind(i([["resize orientationchange",a.proxy(this.winResize,this)]],r));if(this.opts.subIndicators){this.$subArrow=a("<span/>").addClass("sub-arrow");if(this.opts.subIndicatorsText){this.$subArrow.html(this.opts.subIndicatorsText)}}k()}this.$firstSub=this.$root.find("ul").each(function(){l.menuInit(a(this))}).eq(0);this.$firstLink=this.$root.find("a").eq(0);if(this.opts.markCurrentItem){var p=/(index|default)\.[^#\?\/]*/i,m=/#.*/,q=window.location.href.replace(p,""),o=q.replace(m,"");this.$root.find("a").each(function(){var s=this.href.replace(p,""),t=a(this);if(s==q||s==o){t.addClass("current");if(l.opts.markCurrentTree){t.parentsUntil("[data-smartmenus-id]","ul").each(function(){a(this).dataSM("parent-a").addClass("current")})}}})}this.wasCollapsible=this.isCollapsible()},destroy:function(m){if(!m){var n=".smartmenus";this.$root.removeData("smartmenus").removeAttr("data-smartmenus-id").removeDataSM("level").unbind(n).undelegate(n);n+=this.rootId;a(document).unbind(n);a(window).unbind(n);if(this.opts.subIndicators){this.$subArrow=null}}this.menuHideAll();var l=this;this.$root.find("ul").each(function(){var o=a(this);if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}if(o.dataSM("shown-before")){if(l.opts.subMenusMinWidth||l.opts.subMenusMaxWidth){o.css({width:"",minWidth:"",maxWidth:""}).removeClass("sm-nowrap")}if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}o.css({zIndex:"",top:"",left:"",marginLeft:"",marginTop:"",display:""})}if((o.attr("id")||"").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeDataSM("in-mega").removeDataSM("shown-before").removeDataSM("ie-shim").removeDataSM("scroll-arrows").removeDataSM("parent-a").removeDataSM("level").removeDataSM("beforefirstshowfired").removeAttr("role").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeAttr("aria-expanded");this.$root.find("a.has-submenu").each(function(){var o=a(this);if(o.attr("id").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeClass("has-submenu").removeDataSM("sub").removeAttr("aria-haspopup").removeAttr("aria-controls").removeAttr("aria-expanded").closest("li").removeDataSM("sub");if(this.opts.subIndicators){this.$root.find("span.sub-arrow").remove()}if(this.opts.markCurrentItem){this.$root.find("a.current").removeClass("current")}if(!m){this.$root=null;this.$firstLink=null;this.$firstSub=null;if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}b.splice(a.inArray(this,b),1)}},disable:function(l){if(!this.disabled){this.menuHideAll();if(!l&&!this.opts.isPopup&&this.$root.is(":visible")){var m=this.$root.offset();this.$disableOverlay=a('<div class="sm-jquery-disable-overlay"/>').css({position:"absolute",top:m.top,left:m.left,width:this.$root.outerWidth(),height:this.$root.outerHeight(),zIndex:this.getStartZIndex(true),opacity:0}).appendTo(document.body)}this.disabled=true}},docClick:function(l){if(this.$touchScrollingSub){this.$touchScrollingSub=null;return}if(this.visibleSubMenus.length&&!a.contains(this.$root[0],l.target)||a(l.target).is("a")){this.menuHideAll()}},docTouchEnd:function(m){if(!this.lastTouch){return}if(this.visibleSubMenus.length&&(this.lastTouch.x2===undefined||this.lastTouch.x1==this.lastTouch.x2)&&(this.lastTouch.y2===undefined||this.lastTouch.y1==this.lastTouch.y2)&&(!this.lastTouch.target||!a.contains(this.$root[0],this.lastTouch.target))){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},350)}this.lastTouch=null},docTouchMove:function(m){if(!this.lastTouch){return}var l=m.originalEvent.touches[0];this.lastTouch.x2=l.pageX;this.lastTouch.y2=l.pageY},docTouchStart:function(m){var l=m.originalEvent.touches[0];this.lastTouch={x1:l.pageX,y1:l.pageY,target:l.target}},enable:function(){if(this.disabled){if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}this.disabled=false}},getClosestMenu:function(m){var l=a(m).closest("ul");while(l.dataSM("in-mega")){l=l.parent().closest("ul")}return l[0]||null},getHeight:function(l){return this.getOffset(l,true)},getOffset:function(n,l){var m;if(n.css("display")=="none"){m={position:n[0].style.position,visibility:n[0].style.visibility};n.css({position:"absolute",visibility:"hidden"}).show()}var o=n[0].getBoundingClientRect&&n[0].getBoundingClientRect(),p=o&&(l?o.height||o.bottom-o.top:o.width||o.right-o.left);if(!p&&p!==0){p=l?n[0].offsetHeight:n[0].offsetWidth}if(m){n.hide().css(m)}return p},getStartZIndex:function(l){var m=parseInt(this[l?"$root":"$firstSub"].css("z-index"));if(!l&&isNaN(m)){m=parseInt(this.$root.css("z-index"))}return !isNaN(m)?m:1},getTouchPoint:function(l){return l.touches&&l.touches[0]||l.changedTouches&&l.changedTouches[0]||l},getViewport:function(l){var m=l?"Height":"Width",o=document.documentElement["client"+m],n=window["inner"+m];if(n){o=Math.min(o,n)}return o},getViewportHeight:function(){return this.getViewport(true)},getViewportWidth:function(){return this.getViewport()},getWidth:function(l){return this.getOffset(l)},handleEvents:function(){return !this.disabled&&this.isCSSOn()},handleItemEvents:function(l){return this.handleEvents()&&!this.isLinkInMegaMenu(l)},isCollapsible:function(){return this.$firstSub.css("position")=="static"},isCSSOn:function(){return this.$firstLink.css("display")=="block"},isFixed:function(){var l=this.$root.css("position")=="fixed";if(!l){this.$root.parentsUntil("body").each(function(){if(a(this).css("position")=="fixed"){l=true;return false}})}return l},isLinkInMegaMenu:function(l){return a(this.getClosestMenu(l[0])).hasClass("mega-menu")},isTouchMode:function(){return !f||this.opts.noMouseOver||this.isCollapsible()},itemActivate:function(p,l){var n=p.closest("ul"),q=n.dataSM("level");if(q>1&&(!this.activatedItems[q-2]||this.activatedItems[q-2][0]!=n.dataSM("parent-a")[0])){var m=this;a(n.parentsUntil("[data-smartmenus-id]","ul").get().reverse()).add(n).each(function(){m.itemActivate(a(this).dataSM("parent-a"))})}if(!this.isCollapsible()||l){this.menuHideSubMenus(!this.activatedItems[q-1]||this.activatedItems[q-1][0]!=p[0]?q-1:q)}this.activatedItems[q-1]=p;if(this.$root.triggerHandler("activate.smapi",p[0])===false){return}var o=p.dataSM("sub");if(o&&(this.isTouchMode()||(!this.opts.showOnClick||this.clickActivated))){this.menuShow(o)}},itemBlur:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}this.$root.triggerHandler("blur.smapi",l[0])},itemClick:function(o){var n=a(o.currentTarget);if(!this.handleItemEvents(n)){return}if(this.$touchScrollingSub&&this.$touchScrollingSub[0]==n.closest("ul")[0]){this.$touchScrollingSub=null;o.stopPropagation();return false}if(this.$root.triggerHandler("click.smapi",n[0])===false){return false}var p=a(o.target).is("span.sub-arrow"),m=n.dataSM("sub"),l=m?m.dataSM("level")==2:false;if(m&&!m.is(":visible")){if(this.opts.showOnClick&&l){this.clickActivated=true}this.itemActivate(n);if(m.is(":visible")){this.focusActivated=true;return false}}else{if(this.isCollapsible()&&p){this.itemActivate(n);this.menuHide(m);return false}}if(this.opts.showOnClick&&l||n.hasClass("disabled")||this.$root.triggerHandler("select.smapi",n[0])===false){return false}},itemDown:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}l.dataSM("mousedown",true)},itemEnter:function(n){var m=a(n.currentTarget);if(!this.handleItemEvents(m)){return}if(!this.isTouchMode()){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var l=this;this.showTimeout=setTimeout(function(){l.itemActivate(m)},this.opts.showOnClick&&m.closest("ul").dataSM("level")==1?1:this.opts.showTimeout)}this.$root.triggerHandler("mouseenter.smapi",m[0])},itemFocus:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(this.focusActivated&&(!this.isTouchMode()||!l.dataSM("mousedown"))&&(!this.activatedItems.length||this.activatedItems[this.activatedItems.length-1][0]!=l[0])){this.itemActivate(l,true)}this.$root.triggerHandler("focus.smapi",l[0])},itemLeave:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(!this.isTouchMode()){l[0].blur();if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}}l.removeDataSM("mousedown");this.$root.triggerHandler("mouseleave.smapi",l[0])},menuHide:function(m){if(this.$root.triggerHandler("beforehide.smapi",m[0])===false){return}m.stop(true,true);if(m.css("display")!="none"){var l=function(){m.css("z-index","")};if(this.isCollapsible()){if(this.opts.collapsibleHideFunction){this.opts.collapsibleHideFunction.call(this,m,l)}else{m.hide(this.opts.collapsibleHideDuration,l)}}else{if(this.opts.hideFunction){this.opts.hideFunction.call(this,m,l)}else{m.hide(this.opts.hideDuration,l)}}if(m.dataSM("ie-shim")){m.dataSM("ie-shim").remove().css({"-webkit-transform":"",transform:""})}if(m.dataSM("scroll")){this.menuScrollStop(m);m.css({"touch-action":"","-ms-touch-action":"","-webkit-transform":"",transform:""}).unbind(".smartmenus_scroll").removeDataSM("scroll").dataSM("scroll-arrows").hide()}m.dataSM("parent-a").removeClass("highlighted").attr("aria-expanded","false");m.attr({"aria-expanded":"false","aria-hidden":"true"});var n=m.dataSM("level");this.activatedItems.splice(n-1,1);this.visibleSubMenus.splice(a.inArray(m,this.visibleSubMenus),1);this.$root.triggerHandler("hide.smapi",m[0])}},menuHideAll:function(){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var m=this.opts.isPopup?1:0;for(var l=this.visibleSubMenus.length-1;l>=m;l--){this.menuHide(this.visibleSubMenus[l])}if(this.opts.isPopup){this.$root.stop(true,true);if(this.$root.is(":visible")){if(this.opts.hideFunction){this.opts.hideFunction.call(this,this.$root)}else{this.$root.hide(this.opts.hideDuration)}if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").remove()}}}this.activatedItems=[];this.visibleSubMenus=[];this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.$root.triggerHandler("hideAll.smapi")},menuHideSubMenus:function(n){for(var l=this.activatedItems.length-1;l>=n;l--){var m=this.activatedItems[l].dataSM("sub");if(m){this.menuHide(m)}}},menuIframeShim:function(l){if(e&&this.opts.overlapControlsInIE&&!l.dataSM("ie-shim")){l.dataSM("ie-shim",a("<iframe/>").attr({src:"javascript:0",tabindex:-9}).css({position:"absolute",top:"auto",left:"0",opacity:0,border:"0"}))}},menuInit:function(l){if(!l.dataSM("in-mega")){if(l.hasClass("mega-menu")){l.find("ul").dataSM("in-mega",true)}var q=2,m=l[0];while((m=m.parentNode.parentNode)!=this.$root[0]){q++}var n=l.prevAll("a").eq(-1);if(!n.length){n=l.prevAll().find("a").eq(-1)}n.addClass("has-submenu").dataSM("sub",l);l.dataSM("parent-a",n).dataSM("level",q).parent().dataSM("sub",l);var o=n.attr("id")||this.accessIdPrefix+(++this.idInc),p=l.attr("id")||this.accessIdPrefix+(++this.idInc);n.attr({id:o,"aria-haspopup":"true","aria-controls":p,"aria-expanded":"false"});l.attr({id:p,role:"group","aria-hidden":"true","aria-labelledby":o,"aria-expanded":"false"});if(this.opts.subIndicators){n[this.opts.subIndicatorsPos](this.$subArrow.clone())}}},menuPosition:function(K){var r=K.dataSM("parent-a"),D=r.closest("li"),E=D.parent(),l=K.dataSM("level"),t=this.getWidth(K),J=this.getHeight(K),u=r.offset(),o=u.left,m=u.top,q=this.getWidth(r),F=this.getHeight(r),H=a(window),v=H.scrollLeft(),s=H.scrollTop(),z=this.getViewportWidth(),L=this.getViewportHeight(),w=E.parent().is("[data-sm-horizontal-sub]")||l==2&&!E.hasClass("sm-vertical"),B=this.opts.rightToLeftSubMenus&&!D.is("[data-sm-reverse]")||!this.opts.rightToLeftSubMenus&&D.is("[data-sm-reverse]"),p=l==2?this.opts.mainMenuSubOffsetX:this.opts.subMenusSubOffsetX,n=l==2?this.opts.mainMenuSubOffsetY:this.opts.subMenusSubOffsetY,C,A;if(w){C=B?q-t-p:p;A=this.opts.bottomToTopSubMenus?-J-n:F+n}else{C=B?p-t:q-p;A=this.opts.bottomToTopSubMenus?F-n-J:n}if(this.opts.keepInViewport){var N=o+C,M=m+A;if(B&&N<v){C=w?v-N+C:q-p}else{if(!B&&N+t>v+z){C=w?v+z-t-N+C:p-t}}if(!w){if(J<L&&M+J>s+L){A+=s+L-J-M}else{if(J>=L||M<s){A+=s-M}}}if(w&&(M+J>s+L+0.49||M<s)||!w&&J>L+0.49){var G=this;if(!K.dataSM("scroll-arrows")){K.dataSM("scroll-arrows",a([a('<span class="scroll-up"><span class="scroll-up-arrow"></span></span>')[0],a('<span class="scroll-down"><span class="scroll-down-arrow"></span></span>')[0]]).bind({mouseenter:function(){K.dataSM("scroll").up=a(this).hasClass("scroll-up");G.menuScroll(K)},mouseleave:function(x){G.menuScrollStop(K);G.menuScrollOut(K,x)},"mousewheel DOMMouseScroll":function(x){x.preventDefault()}}).insertAfter(K))}var I=".smartmenus_scroll";K.dataSM("scroll",{y:this.cssTransforms3d?0:A-F,step:1,itemH:F,subH:J,arrowDownH:this.getHeight(K.dataSM("scroll-arrows").eq(1))}).bind(i([["mouseover",function(x){G.menuScrollOver(K,x)}],["mouseout",function(x){G.menuScrollOut(K,x)}],["mousewheel DOMMouseScroll",function(x){G.menuScrollMousewheel(K,x)}]],I)).dataSM("scroll-arrows").css({top:"auto",left:"0",marginLeft:C+(parseInt(K.css("border-left-width"))||0),width:t-(parseInt(K.css("border-left-width"))||0)-(parseInt(K.css("border-right-width"))||0),zIndex:K.css("z-index")}).eq(w&&this.opts.bottomToTopSubMenus?0:1).show();if(this.isFixed()){K.css({"touch-action":"none","-ms-touch-action":"none"}).bind(i([[d?"touchstart touchmove touchend":"pointerdown pointermove pointerup MSPointerDown MSPointerMove MSPointerUp",function(x){G.menuScrollTouch(K,x)}]],I))}}}K.css({top:"auto",left:"0",marginLeft:C,marginTop:A-F});this.menuIframeShim(K);if(K.dataSM("ie-shim")){K.dataSM("ie-shim").css({zIndex:K.css("z-index"),width:t,height:J,marginLeft:C,marginTop:A-F})}},menuScroll:function(r,m,n){var p=r.dataSM("scroll"),q=r.dataSM("scroll-arrows"),o=p.up?p.upEnd:p.downEnd,s;if(!m&&p.momentum){p.momentum*=0.92;s=p.momentum;if(s<0.5){this.menuScrollStop(r);return}}else{s=n||(m||!this.opts.scrollAccelerate?this.opts.scrollStep:Math.floor(p.step))}var l=r.dataSM("level");if(this.activatedItems[l-1]&&this.activatedItems[l-1].dataSM("sub")&&this.activatedItems[l-1].dataSM("sub").is(":visible")){this.menuHideSubMenus(l-1)}p.y=p.up&&o<=p.y||!p.up&&o>=p.y?p.y:(Math.abs(o-p.y)>s?p.y+(p.up?s:-s):o);r.add(r.dataSM("ie-shim")).css(this.cssTransforms3d?{"-webkit-transform":"translate3d(0, "+p.y+"px, 0)",transform:"translate3d(0, "+p.y+"px, 0)"}:{marginTop:p.y});if(f&&(p.up&&p.y>p.downEnd||!p.up&&p.y<p.upEnd)){q.eq(p.up?1:0).show()}if(p.y==o){if(f){q.eq(p.up?0:1).hide()}this.menuScrollStop(r)}else{if(!m){if(this.opts.scrollAccelerate&&p.step<this.opts.scrollStep){p.step+=0.2}var t=this;this.scrollTimeout=g(function(){t.menuScroll(r)})}}},menuScrollMousewheel:function(m,n){if(this.getClosestMenu(n.target)==m[0]){n=n.originalEvent;var l=(n.wheelDelta||-n.detail)>0;if(m.dataSM("scroll-arrows").eq(l?0:1).is(":visible")){m.dataSM("scroll").up=l;this.menuScroll(m,true)}}n.preventDefault()},menuScrollOut:function(l,m){if(f){if(!/^scroll-(up|down)/.test((m.relatedTarget||"").className)&&(l[0]!=m.relatedTarget&&!a.contains(l[0],m.relatedTarget)||this.getClosestMenu(m.relatedTarget)!=l[0])){l.dataSM("scroll-arrows").css("visibility","hidden")}}},menuScrollOver:function(n,o){if(f){if(!/^scroll-(up|down)/.test(o.target.className)&&this.getClosestMenu(o.target)==n[0]){this.menuScrollRefreshData(n);var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;n.dataSM("scroll-arrows").eq(0).css("margin-top",l).end().eq(1).css("margin-top",l+this.getViewportHeight()-m.arrowDownH).end().css("visibility","visible")}}},menuScrollRefreshData:function(n){var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;if(this.cssTransforms3d){l=-(parseFloat(n.css("margin-top"))-l)}a.extend(m,{upEnd:l,downEnd:l+this.getViewportHeight()-m.subH})},menuScrollStop:function(l){if(this.scrollTimeout){c(this.scrollTimeout);this.scrollTimeout=0;l.dataSM("scroll").step=1;return true}},menuScrollTouch:function(p,q){q=q.originalEvent;if(j(q)){var m=this.getTouchPoint(q);if(this.getClosestMenu(m.target)==p[0]){var o=p.dataSM("scroll");if(/(start|down)$/i.test(q.type)){if(this.menuScrollStop(p)){q.preventDefault();this.$touchScrollingSub=p}else{this.$touchScrollingSub=null}this.menuScrollRefreshData(p);a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}else{if(/move$/i.test(q.type)){var n=o.touchY!==undefined?o.touchY:o.touchStartY;if(n!==undefined&&n!=m.pageY){this.$touchScrollingSub=p;var l=n<m.pageY;if(o.up!==undefined&&o.up!=l){a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}a.extend(o,{up:l,touchY:m.pageY});this.menuScroll(p,true,Math.abs(m.pageY-n))}q.preventDefault()}else{if(o.touchY!==undefined){if(o.momentum=Math.pow(Math.abs(m.pageY-o.touchStartY)/(q.timeStamp-o.touchStartTime),2)*15){this.menuScrollStop(p);this.menuScroll(p);q.preventDefault()}delete o.touchY}}}}}},menuShow:function(n){if(!n.dataSM("beforefirstshowfired")){n.dataSM("beforefirstshowfired",true);if(this.$root.triggerHandler("beforefirstshow.smapi",n[0])===false){return}}if(this.$root.triggerHandler("beforeshow.smapi",n[0])===false){return}n.dataSM("shown-before",true).stop(true,true);if(!n.is(":visible")){var m=n.dataSM("parent-a");if(this.opts.keepHighlighted||this.isCollapsible()){m.addClass("highlighted")}if(this.isCollapsible()){n.removeClass("sm-nowrap").css({zIndex:"",width:"auto",minWidth:"",maxWidth:"",top:"",left:"",marginLeft:"",marginTop:""})}else{n.css("z-index",this.zIndexInc=(this.zIndexInc||this.getStartZIndex())+1);if(this.opts.subMenusMinWidth||this.opts.subMenusMaxWidth){n.css({width:"auto",minWidth:"",maxWidth:""}).addClass("sm-nowrap");if(this.opts.subMenusMinWidth){n.css("min-width",this.opts.subMenusMinWidth)}if(this.opts.subMenusMaxWidth){var o=this.getWidth(n);n.css("max-width",this.opts.subMenusMaxWidth);if(o>this.getWidth(n)){n.removeClass("sm-nowrap").css("width",this.opts.subMenusMaxWidth)}}}this.menuPosition(n);if(n.dataSM("ie-shim")){n.dataSM("ie-shim").insertBefore(n)}}var l=function(){n.css("overflow","")};if(this.isCollapsible()){if(this.opts.collapsibleShowFunction){this.opts.collapsibleShowFunction.call(this,n,l)}else{n.show(this.opts.collapsibleShowDuration,l)}}else{if(this.opts.showFunction){this.opts.showFunction.call(this,n,l)}else{n.show(this.opts.showDuration,l)}}m.attr("aria-expanded","true");n.attr({"aria-expanded":"true","aria-hidden":"false"});this.visibleSubMenus.push(n);this.$root.triggerHandler("show.smapi",n[0])}},popupHide:function(l){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var m=this;this.hideTimeout=setTimeout(function(){m.menuHideAll()},l?1:this.opts.hideTimeout)},popupShow:function(o,n){if(!this.opts.isPopup){alert('SmartMenus jQuery Error:\n\nIf you want to show this menu via the "popupShow" method, set the isPopup:true option.');return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}this.$root.dataSM("shown-before",true).stop(true,true);if(!this.$root.is(":visible")){this.$root.css({left:o,top:n});this.menuIframeShim(this.$root);if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").css({zIndex:this.$root.css("z-index"),width:this.getWidth(this.$root),height:this.getHeight(this.$root),left:o,top:n}).insertBefore(this.$root)}var m=this,l=function(){m.$root.css("overflow","")};if(this.opts.showFunction){this.opts.showFunction.call(this,this.$root,l)}else{this.$root.show(this.opts.showDuration,l)}this.visibleSubMenus[0]=this.$root}},refresh:function(){this.destroy(true);this.init(true)},rootKeyDown:function(o){if(!this.handleEvents()){return}switch(o.keyCode){case 27:var m=this.activatedItems[0];if(m){this.menuHideAll();m[0].focus();var n=m.dataSM("sub");if(n){this.menuHide(n)}}break;case 32:var l=a(o.target);if(l.is("a")&&this.handleItemEvents(l)){var n=l.dataSM("sub");if(n&&!n.is(":visible")){this.itemClick({currentTarget:o.target});o.preventDefault()}}break}},rootOut:function(m){if(!this.handleEvents()||this.isTouchMode()||m.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}if(!this.opts.showOnClick||!this.opts.hideOnClick){var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},this.opts.hideTimeout)}},rootOver:function(l){if(!this.handleEvents()||this.isTouchMode()||l.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}},winResize:function(m){if(!this.handleEvents()){if(this.$disableOverlay){var n=this.$root.offset();this.$disableOverlay.css({top:n.top,left:n.left,width:this.$root.outerWidth(),height:this.$root.outerHeight()})}return}if(!("onorientationchange" in window)||m.type=="orientationchange"){var l=this.isCollapsible();if(!(this.wasCollapsible&&l)){if(this.activatedItems.length){this.activatedItems[this.activatedItems.length-1][0].blur()}this.menuHideAll()}this.wasCollapsible=l}}}});a.fn.dataSM=function(l,m){if(m){return this.data(l+"_smartmenus",m)}return this.data(l+"_smartmenus")};a.fn.removeDataSM=function(l){return this.removeData(l+"_smartmenus")};a.fn.smartmenus=function(m){if(typeof m=="string"){var l=arguments,o=m;Array.prototype.shift.call(l);return this.each(function(){var p=a(this).data("smartmenus");if(p&&p[o]){p[o].apply(p,l)}})}var n=a.extend({},a.fn.smartmenus.defaults,m);return this.each(function(){new a.SmartMenus(this,n)})};a.fn.smartmenus.defaults={isPopup:false,mainMenuSubOffsetX:0,mainMenuSubOffsetY:0,subMenusSubOffsetX:0,subMenusSubOffsetY:0,subMenusMinWidth:"10em",subMenusMaxWidth:"20em",subIndicators:true,subIndicatorsPos:"prepend",subIndicatorsText:"+",scrollStep:30,scrollAccelerate:true,showTimeout:250,hideTimeout:500,showDuration:0,showFunction:null,hideDuration:0,hideFunction:function(m,l){m.fadeOut(200,l)},collapsibleShowDuration:0,collapsibleShowFunction:function(m,l){m.slideDown(200,l)},collapsibleHideDuration:0,collapsibleHideFunction:function(m,l){m.slideUp(200,l)},showOnClick:false,hideOnClick:true,noMouseOver:false,keepInViewport:true,keepHighlighted:true,markCurrentItem:false,markCurrentTree:true,rightToLeftSubMenus:false,bottomToTopSubMenus:false,overlapControlsInIE:true};return a}));
\ No newline at end of file
diff --git a/docs/html/main_8cpp.html b/docs/html/main_8cpp.html
deleted file mode 100644
index 314d19a7492911e08e8f94bdd8d3e3ea2bcc8c1b..0000000000000000000000000000000000000000
--- a/docs/html/main_8cpp.html
+++ /dev/null
@@ -1,92 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta http-equiv="X-UA-Compatible" content="IE=9"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<meta name="viewport" content="width=device-width, initial-scale=1"/>
-<title>My Project: main.cpp File Reference</title>
-<link href="tabs.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="jquery.js"></script>
-<script type="text/javascript" src="dynsections.js"></script>
-<link href="search/search.css" rel="stylesheet" type="text/css"/>
-<script type="text/javascript" src="search/searchdata.js"></script>
-<script type="text/javascript" src="search/search.js"></script>
-<link href="doxygen.css" rel="stylesheet" type="text/css" />
-</head>
-<body>
-<div id="top"><!-- do not remove this div, it is closed by doxygen! -->
-<div id="titlearea">
-<table cellspacing="0" cellpadding="0">
- <tbody>
- <tr style="height: 56px;">
- <td id="projectalign" style="padding-left: 0.5em;">
- <div id="projectname">My Project
- </div>
- </td>
- </tr>
- </tbody>
-</table>
-</div>
-<!-- end header part -->
-<!-- Generated by Doxygen 1.8.15 -->
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-var searchBox = new SearchBox("searchBox", "search",false,'Search');
-/* @license-end */
-</script>
-<script type="text/javascript" src="menudata.js"></script>
-<script type="text/javascript" src="menu.js"></script>
-<script type="text/javascript">
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-$(function() {
- initMenu('',true,false,'search.php','Search');
- $(document).ready(function() { init_search(); });
-});
-/* @license-end */</script>
-<div id="main-nav"></div>
-<!-- window showing the filter options -->
-<div id="MSearchSelectWindow"
- onmouseover="return searchBox.OnSearchSelectShow()"
- onmouseout="return searchBox.OnSearchSelectHide()"
- onkeydown="return searchBox.OnSearchSelectKey(event)">
-</div>
-
-<!-- iframe showing the search results (closed by default) -->
-<div id="MSearchResultsWindow">
-<iframe src="javascript:void(0)" frameborder="0"
- name="MSearchResults" id="MSearchResults">
-</iframe>
-</div>
-
-</div><!-- top -->
-<div class="header">
- <div class="summary">
-<a href="#func-members">Functions</a> </div>
- <div class="headertitle">
-<div class="title">main.cpp File Reference</div> </div>
-</div><!--header-->
-<div class="contents">
-
-<p>A file that contains the main functions, which starts all the algorithm.
-<a href="#details">More...</a></p>
-<div class="textblock"><code>#include "<a class="el" href="_factor_oracle_8h_source.html">FactorOracle.h</a>"</code><br />
-</div><table class="memberdecls">
-<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="func-members"></a>
-Functions</h2></td></tr>
-<tr class="memitem:ae66f6b31b5ad750f1fe042a706a4e3d4"><td class="memItemLeft" align="right" valign="top"><a id="ae66f6b31b5ad750f1fe042a706a4e3d4"></a>
-int </td><td class="memItemRight" valign="bottom"><b>main</b> ()</td></tr>
-<tr class="separator:ae66f6b31b5ad750f1fe042a706a4e3d4"><td class="memSeparator" colspan="2"> </td></tr>
-</table>
-<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2>
-<div class="textblock"><p>A file that contains the main functions, which starts all the algorithm. </p>
-<p>One functions: main. </p>
-</div></div><!-- contents -->
-<!-- start footer part -->
-<hr class="footer"/><address class="footer"><small>
-Generated by  <a href="http://www.doxygen.org/index.html">
-<img class="footer" src="doxygen.png" alt="doxygen"/>
-</a> 1.8.15
-</small></address>
-</body>
-</html>
diff --git a/docs/html/menu.js b/docs/html/menu.js
deleted file mode 100644
index 433c15b8f01814eb5f5ee0e9bba623e07fc04cb2..0000000000000000000000000000000000000000
--- a/docs/html/menu.js
+++ /dev/null
@@ -1,50 +0,0 @@
-/*
- @licstart The following is the entire license notice for the
- JavaScript code in this file.
-
- Copyright (C) 1997-2017 by Dimitri van Heesch
-
- This program is free software; you can redistribute it and/or modify
- it under the terms of the GNU General Public License as published by
- the Free Software Foundation; either version 2 of the License, or
- (at your option) any later version.
-
- This program is distributed in the hope that it will be useful,
- but WITHOUT ANY WARRANTY; without even the implied warranty of
- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
- GNU General Public License for more details.
-
- You should have received a copy of the GNU General Public License along
- with this program; if not, write to the Free Software Foundation, Inc.,
- 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
- @licend The above is the entire license notice
- for the JavaScript code in this file
- */
-function initMenu(relPath,searchEnabled,serverSide,searchPage,search) {
- function makeTree(data,relPath) {
- var result='';
- if ('children' in data) {
- result+='<ul>';
- for (var i in data.children) {
- result+='<li><a href="'+relPath+data.children[i].url+'">'+
- data.children[i].text+'</a>'+
- makeTree(data.children[i],relPath)+'</li>';
- }
- result+='</ul>';
- }
- return result;
- }
-
- $('#main-nav').append(makeTree(menudata,relPath));
- $('#main-nav').children(':first').addClass('sm sm-dox').attr('id','main-menu');
- if (searchEnabled) {
- if (serverSide) {
- $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><div class="left"><form id="FSearchBox" action="'+relPath+searchPage+'" method="get"><img id="MSearchSelect" src="'+relPath+'search/mag.png" alt=""/><input type="text" id="MSearchField" name="query" value="'+search+'" size="20" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)"></form></div><div class="right"></div></div></li>');
- } else {
- $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><span class="left"><img id="MSearchSelect" src="'+relPath+'search/mag_sel.png" onmouseover="return searchBox.OnSearchSelectShow()" onmouseout="return searchBox.OnSearchSelectHide()" alt=""/><input type="text" id="MSearchField" value="'+search+'" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)" onkeyup="searchBox.OnSearchFieldChange(event)"/></span><span class="right"><a id="MSearchClose" href="javascript:searchBox.CloseResultsWindow()"><img id="MSearchCloseImg" border="0" src="'+relPath+'search/close.png" alt=""/></a></span></div></li>');
- }
- }
- $('#main-menu').smartmenus();
-}
-/* @license-end */
diff --git a/docs/html/menudata.js b/docs/html/menudata.js
deleted file mode 100644
index e3035505b5eae494ebca183d65bf94c53a588be9..0000000000000000000000000000000000000000
--- a/docs/html/menudata.js
+++ /dev/null
@@ -1,34 +0,0 @@
-/*
-@ @licstart The following is the entire license notice for the
-JavaScript code in this file.
-
-Copyright (C) 1997-2017 by Dimitri van Heesch
-
-This program is free software; you can redistribute it and/or modify
-it under the terms of the GNU General Public License as published by
-the Free Software Foundation; either version 2 of the License, or
-(at your option) any later version.
-
-This program is distributed in the hope that it will be useful,
-but WITHOUT ANY WARRANTY; without even the implied warranty of
- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
- GNU General Public License for more details.
-
-You should have received a copy of the GNU General Public License along
-with this program; if not, write to the Free Software Foundation, Inc.,
-51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
-@licend The above is the entire license notice
-for the JavaScript code in this file
-*/
-var menudata={children:[
-{text:"Main Page",url:"index.html"},
-{text:"Classes",url:"annotated.html",children:[
-{text:"Class List",url:"annotated.html"},
-{text:"Class Index",url:"classes.html"},
-{text:"Class Members",url:"functions.html",children:[
-{text:"All",url:"functions.html"},
-{text:"Functions",url:"functions_func.html"},
-{text:"Variables",url:"functions_vars.html"}]}]},
-{text:"Files",url:"files.html",children:[
-{text:"File List",url:"files.html"}]}]}
diff --git a/docs/html/nav_f.png b/docs/html/nav_f.png
deleted file mode 100644
index 72a58a529ed3a9ed6aa0c51a79cf207e026deee2..0000000000000000000000000000000000000000
Binary files a/docs/html/nav_f.png and /dev/null differ
diff --git a/docs/html/nav_g.png b/docs/html/nav_g.png
deleted file mode 100644
index 2093a237a94f6c83e19ec6e5fd42f7ddabdafa81..0000000000000000000000000000000000000000
Binary files a/docs/html/nav_g.png and /dev/null differ
diff --git a/docs/html/nav_h.png b/docs/html/nav_h.png
deleted file mode 100644
index 33389b101d9cd9b4c98ad286b5d9c46a6671f650..0000000000000000000000000000000000000000
Binary files a/docs/html/nav_h.png and /dev/null differ
diff --git a/docs/html/open.png b/docs/html/open.png
deleted file mode 100644
index 30f75c7efe2dd0c9e956e35b69777a02751f048b..0000000000000000000000000000000000000000
Binary files a/docs/html/open.png and /dev/null differ
diff --git a/docs/html/search/all_0.html b/docs/html/search/all_0.html
deleted file mode 100644
index 5330204c2c9385c1ecc09d4c617d84e63ac1f58f..0000000000000000000000000000000000000000
--- a/docs/html/search/all_0.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="all_0.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/all_0.js b/docs/html/search/all_0.js
deleted file mode 100644
index b55324c9cbe1e2342e47f7490bed9d4eccc58986..0000000000000000000000000000000000000000
--- a/docs/html/search/all_0.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['addletter',['AddLetter',['../class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db',1,'FactorOracle']]]
-];
diff --git a/docs/html/search/all_1.html b/docs/html/search/all_1.html
deleted file mode 100644
index 2f46793669134fa7b331c6fb238987472e869d1e..0000000000000000000000000000000000000000
--- a/docs/html/search/all_1.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="all_1.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/all_1.js b/docs/html/search/all_1.js
deleted file mode 100644
index 1feb27c9d44c7b39b6bb6a3ea0b4001084493128..0000000000000000000000000000000000000000
--- a/docs/html/search/all_1.js
+++ /dev/null
@@ -1,10 +0,0 @@
-var searchData=
-[
- ['factororacle',['FactorOracle',['../class_factor_oracle.html',1,'']]],
- ['factororacle_2ecpp',['FactorOracle.cpp',['../_factor_oracle_8cpp.html',1,'']]],
- ['factororacle_2eh',['FactorOracle.h',['../_factor_oracle_8h.html',1,'']]],
- ['factororaclestart',['FactorOracleStart',['../class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f',1,'FactorOracle']]],
- ['findbetter',['FindBetter',['../class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50',1,'FactorOracle']]],
- ['first_5fstate_5f',['first_state_',['../class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6',1,'SingleTransition']]],
- ['fogenerate',['FOGenerate',['../class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390',1,'FactorOracle']]]
-];
diff --git a/docs/html/search/all_2.html b/docs/html/search/all_2.html
deleted file mode 100644
index 4c33d85574a614977e50b78fb110145282e259e8..0000000000000000000000000000000000000000
--- a/docs/html/search/all_2.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="all_2.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/all_2.js b/docs/html/search/all_2.js
deleted file mode 100644
index 3a78109e25e392b82de81e6da93bd0efe2973a07..0000000000000000000000000000000000000000
--- a/docs/html/search/all_2.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['last_5fstate_5f',['last_state_',['../class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69',1,'SingleTransition']]]
-];
diff --git a/docs/html/search/all_3.html b/docs/html/search/all_3.html
deleted file mode 100644
index b634070bc727268b5df07cf78569fe35f3afbd26..0000000000000000000000000000000000000000
--- a/docs/html/search/all_3.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="all_3.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/all_3.js b/docs/html/search/all_3.js
deleted file mode 100644
index c93faff152cf0159d702f29fde2f99ca41c02710..0000000000000000000000000000000000000000
--- a/docs/html/search/all_3.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['main_2ecpp',['main.cpp',['../main_8cpp.html',1,'']]]
-];
diff --git a/docs/html/search/all_4.html b/docs/html/search/all_4.html
deleted file mode 100644
index dd062aeaeed1812cf81a1b380ce312fcfa4913ec..0000000000000000000000000000000000000000
--- a/docs/html/search/all_4.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="all_4.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/all_4.js b/docs/html/search/all_4.js
deleted file mode 100644
index fdcca205c57f624298a67b3898fdec9ded2d50e9..0000000000000000000000000000000000000000
--- a/docs/html/search/all_4.js
+++ /dev/null
@@ -1,8 +0,0 @@
-var searchData=
-[
- ['singletransition',['SingleTransition',['../class_single_transition.html',1,'']]],
- ['state',['State',['../class_state.html',1,'']]],
- ['state_5f',['state_',['../class_state.html#a2dcf672a1560830a8f93b0e9863c6724',1,'State']]],
- ['states_5f',['states_',['../class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d',1,'FactorOracle']]],
- ['symbol_5f',['symbol_',['../class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9',1,'SingleTransition']]]
-];
diff --git a/docs/html/search/all_5.html b/docs/html/search/all_5.html
deleted file mode 100644
index f0780fdd34885b6ac6853d8d1ff64541586d26ab..0000000000000000000000000000000000000000
--- a/docs/html/search/all_5.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="all_5.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/all_5.js b/docs/html/search/all_5.js
deleted file mode 100644
index c20449e777ef00666cfaa350916cfb47c9add63d..0000000000000000000000000000000000000000
--- a/docs/html/search/all_5.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['transition_5f',['transition_',['../class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8',1,'State']]]
-];
diff --git a/docs/html/search/classes_0.html b/docs/html/search/classes_0.html
deleted file mode 100644
index b3c6ec6af3ec1e40d80c36e9f7d50dd88d134bb4..0000000000000000000000000000000000000000
--- a/docs/html/search/classes_0.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="classes_0.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/classes_0.js b/docs/html/search/classes_0.js
deleted file mode 100644
index acf44460e45d0510e56719aae4c701e4b5031c26..0000000000000000000000000000000000000000
--- a/docs/html/search/classes_0.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['factororacle',['FactorOracle',['../class_factor_oracle.html',1,'']]]
-];
diff --git a/docs/html/search/classes_1.html b/docs/html/search/classes_1.html
deleted file mode 100644
index b744c4d15f69fa15e3f1511126c32d9a81f83332..0000000000000000000000000000000000000000
--- a/docs/html/search/classes_1.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="classes_1.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/classes_1.js b/docs/html/search/classes_1.js
deleted file mode 100644
index 2638cbf0fdfd1148c504e0754027d740901d2c3b..0000000000000000000000000000000000000000
--- a/docs/html/search/classes_1.js
+++ /dev/null
@@ -1,5 +0,0 @@
-var searchData=
-[
- ['singletransition',['SingleTransition',['../class_single_transition.html',1,'']]],
- ['state',['State',['../class_state.html',1,'']]]
-];
diff --git a/docs/html/search/close.png b/docs/html/search/close.png
deleted file mode 100644
index 9342d3dfeea7b7c4ee610987e717804b5a42ceb9..0000000000000000000000000000000000000000
Binary files a/docs/html/search/close.png and /dev/null differ
diff --git a/docs/html/search/files_0.html b/docs/html/search/files_0.html
deleted file mode 100644
index 40cd4554390821f622e682e89088a9114a4b22dc..0000000000000000000000000000000000000000
--- a/docs/html/search/files_0.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="files_0.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/files_0.js b/docs/html/search/files_0.js
deleted file mode 100644
index c5991db20cac5ecc546fc950ee95074c3a1e66d9..0000000000000000000000000000000000000000
--- a/docs/html/search/files_0.js
+++ /dev/null
@@ -1,5 +0,0 @@
-var searchData=
-[
- ['factororacle_2ecpp',['FactorOracle.cpp',['../_factor_oracle_8cpp.html',1,'']]],
- ['factororacle_2eh',['FactorOracle.h',['../_factor_oracle_8h.html',1,'']]]
-];
diff --git a/docs/html/search/files_1.html b/docs/html/search/files_1.html
deleted file mode 100644
index 646d1f4cc552e09bc89f57073aa189ea1b7bc75b..0000000000000000000000000000000000000000
--- a/docs/html/search/files_1.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="files_1.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/files_1.js b/docs/html/search/files_1.js
deleted file mode 100644
index c93faff152cf0159d702f29fde2f99ca41c02710..0000000000000000000000000000000000000000
--- a/docs/html/search/files_1.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['main_2ecpp',['main.cpp',['../main_8cpp.html',1,'']]]
-];
diff --git a/docs/html/search/functions_0.html b/docs/html/search/functions_0.html
deleted file mode 100644
index bc73761f526691046ebe143ee37064bd3c9937f4..0000000000000000000000000000000000000000
--- a/docs/html/search/functions_0.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="functions_0.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/functions_0.js b/docs/html/search/functions_0.js
deleted file mode 100644
index b55324c9cbe1e2342e47f7490bed9d4eccc58986..0000000000000000000000000000000000000000
--- a/docs/html/search/functions_0.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['addletter',['AddLetter',['../class_factor_oracle.html#ae10b4d001c338a73f0f44079e842e7db',1,'FactorOracle']]]
-];
diff --git a/docs/html/search/functions_1.html b/docs/html/search/functions_1.html
deleted file mode 100644
index bfcf880be9e64711e057e7a7b5b4aa4532eea22f..0000000000000000000000000000000000000000
--- a/docs/html/search/functions_1.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="functions_1.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/functions_1.js b/docs/html/search/functions_1.js
deleted file mode 100644
index 85622473a791caa5f1dd59fb172fbba9d3a956c5..0000000000000000000000000000000000000000
--- a/docs/html/search/functions_1.js
+++ /dev/null
@@ -1,6 +0,0 @@
-var searchData=
-[
- ['factororaclestart',['FactorOracleStart',['../class_factor_oracle.html#a070d7b00cfcb658c5d13ff275ceae01f',1,'FactorOracle']]],
- ['findbetter',['FindBetter',['../class_factor_oracle.html#a28d2e85676712f983b1dcba83ae07d50',1,'FactorOracle']]],
- ['fogenerate',['FOGenerate',['../class_factor_oracle.html#abe8c4c194b309aeeff1bc05c25563390',1,'FactorOracle']]]
-];
diff --git a/docs/html/search/mag_sel.png b/docs/html/search/mag_sel.png
deleted file mode 100644
index 39c0ed52a25dd9d080ee0d42ae6c6042bdfa04d7..0000000000000000000000000000000000000000
Binary files a/docs/html/search/mag_sel.png and /dev/null differ
diff --git a/docs/html/search/nomatches.html b/docs/html/search/nomatches.html
deleted file mode 100644
index 4377320895b9a5b98e140ebf2f76ec09158d1156..0000000000000000000000000000000000000000
--- a/docs/html/search/nomatches.html
+++ /dev/null
@@ -1,12 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="NoMatches">No Matches</div>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/search.css b/docs/html/search/search.css
deleted file mode 100644
index 3cf9df94a419c3175edbf2ca1719a2deb7a497dd..0000000000000000000000000000000000000000
--- a/docs/html/search/search.css
+++ /dev/null
@@ -1,271 +0,0 @@
-/*---------------- Search Box */
-
-#FSearchBox {
- float: left;
-}
-
-#MSearchBox {
- white-space : nowrap;
- float: none;
- margin-top: 8px;
- right: 0px;
- width: 170px;
- height: 24px;
- z-index: 102;
-}
-
-#MSearchBox .left
-{
- display:block;
- position:absolute;
- left:10px;
- width:20px;
- height:19px;
- background:url('search_l.png') no-repeat;
- background-position:right;
-}
-
-#MSearchSelect {
- display:block;
- position:absolute;
- width:20px;
- height:19px;
-}
-
-.left #MSearchSelect {
- left:4px;
-}
-
-.right #MSearchSelect {
- right:5px;
-}
-
-#MSearchField {
- display:block;
- position:absolute;
- height:19px;
- background:url('search_m.png') repeat-x;
- border:none;
- width:115px;
- margin-left:20px;
- padding-left:4px;
- color: #909090;
- outline: none;
- font: 9pt Arial, Verdana, sans-serif;
- -webkit-border-radius: 0px;
-}
-
-#FSearchBox #MSearchField {
- margin-left:15px;
-}
-
-#MSearchBox .right {
- display:block;
- position:absolute;
- right:10px;
- top:8px;
- width:20px;
- height:19px;
- background:url('search_r.png') no-repeat;
- background-position:left;
-}
-
-#MSearchClose {
- display: none;
- position: absolute;
- top: 4px;
- background : none;
- border: none;
- margin: 0px 4px 0px 0px;
- padding: 0px 0px;
- outline: none;
-}
-
-.left #MSearchClose {
- left: 6px;
-}
-
-.right #MSearchClose {
- right: 2px;
-}
-
-.MSearchBoxActive #MSearchField {
- color: #000000;
-}
-
-/*---------------- Search filter selection */
-
-#MSearchSelectWindow {
- display: none;
- position: absolute;
- left: 0; top: 0;
- border: 1px solid #90A5CE;
- background-color: #F9FAFC;
- z-index: 10001;
- padding-top: 4px;
- padding-bottom: 4px;
- -moz-border-radius: 4px;
- -webkit-border-top-left-radius: 4px;
- -webkit-border-top-right-radius: 4px;
- -webkit-border-bottom-left-radius: 4px;
- -webkit-border-bottom-right-radius: 4px;
- -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
-}
-
-.SelectItem {
- font: 8pt Arial, Verdana, sans-serif;
- padding-left: 2px;
- padding-right: 12px;
- border: 0px;
-}
-
-span.SelectionMark {
- margin-right: 4px;
- font-family: monospace;
- outline-style: none;
- text-decoration: none;
-}
-
-a.SelectItem {
- display: block;
- outline-style: none;
- color: #000000;
- text-decoration: none;
- padding-left: 6px;
- padding-right: 12px;
-}
-
-a.SelectItem:focus,
-a.SelectItem:active {
- color: #000000;
- outline-style: none;
- text-decoration: none;
-}
-
-a.SelectItem:hover {
- color: #FFFFFF;
- background-color: #3D578C;
- outline-style: none;
- text-decoration: none;
- cursor: pointer;
- display: block;
-}
-
-/*---------------- Search results window */
-
-iframe#MSearchResults {
- width: 60ex;
- height: 15em;
-}
-
-#MSearchResultsWindow {
- display: none;
- position: absolute;
- left: 0; top: 0;
- border: 1px solid #000;
- background-color: #EEF1F7;
- z-index:10000;
-}
-
-/* ----------------------------------- */
-
-
-#SRIndex {
- clear:both;
- padding-bottom: 15px;
-}
-
-.SREntry {
- font-size: 10pt;
- padding-left: 1ex;
-}
-
-.SRPage .SREntry {
- font-size: 8pt;
- padding: 1px 5px;
-}
-
-body.SRPage {
- margin: 5px 2px;
-}
-
-.SRChildren {
- padding-left: 3ex; padding-bottom: .5em
-}
-
-.SRPage .SRChildren {
- display: none;
-}
-
-.SRSymbol {
- font-weight: bold;
- color: #425E97;
- font-family: Arial, Verdana, sans-serif;
- text-decoration: none;
- outline: none;
-}
-
-a.SRScope {
- display: block;
- color: #425E97;
- font-family: Arial, Verdana, sans-serif;
- text-decoration: none;
- outline: none;
-}
-
-a.SRSymbol:focus, a.SRSymbol:active,
-a.SRScope:focus, a.SRScope:active {
- text-decoration: underline;
-}
-
-span.SRScope {
- padding-left: 4px;
-}
-
-.SRPage .SRStatus {
- padding: 2px 5px;
- font-size: 8pt;
- font-style: italic;
-}
-
-.SRResult {
- display: none;
-}
-
-DIV.searchresults {
- margin-left: 10px;
- margin-right: 10px;
-}
-
-/*---------------- External search page results */
-
-.searchresult {
- background-color: #F0F3F8;
-}
-
-.pages b {
- color: white;
- padding: 5px 5px 3px 5px;
- background-image: url("../tab_a.png");
- background-repeat: repeat-x;
- text-shadow: 0 1px 1px #000000;
-}
-
-.pages {
- line-height: 17px;
- margin-left: 4px;
- text-decoration: none;
-}
-
-.hl {
- font-weight: bold;
-}
-
-#searchresults {
- margin-bottom: 20px;
-}
-
-.searchpages {
- margin-top: 10px;
-}
-
diff --git a/docs/html/search/search.js b/docs/html/search/search.js
deleted file mode 100644
index a554ab9cb5265ccf73adf8a7d278827ff8b2fbdd..0000000000000000000000000000000000000000
--- a/docs/html/search/search.js
+++ /dev/null
@@ -1,814 +0,0 @@
-/*
- @licstart The following is the entire license notice for the
- JavaScript code in this file.
-
- Copyright (C) 1997-2017 by Dimitri van Heesch
-
- This program is free software; you can redistribute it and/or modify
- it under the terms of the GNU General Public License as published by
- the Free Software Foundation; either version 2 of the License, or
- (at your option) any later version.
-
- This program is distributed in the hope that it will be useful,
- but WITHOUT ANY WARRANTY; without even the implied warranty of
- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
- GNU General Public License for more details.
-
- You should have received a copy of the GNU General Public License along
- with this program; if not, write to the Free Software Foundation, Inc.,
- 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
- @licend The above is the entire license notice
- for the JavaScript code in this file
- */
-function convertToId(search)
-{
- var result = '';
- for (i=0;i<search.length;i++)
- {
- var c = search.charAt(i);
- var cn = c.charCodeAt(0);
- if (c.match(/[a-z0-9\u0080-\uFFFF]/))
- {
- result+=c;
- }
- else if (cn<16)
- {
- result+="_0"+cn.toString(16);
- }
- else
- {
- result+="_"+cn.toString(16);
- }
- }
- return result;
-}
-
-function getXPos(item)
-{
- var x = 0;
- if (item.offsetWidth)
- {
- while (item && item!=document.body)
- {
- x += item.offsetLeft;
- item = item.offsetParent;
- }
- }
- return x;
-}
-
-function getYPos(item)
-{
- var y = 0;
- if (item.offsetWidth)
- {
- while (item && item!=document.body)
- {
- y += item.offsetTop;
- item = item.offsetParent;
- }
- }
- return y;
-}
-
-/* A class handling everything associated with the search panel.
-
- Parameters:
- name - The name of the global variable that will be
- storing this instance. Is needed to be able to set timeouts.
- resultPath - path to use for external files
-*/
-function SearchBox(name, resultsPath, inFrame, label)
-{
- if (!name || !resultsPath) { alert("Missing parameters to SearchBox."); }
-
- // ---------- Instance variables
- this.name = name;
- this.resultsPath = resultsPath;
- this.keyTimeout = 0;
- this.keyTimeoutLength = 500;
- this.closeSelectionTimeout = 300;
- this.lastSearchValue = "";
- this.lastResultsPage = "";
- this.hideTimeout = 0;
- this.searchIndex = 0;
- this.searchActive = false;
- this.insideFrame = inFrame;
- this.searchLabel = label;
-
- // ----------- DOM Elements
-
- this.DOMSearchField = function()
- { return document.getElementById("MSearchField"); }
-
- this.DOMSearchSelect = function()
- { return document.getElementById("MSearchSelect"); }
-
- this.DOMSearchSelectWindow = function()
- { return document.getElementById("MSearchSelectWindow"); }
-
- this.DOMPopupSearchResults = function()
- { return document.getElementById("MSearchResults"); }
-
- this.DOMPopupSearchResultsWindow = function()
- { return document.getElementById("MSearchResultsWindow"); }
-
- this.DOMSearchClose = function()
- { return document.getElementById("MSearchClose"); }
-
- this.DOMSearchBox = function()
- { return document.getElementById("MSearchBox"); }
-
- // ------------ Event Handlers
-
- // Called when focus is added or removed from the search field.
- this.OnSearchFieldFocus = function(isActive)
- {
- this.Activate(isActive);
- }
-
- this.OnSearchSelectShow = function()
- {
- var searchSelectWindow = this.DOMSearchSelectWindow();
- var searchField = this.DOMSearchSelect();
-
- if (this.insideFrame)
- {
- var left = getXPos(searchField);
- var top = getYPos(searchField);
- left += searchField.offsetWidth + 6;
- top += searchField.offsetHeight;
-
- // show search selection popup
- searchSelectWindow.style.display='block';
- left -= searchSelectWindow.offsetWidth;
- searchSelectWindow.style.left = left + 'px';
- searchSelectWindow.style.top = top + 'px';
- }
- else
- {
- var left = getXPos(searchField);
- var top = getYPos(searchField);
- top += searchField.offsetHeight;
-
- // show search selection popup
- searchSelectWindow.style.display='block';
- searchSelectWindow.style.left = left + 'px';
- searchSelectWindow.style.top = top + 'px';
- }
-
- // stop selection hide timer
- if (this.hideTimeout)
- {
- clearTimeout(this.hideTimeout);
- this.hideTimeout=0;
- }
- return false; // to avoid "image drag" default event
- }
-
- this.OnSearchSelectHide = function()
- {
- this.hideTimeout = setTimeout(this.name +".CloseSelectionWindow()",
- this.closeSelectionTimeout);
- }
-
- // Called when the content of the search field is changed.
- this.OnSearchFieldChange = function(evt)
- {
- if (this.keyTimeout) // kill running timer
- {
- clearTimeout(this.keyTimeout);
- this.keyTimeout = 0;
- }
-
- var e = (evt) ? evt : window.event; // for IE
- if (e.keyCode==40 || e.keyCode==13)
- {
- if (e.shiftKey==1)
- {
- this.OnSearchSelectShow();
- var win=this.DOMSearchSelectWindow();
- for (i=0;i<win.childNodes.length;i++)
- {
- var child = win.childNodes[i]; // get span within a
- if (child.className=='SelectItem')
- {
- child.focus();
- return;
- }
- }
- return;
- }
- else if (window.frames.MSearchResults.searchResults)
- {
- var elem = window.frames.MSearchResults.searchResults.NavNext(0);
- if (elem) elem.focus();
- }
- }
- else if (e.keyCode==27) // Escape out of the search field
- {
- this.DOMSearchField().blur();
- this.DOMPopupSearchResultsWindow().style.display = 'none';
- this.DOMSearchClose().style.display = 'none';
- this.lastSearchValue = '';
- this.Activate(false);
- return;
- }
-
- // strip whitespaces
- var searchValue = this.DOMSearchField().value.replace(/ +/g, "");
-
- if (searchValue != this.lastSearchValue) // search value has changed
- {
- if (searchValue != "") // non-empty search
- {
- // set timer for search update
- this.keyTimeout = setTimeout(this.name + '.Search()',
- this.keyTimeoutLength);
- }
- else // empty search field
- {
- this.DOMPopupSearchResultsWindow().style.display = 'none';
- this.DOMSearchClose().style.display = 'none';
- this.lastSearchValue = '';
- }
- }
- }
-
- this.SelectItemCount = function(id)
- {
- var count=0;
- var win=this.DOMSearchSelectWindow();
- for (i=0;i<win.childNodes.length;i++)
- {
- var child = win.childNodes[i]; // get span within a
- if (child.className=='SelectItem')
- {
- count++;
- }
- }
- return count;
- }
-
- this.SelectItemSet = function(id)
- {
- var i,j=0;
- var win=this.DOMSearchSelectWindow();
- for (i=0;i<win.childNodes.length;i++)
- {
- var child = win.childNodes[i]; // get span within a
- if (child.className=='SelectItem')
- {
- var node = child.firstChild;
- if (j==id)
- {
- node.innerHTML='•';
- }
- else
- {
- node.innerHTML=' ';
- }
- j++;
- }
- }
- }
-
- // Called when an search filter selection is made.
- // set item with index id as the active item
- this.OnSelectItem = function(id)
- {
- this.searchIndex = id;
- this.SelectItemSet(id);
- var searchValue = this.DOMSearchField().value.replace(/ +/g, "");
- if (searchValue!="" && this.searchActive) // something was found -> do a search
- {
- this.Search();
- }
- }
-
- this.OnSearchSelectKey = function(evt)
- {
- var e = (evt) ? evt : window.event; // for IE
- if (e.keyCode==40 && this.searchIndex<this.SelectItemCount()) // Down
- {
- this.searchIndex++;
- this.OnSelectItem(this.searchIndex);
- }
- else if (e.keyCode==38 && this.searchIndex>0) // Up
- {
- this.searchIndex--;
- this.OnSelectItem(this.searchIndex);
- }
- else if (e.keyCode==13 || e.keyCode==27)
- {
- this.OnSelectItem(this.searchIndex);
- this.CloseSelectionWindow();
- this.DOMSearchField().focus();
- }
- return false;
- }
-
- // --------- Actions
-
- // Closes the results window.
- this.CloseResultsWindow = function()
- {
- this.DOMPopupSearchResultsWindow().style.display = 'none';
- this.DOMSearchClose().style.display = 'none';
- this.Activate(false);
- }
-
- this.CloseSelectionWindow = function()
- {
- this.DOMSearchSelectWindow().style.display = 'none';
- }
-
- // Performs a search.
- this.Search = function()
- {
- this.keyTimeout = 0;
-
- // strip leading whitespace
- var searchValue = this.DOMSearchField().value.replace(/^ +/, "");
-
- var code = searchValue.toLowerCase().charCodeAt(0);
- var idxChar = searchValue.substr(0, 1).toLowerCase();
- if ( 0xD800 <= code && code <= 0xDBFF && searchValue > 1) // surrogate pair
- {
- idxChar = searchValue.substr(0, 2);
- }
-
- var resultsPage;
- var resultsPageWithSearch;
- var hasResultsPage;
-
- var idx = indexSectionsWithContent[this.searchIndex].indexOf(idxChar);
- if (idx!=-1)
- {
- var hexCode=idx.toString(16);
- resultsPage = this.resultsPath + '/' + indexSectionNames[this.searchIndex] + '_' + hexCode + '.html';
- resultsPageWithSearch = resultsPage+'?'+escape(searchValue);
- hasResultsPage = true;
- }
- else // nothing available for this search term
- {
- resultsPage = this.resultsPath + '/nomatches.html';
- resultsPageWithSearch = resultsPage;
- hasResultsPage = false;
- }
-
- window.frames.MSearchResults.location = resultsPageWithSearch;
- var domPopupSearchResultsWindow = this.DOMPopupSearchResultsWindow();
-
- if (domPopupSearchResultsWindow.style.display!='block')
- {
- var domSearchBox = this.DOMSearchBox();
- this.DOMSearchClose().style.display = 'inline';
- if (this.insideFrame)
- {
- var domPopupSearchResults = this.DOMPopupSearchResults();
- domPopupSearchResultsWindow.style.position = 'relative';
- domPopupSearchResultsWindow.style.display = 'block';
- var width = document.body.clientWidth - 8; // the -8 is for IE :-(
- domPopupSearchResultsWindow.style.width = width + 'px';
- domPopupSearchResults.style.width = width + 'px';
- }
- else
- {
- var domPopupSearchResults = this.DOMPopupSearchResults();
- var left = getXPos(domSearchBox) + 150; // domSearchBox.offsetWidth;
- var top = getYPos(domSearchBox) + 20; // domSearchBox.offsetHeight + 1;
- domPopupSearchResultsWindow.style.display = 'block';
- left -= domPopupSearchResults.offsetWidth;
- domPopupSearchResultsWindow.style.top = top + 'px';
- domPopupSearchResultsWindow.style.left = left + 'px';
- }
- }
-
- this.lastSearchValue = searchValue;
- this.lastResultsPage = resultsPage;
- }
-
- // -------- Activation Functions
-
- // Activates or deactivates the search panel, resetting things to
- // their default values if necessary.
- this.Activate = function(isActive)
- {
- if (isActive || // open it
- this.DOMPopupSearchResultsWindow().style.display == 'block'
- )
- {
- this.DOMSearchBox().className = 'MSearchBoxActive';
-
- var searchField = this.DOMSearchField();
-
- if (searchField.value == this.searchLabel) // clear "Search" term upon entry
- {
- searchField.value = '';
- this.searchActive = true;
- }
- }
- else if (!isActive) // directly remove the panel
- {
- this.DOMSearchBox().className = 'MSearchBoxInactive';
- this.DOMSearchField().value = this.searchLabel;
- this.searchActive = false;
- this.lastSearchValue = ''
- this.lastResultsPage = '';
- }
- }
-}
-
-// -----------------------------------------------------------------------
-
-// The class that handles everything on the search results page.
-function SearchResults(name)
-{
- // The number of matches from the last run of <Search()>.
- this.lastMatchCount = 0;
- this.lastKey = 0;
- this.repeatOn = false;
-
- // Toggles the visibility of the passed element ID.
- this.FindChildElement = function(id)
- {
- var parentElement = document.getElementById(id);
- var element = parentElement.firstChild;
-
- while (element && element!=parentElement)
- {
- if (element.nodeName == 'DIV' && element.className == 'SRChildren')
- {
- return element;
- }
-
- if (element.nodeName == 'DIV' && element.hasChildNodes())
- {
- element = element.firstChild;
- }
- else if (element.nextSibling)
- {
- element = element.nextSibling;
- }
- else
- {
- do
- {
- element = element.parentNode;
- }
- while (element && element!=parentElement && !element.nextSibling);
-
- if (element && element!=parentElement)
- {
- element = element.nextSibling;
- }
- }
- }
- }
-
- this.Toggle = function(id)
- {
- var element = this.FindChildElement(id);
- if (element)
- {
- if (element.style.display == 'block')
- {
- element.style.display = 'none';
- }
- else
- {
- element.style.display = 'block';
- }
- }
- }
-
- // Searches for the passed string. If there is no parameter,
- // it takes it from the URL query.
- //
- // Always returns true, since other documents may try to call it
- // and that may or may not be possible.
- this.Search = function(search)
- {
- if (!search) // get search word from URL
- {
- search = window.location.search;
- search = search.substring(1); // Remove the leading '?'
- search = unescape(search);
- }
-
- search = search.replace(/^ +/, ""); // strip leading spaces
- search = search.replace(/ +$/, ""); // strip trailing spaces
- search = search.toLowerCase();
- search = convertToId(search);
-
- var resultRows = document.getElementsByTagName("div");
- var matches = 0;
-
- var i = 0;
- while (i < resultRows.length)
- {
- var row = resultRows.item(i);
- if (row.className == "SRResult")
- {
- var rowMatchName = row.id.toLowerCase();
- rowMatchName = rowMatchName.replace(/^sr\d*_/, ''); // strip 'sr123_'
-
- if (search.length<=rowMatchName.length &&
- rowMatchName.substr(0, search.length)==search)
- {
- row.style.display = 'block';
- matches++;
- }
- else
- {
- row.style.display = 'none';
- }
- }
- i++;
- }
- document.getElementById("Searching").style.display='none';
- if (matches == 0) // no results
- {
- document.getElementById("NoMatches").style.display='block';
- }
- else // at least one result
- {
- document.getElementById("NoMatches").style.display='none';
- }
- this.lastMatchCount = matches;
- return true;
- }
-
- // return the first item with index index or higher that is visible
- this.NavNext = function(index)
- {
- var focusItem;
- while (1)
- {
- var focusName = 'Item'+index;
- focusItem = document.getElementById(focusName);
- if (focusItem && focusItem.parentNode.parentNode.style.display=='block')
- {
- break;
- }
- else if (!focusItem) // last element
- {
- break;
- }
- focusItem=null;
- index++;
- }
- return focusItem;
- }
-
- this.NavPrev = function(index)
- {
- var focusItem;
- while (1)
- {
- var focusName = 'Item'+index;
- focusItem = document.getElementById(focusName);
- if (focusItem && focusItem.parentNode.parentNode.style.display=='block')
- {
- break;
- }
- else if (!focusItem) // last element
- {
- break;
- }
- focusItem=null;
- index--;
- }
- return focusItem;
- }
-
- this.ProcessKeys = function(e)
- {
- if (e.type == "keydown")
- {
- this.repeatOn = false;
- this.lastKey = e.keyCode;
- }
- else if (e.type == "keypress")
- {
- if (!this.repeatOn)
- {
- if (this.lastKey) this.repeatOn = true;
- return false; // ignore first keypress after keydown
- }
- }
- else if (e.type == "keyup")
- {
- this.lastKey = 0;
- this.repeatOn = false;
- }
- return this.lastKey!=0;
- }
-
- this.Nav = function(evt,itemIndex)
- {
- var e = (evt) ? evt : window.event; // for IE
- if (e.keyCode==13) return true;
- if (!this.ProcessKeys(e)) return false;
-
- if (this.lastKey==38) // Up
- {
- var newIndex = itemIndex-1;
- var focusItem = this.NavPrev(newIndex);
- if (focusItem)
- {
- var child = this.FindChildElement(focusItem.parentNode.parentNode.id);
- if (child && child.style.display == 'block') // children visible
- {
- var n=0;
- var tmpElem;
- while (1) // search for last child
- {
- tmpElem = document.getElementById('Item'+newIndex+'_c'+n);
- if (tmpElem)
- {
- focusItem = tmpElem;
- }
- else // found it!
- {
- break;
- }
- n++;
- }
- }
- }
- if (focusItem)
- {
- focusItem.focus();
- }
- else // return focus to search field
- {
- parent.document.getElementById("MSearchField").focus();
- }
- }
- else if (this.lastKey==40) // Down
- {
- var newIndex = itemIndex+1;
- var focusItem;
- var item = document.getElementById('Item'+itemIndex);
- var elem = this.FindChildElement(item.parentNode.parentNode.id);
- if (elem && elem.style.display == 'block') // children visible
- {
- focusItem = document.getElementById('Item'+itemIndex+'_c0');
- }
- if (!focusItem) focusItem = this.NavNext(newIndex);
- if (focusItem) focusItem.focus();
- }
- else if (this.lastKey==39) // Right
- {
- var item = document.getElementById('Item'+itemIndex);
- var elem = this.FindChildElement(item.parentNode.parentNode.id);
- if (elem) elem.style.display = 'block';
- }
- else if (this.lastKey==37) // Left
- {
- var item = document.getElementById('Item'+itemIndex);
- var elem = this.FindChildElement(item.parentNode.parentNode.id);
- if (elem) elem.style.display = 'none';
- }
- else if (this.lastKey==27) // Escape
- {
- parent.searchBox.CloseResultsWindow();
- parent.document.getElementById("MSearchField").focus();
- }
- else if (this.lastKey==13) // Enter
- {
- return true;
- }
- return false;
- }
-
- this.NavChild = function(evt,itemIndex,childIndex)
- {
- var e = (evt) ? evt : window.event; // for IE
- if (e.keyCode==13) return true;
- if (!this.ProcessKeys(e)) return false;
-
- if (this.lastKey==38) // Up
- {
- if (childIndex>0)
- {
- var newIndex = childIndex-1;
- document.getElementById('Item'+itemIndex+'_c'+newIndex).focus();
- }
- else // already at first child, jump to parent
- {
- document.getElementById('Item'+itemIndex).focus();
- }
- }
- else if (this.lastKey==40) // Down
- {
- var newIndex = childIndex+1;
- var elem = document.getElementById('Item'+itemIndex+'_c'+newIndex);
- if (!elem) // last child, jump to parent next parent
- {
- elem = this.NavNext(itemIndex+1);
- }
- if (elem)
- {
- elem.focus();
- }
- }
- else if (this.lastKey==27) // Escape
- {
- parent.searchBox.CloseResultsWindow();
- parent.document.getElementById("MSearchField").focus();
- }
- else if (this.lastKey==13) // Enter
- {
- return true;
- }
- return false;
- }
-}
-
-function setKeyActions(elem,action)
-{
- elem.setAttribute('onkeydown',action);
- elem.setAttribute('onkeypress',action);
- elem.setAttribute('onkeyup',action);
-}
-
-function setClassAttr(elem,attr)
-{
- elem.setAttribute('class',attr);
- elem.setAttribute('className',attr);
-}
-
-function createResults()
-{
- var results = document.getElementById("SRResults");
- for (var e=0; e<searchData.length; e++)
- {
- var id = searchData[e][0];
- var srResult = document.createElement('div');
- srResult.setAttribute('id','SR_'+id);
- setClassAttr(srResult,'SRResult');
- var srEntry = document.createElement('div');
- setClassAttr(srEntry,'SREntry');
- var srLink = document.createElement('a');
- srLink.setAttribute('id','Item'+e);
- setKeyActions(srLink,'return searchResults.Nav(event,'+e+')');
- setClassAttr(srLink,'SRSymbol');
- srLink.innerHTML = searchData[e][1][0];
- srEntry.appendChild(srLink);
- if (searchData[e][1].length==2) // single result
- {
- srLink.setAttribute('href',searchData[e][1][1][0]);
- if (searchData[e][1][1][1])
- {
- srLink.setAttribute('target','_parent');
- }
- var srScope = document.createElement('span');
- setClassAttr(srScope,'SRScope');
- srScope.innerHTML = searchData[e][1][1][2];
- srEntry.appendChild(srScope);
- }
- else // multiple results
- {
- srLink.setAttribute('href','javascript:searchResults.Toggle("SR_'+id+'")');
- var srChildren = document.createElement('div');
- setClassAttr(srChildren,'SRChildren');
- for (var c=0; c<searchData[e][1].length-1; c++)
- {
- var srChild = document.createElement('a');
- srChild.setAttribute('id','Item'+e+'_c'+c);
- setKeyActions(srChild,'return searchResults.NavChild(event,'+e+','+c+')');
- setClassAttr(srChild,'SRScope');
- srChild.setAttribute('href',searchData[e][1][c+1][0]);
- if (searchData[e][1][c+1][1])
- {
- srChild.setAttribute('target','_parent');
- }
- srChild.innerHTML = searchData[e][1][c+1][2];
- srChildren.appendChild(srChild);
- }
- srEntry.appendChild(srChildren);
- }
- srResult.appendChild(srEntry);
- results.appendChild(srResult);
- }
-}
-
-function init_search()
-{
- var results = document.getElementById("MSearchSelectWindow");
- for (var key in indexSectionLabels)
- {
- var link = document.createElement('a');
- link.setAttribute('class','SelectItem');
- link.setAttribute('onclick','searchBox.OnSelectItem('+key+')');
- link.href='javascript:void(0)';
- link.innerHTML='<span class="SelectionMark"> </span>'+indexSectionLabels[key];
- results.appendChild(link);
- }
- searchBox.OnSelectItem(0);
-}
-/* @license-end */
diff --git a/docs/html/search/search_l.png b/docs/html/search/search_l.png
deleted file mode 100644
index fd5f7daa41a4c79b4ae9bea5aa7bdfb94e14084b..0000000000000000000000000000000000000000
Binary files a/docs/html/search/search_l.png and /dev/null differ
diff --git a/docs/html/search/search_m.png b/docs/html/search/search_m.png
deleted file mode 100644
index b429a16ba641960da1e52e5da85dc80fd82635c8..0000000000000000000000000000000000000000
Binary files a/docs/html/search/search_m.png and /dev/null differ
diff --git a/docs/html/search/search_r.png b/docs/html/search/search_r.png
deleted file mode 100644
index 1af5d21ee13e070d7600f1c4657fde843b953a69..0000000000000000000000000000000000000000
Binary files a/docs/html/search/search_r.png and /dev/null differ
diff --git a/docs/html/search/searchdata.js b/docs/html/search/searchdata.js
deleted file mode 100644
index f4268d2939bacc6379c6f9c6c1166714f70a020c..0000000000000000000000000000000000000000
--- a/docs/html/search/searchdata.js
+++ /dev/null
@@ -1,27 +0,0 @@
-var indexSectionsWithContent =
-{
- 0: "aflmst",
- 1: "fs",
- 2: "fm",
- 3: "af",
- 4: "flst"
-};
-
-var indexSectionNames =
-{
- 0: "all",
- 1: "classes",
- 2: "files",
- 3: "functions",
- 4: "variables"
-};
-
-var indexSectionLabels =
-{
- 0: "All",
- 1: "Classes",
- 2: "Files",
- 3: "Functions",
- 4: "Variables"
-};
-
diff --git a/docs/html/search/variables_0.html b/docs/html/search/variables_0.html
deleted file mode 100644
index 12104bcb5f353e0b3de82e8ca3cd030d75c61a69..0000000000000000000000000000000000000000
--- a/docs/html/search/variables_0.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="variables_0.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/variables_0.js b/docs/html/search/variables_0.js
deleted file mode 100644
index 8ca34f438f64be9f54efda1eb41d9eb7392554d2..0000000000000000000000000000000000000000
--- a/docs/html/search/variables_0.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['first_5fstate_5f',['first_state_',['../class_single_transition.html#a88f7e002e072ffe7bb5eeb168cf0fea6',1,'SingleTransition']]]
-];
diff --git a/docs/html/search/variables_1.html b/docs/html/search/variables_1.html
deleted file mode 100644
index b784017a1ab24592168ff054f3fdb3f075a5e1f1..0000000000000000000000000000000000000000
--- a/docs/html/search/variables_1.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="variables_1.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/variables_1.js b/docs/html/search/variables_1.js
deleted file mode 100644
index 3a78109e25e392b82de81e6da93bd0efe2973a07..0000000000000000000000000000000000000000
--- a/docs/html/search/variables_1.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['last_5fstate_5f',['last_state_',['../class_single_transition.html#a9d07ad3e0f9d7728919a372111313c69',1,'SingleTransition']]]
-];
diff --git a/docs/html/search/variables_2.html b/docs/html/search/variables_2.html
deleted file mode 100644
index 0cb98d30572d327010d02331478a7e4b3fab59e3..0000000000000000000000000000000000000000
--- a/docs/html/search/variables_2.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="variables_2.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/variables_2.js b/docs/html/search/variables_2.js
deleted file mode 100644
index 2fc24d54cb173fddebac29af15d5d557356cbba8..0000000000000000000000000000000000000000
--- a/docs/html/search/variables_2.js
+++ /dev/null
@@ -1,6 +0,0 @@
-var searchData=
-[
- ['state_5f',['state_',['../class_state.html#a2dcf672a1560830a8f93b0e9863c6724',1,'State']]],
- ['states_5f',['states_',['../class_factor_oracle.html#a6e8dacf834f9ee820818c3655d77d56d',1,'FactorOracle']]],
- ['symbol_5f',['symbol_',['../class_single_transition.html#ae632ebd30fd4818e999fd1009cb2a8f9',1,'SingleTransition']]]
-];
diff --git a/docs/html/search/variables_3.html b/docs/html/search/variables_3.html
deleted file mode 100644
index 1e83bf5a9f85974b64ef52f50bb291d1b94830a6..0000000000000000000000000000000000000000
--- a/docs/html/search/variables_3.html
+++ /dev/null
@@ -1,30 +0,0 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "https://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html><head><title></title>
-<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/>
-<meta name="generator" content="Doxygen 1.8.15"/>
-<link rel="stylesheet" type="text/css" href="search.css"/>
-<script type="text/javascript" src="variables_3.js"></script>
-<script type="text/javascript" src="search.js"></script>
-</head>
-<body class="SRPage">
-<div id="SRIndex">
-<div class="SRStatus" id="Loading">Loading...</div>
-<div id="SRResults"></div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-createResults();
-/* @license-end */
---></script>
-<div class="SRStatus" id="Searching">Searching...</div>
-<div class="SRStatus" id="NoMatches">No Matches</div>
-<script type="text/javascript"><!--
-/* @license magnet:?xt=urn:btih:cf05388f2679ee054f2beb29a391d25f4e673ac3&dn=gpl-2.0.txt GPL-v2 */
-document.getElementById("Loading").style.display="none";
-document.getElementById("NoMatches").style.display="none";
-var searchResults = new SearchResults("searchResults");
-searchResults.Search();
-/* @license-end */
---></script>
-</div>
-</body>
-</html>
diff --git a/docs/html/search/variables_3.js b/docs/html/search/variables_3.js
deleted file mode 100644
index c20449e777ef00666cfaa350916cfb47c9add63d..0000000000000000000000000000000000000000
--- a/docs/html/search/variables_3.js
+++ /dev/null
@@ -1,4 +0,0 @@
-var searchData=
-[
- ['transition_5f',['transition_',['../class_state.html#afd5b3d2afbba2fc03583f76a7cb08fe8',1,'State']]]
-];
diff --git a/docs/html/splitbar.png b/docs/html/splitbar.png
deleted file mode 100644
index fe895f2c58179b471a22d8320b39a4bd7312ec8e..0000000000000000000000000000000000000000
Binary files a/docs/html/splitbar.png and /dev/null differ
diff --git a/docs/html/sync_off.png b/docs/html/sync_off.png
deleted file mode 100644
index 3b443fc62892114406e3d399421b2a881b897acc..0000000000000000000000000000000000000000
Binary files a/docs/html/sync_off.png and /dev/null differ
diff --git a/docs/html/sync_on.png b/docs/html/sync_on.png
deleted file mode 100644
index e08320fb64e6fa33b573005ed6d8fe294e19db76..0000000000000000000000000000000000000000
Binary files a/docs/html/sync_on.png and /dev/null differ
diff --git a/docs/html/tab_a.png b/docs/html/tab_a.png
deleted file mode 100644
index 3b725c41c5a527a3a3e40097077d0e206a681247..0000000000000000000000000000000000000000
Binary files a/docs/html/tab_a.png and /dev/null differ
diff --git a/docs/html/tab_b.png b/docs/html/tab_b.png
deleted file mode 100644
index e2b4a8638cb3496a016eaed9e16ffc12846dea18..0000000000000000000000000000000000000000
Binary files a/docs/html/tab_b.png and /dev/null differ
diff --git a/docs/html/tab_h.png b/docs/html/tab_h.png
deleted file mode 100644
index fd5cb705488e60fcf30f56fcc951dee74f3b095b..0000000000000000000000000000000000000000
Binary files a/docs/html/tab_h.png and /dev/null differ
diff --git a/docs/html/tab_s.png b/docs/html/tab_s.png
deleted file mode 100644
index ab478c95b67371d700a20869f7de1ddd73522d50..0000000000000000000000000000000000000000
Binary files a/docs/html/tab_s.png and /dev/null differ
diff --git a/docs/html/tabs.css b/docs/html/tabs.css
deleted file mode 100644
index 8ea7d549614948ae6fe47dd3a01a4a70b1611abc..0000000000000000000000000000000000000000
--- a/docs/html/tabs.css
+++ /dev/null
@@ -1 +0,0 @@
-.sm{position:relative;z-index:9999}.sm,.sm ul,.sm li{display:block;list-style:none;margin:0;padding:0;line-height:normal;direction:ltr;text-align:left;-webkit-tap-highlight-color:rgba(0,0,0,0)}.sm-rtl,.sm-rtl ul,.sm-rtl li{direction:rtl;text-align:right}.sm>li>h1,.sm>li>h2,.sm>li>h3,.sm>li>h4,.sm>li>h5,.sm>li>h6{margin:0;padding:0}.sm ul{display:none}.sm li,.sm a{position:relative}.sm a{display:block}.sm a.disabled{cursor:not-allowed}.sm:after{content:"\00a0";display:block;height:0;font:0/0 serif;clear:both;visibility:hidden;overflow:hidden}.sm,.sm *,.sm *:before,.sm *:after{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sm-dox{background-image:url("tab_b.png")}.sm-dox a,.sm-dox a:focus,.sm-dox a:hover,.sm-dox a:active{padding:0 12px;padding-right:43px;font-family:"Lucida Grande","Geneva","Helvetica",Arial,sans-serif;font-size:13px;font-weight:bold;line-height:36px;text-decoration:none;text-shadow:0 1px 1px rgba(255,255,255,0.9);color:#283a5d;outline:0}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox a.current{color:#d23600}.sm-dox a.disabled{color:#bbb}.sm-dox a span.sub-arrow{position:absolute;top:50%;margin-top:-14px;left:auto;right:3px;width:28px;height:28px;overflow:hidden;font:bold 12px/28px monospace !important;text-align:center;text-shadow:none;background:rgba(255,255,255,0.5);-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}.sm-dox a.highlighted span.sub-arrow:before{display:block;content:'-'}.sm-dox>li:first-child>a,.sm-dox>li:first-child>:not(ul) a{-moz-border-radius:5px 5px 0 0;-webkit-border-radius:5px;border-radius:5px 5px 0 0}.sm-dox>li:last-child>a,.sm-dox>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul{-moz-border-radius:0 0 5px 5px;-webkit-border-radius:0;border-radius:0 0 5px 5px}.sm-dox>li:last-child>a.highlighted,.sm-dox>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted{-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.sm-dox ul{background:rgba(162,162,162,0.1)}.sm-dox ul a,.sm-dox ul a:focus,.sm-dox ul a:hover,.sm-dox ul a:active{font-size:12px;border-left:8px solid transparent;line-height:36px;text-shadow:none;background-color:white;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox ul ul a,.sm-dox ul ul a:hover,.sm-dox ul ul a:focus,.sm-dox ul ul a:active{border-left:16px solid transparent}.sm-dox ul ul ul a,.sm-dox ul ul ul a:hover,.sm-dox ul ul ul a:focus,.sm-dox ul ul ul a:active{border-left:24px solid transparent}.sm-dox ul ul ul ul a,.sm-dox ul ul ul ul a:hover,.sm-dox ul ul ul ul a:focus,.sm-dox ul ul ul ul a:active{border-left:32px solid transparent}.sm-dox ul ul ul ul ul a,.sm-dox ul ul ul ul ul a:hover,.sm-dox ul ul ul ul ul a:focus,.sm-dox ul ul ul ul ul a:active{border-left:40px solid transparent}@media(min-width:768px){.sm-dox ul{position:absolute;width:12em}.sm-dox li{float:left}.sm-dox.sm-rtl li{float:right}.sm-dox ul li,.sm-dox.sm-rtl ul li,.sm-dox.sm-vertical li{float:none}.sm-dox a{white-space:nowrap}.sm-dox ul a,.sm-dox.sm-vertical a{white-space:normal}.sm-dox .sm-nowrap>li>a,.sm-dox .sm-nowrap>li>:not(ul) a{white-space:nowrap}.sm-dox{padding:0 10px;background-image:url("tab_b.png");line-height:36px}.sm-dox a span.sub-arrow{top:50%;margin-top:-2px;right:12px;width:0;height:0;border-width:4px;border-style:solid dashed dashed dashed;border-color:#283a5d transparent transparent transparent;background:transparent;-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.sm-dox a,.sm-dox a:focus,.sm-dox a:active,.sm-dox a:hover,.sm-dox a.highlighted{padding:0 12px;background-image:url("tab_s.png");background-repeat:no-repeat;background-position:right;-moz-border-radius:0 !important;-webkit-border-radius:0;border-radius:0 !important}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox a:hover span.sub-arrow{border-color:white transparent transparent transparent}.sm-dox a.has-submenu{padding-right:24px}.sm-dox li{border-top:0}.sm-dox>li>ul:before,.sm-dox>li>ul:after{content:'';position:absolute;top:-18px;left:30px;width:0;height:0;overflow:hidden;border-width:9px;border-style:dashed dashed solid dashed;border-color:transparent transparent #bbb transparent}.sm-dox>li>ul:after{top:-16px;left:31px;border-width:8px;border-color:transparent transparent #fff transparent}.sm-dox ul{border:1px solid #bbb;padding:5px 0;background:#fff;-moz-border-radius:5px !important;-webkit-border-radius:5px;border-radius:5px !important;-moz-box-shadow:0 5px 9px rgba(0,0,0,0.2);-webkit-box-shadow:0 5px 9px rgba(0,0,0,0.2);box-shadow:0 5px 9px rgba(0,0,0,0.2)}.sm-dox ul a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-color:transparent transparent transparent #555;border-style:dashed dashed dashed solid}.sm-dox ul a,.sm-dox ul a:hover,.sm-dox ul a:focus,.sm-dox ul a:active,.sm-dox ul a.highlighted{color:#555;background-image:none;border:0 !important;color:#555;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox ul a:hover span.sub-arrow{border-color:transparent transparent transparent white}.sm-dox span.scroll-up,.sm-dox span.scroll-down{position:absolute;display:none;visibility:hidden;overflow:hidden;background:#fff;height:36px}.sm-dox span.scroll-up:hover,.sm-dox span.scroll-down:hover{background:#eee}.sm-dox span.scroll-up:hover span.scroll-up-arrow,.sm-dox span.scroll-up:hover span.scroll-down-arrow{border-color:transparent transparent #d23600 transparent}.sm-dox span.scroll-down:hover span.scroll-down-arrow{border-color:#d23600 transparent transparent transparent}.sm-dox span.scroll-up-arrow,.sm-dox span.scroll-down-arrow{position:absolute;top:0;left:50%;margin-left:-6px;width:0;height:0;overflow:hidden;border-width:6px;border-style:dashed dashed solid dashed;border-color:transparent transparent #555 transparent}.sm-dox span.scroll-down-arrow{top:8px;border-style:solid dashed dashed dashed;border-color:#555 transparent transparent transparent}.sm-dox.sm-rtl a.has-submenu{padding-right:12px;padding-left:24px}.sm-dox.sm-rtl a span.sub-arrow{right:auto;left:12px}.sm-dox.sm-rtl.sm-vertical a.has-submenu{padding:10px 20px}.sm-dox.sm-rtl.sm-vertical a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-rtl>li>ul:before{left:auto;right:30px}.sm-dox.sm-rtl>li>ul:after{left:auto;right:31px}.sm-dox.sm-rtl ul a.has-submenu{padding:10px 20px !important}.sm-dox.sm-rtl ul a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-vertical{padding:10px 0;-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}.sm-dox.sm-vertical a{padding:10px 20px}.sm-dox.sm-vertical a:hover,.sm-dox.sm-vertical a:focus,.sm-dox.sm-vertical a:active,.sm-dox.sm-vertical a.highlighted{background:#fff}.sm-dox.sm-vertical a.disabled{background-image:url("tab_b.png")}.sm-dox.sm-vertical a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-style:dashed dashed dashed solid;border-color:transparent transparent transparent #555}.sm-dox.sm-vertical>li>ul:before,.sm-dox.sm-vertical>li>ul:after{display:none}.sm-dox.sm-vertical ul a{padding:10px 20px}.sm-dox.sm-vertical ul a:hover,.sm-dox.sm-vertical ul a:focus,.sm-dox.sm-vertical ul a:active,.sm-dox.sm-vertical ul a.highlighted{background:#eee}.sm-dox.sm-vertical ul a.disabled{background:#fff}}
\ No newline at end of file
diff --git a/docs/latex/_factor_oracle_8cpp.tex b/docs/latex/_factor_oracle_8cpp.tex
deleted file mode 100644
index bb8445ce9b2f12d13e45165cb8b6675798c37292..0000000000000000000000000000000000000000
--- a/docs/latex/_factor_oracle_8cpp.tex
+++ /dev/null
@@ -1,26 +0,0 @@
-\hypertarget{_factor_oracle_8cpp}{}\section{Factor\+Oracle.\+cpp File Reference}
-\label{_factor_oracle_8cpp}\index{FactorOracle.cpp@{FactorOracle.cpp}}
-
-
-A file that contains the functions needed for the creation of a Factor Oracle.
-
-
-{\ttfamily \#include \char`\"{}Factor\+Oracle.\+h\char`\"{}}\newline
-\subsection*{Variables}
-\begin{DoxyCompactItemize}
-\item
-\mbox{\Hypertarget{_factor_oracle_8cpp_a5eb6eb3bacab6fd40c8df6d435e06209}\label{_factor_oracle_8cpp_a5eb6eb3bacab6fd40c8df6d435e06209}}
-int {\bfseries phi}
-\item
-\mbox{\Hypertarget{_factor_oracle_8cpp_ab66ed8e0098c0a86b458672a55a9cca9}\label{_factor_oracle_8cpp_ab66ed8e0098c0a86b458672a55a9cca9}}
-int {\bfseries k}
-\item
-\mbox{\Hypertarget{_factor_oracle_8cpp_aa2fc876c0cc6ed51259586d7bea34f0f}\label{_factor_oracle_8cpp_aa2fc876c0cc6ed51259586d7bea34f0f}}
-int {\bfseries fo\+\_\+iter}
-\end{DoxyCompactItemize}
-
-
-\subsection{Detailed Description}
-A file that contains the functions needed for the creation of a Factor Oracle.
-
-Five main functions\+: Factor\+Oracle\+Start, Add\+Letter, Length\+Common\+Suffix, Find\+Better and F\+O\+Generate.
\ No newline at end of file
diff --git a/docs/latex/_factor_oracle_8h.tex b/docs/latex/_factor_oracle_8h.tex
deleted file mode 100644
index 39ef3c5fb9138b6f8eb4f8e263d157b54e218157..0000000000000000000000000000000000000000
--- a/docs/latex/_factor_oracle_8h.tex
+++ /dev/null
@@ -1,38 +0,0 @@
-\hypertarget{_factor_oracle_8h}{}\section{Factor\+Oracle.\+h File Reference}
-\label{_factor_oracle_8h}\index{FactorOracle.h@{FactorOracle.h}}
-
-
-A file that contains the definitions of the classes needed for the creation of a Factor Oracle.
-
-
-{\ttfamily \#include $<$iostream$>$}\newline
-{\ttfamily \#include $<$new$>$}\newline
-{\ttfamily \#include $<$string$>$}\newline
-{\ttfamily \#include $<$vector$>$}\newline
-{\ttfamily \#include $<$variant$>$}\newline
-{\ttfamily \#include $<$random$>$}\newline
-{\ttfamily \#include $<$algorithm$>$}\newline
-\subsection*{Classes}
-\begin{DoxyCompactItemize}
-\item
-class \mbox{\hyperlink{class_single_transition}{Single\+Transition}}
-\item
-class \mbox{\hyperlink{class_state}{State}}
-\item
-class \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}}
-\end{DoxyCompactItemize}
-\subsection*{Macros}
-\begin{DoxyCompactItemize}
-\item
-\mbox{\Hypertarget{_factor_oracle_8h_a5c71a5e59a53413cd6c270266d63b031}\label{_factor_oracle_8h_a5c71a5e59a53413cd6c270266d63b031}}
-\#define {\bfseries R}~10
-\item
-\mbox{\Hypertarget{_factor_oracle_8h_a690f251553b39fd4f31894826141b61a}\label{_factor_oracle_8h_a690f251553b39fd4f31894826141b61a}}
-\#define {\bfseries R\+A\+N\+D\+\_\+\+M\+AX}~0x7fffffff
-\end{DoxyCompactItemize}
-
-
-\subsection{Detailed Description}
-A file that contains the definitions of the classes needed for the creation of a Factor Oracle.
-
-Three main classes\+: \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}}, \mbox{\hyperlink{class_state}{State}} and \mbox{\hyperlink{class_single_transition}{Single\+Transition}}.
\ No newline at end of file
diff --git a/docs/latex/annotated.tex b/docs/latex/annotated.tex
deleted file mode 100644
index 77167937b977e5d3dcff8dcccc36f2e9f81e21d0..0000000000000000000000000000000000000000
--- a/docs/latex/annotated.tex
+++ /dev/null
@@ -1,6 +0,0 @@
-\section{Class List}
-Here are the classes, structs, unions and interfaces with brief descriptions\+:\begin{DoxyCompactList}
-\item\contentsline{section}{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} }{\pageref{class_factor_oracle}}{}
-\item\contentsline{section}{\mbox{\hyperlink{class_single_transition}{Single\+Transition}} }{\pageref{class_single_transition}}{}
-\item\contentsline{section}{\mbox{\hyperlink{class_state}{State}} }{\pageref{class_state}}{}
-\end{DoxyCompactList}
diff --git a/docs/latex/class_factor_oracle.tex b/docs/latex/class_factor_oracle.tex
deleted file mode 100644
index baae44ab0a83df72b4438c617c475c35362a09d9..0000000000000000000000000000000000000000
--- a/docs/latex/class_factor_oracle.tex
+++ /dev/null
@@ -1,135 +0,0 @@
-\hypertarget{class_factor_oracle}{}\section{Factor\+Oracle Class Reference}
-\label{class_factor_oracle}\index{FactorOracle@{FactorOracle}}
-\subsection*{Public Member Functions}
-\begin{DoxyCompactItemize}
-\item
-void \mbox{\hyperlink{class_factor_oracle_ae10b4d001c338a73f0f44079e842e7db}{Add\+Letter}} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&States, vector$<$ vector$<$ int $>$$>$ \&T, int i, string word)
-\item
-\mbox{\Hypertarget{class_factor_oracle_a9511ac49e53ccf3a1907db4591e1ad0b}\label{class_factor_oracle_a9511ac49e53ccf3a1907db4591e1ad0b}}
-int {\bfseries Length\+Common\+Suffix} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&States, int phi\+\_\+one, int phi\+\_\+two)
-\item
-int \mbox{\hyperlink{class_factor_oracle_a28d2e85676712f983b1dcba83ae07d50}{Find\+Better}} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&States, vector$<$ vector$<$ int $>$$>$ \&T, int i, char alpha, string word)
-\item
-string \mbox{\hyperlink{class_factor_oracle_abe8c4c194b309aeeff1bc05c25563390}{F\+O\+Generate}} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&States, int i, string v, float q)
-\item
-void \mbox{\hyperlink{class_factor_oracle_a070d7b00cfcb658c5d13ff275ceae01f}{Factor\+Oracle\+Start}} (\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&Oracle\+Relations, string word)
-\end{DoxyCompactItemize}
-\subsection*{Public Attributes}
-\begin{DoxyCompactItemize}
-\item
-vector$<$ \mbox{\hyperlink{class_state}{State}} $>$ \mbox{\hyperlink{class_factor_oracle_a6e8dacf834f9ee820818c3655d77d56d}{states\+\_\+}}
-\end{DoxyCompactItemize}
-
-
-\subsection{Member Function Documentation}
-\mbox{\Hypertarget{class_factor_oracle_ae10b4d001c338a73f0f44079e842e7db}\label{class_factor_oracle_ae10b4d001c338a73f0f44079e842e7db}}
-\index{FactorOracle@{FactorOracle}!AddLetter@{AddLetter}}
-\index{AddLetter@{AddLetter}!FactorOracle@{FactorOracle}}
-\subsubsection{\texorpdfstring{AddLetter()}{AddLetter()}}
-{\footnotesize\ttfamily void Factor\+Oracle\+::\+Add\+Letter (\begin{DoxyParamCaption}\item[{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&}]{States, }\item[{vector$<$ vector$<$ int $>$$>$ \&}]{T, }\item[{int}]{i, }\item[{string}]{word }\end{DoxyParamCaption})}
-
-A normal member taking four arguments and returning no value.
-
-
-\begin{DoxyParams}{Parameters}
-{\em all\+\_\+states\+\_\+} & a reference to a \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} class. \\
-\hline
-{\em T} & a reference to a vector of vector of integers. \\
-\hline
-{\em i} & an integer argument. \\
-\hline
-{\em word} & a string argument.\\
-\hline
-\end{DoxyParams}
-$<$ delta(i-\/1, p\mbox{[}i\mbox{]}) $<$-\/ i
-
-$<$ k = S\mbox{[}i-\/1\mbox{]}
-
-$<$ phi\+\_\+one = i-\/1
-
-while k $>$ -\/1 and delta(k,p\mbox{[}i\mbox{]}) is undefined do delta(k, p\mbox{[}i\mbox{]}) $<$-\/ i phi\+\_\+one = k k = S\mbox{[}k\mbox{]}\mbox{\Hypertarget{class_factor_oracle_a070d7b00cfcb658c5d13ff275ceae01f}\label{class_factor_oracle_a070d7b00cfcb658c5d13ff275ceae01f}}
-\index{FactorOracle@{FactorOracle}!FactorOracleStart@{FactorOracleStart}}
-\index{FactorOracleStart@{FactorOracleStart}!FactorOracle@{FactorOracle}}
-\subsubsection{\texorpdfstring{FactorOracleStart()}{FactorOracleStart()}}
-{\footnotesize\ttfamily void Factor\+Oracle\+::\+Factor\+Oracle\+Start (\begin{DoxyParamCaption}\item[{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&}]{Oracle\+Relations, }\item[{string}]{word }\end{DoxyParamCaption})}
-
-A normal member taking one argument and returning no value.
-
-
-\begin{DoxyParams}{Parameters}
-{\em oracle\+\_\+relations} & a reference to a \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} class. \\
-\hline
-{\em word} & a string argument.\\
-\hline
-\end{DoxyParams}
-$<$ S\mbox{[}0\mbox{]} = -\/1
-
-$<$ for i $<$-\/ 1 to m do Add\+Letter(i)\mbox{\Hypertarget{class_factor_oracle_a28d2e85676712f983b1dcba83ae07d50}\label{class_factor_oracle_a28d2e85676712f983b1dcba83ae07d50}}
-\index{FactorOracle@{FactorOracle}!FindBetter@{FindBetter}}
-\index{FindBetter@{FindBetter}!FactorOracle@{FactorOracle}}
-\subsubsection{\texorpdfstring{FindBetter()}{FindBetter()}}
-{\footnotesize\ttfamily int Factor\+Oracle\+::\+Find\+Better (\begin{DoxyParamCaption}\item[{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&}]{States, }\item[{vector$<$ vector$<$ int $>$$>$ \&}]{T, }\item[{int}]{i, }\item[{char}]{alpha, }\item[{string}]{word }\end{DoxyParamCaption})}
-
-A normal member taking five arguments and returning an integer value.
-
-
-\begin{DoxyParams}{Parameters}
-{\em all\+\_\+states\+\_\+} & a reference to a \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} class. \\
-\hline
-{\em T} & a reference to a vector of vector of integers. \\
-\hline
-{\em i} & an integer argument. \\
-\hline
-{\em alpha} & a char argument. \\
-\hline
-{\em word} & a string argument. \\
-\hline
-\end{DoxyParams}
-\begin{DoxyReturn}{Returns}
-A better state
-\end{DoxyReturn}
-\mbox{\Hypertarget{class_factor_oracle_abe8c4c194b309aeeff1bc05c25563390}\label{class_factor_oracle_abe8c4c194b309aeeff1bc05c25563390}}
-\index{FactorOracle@{FactorOracle}!FOGenerate@{FOGenerate}}
-\index{FOGenerate@{FOGenerate}!FactorOracle@{FactorOracle}}
-\subsubsection{\texorpdfstring{FOGenerate()}{FOGenerate()}}
-{\footnotesize\ttfamily string Factor\+Oracle\+::\+F\+O\+Generate (\begin{DoxyParamCaption}\item[{\mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} \&}]{States, }\item[{int}]{i, }\item[{string}]{v, }\item[{float}]{q }\end{DoxyParamCaption})}
-
-A normal member taking four arguments and returning a string value.
-
-
-\begin{DoxyParams}{Parameters}
-{\em all\+\_\+states\+\_\+} & a reference to a \mbox{\hyperlink{class_factor_oracle}{Factor\+Oracle}} class. \\
-\hline
-{\em i} & an integer argument. \\
-\hline
-{\em v} & a string argument. \\
-\hline
-{\em q} & a float argument. \\
-\hline
-\end{DoxyParams}
-\begin{DoxyReturn}{Returns}
-The factor oracle improvisation
-\end{DoxyReturn}
-Will be used to obtain a seed for the random number engine
-
-Standard mersenne\+\_\+twister\+\_\+engine seeded with rd()
-
-float u = (float)rand() / R\+A\+N\+D\+\_\+\+M\+AX;
-
-Will be used to obtain a seed for the random number engine
-
-Standard mersenne\+\_\+twister\+\_\+engine seeded with rd()
-
-\subsection{Member Data Documentation}
-\mbox{\Hypertarget{class_factor_oracle_a6e8dacf834f9ee820818c3655d77d56d}\label{class_factor_oracle_a6e8dacf834f9ee820818c3655d77d56d}}
-\index{FactorOracle@{FactorOracle}!states\_@{states\_}}
-\index{states\_@{states\_}!FactorOracle@{FactorOracle}}
-\subsubsection{\texorpdfstring{states\_}{states\_}}
-{\footnotesize\ttfamily vector$<$\mbox{\hyperlink{class_state}{State}}$>$ Factor\+Oracle\+::states\+\_\+}
-
-vector of all the states
-
-The documentation for this class was generated from the following files\+:\begin{DoxyCompactItemize}
-\item
-\mbox{\hyperlink{_factor_oracle_8h}{Factor\+Oracle.\+h}}\item
-\mbox{\hyperlink{_factor_oracle_8cpp}{Factor\+Oracle.\+cpp}}\end{DoxyCompactItemize}
diff --git a/docs/latex/class_single_transition.tex b/docs/latex/class_single_transition.tex
deleted file mode 100644
index 5ee47cc37ce0be15653efdc7a398fc3b5b471e2f..0000000000000000000000000000000000000000
--- a/docs/latex/class_single_transition.tex
+++ /dev/null
@@ -1,44 +0,0 @@
-\hypertarget{class_single_transition}{}\section{Single\+Transition Class Reference}
-\label{class_single_transition}\index{SingleTransition@{SingleTransition}}
-
-
-{\ttfamily \#include $<$Factor\+Oracle.\+h$>$}
-
-\subsection*{Public Attributes}
-\begin{DoxyCompactItemize}
-\item
-int \mbox{\hyperlink{class_single_transition_a88f7e002e072ffe7bb5eeb168cf0fea6}{first\+\_\+state\+\_\+}}
-\item
-int \mbox{\hyperlink{class_single_transition_a9d07ad3e0f9d7728919a372111313c69}{last\+\_\+state\+\_\+}}
-\item
-char \mbox{\hyperlink{class_single_transition_ae632ebd30fd4818e999fd1009cb2a8f9}{symbol\+\_\+}}
-\end{DoxyCompactItemize}
-
-
-\subsection{Detailed Description}
-The class \mbox{\hyperlink{class_single_transition}{Single\+Transition}} denotes the elements that belong to each transition
-
-\subsection{Member Data Documentation}
-\mbox{\Hypertarget{class_single_transition_a88f7e002e072ffe7bb5eeb168cf0fea6}\label{class_single_transition_a88f7e002e072ffe7bb5eeb168cf0fea6}}
-\index{SingleTransition@{SingleTransition}!first\_state\_@{first\_state\_}}
-\index{first\_state\_@{first\_state\_}!SingleTransition@{SingleTransition}}
-\subsubsection{\texorpdfstring{first\_state\_}{first\_state\_}}
-{\footnotesize\ttfamily int Single\+Transition\+::first\+\_\+state\+\_\+}
-
-denotes the first state of the transition \mbox{\Hypertarget{class_single_transition_a9d07ad3e0f9d7728919a372111313c69}\label{class_single_transition_a9d07ad3e0f9d7728919a372111313c69}}
-\index{SingleTransition@{SingleTransition}!last\_state\_@{last\_state\_}}
-\index{last\_state\_@{last\_state\_}!SingleTransition@{SingleTransition}}
-\subsubsection{\texorpdfstring{last\_state\_}{last\_state\_}}
-{\footnotesize\ttfamily int Single\+Transition\+::last\+\_\+state\+\_\+}
-
-denotes the last state of the transition \mbox{\Hypertarget{class_single_transition_ae632ebd30fd4818e999fd1009cb2a8f9}\label{class_single_transition_ae632ebd30fd4818e999fd1009cb2a8f9}}
-\index{SingleTransition@{SingleTransition}!symbol\_@{symbol\_}}
-\index{symbol\_@{symbol\_}!SingleTransition@{SingleTransition}}
-\subsubsection{\texorpdfstring{symbol\_}{symbol\_}}
-{\footnotesize\ttfamily char Single\+Transition\+::symbol\+\_\+}
-
-denotes the symbol (letter) of the transition
-
-The documentation for this class was generated from the following file\+:\begin{DoxyCompactItemize}
-\item
-\mbox{\hyperlink{_factor_oracle_8h}{Factor\+Oracle.\+h}}\end{DoxyCompactItemize}
diff --git a/docs/latex/class_state.tex b/docs/latex/class_state.tex
deleted file mode 100644
index edc56025961f222113546c74bba77221d993c2b4..0000000000000000000000000000000000000000
--- a/docs/latex/class_state.tex
+++ /dev/null
@@ -1,48 +0,0 @@
-\hypertarget{class_state}{}\section{State Class Reference}
-\label{class_state}\index{State@{State}}
-
-
-{\ttfamily \#include $<$Factor\+Oracle.\+h$>$}
-
-\subsection*{Public Member Functions}
-\begin{DoxyCompactItemize}
-\item
-\mbox{\Hypertarget{class_state_a472cf58ec39b9f2158560f8aae3b89c8}\label{class_state_a472cf58ec39b9f2158560f8aae3b89c8}}
-void {\bfseries single\+Transition\+Resize} ()
-\end{DoxyCompactItemize}
-\subsection*{Public Attributes}
-\begin{DoxyCompactItemize}
-\item
-int \mbox{\hyperlink{class_state_a2dcf672a1560830a8f93b0e9863c6724}{state\+\_\+}}
-\item
-vector$<$ \mbox{\hyperlink{class_single_transition}{Single\+Transition}} $>$ \mbox{\hyperlink{class_state_afd5b3d2afbba2fc03583f76a7cb08fe8}{transition\+\_\+}}
-\item
-\mbox{\Hypertarget{class_state_ae1daff1d8cfaf403f5f81b74a32d18cf}\label{class_state_ae1daff1d8cfaf403f5f81b74a32d18cf}}
-int {\bfseries suffix\+\_\+transition\+\_\+}
-\item
-\mbox{\Hypertarget{class_state_a232fd4e8e92e228c5ad8542c8d45e9b6}\label{class_state_a232fd4e8e92e228c5ad8542c8d45e9b6}}
-int {\bfseries lrs\+\_\+} = 0
-\end{DoxyCompactItemize}
-
-
-\subsection{Detailed Description}
-The class \mbox{\hyperlink{class_state}{State}} denotes the elements that belong to each state state denotes de number of the state vector $<$\+Single\+Transition$>$ transition is the vector where all forward links of the state are defined suffix\+\_\+transition denotes which is the suffix link of this state lrs is the longest repeated subsequence of this state
-
-\subsection{Member Data Documentation}
-\mbox{\Hypertarget{class_state_a2dcf672a1560830a8f93b0e9863c6724}\label{class_state_a2dcf672a1560830a8f93b0e9863c6724}}
-\index{State@{State}!state\_@{state\_}}
-\index{state\_@{state\_}!State@{State}}
-\subsubsection{\texorpdfstring{state\_}{state\_}}
-{\footnotesize\ttfamily int State\+::state\+\_\+}
-
-denotes the number of the state \mbox{\Hypertarget{class_state_afd5b3d2afbba2fc03583f76a7cb08fe8}\label{class_state_afd5b3d2afbba2fc03583f76a7cb08fe8}}
-\index{State@{State}!transition\_@{transition\_}}
-\index{transition\_@{transition\_}!State@{State}}
-\subsubsection{\texorpdfstring{transition\_}{transition\_}}
-{\footnotesize\ttfamily vector$<$\mbox{\hyperlink{class_single_transition}{Single\+Transition}}$>$ State\+::transition\+\_\+}
-
-denotes the number of the state
-
-The documentation for this class was generated from the following file\+:\begin{DoxyCompactItemize}
-\item
-\mbox{\hyperlink{_factor_oracle_8h}{Factor\+Oracle.\+h}}\end{DoxyCompactItemize}
diff --git a/docs/latex/doxygen.sty b/docs/latex/doxygen.sty
deleted file mode 100644
index cf92712fabe94414d3f998f113c83835d014ead3..0000000000000000000000000000000000000000
--- a/docs/latex/doxygen.sty
+++ /dev/null
@@ -1,549 +0,0 @@
-\NeedsTeXFormat{LaTeX2e}
-\ProvidesPackage{doxygen}
-
-% Packages used by this style file
-\RequirePackage{alltt}
-\RequirePackage{array}
-\RequirePackage{calc}
-\RequirePackage{float}
-\RequirePackage{ifthen}
-\RequirePackage{verbatim}
-\RequirePackage[table]{xcolor}
-\RequirePackage{longtable}
-\RequirePackage{tabu}
-\RequirePackage{fancyvrb}
-\RequirePackage{tabularx}
-\RequirePackage{multirow}
-\RequirePackage{hanging}
-\RequirePackage{ifpdf}
-\RequirePackage{adjustbox}
-\RequirePackage{amssymb}
-\RequirePackage{stackengine}
-\RequirePackage[normalem]{ulem} % for strikeout, but don't modify emphasis
-
-%---------- Internal commands used in this style file ----------------
-
-\newcommand{\ensurespace}[1]{%
- \begingroup%
- \setlength{\dimen@}{#1}%
- \vskip\z@\@plus\dimen@%
- \penalty -100\vskip\z@\@plus -\dimen@%
- \vskip\dimen@%
- \penalty 9999%
- \vskip -\dimen@%
- \vskip\z@skip% hide the previous |\vskip| from |\addvspace|
- \endgroup%
-}
-
-\newcommand{\DoxyLabelFont}{}
-\newcommand{\entrylabel}[1]{%
- {%
- \parbox[b]{\labelwidth-4pt}{%
- \makebox[0pt][l]{\DoxyLabelFont#1}%
- \vspace{1.5\baselineskip}%
- }%
- }%
-}
-
-\newenvironment{DoxyDesc}[1]{%
- \ensurespace{4\baselineskip}%
- \begin{list}{}{%
- \settowidth{\labelwidth}{20pt}%
- \setlength{\parsep}{0pt}%
- \setlength{\itemsep}{0pt}%
- \setlength{\leftmargin}{\labelwidth+\labelsep}%
- \renewcommand{\makelabel}{\entrylabel}%
- }%
- \item[#1]%
-}{%
- \end{list}%
-}
-
-\newsavebox{\xrefbox}
-\newlength{\xreflength}
-\newcommand{\xreflabel}[1]{%
- \sbox{\xrefbox}{#1}%
- \setlength{\xreflength}{\wd\xrefbox}%
- \ifthenelse{\xreflength>\labelwidth}{%
- \begin{minipage}{\textwidth}%
- \setlength{\parindent}{0pt}%
- \hangindent=15pt\bfseries #1\vspace{1.2\itemsep}%
- \end{minipage}%
- }{%
- \parbox[b]{\labelwidth}{\makebox[0pt][l]{\textbf{#1}}}%
- }%
-}
-
-%---------- Commands used by doxygen LaTeX output generator ----------
-
-% Used by <pre> ... </pre>
-\newenvironment{DoxyPre}{%
- \small%
- \begin{alltt}%
-}{%
- \end{alltt}%
- \normalsize%
-}
-% Necessary for redefining not defined charcaters, i.e. "Replacement Character" in tex output.
-\newlength{\CodeWidthChar}
-\newlength{\CodeHeightChar}
-\settowidth{\CodeWidthChar}{?}
-\settoheight{\CodeHeightChar}{?}
-% Necessary for hanging indent
-\newlength{\DoxyCodeWidth}
-
-\newcommand\DoxyCodeLine[1]{\hangpara{\DoxyCodeWidth}{1}{#1}\par}
-
-\newcommand\NiceSpace{%
- \discretionary{}{\kern\fontdimen2\font}{\kern\fontdimen2\font}%
-}
-
-% Used by @code ... @endcode
-\newenvironment{DoxyCode}[1]{%
- \par%
- \scriptsize%
- \normalfont\ttfamily%
- \rightskip0pt plus 1fil%
- \settowidth{\DoxyCodeWidth}{000000}%
- \settowidth{\CodeWidthChar}{?}%
- \settoheight{\CodeHeightChar}{?}%
- \setlength{\parskip}{0ex plus 0ex minus 0ex}%
- \ifthenelse{\equal{#1}{0}}
- {
- {\lccode`~32 \lowercase{\global\let~}\NiceSpace}\obeyspaces%
- }
- {
- {\lccode`~32 \lowercase{\global\let~}}\obeyspaces%
- }
-
-}{%
- \normalfont%
- \normalsize%
- \settowidth{\CodeWidthChar}{?}%
- \settoheight{\CodeHeightChar}{?}%
-}
-
-% Redefining not defined characters, i.e. "Replacement Character" in tex output.
-\def\ucr{\adjustbox{width=\CodeWidthChar,height=\CodeHeightChar}{\stackinset{c}{}{c}{-.2pt}{%
- \textcolor{white}{\sffamily\bfseries\small ?}}{%
- \rotatebox{45}{$\blacksquare$}}}}
-
-% Used by @example, @include, @includelineno and @dontinclude
-\newenvironment{DoxyCodeInclude}[1]{%
- \DoxyCode{#1}%
-}{%
- \endDoxyCode%
-}
-
-% Used by @verbatim ... @endverbatim
-\newenvironment{DoxyVerb}{%
- \footnotesize%
- \verbatim%
-}{%
- \endverbatim%
- \normalsize%
-}
-
-% Used by @verbinclude
-\newenvironment{DoxyVerbInclude}{%
- \DoxyVerb%
-}{%
- \endDoxyVerb%
-}
-
-% Used by numbered lists (using '-#' or <ol> ... </ol>)
-\newenvironment{DoxyEnumerate}{%
- \enumerate%
-}{%
- \endenumerate%
-}
-
-% Used by bullet lists (using '-', @li, @arg, or <ul> ... </ul>)
-\newenvironment{DoxyItemize}{%
- \itemize%
-}{%
- \enditemize%
-}
-
-% Used by description lists (using <dl> ... </dl>)
-\newenvironment{DoxyDescription}{%
- \description%
-}{%
- \enddescription%
-}
-
-% Used by @image, @dotfile, @dot ... @enddot, and @msc ... @endmsc
-% (only if caption is specified)
-\newenvironment{DoxyImage}{%
- \begin{figure}[H]%
- \begin{center}%
-}{%
- \end{center}%
- \end{figure}%
-}
-
-% Used by @image, @dotfile, @dot ... @enddot, and @msc ... @endmsc
-% (only if no caption is specified)
-\newenvironment{DoxyImageNoCaption}{%
- \begin{center}%
-}{%
- \end{center}%
-}
-
-% Used by @image
-% (only if inline is specified)
-\newenvironment{DoxyInlineImage}{%
-}{%
-}
-
-% Used by @attention
-\newenvironment{DoxyAttention}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @author and @authors
-\newenvironment{DoxyAuthor}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @date
-\newenvironment{DoxyDate}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @invariant
-\newenvironment{DoxyInvariant}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @note
-\newenvironment{DoxyNote}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @post
-\newenvironment{DoxyPostcond}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @pre
-\newenvironment{DoxyPrecond}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @copyright
-\newenvironment{DoxyCopyright}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @remark
-\newenvironment{DoxyRemark}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @return and @returns
-\newenvironment{DoxyReturn}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @since
-\newenvironment{DoxySince}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @see
-\newenvironment{DoxySeeAlso}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @version
-\newenvironment{DoxyVersion}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @warning
-\newenvironment{DoxyWarning}[1]{%
- \begin{DoxyDesc}{#1}%
-}{%
- \end{DoxyDesc}%
-}
-
-% Used by @internal
-\newenvironment{DoxyInternal}[1]{%
- \paragraph*{#1}%
-}{%
-}
-
-% Used by @par and @paragraph
-\newenvironment{DoxyParagraph}[1]{%
- \begin{list}{}{%
- \settowidth{\labelwidth}{40pt}%
- \setlength{\leftmargin}{\labelwidth}%
- \setlength{\parsep}{0pt}%
- \setlength{\itemsep}{-4pt}%
- \renewcommand{\makelabel}{\entrylabel}%
- }%
- \item[#1]%
-}{%
- \end{list}%
-}
-
-% Used by parameter lists
-\newenvironment{DoxyParams}[2][]{%
- \tabulinesep=1mm%
- \par%
- \ifthenelse{\equal{#1}{}}%
- {\begin{longtabu*}spread 0pt [l]{|X[-1,l]|X[-1,l]|}}% name + description
- {\ifthenelse{\equal{#1}{1}}%
- {\begin{longtabu*}spread 0pt [l]{|X[-1,l]|X[-1,l]|X[-1,l]|}}% in/out + name + desc
- {\begin{longtabu*}spread 0pt [l]{|X[-1,l]|X[-1,l]|X[-1,l]|X[-1,l]|}}% in/out + type + name + desc
- }
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #2}\\[1ex]%
- \hline%
- \endfirsthead%
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #2}\\[1ex]%
- \hline%
- \endhead%
-}{%
- \end{longtabu*}%
- \vspace{6pt}%
-}
-
-% Used for fields of simple structs
-\newenvironment{DoxyFields}[1]{%
- \tabulinesep=1mm%
- \par%
- \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|X[-1,l]|}%
- \multicolumn{3}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endfirsthead%
- \multicolumn{3}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endhead%
-}{%
- \end{longtabu*}%
- \vspace{6pt}%
-}
-
-% Used for fields simple class style enums
-\newenvironment{DoxyEnumFields}[1]{%
- \tabulinesep=1mm%
- \par%
- \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|}%
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endfirsthead%
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endhead%
-}{%
- \end{longtabu*}%
- \vspace{6pt}%
-}
-
-% Used for parameters within a detailed function description
-\newenvironment{DoxyParamCaption}{%
- \renewcommand{\item}[2][]{\\ \hspace*{2.0cm} ##1 {\em ##2}}%
-}{%
-}
-
-% Used by return value lists
-\newenvironment{DoxyRetVals}[1]{%
- \tabulinesep=1mm%
- \par%
- \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|}%
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endfirsthead%
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endhead%
-}{%
- \end{longtabu*}%
- \vspace{6pt}%
-}
-
-% Used by exception lists
-\newenvironment{DoxyExceptions}[1]{%
- \tabulinesep=1mm%
- \par%
- \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|}%
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endfirsthead%
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endhead%
-}{%
- \end{longtabu*}%
- \vspace{6pt}%
-}
-
-% Used by template parameter lists
-\newenvironment{DoxyTemplParams}[1]{%
- \tabulinesep=1mm%
- \par%
- \begin{longtabu*}spread 0pt [l]{|X[-1,r]|X[-1,l]|}%
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endfirsthead%
- \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]%
- \hline%
- \endhead%
-}{%
- \end{longtabu*}%
- \vspace{6pt}%
-}
-
-% Used for member lists
-\newenvironment{DoxyCompactItemize}{%
- \begin{itemize}%
- \setlength{\itemsep}{-3pt}%
- \setlength{\parsep}{0pt}%
- \setlength{\topsep}{0pt}%
- \setlength{\partopsep}{0pt}%
-}{%
- \end{itemize}%
-}
-
-% Used for member descriptions
-\newenvironment{DoxyCompactList}{%
- \begin{list}{}{%
- \setlength{\leftmargin}{0.5cm}%
- \setlength{\itemsep}{0pt}%
- \setlength{\parsep}{0pt}%
- \setlength{\topsep}{0pt}%
- \renewcommand{\makelabel}{\hfill}%
- }%
-}{%
- \end{list}%
-}
-
-% Used for reference lists (@bug, @deprecated, @todo, etc.)
-\newenvironment{DoxyRefList}{%
- \begin{list}{}{%
- \setlength{\labelwidth}{10pt}%
- \setlength{\leftmargin}{\labelwidth}%
- \addtolength{\leftmargin}{\labelsep}%
- \renewcommand{\makelabel}{\xreflabel}%
- }%
-}{%
- \end{list}%
-}
-
-% Used by @bug, @deprecated, @todo, etc.
-\newenvironment{DoxyRefDesc}[1]{%
- \begin{list}{}{%
- \renewcommand\makelabel[1]{\textbf{##1}}%
- \settowidth\labelwidth{\makelabel{#1}}%
- \setlength\leftmargin{\labelwidth+\labelsep}%
- }%
-}{%
- \end{list}%
-}
-
-% Used by parameter lists and simple sections
-\newenvironment{Desc}
-{\begin{list}{}{%
- \settowidth{\labelwidth}{20pt}%
- \setlength{\parsep}{0pt}%
- \setlength{\itemsep}{0pt}%
- \setlength{\leftmargin}{\labelwidth+\labelsep}%
- \renewcommand{\makelabel}{\entrylabel}%
- }
-}{%
- \end{list}%
-}
-
-% Used by tables
-\newcommand{\PBS}[1]{\let\temp=\\#1\let\\=\temp}%
-\newenvironment{TabularC}[1]%
-{\tabulinesep=1mm
-\begin{longtabu*}spread 0pt [c]{*#1{|X[-1]}|}}%
-{\end{longtabu*}\par}%
-
-\newenvironment{TabularNC}[1]%
-{\begin{tabu}spread 0pt [l]{*#1{|X[-1]}|}}%
-{\end{tabu}\par}%
-
-% Used for member group headers
-\newenvironment{Indent}{%
- \begin{list}{}{%
- \setlength{\leftmargin}{0.5cm}%
- }%
- \item[]\ignorespaces%
-}{%
- \unskip%
- \end{list}%
-}
-
-% Used when hyperlinks are turned off
-\newcommand{\doxyref}[3]{%
- \textbf{#1} (\textnormal{#2}\,\pageref{#3})%
-}
-
-% Used to link to a table when hyperlinks are turned on
-\newcommand{\doxytablelink}[2]{%
- \ref{#1}%
-}
-
-% Used to link to a table when hyperlinks are turned off
-\newcommand{\doxytableref}[3]{%
- \ref{#3}%
-}
-
-% Used by @addindex
-\newcommand{\lcurly}{\{}
-\newcommand{\rcurly}{\}}
-
-% Colors used for syntax highlighting
-\definecolor{comment}{rgb}{0.5,0.0,0.0}
-\definecolor{keyword}{rgb}{0.0,0.5,0.0}
-\definecolor{keywordtype}{rgb}{0.38,0.25,0.125}
-\definecolor{keywordflow}{rgb}{0.88,0.5,0.0}
-\definecolor{preprocessor}{rgb}{0.5,0.38,0.125}
-\definecolor{stringliteral}{rgb}{0.0,0.125,0.25}
-\definecolor{charliteral}{rgb}{0.0,0.5,0.5}
-\definecolor{vhdldigit}{rgb}{1.0,0.0,1.0}
-\definecolor{vhdlkeyword}{rgb}{0.43,0.0,0.43}
-\definecolor{vhdllogic}{rgb}{1.0,0.0,0.0}
-\definecolor{vhdlchar}{rgb}{0.0,0.0,0.0}
-
-% Color used for table heading
-\newcommand{\tableheadbgcolor}{lightgray}%
-
-% Version of hypertarget with correct landing location
-\newcommand{\Hypertarget}[1]{\Hy@raisedlink{\hypertarget{#1}{}}}
-
-% Define caption that is also suitable in a table
-\makeatletter
-\def\doxyfigcaption{%
-\refstepcounter{figure}%
-\@dblarg{\@caption{figure}}}
-\makeatother
diff --git a/docs/latex/files.tex b/docs/latex/files.tex
deleted file mode 100644
index dd3f8c403d91f08341f15f875d16f71e9c34e1ac..0000000000000000000000000000000000000000
--- a/docs/latex/files.tex
+++ /dev/null
@@ -1,6 +0,0 @@
-\section{File List}
-Here is a list of all documented files with brief descriptions\+:\begin{DoxyCompactList}
-\item\contentsline{section}{\mbox{\hyperlink{_factor_oracle_8cpp}{Factor\+Oracle.\+cpp}} \\*A file that contains the functions needed for the creation of a Factor Oracle }{\pageref{_factor_oracle_8cpp}}{}
-\item\contentsline{section}{\mbox{\hyperlink{_factor_oracle_8h}{Factor\+Oracle.\+h}} \\*A file that contains the definitions of the classes needed for the creation of a Factor Oracle }{\pageref{_factor_oracle_8h}}{}
-\item\contentsline{section}{\mbox{\hyperlink{main_8cpp}{main.\+cpp}} \\*A file that contains the main functions, which starts all the algorithm }{\pageref{main_8cpp}}{}
-\end{DoxyCompactList}
diff --git a/docs/latex/main_8cpp.tex b/docs/latex/main_8cpp.tex
deleted file mode 100644
index 068fd1aa1a7ad359c058486d30c7155edaed339c..0000000000000000000000000000000000000000
--- a/docs/latex/main_8cpp.tex
+++ /dev/null
@@ -1,20 +0,0 @@
-\hypertarget{main_8cpp}{}\section{main.\+cpp File Reference}
-\label{main_8cpp}\index{main.cpp@{main.cpp}}
-
-
-A file that contains the main functions, which starts all the algorithm.
-
-
-{\ttfamily \#include \char`\"{}Factor\+Oracle.\+h\char`\"{}}\newline
-\subsection*{Functions}
-\begin{DoxyCompactItemize}
-\item
-\mbox{\Hypertarget{main_8cpp_ae66f6b31b5ad750f1fe042a706a4e3d4}\label{main_8cpp_ae66f6b31b5ad750f1fe042a706a4e3d4}}
-int {\bfseries main} ()
-\end{DoxyCompactItemize}
-
-
-\subsection{Detailed Description}
-A file that contains the main functions, which starts all the algorithm.
-
-One functions\+: main.
\ No newline at end of file
diff --git a/docs/latex/refman.tex b/docs/latex/refman.tex
deleted file mode 100644
index 07c92b3b5a403d2066950f7c7d3d8080e5e2b507..0000000000000000000000000000000000000000
--- a/docs/latex/refman.tex
+++ /dev/null
@@ -1,184 +0,0 @@
-\let\mypdfximage\pdfximage\def\pdfximage{\immediate\mypdfximage}\documentclass[twoside]{book}
-
-% Packages required by doxygen
-\usepackage{fixltx2e}
-\usepackage{calc}
-\usepackage{doxygen}
-\usepackage{graphicx}
-\usepackage[utf8]{inputenc}
-\usepackage{makeidx}
-\usepackage{multicol}
-\usepackage{multirow}
-\PassOptionsToPackage{warn}{textcomp}
-\usepackage{textcomp}
-\usepackage[nointegrals]{wasysym}
-\usepackage[table]{xcolor}
-\usepackage{ifpdf,ifxetex}
-
-% Font selection
-\usepackage[T1]{fontenc}
-\usepackage[scaled=.90]{helvet}
-\usepackage{courier}
-\usepackage{amssymb}
-\usepackage{sectsty}
-\renewcommand{\familydefault}{\sfdefault}
-\allsectionsfont{%
- \fontseries{bc}\selectfont%
- \color{darkgray}%
-}
-\renewcommand{\DoxyLabelFont}{%
- \fontseries{bc}\selectfont%
- \color{darkgray}%
-}
-\newcommand{\+}{\discretionary{\mbox{\scriptsize$\hookleftarrow$}}{}{}}
-
-% Arguments of doxygenemoji:
-% 1) ':<text>:' form of the emoji, already "LaTeX"-escaped
-% 2) file with the name of the emoji without the .png extension
-% in case image exist use this otherwise use the ':<text>:' form
-\newcommand{\doxygenemoji}[2]{%
- \IfFileExists{./#2.png}{\raisebox{-0.1em}{\includegraphics[height=0.9em]{./#2.png}}}{#1}%
-}
-% Page & text layout
-\usepackage{geometry}
-\geometry{%
- a4paper,%
- top=2.5cm,%
- bottom=2.5cm,%
- left=2.5cm,%
- right=2.5cm%
-}
-\tolerance=750
-\hfuzz=15pt
-\hbadness=750
-\setlength{\emergencystretch}{15pt}
-\setlength{\parindent}{0cm}
-\newcommand{\doxynormalparskip}{\setlength{\parskip}{3ex plus 2ex minus 2ex}}
-\newcommand{\doxytocparskip}{\setlength{\parskip}{1ex plus 0ex minus 0ex}}
-\doxynormalparskip
-\makeatletter
-\renewcommand{\paragraph}{%
- \@startsection{paragraph}{4}{0ex}{-1.0ex}{1.0ex}{%
- \normalfont\normalsize\bfseries\SS@parafont%
- }%
-}
-\renewcommand{\subparagraph}{%
- \@startsection{subparagraph}{5}{0ex}{-1.0ex}{1.0ex}{%
- \normalfont\normalsize\bfseries\SS@subparafont%
- }%
-}
-\makeatother
-
-% Headers & footers
-\usepackage{fancyhdr}
-\pagestyle{fancyplain}
-\fancyhead[LE]{\fancyplain{}{\bfseries\thepage}}
-\fancyhead[CE]{\fancyplain{}{}}
-\fancyhead[RE]{\fancyplain{}{\bfseries\leftmark}}
-\fancyhead[LO]{\fancyplain{}{\bfseries\rightmark}}
-\fancyhead[CO]{\fancyplain{}{}}
-\fancyhead[RO]{\fancyplain{}{\bfseries\thepage}}
-\fancyfoot[LE]{\fancyplain{}{}}
-\fancyfoot[CE]{\fancyplain{}{}}
-\fancyfoot[RE]{\fancyplain{}{\bfseries\scriptsize Generated by Doxygen }}
-\fancyfoot[LO]{\fancyplain{}{\bfseries\scriptsize Generated by Doxygen }}
-\fancyfoot[CO]{\fancyplain{}{}}
-\fancyfoot[RO]{\fancyplain{}{}}
-\renewcommand{\footrulewidth}{0.4pt}
-\renewcommand{\chaptermark}[1]{%
- \markboth{#1}{}%
-}
-\renewcommand{\sectionmark}[1]{%
- \markright{\thesection\ #1}%
-}
-
-% Indices & bibliography
-\usepackage{natbib}
-\usepackage[titles]{tocloft}
-\setcounter{tocdepth}{3}
-\setcounter{secnumdepth}{5}
-\makeindex
-
-\usepackage{newunicodechar}
- \newunicodechar{â»}{${}^{-}$}% Superscript minus
- \newunicodechar{²}{${}^{2}$}% Superscript two
- \newunicodechar{³}{${}^{3}$}% Superscript three
-
-% Hyperlinks (required, but should be loaded last)
-\ifpdf
- \usepackage[pdftex,pagebackref=true]{hyperref}
-\else
- \ifxetex
- \usepackage[pagebackref=true]{hyperref}
- \else
- \usepackage[ps2pdf,pagebackref=true]{hyperref}
- \fi
-\fi
-
-\hypersetup{%
- colorlinks=true,%
- linkcolor=blue,%
- citecolor=blue,%
- unicode%
-}
-
-% Custom commands
-\newcommand{\clearemptydoublepage}{%
- \newpage{\pagestyle{empty}\cleardoublepage}%
-}
-
-\usepackage{caption}
-\captionsetup{labelsep=space,justification=centering,font={bf},singlelinecheck=off,skip=4pt,position=top}
-
-\usepackage{etoc}
-\etocsettocstyle{\doxytocparskip}{\doxynormalparskip}
-\renewcommand{\numberline}[1]{#1~}
-%===== C O N T E N T S =====
-
-\begin{document}
-
-% Titlepage & ToC
-\hypersetup{pageanchor=false,
- bookmarksnumbered=true,
- pdfencoding=unicode
- }
-\pagenumbering{alph}
-\begin{titlepage}
-\vspace*{7cm}
-\begin{center}%
-{\Large My Project }\\
-\vspace*{1cm}
-{\large Generated by Doxygen 1.8.15}\\
-\end{center}
-\end{titlepage}
-\clearemptydoublepage
-\pagenumbering{roman}
-\tableofcontents
-\clearemptydoublepage
-\pagenumbering{arabic}
-\hypersetup{pageanchor=true}
-
-%--- Begin generated contents ---
-\chapter{Class Index}
-\input{annotated}
-\chapter{File Index}
-\input{files}
-\chapter{Class Documentation}
-\input{class_factor_oracle}
-\input{class_single_transition}
-\input{class_state}
-\chapter{File Documentation}
-\input{_factor_oracle_8cpp}
-\input{_factor_oracle_8h}
-\input{main_8cpp}
-%--- End generated contents ---
-
-% Index
-\backmatter
-\newpage
-\phantomsection
-\clearemptydoublepage
-\addcontentsline{toc}{chapter}{\indexname}
-\printindex
-
-\end{document}
diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt
new file mode 100644
index 0000000000000000000000000000000000000000..e0c1239964a90bd92c7370615185d105033b0dde
--- /dev/null
+++ b/src/CMakeLists.txt
@@ -0,0 +1,15 @@
+# Specify the minimum version for CMake
+cmake_minimum_required(VERSION 3.0.0)
+
+# project information
+project(factor-oracle_exec CXX)
+
+# Libraries
+add_library(fo_libs FactorOracle.cpp)
+target_include_directories(fo_libs PUBLIC ${CMAKE_CURRENT_LIST_DIR})
+
+
+# The main programn
+add_executable(factor-oracle main.cpp)
+set_property(TARGET factor-oracle PROPERTY CXX_STANDARD 14)
+target_link_libraries(factor-oracle fo_libs)
diff --git a/src/FactorOracle.h b/src/FactorOracle.h
index 2375a620799f9812a35e1ecf9dc178afded464c3..5bd4585ae0d0d7b64759919c5d79d6c702f80994 100644
--- a/src/FactorOracle.h
+++ b/src/FactorOracle.h
@@ -1,14 +1,13 @@
//
// Created by MARIA PAULA CARRERO on 7/16/19.
//
+#include <algorithm>
#include <iostream>
#include <new>
+#include <random>
#include <string>
-#include <vector>
#include <variant>
-#include <random>
-#include <algorithm>
-
+#include <vector>
#ifndef FACTORORACLESTRING_FACTORORACLE_H
#define FACTORORACLESTRING_FACTORORACLE_H
@@ -17,32 +16,31 @@
#define RAND_MAX 0x7fffffff
/*! \file FactorOracle.h
- \brief A file that contains the definitions of the classes needed for the creation of a Factor Oracle.
+ \brief A file that contains the definitions of the classes needed for the
+ creation of a Factor Oracle.
Three main classes: FactorOracle, State and SingleTransition.
*/
-/*! \fn void AddLetter(FactorOracle& States, vector <vector<int>> &T, int i, string word)
- \brief Adds new transitions from state i-1 to state i.
- \param States A reference to a FactorOracle class.
- \param T A vector where each position has all the suffix transitions directed to each state.
- \param i The integer of the current state.
- \param word The input string.
+/*! \fn void AddLetter(FactorOracle& States, vector <vector<int>> &T, int i,
+ string word) \brief Adds new transitions from state i-1 to state i. \param
+ States A reference to a FactorOracle class. \param T A vector where each
+ position has all the suffix transitions directed to each state. \param i The
+ integer of the current state. \param word The input string.
*/
/*! \fn int LengthCommonSuffix(FactorOracle& States, int phi_one, int phi_two)
- \brief Finds the length of a common suffix ending at the position phi_one and phi_two by traversing the suffix links.
- \param States A reference to a FactorOracle class.
- \param phi_one The position of the state.
- \param phi_two The position of the state.
+ \brief Finds the length of a common suffix ending at the position phi_one
+ and phi_two by traversing the suffix links. \param States A reference to a
+ FactorOracle class. \param phi_one The position of the state. \param phi_two
+ The position of the state.
*/
-/*! \fn int FindBetter(FactorOracle& States, vector <vector<int>> &T, int i, char alpha, string word)
- \brief Writes \a count bytes from \a buf to the filedescriptor \a fd.
- \param States a reference to a FactorOracle class.
- \param T A vector where each position has all the suffix transitions directed to each state.
- \param i The integer of the current state.
- \param alpha The transition symbol.
- \param word The input string.
- \return A better state
+/*! \fn int FindBetter(FactorOracle& States, vector <vector<int>> &T, int i,
+ char alpha, string word) \brief Writes \a count bytes from \a buf to the
+ filedescriptor \a fd. \param States a reference to a FactorOracle class.
+ \param T A vector where each position has all the suffix transitions
+ directed to each state. \param i The integer of the current state. \param
+ alpha The transition symbol. \param word The input string. \return A better
+ state
*/
/*! \fn string FOGenerate(FactorOracle& States, int i, string v, float q)
\brief Generates the Factor Oracle improvisation.
@@ -58,51 +56,42 @@
\param word The input string.
*/
-
-
-
using namespace std;
-/** The class SingleTransition denotes the elements that belong to each transition
- */
-class SingleTransition
-{
-public:
- int first_state_; /**< denotes the first state of the transition */
- int last_state_; /**< denotes the last state of the transition */
- char symbol_; /**< denotes the symbol (letter) of the transition */
+/** The class SingleTransition denotes the elements that belong to each
+ * transition
+ */
+class SingleTransition {
+ public:
+ int first_state_; /**< denotes the first state of the transition */
+ int last_state_; /**< denotes the last state of the transition */
+ char symbol_; /**< denotes the symbol (letter) of the transition */
};
/** The class State denotes the elements that belong to each state
* state denotes de number of the state
- * vector <SingleTransition> transition is the vector where all forward links of the state are defined
- * suffix_transition denotes which is the suffix link of this state
- * lrs is the longest repeated subsequence of this state
+ * vector <SingleTransition> transition is the vector where all forward links of
+ * the state are defined suffix_transition denotes which is the suffix link of
+ * this state lrs is the longest repeated subsequence of this state
* */
-class State
-{
-public:
- int state_; /*!< denotes the number of the state */
- vector <SingleTransition> transition_; /*!< denotes the number of the state */
- int suffix_transition_;
- int lrs_ = 0;
- void singleTransitionResize(){
- transition_.resize(R);
- }
+class State {
+ public:
+ int state_; /*!< denotes the number of the state */
+ vector<SingleTransition> transition_; /*!< denotes the number of the state */
+ int suffix_transition_;
+ int lrs_ = 0;
+ void singleTransitionResize() { transition_.resize(R); }
};
-
-class FactorOracle
-{
-public:
- vector <State> states_; /**< vector of all the states */
- void AddLetter(FactorOracle& States, vector <vector<int>> &T, int i, string word);
- int LengthCommonSuffix(FactorOracle& States, int phi_one, int phi_two);
- int FindBetter(FactorOracle& States, vector <vector<int>> &T, int i, char alpha, string word);
- string FOGenerate(FactorOracle& States, int i, string v, float q);
- void FactorOracleStart(FactorOracle& OracleRelations,string word);
-
+class FactorOracle {
+ public:
+ vector<State> states_; /**< vector of all the states */
+ void AddLetter(FactorOracle& States, vector<vector<int>>& T, int i,
+ string word);
+ int LengthCommonSuffix(FactorOracle& States, int phi_one, int phi_two);
+ int FindBetter(FactorOracle& States, vector<vector<int>>& T, int i,
+ char alpha, string word);
+ string FOGenerate(FactorOracle& States, int& i, string v, float q);
+ void FactorOracleStart(FactorOracle& OracleRelations, string word);
};
-
-
-#endif //FACTORORACLESTRING_FACTORORACLE_H
+#endif // FACTORORACLESTRING_FACTORORACLE_H
diff --git a/tests/CMakeLists.txt b/tests/CMakeLists.txt
new file mode 100644
index 0000000000000000000000000000000000000000..77340373220dbac979d8879d8b194d0cf04c323a
--- /dev/null
+++ b/tests/CMakeLists.txt
@@ -0,0 +1,17 @@
+# Specify the minimum version for CMake
+cmake_minimum_required(VERSION 3.0.0)
+
+# project information
+project(factor-oracle_tests CXX)
+
+# Requires Catch2
+set(CATCH_INCLUDE_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../third-party/catch2)
+add_library(catch INTERFACE)
+target_include_directories(catch INTERFACE ${CATCH_INCLUDE_DIR})
+
+# Make test executable
+add_executable(unit_tests main.cpp)
+target_link_libraries(unit_tests catch fo_libs)
+
+# Enable Unit testing
+add_test(NAME UnitTests COMMAND unit_tests)
diff --git a/tests/factor_oracle.cpp b/tests/factor_oracle.cpp
new file mode 100644
index 0000000000000000000000000000000000000000..7f156535b2127bedb9397940e5f96eeac2784f1b
--- /dev/null
+++ b/tests/factor_oracle.cpp
@@ -0,0 +1,5 @@
+#include <catch.hpp>
+#include <string>
+#include "FactorOracle.hpp"
+
+TEST_CASE() { /** Insert here the tests */ }
diff --git a/tests/main.cpp b/tests/main.cpp
new file mode 100644
index 0000000000000000000000000000000000000000..0c7c351f437f5f43f3bb62beb254a9f1ecbec5a0
--- /dev/null
+++ b/tests/main.cpp
@@ -0,0 +1,2 @@
+#define CATCH_CONFIG_MAIN
+#include "catch.hpp"
diff --git a/third-party/catch2/catch.hpp b/third-party/catch2/catch.hpp
new file mode 100644
index 0000000000000000000000000000000000000000..303f664ffc3b051af3e39f1b89252d4b235d57d9
--- /dev/null
+++ b/third-party/catch2/catch.hpp
@@ -0,0 +1,16865 @@
+/*
+ * Catch v2.9.1
+ * Generated: 2019-06-17 11:59:24.363643
+ * ----------------------------------------------------------
+ * This file has been merged from multiple headers. Please don't edit it directly
+ * Copyright (c) 2019 Two Blue Cubes Ltd. All rights reserved.
+ *
+ * Distributed under the Boost Software License, Version 1.0. (See accompanying
+ * file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
+ */
+#ifndef TWOBLUECUBES_SINGLE_INCLUDE_CATCH_HPP_INCLUDED
+#define TWOBLUECUBES_SINGLE_INCLUDE_CATCH_HPP_INCLUDED
+// start catch.hpp
+
+
+#define CATCH_VERSION_MAJOR 2
+#define CATCH_VERSION_MINOR 9
+#define CATCH_VERSION_PATCH 1
+
+#ifdef __clang__
+# pragma clang system_header
+#elif defined __GNUC__
+# pragma GCC system_header
+#endif
+
+// start catch_suppress_warnings.h
+
+#ifdef __clang__
+# ifdef __ICC // icpc defines the __clang__ macro
+# pragma warning(push)
+# pragma warning(disable: 161 1682)
+# else // __ICC
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wpadded"
+# pragma clang diagnostic ignored "-Wswitch-enum"
+# pragma clang diagnostic ignored "-Wcovered-switch-default"
+# endif
+#elif defined __GNUC__
+ // Because REQUIREs trigger GCC's -Wparentheses, and because still
+ // supported version of g++ have only buggy support for _Pragmas,
+ // Wparentheses have to be suppressed globally.
+# pragma GCC diagnostic ignored "-Wparentheses" // See #674 for details
+
+# pragma GCC diagnostic push
+# pragma GCC diagnostic ignored "-Wunused-variable"
+# pragma GCC diagnostic ignored "-Wpadded"
+#endif
+// end catch_suppress_warnings.h
+#if defined(CATCH_CONFIG_MAIN) || defined(CATCH_CONFIG_RUNNER)
+# define CATCH_IMPL
+# define CATCH_CONFIG_ALL_PARTS
+#endif
+
+// In the impl file, we want to have access to all parts of the headers
+// Can also be used to sanely support PCHs
+#if defined(CATCH_CONFIG_ALL_PARTS)
+# define CATCH_CONFIG_EXTERNAL_INTERFACES
+# if defined(CATCH_CONFIG_DISABLE_MATCHERS)
+# undef CATCH_CONFIG_DISABLE_MATCHERS
+# endif
+# if !defined(CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER)
+# define CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER
+# endif
+#endif
+
+#if !defined(CATCH_CONFIG_IMPL_ONLY)
+// start catch_platform.h
+
+#ifdef __APPLE__
+# include <TargetConditionals.h>
+# if TARGET_OS_OSX == 1
+# define CATCH_PLATFORM_MAC
+# elif TARGET_OS_IPHONE == 1
+# define CATCH_PLATFORM_IPHONE
+# endif
+
+#elif defined(linux) || defined(__linux) || defined(__linux__)
+# define CATCH_PLATFORM_LINUX
+
+#elif defined(WIN32) || defined(__WIN32__) || defined(_WIN32) || defined(_MSC_VER) || defined(__MINGW32__)
+# define CATCH_PLATFORM_WINDOWS
+#endif
+
+// end catch_platform.h
+
+#ifdef CATCH_IMPL
+# ifndef CLARA_CONFIG_MAIN
+# define CLARA_CONFIG_MAIN_NOT_DEFINED
+# define CLARA_CONFIG_MAIN
+# endif
+#endif
+
+// start catch_user_interfaces.h
+
+namespace Catch {
+ unsigned int rngSeed();
+}
+
+// end catch_user_interfaces.h
+// start catch_tag_alias_autoregistrar.h
+
+// start catch_common.h
+
+// start catch_compiler_capabilities.h
+
+// Detect a number of compiler features - by compiler
+// The following features are defined:
+//
+// CATCH_CONFIG_COUNTER : is the __COUNTER__ macro supported?
+// CATCH_CONFIG_WINDOWS_SEH : is Windows SEH supported?
+// CATCH_CONFIG_POSIX_SIGNALS : are POSIX signals supported?
+// CATCH_CONFIG_DISABLE_EXCEPTIONS : Are exceptions enabled?
+// ****************
+// Note to maintainers: if new toggles are added please document them
+// in configuration.md, too
+// ****************
+
+// In general each macro has a _NO_<feature name> form
+// (e.g. CATCH_CONFIG_NO_POSIX_SIGNALS) which disables the feature.
+// Many features, at point of detection, define an _INTERNAL_ macro, so they
+// can be combined, en-mass, with the _NO_ forms later.
+
+#ifdef __cplusplus
+
+# if (__cplusplus >= 201402L) || (defined(_MSVC_LANG) && _MSVC_LANG >= 201402L)
+# define CATCH_CPP14_OR_GREATER
+# endif
+
+# if (__cplusplus >= 201703L) || (defined(_MSVC_LANG) && _MSVC_LANG >= 201703L)
+# define CATCH_CPP17_OR_GREATER
+# endif
+
+#endif
+
+#if defined(CATCH_CPP17_OR_GREATER)
+# define CATCH_INTERNAL_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS
+#endif
+
+#ifdef __clang__
+
+# define CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ _Pragma( "clang diagnostic push" ) \
+ _Pragma( "clang diagnostic ignored \"-Wexit-time-destructors\"" ) \
+ _Pragma( "clang diagnostic ignored \"-Wglobal-constructors\"")
+# define CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ _Pragma( "clang diagnostic pop" )
+
+# define CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS \
+ _Pragma( "clang diagnostic push" ) \
+ _Pragma( "clang diagnostic ignored \"-Wparentheses\"" )
+# define CATCH_INTERNAL_UNSUPPRESS_PARENTHESES_WARNINGS \
+ _Pragma( "clang diagnostic pop" )
+
+# define CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS \
+ _Pragma( "clang diagnostic push" ) \
+ _Pragma( "clang diagnostic ignored \"-Wunused-variable\"" )
+# define CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS \
+ _Pragma( "clang diagnostic pop" )
+
+# define CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ _Pragma( "clang diagnostic push" ) \
+ _Pragma( "clang diagnostic ignored \"-Wgnu-zero-variadic-macro-arguments\"" )
+# define CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \
+ _Pragma( "clang diagnostic pop" )
+
+#endif // __clang__
+
+////////////////////////////////////////////////////////////////////////////////
+// Assume that non-Windows platforms support posix signals by default
+#if !defined(CATCH_PLATFORM_WINDOWS)
+ #define CATCH_INTERNAL_CONFIG_POSIX_SIGNALS
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// We know some environments not to support full POSIX signals
+#if defined(__CYGWIN__) || defined(__QNX__) || defined(__EMSCRIPTEN__) || defined(__DJGPP__)
+ #define CATCH_INTERNAL_CONFIG_NO_POSIX_SIGNALS
+#endif
+
+#ifdef __OS400__
+# define CATCH_INTERNAL_CONFIG_NO_POSIX_SIGNALS
+# define CATCH_CONFIG_COLOUR_NONE
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Android somehow still does not support std::to_string
+#if defined(__ANDROID__)
+# define CATCH_INTERNAL_CONFIG_NO_CPP11_TO_STRING
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Not all Windows environments support SEH properly
+#if defined(__MINGW32__)
+# define CATCH_INTERNAL_CONFIG_NO_WINDOWS_SEH
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// PS4
+#if defined(__ORBIS__)
+# define CATCH_INTERNAL_CONFIG_NO_NEW_CAPTURE
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Cygwin
+#ifdef __CYGWIN__
+
+// Required for some versions of Cygwin to declare gettimeofday
+// see: http://stackoverflow.com/questions/36901803/gettimeofday-not-declared-in-this-scope-cygwin
+# define _BSD_SOURCE
+// some versions of cygwin (most) do not support std::to_string. Use the libstd check.
+// https://gcc.gnu.org/onlinedocs/gcc-4.8.2/libstdc++/api/a01053_source.html line 2812-2813
+# if !((__cplusplus >= 201103L) && defined(_GLIBCXX_USE_C99) \
+ && !defined(_GLIBCXX_HAVE_BROKEN_VSWPRINTF))
+
+# define CATCH_INTERNAL_CONFIG_NO_CPP11_TO_STRING
+
+# endif
+#endif // __CYGWIN__
+
+////////////////////////////////////////////////////////////////////////////////
+// Visual C++
+#ifdef _MSC_VER
+
+# if _MSC_VER >= 1900 // Visual Studio 2015 or newer
+# define CATCH_INTERNAL_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS
+# endif
+
+// Universal Windows platform does not support SEH
+// Or console colours (or console at all...)
+# if defined(WINAPI_FAMILY) && (WINAPI_FAMILY == WINAPI_FAMILY_APP)
+# define CATCH_CONFIG_COLOUR_NONE
+# else
+# define CATCH_INTERNAL_CONFIG_WINDOWS_SEH
+# endif
+
+// MSVC traditional preprocessor needs some workaround for __VA_ARGS__
+// _MSVC_TRADITIONAL == 0 means new conformant preprocessor
+// _MSVC_TRADITIONAL == 1 means old traditional non-conformant preprocessor
+# if !defined(_MSVC_TRADITIONAL) || (defined(_MSVC_TRADITIONAL) && _MSVC_TRADITIONAL)
+# define CATCH_INTERNAL_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+# endif
+#endif // _MSC_VER
+
+#if defined(_REENTRANT) || defined(_MSC_VER)
+// Enable async processing, as -pthread is specified or no additional linking is required
+# define CATCH_INTERNAL_CONFIG_USE_ASYNC
+#endif // _MSC_VER
+
+////////////////////////////////////////////////////////////////////////////////
+// Check if we are compiled with -fno-exceptions or equivalent
+#if defined(__EXCEPTIONS) || defined(__cpp_exceptions) || defined(_CPPUNWIND)
+# define CATCH_INTERNAL_CONFIG_EXCEPTIONS_ENABLED
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// DJGPP
+#ifdef __DJGPP__
+# define CATCH_INTERNAL_CONFIG_NO_WCHAR
+#endif // __DJGPP__
+
+////////////////////////////////////////////////////////////////////////////////
+// Embarcadero C++Build
+#if defined(__BORLANDC__)
+ #define CATCH_INTERNAL_CONFIG_POLYFILL_ISNAN
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+
+// Use of __COUNTER__ is suppressed during code analysis in
+// CLion/AppCode 2017.2.x and former, because __COUNTER__ is not properly
+// handled by it.
+// Otherwise all supported compilers support COUNTER macro,
+// but user still might want to turn it off
+#if ( !defined(__JETBRAINS_IDE__) || __JETBRAINS_IDE__ >= 20170300L )
+ #define CATCH_INTERNAL_CONFIG_COUNTER
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Check if string_view is available and usable
+// The check is split apart to work around v140 (VS2015) preprocessor issue...
+#if defined(__has_include)
+#if __has_include(<string_view>) && defined(CATCH_CPP17_OR_GREATER)
+# define CATCH_INTERNAL_CONFIG_CPP17_STRING_VIEW
+#endif
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Check if optional is available and usable
+#if defined(__has_include)
+# if __has_include(<optional>) && defined(CATCH_CPP17_OR_GREATER)
+# define CATCH_INTERNAL_CONFIG_CPP17_OPTIONAL
+# endif // __has_include(<optional>) && defined(CATCH_CPP17_OR_GREATER)
+#endif // __has_include
+
+////////////////////////////////////////////////////////////////////////////////
+// Check if variant is available and usable
+#if defined(__has_include)
+# if __has_include(<variant>) && defined(CATCH_CPP17_OR_GREATER)
+# if defined(__clang__) && (__clang_major__ < 8)
+ // work around clang bug with libstdc++ https://bugs.llvm.org/show_bug.cgi?id=31852
+ // fix should be in clang 8, workaround in libstdc++ 8.2
+# include <ciso646>
+# if defined(__GLIBCXX__) && defined(_GLIBCXX_RELEASE) && (_GLIBCXX_RELEASE < 9)
+# define CATCH_CONFIG_NO_CPP17_VARIANT
+# else
+# define CATCH_INTERNAL_CONFIG_CPP17_VARIANT
+# endif // defined(__GLIBCXX__) && defined(_GLIBCXX_RELEASE) && (_GLIBCXX_RELEASE < 9)
+# else
+# define CATCH_INTERNAL_CONFIG_CPP17_VARIANT
+# endif // defined(__clang__) && (__clang_major__ < 8)
+# endif // __has_include(<variant>) && defined(CATCH_CPP17_OR_GREATER)
+#endif // __has_include
+
+#if defined(CATCH_INTERNAL_CONFIG_COUNTER) && !defined(CATCH_CONFIG_NO_COUNTER) && !defined(CATCH_CONFIG_COUNTER)
+# define CATCH_CONFIG_COUNTER
+#endif
+#if defined(CATCH_INTERNAL_CONFIG_WINDOWS_SEH) && !defined(CATCH_CONFIG_NO_WINDOWS_SEH) && !defined(CATCH_CONFIG_WINDOWS_SEH) && !defined(CATCH_INTERNAL_CONFIG_NO_WINDOWS_SEH)
+# define CATCH_CONFIG_WINDOWS_SEH
+#endif
+// This is set by default, because we assume that unix compilers are posix-signal-compatible by default.
+#if defined(CATCH_INTERNAL_CONFIG_POSIX_SIGNALS) && !defined(CATCH_INTERNAL_CONFIG_NO_POSIX_SIGNALS) && !defined(CATCH_CONFIG_NO_POSIX_SIGNALS) && !defined(CATCH_CONFIG_POSIX_SIGNALS)
+# define CATCH_CONFIG_POSIX_SIGNALS
+#endif
+// This is set by default, because we assume that compilers with no wchar_t support are just rare exceptions.
+#if !defined(CATCH_INTERNAL_CONFIG_NO_WCHAR) && !defined(CATCH_CONFIG_NO_WCHAR) && !defined(CATCH_CONFIG_WCHAR)
+# define CATCH_CONFIG_WCHAR
+#endif
+
+#if !defined(CATCH_INTERNAL_CONFIG_NO_CPP11_TO_STRING) && !defined(CATCH_CONFIG_NO_CPP11_TO_STRING) && !defined(CATCH_CONFIG_CPP11_TO_STRING)
+# define CATCH_CONFIG_CPP11_TO_STRING
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_CPP17_OPTIONAL) && !defined(CATCH_CONFIG_NO_CPP17_OPTIONAL) && !defined(CATCH_CONFIG_CPP17_OPTIONAL)
+# define CATCH_CONFIG_CPP17_OPTIONAL
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS) && !defined(CATCH_CONFIG_NO_CPP17_UNCAUGHT_EXCEPTIONS) && !defined(CATCH_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS)
+# define CATCH_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_CPP17_STRING_VIEW) && !defined(CATCH_CONFIG_NO_CPP17_STRING_VIEW) && !defined(CATCH_CONFIG_CPP17_STRING_VIEW)
+# define CATCH_CONFIG_CPP17_STRING_VIEW
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_CPP17_VARIANT) && !defined(CATCH_CONFIG_NO_CPP17_VARIANT) && !defined(CATCH_CONFIG_CPP17_VARIANT)
+# define CATCH_CONFIG_CPP17_VARIANT
+#endif
+
+#if defined(CATCH_CONFIG_EXPERIMENTAL_REDIRECT)
+# define CATCH_INTERNAL_CONFIG_NEW_CAPTURE
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_NEW_CAPTURE) && !defined(CATCH_INTERNAL_CONFIG_NO_NEW_CAPTURE) && !defined(CATCH_CONFIG_NO_NEW_CAPTURE) && !defined(CATCH_CONFIG_NEW_CAPTURE)
+# define CATCH_CONFIG_NEW_CAPTURE
+#endif
+
+#if !defined(CATCH_INTERNAL_CONFIG_EXCEPTIONS_ENABLED) && !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+# define CATCH_CONFIG_DISABLE_EXCEPTIONS
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_POLYFILL_ISNAN) && !defined(CATCH_CONFIG_NO_POLYFILL_ISNAN) && !defined(CATCH_CONFIG_POLYFILL_ISNAN)
+# define CATCH_CONFIG_POLYFILL_ISNAN
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_USE_ASYNC) && !defined(CATCH_CONFIG_NO_USE_ASYNC) && !defined(CATCH_CONFIG_USE_ASYNC)
+# define CATCH_CONFIG_USE_ASYNC
+#endif
+
+#if !defined(CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS)
+# define CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS
+# define CATCH_INTERNAL_UNSUPPRESS_PARENTHESES_WARNINGS
+#endif
+#if !defined(CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS)
+# define CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS
+# define CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+#endif
+#if !defined(CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS)
+# define CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS
+# define CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS
+#endif
+#if !defined(CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS)
+# define CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS
+# define CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS
+#endif
+
+#if defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+#define CATCH_TRY if ((true))
+#define CATCH_CATCH_ALL if ((false))
+#define CATCH_CATCH_ANON(type) if ((false))
+#else
+#define CATCH_TRY try
+#define CATCH_CATCH_ALL catch (...)
+#define CATCH_CATCH_ANON(type) catch (type)
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR) && !defined(CATCH_CONFIG_NO_TRADITIONAL_MSVC_PREPROCESSOR) && !defined(CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR)
+#define CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#endif
+
+// end catch_compiler_capabilities.h
+#define INTERNAL_CATCH_UNIQUE_NAME_LINE2( name, line ) name##line
+#define INTERNAL_CATCH_UNIQUE_NAME_LINE( name, line ) INTERNAL_CATCH_UNIQUE_NAME_LINE2( name, line )
+#ifdef CATCH_CONFIG_COUNTER
+# define INTERNAL_CATCH_UNIQUE_NAME( name ) INTERNAL_CATCH_UNIQUE_NAME_LINE( name, __COUNTER__ )
+#else
+# define INTERNAL_CATCH_UNIQUE_NAME( name ) INTERNAL_CATCH_UNIQUE_NAME_LINE( name, __LINE__ )
+#endif
+
+#include <iosfwd>
+#include <string>
+#include <cstdint>
+
+// We need a dummy global operator<< so we can bring it into Catch namespace later
+struct Catch_global_namespace_dummy {};
+std::ostream& operator<<(std::ostream&, Catch_global_namespace_dummy);
+
+namespace Catch {
+
+ struct CaseSensitive { enum Choice {
+ Yes,
+ No
+ }; };
+
+ class NonCopyable {
+ NonCopyable( NonCopyable const& ) = delete;
+ NonCopyable( NonCopyable && ) = delete;
+ NonCopyable& operator = ( NonCopyable const& ) = delete;
+ NonCopyable& operator = ( NonCopyable && ) = delete;
+
+ protected:
+ NonCopyable();
+ virtual ~NonCopyable();
+ };
+
+ struct SourceLineInfo {
+
+ SourceLineInfo() = delete;
+ SourceLineInfo( char const* _file, std::size_t _line ) noexcept
+ : file( _file ),
+ line( _line )
+ {}
+
+ SourceLineInfo( SourceLineInfo const& other ) = default;
+ SourceLineInfo& operator = ( SourceLineInfo const& ) = default;
+ SourceLineInfo( SourceLineInfo&& ) noexcept = default;
+ SourceLineInfo& operator = ( SourceLineInfo&& ) noexcept = default;
+
+ bool empty() const noexcept;
+ bool operator == ( SourceLineInfo const& other ) const noexcept;
+ bool operator < ( SourceLineInfo const& other ) const noexcept;
+
+ char const* file;
+ std::size_t line;
+ };
+
+ std::ostream& operator << ( std::ostream& os, SourceLineInfo const& info );
+
+ // Bring in operator<< from global namespace into Catch namespace
+ // This is necessary because the overload of operator<< above makes
+ // lookup stop at namespace Catch
+ using ::operator<<;
+
+ // Use this in variadic streaming macros to allow
+ // >> +StreamEndStop
+ // as well as
+ // >> stuff +StreamEndStop
+ struct StreamEndStop {
+ std::string operator+() const;
+ };
+ template<typename T>
+ T const& operator + ( T const& value, StreamEndStop ) {
+ return value;
+ }
+}
+
+#define CATCH_INTERNAL_LINEINFO \
+ ::Catch::SourceLineInfo( __FILE__, static_cast<std::size_t>( __LINE__ ) )
+
+// end catch_common.h
+namespace Catch {
+
+ struct RegistrarForTagAliases {
+ RegistrarForTagAliases( char const* alias, char const* tag, SourceLineInfo const& lineInfo );
+ };
+
+} // end namespace Catch
+
+#define CATCH_REGISTER_TAG_ALIAS( alias, spec ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::RegistrarForTagAliases INTERNAL_CATCH_UNIQUE_NAME( AutoRegisterTagAlias )( alias, spec, CATCH_INTERNAL_LINEINFO ); } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+
+// end catch_tag_alias_autoregistrar.h
+// start catch_test_registry.h
+
+// start catch_interfaces_testcase.h
+
+#include <vector>
+
+namespace Catch {
+
+ class TestSpec;
+
+ struct ITestInvoker {
+ virtual void invoke () const = 0;
+ virtual ~ITestInvoker();
+ };
+
+ class TestCase;
+ struct IConfig;
+
+ struct ITestCaseRegistry {
+ virtual ~ITestCaseRegistry();
+ virtual std::vector<TestCase> const& getAllTests() const = 0;
+ virtual std::vector<TestCase> const& getAllTestsSorted( IConfig const& config ) const = 0;
+ };
+
+ bool matchTest( TestCase const& testCase, TestSpec const& testSpec, IConfig const& config );
+ std::vector<TestCase> filterTests( std::vector<TestCase> const& testCases, TestSpec const& testSpec, IConfig const& config );
+ std::vector<TestCase> const& getAllTestCasesSorted( IConfig const& config );
+
+}
+
+// end catch_interfaces_testcase.h
+// start catch_stringref.h
+
+#include <cstddef>
+#include <string>
+#include <iosfwd>
+
+namespace Catch {
+
+ /// A non-owning string class (similar to the forthcoming std::string_view)
+ /// Note that, because a StringRef may be a substring of another string,
+ /// it may not be null terminated. c_str() must return a null terminated
+ /// string, however, and so the StringRef will internally take ownership
+ /// (taking a copy), if necessary. In theory this ownership is not externally
+ /// visible - but it does mean (substring) StringRefs should not be shared between
+ /// threads.
+ class StringRef {
+ public:
+ using size_type = std::size_t;
+
+ private:
+ friend struct StringRefTestAccess;
+
+ char const* m_start;
+ size_type m_size;
+
+ char* m_data = nullptr;
+
+ void takeOwnership();
+
+ static constexpr char const* const s_empty = "";
+
+ public: // construction/ assignment
+ StringRef() noexcept
+ : StringRef( s_empty, 0 )
+ {}
+
+ StringRef( StringRef const& other ) noexcept
+ : m_start( other.m_start ),
+ m_size( other.m_size )
+ {}
+
+ StringRef( StringRef&& other ) noexcept
+ : m_start( other.m_start ),
+ m_size( other.m_size ),
+ m_data( other.m_data )
+ {
+ other.m_data = nullptr;
+ }
+
+ StringRef( char const* rawChars ) noexcept;
+
+ StringRef( char const* rawChars, size_type size ) noexcept
+ : m_start( rawChars ),
+ m_size( size )
+ {}
+
+ StringRef( std::string const& stdString ) noexcept
+ : m_start( stdString.c_str() ),
+ m_size( stdString.size() )
+ {}
+
+ ~StringRef() noexcept {
+ delete[] m_data;
+ }
+
+ auto operator = ( StringRef const &other ) noexcept -> StringRef& {
+ delete[] m_data;
+ m_data = nullptr;
+ m_start = other.m_start;
+ m_size = other.m_size;
+ return *this;
+ }
+
+ operator std::string() const;
+
+ void swap( StringRef& other ) noexcept;
+
+ public: // operators
+ auto operator == ( StringRef const& other ) const noexcept -> bool;
+ auto operator != ( StringRef const& other ) const noexcept -> bool;
+
+ auto operator[] ( size_type index ) const noexcept -> char;
+
+ public: // named queries
+ auto empty() const noexcept -> bool {
+ return m_size == 0;
+ }
+ auto size() const noexcept -> size_type {
+ return m_size;
+ }
+
+ auto numberOfCharacters() const noexcept -> size_type;
+ auto c_str() const -> char const*;
+
+ public: // substrings and searches
+ auto substr( size_type start, size_type size ) const noexcept -> StringRef;
+
+ // Returns the current start pointer.
+ // Note that the pointer can change when if the StringRef is a substring
+ auto currentData() const noexcept -> char const*;
+
+ private: // ownership queries - may not be consistent between calls
+ auto isOwned() const noexcept -> bool;
+ auto isSubstring() const noexcept -> bool;
+ };
+
+ auto operator + ( StringRef const& lhs, StringRef const& rhs ) -> std::string;
+ auto operator + ( StringRef const& lhs, char const* rhs ) -> std::string;
+ auto operator + ( char const* lhs, StringRef const& rhs ) -> std::string;
+
+ auto operator += ( std::string& lhs, StringRef const& sr ) -> std::string&;
+ auto operator << ( std::ostream& os, StringRef const& sr ) -> std::ostream&;
+
+ inline auto operator "" _sr( char const* rawChars, std::size_t size ) noexcept -> StringRef {
+ return StringRef( rawChars, size );
+ }
+
+} // namespace Catch
+
+inline auto operator "" _catch_sr( char const* rawChars, std::size_t size ) noexcept -> Catch::StringRef {
+ return Catch::StringRef( rawChars, size );
+}
+
+// end catch_stringref.h
+// start catch_type_traits.hpp
+
+
+#include <type_traits>
+
+namespace Catch{
+
+#ifdef CATCH_CPP17_OR_GREATER
+ template <typename...>
+ inline constexpr auto is_unique = std::true_type{};
+
+ template <typename T, typename... Rest>
+ inline constexpr auto is_unique<T, Rest...> = std::bool_constant<
+ (!std::is_same_v<T, Rest> && ...) && is_unique<Rest...>
+ >{};
+#else
+
+template <typename...>
+struct is_unique : std::true_type{};
+
+template <typename T0, typename T1, typename... Rest>
+struct is_unique<T0, T1, Rest...> : std::integral_constant
+<bool,
+ !std::is_same<T0, T1>::value
+ && is_unique<T0, Rest...>::value
+ && is_unique<T1, Rest...>::value
+>{};
+
+#endif
+}
+
+// end catch_type_traits.hpp
+// start catch_preprocessor.hpp
+
+
+#define CATCH_RECURSION_LEVEL0(...) __VA_ARGS__
+#define CATCH_RECURSION_LEVEL1(...) CATCH_RECURSION_LEVEL0(CATCH_RECURSION_LEVEL0(CATCH_RECURSION_LEVEL0(__VA_ARGS__)))
+#define CATCH_RECURSION_LEVEL2(...) CATCH_RECURSION_LEVEL1(CATCH_RECURSION_LEVEL1(CATCH_RECURSION_LEVEL1(__VA_ARGS__)))
+#define CATCH_RECURSION_LEVEL3(...) CATCH_RECURSION_LEVEL2(CATCH_RECURSION_LEVEL2(CATCH_RECURSION_LEVEL2(__VA_ARGS__)))
+#define CATCH_RECURSION_LEVEL4(...) CATCH_RECURSION_LEVEL3(CATCH_RECURSION_LEVEL3(CATCH_RECURSION_LEVEL3(__VA_ARGS__)))
+#define CATCH_RECURSION_LEVEL5(...) CATCH_RECURSION_LEVEL4(CATCH_RECURSION_LEVEL4(CATCH_RECURSION_LEVEL4(__VA_ARGS__)))
+
+#ifdef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define INTERNAL_CATCH_EXPAND_VARGS(...) __VA_ARGS__
+// MSVC needs more evaluations
+#define CATCH_RECURSION_LEVEL6(...) CATCH_RECURSION_LEVEL5(CATCH_RECURSION_LEVEL5(CATCH_RECURSION_LEVEL5(__VA_ARGS__)))
+#define CATCH_RECURSE(...) CATCH_RECURSION_LEVEL6(CATCH_RECURSION_LEVEL6(__VA_ARGS__))
+#else
+#define CATCH_RECURSE(...) CATCH_RECURSION_LEVEL5(__VA_ARGS__)
+#endif
+
+#define CATCH_REC_END(...)
+#define CATCH_REC_OUT
+
+#define CATCH_EMPTY()
+#define CATCH_DEFER(id) id CATCH_EMPTY()
+
+#define CATCH_REC_GET_END2() 0, CATCH_REC_END
+#define CATCH_REC_GET_END1(...) CATCH_REC_GET_END2
+#define CATCH_REC_GET_END(...) CATCH_REC_GET_END1
+#define CATCH_REC_NEXT0(test, next, ...) next CATCH_REC_OUT
+#define CATCH_REC_NEXT1(test, next) CATCH_DEFER ( CATCH_REC_NEXT0 ) ( test, next, 0)
+#define CATCH_REC_NEXT(test, next) CATCH_REC_NEXT1(CATCH_REC_GET_END test, next)
+
+#define CATCH_REC_LIST0(f, x, peek, ...) , f(x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1) ) ( f, peek, __VA_ARGS__ )
+#define CATCH_REC_LIST1(f, x, peek, ...) , f(x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST0) ) ( f, peek, __VA_ARGS__ )
+#define CATCH_REC_LIST2(f, x, peek, ...) f(x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1) ) ( f, peek, __VA_ARGS__ )
+
+#define CATCH_REC_LIST0_UD(f, userdata, x, peek, ...) , f(userdata, x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1_UD) ) ( f, userdata, peek, __VA_ARGS__ )
+#define CATCH_REC_LIST1_UD(f, userdata, x, peek, ...) , f(userdata, x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST0_UD) ) ( f, userdata, peek, __VA_ARGS__ )
+#define CATCH_REC_LIST2_UD(f, userdata, x, peek, ...) f(userdata, x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1_UD) ) ( f, userdata, peek, __VA_ARGS__ )
+
+// Applies the function macro `f` to each of the remaining parameters, inserts commas between the results,
+// and passes userdata as the first parameter to each invocation,
+// e.g. CATCH_REC_LIST_UD(f, x, a, b, c) evaluates to f(x, a), f(x, b), f(x, c)
+#define CATCH_REC_LIST_UD(f, userdata, ...) CATCH_RECURSE(CATCH_REC_LIST2_UD(f, userdata, __VA_ARGS__, ()()(), ()()(), ()()(), 0))
+
+#define CATCH_REC_LIST(f, ...) CATCH_RECURSE(CATCH_REC_LIST2(f, __VA_ARGS__, ()()(), ()()(), ()()(), 0))
+
+#define INTERNAL_CATCH_EXPAND1(param) INTERNAL_CATCH_EXPAND2(param)
+#define INTERNAL_CATCH_EXPAND2(...) INTERNAL_CATCH_NO## __VA_ARGS__
+#define INTERNAL_CATCH_DEF(...) INTERNAL_CATCH_DEF __VA_ARGS__
+#define INTERNAL_CATCH_NOINTERNAL_CATCH_DEF
+#define INTERNAL_CATCH_STRINGIZE(...) INTERNAL_CATCH_STRINGIZE2(__VA_ARGS__)
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define INTERNAL_CATCH_STRINGIZE2(...) #__VA_ARGS__
+#define INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS(param) INTERNAL_CATCH_STRINGIZE(INTERNAL_CATCH_REMOVE_PARENS(param))
+#else
+// MSVC is adding extra space and needs another indirection to expand INTERNAL_CATCH_NOINTERNAL_CATCH_DEF
+#define INTERNAL_CATCH_STRINGIZE2(...) INTERNAL_CATCH_STRINGIZE3(__VA_ARGS__)
+#define INTERNAL_CATCH_STRINGIZE3(...) #__VA_ARGS__
+#define INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS(param) (INTERNAL_CATCH_STRINGIZE(INTERNAL_CATCH_REMOVE_PARENS(param)) + 1)
+#endif
+
+#define INTERNAL_CATCH_MAKE_NAMESPACE2(...) ns_##__VA_ARGS__
+#define INTERNAL_CATCH_MAKE_NAMESPACE(name) INTERNAL_CATCH_MAKE_NAMESPACE2(name)
+
+#define INTERNAL_CATCH_REMOVE_PARENS(...) INTERNAL_CATCH_EXPAND1(INTERNAL_CATCH_DEF __VA_ARGS__)
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define INTERNAL_CATCH_MAKE_TYPE_LIST2(...) decltype(get_wrapper<INTERNAL_CATCH_REMOVE_PARENS_GEN(__VA_ARGS__)>())
+#define INTERNAL_CATCH_MAKE_TYPE_LIST(...) INTERNAL_CATCH_MAKE_TYPE_LIST2(INTERNAL_CATCH_REMOVE_PARENS(__VA_ARGS__))
+#else
+#define INTERNAL_CATCH_MAKE_TYPE_LIST2(...) INTERNAL_CATCH_EXPAND_VARGS(decltype(get_wrapper<INTERNAL_CATCH_REMOVE_PARENS_GEN(__VA_ARGS__)>()))
+#define INTERNAL_CATCH_MAKE_TYPE_LIST(...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_MAKE_TYPE_LIST2(INTERNAL_CATCH_REMOVE_PARENS(__VA_ARGS__)))
+#endif
+
+#define INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(...)\
+ CATCH_REC_LIST(INTERNAL_CATCH_MAKE_TYPE_LIST,__VA_ARGS__)
+
+#define INTERNAL_CATCH_REMOVE_PARENS_1_ARG(_0) INTERNAL_CATCH_REMOVE_PARENS(_0)
+#define INTERNAL_CATCH_REMOVE_PARENS_2_ARG(_0, _1) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_1_ARG(_1)
+#define INTERNAL_CATCH_REMOVE_PARENS_3_ARG(_0, _1, _2) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_2_ARG(_1, _2)
+#define INTERNAL_CATCH_REMOVE_PARENS_4_ARG(_0, _1, _2, _3) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_3_ARG(_1, _2, _3)
+#define INTERNAL_CATCH_REMOVE_PARENS_5_ARG(_0, _1, _2, _3, _4) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_4_ARG(_1, _2, _3, _4)
+#define INTERNAL_CATCH_REMOVE_PARENS_6_ARG(_0, _1, _2, _3, _4, _5) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_5_ARG(_1, _2, _3, _4, _5)
+#define INTERNAL_CATCH_REMOVE_PARENS_7_ARG(_0, _1, _2, _3, _4, _5, _6) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_6_ARG(_1, _2, _4, _5, _6)
+#define INTERNAL_CATCH_REMOVE_PARENS_8_ARG(_0, _1, _2, _3, _4, _5, _6, _7) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_7_ARG(_1, _2, _3, _4, _5, _6, _7)
+#define INTERNAL_CATCH_REMOVE_PARENS_9_ARG(_0, _1, _2, _3, _4, _5, _6, _7, _8) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_8_ARG(_1, _2, _3, _4, _5, _6, _7, _8)
+#define INTERNAL_CATCH_REMOVE_PARENS_10_ARG(_0, _1, _2, _3, _4, _5, _6, _7, _8, _9) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_9_ARG(_1, _2, _3, _4, _5, _6, _7, _8, _9)
+#define INTERNAL_CATCH_REMOVE_PARENS_11_ARG(_0, _1, _2, _3, _4, _5, _6, _7, _8, _9, _10) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_10_ARG(_1, _2, _3, _4, _5, _6, _7, _8, _9, _10)
+
+#define INTERNAL_CATCH_VA_NARGS_IMPL(_0, _1, _2, _3, _4, _5, _6, _7, _8, _9, _10, N, ...) N
+
+#define INTERNAL_CATCH_TYPE_GEN\
+ template<typename...> struct TypeList {};\
+ template<typename...Ts>\
+ constexpr auto get_wrapper() noexcept -> TypeList<Ts...> { return {}; }\
+ \
+ template<template<typename...> class L1, typename...E1, template<typename...> class L2, typename...E2> \
+ constexpr auto append(L1<E1...>, L2<E2...>) noexcept -> L1<E1...,E2...> { return {}; }\
+ template< template<typename...> class L1, typename...E1, template<typename...> class L2, typename...E2, typename...Rest>\
+ constexpr auto append(L1<E1...>, L2<E2...>, Rest...) noexcept -> decltype(append(L1<E1...,E2...>{}, Rest{}...)) { return {}; }\
+ template< template<typename...> class L1, typename...E1, typename...Rest>\
+ constexpr auto append(L1<E1...>, TypeList<mpl_::na>, Rest...) noexcept -> L1<E1...> { return {}; }\
+ \
+ template< template<typename...> class Container, template<typename...> class List, typename...elems>\
+ constexpr auto rewrap(List<elems...>) noexcept -> TypeList<Container<elems...>> { return {}; }\
+ template< template<typename...> class Container, template<typename...> class List, class...Elems, typename...Elements>\
+ constexpr auto rewrap(List<Elems...>,Elements...) noexcept -> decltype(append(TypeList<Container<Elems...>>{}, rewrap<Container>(Elements{}...))) { return {}; }\
+ \
+ template<template <typename...> class Final, template< typename...> class...Containers, typename...Types>\
+ constexpr auto create(TypeList<Types...>) noexcept -> decltype(append(Final<>{}, rewrap<Containers>(Types{}...)...)) { return {}; }\
+ template<template <typename...> class Final, template <typename...> class List, typename...Ts>\
+ constexpr auto convert(List<Ts...>) noexcept -> decltype(append(Final<>{},TypeList<Ts>{}...)) { return {}; }
+
+#define INTERNAL_CATCH_NTTP_1(signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)> struct Nttp{};\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ constexpr auto get_wrapper() noexcept -> Nttp<__VA_ARGS__> { return {}; } \
+ \
+ template< template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class Container, template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class List, INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ constexpr auto rewrap(List<__VA_ARGS__>) noexcept -> TypeList<Container<__VA_ARGS__>> { return {}; }\
+ template< template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class Container, template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class List, INTERNAL_CATCH_REMOVE_PARENS(signature), typename...Elements>\
+ constexpr auto rewrap(List<__VA_ARGS__>,Elements...elems) noexcept -> decltype(append(TypeList<Container<__VA_ARGS__>>{}, rewrap<Container>(elems...))) { return {}; }\
+ template<template <typename...> class Final, template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class...Containers, typename...Types>\
+ constexpr auto create(TypeList<Types...>) noexcept -> decltype(append(Final<>{}, rewrap<Containers>(Types{}...)...)) { return {}; }
+
+#define INTERNAL_CATCH_DECLARE_SIG_TEST0(TestName)
+#define INTERNAL_CATCH_DECLARE_SIG_TEST1(TestName, signature)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ static void TestName()
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_X(TestName, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ static void TestName()
+
+#define INTERNAL_CATCH_DEFINE_SIG_TEST0(TestName)
+#define INTERNAL_CATCH_DEFINE_SIG_TEST1(TestName, signature)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ static void TestName()
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_X(TestName, signature,...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ static void TestName()
+
+#define INTERNAL_CATCH_NTTP_REGISTER0(TestFunc, signature)\
+ template<typename Type>\
+ void reg_test(TypeList<Type>, Catch::NameAndTags nameAndTags)\
+ {\
+ Catch::AutoReg( Catch::makeTestInvoker(&TestFunc<Type>), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), nameAndTags);\
+ }
+
+#define INTERNAL_CATCH_NTTP_REGISTER(TestFunc, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ void reg_test(Nttp<__VA_ARGS__>, Catch::NameAndTags nameAndTags)\
+ {\
+ Catch::AutoReg( Catch::makeTestInvoker(&TestFunc<__VA_ARGS__>), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), nameAndTags);\
+ }
+
+#define INTERNAL_CATCH_NTTP_REGISTER_METHOD0(TestName, signature, ...)\
+ template<typename Type>\
+ void reg_test(TypeList<Type>, Catch::StringRef className, Catch::NameAndTags nameAndTags)\
+ {\
+ Catch::AutoReg( Catch::makeTestInvoker(&TestName<Type>::test), CATCH_INTERNAL_LINEINFO, className, nameAndTags);\
+ }
+
+#define INTERNAL_CATCH_NTTP_REGISTER_METHOD(TestName, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ void reg_test(Nttp<__VA_ARGS__>, Catch::StringRef className, Catch::NameAndTags nameAndTags)\
+ {\
+ Catch::AutoReg( Catch::makeTestInvoker(&TestName<__VA_ARGS__>::test), CATCH_INTERNAL_LINEINFO, className, nameAndTags);\
+ }
+
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD0(TestName, ClassName)
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD1(TestName, ClassName, signature)\
+ template<typename TestType> \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName)<TestType> { \
+ void test();\
+ }
+
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X(TestName, ClassName, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)> \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName)<__VA_ARGS__> { \
+ void test();\
+ }
+
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD0(TestName)
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD1(TestName, signature)\
+ template<typename TestType> \
+ void INTERNAL_CATCH_MAKE_NAMESPACE(TestName)::TestName<TestType>::test()
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X(TestName, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)> \
+ void INTERNAL_CATCH_MAKE_NAMESPACE(TestName)::TestName<__VA_ARGS__>::test()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define INTERNAL_CATCH_NTTP_0
+#define INTERNAL_CATCH_NTTP_GEN(...) INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__),INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_0)
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD1, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD0)(TestName, __VA_ARGS__)
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD1, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD0)(TestName, ClassName, __VA_ARGS__)
+#define INTERNAL_CATCH_NTTP_REG_METHOD_GEN(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD0, INTERNAL_CATCH_NTTP_REGISTER_METHOD0)(TestName, __VA_ARGS__)
+#define INTERNAL_CATCH_NTTP_REG_GEN(TestFunc, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER0, INTERNAL_CATCH_NTTP_REGISTER0)(TestFunc, __VA_ARGS__)
+#define INTERNAL_CATCH_DEFINE_SIG_TEST(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST1, INTERNAL_CATCH_DEFINE_SIG_TEST0)(TestName, __VA_ARGS__)
+#define INTERNAL_CATCH_DECLARE_SIG_TEST(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST1, INTERNAL_CATCH_DECLARE_SIG_TEST0)(TestName, __VA_ARGS__)
+#define INTERNAL_CATCH_REMOVE_PARENS_GEN(...) INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_REMOVE_PARENS_11_ARG,INTERNAL_CATCH_REMOVE_PARENS_10_ARG,INTERNAL_CATCH_REMOVE_PARENS_9_ARG,INTERNAL_CATCH_REMOVE_PARENS_8_ARG,INTERNAL_CATCH_REMOVE_PARENS_7_ARG,INTERNAL_CATCH_REMOVE_PARENS_6_ARG,INTERNAL_CATCH_REMOVE_PARENS_5_ARG,INTERNAL_CATCH_REMOVE_PARENS_4_ARG,INTERNAL_CATCH_REMOVE_PARENS_3_ARG,INTERNAL_CATCH_REMOVE_PARENS_2_ARG,INTERNAL_CATCH_REMOVE_PARENS_1_ARG)(__VA_ARGS__)
+#else
+#define INTERNAL_CATCH_NTTP_0(signature)
+#define INTERNAL_CATCH_NTTP_GEN(...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1,INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_0)( __VA_ARGS__))
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD1, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD0)(TestName, __VA_ARGS__))
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD1, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD0)(TestName, ClassName, __VA_ARGS__))
+#define INTERNAL_CATCH_NTTP_REG_METHOD_GEN(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD0, INTERNAL_CATCH_NTTP_REGISTER_METHOD0)(TestName, __VA_ARGS__))
+#define INTERNAL_CATCH_NTTP_REG_GEN(TestFunc, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER0, INTERNAL_CATCH_NTTP_REGISTER0)(TestFunc, __VA_ARGS__))
+#define INTERNAL_CATCH_DEFINE_SIG_TEST(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST1, INTERNAL_CATCH_DEFINE_SIG_TEST0)(TestName, __VA_ARGS__))
+#define INTERNAL_CATCH_DECLARE_SIG_TEST(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST1, INTERNAL_CATCH_DECLARE_SIG_TEST0)(TestName, __VA_ARGS__))
+#define INTERNAL_CATCH_REMOVE_PARENS_GEN(...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_REMOVE_PARENS_11_ARG,INTERNAL_CATCH_REMOVE_PARENS_10_ARG,INTERNAL_CATCH_REMOVE_PARENS_9_ARG,INTERNAL_CATCH_REMOVE_PARENS_8_ARG,INTERNAL_CATCH_REMOVE_PARENS_7_ARG,INTERNAL_CATCH_REMOVE_PARENS_6_ARG,INTERNAL_CATCH_REMOVE_PARENS_5_ARG,INTERNAL_CATCH_REMOVE_PARENS_4_ARG,INTERNAL_CATCH_REMOVE_PARENS_3_ARG,INTERNAL_CATCH_REMOVE_PARENS_2_ARG,INTERNAL_CATCH_REMOVE_PARENS_1_ARG)(__VA_ARGS__))
+#endif
+
+// end catch_preprocessor.hpp
+// start catch_meta.hpp
+
+
+#include <type_traits>
+
+namespace Catch {
+template<typename T>
+struct always_false : std::false_type {};
+
+template <typename> struct true_given : std::true_type {};
+struct is_callable_tester {
+ template <typename Fun, typename... Args>
+ true_given<decltype(std::declval<Fun>()(std::declval<Args>()...))> static test(int);
+ template <typename...>
+ std::false_type static test(...);
+};
+
+template <typename T>
+struct is_callable;
+
+template <typename Fun, typename... Args>
+struct is_callable<Fun(Args...)> : decltype(is_callable_tester::test<Fun, Args...>(0)) {};
+
+} // namespace Catch
+
+namespace mpl_{
+ struct na;
+}
+
+// end catch_meta.hpp
+namespace Catch {
+
+template<typename C>
+class TestInvokerAsMethod : public ITestInvoker {
+ void (C::*m_testAsMethod)();
+public:
+ TestInvokerAsMethod( void (C::*testAsMethod)() ) noexcept : m_testAsMethod( testAsMethod ) {}
+
+ void invoke() const override {
+ C obj;
+ (obj.*m_testAsMethod)();
+ }
+};
+
+auto makeTestInvoker( void(*testAsFunction)() ) noexcept -> ITestInvoker*;
+
+template<typename C>
+auto makeTestInvoker( void (C::*testAsMethod)() ) noexcept -> ITestInvoker* {
+ return new(std::nothrow) TestInvokerAsMethod<C>( testAsMethod );
+}
+
+struct NameAndTags {
+ NameAndTags( StringRef const& name_ = StringRef(), StringRef const& tags_ = StringRef() ) noexcept;
+ StringRef name;
+ StringRef tags;
+};
+
+struct AutoReg : NonCopyable {
+ AutoReg( ITestInvoker* invoker, SourceLineInfo const& lineInfo, StringRef const& classOrMethod, NameAndTags const& nameAndTags ) noexcept;
+ ~AutoReg();
+};
+
+} // end namespace Catch
+
+#if defined(CATCH_CONFIG_DISABLE)
+ #define INTERNAL_CATCH_TESTCASE_NO_REGISTRATION( TestName, ... ) \
+ static void TestName()
+ #define INTERNAL_CATCH_TESTCASE_METHOD_NO_REGISTRATION( TestName, ClassName, ... ) \
+ namespace{ \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName) { \
+ void test(); \
+ }; \
+ } \
+ void TestName::test()
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( TestName, TestFunc, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_DEFINE_SIG_TEST(TestFunc, INTERNAL_CATCH_REMOVE_PARENS(Signature))
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( TestNameClass, TestName, ClassName, Name, Tags, Signature, ... ) \
+ namespace{ \
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName) { \
+ INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, INTERNAL_CATCH_REMOVE_PARENS(Signature));\
+ } \
+ } \
+ INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, INTERNAL_CATCH_REMOVE_PARENS(Signature))
+
+ #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(Name, Tags, ...) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ )
+ #else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(Name, Tags, ...) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ ) )
+ #endif
+
+ #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(Name, Tags, Signature, ...) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ )
+ #else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(Name, Tags, Signature, ...) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) )
+ #endif
+
+ #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION( ClassName, Name, Tags,... ) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ )
+ #else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION( ClassName, Name, Tags,... ) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ ) )
+ #endif
+
+ #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION( ClassName, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ )
+ #else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION( ClassName, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ ) )
+ #endif
+#endif
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_TESTCASE2( TestName, ... ) \
+ static void TestName(); \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar )( Catch::makeTestInvoker( &TestName ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ __VA_ARGS__ } ); } /* NOLINT */ \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ static void TestName()
+ #define INTERNAL_CATCH_TESTCASE( ... ) \
+ INTERNAL_CATCH_TESTCASE2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), __VA_ARGS__ )
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_METHOD_AS_TEST_CASE( QualifiedMethod, ... ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar )( Catch::makeTestInvoker( &QualifiedMethod ), CATCH_INTERNAL_LINEINFO, "&" #QualifiedMethod, Catch::NameAndTags{ __VA_ARGS__ } ); } /* NOLINT */ \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_TEST_CASE_METHOD2( TestName, ClassName, ... )\
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName) { \
+ void test(); \
+ }; \
+ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar ) ( Catch::makeTestInvoker( &TestName::test ), CATCH_INTERNAL_LINEINFO, #ClassName, Catch::NameAndTags{ __VA_ARGS__ } ); /* NOLINT */ \
+ } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ void TestName::test()
+ #define INTERNAL_CATCH_TEST_CASE_METHOD( ClassName, ... ) \
+ INTERNAL_CATCH_TEST_CASE_METHOD2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), ClassName, __VA_ARGS__ )
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_REGISTER_TESTCASE( Function, ... ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar )( Catch::makeTestInvoker( Function ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ __VA_ARGS__ } ); /* NOLINT */ \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_2(TestName, TestFunc, Name, Tags, Signature, ... )\
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ INTERNAL_CATCH_DECLARE_SIG_TEST(TestFunc, INTERNAL_CATCH_REMOVE_PARENS(Signature));\
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){\
+ INTERNAL_CATCH_TYPE_GEN\
+ INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ INTERNAL_CATCH_NTTP_REG_GEN(TestFunc,INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ template<typename...Types> \
+ struct TestName{\
+ TestName(){\
+ int index = 0; \
+ constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, __VA_ARGS__)};\
+ using expander = int[];\
+ (void)expander{(reg_test(Types{}, Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index]), Tags } ), index++, 0)... };/* NOLINT */ \
+ }\
+ };\
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\
+ TestName<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(__VA_ARGS__)>();\
+ return 0;\
+ }();\
+ }\
+ }\
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \
+ INTERNAL_CATCH_DEFINE_SIG_TEST(TestFunc,INTERNAL_CATCH_REMOVE_PARENS(Signature))
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE(Name, Tags, ...) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE(Name, Tags, ...) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ ) )
+#endif
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG(Name, Tags, Signature, ...) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG(Name, Tags, Signature, ...) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) )
+#endif
+
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2(TestName, TestFuncName, Name, Tags, Signature, TmplTypes, TypesList) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ template<typename TestType> static void TestFuncName(); \
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName) { \
+ INTERNAL_CATCH_TYPE_GEN \
+ INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature)) \
+ template<typename... Types> \
+ struct TestName { \
+ void reg_tests() { \
+ int index = 0; \
+ using expander = int[]; \
+ constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes))};\
+ constexpr char const* types_list[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TypesList))};\
+ constexpr auto num_types = sizeof(types_list) / sizeof(types_list[0]);\
+ (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestFuncName<Types> ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index / num_types]) + "<" + std::string(types_list[index % num_types]) + ">", Tags } ), index++, 0)... };/* NOLINT */\
+ } \
+ }; \
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){ \
+ using TestInit = decltype(create<TestName, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes)>(TypeList<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(INTERNAL_CATCH_REMOVE_PARENS(TypesList))>{})); \
+ TestInit t; \
+ t.reg_tests(); \
+ return 0; \
+ }(); \
+ } \
+ } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \
+ template<typename TestType> \
+ static void TestFuncName()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE(Name, Tags, ...)\
+ INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename T,__VA_ARGS__)
+#else
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE(Name, Tags, ...)\
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename T, __VA_ARGS__ ) )
+#endif
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG(Name, Tags, Signature, ...)\
+ INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__)
+#else
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG(Name, Tags, Signature, ...)\
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) )
+#endif
+
+ #define INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_2(TestName, TestFunc, Name, Tags, TmplList)\
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ template<typename TestType> static void TestFunc(); \
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){\
+ INTERNAL_CATCH_TYPE_GEN\
+ template<typename... Types> \
+ struct TestName { \
+ void reg_tests() { \
+ int index = 0; \
+ using expander = int[]; \
+ (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestFunc<Types> ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ Name " - " + std::string(INTERNAL_CATCH_STRINGIZE(TmplList)) + " - " + std::to_string(index), Tags } ), index++, 0)... };/* NOLINT */\
+ } \
+ };\
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){ \
+ using TestInit = decltype(convert<TestName>(TmplList {})); \
+ TestInit t; \
+ t.reg_tests(); \
+ return 0; \
+ }(); \
+ }}\
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ template<typename TestType> \
+ static void TestFunc()
+
+ #define INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE(Name, Tags, TmplList) \
+ INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, TmplList )
+
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( TestNameClass, TestName, ClassName, Name, Tags, Signature, ... ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){ \
+ INTERNAL_CATCH_TYPE_GEN\
+ INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, INTERNAL_CATCH_REMOVE_PARENS(Signature));\
+ INTERNAL_CATCH_NTTP_REG_METHOD_GEN(TestName, INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ template<typename...Types> \
+ struct TestNameClass{\
+ TestNameClass(){\
+ int index = 0; \
+ constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, __VA_ARGS__)};\
+ using expander = int[];\
+ (void)expander{(reg_test(Types{}, #ClassName, Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index]), Tags } ), index++, 0)... };/* NOLINT */ \
+ }\
+ };\
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\
+ TestNameClass<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(__VA_ARGS__)>();\
+ return 0;\
+ }();\
+ }\
+ }\
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS\
+ CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS\
+ INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, INTERNAL_CATCH_REMOVE_PARENS(Signature))
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( ClassName, Name, Tags,... ) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( ClassName, Name, Tags,... ) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ ) )
+#endif
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ ) )
+#endif
+
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2(TestNameClass, TestName, ClassName, Name, Tags, Signature, TmplTypes, TypesList)\
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ template<typename TestType> \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName <TestType>) { \
+ void test();\
+ };\
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestNameClass) {\
+ INTERNAL_CATCH_TYPE_GEN \
+ INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ template<typename...Types>\
+ struct TestNameClass{\
+ void reg_tests(){\
+ int index = 0;\
+ using expander = int[];\
+ constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes))};\
+ constexpr char const* types_list[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TypesList))};\
+ constexpr auto num_types = sizeof(types_list) / sizeof(types_list[0]);\
+ (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestName<Types>::test ), CATCH_INTERNAL_LINEINFO, #ClassName, Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index / num_types]) + "<" + std::string(types_list[index % num_types]) + ">", Tags } ), index++, 0)... };/* NOLINT */ \
+ }\
+ };\
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\
+ using TestInit = decltype(create<TestNameClass, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes)>(TypeList<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(INTERNAL_CATCH_REMOVE_PARENS(TypesList))>{}));\
+ TestInit t;\
+ t.reg_tests();\
+ return 0;\
+ }(); \
+ }\
+ }\
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \
+ template<typename TestType> \
+ void TestName<TestType>::test()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( ClassName, Name, Tags, ... )\
+ INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, typename T, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( ClassName, Name, Tags, ... )\
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, typename T,__VA_ARGS__ ) )
+#endif
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... )\
+ INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, Signature, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... )\
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, Signature,__VA_ARGS__ ) )
+#endif
+
+ #define INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD_2( TestNameClass, TestName, ClassName, Name, Tags, TmplList) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ template<typename TestType> \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName <TestType>) { \
+ void test();\
+ };\
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){ \
+ INTERNAL_CATCH_TYPE_GEN\
+ template<typename...Types>\
+ struct TestNameClass{\
+ void reg_tests(){\
+ int index = 0;\
+ using expander = int[];\
+ (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestName<Types>::test ), CATCH_INTERNAL_LINEINFO, #ClassName, Catch::NameAndTags{ Name " - " + std::string(INTERNAL_CATCH_STRINGIZE(TmplList)) + " - " + std::to_string(index), Tags } ), index++, 0)... };/* NOLINT */ \
+ }\
+ };\
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\
+ using TestInit = decltype(convert<TestNameClass>(TmplList {}));\
+ TestInit t;\
+ t.reg_tests();\
+ return 0;\
+ }(); \
+ }}\
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ template<typename TestType> \
+ void TestName<TestType>::test()
+
+#define INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD(ClassName, Name, Tags, TmplList) \
+ INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, TmplList )
+
+// end catch_test_registry.h
+// start catch_capture.hpp
+
+// start catch_assertionhandler.h
+
+// start catch_assertioninfo.h
+
+// start catch_result_type.h
+
+namespace Catch {
+
+ // ResultWas::OfType enum
+ struct ResultWas { enum OfType {
+ Unknown = -1,
+ Ok = 0,
+ Info = 1,
+ Warning = 2,
+
+ FailureBit = 0x10,
+
+ ExpressionFailed = FailureBit | 1,
+ ExplicitFailure = FailureBit | 2,
+
+ Exception = 0x100 | FailureBit,
+
+ ThrewException = Exception | 1,
+ DidntThrowException = Exception | 2,
+
+ FatalErrorCondition = 0x200 | FailureBit
+
+ }; };
+
+ bool isOk( ResultWas::OfType resultType );
+ bool isJustInfo( int flags );
+
+ // ResultDisposition::Flags enum
+ struct ResultDisposition { enum Flags {
+ Normal = 0x01,
+
+ ContinueOnFailure = 0x02, // Failures fail test, but execution continues
+ FalseTest = 0x04, // Prefix expression with !
+ SuppressFail = 0x08 // Failures are reported but do not fail the test
+ }; };
+
+ ResultDisposition::Flags operator | ( ResultDisposition::Flags lhs, ResultDisposition::Flags rhs );
+
+ bool shouldContinueOnFailure( int flags );
+ inline bool isFalseTest( int flags ) { return ( flags & ResultDisposition::FalseTest ) != 0; }
+ bool shouldSuppressFailure( int flags );
+
+} // end namespace Catch
+
+// end catch_result_type.h
+namespace Catch {
+
+ struct AssertionInfo
+ {
+ StringRef macroName;
+ SourceLineInfo lineInfo;
+ StringRef capturedExpression;
+ ResultDisposition::Flags resultDisposition;
+
+ // We want to delete this constructor but a compiler bug in 4.8 means
+ // the struct is then treated as non-aggregate
+ //AssertionInfo() = delete;
+ };
+
+} // end namespace Catch
+
+// end catch_assertioninfo.h
+// start catch_decomposer.h
+
+// start catch_tostring.h
+
+#include <vector>
+#include <cstddef>
+#include <type_traits>
+#include <string>
+// start catch_stream.h
+
+#include <iosfwd>
+#include <cstddef>
+#include <ostream>
+
+namespace Catch {
+
+ std::ostream& cout();
+ std::ostream& cerr();
+ std::ostream& clog();
+
+ class StringRef;
+
+ struct IStream {
+ virtual ~IStream();
+ virtual std::ostream& stream() const = 0;
+ };
+
+ auto makeStream( StringRef const &filename ) -> IStream const*;
+
+ class ReusableStringStream {
+ std::size_t m_index;
+ std::ostream* m_oss;
+ public:
+ ReusableStringStream();
+ ~ReusableStringStream();
+
+ auto str() const -> std::string;
+
+ template<typename T>
+ auto operator << ( T const& value ) -> ReusableStringStream& {
+ *m_oss << value;
+ return *this;
+ }
+ auto get() -> std::ostream& { return *m_oss; }
+ };
+}
+
+// end catch_stream.h
+// start catch_interfaces_enum_values_registry.h
+
+#include <vector>
+
+namespace Catch {
+
+ namespace Detail {
+ struct EnumInfo {
+ StringRef m_name;
+ std::vector<std::pair<int, std::string>> m_values;
+
+ ~EnumInfo();
+
+ StringRef lookup( int value ) const;
+ };
+ } // namespace Detail
+
+ struct IMutableEnumValuesRegistry {
+ virtual ~IMutableEnumValuesRegistry();
+
+ virtual Detail::EnumInfo const& registerEnum( StringRef enumName, StringRef allEnums, std::vector<int> const& values ) = 0;
+
+ template<typename E>
+ Detail::EnumInfo const& registerEnum( StringRef enumName, StringRef allEnums, std::initializer_list<E> values ) {
+ std::vector<int> intValues;
+ intValues.reserve( values.size() );
+ for( auto enumValue : values )
+ intValues.push_back( static_cast<int>( enumValue ) );
+ return registerEnum( enumName, allEnums, intValues );
+ }
+ };
+
+} // Catch
+
+// end catch_interfaces_enum_values_registry.h
+
+#ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+#include <string_view>
+#endif
+
+#ifdef __OBJC__
+// start catch_objc_arc.hpp
+
+#import <Foundation/Foundation.h>
+
+#ifdef __has_feature
+#define CATCH_ARC_ENABLED __has_feature(objc_arc)
+#else
+#define CATCH_ARC_ENABLED 0
+#endif
+
+void arcSafeRelease( NSObject* obj );
+id performOptionalSelector( id obj, SEL sel );
+
+#if !CATCH_ARC_ENABLED
+inline void arcSafeRelease( NSObject* obj ) {
+ [obj release];
+}
+inline id performOptionalSelector( id obj, SEL sel ) {
+ if( [obj respondsToSelector: sel] )
+ return [obj performSelector: sel];
+ return nil;
+}
+#define CATCH_UNSAFE_UNRETAINED
+#define CATCH_ARC_STRONG
+#else
+inline void arcSafeRelease( NSObject* ){}
+inline id performOptionalSelector( id obj, SEL sel ) {
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Warc-performSelector-leaks"
+#endif
+ if( [obj respondsToSelector: sel] )
+ return [obj performSelector: sel];
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+ return nil;
+}
+#define CATCH_UNSAFE_UNRETAINED __unsafe_unretained
+#define CATCH_ARC_STRONG __strong
+#endif
+
+// end catch_objc_arc.hpp
+#endif
+
+#ifdef _MSC_VER
+#pragma warning(push)
+#pragma warning(disable:4180) // We attempt to stream a function (address) by const&, which MSVC complains about but is harmless
+#endif
+
+namespace Catch {
+ namespace Detail {
+
+ extern const std::string unprintableString;
+
+ std::string rawMemoryToString( const void *object, std::size_t size );
+
+ template<typename T>
+ std::string rawMemoryToString( const T& object ) {
+ return rawMemoryToString( &object, sizeof(object) );
+ }
+
+ template<typename T>
+ class IsStreamInsertable {
+ template<typename SS, typename TT>
+ static auto test(int)
+ -> decltype(std::declval<SS&>() << std::declval<TT>(), std::true_type());
+
+ template<typename, typename>
+ static auto test(...)->std::false_type;
+
+ public:
+ static const bool value = decltype(test<std::ostream, const T&>(0))::value;
+ };
+
+ template<typename E>
+ std::string convertUnknownEnumToString( E e );
+
+ template<typename T>
+ typename std::enable_if<
+ !std::is_enum<T>::value && !std::is_base_of<std::exception, T>::value,
+ std::string>::type convertUnstreamable( T const& ) {
+ return Detail::unprintableString;
+ }
+ template<typename T>
+ typename std::enable_if<
+ !std::is_enum<T>::value && std::is_base_of<std::exception, T>::value,
+ std::string>::type convertUnstreamable(T const& ex) {
+ return ex.what();
+ }
+
+ template<typename T>
+ typename std::enable_if<
+ std::is_enum<T>::value
+ , std::string>::type convertUnstreamable( T const& value ) {
+ return convertUnknownEnumToString( value );
+ }
+
+#if defined(_MANAGED)
+ //! Convert a CLR string to a utf8 std::string
+ template<typename T>
+ std::string clrReferenceToString( T^ ref ) {
+ if (ref == nullptr)
+ return std::string("null");
+ auto bytes = System::Text::Encoding::UTF8->GetBytes(ref->ToString());
+ cli::pin_ptr<System::Byte> p = &bytes[0];
+ return std::string(reinterpret_cast<char const *>(p), bytes->Length);
+ }
+#endif
+
+ } // namespace Detail
+
+ // If we decide for C++14, change these to enable_if_ts
+ template <typename T, typename = void>
+ struct StringMaker {
+ template <typename Fake = T>
+ static
+ typename std::enable_if<::Catch::Detail::IsStreamInsertable<Fake>::value, std::string>::type
+ convert(const Fake& value) {
+ ReusableStringStream rss;
+ // NB: call using the function-like syntax to avoid ambiguity with
+ // user-defined templated operator<< under clang.
+ rss.operator<<(value);
+ return rss.str();
+ }
+
+ template <typename Fake = T>
+ static
+ typename std::enable_if<!::Catch::Detail::IsStreamInsertable<Fake>::value, std::string>::type
+ convert( const Fake& value ) {
+#if !defined(CATCH_CONFIG_FALLBACK_STRINGIFIER)
+ return Detail::convertUnstreamable(value);
+#else
+ return CATCH_CONFIG_FALLBACK_STRINGIFIER(value);
+#endif
+ }
+ };
+
+ namespace Detail {
+
+ // This function dispatches all stringification requests inside of Catch.
+ // Should be preferably called fully qualified, like ::Catch::Detail::stringify
+ template <typename T>
+ std::string stringify(const T& e) {
+ return ::Catch::StringMaker<typename std::remove_cv<typename std::remove_reference<T>::type>::type>::convert(e);
+ }
+
+ template<typename E>
+ std::string convertUnknownEnumToString( E e ) {
+ return ::Catch::Detail::stringify(static_cast<typename std::underlying_type<E>::type>(e));
+ }
+
+#if defined(_MANAGED)
+ template <typename T>
+ std::string stringify( T^ e ) {
+ return ::Catch::StringMaker<T^>::convert(e);
+ }
+#endif
+
+ } // namespace Detail
+
+ // Some predefined specializations
+
+ template<>
+ struct StringMaker<std::string> {
+ static std::string convert(const std::string& str);
+ };
+
+#ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+ template<>
+ struct StringMaker<std::string_view> {
+ static std::string convert(std::string_view str);
+ };
+#endif
+
+ template<>
+ struct StringMaker<char const *> {
+ static std::string convert(char const * str);
+ };
+ template<>
+ struct StringMaker<char *> {
+ static std::string convert(char * str);
+ };
+
+#ifdef CATCH_CONFIG_WCHAR
+ template<>
+ struct StringMaker<std::wstring> {
+ static std::string convert(const std::wstring& wstr);
+ };
+
+# ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+ template<>
+ struct StringMaker<std::wstring_view> {
+ static std::string convert(std::wstring_view str);
+ };
+# endif
+
+ template<>
+ struct StringMaker<wchar_t const *> {
+ static std::string convert(wchar_t const * str);
+ };
+ template<>
+ struct StringMaker<wchar_t *> {
+ static std::string convert(wchar_t * str);
+ };
+#endif
+
+ // TBD: Should we use `strnlen` to ensure that we don't go out of the buffer,
+ // while keeping string semantics?
+ template<int SZ>
+ struct StringMaker<char[SZ]> {
+ static std::string convert(char const* str) {
+ return ::Catch::Detail::stringify(std::string{ str });
+ }
+ };
+ template<int SZ>
+ struct StringMaker<signed char[SZ]> {
+ static std::string convert(signed char const* str) {
+ return ::Catch::Detail::stringify(std::string{ reinterpret_cast<char const *>(str) });
+ }
+ };
+ template<int SZ>
+ struct StringMaker<unsigned char[SZ]> {
+ static std::string convert(unsigned char const* str) {
+ return ::Catch::Detail::stringify(std::string{ reinterpret_cast<char const *>(str) });
+ }
+ };
+
+ template<>
+ struct StringMaker<int> {
+ static std::string convert(int value);
+ };
+ template<>
+ struct StringMaker<long> {
+ static std::string convert(long value);
+ };
+ template<>
+ struct StringMaker<long long> {
+ static std::string convert(long long value);
+ };
+ template<>
+ struct StringMaker<unsigned int> {
+ static std::string convert(unsigned int value);
+ };
+ template<>
+ struct StringMaker<unsigned long> {
+ static std::string convert(unsigned long value);
+ };
+ template<>
+ struct StringMaker<unsigned long long> {
+ static std::string convert(unsigned long long value);
+ };
+
+ template<>
+ struct StringMaker<bool> {
+ static std::string convert(bool b);
+ };
+
+ template<>
+ struct StringMaker<char> {
+ static std::string convert(char c);
+ };
+ template<>
+ struct StringMaker<signed char> {
+ static std::string convert(signed char c);
+ };
+ template<>
+ struct StringMaker<unsigned char> {
+ static std::string convert(unsigned char c);
+ };
+
+ template<>
+ struct StringMaker<std::nullptr_t> {
+ static std::string convert(std::nullptr_t);
+ };
+
+ template<>
+ struct StringMaker<float> {
+ static std::string convert(float value);
+ static int precision;
+ };
+
+ template<>
+ struct StringMaker<double> {
+ static std::string convert(double value);
+ static int precision;
+ };
+
+ template <typename T>
+ struct StringMaker<T*> {
+ template <typename U>
+ static std::string convert(U* p) {
+ if (p) {
+ return ::Catch::Detail::rawMemoryToString(p);
+ } else {
+ return "nullptr";
+ }
+ }
+ };
+
+ template <typename R, typename C>
+ struct StringMaker<R C::*> {
+ static std::string convert(R C::* p) {
+ if (p) {
+ return ::Catch::Detail::rawMemoryToString(p);
+ } else {
+ return "nullptr";
+ }
+ }
+ };
+
+#if defined(_MANAGED)
+ template <typename T>
+ struct StringMaker<T^> {
+ static std::string convert( T^ ref ) {
+ return ::Catch::Detail::clrReferenceToString(ref);
+ }
+ };
+#endif
+
+ namespace Detail {
+ template<typename InputIterator>
+ std::string rangeToString(InputIterator first, InputIterator last) {
+ ReusableStringStream rss;
+ rss << "{ ";
+ if (first != last) {
+ rss << ::Catch::Detail::stringify(*first);
+ for (++first; first != last; ++first)
+ rss << ", " << ::Catch::Detail::stringify(*first);
+ }
+ rss << " }";
+ return rss.str();
+ }
+ }
+
+#ifdef __OBJC__
+ template<>
+ struct StringMaker<NSString*> {
+ static std::string convert(NSString * nsstring) {
+ if (!nsstring)
+ return "nil";
+ return std::string("@") + [nsstring UTF8String];
+ }
+ };
+ template<>
+ struct StringMaker<NSObject*> {
+ static std::string convert(NSObject* nsObject) {
+ return ::Catch::Detail::stringify([nsObject description]);
+ }
+
+ };
+ namespace Detail {
+ inline std::string stringify( NSString* nsstring ) {
+ return StringMaker<NSString*>::convert( nsstring );
+ }
+
+ } // namespace Detail
+#endif // __OBJC__
+
+} // namespace Catch
+
+//////////////////////////////////////////////////////
+// Separate std-lib types stringification, so it can be selectively enabled
+// This means that we do not bring in
+
+#if defined(CATCH_CONFIG_ENABLE_ALL_STRINGMAKERS)
+# define CATCH_CONFIG_ENABLE_PAIR_STRINGMAKER
+# define CATCH_CONFIG_ENABLE_TUPLE_STRINGMAKER
+# define CATCH_CONFIG_ENABLE_VARIANT_STRINGMAKER
+# define CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER
+# define CATCH_CONFIG_ENABLE_OPTIONAL_STRINGMAKER
+#endif
+
+// Separate std::pair specialization
+#if defined(CATCH_CONFIG_ENABLE_PAIR_STRINGMAKER)
+#include <utility>
+namespace Catch {
+ template<typename T1, typename T2>
+ struct StringMaker<std::pair<T1, T2> > {
+ static std::string convert(const std::pair<T1, T2>& pair) {
+ ReusableStringStream rss;
+ rss << "{ "
+ << ::Catch::Detail::stringify(pair.first)
+ << ", "
+ << ::Catch::Detail::stringify(pair.second)
+ << " }";
+ return rss.str();
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_PAIR_STRINGMAKER
+
+#if defined(CATCH_CONFIG_ENABLE_OPTIONAL_STRINGMAKER) && defined(CATCH_CONFIG_CPP17_OPTIONAL)
+#include <optional>
+namespace Catch {
+ template<typename T>
+ struct StringMaker<std::optional<T> > {
+ static std::string convert(const std::optional<T>& optional) {
+ ReusableStringStream rss;
+ if (optional.has_value()) {
+ rss << ::Catch::Detail::stringify(*optional);
+ } else {
+ rss << "{ }";
+ }
+ return rss.str();
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_OPTIONAL_STRINGMAKER
+
+// Separate std::tuple specialization
+#if defined(CATCH_CONFIG_ENABLE_TUPLE_STRINGMAKER)
+#include <tuple>
+namespace Catch {
+ namespace Detail {
+ template<
+ typename Tuple,
+ std::size_t N = 0,
+ bool = (N < std::tuple_size<Tuple>::value)
+ >
+ struct TupleElementPrinter {
+ static void print(const Tuple& tuple, std::ostream& os) {
+ os << (N ? ", " : " ")
+ << ::Catch::Detail::stringify(std::get<N>(tuple));
+ TupleElementPrinter<Tuple, N + 1>::print(tuple, os);
+ }
+ };
+
+ template<
+ typename Tuple,
+ std::size_t N
+ >
+ struct TupleElementPrinter<Tuple, N, false> {
+ static void print(const Tuple&, std::ostream&) {}
+ };
+
+ }
+
+ template<typename ...Types>
+ struct StringMaker<std::tuple<Types...>> {
+ static std::string convert(const std::tuple<Types...>& tuple) {
+ ReusableStringStream rss;
+ rss << '{';
+ Detail::TupleElementPrinter<std::tuple<Types...>>::print(tuple, rss.get());
+ rss << " }";
+ return rss.str();
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_TUPLE_STRINGMAKER
+
+#if defined(CATCH_CONFIG_ENABLE_VARIANT_STRINGMAKER) && defined(CATCH_CONFIG_CPP17_VARIANT)
+#include <variant>
+namespace Catch {
+ template<>
+ struct StringMaker<std::monostate> {
+ static std::string convert(const std::monostate&) {
+ return "{ }";
+ }
+ };
+
+ template<typename... Elements>
+ struct StringMaker<std::variant<Elements...>> {
+ static std::string convert(const std::variant<Elements...>& variant) {
+ if (variant.valueless_by_exception()) {
+ return "{valueless variant}";
+ } else {
+ return std::visit(
+ [](const auto& value) {
+ return ::Catch::Detail::stringify(value);
+ },
+ variant
+ );
+ }
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_VARIANT_STRINGMAKER
+
+namespace Catch {
+ struct not_this_one {}; // Tag type for detecting which begin/ end are being selected
+
+ // Import begin/ end from std here so they are considered alongside the fallback (...) overloads in this namespace
+ using std::begin;
+ using std::end;
+
+ not_this_one begin( ... );
+ not_this_one end( ... );
+
+ template <typename T>
+ struct is_range {
+ static const bool value =
+ !std::is_same<decltype(begin(std::declval<T>())), not_this_one>::value &&
+ !std::is_same<decltype(end(std::declval<T>())), not_this_one>::value;
+ };
+
+#if defined(_MANAGED) // Managed types are never ranges
+ template <typename T>
+ struct is_range<T^> {
+ static const bool value = false;
+ };
+#endif
+
+ template<typename Range>
+ std::string rangeToString( Range const& range ) {
+ return ::Catch::Detail::rangeToString( begin( range ), end( range ) );
+ }
+
+ // Handle vector<bool> specially
+ template<typename Allocator>
+ std::string rangeToString( std::vector<bool, Allocator> const& v ) {
+ ReusableStringStream rss;
+ rss << "{ ";
+ bool first = true;
+ for( bool b : v ) {
+ if( first )
+ first = false;
+ else
+ rss << ", ";
+ rss << ::Catch::Detail::stringify( b );
+ }
+ rss << " }";
+ return rss.str();
+ }
+
+ template<typename R>
+ struct StringMaker<R, typename std::enable_if<is_range<R>::value && !::Catch::Detail::IsStreamInsertable<R>::value>::type> {
+ static std::string convert( R const& range ) {
+ return rangeToString( range );
+ }
+ };
+
+ template <typename T, int SZ>
+ struct StringMaker<T[SZ]> {
+ static std::string convert(T const(&arr)[SZ]) {
+ return rangeToString(arr);
+ }
+ };
+
+} // namespace Catch
+
+// Separate std::chrono::duration specialization
+#if defined(CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER)
+#include <ctime>
+#include <ratio>
+#include <chrono>
+
+namespace Catch {
+
+template <class Ratio>
+struct ratio_string {
+ static std::string symbol();
+};
+
+template <class Ratio>
+std::string ratio_string<Ratio>::symbol() {
+ Catch::ReusableStringStream rss;
+ rss << '[' << Ratio::num << '/'
+ << Ratio::den << ']';
+ return rss.str();
+}
+template <>
+struct ratio_string<std::atto> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::femto> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::pico> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::nano> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::micro> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::milli> {
+ static std::string symbol();
+};
+
+ ////////////
+ // std::chrono::duration specializations
+ template<typename Value, typename Ratio>
+ struct StringMaker<std::chrono::duration<Value, Ratio>> {
+ static std::string convert(std::chrono::duration<Value, Ratio> const& duration) {
+ ReusableStringStream rss;
+ rss << duration.count() << ' ' << ratio_string<Ratio>::symbol() << 's';
+ return rss.str();
+ }
+ };
+ template<typename Value>
+ struct StringMaker<std::chrono::duration<Value, std::ratio<1>>> {
+ static std::string convert(std::chrono::duration<Value, std::ratio<1>> const& duration) {
+ ReusableStringStream rss;
+ rss << duration.count() << " s";
+ return rss.str();
+ }
+ };
+ template<typename Value>
+ struct StringMaker<std::chrono::duration<Value, std::ratio<60>>> {
+ static std::string convert(std::chrono::duration<Value, std::ratio<60>> const& duration) {
+ ReusableStringStream rss;
+ rss << duration.count() << " m";
+ return rss.str();
+ }
+ };
+ template<typename Value>
+ struct StringMaker<std::chrono::duration<Value, std::ratio<3600>>> {
+ static std::string convert(std::chrono::duration<Value, std::ratio<3600>> const& duration) {
+ ReusableStringStream rss;
+ rss << duration.count() << " h";
+ return rss.str();
+ }
+ };
+
+ ////////////
+ // std::chrono::time_point specialization
+ // Generic time_point cannot be specialized, only std::chrono::time_point<system_clock>
+ template<typename Clock, typename Duration>
+ struct StringMaker<std::chrono::time_point<Clock, Duration>> {
+ static std::string convert(std::chrono::time_point<Clock, Duration> const& time_point) {
+ return ::Catch::Detail::stringify(time_point.time_since_epoch()) + " since epoch";
+ }
+ };
+ // std::chrono::time_point<system_clock> specialization
+ template<typename Duration>
+ struct StringMaker<std::chrono::time_point<std::chrono::system_clock, Duration>> {
+ static std::string convert(std::chrono::time_point<std::chrono::system_clock, Duration> const& time_point) {
+ auto converted = std::chrono::system_clock::to_time_t(time_point);
+
+#ifdef _MSC_VER
+ std::tm timeInfo = {};
+ gmtime_s(&timeInfo, &converted);
+#else
+ std::tm* timeInfo = std::gmtime(&converted);
+#endif
+
+ auto const timeStampSize = sizeof("2017-01-16T17:06:45Z");
+ char timeStamp[timeStampSize];
+ const char * const fmt = "%Y-%m-%dT%H:%M:%SZ";
+
+#ifdef _MSC_VER
+ std::strftime(timeStamp, timeStampSize, fmt, &timeInfo);
+#else
+ std::strftime(timeStamp, timeStampSize, fmt, timeInfo);
+#endif
+ return std::string(timeStamp);
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER
+
+#define INTERNAL_CATCH_REGISTER_ENUM( enumName, ... ) \
+namespace Catch { \
+ template<> struct StringMaker<enumName> { \
+ static std::string convert( enumName value ) { \
+ static const auto& enumInfo = ::Catch::getMutableRegistryHub().getMutableEnumValuesRegistry().registerEnum( #enumName, #__VA_ARGS__, { __VA_ARGS__ } ); \
+ return enumInfo.lookup( static_cast<int>( value ) ); \
+ } \
+ }; \
+}
+
+#define CATCH_REGISTER_ENUM( enumName, ... ) INTERNAL_CATCH_REGISTER_ENUM( enumName, __VA_ARGS__ )
+
+#ifdef _MSC_VER
+#pragma warning(pop)
+#endif
+
+// end catch_tostring.h
+#include <iosfwd>
+
+#ifdef _MSC_VER
+#pragma warning(push)
+#pragma warning(disable:4389) // '==' : signed/unsigned mismatch
+#pragma warning(disable:4018) // more "signed/unsigned mismatch"
+#pragma warning(disable:4312) // Converting int to T* using reinterpret_cast (issue on x64 platform)
+#pragma warning(disable:4180) // qualifier applied to function type has no meaning
+#pragma warning(disable:4800) // Forcing result to true or false
+#endif
+
+namespace Catch {
+
+ struct ITransientExpression {
+ auto isBinaryExpression() const -> bool { return m_isBinaryExpression; }
+ auto getResult() const -> bool { return m_result; }
+ virtual void streamReconstructedExpression( std::ostream &os ) const = 0;
+
+ ITransientExpression( bool isBinaryExpression, bool result )
+ : m_isBinaryExpression( isBinaryExpression ),
+ m_result( result )
+ {}
+
+ // We don't actually need a virtual destructor, but many static analysers
+ // complain if it's not here :-(
+ virtual ~ITransientExpression();
+
+ bool m_isBinaryExpression;
+ bool m_result;
+
+ };
+
+ void formatReconstructedExpression( std::ostream &os, std::string const& lhs, StringRef op, std::string const& rhs );
+
+ template<typename LhsT, typename RhsT>
+ class BinaryExpr : public ITransientExpression {
+ LhsT m_lhs;
+ StringRef m_op;
+ RhsT m_rhs;
+
+ void streamReconstructedExpression( std::ostream &os ) const override {
+ formatReconstructedExpression
+ ( os, Catch::Detail::stringify( m_lhs ), m_op, Catch::Detail::stringify( m_rhs ) );
+ }
+
+ public:
+ BinaryExpr( bool comparisonResult, LhsT lhs, StringRef op, RhsT rhs )
+ : ITransientExpression{ true, comparisonResult },
+ m_lhs( lhs ),
+ m_op( op ),
+ m_rhs( rhs )
+ {}
+
+ template<typename T>
+ auto operator && ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator || ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator == ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator != ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator > ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator < ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator >= ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator <= ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+ };
+
+ template<typename LhsT>
+ class UnaryExpr : public ITransientExpression {
+ LhsT m_lhs;
+
+ void streamReconstructedExpression( std::ostream &os ) const override {
+ os << Catch::Detail::stringify( m_lhs );
+ }
+
+ public:
+ explicit UnaryExpr( LhsT lhs )
+ : ITransientExpression{ false, static_cast<bool>(lhs) },
+ m_lhs( lhs )
+ {}
+ };
+
+ // Specialised comparison functions to handle equality comparisons between ints and pointers (NULL deduces as an int)
+ template<typename LhsT, typename RhsT>
+ auto compareEqual( LhsT const& lhs, RhsT const& rhs ) -> bool { return static_cast<bool>(lhs == rhs); }
+ template<typename T>
+ auto compareEqual( T* const& lhs, int rhs ) -> bool { return lhs == reinterpret_cast<void const*>( rhs ); }
+ template<typename T>
+ auto compareEqual( T* const& lhs, long rhs ) -> bool { return lhs == reinterpret_cast<void const*>( rhs ); }
+ template<typename T>
+ auto compareEqual( int lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) == rhs; }
+ template<typename T>
+ auto compareEqual( long lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) == rhs; }
+
+ template<typename LhsT, typename RhsT>
+ auto compareNotEqual( LhsT const& lhs, RhsT&& rhs ) -> bool { return static_cast<bool>(lhs != rhs); }
+ template<typename T>
+ auto compareNotEqual( T* const& lhs, int rhs ) -> bool { return lhs != reinterpret_cast<void const*>( rhs ); }
+ template<typename T>
+ auto compareNotEqual( T* const& lhs, long rhs ) -> bool { return lhs != reinterpret_cast<void const*>( rhs ); }
+ template<typename T>
+ auto compareNotEqual( int lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) != rhs; }
+ template<typename T>
+ auto compareNotEqual( long lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) != rhs; }
+
+ template<typename LhsT>
+ class ExprLhs {
+ LhsT m_lhs;
+ public:
+ explicit ExprLhs( LhsT lhs ) : m_lhs( lhs ) {}
+
+ template<typename RhsT>
+ auto operator == ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { compareEqual( m_lhs, rhs ), m_lhs, "==", rhs };
+ }
+ auto operator == ( bool rhs ) -> BinaryExpr<LhsT, bool> const {
+ return { m_lhs == rhs, m_lhs, "==", rhs };
+ }
+
+ template<typename RhsT>
+ auto operator != ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { compareNotEqual( m_lhs, rhs ), m_lhs, "!=", rhs };
+ }
+ auto operator != ( bool rhs ) -> BinaryExpr<LhsT, bool> const {
+ return { m_lhs != rhs, m_lhs, "!=", rhs };
+ }
+
+ template<typename RhsT>
+ auto operator > ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { static_cast<bool>(m_lhs > rhs), m_lhs, ">", rhs };
+ }
+ template<typename RhsT>
+ auto operator < ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { static_cast<bool>(m_lhs < rhs), m_lhs, "<", rhs };
+ }
+ template<typename RhsT>
+ auto operator >= ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { static_cast<bool>(m_lhs >= rhs), m_lhs, ">=", rhs };
+ }
+ template<typename RhsT>
+ auto operator <= ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { static_cast<bool>(m_lhs <= rhs), m_lhs, "<=", rhs };
+ }
+
+ template<typename RhsT>
+ auto operator && ( RhsT const& ) -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<RhsT>::value,
+ "operator&& is not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename RhsT>
+ auto operator || ( RhsT const& ) -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<RhsT>::value,
+ "operator|| is not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ auto makeUnaryExpr() const -> UnaryExpr<LhsT> {
+ return UnaryExpr<LhsT>{ m_lhs };
+ }
+ };
+
+ void handleExpression( ITransientExpression const& expr );
+
+ template<typename T>
+ void handleExpression( ExprLhs<T> const& expr ) {
+ handleExpression( expr.makeUnaryExpr() );
+ }
+
+ struct Decomposer {
+ template<typename T>
+ auto operator <= ( T const& lhs ) -> ExprLhs<T const&> {
+ return ExprLhs<T const&>{ lhs };
+ }
+
+ auto operator <=( bool value ) -> ExprLhs<bool> {
+ return ExprLhs<bool>{ value };
+ }
+ };
+
+} // end namespace Catch
+
+#ifdef _MSC_VER
+#pragma warning(pop)
+#endif
+
+// end catch_decomposer.h
+// start catch_interfaces_capture.h
+
+#include <string>
+#include <chrono>
+
+namespace Catch {
+
+ class AssertionResult;
+ struct AssertionInfo;
+ struct SectionInfo;
+ struct SectionEndInfo;
+ struct MessageInfo;
+ struct MessageBuilder;
+ struct Counts;
+ struct AssertionReaction;
+ struct SourceLineInfo;
+
+ struct ITransientExpression;
+ struct IGeneratorTracker;
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ struct BenchmarkInfo;
+ template <typename Duration = std::chrono::duration<double, std::nano>>
+ struct BenchmarkStats;
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ struct IResultCapture {
+
+ virtual ~IResultCapture();
+
+ virtual bool sectionStarted( SectionInfo const& sectionInfo,
+ Counts& assertions ) = 0;
+ virtual void sectionEnded( SectionEndInfo const& endInfo ) = 0;
+ virtual void sectionEndedEarly( SectionEndInfo const& endInfo ) = 0;
+
+ virtual auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& = 0;
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ virtual void benchmarkPreparing( std::string const& name ) = 0;
+ virtual void benchmarkStarting( BenchmarkInfo const& info ) = 0;
+ virtual void benchmarkEnded( BenchmarkStats<> const& stats ) = 0;
+ virtual void benchmarkFailed( std::string const& error ) = 0;
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ virtual void pushScopedMessage( MessageInfo const& message ) = 0;
+ virtual void popScopedMessage( MessageInfo const& message ) = 0;
+
+ virtual void emplaceUnscopedMessage( MessageBuilder const& builder ) = 0;
+
+ virtual void handleFatalErrorCondition( StringRef message ) = 0;
+
+ virtual void handleExpr
+ ( AssertionInfo const& info,
+ ITransientExpression const& expr,
+ AssertionReaction& reaction ) = 0;
+ virtual void handleMessage
+ ( AssertionInfo const& info,
+ ResultWas::OfType resultType,
+ StringRef const& message,
+ AssertionReaction& reaction ) = 0;
+ virtual void handleUnexpectedExceptionNotThrown
+ ( AssertionInfo const& info,
+ AssertionReaction& reaction ) = 0;
+ virtual void handleUnexpectedInflightException
+ ( AssertionInfo const& info,
+ std::string const& message,
+ AssertionReaction& reaction ) = 0;
+ virtual void handleIncomplete
+ ( AssertionInfo const& info ) = 0;
+ virtual void handleNonExpr
+ ( AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ AssertionReaction &reaction ) = 0;
+
+ virtual bool lastAssertionPassed() = 0;
+ virtual void assertionPassed() = 0;
+
+ // Deprecated, do not use:
+ virtual std::string getCurrentTestName() const = 0;
+ virtual const AssertionResult* getLastResult() const = 0;
+ virtual void exceptionEarlyReported() = 0;
+ };
+
+ IResultCapture& getResultCapture();
+}
+
+// end catch_interfaces_capture.h
+namespace Catch {
+
+ struct TestFailureException{};
+ struct AssertionResultData;
+ struct IResultCapture;
+ class RunContext;
+
+ class LazyExpression {
+ friend class AssertionHandler;
+ friend struct AssertionStats;
+ friend class RunContext;
+
+ ITransientExpression const* m_transientExpression = nullptr;
+ bool m_isNegated;
+ public:
+ LazyExpression( bool isNegated );
+ LazyExpression( LazyExpression const& other );
+ LazyExpression& operator = ( LazyExpression const& ) = delete;
+
+ explicit operator bool() const;
+
+ friend auto operator << ( std::ostream& os, LazyExpression const& lazyExpr ) -> std::ostream&;
+ };
+
+ struct AssertionReaction {
+ bool shouldDebugBreak = false;
+ bool shouldThrow = false;
+ };
+
+ class AssertionHandler {
+ AssertionInfo m_assertionInfo;
+ AssertionReaction m_reaction;
+ bool m_completed = false;
+ IResultCapture& m_resultCapture;
+
+ public:
+ AssertionHandler
+ ( StringRef const& macroName,
+ SourceLineInfo const& lineInfo,
+ StringRef capturedExpression,
+ ResultDisposition::Flags resultDisposition );
+ ~AssertionHandler() {
+ if ( !m_completed ) {
+ m_resultCapture.handleIncomplete( m_assertionInfo );
+ }
+ }
+
+ template<typename T>
+ void handleExpr( ExprLhs<T> const& expr ) {
+ handleExpr( expr.makeUnaryExpr() );
+ }
+ void handleExpr( ITransientExpression const& expr );
+
+ void handleMessage(ResultWas::OfType resultType, StringRef const& message);
+
+ void handleExceptionThrownAsExpected();
+ void handleUnexpectedExceptionNotThrown();
+ void handleExceptionNotThrownAsExpected();
+ void handleThrowingCallSkipped();
+ void handleUnexpectedInflightException();
+
+ void complete();
+ void setCompleted();
+
+ // query
+ auto allowThrows() const -> bool;
+ };
+
+ void handleExceptionMatchExpr( AssertionHandler& handler, std::string const& str, StringRef const& matcherString );
+
+} // namespace Catch
+
+// end catch_assertionhandler.h
+// start catch_message.h
+
+#include <string>
+#include <vector>
+
+namespace Catch {
+
+ struct MessageInfo {
+ MessageInfo( StringRef const& _macroName,
+ SourceLineInfo const& _lineInfo,
+ ResultWas::OfType _type );
+
+ StringRef macroName;
+ std::string message;
+ SourceLineInfo lineInfo;
+ ResultWas::OfType type;
+ unsigned int sequence;
+
+ bool operator == ( MessageInfo const& other ) const;
+ bool operator < ( MessageInfo const& other ) const;
+ private:
+ static unsigned int globalCount;
+ };
+
+ struct MessageStream {
+
+ template<typename T>
+ MessageStream& operator << ( T const& value ) {
+ m_stream << value;
+ return *this;
+ }
+
+ ReusableStringStream m_stream;
+ };
+
+ struct MessageBuilder : MessageStream {
+ MessageBuilder( StringRef const& macroName,
+ SourceLineInfo const& lineInfo,
+ ResultWas::OfType type );
+
+ template<typename T>
+ MessageBuilder& operator << ( T const& value ) {
+ m_stream << value;
+ return *this;
+ }
+
+ MessageInfo m_info;
+ };
+
+ class ScopedMessage {
+ public:
+ explicit ScopedMessage( MessageBuilder const& builder );
+ ScopedMessage( ScopedMessage& duplicate ) = delete;
+ ScopedMessage( ScopedMessage&& old );
+ ~ScopedMessage();
+
+ MessageInfo m_info;
+ bool m_moved;
+ };
+
+ class Capturer {
+ std::vector<MessageInfo> m_messages;
+ IResultCapture& m_resultCapture = getResultCapture();
+ size_t m_captured = 0;
+ public:
+ Capturer( StringRef macroName, SourceLineInfo const& lineInfo, ResultWas::OfType resultType, StringRef names );
+ ~Capturer();
+
+ void captureValue( size_t index, std::string const& value );
+
+ template<typename T>
+ void captureValues( size_t index, T const& value ) {
+ captureValue( index, Catch::Detail::stringify( value ) );
+ }
+
+ template<typename T, typename... Ts>
+ void captureValues( size_t index, T const& value, Ts const&... values ) {
+ captureValue( index, Catch::Detail::stringify(value) );
+ captureValues( index+1, values... );
+ }
+ };
+
+} // end namespace Catch
+
+// end catch_message.h
+#if !defined(CATCH_CONFIG_DISABLE)
+
+#if !defined(CATCH_CONFIG_DISABLE_STRINGIFICATION)
+ #define CATCH_INTERNAL_STRINGIFY(...) #__VA_ARGS__
+#else
+ #define CATCH_INTERNAL_STRINGIFY(...) "Disabled by CATCH_CONFIG_DISABLE_STRINGIFICATION"
+#endif
+
+#if defined(CATCH_CONFIG_FAST_COMPILE) || defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+
+///////////////////////////////////////////////////////////////////////////////
+// Another way to speed-up compilation is to omit local try-catch for REQUIRE*
+// macros.
+#define INTERNAL_CATCH_TRY
+#define INTERNAL_CATCH_CATCH( capturer )
+
+#else // CATCH_CONFIG_FAST_COMPILE
+
+#define INTERNAL_CATCH_TRY try
+#define INTERNAL_CATCH_CATCH( handler ) catch(...) { handler.handleUnexpectedInflightException(); }
+
+#endif
+
+#define INTERNAL_CATCH_REACT( handler ) handler.complete();
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_TEST( macroName, resultDisposition, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__), resultDisposition ); \
+ INTERNAL_CATCH_TRY { \
+ CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS \
+ catchAssertionHandler.handleExpr( Catch::Decomposer() <= __VA_ARGS__ ); \
+ CATCH_INTERNAL_UNSUPPRESS_PARENTHESES_WARNINGS \
+ } INTERNAL_CATCH_CATCH( catchAssertionHandler ) \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( (void)0, (false) && static_cast<bool>( !!(__VA_ARGS__) ) ) // the expression here is never evaluated at runtime but it forces the compiler to give it a look
+ // The double negation silences MSVC's C4800 warning, the static_cast forces short-circuit evaluation if the type has overloaded &&.
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_IF( macroName, resultDisposition, ... ) \
+ INTERNAL_CATCH_TEST( macroName, resultDisposition, __VA_ARGS__ ); \
+ if( Catch::getResultCapture().lastAssertionPassed() )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_ELSE( macroName, resultDisposition, ... ) \
+ INTERNAL_CATCH_TEST( macroName, resultDisposition, __VA_ARGS__ ); \
+ if( !Catch::getResultCapture().lastAssertionPassed() )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_NO_THROW( macroName, resultDisposition, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__), resultDisposition ); \
+ try { \
+ static_cast<void>(__VA_ARGS__); \
+ catchAssertionHandler.handleExceptionNotThrownAsExpected(); \
+ } \
+ catch( ... ) { \
+ catchAssertionHandler.handleUnexpectedInflightException(); \
+ } \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_THROWS( macroName, resultDisposition, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__), resultDisposition); \
+ if( catchAssertionHandler.allowThrows() ) \
+ try { \
+ static_cast<void>(__VA_ARGS__); \
+ catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \
+ } \
+ catch( ... ) { \
+ catchAssertionHandler.handleExceptionThrownAsExpected(); \
+ } \
+ else \
+ catchAssertionHandler.handleThrowingCallSkipped(); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_THROWS_AS( macroName, exceptionType, resultDisposition, expr ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(expr) ", " CATCH_INTERNAL_STRINGIFY(exceptionType), resultDisposition ); \
+ if( catchAssertionHandler.allowThrows() ) \
+ try { \
+ static_cast<void>(expr); \
+ catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \
+ } \
+ catch( exceptionType const& ) { \
+ catchAssertionHandler.handleExceptionThrownAsExpected(); \
+ } \
+ catch( ... ) { \
+ catchAssertionHandler.handleUnexpectedInflightException(); \
+ } \
+ else \
+ catchAssertionHandler.handleThrowingCallSkipped(); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_MSG( macroName, messageType, resultDisposition, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, Catch::StringRef(), resultDisposition ); \
+ catchAssertionHandler.handleMessage( messageType, ( Catch::MessageStream() << __VA_ARGS__ + ::Catch::StreamEndStop() ).m_stream.str() ); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_CAPTURE( varName, macroName, ... ) \
+ auto varName = Catch::Capturer( macroName, CATCH_INTERNAL_LINEINFO, Catch::ResultWas::Info, #__VA_ARGS__ ); \
+ varName.captureValues( 0, __VA_ARGS__ )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_INFO( macroName, log ) \
+ Catch::ScopedMessage INTERNAL_CATCH_UNIQUE_NAME( scopedMessage )( Catch::MessageBuilder( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, Catch::ResultWas::Info ) << log );
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_UNSCOPED_INFO( macroName, log ) \
+ Catch::getResultCapture().emplaceUnscopedMessage( Catch::MessageBuilder( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, Catch::ResultWas::Info ) << log )
+
+///////////////////////////////////////////////////////////////////////////////
+// Although this is matcher-based, it can be used with just a string
+#define INTERNAL_CATCH_THROWS_STR_MATCHES( macroName, resultDisposition, matcher, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__) ", " CATCH_INTERNAL_STRINGIFY(matcher), resultDisposition ); \
+ if( catchAssertionHandler.allowThrows() ) \
+ try { \
+ static_cast<void>(__VA_ARGS__); \
+ catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \
+ } \
+ catch( ... ) { \
+ Catch::handleExceptionMatchExpr( catchAssertionHandler, matcher, #matcher##_catch_sr ); \
+ } \
+ else \
+ catchAssertionHandler.handleThrowingCallSkipped(); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+#endif // CATCH_CONFIG_DISABLE
+
+// end catch_capture.hpp
+// start catch_section.h
+
+// start catch_section_info.h
+
+// start catch_totals.h
+
+#include <cstddef>
+
+namespace Catch {
+
+ struct Counts {
+ Counts operator - ( Counts const& other ) const;
+ Counts& operator += ( Counts const& other );
+
+ std::size_t total() const;
+ bool allPassed() const;
+ bool allOk() const;
+
+ std::size_t passed = 0;
+ std::size_t failed = 0;
+ std::size_t failedButOk = 0;
+ };
+
+ struct Totals {
+
+ Totals operator - ( Totals const& other ) const;
+ Totals& operator += ( Totals const& other );
+
+ Totals delta( Totals const& prevTotals ) const;
+
+ int error = 0;
+ Counts assertions;
+ Counts testCases;
+ };
+}
+
+// end catch_totals.h
+#include <string>
+
+namespace Catch {
+
+ struct SectionInfo {
+ SectionInfo
+ ( SourceLineInfo const& _lineInfo,
+ std::string const& _name );
+
+ // Deprecated
+ SectionInfo
+ ( SourceLineInfo const& _lineInfo,
+ std::string const& _name,
+ std::string const& ) : SectionInfo( _lineInfo, _name ) {}
+
+ std::string name;
+ std::string description; // !Deprecated: this will always be empty
+ SourceLineInfo lineInfo;
+ };
+
+ struct SectionEndInfo {
+ SectionInfo sectionInfo;
+ Counts prevAssertions;
+ double durationInSeconds;
+ };
+
+} // end namespace Catch
+
+// end catch_section_info.h
+// start catch_timer.h
+
+#include <cstdint>
+
+namespace Catch {
+
+ auto getCurrentNanosecondsSinceEpoch() -> uint64_t;
+ auto getEstimatedClockResolution() -> uint64_t;
+
+ class Timer {
+ uint64_t m_nanoseconds = 0;
+ public:
+ void start();
+ auto getElapsedNanoseconds() const -> uint64_t;
+ auto getElapsedMicroseconds() const -> uint64_t;
+ auto getElapsedMilliseconds() const -> unsigned int;
+ auto getElapsedSeconds() const -> double;
+ };
+
+} // namespace Catch
+
+// end catch_timer.h
+#include <string>
+
+namespace Catch {
+
+ class Section : NonCopyable {
+ public:
+ Section( SectionInfo const& info );
+ ~Section();
+
+ // This indicates whether the section should be executed or not
+ explicit operator bool() const;
+
+ private:
+ SectionInfo m_info;
+
+ std::string m_name;
+ Counts m_assertions;
+ bool m_sectionIncluded;
+ Timer m_timer;
+ };
+
+} // end namespace Catch
+
+#define INTERNAL_CATCH_SECTION( ... ) \
+ CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS \
+ if( Catch::Section const& INTERNAL_CATCH_UNIQUE_NAME( catch_internal_Section ) = Catch::SectionInfo( CATCH_INTERNAL_LINEINFO, __VA_ARGS__ ) ) \
+ CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS
+
+#define INTERNAL_CATCH_DYNAMIC_SECTION( ... ) \
+ CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS \
+ if( Catch::Section const& INTERNAL_CATCH_UNIQUE_NAME( catch_internal_Section ) = Catch::SectionInfo( CATCH_INTERNAL_LINEINFO, (Catch::ReusableStringStream() << __VA_ARGS__).str() ) ) \
+ CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS
+
+// end catch_section.h
+// start catch_interfaces_exception.h
+
+// start catch_interfaces_registry_hub.h
+
+#include <string>
+#include <memory>
+
+namespace Catch {
+
+ class TestCase;
+ struct ITestCaseRegistry;
+ struct IExceptionTranslatorRegistry;
+ struct IExceptionTranslator;
+ struct IReporterRegistry;
+ struct IReporterFactory;
+ struct ITagAliasRegistry;
+ struct IMutableEnumValuesRegistry;
+
+ class StartupExceptionRegistry;
+
+ using IReporterFactoryPtr = std::shared_ptr<IReporterFactory>;
+
+ struct IRegistryHub {
+ virtual ~IRegistryHub();
+
+ virtual IReporterRegistry const& getReporterRegistry() const = 0;
+ virtual ITestCaseRegistry const& getTestCaseRegistry() const = 0;
+ virtual ITagAliasRegistry const& getTagAliasRegistry() const = 0;
+ virtual IExceptionTranslatorRegistry const& getExceptionTranslatorRegistry() const = 0;
+
+ virtual StartupExceptionRegistry const& getStartupExceptionRegistry() const = 0;
+ };
+
+ struct IMutableRegistryHub {
+ virtual ~IMutableRegistryHub();
+ virtual void registerReporter( std::string const& name, IReporterFactoryPtr const& factory ) = 0;
+ virtual void registerListener( IReporterFactoryPtr const& factory ) = 0;
+ virtual void registerTest( TestCase const& testInfo ) = 0;
+ virtual void registerTranslator( const IExceptionTranslator* translator ) = 0;
+ virtual void registerTagAlias( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ) = 0;
+ virtual void registerStartupException() noexcept = 0;
+ virtual IMutableEnumValuesRegistry& getMutableEnumValuesRegistry() = 0;
+ };
+
+ IRegistryHub const& getRegistryHub();
+ IMutableRegistryHub& getMutableRegistryHub();
+ void cleanUp();
+ std::string translateActiveException();
+
+}
+
+// end catch_interfaces_registry_hub.h
+#if defined(CATCH_CONFIG_DISABLE)
+ #define INTERNAL_CATCH_TRANSLATE_EXCEPTION_NO_REG( translatorName, signature) \
+ static std::string translatorName( signature )
+#endif
+
+#include <exception>
+#include <string>
+#include <vector>
+
+namespace Catch {
+ using exceptionTranslateFunction = std::string(*)();
+
+ struct IExceptionTranslator;
+ using ExceptionTranslators = std::vector<std::unique_ptr<IExceptionTranslator const>>;
+
+ struct IExceptionTranslator {
+ virtual ~IExceptionTranslator();
+ virtual std::string translate( ExceptionTranslators::const_iterator it, ExceptionTranslators::const_iterator itEnd ) const = 0;
+ };
+
+ struct IExceptionTranslatorRegistry {
+ virtual ~IExceptionTranslatorRegistry();
+
+ virtual std::string translateActiveException() const = 0;
+ };
+
+ class ExceptionTranslatorRegistrar {
+ template<typename T>
+ class ExceptionTranslator : public IExceptionTranslator {
+ public:
+
+ ExceptionTranslator( std::string(*translateFunction)( T& ) )
+ : m_translateFunction( translateFunction )
+ {}
+
+ std::string translate( ExceptionTranslators::const_iterator it, ExceptionTranslators::const_iterator itEnd ) const override {
+ try {
+ if( it == itEnd )
+ std::rethrow_exception(std::current_exception());
+ else
+ return (*it)->translate( it+1, itEnd );
+ }
+ catch( T& ex ) {
+ return m_translateFunction( ex );
+ }
+ }
+
+ protected:
+ std::string(*m_translateFunction)( T& );
+ };
+
+ public:
+ template<typename T>
+ ExceptionTranslatorRegistrar( std::string(*translateFunction)( T& ) ) {
+ getMutableRegistryHub().registerTranslator
+ ( new ExceptionTranslator<T>( translateFunction ) );
+ }
+ };
+}
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_TRANSLATE_EXCEPTION2( translatorName, signature ) \
+ static std::string translatorName( signature ); \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::ExceptionTranslatorRegistrar INTERNAL_CATCH_UNIQUE_NAME( catch_internal_ExceptionRegistrar )( &translatorName ); } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ static std::string translatorName( signature )
+
+#define INTERNAL_CATCH_TRANSLATE_EXCEPTION( signature ) INTERNAL_CATCH_TRANSLATE_EXCEPTION2( INTERNAL_CATCH_UNIQUE_NAME( catch_internal_ExceptionTranslator ), signature )
+
+// end catch_interfaces_exception.h
+// start catch_approx.h
+
+#include <type_traits>
+
+namespace Catch {
+namespace Detail {
+
+ class Approx {
+ private:
+ bool equalityComparisonImpl(double other) const;
+ // Validates the new margin (margin >= 0)
+ // out-of-line to avoid including stdexcept in the header
+ void setMargin(double margin);
+ // Validates the new epsilon (0 < epsilon < 1)
+ // out-of-line to avoid including stdexcept in the header
+ void setEpsilon(double epsilon);
+
+ public:
+ explicit Approx ( double value );
+
+ static Approx custom();
+
+ Approx operator-() const;
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ Approx operator()( T const& value ) {
+ Approx approx( static_cast<double>(value) );
+ approx.m_epsilon = m_epsilon;
+ approx.m_margin = m_margin;
+ approx.m_scale = m_scale;
+ return approx;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ explicit Approx( T const& value ): Approx(static_cast<double>(value))
+ {}
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator == ( const T& lhs, Approx const& rhs ) {
+ auto lhs_v = static_cast<double>(lhs);
+ return rhs.equalityComparisonImpl(lhs_v);
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator == ( Approx const& lhs, const T& rhs ) {
+ return operator==( rhs, lhs );
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator != ( T const& lhs, Approx const& rhs ) {
+ return !operator==( lhs, rhs );
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator != ( Approx const& lhs, T const& rhs ) {
+ return !operator==( rhs, lhs );
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator <= ( T const& lhs, Approx const& rhs ) {
+ return static_cast<double>(lhs) < rhs.m_value || lhs == rhs;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator <= ( Approx const& lhs, T const& rhs ) {
+ return lhs.m_value < static_cast<double>(rhs) || lhs == rhs;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator >= ( T const& lhs, Approx const& rhs ) {
+ return static_cast<double>(lhs) > rhs.m_value || lhs == rhs;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator >= ( Approx const& lhs, T const& rhs ) {
+ return lhs.m_value > static_cast<double>(rhs) || lhs == rhs;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ Approx& epsilon( T const& newEpsilon ) {
+ double epsilonAsDouble = static_cast<double>(newEpsilon);
+ setEpsilon(epsilonAsDouble);
+ return *this;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ Approx& margin( T const& newMargin ) {
+ double marginAsDouble = static_cast<double>(newMargin);
+ setMargin(marginAsDouble);
+ return *this;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ Approx& scale( T const& newScale ) {
+ m_scale = static_cast<double>(newScale);
+ return *this;
+ }
+
+ std::string toString() const;
+
+ private:
+ double m_epsilon;
+ double m_margin;
+ double m_scale;
+ double m_value;
+ };
+} // end namespace Detail
+
+namespace literals {
+ Detail::Approx operator "" _a(long double val);
+ Detail::Approx operator "" _a(unsigned long long val);
+} // end namespace literals
+
+template<>
+struct StringMaker<Catch::Detail::Approx> {
+ static std::string convert(Catch::Detail::Approx const& value);
+};
+
+} // end namespace Catch
+
+// end catch_approx.h
+// start catch_string_manip.h
+
+#include <string>
+#include <iosfwd>
+#include <vector>
+
+namespace Catch {
+
+ bool startsWith( std::string const& s, std::string const& prefix );
+ bool startsWith( std::string const& s, char prefix );
+ bool endsWith( std::string const& s, std::string const& suffix );
+ bool endsWith( std::string const& s, char suffix );
+ bool contains( std::string const& s, std::string const& infix );
+ void toLowerInPlace( std::string& s );
+ std::string toLower( std::string const& s );
+ std::string trim( std::string const& str );
+
+ // !!! Be aware, returns refs into original string - make sure original string outlives them
+ std::vector<StringRef> splitStringRef( StringRef str, char delimiter );
+ bool replaceInPlace( std::string& str, std::string const& replaceThis, std::string const& withThis );
+
+ struct pluralise {
+ pluralise( std::size_t count, std::string const& label );
+
+ friend std::ostream& operator << ( std::ostream& os, pluralise const& pluraliser );
+
+ std::size_t m_count;
+ std::string m_label;
+ };
+}
+
+// end catch_string_manip.h
+#ifndef CATCH_CONFIG_DISABLE_MATCHERS
+// start catch_capture_matchers.h
+
+// start catch_matchers.h
+
+#include <string>
+#include <vector>
+
+namespace Catch {
+namespace Matchers {
+ namespace Impl {
+
+ template<typename ArgT> struct MatchAllOf;
+ template<typename ArgT> struct MatchAnyOf;
+ template<typename ArgT> struct MatchNotOf;
+
+ class MatcherUntypedBase {
+ public:
+ MatcherUntypedBase() = default;
+ MatcherUntypedBase ( MatcherUntypedBase const& ) = default;
+ MatcherUntypedBase& operator = ( MatcherUntypedBase const& ) = delete;
+ std::string toString() const;
+
+ protected:
+ virtual ~MatcherUntypedBase();
+ virtual std::string describe() const = 0;
+ mutable std::string m_cachedToString;
+ };
+
+#ifdef __clang__
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wnon-virtual-dtor"
+#endif
+
+ template<typename ObjectT>
+ struct MatcherMethod {
+ virtual bool match( ObjectT const& arg ) const = 0;
+ };
+
+#ifdef __clang__
+# pragma clang diagnostic pop
+#endif
+
+ template<typename T>
+ struct MatcherBase : MatcherUntypedBase, MatcherMethod<T> {
+
+ MatchAllOf<T> operator && ( MatcherBase const& other ) const;
+ MatchAnyOf<T> operator || ( MatcherBase const& other ) const;
+ MatchNotOf<T> operator ! () const;
+ };
+
+ template<typename ArgT>
+ struct MatchAllOf : MatcherBase<ArgT> {
+ bool match( ArgT const& arg ) const override {
+ for( auto matcher : m_matchers ) {
+ if (!matcher->match(arg))
+ return false;
+ }
+ return true;
+ }
+ std::string describe() const override {
+ std::string description;
+ description.reserve( 4 + m_matchers.size()*32 );
+ description += "( ";
+ bool first = true;
+ for( auto matcher : m_matchers ) {
+ if( first )
+ first = false;
+ else
+ description += " and ";
+ description += matcher->toString();
+ }
+ description += " )";
+ return description;
+ }
+
+ MatchAllOf<ArgT>& operator && ( MatcherBase<ArgT> const& other ) {
+ m_matchers.push_back( &other );
+ return *this;
+ }
+
+ std::vector<MatcherBase<ArgT> const*> m_matchers;
+ };
+ template<typename ArgT>
+ struct MatchAnyOf : MatcherBase<ArgT> {
+
+ bool match( ArgT const& arg ) const override {
+ for( auto matcher : m_matchers ) {
+ if (matcher->match(arg))
+ return true;
+ }
+ return false;
+ }
+ std::string describe() const override {
+ std::string description;
+ description.reserve( 4 + m_matchers.size()*32 );
+ description += "( ";
+ bool first = true;
+ for( auto matcher : m_matchers ) {
+ if( first )
+ first = false;
+ else
+ description += " or ";
+ description += matcher->toString();
+ }
+ description += " )";
+ return description;
+ }
+
+ MatchAnyOf<ArgT>& operator || ( MatcherBase<ArgT> const& other ) {
+ m_matchers.push_back( &other );
+ return *this;
+ }
+
+ std::vector<MatcherBase<ArgT> const*> m_matchers;
+ };
+
+ template<typename ArgT>
+ struct MatchNotOf : MatcherBase<ArgT> {
+
+ MatchNotOf( MatcherBase<ArgT> const& underlyingMatcher ) : m_underlyingMatcher( underlyingMatcher ) {}
+
+ bool match( ArgT const& arg ) const override {
+ return !m_underlyingMatcher.match( arg );
+ }
+
+ std::string describe() const override {
+ return "not " + m_underlyingMatcher.toString();
+ }
+ MatcherBase<ArgT> const& m_underlyingMatcher;
+ };
+
+ template<typename T>
+ MatchAllOf<T> MatcherBase<T>::operator && ( MatcherBase const& other ) const {
+ return MatchAllOf<T>() && *this && other;
+ }
+ template<typename T>
+ MatchAnyOf<T> MatcherBase<T>::operator || ( MatcherBase const& other ) const {
+ return MatchAnyOf<T>() || *this || other;
+ }
+ template<typename T>
+ MatchNotOf<T> MatcherBase<T>::operator ! () const {
+ return MatchNotOf<T>( *this );
+ }
+
+ } // namespace Impl
+
+} // namespace Matchers
+
+using namespace Matchers;
+using Matchers::Impl::MatcherBase;
+
+} // namespace Catch
+
+// end catch_matchers.h
+// start catch_matchers_floating.h
+
+#include <type_traits>
+#include <cmath>
+
+namespace Catch {
+namespace Matchers {
+
+ namespace Floating {
+
+ enum class FloatingPointKind : uint8_t;
+
+ struct WithinAbsMatcher : MatcherBase<double> {
+ WithinAbsMatcher(double target, double margin);
+ bool match(double const& matchee) const override;
+ std::string describe() const override;
+ private:
+ double m_target;
+ double m_margin;
+ };
+
+ struct WithinUlpsMatcher : MatcherBase<double> {
+ WithinUlpsMatcher(double target, int ulps, FloatingPointKind baseType);
+ bool match(double const& matchee) const override;
+ std::string describe() const override;
+ private:
+ double m_target;
+ int m_ulps;
+ FloatingPointKind m_type;
+ };
+
+ } // namespace Floating
+
+ // The following functions create the actual matcher objects.
+ // This allows the types to be inferred
+ Floating::WithinUlpsMatcher WithinULP(double target, int maxUlpDiff);
+ Floating::WithinUlpsMatcher WithinULP(float target, int maxUlpDiff);
+ Floating::WithinAbsMatcher WithinAbs(double target, double margin);
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_floating.h
+// start catch_matchers_generic.hpp
+
+#include <functional>
+#include <string>
+
+namespace Catch {
+namespace Matchers {
+namespace Generic {
+
+namespace Detail {
+ std::string finalizeDescription(const std::string& desc);
+}
+
+template <typename T>
+class PredicateMatcher : public MatcherBase<T> {
+ std::function<bool(T const&)> m_predicate;
+ std::string m_description;
+public:
+
+ PredicateMatcher(std::function<bool(T const&)> const& elem, std::string const& descr)
+ :m_predicate(std::move(elem)),
+ m_description(Detail::finalizeDescription(descr))
+ {}
+
+ bool match( T const& item ) const override {
+ return m_predicate(item);
+ }
+
+ std::string describe() const override {
+ return m_description;
+ }
+};
+
+} // namespace Generic
+
+ // The following functions create the actual matcher objects.
+ // The user has to explicitly specify type to the function, because
+ // inferring std::function<bool(T const&)> is hard (but possible) and
+ // requires a lot of TMP.
+ template<typename T>
+ Generic::PredicateMatcher<T> Predicate(std::function<bool(T const&)> const& predicate, std::string const& description = "") {
+ return Generic::PredicateMatcher<T>(predicate, description);
+ }
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_generic.hpp
+// start catch_matchers_string.h
+
+#include <string>
+
+namespace Catch {
+namespace Matchers {
+
+ namespace StdString {
+
+ struct CasedString
+ {
+ CasedString( std::string const& str, CaseSensitive::Choice caseSensitivity );
+ std::string adjustString( std::string const& str ) const;
+ std::string caseSensitivitySuffix() const;
+
+ CaseSensitive::Choice m_caseSensitivity;
+ std::string m_str;
+ };
+
+ struct StringMatcherBase : MatcherBase<std::string> {
+ StringMatcherBase( std::string const& operation, CasedString const& comparator );
+ std::string describe() const override;
+
+ CasedString m_comparator;
+ std::string m_operation;
+ };
+
+ struct EqualsMatcher : StringMatcherBase {
+ EqualsMatcher( CasedString const& comparator );
+ bool match( std::string const& source ) const override;
+ };
+ struct ContainsMatcher : StringMatcherBase {
+ ContainsMatcher( CasedString const& comparator );
+ bool match( std::string const& source ) const override;
+ };
+ struct StartsWithMatcher : StringMatcherBase {
+ StartsWithMatcher( CasedString const& comparator );
+ bool match( std::string const& source ) const override;
+ };
+ struct EndsWithMatcher : StringMatcherBase {
+ EndsWithMatcher( CasedString const& comparator );
+ bool match( std::string const& source ) const override;
+ };
+
+ struct RegexMatcher : MatcherBase<std::string> {
+ RegexMatcher( std::string regex, CaseSensitive::Choice caseSensitivity );
+ bool match( std::string const& matchee ) const override;
+ std::string describe() const override;
+
+ private:
+ std::string m_regex;
+ CaseSensitive::Choice m_caseSensitivity;
+ };
+
+ } // namespace StdString
+
+ // The following functions create the actual matcher objects.
+ // This allows the types to be inferred
+
+ StdString::EqualsMatcher Equals( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+ StdString::ContainsMatcher Contains( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+ StdString::EndsWithMatcher EndsWith( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+ StdString::StartsWithMatcher StartsWith( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+ StdString::RegexMatcher Matches( std::string const& regex, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_string.h
+// start catch_matchers_vector.h
+
+#include <algorithm>
+
+namespace Catch {
+namespace Matchers {
+
+ namespace Vector {
+ template<typename T>
+ struct ContainsElementMatcher : MatcherBase<std::vector<T>> {
+
+ ContainsElementMatcher(T const &comparator) : m_comparator( comparator) {}
+
+ bool match(std::vector<T> const &v) const override {
+ for (auto const& el : v) {
+ if (el == m_comparator) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ std::string describe() const override {
+ return "Contains: " + ::Catch::Detail::stringify( m_comparator );
+ }
+
+ T const& m_comparator;
+ };
+
+ template<typename T>
+ struct ContainsMatcher : MatcherBase<std::vector<T>> {
+
+ ContainsMatcher(std::vector<T> const &comparator) : m_comparator( comparator ) {}
+
+ bool match(std::vector<T> const &v) const override {
+ // !TBD: see note in EqualsMatcher
+ if (m_comparator.size() > v.size())
+ return false;
+ for (auto const& comparator : m_comparator) {
+ auto present = false;
+ for (const auto& el : v) {
+ if (el == comparator) {
+ present = true;
+ break;
+ }
+ }
+ if (!present) {
+ return false;
+ }
+ }
+ return true;
+ }
+ std::string describe() const override {
+ return "Contains: " + ::Catch::Detail::stringify( m_comparator );
+ }
+
+ std::vector<T> const& m_comparator;
+ };
+
+ template<typename T>
+ struct EqualsMatcher : MatcherBase<std::vector<T>> {
+
+ EqualsMatcher(std::vector<T> const &comparator) : m_comparator( comparator ) {}
+
+ bool match(std::vector<T> const &v) const override {
+ // !TBD: This currently works if all elements can be compared using !=
+ // - a more general approach would be via a compare template that defaults
+ // to using !=. but could be specialised for, e.g. std::vector<T> etc
+ // - then just call that directly
+ if (m_comparator.size() != v.size())
+ return false;
+ for (std::size_t i = 0; i < v.size(); ++i)
+ if (m_comparator[i] != v[i])
+ return false;
+ return true;
+ }
+ std::string describe() const override {
+ return "Equals: " + ::Catch::Detail::stringify( m_comparator );
+ }
+ std::vector<T> const& m_comparator;
+ };
+
+ template<typename T>
+ struct ApproxMatcher : MatcherBase<std::vector<T>> {
+
+ ApproxMatcher(std::vector<T> const& comparator) : m_comparator( comparator ) {}
+
+ bool match(std::vector<T> const &v) const override {
+ if (m_comparator.size() != v.size())
+ return false;
+ for (std::size_t i = 0; i < v.size(); ++i)
+ if (m_comparator[i] != approx(v[i]))
+ return false;
+ return true;
+ }
+ std::string describe() const override {
+ return "is approx: " + ::Catch::Detail::stringify( m_comparator );
+ }
+ template <typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ ApproxMatcher& epsilon( T const& newEpsilon ) {
+ approx.epsilon(newEpsilon);
+ return *this;
+ }
+ template <typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ ApproxMatcher& margin( T const& newMargin ) {
+ approx.margin(newMargin);
+ return *this;
+ }
+ template <typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ ApproxMatcher& scale( T const& newScale ) {
+ approx.scale(newScale);
+ return *this;
+ }
+
+ std::vector<T> const& m_comparator;
+ mutable Catch::Detail::Approx approx = Catch::Detail::Approx::custom();
+ };
+
+ template<typename T>
+ struct UnorderedEqualsMatcher : MatcherBase<std::vector<T>> {
+ UnorderedEqualsMatcher(std::vector<T> const& target) : m_target(target) {}
+ bool match(std::vector<T> const& vec) const override {
+ // Note: This is a reimplementation of std::is_permutation,
+ // because I don't want to include <algorithm> inside the common path
+ if (m_target.size() != vec.size()) {
+ return false;
+ }
+ return std::is_permutation(m_target.begin(), m_target.end(), vec.begin());
+ }
+
+ std::string describe() const override {
+ return "UnorderedEquals: " + ::Catch::Detail::stringify(m_target);
+ }
+ private:
+ std::vector<T> const& m_target;
+ };
+
+ } // namespace Vector
+
+ // The following functions create the actual matcher objects.
+ // This allows the types to be inferred
+
+ template<typename T>
+ Vector::ContainsMatcher<T> Contains( std::vector<T> const& comparator ) {
+ return Vector::ContainsMatcher<T>( comparator );
+ }
+
+ template<typename T>
+ Vector::ContainsElementMatcher<T> VectorContains( T const& comparator ) {
+ return Vector::ContainsElementMatcher<T>( comparator );
+ }
+
+ template<typename T>
+ Vector::EqualsMatcher<T> Equals( std::vector<T> const& comparator ) {
+ return Vector::EqualsMatcher<T>( comparator );
+ }
+
+ template<typename T>
+ Vector::ApproxMatcher<T> Approx( std::vector<T> const& comparator ) {
+ return Vector::ApproxMatcher<T>( comparator );
+ }
+
+ template<typename T>
+ Vector::UnorderedEqualsMatcher<T> UnorderedEquals(std::vector<T> const& target) {
+ return Vector::UnorderedEqualsMatcher<T>(target);
+ }
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_vector.h
+namespace Catch {
+
+ template<typename ArgT, typename MatcherT>
+ class MatchExpr : public ITransientExpression {
+ ArgT const& m_arg;
+ MatcherT m_matcher;
+ StringRef m_matcherString;
+ public:
+ MatchExpr( ArgT const& arg, MatcherT const& matcher, StringRef const& matcherString )
+ : ITransientExpression{ true, matcher.match( arg ) },
+ m_arg( arg ),
+ m_matcher( matcher ),
+ m_matcherString( matcherString )
+ {}
+
+ void streamReconstructedExpression( std::ostream &os ) const override {
+ auto matcherAsString = m_matcher.toString();
+ os << Catch::Detail::stringify( m_arg ) << ' ';
+ if( matcherAsString == Detail::unprintableString )
+ os << m_matcherString;
+ else
+ os << matcherAsString;
+ }
+ };
+
+ using StringMatcher = Matchers::Impl::MatcherBase<std::string>;
+
+ void handleExceptionMatchExpr( AssertionHandler& handler, StringMatcher const& matcher, StringRef const& matcherString );
+
+ template<typename ArgT, typename MatcherT>
+ auto makeMatchExpr( ArgT const& arg, MatcherT const& matcher, StringRef const& matcherString ) -> MatchExpr<ArgT, MatcherT> {
+ return MatchExpr<ArgT, MatcherT>( arg, matcher, matcherString );
+ }
+
+} // namespace Catch
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CHECK_THAT( macroName, matcher, resultDisposition, arg ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(arg) ", " CATCH_INTERNAL_STRINGIFY(matcher), resultDisposition ); \
+ INTERNAL_CATCH_TRY { \
+ catchAssertionHandler.handleExpr( Catch::makeMatchExpr( arg, matcher, #matcher##_catch_sr ) ); \
+ } INTERNAL_CATCH_CATCH( catchAssertionHandler ) \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_THROWS_MATCHES( macroName, exceptionType, resultDisposition, matcher, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__) ", " CATCH_INTERNAL_STRINGIFY(exceptionType) ", " CATCH_INTERNAL_STRINGIFY(matcher), resultDisposition ); \
+ if( catchAssertionHandler.allowThrows() ) \
+ try { \
+ static_cast<void>(__VA_ARGS__ ); \
+ catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \
+ } \
+ catch( exceptionType const& ex ) { \
+ catchAssertionHandler.handleExpr( Catch::makeMatchExpr( ex, matcher, #matcher##_catch_sr ) ); \
+ } \
+ catch( ... ) { \
+ catchAssertionHandler.handleUnexpectedInflightException(); \
+ } \
+ else \
+ catchAssertionHandler.handleThrowingCallSkipped(); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+// end catch_capture_matchers.h
+#endif
+// start catch_generators.hpp
+
+// start catch_interfaces_generatortracker.h
+
+
+#include <memory>
+
+namespace Catch {
+
+ namespace Generators {
+ class GeneratorUntypedBase {
+ public:
+ GeneratorUntypedBase() = default;
+ virtual ~GeneratorUntypedBase();
+ // Attempts to move the generator to the next element
+ //
+ // Returns true iff the move succeeded (and a valid element
+ // can be retrieved).
+ virtual bool next() = 0;
+ };
+ using GeneratorBasePtr = std::unique_ptr<GeneratorUntypedBase>;
+
+ } // namespace Generators
+
+ struct IGeneratorTracker {
+ virtual ~IGeneratorTracker();
+ virtual auto hasGenerator() const -> bool = 0;
+ virtual auto getGenerator() const -> Generators::GeneratorBasePtr const& = 0;
+ virtual void setGenerator( Generators::GeneratorBasePtr&& generator ) = 0;
+ };
+
+} // namespace Catch
+
+// end catch_interfaces_generatortracker.h
+// start catch_enforce.h
+
+#include <exception>
+
+namespace Catch {
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ template <typename Ex>
+ [[noreturn]]
+ void throw_exception(Ex const& e) {
+ throw e;
+ }
+#else // ^^ Exceptions are enabled // Exceptions are disabled vv
+ [[noreturn]]
+ void throw_exception(std::exception const& e);
+#endif
+
+ [[noreturn]]
+ void throw_logic_error(std::string const& msg);
+ [[noreturn]]
+ void throw_domain_error(std::string const& msg);
+ [[noreturn]]
+ void throw_runtime_error(std::string const& msg);
+
+} // namespace Catch;
+
+#define CATCH_MAKE_MSG(...) \
+ (Catch::ReusableStringStream() << __VA_ARGS__).str()
+
+#define CATCH_INTERNAL_ERROR(...) \
+ Catch::throw_logic_error(CATCH_MAKE_MSG( CATCH_INTERNAL_LINEINFO << ": Internal Catch2 error: " << __VA_ARGS__));
+
+#define CATCH_ERROR(...) \
+ Catch::throw_domain_error(CATCH_MAKE_MSG( __VA_ARGS__ ));
+
+#define CATCH_RUNTIME_ERROR(...) \
+ Catch::throw_runtime_error(CATCH_MAKE_MSG( __VA_ARGS__ ));
+
+#define CATCH_ENFORCE( condition, ... ) \
+ do{ if( !(condition) ) CATCH_ERROR( __VA_ARGS__ ); } while(false)
+
+// end catch_enforce.h
+#include <memory>
+#include <vector>
+#include <cassert>
+
+#include <utility>
+#include <exception>
+
+namespace Catch {
+
+class GeneratorException : public std::exception {
+ const char* const m_msg = "";
+
+public:
+ GeneratorException(const char* msg):
+ m_msg(msg)
+ {}
+
+ const char* what() const noexcept override final;
+};
+
+namespace Generators {
+
+ // !TBD move this into its own location?
+ namespace pf{
+ template<typename T, typename... Args>
+ std::unique_ptr<T> make_unique( Args&&... args ) {
+ return std::unique_ptr<T>(new T(std::forward<Args>(args)...));
+ }
+ }
+
+ template<typename T>
+ struct IGenerator : GeneratorUntypedBase {
+ virtual ~IGenerator() = default;
+
+ // Returns the current element of the generator
+ //
+ // \Precondition The generator is either freshly constructed,
+ // or the last call to `next()` returned true
+ virtual T const& get() const = 0;
+ using type = T;
+ };
+
+ template<typename T>
+ class SingleValueGenerator final : public IGenerator<T> {
+ T m_value;
+ public:
+ SingleValueGenerator(T const& value) : m_value( value ) {}
+ SingleValueGenerator(T&& value) : m_value(std::move(value)) {}
+
+ T const& get() const override {
+ return m_value;
+ }
+ bool next() override {
+ return false;
+ }
+ };
+
+ template<typename T>
+ class FixedValuesGenerator final : public IGenerator<T> {
+ std::vector<T> m_values;
+ size_t m_idx = 0;
+ public:
+ FixedValuesGenerator( std::initializer_list<T> values ) : m_values( values ) {}
+
+ T const& get() const override {
+ return m_values[m_idx];
+ }
+ bool next() override {
+ ++m_idx;
+ return m_idx < m_values.size();
+ }
+ };
+
+ template <typename T>
+ class GeneratorWrapper final {
+ std::unique_ptr<IGenerator<T>> m_generator;
+ public:
+ GeneratorWrapper(std::unique_ptr<IGenerator<T>> generator):
+ m_generator(std::move(generator))
+ {}
+ T const& get() const {
+ return m_generator->get();
+ }
+ bool next() {
+ return m_generator->next();
+ }
+ };
+
+ template <typename T>
+ GeneratorWrapper<T> value(T&& value) {
+ return GeneratorWrapper<T>(pf::make_unique<SingleValueGenerator<T>>(std::forward<T>(value)));
+ }
+ template <typename T>
+ GeneratorWrapper<T> values(std::initializer_list<T> values) {
+ return GeneratorWrapper<T>(pf::make_unique<FixedValuesGenerator<T>>(values));
+ }
+
+ template<typename T>
+ class Generators : public IGenerator<T> {
+ std::vector<GeneratorWrapper<T>> m_generators;
+ size_t m_current = 0;
+
+ void populate(GeneratorWrapper<T>&& generator) {
+ m_generators.emplace_back(std::move(generator));
+ }
+ void populate(T&& val) {
+ m_generators.emplace_back(value(std::move(val)));
+ }
+ template<typename U>
+ void populate(U&& val) {
+ populate(T(std::move(val)));
+ }
+ template<typename U, typename... Gs>
+ void populate(U&& valueOrGenerator, Gs... moreGenerators) {
+ populate(std::forward<U>(valueOrGenerator));
+ populate(std::forward<Gs>(moreGenerators)...);
+ }
+
+ public:
+ template <typename... Gs>
+ Generators(Gs... moreGenerators) {
+ m_generators.reserve(sizeof...(Gs));
+ populate(std::forward<Gs>(moreGenerators)...);
+ }
+
+ T const& get() const override {
+ return m_generators[m_current].get();
+ }
+
+ bool next() override {
+ if (m_current >= m_generators.size()) {
+ return false;
+ }
+ const bool current_status = m_generators[m_current].next();
+ if (!current_status) {
+ ++m_current;
+ }
+ return m_current < m_generators.size();
+ }
+ };
+
+ template<typename... Ts>
+ GeneratorWrapper<std::tuple<Ts...>> table( std::initializer_list<std::tuple<typename std::decay<Ts>::type...>> tuples ) {
+ return values<std::tuple<Ts...>>( tuples );
+ }
+
+ // Tag type to signal that a generator sequence should convert arguments to a specific type
+ template <typename T>
+ struct as {};
+
+ template<typename T, typename... Gs>
+ auto makeGenerators( GeneratorWrapper<T>&& generator, Gs... moreGenerators ) -> Generators<T> {
+ return Generators<T>(std::move(generator), std::forward<Gs>(moreGenerators)...);
+ }
+ template<typename T>
+ auto makeGenerators( GeneratorWrapper<T>&& generator ) -> Generators<T> {
+ return Generators<T>(std::move(generator));
+ }
+ template<typename T, typename... Gs>
+ auto makeGenerators( T&& val, Gs... moreGenerators ) -> Generators<T> {
+ return makeGenerators( value( std::forward<T>( val ) ), std::forward<Gs>( moreGenerators )... );
+ }
+ template<typename T, typename U, typename... Gs>
+ auto makeGenerators( as<T>, U&& val, Gs... moreGenerators ) -> Generators<T> {
+ return makeGenerators( value( T( std::forward<U>( val ) ) ), std::forward<Gs>( moreGenerators )... );
+ }
+
+ auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker&;
+
+ template<typename L>
+ // Note: The type after -> is weird, because VS2015 cannot parse
+ // the expression used in the typedef inside, when it is in
+ // return type. Yeah.
+ auto generate( SourceLineInfo const& lineInfo, L const& generatorExpression ) -> decltype(std::declval<decltype(generatorExpression())>().get()) {
+ using UnderlyingType = typename decltype(generatorExpression())::type;
+
+ IGeneratorTracker& tracker = acquireGeneratorTracker( lineInfo );
+ if (!tracker.hasGenerator()) {
+ tracker.setGenerator(pf::make_unique<Generators<UnderlyingType>>(generatorExpression()));
+ }
+
+ auto const& generator = static_cast<IGenerator<UnderlyingType> const&>( *tracker.getGenerator() );
+ return generator.get();
+ }
+
+} // namespace Generators
+} // namespace Catch
+
+#define GENERATE( ... ) \
+ Catch::Generators::generate( CATCH_INTERNAL_LINEINFO, [ ]{ using namespace Catch::Generators; return makeGenerators( __VA_ARGS__ ); } )
+#define GENERATE_COPY( ... ) \
+ Catch::Generators::generate( CATCH_INTERNAL_LINEINFO, [=]{ using namespace Catch::Generators; return makeGenerators( __VA_ARGS__ ); } )
+#define GENERATE_REF( ... ) \
+ Catch::Generators::generate( CATCH_INTERNAL_LINEINFO, [&]{ using namespace Catch::Generators; return makeGenerators( __VA_ARGS__ ); } )
+
+// end catch_generators.hpp
+// start catch_generators_generic.hpp
+
+namespace Catch {
+namespace Generators {
+
+ template <typename T>
+ class TakeGenerator : public IGenerator<T> {
+ GeneratorWrapper<T> m_generator;
+ size_t m_returned = 0;
+ size_t m_target;
+ public:
+ TakeGenerator(size_t target, GeneratorWrapper<T>&& generator):
+ m_generator(std::move(generator)),
+ m_target(target)
+ {
+ assert(target != 0 && "Empty generators are not allowed");
+ }
+ T const& get() const override {
+ return m_generator.get();
+ }
+ bool next() override {
+ ++m_returned;
+ if (m_returned >= m_target) {
+ return false;
+ }
+
+ const auto success = m_generator.next();
+ // If the underlying generator does not contain enough values
+ // then we cut short as well
+ if (!success) {
+ m_returned = m_target;
+ }
+ return success;
+ }
+ };
+
+ template <typename T>
+ GeneratorWrapper<T> take(size_t target, GeneratorWrapper<T>&& generator) {
+ return GeneratorWrapper<T>(pf::make_unique<TakeGenerator<T>>(target, std::move(generator)));
+ }
+
+ template <typename T, typename Predicate>
+ class FilterGenerator : public IGenerator<T> {
+ GeneratorWrapper<T> m_generator;
+ Predicate m_predicate;
+ public:
+ template <typename P = Predicate>
+ FilterGenerator(P&& pred, GeneratorWrapper<T>&& generator):
+ m_generator(std::move(generator)),
+ m_predicate(std::forward<P>(pred))
+ {
+ if (!m_predicate(m_generator.get())) {
+ // It might happen that there are no values that pass the
+ // filter. In that case we throw an exception.
+ auto has_initial_value = next();
+ if (!has_initial_value) {
+ Catch::throw_exception(GeneratorException("No valid value found in filtered generator"));
+ }
+ }
+ }
+
+ T const& get() const override {
+ return m_generator.get();
+ }
+
+ bool next() override {
+ bool success = m_generator.next();
+ if (!success) {
+ return false;
+ }
+ while (!m_predicate(m_generator.get()) && (success = m_generator.next()) == true);
+ return success;
+ }
+ };
+
+ template <typename T, typename Predicate>
+ GeneratorWrapper<T> filter(Predicate&& pred, GeneratorWrapper<T>&& generator) {
+ return GeneratorWrapper<T>(std::unique_ptr<IGenerator<T>>(pf::make_unique<FilterGenerator<T, Predicate>>(std::forward<Predicate>(pred), std::move(generator))));
+ }
+
+ template <typename T>
+ class RepeatGenerator : public IGenerator<T> {
+ GeneratorWrapper<T> m_generator;
+ mutable std::vector<T> m_returned;
+ size_t m_target_repeats;
+ size_t m_current_repeat = 0;
+ size_t m_repeat_index = 0;
+ public:
+ RepeatGenerator(size_t repeats, GeneratorWrapper<T>&& generator):
+ m_generator(std::move(generator)),
+ m_target_repeats(repeats)
+ {
+ assert(m_target_repeats > 0 && "Repeat generator must repeat at least once");
+ }
+
+ T const& get() const override {
+ if (m_current_repeat == 0) {
+ m_returned.push_back(m_generator.get());
+ return m_returned.back();
+ }
+ return m_returned[m_repeat_index];
+ }
+
+ bool next() override {
+ // There are 2 basic cases:
+ // 1) We are still reading the generator
+ // 2) We are reading our own cache
+
+ // In the first case, we need to poke the underlying generator.
+ // If it happily moves, we are left in that state, otherwise it is time to start reading from our cache
+ if (m_current_repeat == 0) {
+ const auto success = m_generator.next();
+ if (!success) {
+ ++m_current_repeat;
+ }
+ return m_current_repeat < m_target_repeats;
+ }
+
+ // In the second case, we need to move indices forward and check that we haven't run up against the end
+ ++m_repeat_index;
+ if (m_repeat_index == m_returned.size()) {
+ m_repeat_index = 0;
+ ++m_current_repeat;
+ }
+ return m_current_repeat < m_target_repeats;
+ }
+ };
+
+ template <typename T>
+ GeneratorWrapper<T> repeat(size_t repeats, GeneratorWrapper<T>&& generator) {
+ return GeneratorWrapper<T>(pf::make_unique<RepeatGenerator<T>>(repeats, std::move(generator)));
+ }
+
+ template <typename T, typename U, typename Func>
+ class MapGenerator : public IGenerator<T> {
+ // TBD: provide static assert for mapping function, for friendly error message
+ GeneratorWrapper<U> m_generator;
+ Func m_function;
+ // To avoid returning dangling reference, we have to save the values
+ T m_cache;
+ public:
+ template <typename F2 = Func>
+ MapGenerator(F2&& function, GeneratorWrapper<U>&& generator) :
+ m_generator(std::move(generator)),
+ m_function(std::forward<F2>(function)),
+ m_cache(m_function(m_generator.get()))
+ {}
+
+ T const& get() const override {
+ return m_cache;
+ }
+ bool next() override {
+ const auto success = m_generator.next();
+ if (success) {
+ m_cache = m_function(m_generator.get());
+ }
+ return success;
+ }
+ };
+
+#if defined(__cpp_lib_is_invocable) && __cpp_lib_is_invocable >= 201703
+ // std::result_of is deprecated in C++17 and removed in C++20. Hence, it is
+ // replaced with std::invoke_result here. Also *_t format is preferred over
+ // typename *::type format.
+ template <typename Func, typename U>
+ using MapFunctionReturnType = std::remove_reference_t<std::remove_cv_t<std::invoke_result_t<Func, U>>>;
+#else
+ template <typename Func, typename U>
+ using MapFunctionReturnType = typename std::remove_reference<typename std::remove_cv<typename std::result_of<Func(U)>::type>::type>::type;
+#endif
+
+ template <typename Func, typename U, typename T = MapFunctionReturnType<Func, U>>
+ GeneratorWrapper<T> map(Func&& function, GeneratorWrapper<U>&& generator) {
+ return GeneratorWrapper<T>(
+ pf::make_unique<MapGenerator<T, U, Func>>(std::forward<Func>(function), std::move(generator))
+ );
+ }
+
+ template <typename T, typename U, typename Func>
+ GeneratorWrapper<T> map(Func&& function, GeneratorWrapper<U>&& generator) {
+ return GeneratorWrapper<T>(
+ pf::make_unique<MapGenerator<T, U, Func>>(std::forward<Func>(function), std::move(generator))
+ );
+ }
+
+ template <typename T>
+ class ChunkGenerator final : public IGenerator<std::vector<T>> {
+ std::vector<T> m_chunk;
+ size_t m_chunk_size;
+ GeneratorWrapper<T> m_generator;
+ bool m_used_up = false;
+ public:
+ ChunkGenerator(size_t size, GeneratorWrapper<T> generator) :
+ m_chunk_size(size), m_generator(std::move(generator))
+ {
+ m_chunk.reserve(m_chunk_size);
+ m_chunk.push_back(m_generator.get());
+ for (size_t i = 1; i < m_chunk_size; ++i) {
+ if (!m_generator.next()) {
+ Catch::throw_exception(GeneratorException("Not enough values to initialize the first chunk"));
+ }
+ m_chunk.push_back(m_generator.get());
+ }
+ }
+ std::vector<T> const& get() const override {
+ return m_chunk;
+ }
+ bool next() override {
+ m_chunk.clear();
+ for (size_t idx = 0; idx < m_chunk_size; ++idx) {
+ if (!m_generator.next()) {
+ return false;
+ }
+ m_chunk.push_back(m_generator.get());
+ }
+ return true;
+ }
+ };
+
+ template <typename T>
+ GeneratorWrapper<std::vector<T>> chunk(size_t size, GeneratorWrapper<T>&& generator) {
+ return GeneratorWrapper<std::vector<T>>(
+ pf::make_unique<ChunkGenerator<T>>(size, std::move(generator))
+ );
+ }
+
+} // namespace Generators
+} // namespace Catch
+
+// end catch_generators_generic.hpp
+// start catch_generators_specific.hpp
+
+// start catch_context.h
+
+#include <memory>
+
+namespace Catch {
+
+ struct IResultCapture;
+ struct IRunner;
+ struct IConfig;
+ struct IMutableContext;
+
+ using IConfigPtr = std::shared_ptr<IConfig const>;
+
+ struct IContext
+ {
+ virtual ~IContext();
+
+ virtual IResultCapture* getResultCapture() = 0;
+ virtual IRunner* getRunner() = 0;
+ virtual IConfigPtr const& getConfig() const = 0;
+ };
+
+ struct IMutableContext : IContext
+ {
+ virtual ~IMutableContext();
+ virtual void setResultCapture( IResultCapture* resultCapture ) = 0;
+ virtual void setRunner( IRunner* runner ) = 0;
+ virtual void setConfig( IConfigPtr const& config ) = 0;
+
+ private:
+ static IMutableContext *currentContext;
+ friend IMutableContext& getCurrentMutableContext();
+ friend void cleanUpContext();
+ static void createContext();
+ };
+
+ inline IMutableContext& getCurrentMutableContext()
+ {
+ if( !IMutableContext::currentContext )
+ IMutableContext::createContext();
+ return *IMutableContext::currentContext;
+ }
+
+ inline IContext& getCurrentContext()
+ {
+ return getCurrentMutableContext();
+ }
+
+ void cleanUpContext();
+}
+
+// end catch_context.h
+// start catch_interfaces_config.h
+
+// start catch_option.hpp
+
+namespace Catch {
+
+ // An optional type
+ template<typename T>
+ class Option {
+ public:
+ Option() : nullableValue( nullptr ) {}
+ Option( T const& _value )
+ : nullableValue( new( storage ) T( _value ) )
+ {}
+ Option( Option const& _other )
+ : nullableValue( _other ? new( storage ) T( *_other ) : nullptr )
+ {}
+
+ ~Option() {
+ reset();
+ }
+
+ Option& operator= ( Option const& _other ) {
+ if( &_other != this ) {
+ reset();
+ if( _other )
+ nullableValue = new( storage ) T( *_other );
+ }
+ return *this;
+ }
+ Option& operator = ( T const& _value ) {
+ reset();
+ nullableValue = new( storage ) T( _value );
+ return *this;
+ }
+
+ void reset() {
+ if( nullableValue )
+ nullableValue->~T();
+ nullableValue = nullptr;
+ }
+
+ T& operator*() { return *nullableValue; }
+ T const& operator*() const { return *nullableValue; }
+ T* operator->() { return nullableValue; }
+ const T* operator->() const { return nullableValue; }
+
+ T valueOr( T const& defaultValue ) const {
+ return nullableValue ? *nullableValue : defaultValue;
+ }
+
+ bool some() const { return nullableValue != nullptr; }
+ bool none() const { return nullableValue == nullptr; }
+
+ bool operator !() const { return nullableValue == nullptr; }
+ explicit operator bool() const {
+ return some();
+ }
+
+ private:
+ T *nullableValue;
+ alignas(alignof(T)) char storage[sizeof(T)];
+ };
+
+} // end namespace Catch
+
+// end catch_option.hpp
+#include <iosfwd>
+#include <string>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ enum class Verbosity {
+ Quiet = 0,
+ Normal,
+ High
+ };
+
+ struct WarnAbout { enum What {
+ Nothing = 0x00,
+ NoAssertions = 0x01,
+ NoTests = 0x02
+ }; };
+
+ struct ShowDurations { enum OrNot {
+ DefaultForReporter,
+ Always,
+ Never
+ }; };
+ struct RunTests { enum InWhatOrder {
+ InDeclarationOrder,
+ InLexicographicalOrder,
+ InRandomOrder
+ }; };
+ struct UseColour { enum YesOrNo {
+ Auto,
+ Yes,
+ No
+ }; };
+ struct WaitForKeypress { enum When {
+ Never,
+ BeforeStart = 1,
+ BeforeExit = 2,
+ BeforeStartAndExit = BeforeStart | BeforeExit
+ }; };
+
+ class TestSpec;
+
+ struct IConfig : NonCopyable {
+
+ virtual ~IConfig();
+
+ virtual bool allowThrows() const = 0;
+ virtual std::ostream& stream() const = 0;
+ virtual std::string name() const = 0;
+ virtual bool includeSuccessfulResults() const = 0;
+ virtual bool shouldDebugBreak() const = 0;
+ virtual bool warnAboutMissingAssertions() const = 0;
+ virtual bool warnAboutNoTests() const = 0;
+ virtual int abortAfter() const = 0;
+ virtual bool showInvisibles() const = 0;
+ virtual ShowDurations::OrNot showDurations() const = 0;
+ virtual TestSpec const& testSpec() const = 0;
+ virtual bool hasTestFilters() const = 0;
+ virtual std::vector<std::string> const& getTestsOrTags() const = 0;
+ virtual RunTests::InWhatOrder runOrder() const = 0;
+ virtual unsigned int rngSeed() const = 0;
+ virtual UseColour::YesOrNo useColour() const = 0;
+ virtual std::vector<std::string> const& getSectionsToRun() const = 0;
+ virtual Verbosity verbosity() const = 0;
+
+ virtual bool benchmarkNoAnalysis() const = 0;
+ virtual int benchmarkSamples() const = 0;
+ virtual double benchmarkConfidenceInterval() const = 0;
+ virtual unsigned int benchmarkResamples() const = 0;
+ };
+
+ using IConfigPtr = std::shared_ptr<IConfig const>;
+}
+
+// end catch_interfaces_config.h
+#include <random>
+
+namespace Catch {
+namespace Generators {
+
+template <typename Float>
+class RandomFloatingGenerator final : public IGenerator<Float> {
+ // FIXME: What is the right seed?
+ std::minstd_rand m_rand;
+ std::uniform_real_distribution<Float> m_dist;
+ Float m_current_number;
+public:
+
+ RandomFloatingGenerator(Float a, Float b):
+ m_rand(getCurrentContext().getConfig()->rngSeed()),
+ m_dist(a, b) {
+ static_cast<void>(next());
+ }
+
+ Float const& get() const override {
+ return m_current_number;
+ }
+ bool next() override {
+ m_current_number = m_dist(m_rand);
+ return true;
+ }
+};
+
+template <typename Integer>
+class RandomIntegerGenerator final : public IGenerator<Integer> {
+ std::minstd_rand m_rand;
+ std::uniform_int_distribution<Integer> m_dist;
+ Integer m_current_number;
+public:
+
+ RandomIntegerGenerator(Integer a, Integer b):
+ m_rand(getCurrentContext().getConfig()->rngSeed()),
+ m_dist(a, b) {
+ static_cast<void>(next());
+ }
+
+ Integer const& get() const override {
+ return m_current_number;
+ }
+ bool next() override {
+ m_current_number = m_dist(m_rand);
+ return true;
+ }
+};
+
+// TODO: Ideally this would be also constrained against the various char types,
+// but I don't expect users to run into that in practice.
+template <typename T>
+typename std::enable_if<std::is_integral<T>::value && !std::is_same<T, bool>::value,
+GeneratorWrapper<T>>::type
+random(T a, T b) {
+ return GeneratorWrapper<T>(
+ pf::make_unique<RandomIntegerGenerator<T>>(a, b)
+ );
+}
+
+template <typename T>
+typename std::enable_if<std::is_floating_point<T>::value,
+GeneratorWrapper<T>>::type
+random(T a, T b) {
+ return GeneratorWrapper<T>(
+ pf::make_unique<RandomFloatingGenerator<T>>(a, b)
+ );
+}
+
+template <typename T>
+class RangeGenerator final : public IGenerator<T> {
+ T m_current;
+ T m_end;
+ T m_step;
+ bool m_positive;
+
+public:
+ RangeGenerator(T const& start, T const& end, T const& step):
+ m_current(start),
+ m_end(end),
+ m_step(step),
+ m_positive(m_step > T(0))
+ {
+ assert(m_current != m_end && "Range start and end cannot be equal");
+ assert(m_step != T(0) && "Step size cannot be zero");
+ assert(((m_positive && m_current <= m_end) || (!m_positive && m_current >= m_end)) && "Step moves away from end");
+ }
+
+ RangeGenerator(T const& start, T const& end):
+ RangeGenerator(start, end, (start < end) ? T(1) : T(-1))
+ {}
+
+ T const& get() const override {
+ return m_current;
+ }
+
+ bool next() override {
+ m_current += m_step;
+ return (m_positive) ? (m_current < m_end) : (m_current > m_end);
+ }
+};
+
+template <typename T>
+GeneratorWrapper<T> range(T const& start, T const& end, T const& step) {
+ static_assert(std::is_integral<T>::value && !std::is_same<T, bool>::value, "Type must be an integer");
+ return GeneratorWrapper<T>(pf::make_unique<RangeGenerator<T>>(start, end, step));
+}
+
+template <typename T>
+GeneratorWrapper<T> range(T const& start, T const& end) {
+ static_assert(std::is_integral<T>::value && !std::is_same<T, bool>::value, "Type must be an integer");
+ return GeneratorWrapper<T>(pf::make_unique<RangeGenerator<T>>(start, end));
+}
+
+} // namespace Generators
+} // namespace Catch
+
+// end catch_generators_specific.hpp
+
+// These files are included here so the single_include script doesn't put them
+// in the conditionally compiled sections
+// start catch_test_case_info.h
+
+#include <string>
+#include <vector>
+#include <memory>
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wpadded"
+#endif
+
+namespace Catch {
+
+ struct ITestInvoker;
+
+ struct TestCaseInfo {
+ enum SpecialProperties{
+ None = 0,
+ IsHidden = 1 << 1,
+ ShouldFail = 1 << 2,
+ MayFail = 1 << 3,
+ Throws = 1 << 4,
+ NonPortable = 1 << 5,
+ Benchmark = 1 << 6
+ };
+
+ TestCaseInfo( std::string const& _name,
+ std::string const& _className,
+ std::string const& _description,
+ std::vector<std::string> const& _tags,
+ SourceLineInfo const& _lineInfo );
+
+ friend void setTags( TestCaseInfo& testCaseInfo, std::vector<std::string> tags );
+
+ bool isHidden() const;
+ bool throws() const;
+ bool okToFail() const;
+ bool expectedToFail() const;
+
+ std::string tagsAsString() const;
+
+ std::string name;
+ std::string className;
+ std::string description;
+ std::vector<std::string> tags;
+ std::vector<std::string> lcaseTags;
+ SourceLineInfo lineInfo;
+ SpecialProperties properties;
+ };
+
+ class TestCase : public TestCaseInfo {
+ public:
+
+ TestCase( ITestInvoker* testCase, TestCaseInfo&& info );
+
+ TestCase withName( std::string const& _newName ) const;
+
+ void invoke() const;
+
+ TestCaseInfo const& getTestCaseInfo() const;
+
+ bool operator == ( TestCase const& other ) const;
+ bool operator < ( TestCase const& other ) const;
+
+ private:
+ std::shared_ptr<ITestInvoker> test;
+ };
+
+ TestCase makeTestCase( ITestInvoker* testCase,
+ std::string const& className,
+ NameAndTags const& nameAndTags,
+ SourceLineInfo const& lineInfo );
+}
+
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// end catch_test_case_info.h
+// start catch_interfaces_runner.h
+
+namespace Catch {
+
+ struct IRunner {
+ virtual ~IRunner();
+ virtual bool aborting() const = 0;
+ };
+}
+
+// end catch_interfaces_runner.h
+
+#ifdef __OBJC__
+// start catch_objc.hpp
+
+#import <objc/runtime.h>
+
+#include <string>
+
+// NB. Any general catch headers included here must be included
+// in catch.hpp first to make sure they are included by the single
+// header for non obj-usage
+
+///////////////////////////////////////////////////////////////////////////////
+// This protocol is really only here for (self) documenting purposes, since
+// all its methods are optional.
+@protocol OcFixture
+
+@optional
+
+-(void) setUp;
+-(void) tearDown;
+
+@end
+
+namespace Catch {
+
+ class OcMethod : public ITestInvoker {
+
+ public:
+ OcMethod( Class cls, SEL sel ) : m_cls( cls ), m_sel( sel ) {}
+
+ virtual void invoke() const {
+ id obj = [[m_cls alloc] init];
+
+ performOptionalSelector( obj, @selector(setUp) );
+ performOptionalSelector( obj, m_sel );
+ performOptionalSelector( obj, @selector(tearDown) );
+
+ arcSafeRelease( obj );
+ }
+ private:
+ virtual ~OcMethod() {}
+
+ Class m_cls;
+ SEL m_sel;
+ };
+
+ namespace Detail{
+
+ inline std::string getAnnotation( Class cls,
+ std::string const& annotationName,
+ std::string const& testCaseName ) {
+ NSString* selStr = [[NSString alloc] initWithFormat:@"Catch_%s_%s", annotationName.c_str(), testCaseName.c_str()];
+ SEL sel = NSSelectorFromString( selStr );
+ arcSafeRelease( selStr );
+ id value = performOptionalSelector( cls, sel );
+ if( value )
+ return [(NSString*)value UTF8String];
+ return "";
+ }
+ }
+
+ inline std::size_t registerTestMethods() {
+ std::size_t noTestMethods = 0;
+ int noClasses = objc_getClassList( nullptr, 0 );
+
+ Class* classes = (CATCH_UNSAFE_UNRETAINED Class *)malloc( sizeof(Class) * noClasses);
+ objc_getClassList( classes, noClasses );
+
+ for( int c = 0; c < noClasses; c++ ) {
+ Class cls = classes[c];
+ {
+ u_int count;
+ Method* methods = class_copyMethodList( cls, &count );
+ for( u_int m = 0; m < count ; m++ ) {
+ SEL selector = method_getName(methods[m]);
+ std::string methodName = sel_getName(selector);
+ if( startsWith( methodName, "Catch_TestCase_" ) ) {
+ std::string testCaseName = methodName.substr( 15 );
+ std::string name = Detail::getAnnotation( cls, "Name", testCaseName );
+ std::string desc = Detail::getAnnotation( cls, "Description", testCaseName );
+ const char* className = class_getName( cls );
+
+ getMutableRegistryHub().registerTest( makeTestCase( new OcMethod( cls, selector ), className, NameAndTags( name.c_str(), desc.c_str() ), SourceLineInfo("",0) ) );
+ noTestMethods++;
+ }
+ }
+ free(methods);
+ }
+ }
+ return noTestMethods;
+ }
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+
+ namespace Matchers {
+ namespace Impl {
+ namespace NSStringMatchers {
+
+ struct StringHolder : MatcherBase<NSString*>{
+ StringHolder( NSString* substr ) : m_substr( [substr copy] ){}
+ StringHolder( StringHolder const& other ) : m_substr( [other.m_substr copy] ){}
+ StringHolder() {
+ arcSafeRelease( m_substr );
+ }
+
+ bool match( NSString* const& str ) const override {
+ return false;
+ }
+
+ NSString* CATCH_ARC_STRONG m_substr;
+ };
+
+ struct Equals : StringHolder {
+ Equals( NSString* substr ) : StringHolder( substr ){}
+
+ bool match( NSString* const& str ) const override {
+ return (str != nil || m_substr == nil ) &&
+ [str isEqualToString:m_substr];
+ }
+
+ std::string describe() const override {
+ return "equals string: " + Catch::Detail::stringify( m_substr );
+ }
+ };
+
+ struct Contains : StringHolder {
+ Contains( NSString* substr ) : StringHolder( substr ){}
+
+ bool match( NSString* const& str ) const override {
+ return (str != nil || m_substr == nil ) &&
+ [str rangeOfString:m_substr].location != NSNotFound;
+ }
+
+ std::string describe() const override {
+ return "contains string: " + Catch::Detail::stringify( m_substr );
+ }
+ };
+
+ struct StartsWith : StringHolder {
+ StartsWith( NSString* substr ) : StringHolder( substr ){}
+
+ bool match( NSString* const& str ) const override {
+ return (str != nil || m_substr == nil ) &&
+ [str rangeOfString:m_substr].location == 0;
+ }
+
+ std::string describe() const override {
+ return "starts with: " + Catch::Detail::stringify( m_substr );
+ }
+ };
+ struct EndsWith : StringHolder {
+ EndsWith( NSString* substr ) : StringHolder( substr ){}
+
+ bool match( NSString* const& str ) const override {
+ return (str != nil || m_substr == nil ) &&
+ [str rangeOfString:m_substr].location == [str length] - [m_substr length];
+ }
+
+ std::string describe() const override {
+ return "ends with: " + Catch::Detail::stringify( m_substr );
+ }
+ };
+
+ } // namespace NSStringMatchers
+ } // namespace Impl
+
+ inline Impl::NSStringMatchers::Equals
+ Equals( NSString* substr ){ return Impl::NSStringMatchers::Equals( substr ); }
+
+ inline Impl::NSStringMatchers::Contains
+ Contains( NSString* substr ){ return Impl::NSStringMatchers::Contains( substr ); }
+
+ inline Impl::NSStringMatchers::StartsWith
+ StartsWith( NSString* substr ){ return Impl::NSStringMatchers::StartsWith( substr ); }
+
+ inline Impl::NSStringMatchers::EndsWith
+ EndsWith( NSString* substr ){ return Impl::NSStringMatchers::EndsWith( substr ); }
+
+ } // namespace Matchers
+
+ using namespace Matchers;
+
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+} // namespace Catch
+
+///////////////////////////////////////////////////////////////////////////////
+#define OC_MAKE_UNIQUE_NAME( root, uniqueSuffix ) root##uniqueSuffix
+#define OC_TEST_CASE2( name, desc, uniqueSuffix ) \
++(NSString*) OC_MAKE_UNIQUE_NAME( Catch_Name_test_, uniqueSuffix ) \
+{ \
+return @ name; \
+} \
++(NSString*) OC_MAKE_UNIQUE_NAME( Catch_Description_test_, uniqueSuffix ) \
+{ \
+return @ desc; \
+} \
+-(void) OC_MAKE_UNIQUE_NAME( Catch_TestCase_test_, uniqueSuffix )
+
+#define OC_TEST_CASE( name, desc ) OC_TEST_CASE2( name, desc, __LINE__ )
+
+// end catch_objc.hpp
+#endif
+
+// Benchmarking needs the externally-facing parts of reporters to work
+#if defined(CATCH_CONFIG_EXTERNAL_INTERFACES) || defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+// start catch_external_interfaces.h
+
+// start catch_reporter_bases.hpp
+
+// start catch_interfaces_reporter.h
+
+// start catch_config.hpp
+
+// start catch_test_spec_parser.h
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wpadded"
+#endif
+
+// start catch_test_spec.h
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wpadded"
+#endif
+
+// start catch_wildcard_pattern.h
+
+namespace Catch
+{
+ class WildcardPattern {
+ enum WildcardPosition {
+ NoWildcard = 0,
+ WildcardAtStart = 1,
+ WildcardAtEnd = 2,
+ WildcardAtBothEnds = WildcardAtStart | WildcardAtEnd
+ };
+
+ public:
+
+ WildcardPattern( std::string const& pattern, CaseSensitive::Choice caseSensitivity );
+ virtual ~WildcardPattern() = default;
+ virtual bool matches( std::string const& str ) const;
+
+ private:
+ std::string adjustCase( std::string const& str ) const;
+ CaseSensitive::Choice m_caseSensitivity;
+ WildcardPosition m_wildcard = NoWildcard;
+ std::string m_pattern;
+ };
+}
+
+// end catch_wildcard_pattern.h
+#include <string>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ class TestSpec {
+ struct Pattern {
+ virtual ~Pattern();
+ virtual bool matches( TestCaseInfo const& testCase ) const = 0;
+ };
+ using PatternPtr = std::shared_ptr<Pattern>;
+
+ class NamePattern : public Pattern {
+ public:
+ NamePattern( std::string const& name );
+ virtual ~NamePattern();
+ bool matches( TestCaseInfo const& testCase ) const override;
+ private:
+ WildcardPattern m_wildcardPattern;
+ };
+
+ class TagPattern : public Pattern {
+ public:
+ TagPattern( std::string const& tag );
+ virtual ~TagPattern();
+ bool matches( TestCaseInfo const& testCase ) const override;
+ private:
+ std::string m_tag;
+ };
+
+ class ExcludedPattern : public Pattern {
+ public:
+ ExcludedPattern( PatternPtr const& underlyingPattern );
+ virtual ~ExcludedPattern();
+ bool matches( TestCaseInfo const& testCase ) const override;
+ private:
+ PatternPtr m_underlyingPattern;
+ };
+
+ struct Filter {
+ std::vector<PatternPtr> m_patterns;
+
+ bool matches( TestCaseInfo const& testCase ) const;
+ };
+
+ public:
+ bool hasFilters() const;
+ bool matches( TestCaseInfo const& testCase ) const;
+
+ private:
+ std::vector<Filter> m_filters;
+
+ friend class TestSpecParser;
+ };
+}
+
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// end catch_test_spec.h
+// start catch_interfaces_tag_alias_registry.h
+
+#include <string>
+
+namespace Catch {
+
+ struct TagAlias;
+
+ struct ITagAliasRegistry {
+ virtual ~ITagAliasRegistry();
+ // Nullptr if not present
+ virtual TagAlias const* find( std::string const& alias ) const = 0;
+ virtual std::string expandAliases( std::string const& unexpandedTestSpec ) const = 0;
+
+ static ITagAliasRegistry const& get();
+ };
+
+} // end namespace Catch
+
+// end catch_interfaces_tag_alias_registry.h
+namespace Catch {
+
+ class TestSpecParser {
+ enum Mode{ None, Name, QuotedName, Tag, EscapedName };
+ Mode m_mode = None;
+ bool m_exclusion = false;
+ std::size_t m_start = std::string::npos, m_pos = 0;
+ std::string m_arg;
+ std::vector<std::size_t> m_escapeChars;
+ TestSpec::Filter m_currentFilter;
+ TestSpec m_testSpec;
+ ITagAliasRegistry const* m_tagAliases = nullptr;
+
+ public:
+ TestSpecParser( ITagAliasRegistry const& tagAliases );
+
+ TestSpecParser& parse( std::string const& arg );
+ TestSpec testSpec();
+
+ private:
+ void visitChar( char c );
+ void startNewMode( Mode mode, std::size_t start );
+ void escape();
+ std::string subString() const;
+
+ template<typename T>
+ void addPattern() {
+ std::string token = subString();
+ for( std::size_t i = 0; i < m_escapeChars.size(); ++i )
+ token = token.substr( 0, m_escapeChars[i]-m_start-i ) + token.substr( m_escapeChars[i]-m_start-i+1 );
+ m_escapeChars.clear();
+ if( startsWith( token, "exclude:" ) ) {
+ m_exclusion = true;
+ token = token.substr( 8 );
+ }
+ if( !token.empty() ) {
+ TestSpec::PatternPtr pattern = std::make_shared<T>( token );
+ if( m_exclusion )
+ pattern = std::make_shared<TestSpec::ExcludedPattern>( pattern );
+ m_currentFilter.m_patterns.push_back( pattern );
+ }
+ m_exclusion = false;
+ m_mode = None;
+ }
+
+ void addFilter();
+ };
+ TestSpec parseTestSpec( std::string const& arg );
+
+} // namespace Catch
+
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// end catch_test_spec_parser.h
+// Libstdc++ doesn't like incomplete classes for unique_ptr
+
+#include <memory>
+#include <vector>
+#include <string>
+
+#ifndef CATCH_CONFIG_CONSOLE_WIDTH
+#define CATCH_CONFIG_CONSOLE_WIDTH 80
+#endif
+
+namespace Catch {
+
+ struct IStream;
+
+ struct ConfigData {
+ bool listTests = false;
+ bool listTags = false;
+ bool listReporters = false;
+ bool listTestNamesOnly = false;
+
+ bool showSuccessfulTests = false;
+ bool shouldDebugBreak = false;
+ bool noThrow = false;
+ bool showHelp = false;
+ bool showInvisibles = false;
+ bool filenamesAsTags = false;
+ bool libIdentify = false;
+
+ int abortAfter = -1;
+ unsigned int rngSeed = 0;
+
+ bool benchmarkNoAnalysis = false;
+ unsigned int benchmarkSamples = 100;
+ double benchmarkConfidenceInterval = 0.95;
+ unsigned int benchmarkResamples = 100000;
+
+ Verbosity verbosity = Verbosity::Normal;
+ WarnAbout::What warnings = WarnAbout::Nothing;
+ ShowDurations::OrNot showDurations = ShowDurations::DefaultForReporter;
+ RunTests::InWhatOrder runOrder = RunTests::InDeclarationOrder;
+ UseColour::YesOrNo useColour = UseColour::Auto;
+ WaitForKeypress::When waitForKeypress = WaitForKeypress::Never;
+
+ std::string outputFilename;
+ std::string name;
+ std::string processName;
+#ifndef CATCH_CONFIG_DEFAULT_REPORTER
+#define CATCH_CONFIG_DEFAULT_REPORTER "console"
+#endif
+ std::string reporterName = CATCH_CONFIG_DEFAULT_REPORTER;
+#undef CATCH_CONFIG_DEFAULT_REPORTER
+
+ std::vector<std::string> testsOrTags;
+ std::vector<std::string> sectionsToRun;
+ };
+
+ class Config : public IConfig {
+ public:
+
+ Config() = default;
+ Config( ConfigData const& data );
+ virtual ~Config() = default;
+
+ std::string const& getFilename() const;
+
+ bool listTests() const;
+ bool listTestNamesOnly() const;
+ bool listTags() const;
+ bool listReporters() const;
+
+ std::string getProcessName() const;
+ std::string const& getReporterName() const;
+
+ std::vector<std::string> const& getTestsOrTags() const override;
+ std::vector<std::string> const& getSectionsToRun() const override;
+
+ TestSpec const& testSpec() const override;
+ bool hasTestFilters() const override;
+
+ bool showHelp() const;
+
+ // IConfig interface
+ bool allowThrows() const override;
+ std::ostream& stream() const override;
+ std::string name() const override;
+ bool includeSuccessfulResults() const override;
+ bool warnAboutMissingAssertions() const override;
+ bool warnAboutNoTests() const override;
+ ShowDurations::OrNot showDurations() const override;
+ RunTests::InWhatOrder runOrder() const override;
+ unsigned int rngSeed() const override;
+ UseColour::YesOrNo useColour() const override;
+ bool shouldDebugBreak() const override;
+ int abortAfter() const override;
+ bool showInvisibles() const override;
+ Verbosity verbosity() const override;
+ bool benchmarkNoAnalysis() const override;
+ int benchmarkSamples() const override;
+ double benchmarkConfidenceInterval() const override;
+ unsigned int benchmarkResamples() const override;
+
+ private:
+
+ IStream const* openStream();
+ ConfigData m_data;
+
+ std::unique_ptr<IStream const> m_stream;
+ TestSpec m_testSpec;
+ bool m_hasTestFilters = false;
+ };
+
+} // end namespace Catch
+
+// end catch_config.hpp
+// start catch_assertionresult.h
+
+#include <string>
+
+namespace Catch {
+
+ struct AssertionResultData
+ {
+ AssertionResultData() = delete;
+
+ AssertionResultData( ResultWas::OfType _resultType, LazyExpression const& _lazyExpression );
+
+ std::string message;
+ mutable std::string reconstructedExpression;
+ LazyExpression lazyExpression;
+ ResultWas::OfType resultType;
+
+ std::string reconstructExpression() const;
+ };
+
+ class AssertionResult {
+ public:
+ AssertionResult() = delete;
+ AssertionResult( AssertionInfo const& info, AssertionResultData const& data );
+
+ bool isOk() const;
+ bool succeeded() const;
+ ResultWas::OfType getResultType() const;
+ bool hasExpression() const;
+ bool hasMessage() const;
+ std::string getExpression() const;
+ std::string getExpressionInMacro() const;
+ bool hasExpandedExpression() const;
+ std::string getExpandedExpression() const;
+ std::string getMessage() const;
+ SourceLineInfo getSourceInfo() const;
+ StringRef getTestMacroName() const;
+
+ //protected:
+ AssertionInfo m_info;
+ AssertionResultData m_resultData;
+ };
+
+} // end namespace Catch
+
+// end catch_assertionresult.h
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+// start catch_estimate.hpp
+
+ // Statistics estimates
+
+
+namespace Catch {
+ namespace Benchmark {
+ template <typename Duration>
+ struct Estimate {
+ Duration point;
+ Duration lower_bound;
+ Duration upper_bound;
+ double confidence_interval;
+
+ template <typename Duration2>
+ operator Estimate<Duration2>() const {
+ return { point, lower_bound, upper_bound, confidence_interval };
+ }
+ };
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_estimate.hpp
+// start catch_outlier_classification.hpp
+
+// Outlier information
+
+namespace Catch {
+ namespace Benchmark {
+ struct OutlierClassification {
+ int samples_seen = 0;
+ int low_severe = 0; // more than 3 times IQR below Q1
+ int low_mild = 0; // 1.5 to 3 times IQR below Q1
+ int high_mild = 0; // 1.5 to 3 times IQR above Q3
+ int high_severe = 0; // more than 3 times IQR above Q3
+
+ int total() const {
+ return low_severe + low_mild + high_mild + high_severe;
+ }
+ };
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_outlier_classification.hpp
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+#include <string>
+#include <iosfwd>
+#include <map>
+#include <set>
+#include <memory>
+#include <algorithm>
+
+namespace Catch {
+
+ struct ReporterConfig {
+ explicit ReporterConfig( IConfigPtr const& _fullConfig );
+
+ ReporterConfig( IConfigPtr const& _fullConfig, std::ostream& _stream );
+
+ std::ostream& stream() const;
+ IConfigPtr fullConfig() const;
+
+ private:
+ std::ostream* m_stream;
+ IConfigPtr m_fullConfig;
+ };
+
+ struct ReporterPreferences {
+ bool shouldRedirectStdOut = false;
+ bool shouldReportAllAssertions = false;
+ };
+
+ template<typename T>
+ struct LazyStat : Option<T> {
+ LazyStat& operator=( T const& _value ) {
+ Option<T>::operator=( _value );
+ used = false;
+ return *this;
+ }
+ void reset() {
+ Option<T>::reset();
+ used = false;
+ }
+ bool used = false;
+ };
+
+ struct TestRunInfo {
+ TestRunInfo( std::string const& _name );
+ std::string name;
+ };
+ struct GroupInfo {
+ GroupInfo( std::string const& _name,
+ std::size_t _groupIndex,
+ std::size_t _groupsCount );
+
+ std::string name;
+ std::size_t groupIndex;
+ std::size_t groupsCounts;
+ };
+
+ struct AssertionStats {
+ AssertionStats( AssertionResult const& _assertionResult,
+ std::vector<MessageInfo> const& _infoMessages,
+ Totals const& _totals );
+
+ AssertionStats( AssertionStats const& ) = default;
+ AssertionStats( AssertionStats && ) = default;
+ AssertionStats& operator = ( AssertionStats const& ) = delete;
+ AssertionStats& operator = ( AssertionStats && ) = delete;
+ virtual ~AssertionStats();
+
+ AssertionResult assertionResult;
+ std::vector<MessageInfo> infoMessages;
+ Totals totals;
+ };
+
+ struct SectionStats {
+ SectionStats( SectionInfo const& _sectionInfo,
+ Counts const& _assertions,
+ double _durationInSeconds,
+ bool _missingAssertions );
+ SectionStats( SectionStats const& ) = default;
+ SectionStats( SectionStats && ) = default;
+ SectionStats& operator = ( SectionStats const& ) = default;
+ SectionStats& operator = ( SectionStats && ) = default;
+ virtual ~SectionStats();
+
+ SectionInfo sectionInfo;
+ Counts assertions;
+ double durationInSeconds;
+ bool missingAssertions;
+ };
+
+ struct TestCaseStats {
+ TestCaseStats( TestCaseInfo const& _testInfo,
+ Totals const& _totals,
+ std::string const& _stdOut,
+ std::string const& _stdErr,
+ bool _aborting );
+
+ TestCaseStats( TestCaseStats const& ) = default;
+ TestCaseStats( TestCaseStats && ) = default;
+ TestCaseStats& operator = ( TestCaseStats const& ) = default;
+ TestCaseStats& operator = ( TestCaseStats && ) = default;
+ virtual ~TestCaseStats();
+
+ TestCaseInfo testInfo;
+ Totals totals;
+ std::string stdOut;
+ std::string stdErr;
+ bool aborting;
+ };
+
+ struct TestGroupStats {
+ TestGroupStats( GroupInfo const& _groupInfo,
+ Totals const& _totals,
+ bool _aborting );
+ TestGroupStats( GroupInfo const& _groupInfo );
+
+ TestGroupStats( TestGroupStats const& ) = default;
+ TestGroupStats( TestGroupStats && ) = default;
+ TestGroupStats& operator = ( TestGroupStats const& ) = default;
+ TestGroupStats& operator = ( TestGroupStats && ) = default;
+ virtual ~TestGroupStats();
+
+ GroupInfo groupInfo;
+ Totals totals;
+ bool aborting;
+ };
+
+ struct TestRunStats {
+ TestRunStats( TestRunInfo const& _runInfo,
+ Totals const& _totals,
+ bool _aborting );
+
+ TestRunStats( TestRunStats const& ) = default;
+ TestRunStats( TestRunStats && ) = default;
+ TestRunStats& operator = ( TestRunStats const& ) = default;
+ TestRunStats& operator = ( TestRunStats && ) = default;
+ virtual ~TestRunStats();
+
+ TestRunInfo runInfo;
+ Totals totals;
+ bool aborting;
+ };
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ struct BenchmarkInfo {
+ std::string name;
+ double estimatedDuration;
+ int iterations;
+ int samples;
+ unsigned int resamples;
+ double clockResolution;
+ double clockCost;
+ };
+
+ template <class Duration>
+ struct BenchmarkStats {
+ BenchmarkInfo info;
+
+ std::vector<Duration> samples;
+ Benchmark::Estimate<Duration> mean;
+ Benchmark::Estimate<Duration> standardDeviation;
+ Benchmark::OutlierClassification outliers;
+ double outlierVariance;
+
+ template <typename Duration2>
+ operator BenchmarkStats<Duration2>() const {
+ std::vector<Duration2> samples2;
+ samples2.reserve(samples.size());
+ std::transform(samples.begin(), samples.end(), std::back_inserter(samples2), [](Duration d) { return Duration2(d); });
+ return {
+ info,
+ std::move(samples2),
+ mean,
+ standardDeviation,
+ outliers,
+ outlierVariance,
+ };
+ }
+ };
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ struct IStreamingReporter {
+ virtual ~IStreamingReporter() = default;
+
+ // Implementing class must also provide the following static methods:
+ // static std::string getDescription();
+ // static std::set<Verbosity> getSupportedVerbosities()
+
+ virtual ReporterPreferences getPreferences() const = 0;
+
+ virtual void noMatchingTestCases( std::string const& spec ) = 0;
+
+ virtual void testRunStarting( TestRunInfo const& testRunInfo ) = 0;
+ virtual void testGroupStarting( GroupInfo const& groupInfo ) = 0;
+
+ virtual void testCaseStarting( TestCaseInfo const& testInfo ) = 0;
+ virtual void sectionStarting( SectionInfo const& sectionInfo ) = 0;
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ virtual void benchmarkPreparing( std::string const& ) {}
+ virtual void benchmarkStarting( BenchmarkInfo const& ) {}
+ virtual void benchmarkEnded( BenchmarkStats<> const& ) {}
+ virtual void benchmarkFailed( std::string const& ) {}
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ virtual void assertionStarting( AssertionInfo const& assertionInfo ) = 0;
+
+ // The return value indicates if the messages buffer should be cleared:
+ virtual bool assertionEnded( AssertionStats const& assertionStats ) = 0;
+
+ virtual void sectionEnded( SectionStats const& sectionStats ) = 0;
+ virtual void testCaseEnded( TestCaseStats const& testCaseStats ) = 0;
+ virtual void testGroupEnded( TestGroupStats const& testGroupStats ) = 0;
+ virtual void testRunEnded( TestRunStats const& testRunStats ) = 0;
+
+ virtual void skipTest( TestCaseInfo const& testInfo ) = 0;
+
+ // Default empty implementation provided
+ virtual void fatalErrorEncountered( StringRef name );
+
+ virtual bool isMulti() const;
+ };
+ using IStreamingReporterPtr = std::unique_ptr<IStreamingReporter>;
+
+ struct IReporterFactory {
+ virtual ~IReporterFactory();
+ virtual IStreamingReporterPtr create( ReporterConfig const& config ) const = 0;
+ virtual std::string getDescription() const = 0;
+ };
+ using IReporterFactoryPtr = std::shared_ptr<IReporterFactory>;
+
+ struct IReporterRegistry {
+ using FactoryMap = std::map<std::string, IReporterFactoryPtr>;
+ using Listeners = std::vector<IReporterFactoryPtr>;
+
+ virtual ~IReporterRegistry();
+ virtual IStreamingReporterPtr create( std::string const& name, IConfigPtr const& config ) const = 0;
+ virtual FactoryMap const& getFactories() const = 0;
+ virtual Listeners const& getListeners() const = 0;
+ };
+
+} // end namespace Catch
+
+// end catch_interfaces_reporter.h
+#include <algorithm>
+#include <cstring>
+#include <cfloat>
+#include <cstdio>
+#include <cassert>
+#include <memory>
+#include <ostream>
+
+namespace Catch {
+ void prepareExpandedExpression(AssertionResult& result);
+
+ // Returns double formatted as %.3f (format expected on output)
+ std::string getFormattedDuration( double duration );
+
+ std::string serializeFilters( std::vector<std::string> const& container );
+
+ template<typename DerivedT>
+ struct StreamingReporterBase : IStreamingReporter {
+
+ StreamingReporterBase( ReporterConfig const& _config )
+ : m_config( _config.fullConfig() ),
+ stream( _config.stream() )
+ {
+ m_reporterPrefs.shouldRedirectStdOut = false;
+ if( !DerivedT::getSupportedVerbosities().count( m_config->verbosity() ) )
+ CATCH_ERROR( "Verbosity level not supported by this reporter" );
+ }
+
+ ReporterPreferences getPreferences() const override {
+ return m_reporterPrefs;
+ }
+
+ static std::set<Verbosity> getSupportedVerbosities() {
+ return { Verbosity::Normal };
+ }
+
+ ~StreamingReporterBase() override = default;
+
+ void noMatchingTestCases(std::string const&) override {}
+
+ void testRunStarting(TestRunInfo const& _testRunInfo) override {
+ currentTestRunInfo = _testRunInfo;
+ }
+
+ void testGroupStarting(GroupInfo const& _groupInfo) override {
+ currentGroupInfo = _groupInfo;
+ }
+
+ void testCaseStarting(TestCaseInfo const& _testInfo) override {
+ currentTestCaseInfo = _testInfo;
+ }
+ void sectionStarting(SectionInfo const& _sectionInfo) override {
+ m_sectionStack.push_back(_sectionInfo);
+ }
+
+ void sectionEnded(SectionStats const& /* _sectionStats */) override {
+ m_sectionStack.pop_back();
+ }
+ void testCaseEnded(TestCaseStats const& /* _testCaseStats */) override {
+ currentTestCaseInfo.reset();
+ }
+ void testGroupEnded(TestGroupStats const& /* _testGroupStats */) override {
+ currentGroupInfo.reset();
+ }
+ void testRunEnded(TestRunStats const& /* _testRunStats */) override {
+ currentTestCaseInfo.reset();
+ currentGroupInfo.reset();
+ currentTestRunInfo.reset();
+ }
+
+ void skipTest(TestCaseInfo const&) override {
+ // Don't do anything with this by default.
+ // It can optionally be overridden in the derived class.
+ }
+
+ IConfigPtr m_config;
+ std::ostream& stream;
+
+ LazyStat<TestRunInfo> currentTestRunInfo;
+ LazyStat<GroupInfo> currentGroupInfo;
+ LazyStat<TestCaseInfo> currentTestCaseInfo;
+
+ std::vector<SectionInfo> m_sectionStack;
+ ReporterPreferences m_reporterPrefs;
+ };
+
+ template<typename DerivedT>
+ struct CumulativeReporterBase : IStreamingReporter {
+ template<typename T, typename ChildNodeT>
+ struct Node {
+ explicit Node( T const& _value ) : value( _value ) {}
+ virtual ~Node() {}
+
+ using ChildNodes = std::vector<std::shared_ptr<ChildNodeT>>;
+ T value;
+ ChildNodes children;
+ };
+ struct SectionNode {
+ explicit SectionNode(SectionStats const& _stats) : stats(_stats) {}
+ virtual ~SectionNode() = default;
+
+ bool operator == (SectionNode const& other) const {
+ return stats.sectionInfo.lineInfo == other.stats.sectionInfo.lineInfo;
+ }
+ bool operator == (std::shared_ptr<SectionNode> const& other) const {
+ return operator==(*other);
+ }
+
+ SectionStats stats;
+ using ChildSections = std::vector<std::shared_ptr<SectionNode>>;
+ using Assertions = std::vector<AssertionStats>;
+ ChildSections childSections;
+ Assertions assertions;
+ std::string stdOut;
+ std::string stdErr;
+ };
+
+ struct BySectionInfo {
+ BySectionInfo( SectionInfo const& other ) : m_other( other ) {}
+ BySectionInfo( BySectionInfo const& other ) : m_other( other.m_other ) {}
+ bool operator() (std::shared_ptr<SectionNode> const& node) const {
+ return ((node->stats.sectionInfo.name == m_other.name) &&
+ (node->stats.sectionInfo.lineInfo == m_other.lineInfo));
+ }
+ void operator=(BySectionInfo const&) = delete;
+
+ private:
+ SectionInfo const& m_other;
+ };
+
+ using TestCaseNode = Node<TestCaseStats, SectionNode>;
+ using TestGroupNode = Node<TestGroupStats, TestCaseNode>;
+ using TestRunNode = Node<TestRunStats, TestGroupNode>;
+
+ CumulativeReporterBase( ReporterConfig const& _config )
+ : m_config( _config.fullConfig() ),
+ stream( _config.stream() )
+ {
+ m_reporterPrefs.shouldRedirectStdOut = false;
+ if( !DerivedT::getSupportedVerbosities().count( m_config->verbosity() ) )
+ CATCH_ERROR( "Verbosity level not supported by this reporter" );
+ }
+ ~CumulativeReporterBase() override = default;
+
+ ReporterPreferences getPreferences() const override {
+ return m_reporterPrefs;
+ }
+
+ static std::set<Verbosity> getSupportedVerbosities() {
+ return { Verbosity::Normal };
+ }
+
+ void testRunStarting( TestRunInfo const& ) override {}
+ void testGroupStarting( GroupInfo const& ) override {}
+
+ void testCaseStarting( TestCaseInfo const& ) override {}
+
+ void sectionStarting( SectionInfo const& sectionInfo ) override {
+ SectionStats incompleteStats( sectionInfo, Counts(), 0, false );
+ std::shared_ptr<SectionNode> node;
+ if( m_sectionStack.empty() ) {
+ if( !m_rootSection )
+ m_rootSection = std::make_shared<SectionNode>( incompleteStats );
+ node = m_rootSection;
+ }
+ else {
+ SectionNode& parentNode = *m_sectionStack.back();
+ auto it =
+ std::find_if( parentNode.childSections.begin(),
+ parentNode.childSections.end(),
+ BySectionInfo( sectionInfo ) );
+ if( it == parentNode.childSections.end() ) {
+ node = std::make_shared<SectionNode>( incompleteStats );
+ parentNode.childSections.push_back( node );
+ }
+ else
+ node = *it;
+ }
+ m_sectionStack.push_back( node );
+ m_deepestSection = std::move(node);
+ }
+
+ void assertionStarting(AssertionInfo const&) override {}
+
+ bool assertionEnded(AssertionStats const& assertionStats) override {
+ assert(!m_sectionStack.empty());
+ // AssertionResult holds a pointer to a temporary DecomposedExpression,
+ // which getExpandedExpression() calls to build the expression string.
+ // Our section stack copy of the assertionResult will likely outlive the
+ // temporary, so it must be expanded or discarded now to avoid calling
+ // a destroyed object later.
+ prepareExpandedExpression(const_cast<AssertionResult&>( assertionStats.assertionResult ) );
+ SectionNode& sectionNode = *m_sectionStack.back();
+ sectionNode.assertions.push_back(assertionStats);
+ return true;
+ }
+ void sectionEnded(SectionStats const& sectionStats) override {
+ assert(!m_sectionStack.empty());
+ SectionNode& node = *m_sectionStack.back();
+ node.stats = sectionStats;
+ m_sectionStack.pop_back();
+ }
+ void testCaseEnded(TestCaseStats const& testCaseStats) override {
+ auto node = std::make_shared<TestCaseNode>(testCaseStats);
+ assert(m_sectionStack.size() == 0);
+ node->children.push_back(m_rootSection);
+ m_testCases.push_back(node);
+ m_rootSection.reset();
+
+ assert(m_deepestSection);
+ m_deepestSection->stdOut = testCaseStats.stdOut;
+ m_deepestSection->stdErr = testCaseStats.stdErr;
+ }
+ void testGroupEnded(TestGroupStats const& testGroupStats) override {
+ auto node = std::make_shared<TestGroupNode>(testGroupStats);
+ node->children.swap(m_testCases);
+ m_testGroups.push_back(node);
+ }
+ void testRunEnded(TestRunStats const& testRunStats) override {
+ auto node = std::make_shared<TestRunNode>(testRunStats);
+ node->children.swap(m_testGroups);
+ m_testRuns.push_back(node);
+ testRunEndedCumulative();
+ }
+ virtual void testRunEndedCumulative() = 0;
+
+ void skipTest(TestCaseInfo const&) override {}
+
+ IConfigPtr m_config;
+ std::ostream& stream;
+ std::vector<AssertionStats> m_assertions;
+ std::vector<std::vector<std::shared_ptr<SectionNode>>> m_sections;
+ std::vector<std::shared_ptr<TestCaseNode>> m_testCases;
+ std::vector<std::shared_ptr<TestGroupNode>> m_testGroups;
+
+ std::vector<std::shared_ptr<TestRunNode>> m_testRuns;
+
+ std::shared_ptr<SectionNode> m_rootSection;
+ std::shared_ptr<SectionNode> m_deepestSection;
+ std::vector<std::shared_ptr<SectionNode>> m_sectionStack;
+ ReporterPreferences m_reporterPrefs;
+ };
+
+ template<char C>
+ char const* getLineOfChars() {
+ static char line[CATCH_CONFIG_CONSOLE_WIDTH] = {0};
+ if( !*line ) {
+ std::memset( line, C, CATCH_CONFIG_CONSOLE_WIDTH-1 );
+ line[CATCH_CONFIG_CONSOLE_WIDTH-1] = 0;
+ }
+ return line;
+ }
+
+ struct TestEventListenerBase : StreamingReporterBase<TestEventListenerBase> {
+ TestEventListenerBase( ReporterConfig const& _config );
+
+ static std::set<Verbosity> getSupportedVerbosities();
+
+ void assertionStarting(AssertionInfo const&) override;
+ bool assertionEnded(AssertionStats const&) override;
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_bases.hpp
+// start catch_console_colour.h
+
+namespace Catch {
+
+ struct Colour {
+ enum Code {
+ None = 0,
+
+ White,
+ Red,
+ Green,
+ Blue,
+ Cyan,
+ Yellow,
+ Grey,
+
+ Bright = 0x10,
+
+ BrightRed = Bright | Red,
+ BrightGreen = Bright | Green,
+ LightGrey = Bright | Grey,
+ BrightWhite = Bright | White,
+ BrightYellow = Bright | Yellow,
+
+ // By intention
+ FileName = LightGrey,
+ Warning = BrightYellow,
+ ResultError = BrightRed,
+ ResultSuccess = BrightGreen,
+ ResultExpectedFailure = Warning,
+
+ Error = BrightRed,
+ Success = Green,
+
+ OriginalExpression = Cyan,
+ ReconstructedExpression = BrightYellow,
+
+ SecondaryText = LightGrey,
+ Headers = White
+ };
+
+ // Use constructed object for RAII guard
+ Colour( Code _colourCode );
+ Colour( Colour&& other ) noexcept;
+ Colour& operator=( Colour&& other ) noexcept;
+ ~Colour();
+
+ // Use static method for one-shot changes
+ static void use( Code _colourCode );
+
+ private:
+ bool m_moved = false;
+ };
+
+ std::ostream& operator << ( std::ostream& os, Colour const& );
+
+} // end namespace Catch
+
+// end catch_console_colour.h
+// start catch_reporter_registrars.hpp
+
+
+namespace Catch {
+
+ template<typename T>
+ class ReporterRegistrar {
+
+ class ReporterFactory : public IReporterFactory {
+
+ IStreamingReporterPtr create( ReporterConfig const& config ) const override {
+ return std::unique_ptr<T>( new T( config ) );
+ }
+
+ std::string getDescription() const override {
+ return T::getDescription();
+ }
+ };
+
+ public:
+
+ explicit ReporterRegistrar( std::string const& name ) {
+ getMutableRegistryHub().registerReporter( name, std::make_shared<ReporterFactory>() );
+ }
+ };
+
+ template<typename T>
+ class ListenerRegistrar {
+
+ class ListenerFactory : public IReporterFactory {
+
+ IStreamingReporterPtr create( ReporterConfig const& config ) const override {
+ return std::unique_ptr<T>( new T( config ) );
+ }
+ std::string getDescription() const override {
+ return std::string();
+ }
+ };
+
+ public:
+
+ ListenerRegistrar() {
+ getMutableRegistryHub().registerListener( std::make_shared<ListenerFactory>() );
+ }
+ };
+}
+
+#if !defined(CATCH_CONFIG_DISABLE)
+
+#define CATCH_REGISTER_REPORTER( name, reporterType ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::ReporterRegistrar<reporterType> catch_internal_RegistrarFor##reporterType( name ); } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+
+#define CATCH_REGISTER_LISTENER( listenerType ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::ListenerRegistrar<listenerType> catch_internal_RegistrarFor##listenerType; } \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS
+#else // CATCH_CONFIG_DISABLE
+
+#define CATCH_REGISTER_REPORTER(name, reporterType)
+#define CATCH_REGISTER_LISTENER(listenerType)
+
+#endif // CATCH_CONFIG_DISABLE
+
+// end catch_reporter_registrars.hpp
+// Allow users to base their work off existing reporters
+// start catch_reporter_compact.h
+
+namespace Catch {
+
+ struct CompactReporter : StreamingReporterBase<CompactReporter> {
+
+ using StreamingReporterBase::StreamingReporterBase;
+
+ ~CompactReporter() override;
+
+ static std::string getDescription();
+
+ ReporterPreferences getPreferences() const override;
+
+ void noMatchingTestCases(std::string const& spec) override;
+
+ void assertionStarting(AssertionInfo const&) override;
+
+ bool assertionEnded(AssertionStats const& _assertionStats) override;
+
+ void sectionEnded(SectionStats const& _sectionStats) override;
+
+ void testRunEnded(TestRunStats const& _testRunStats) override;
+
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_compact.h
+// start catch_reporter_console.h
+
+#if defined(_MSC_VER)
+#pragma warning(push)
+#pragma warning(disable:4061) // Not all labels are EXPLICITLY handled in switch
+ // Note that 4062 (not all labels are handled
+ // and default is missing) is enabled
+#endif
+
+namespace Catch {
+ // Fwd decls
+ struct SummaryColumn;
+ class TablePrinter;
+
+ struct ConsoleReporter : StreamingReporterBase<ConsoleReporter> {
+ std::unique_ptr<TablePrinter> m_tablePrinter;
+
+ ConsoleReporter(ReporterConfig const& config);
+ ~ConsoleReporter() override;
+ static std::string getDescription();
+
+ void noMatchingTestCases(std::string const& spec) override;
+
+ void assertionStarting(AssertionInfo const&) override;
+
+ bool assertionEnded(AssertionStats const& _assertionStats) override;
+
+ void sectionStarting(SectionInfo const& _sectionInfo) override;
+ void sectionEnded(SectionStats const& _sectionStats) override;
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ void benchmarkPreparing(std::string const& name) override;
+ void benchmarkStarting(BenchmarkInfo const& info) override;
+ void benchmarkEnded(BenchmarkStats<> const& stats) override;
+ void benchmarkFailed(std::string const& error) override;
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ void testCaseEnded(TestCaseStats const& _testCaseStats) override;
+ void testGroupEnded(TestGroupStats const& _testGroupStats) override;
+ void testRunEnded(TestRunStats const& _testRunStats) override;
+ void testRunStarting(TestRunInfo const& _testRunInfo) override;
+ private:
+
+ void lazyPrint();
+
+ void lazyPrintWithoutClosingBenchmarkTable();
+ void lazyPrintRunInfo();
+ void lazyPrintGroupInfo();
+ void printTestCaseAndSectionHeader();
+
+ void printClosedHeader(std::string const& _name);
+ void printOpenHeader(std::string const& _name);
+
+ // if string has a : in first line will set indent to follow it on
+ // subsequent lines
+ void printHeaderString(std::string const& _string, std::size_t indent = 0);
+
+ void printTotals(Totals const& totals);
+ void printSummaryRow(std::string const& label, std::vector<SummaryColumn> const& cols, std::size_t row);
+
+ void printTotalsDivider(Totals const& totals);
+ void printSummaryDivider();
+ void printTestFilters();
+
+ private:
+ bool m_headerPrinted = false;
+ };
+
+} // end namespace Catch
+
+#if defined(_MSC_VER)
+#pragma warning(pop)
+#endif
+
+// end catch_reporter_console.h
+// start catch_reporter_junit.h
+
+// start catch_xmlwriter.h
+
+#include <vector>
+
+namespace Catch {
+
+ class XmlEncode {
+ public:
+ enum ForWhat { ForTextNodes, ForAttributes };
+
+ XmlEncode( std::string const& str, ForWhat forWhat = ForTextNodes );
+
+ void encodeTo( std::ostream& os ) const;
+
+ friend std::ostream& operator << ( std::ostream& os, XmlEncode const& xmlEncode );
+
+ private:
+ std::string m_str;
+ ForWhat m_forWhat;
+ };
+
+ class XmlWriter {
+ public:
+
+ class ScopedElement {
+ public:
+ ScopedElement( XmlWriter* writer );
+
+ ScopedElement( ScopedElement&& other ) noexcept;
+ ScopedElement& operator=( ScopedElement&& other ) noexcept;
+
+ ~ScopedElement();
+
+ ScopedElement& writeText( std::string const& text, bool indent = true );
+
+ template<typename T>
+ ScopedElement& writeAttribute( std::string const& name, T const& attribute ) {
+ m_writer->writeAttribute( name, attribute );
+ return *this;
+ }
+
+ private:
+ mutable XmlWriter* m_writer = nullptr;
+ };
+
+ XmlWriter( std::ostream& os = Catch::cout() );
+ ~XmlWriter();
+
+ XmlWriter( XmlWriter const& ) = delete;
+ XmlWriter& operator=( XmlWriter const& ) = delete;
+
+ XmlWriter& startElement( std::string const& name );
+
+ ScopedElement scopedElement( std::string const& name );
+
+ XmlWriter& endElement();
+
+ XmlWriter& writeAttribute( std::string const& name, std::string const& attribute );
+
+ XmlWriter& writeAttribute( std::string const& name, bool attribute );
+
+ template<typename T>
+ XmlWriter& writeAttribute( std::string const& name, T const& attribute ) {
+ ReusableStringStream rss;
+ rss << attribute;
+ return writeAttribute( name, rss.str() );
+ }
+
+ XmlWriter& writeText( std::string const& text, bool indent = true );
+
+ XmlWriter& writeComment( std::string const& text );
+
+ void writeStylesheetRef( std::string const& url );
+
+ XmlWriter& writeBlankLine();
+
+ void ensureTagClosed();
+
+ private:
+
+ void writeDeclaration();
+
+ void newlineIfNecessary();
+
+ bool m_tagIsOpen = false;
+ bool m_needsNewline = false;
+ std::vector<std::string> m_tags;
+ std::string m_indent;
+ std::ostream& m_os;
+ };
+
+}
+
+// end catch_xmlwriter.h
+namespace Catch {
+
+ class JunitReporter : public CumulativeReporterBase<JunitReporter> {
+ public:
+ JunitReporter(ReporterConfig const& _config);
+
+ ~JunitReporter() override;
+
+ static std::string getDescription();
+
+ void noMatchingTestCases(std::string const& /*spec*/) override;
+
+ void testRunStarting(TestRunInfo const& runInfo) override;
+
+ void testGroupStarting(GroupInfo const& groupInfo) override;
+
+ void testCaseStarting(TestCaseInfo const& testCaseInfo) override;
+ bool assertionEnded(AssertionStats const& assertionStats) override;
+
+ void testCaseEnded(TestCaseStats const& testCaseStats) override;
+
+ void testGroupEnded(TestGroupStats const& testGroupStats) override;
+
+ void testRunEndedCumulative() override;
+
+ void writeGroup(TestGroupNode const& groupNode, double suiteTime);
+
+ void writeTestCase(TestCaseNode const& testCaseNode);
+
+ void writeSection(std::string const& className,
+ std::string const& rootName,
+ SectionNode const& sectionNode);
+
+ void writeAssertions(SectionNode const& sectionNode);
+ void writeAssertion(AssertionStats const& stats);
+
+ XmlWriter xml;
+ Timer suiteTimer;
+ std::string stdOutForSuite;
+ std::string stdErrForSuite;
+ unsigned int unexpectedExceptions = 0;
+ bool m_okToFail = false;
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_junit.h
+// start catch_reporter_xml.h
+
+namespace Catch {
+ class XmlReporter : public StreamingReporterBase<XmlReporter> {
+ public:
+ XmlReporter(ReporterConfig const& _config);
+
+ ~XmlReporter() override;
+
+ static std::string getDescription();
+
+ virtual std::string getStylesheetRef() const;
+
+ void writeSourceInfo(SourceLineInfo const& sourceInfo);
+
+ public: // StreamingReporterBase
+
+ void noMatchingTestCases(std::string const& s) override;
+
+ void testRunStarting(TestRunInfo const& testInfo) override;
+
+ void testGroupStarting(GroupInfo const& groupInfo) override;
+
+ void testCaseStarting(TestCaseInfo const& testInfo) override;
+
+ void sectionStarting(SectionInfo const& sectionInfo) override;
+
+ void assertionStarting(AssertionInfo const&) override;
+
+ bool assertionEnded(AssertionStats const& assertionStats) override;
+
+ void sectionEnded(SectionStats const& sectionStats) override;
+
+ void testCaseEnded(TestCaseStats const& testCaseStats) override;
+
+ void testGroupEnded(TestGroupStats const& testGroupStats) override;
+
+ void testRunEnded(TestRunStats const& testRunStats) override;
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ void benchmarkStarting(BenchmarkInfo const&) override;
+ void benchmarkEnded(BenchmarkStats<> const&) override;
+ void benchmarkFailed(std::string const&) override;
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ private:
+ Timer m_testCaseTimer;
+ XmlWriter m_xml;
+ int m_sectionDepth = 0;
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_xml.h
+
+// end catch_external_interfaces.h
+#endif
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+// start catch_benchmark.hpp
+
+ // Benchmark
+
+// start catch_chronometer.hpp
+
+// User-facing chronometer
+
+
+// start catch_clock.hpp
+
+// Clocks
+
+
+#include <chrono>
+#include <ratio>
+
+namespace Catch {
+ namespace Benchmark {
+ template <typename Clock>
+ using ClockDuration = typename Clock::duration;
+ template <typename Clock>
+ using FloatDuration = std::chrono::duration<double, typename Clock::period>;
+
+ template <typename Clock>
+ using TimePoint = typename Clock::time_point;
+
+ using default_clock = std::chrono::steady_clock;
+
+ template <typename Clock>
+ struct now {
+ TimePoint<Clock> operator()() const {
+ return Clock::now();
+ }
+ };
+
+ using fp_seconds = std::chrono::duration<double, std::ratio<1>>;
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_clock.hpp
+// start catch_optimizer.hpp
+
+ // Hinting the optimizer
+
+
+#if defined(_MSC_VER)
+# include <atomic> // atomic_thread_fence
+#endif
+
+namespace Catch {
+ namespace Benchmark {
+#if defined(__GNUC__) || defined(__clang__)
+ template <typename T>
+ inline void keep_memory(T* p) {
+ asm volatile("" : : "g"(p) : "memory");
+ }
+ inline void keep_memory() {
+ asm volatile("" : : : "memory");
+ }
+
+ namespace Detail {
+ inline void optimizer_barrier() { keep_memory(); }
+ } // namespace Detail
+#elif defined(_MSC_VER)
+
+#pragma optimize("", off)
+ template <typename T>
+ inline void keep_memory(T* p) {
+ // thanks @milleniumbug
+ *reinterpret_cast<char volatile*>(p) = *reinterpret_cast<char const volatile*>(p);
+ }
+ // TODO equivalent keep_memory()
+#pragma optimize("", on)
+
+ namespace Detail {
+ inline void optimizer_barrier() {
+ std::atomic_thread_fence(std::memory_order_seq_cst);
+ }
+ } // namespace Detail
+
+#endif
+
+ template <typename T>
+ inline void deoptimize_value(T&& x) {
+ keep_memory(&x);
+ }
+
+ template <typename Fn, typename... Args>
+ inline auto invoke_deoptimized(Fn&& fn, Args&&... args) -> typename std::enable_if<!std::is_same<void, decltype(fn(args...))>::value>::type {
+ deoptimize_value(std::forward<Fn>(fn) (std::forward<Args...>(args...)));
+ }
+
+ template <typename Fn, typename... Args>
+ inline auto invoke_deoptimized(Fn&& fn, Args&&... args) -> typename std::enable_if<std::is_same<void, decltype(fn(args...))>::value>::type {
+ std::forward<Fn>(fn) (std::forward<Args...>(args...));
+ }
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_optimizer.hpp
+// start catch_complete_invoke.hpp
+
+// Invoke with a special case for void
+
+
+#include <type_traits>
+#include <utility>
+
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+ template <typename T>
+ struct CompleteType { using type = T; };
+ template <>
+ struct CompleteType<void> { struct type {}; };
+
+ template <typename T>
+ using CompleteType_t = typename CompleteType<T>::type;
+
+ template <typename Result>
+ struct CompleteInvoker {
+ template <typename Fun, typename... Args>
+ static Result invoke(Fun&& fun, Args&&... args) {
+ return std::forward<Fun>(fun)(std::forward<Args>(args)...);
+ }
+ };
+ template <>
+ struct CompleteInvoker<void> {
+ template <typename Fun, typename... Args>
+ static CompleteType_t<void> invoke(Fun&& fun, Args&&... args) {
+ std::forward<Fun>(fun)(std::forward<Args>(args)...);
+ return {};
+ }
+ };
+ template <typename Sig>
+ using ResultOf_t = typename std::result_of<Sig>::type;
+
+ // invoke and not return void :(
+ template <typename Fun, typename... Args>
+ CompleteType_t<ResultOf_t<Fun(Args...)>> complete_invoke(Fun&& fun, Args&&... args) {
+ return CompleteInvoker<ResultOf_t<Fun(Args...)>>::invoke(std::forward<Fun>(fun), std::forward<Args>(args)...);
+ }
+
+ const std::string benchmarkErrorMsg = "a benchmark failed to run successfully";
+ } // namespace Detail
+
+ template <typename Fun>
+ Detail::CompleteType_t<Detail::ResultOf_t<Fun()>> user_code(Fun&& fun) {
+ CATCH_TRY{
+ return Detail::complete_invoke(std::forward<Fun>(fun));
+ } CATCH_CATCH_ALL{
+ getResultCapture().benchmarkFailed(translateActiveException());
+ CATCH_RUNTIME_ERROR(Detail::benchmarkErrorMsg);
+ }
+ }
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_complete_invoke.hpp
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+ struct ChronometerConcept {
+ virtual void start() = 0;
+ virtual void finish() = 0;
+ virtual ~ChronometerConcept() = default;
+ };
+ template <typename Clock>
+ struct ChronometerModel final : public ChronometerConcept {
+ void start() override { started = Clock::now(); }
+ void finish() override { finished = Clock::now(); }
+
+ ClockDuration<Clock> elapsed() const { return finished - started; }
+
+ TimePoint<Clock> started;
+ TimePoint<Clock> finished;
+ };
+ } // namespace Detail
+
+ struct Chronometer {
+ public:
+ template <typename Fun>
+ void measure(Fun&& fun) { measure(std::forward<Fun>(fun), is_callable<Fun(int)>()); }
+
+ int runs() const { return k; }
+
+ Chronometer(Detail::ChronometerConcept& meter, int k)
+ : impl(&meter)
+ , k(k) {}
+
+ private:
+ template <typename Fun>
+ void measure(Fun&& fun, std::false_type) {
+ measure([&fun](int) { return fun(); }, std::true_type());
+ }
+
+ template <typename Fun>
+ void measure(Fun&& fun, std::true_type) {
+ Detail::optimizer_barrier();
+ impl->start();
+ for (int i = 0; i < k; ++i) invoke_deoptimized(fun, i);
+ impl->finish();
+ Detail::optimizer_barrier();
+ }
+
+ Detail::ChronometerConcept* impl;
+ int k;
+ };
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_chronometer.hpp
+// start catch_environment.hpp
+
+// Environment information
+
+
+namespace Catch {
+ namespace Benchmark {
+ template <typename Duration>
+ struct EnvironmentEstimate {
+ Duration mean;
+ OutlierClassification outliers;
+
+ template <typename Duration2>
+ operator EnvironmentEstimate<Duration2>() const {
+ return { mean, outliers };
+ }
+ };
+ template <typename Clock>
+ struct Environment {
+ using clock_type = Clock;
+ EnvironmentEstimate<FloatDuration<Clock>> clock_resolution;
+ EnvironmentEstimate<FloatDuration<Clock>> clock_cost;
+ };
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_environment.hpp
+// start catch_execution_plan.hpp
+
+ // Execution plan
+
+
+// start catch_benchmark_function.hpp
+
+ // Dumb std::function implementation for consistent call overhead
+
+
+#include <cassert>
+#include <type_traits>
+#include <utility>
+#include <memory>
+
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+ template <typename T>
+ using Decay = typename std::decay<T>::type;
+ template <typename T, typename U>
+ struct is_related
+ : std::is_same<Decay<T>, Decay<U>> {};
+
+ /// We need to reinvent std::function because every piece of code that might add overhead
+ /// in a measurement context needs to have consistent performance characteristics so that we
+ /// can account for it in the measurement.
+ /// Implementations of std::function with optimizations that aren't always applicable, like
+ /// small buffer optimizations, are not uncommon.
+ /// This is effectively an implementation of std::function without any such optimizations;
+ /// it may be slow, but it is consistently slow.
+ struct BenchmarkFunction {
+ private:
+ struct callable {
+ virtual void call(Chronometer meter) const = 0;
+ virtual callable* clone() const = 0;
+ virtual ~callable() = default;
+ };
+ template <typename Fun>
+ struct model : public callable {
+ model(Fun&& fun) : fun(std::move(fun)) {}
+ model(Fun const& fun) : fun(fun) {}
+
+ model<Fun>* clone() const override { return new model<Fun>(*this); }
+
+ void call(Chronometer meter) const override {
+ call(meter, is_callable<Fun(Chronometer)>());
+ }
+ void call(Chronometer meter, std::true_type) const {
+ fun(meter);
+ }
+ void call(Chronometer meter, std::false_type) const {
+ meter.measure(fun);
+ }
+
+ Fun fun;
+ };
+
+ struct do_nothing { void operator()() const {} };
+
+ template <typename T>
+ BenchmarkFunction(model<T>* c) : f(c) {}
+
+ public:
+ BenchmarkFunction()
+ : f(new model<do_nothing>{ {} }) {}
+
+ template <typename Fun,
+ typename std::enable_if<!is_related<Fun, BenchmarkFunction>::value, int>::type = 0>
+ BenchmarkFunction(Fun&& fun)
+ : f(new model<typename std::decay<Fun>::type>(std::forward<Fun>(fun))) {}
+
+ BenchmarkFunction(BenchmarkFunction&& that)
+ : f(std::move(that.f)) {}
+
+ BenchmarkFunction(BenchmarkFunction const& that)
+ : f(that.f->clone()) {}
+
+ BenchmarkFunction& operator=(BenchmarkFunction&& that) {
+ f = std::move(that.f);
+ return *this;
+ }
+
+ BenchmarkFunction& operator=(BenchmarkFunction const& that) {
+ f.reset(that.f->clone());
+ return *this;
+ }
+
+ void operator()(Chronometer meter) const { f->call(meter); }
+
+ private:
+ std::unique_ptr<callable> f;
+ };
+ } // namespace Detail
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_benchmark_function.hpp
+// start catch_repeat.hpp
+
+// repeat algorithm
+
+
+#include <type_traits>
+#include <utility>
+
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+ template <typename Fun>
+ struct repeater {
+ void operator()(int k) const {
+ for (int i = 0; i < k; ++i) {
+ fun();
+ }
+ }
+ Fun fun;
+ };
+ template <typename Fun>
+ repeater<typename std::decay<Fun>::type> repeat(Fun&& fun) {
+ return { std::forward<Fun>(fun) };
+ }
+ } // namespace Detail
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_repeat.hpp
+// start catch_run_for_at_least.hpp
+
+// Run a function for a minimum amount of time
+
+
+// start catch_measure.hpp
+
+// Measure
+
+
+// start catch_timing.hpp
+
+// Timing
+
+
+#include <tuple>
+#include <type_traits>
+
+namespace Catch {
+ namespace Benchmark {
+ template <typename Duration, typename Result>
+ struct Timing {
+ Duration elapsed;
+ Result result;
+ int iterations;
+ };
+ template <typename Clock, typename Sig>
+ using TimingOf = Timing<ClockDuration<Clock>, Detail::CompleteType_t<Detail::ResultOf_t<Sig>>>;
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_timing.hpp
+#include <utility>
+
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+ template <typename Clock, typename Fun, typename... Args>
+ TimingOf<Clock, Fun(Args...)> measure(Fun&& fun, Args&&... args) {
+ auto start = Clock::now();
+ auto&& r = Detail::complete_invoke(fun, std::forward<Args>(args)...);
+ auto end = Clock::now();
+ auto delta = end - start;
+ return { delta, std::forward<decltype(r)>(r), 1 };
+ }
+ } // namespace Detail
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_measure.hpp
+#include <utility>
+#include <type_traits>
+
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+ template <typename Clock, typename Fun>
+ TimingOf<Clock, Fun(int)> measure_one(Fun&& fun, int iters, std::false_type) {
+ return Detail::measure<Clock>(fun, iters);
+ }
+ template <typename Clock, typename Fun>
+ TimingOf<Clock, Fun(Chronometer)> measure_one(Fun&& fun, int iters, std::true_type) {
+ Detail::ChronometerModel<Clock> meter;
+ auto&& result = Detail::complete_invoke(fun, Chronometer(meter, iters));
+
+ return { meter.elapsed(), std::move(result), iters };
+ }
+
+ template <typename Clock, typename Fun>
+ using run_for_at_least_argument_t = typename std::conditional<is_callable<Fun(Chronometer)>::value, Chronometer, int>::type;
+
+ struct optimized_away_error : std::exception {
+ const char* what() const noexcept override {
+ return "could not measure benchmark, maybe it was optimized away";
+ }
+ };
+
+ template <typename Clock, typename Fun>
+ TimingOf<Clock, Fun(run_for_at_least_argument_t<Clock, Fun>)> run_for_at_least(ClockDuration<Clock> how_long, int seed, Fun&& fun) {
+ auto iters = seed;
+ while (iters < (1 << 30)) {
+ auto&& Timing = measure_one<Clock>(fun, iters, is_callable<Fun(Chronometer)>());
+
+ if (Timing.elapsed >= how_long) {
+ return { Timing.elapsed, std::move(Timing.result), iters };
+ }
+ iters *= 2;
+ }
+ throw optimized_away_error{};
+ }
+ } // namespace Detail
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_run_for_at_least.hpp
+#include <algorithm>
+
+namespace Catch {
+ namespace Benchmark {
+ template <typename Duration>
+ struct ExecutionPlan {
+ int iterations_per_sample;
+ Duration estimated_duration;
+ Detail::BenchmarkFunction benchmark;
+ Duration warmup_time;
+ int warmup_iterations;
+
+ template <typename Duration2>
+ operator ExecutionPlan<Duration2>() const {
+ return { iterations_per_sample, estimated_duration, benchmark, warmup_time, warmup_iterations };
+ }
+
+ template <typename Clock>
+ std::vector<FloatDuration<Clock>> run(const IConfig &cfg, Environment<FloatDuration<Clock>> env) const {
+ // warmup a bit
+ Detail::run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(warmup_time), warmup_iterations, Detail::repeat(now<Clock>{}));
+
+ std::vector<FloatDuration<Clock>> times;
+ times.reserve(cfg.benchmarkSamples());
+ std::generate_n(std::back_inserter(times), cfg.benchmarkSamples(), [this, env] {
+ Detail::ChronometerModel<Clock> model;
+ this->benchmark(Chronometer(model, iterations_per_sample));
+ auto sample_time = model.elapsed() - env.clock_cost.mean;
+ if (sample_time < FloatDuration<Clock>::zero()) sample_time = FloatDuration<Clock>::zero();
+ return sample_time / iterations_per_sample;
+ });
+ return times;
+ }
+ };
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_execution_plan.hpp
+// start catch_estimate_clock.hpp
+
+ // Environment measurement
+
+
+// start catch_stats.hpp
+
+// Statistical analysis tools
+
+
+#include <algorithm>
+#include <functional>
+#include <vector>
+#include <numeric>
+#include <tuple>
+#include <cmath>
+#include <utility>
+#include <cstddef>
+
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+ using sample = std::vector<double>;
+
+ double weighted_average_quantile(int k, int q, std::vector<double>::iterator first, std::vector<double>::iterator last);
+
+ template <typename Iterator>
+ OutlierClassification classify_outliers(Iterator first, Iterator last) {
+ std::vector<double> copy(first, last);
+
+ auto q1 = weighted_average_quantile(1, 4, copy.begin(), copy.end());
+ auto q3 = weighted_average_quantile(3, 4, copy.begin(), copy.end());
+ auto iqr = q3 - q1;
+ auto los = q1 - (iqr * 3.);
+ auto lom = q1 - (iqr * 1.5);
+ auto him = q3 + (iqr * 1.5);
+ auto his = q3 + (iqr * 3.);
+
+ OutlierClassification o;
+ for (; first != last; ++first) {
+ auto&& t = *first;
+ if (t < los) ++o.low_severe;
+ else if (t < lom) ++o.low_mild;
+ else if (t > his) ++o.high_severe;
+ else if (t > him) ++o.high_mild;
+ ++o.samples_seen;
+ }
+ return o;
+ }
+
+ template <typename Iterator>
+ double mean(Iterator first, Iterator last) {
+ auto count = last - first;
+ double sum = std::accumulate(first, last, 0.);
+ return sum / count;
+ }
+
+ template <typename URng, typename Iterator, typename Estimator>
+ sample resample(URng& rng, int resamples, Iterator first, Iterator last, Estimator& estimator) {
+ auto n = last - first;
+ std::uniform_int_distribution<decltype(n)> dist(0, n - 1);
+
+ sample out;
+ out.reserve(resamples);
+ std::generate_n(std::back_inserter(out), resamples, [n, first, &estimator, &dist, &rng] {
+ std::vector<double> resampled;
+ resampled.reserve(n);
+ std::generate_n(std::back_inserter(resampled), n, [first, &dist, &rng] { return first[dist(rng)]; });
+ return estimator(resampled.begin(), resampled.end());
+ });
+ std::sort(out.begin(), out.end());
+ return out;
+ }
+
+ template <typename Estimator, typename Iterator>
+ sample jackknife(Estimator&& estimator, Iterator first, Iterator last) {
+ auto n = last - first;
+ auto second = std::next(first);
+ sample results;
+ results.reserve(n);
+
+ for (auto it = first; it != last; ++it) {
+ std::iter_swap(it, first);
+ results.push_back(estimator(second, last));
+ }
+
+ return results;
+ }
+
+ inline double normal_cdf(double x) {
+ return std::erfc(-x / std::sqrt(2.0)) / 2.0;
+ }
+
+ double erfc_inv(double x);
+
+ double normal_quantile(double p);
+
+ template <typename Iterator, typename Estimator>
+ Estimate<double> bootstrap(double confidence_level, Iterator first, Iterator last, sample const& resample, Estimator&& estimator) {
+ auto n_samples = last - first;
+
+ double point = estimator(first, last);
+ // Degenerate case with a single sample
+ if (n_samples == 1) return { point, point, point, confidence_level };
+
+ sample jack = jackknife(estimator, first, last);
+ double jack_mean = mean(jack.begin(), jack.end());
+ double sum_squares, sum_cubes;
+ std::tie(sum_squares, sum_cubes) = std::accumulate(jack.begin(), jack.end(), std::make_pair(0., 0.), [jack_mean](std::pair<double, double> sqcb, double x) -> std::pair<double, double> {
+ auto d = jack_mean - x;
+ auto d2 = d * d;
+ auto d3 = d2 * d;
+ return { sqcb.first + d2, sqcb.second + d3 };
+ });
+
+ double accel = sum_cubes / (6 * std::pow(sum_squares, 1.5));
+ int n = static_cast<int>(resample.size());
+ double prob_n = std::count_if(resample.begin(), resample.end(), [point](double x) { return x < point; }) / (double)n;
+ // degenerate case with uniform samples
+ if (prob_n == 0) return { point, point, point, confidence_level };
+
+ double bias = normal_quantile(prob_n);
+ double z1 = normal_quantile((1. - confidence_level) / 2.);
+
+ auto cumn = [n](double x) -> int {
+ return std::lround(normal_cdf(x) * n); };
+ auto a = [bias, accel](double b) { return bias + b / (1. - accel * b); };
+ double b1 = bias + z1;
+ double b2 = bias - z1;
+ double a1 = a(b1);
+ double a2 = a(b2);
+ auto lo = std::max(cumn(a1), 0);
+ auto hi = std::min(cumn(a2), n - 1);
+
+ return { point, resample[lo], resample[hi], confidence_level };
+ }
+
+ double outlier_variance(Estimate<double> mean, Estimate<double> stddev, int n);
+
+ struct bootstrap_analysis {
+ Estimate<double> mean;
+ Estimate<double> standard_deviation;
+ double outlier_variance;
+ };
+
+ bootstrap_analysis analyse_samples(double confidence_level, int n_resamples, std::vector<double>::iterator first, std::vector<double>::iterator last);
+ } // namespace Detail
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_stats.hpp
+#include <algorithm>
+#include <iterator>
+#include <tuple>
+#include <vector>
+#include <cmath>
+
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+ template <typename Clock>
+ std::vector<double> resolution(int k) {
+ std::vector<TimePoint<Clock>> times;
+ times.reserve(k + 1);
+ std::generate_n(std::back_inserter(times), k + 1, now<Clock>{});
+
+ std::vector<double> deltas;
+ deltas.reserve(k);
+ std::transform(std::next(times.begin()), times.end(), times.begin(),
+ std::back_inserter(deltas),
+ [](TimePoint<Clock> a, TimePoint<Clock> b) { return static_cast<double>((a - b).count()); });
+
+ return deltas;
+ }
+
+ const auto warmup_iterations = 10000;
+ const auto warmup_time = std::chrono::milliseconds(100);
+ const auto minimum_ticks = 1000;
+ const auto warmup_seed = 10000;
+ const auto clock_resolution_estimation_time = std::chrono::milliseconds(500);
+ const auto clock_cost_estimation_time_limit = std::chrono::seconds(1);
+ const auto clock_cost_estimation_tick_limit = 100000;
+ const auto clock_cost_estimation_time = std::chrono::milliseconds(10);
+ const auto clock_cost_estimation_iterations = 10000;
+
+ template <typename Clock>
+ int warmup() {
+ return run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(warmup_time), warmup_seed, &resolution<Clock>)
+ .iterations;
+ }
+ template <typename Clock>
+ EnvironmentEstimate<FloatDuration<Clock>> estimate_clock_resolution(int iterations) {
+ auto r = run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(clock_resolution_estimation_time), iterations, &resolution<Clock>)
+ .result;
+ return {
+ FloatDuration<Clock>(mean(r.begin(), r.end())),
+ classify_outliers(r.begin(), r.end()),
+ };
+ }
+ template <typename Clock>
+ EnvironmentEstimate<FloatDuration<Clock>> estimate_clock_cost(FloatDuration<Clock> resolution) {
+ auto time_limit = std::min(resolution * clock_cost_estimation_tick_limit, FloatDuration<Clock>(clock_cost_estimation_time_limit));
+ auto time_clock = [](int k) {
+ return Detail::measure<Clock>([k] {
+ for (int i = 0; i < k; ++i) {
+ volatile auto ignored = Clock::now();
+ (void)ignored;
+ }
+ }).elapsed;
+ };
+ time_clock(1);
+ int iters = clock_cost_estimation_iterations;
+ auto&& r = run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(clock_cost_estimation_time), iters, time_clock);
+ std::vector<double> times;
+ int nsamples = static_cast<int>(std::ceil(time_limit / r.elapsed));
+ times.reserve(nsamples);
+ std::generate_n(std::back_inserter(times), nsamples, [time_clock, &r] {
+ return static_cast<double>((time_clock(r.iterations) / r.iterations).count());
+ });
+ return {
+ FloatDuration<Clock>(mean(times.begin(), times.end())),
+ classify_outliers(times.begin(), times.end()),
+ };
+ }
+
+ template <typename Clock>
+ Environment<FloatDuration<Clock>> measure_environment() {
+ static Environment<FloatDuration<Clock>>* env = nullptr;
+ if (env) {
+ return *env;
+ }
+
+ auto iters = Detail::warmup<Clock>();
+ auto resolution = Detail::estimate_clock_resolution<Clock>(iters);
+ auto cost = Detail::estimate_clock_cost<Clock>(resolution.mean);
+
+ env = new Environment<FloatDuration<Clock>>{ resolution, cost };
+ return *env;
+ }
+ } // namespace Detail
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_estimate_clock.hpp
+// start catch_analyse.hpp
+
+ // Run and analyse one benchmark
+
+
+// start catch_sample_analysis.hpp
+
+// Benchmark results
+
+
+#include <algorithm>
+#include <vector>
+#include <string>
+#include <iterator>
+
+namespace Catch {
+ namespace Benchmark {
+ template <typename Duration>
+ struct SampleAnalysis {
+ std::vector<Duration> samples;
+ Estimate<Duration> mean;
+ Estimate<Duration> standard_deviation;
+ OutlierClassification outliers;
+ double outlier_variance;
+
+ template <typename Duration2>
+ operator SampleAnalysis<Duration2>() const {
+ std::vector<Duration2> samples2;
+ samples2.reserve(samples.size());
+ std::transform(samples.begin(), samples.end(), std::back_inserter(samples2), [](Duration d) { return Duration2(d); });
+ return {
+ std::move(samples2),
+ mean,
+ standard_deviation,
+ outliers,
+ outlier_variance,
+ };
+ }
+ };
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_sample_analysis.hpp
+#include <algorithm>
+#include <iterator>
+#include <vector>
+
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+ template <typename Duration, typename Iterator>
+ SampleAnalysis<Duration> analyse(const IConfig &cfg, Environment<Duration>, Iterator first, Iterator last) {
+ if (!cfg.benchmarkNoAnalysis()) {
+ std::vector<double> samples;
+ samples.reserve(last - first);
+ std::transform(first, last, std::back_inserter(samples), [](Duration d) { return d.count(); });
+
+ auto analysis = Catch::Benchmark::Detail::analyse_samples(cfg.benchmarkConfidenceInterval(), cfg.benchmarkResamples(), samples.begin(), samples.end());
+ auto outliers = Catch::Benchmark::Detail::classify_outliers(samples.begin(), samples.end());
+
+ auto wrap_estimate = [](Estimate<double> e) {
+ return Estimate<Duration> {
+ Duration(e.point),
+ Duration(e.lower_bound),
+ Duration(e.upper_bound),
+ e.confidence_interval,
+ };
+ };
+ std::vector<Duration> samples2;
+ samples2.reserve(samples.size());
+ std::transform(samples.begin(), samples.end(), std::back_inserter(samples2), [](double d) { return Duration(d); });
+ return {
+ std::move(samples2),
+ wrap_estimate(analysis.mean),
+ wrap_estimate(analysis.standard_deviation),
+ outliers,
+ analysis.outlier_variance,
+ };
+ } else {
+ std::vector<Duration> samples;
+ samples.reserve(last - first);
+
+ Duration mean = Duration(0);
+ int i = 0;
+ for (auto it = first; it < last; ++it, ++i) {
+ samples.push_back(Duration(*it));
+ mean += Duration(*it);
+ }
+ mean /= i;
+
+ return {
+ std::move(samples),
+ Estimate<Duration>{mean, mean, mean, 0.0},
+ Estimate<Duration>{Duration(0), Duration(0), Duration(0), 0.0},
+ OutlierClassification{},
+ 0.0
+ };
+ }
+ }
+ } // namespace Detail
+ } // namespace Benchmark
+} // namespace Catch
+
+// end catch_analyse.hpp
+#include <algorithm>
+#include <functional>
+#include <string>
+#include <vector>
+#include <cmath>
+
+namespace Catch {
+ namespace Benchmark {
+ struct Benchmark {
+ Benchmark(std::string &&name)
+ : name(std::move(name)) {}
+
+ template <class FUN>
+ Benchmark(std::string &&name, FUN &&func)
+ : fun(std::move(func)), name(std::move(name)) {}
+
+ template <typename Clock>
+ ExecutionPlan<FloatDuration<Clock>> prepare(const IConfig &cfg, Environment<FloatDuration<Clock>> env) const {
+ auto min_time = env.clock_resolution.mean * Detail::minimum_ticks;
+ auto run_time = std::max(min_time, std::chrono::duration_cast<decltype(min_time)>(Detail::warmup_time));
+ auto&& test = Detail::run_for_at_least<Clock>(std::chrono::duration_cast<ClockDuration<Clock>>(run_time), 1, fun);
+ int new_iters = static_cast<int>(std::ceil(min_time * test.iterations / test.elapsed));
+ return { new_iters, test.elapsed / test.iterations * new_iters * cfg.benchmarkSamples(), fun, std::chrono::duration_cast<FloatDuration<Clock>>(Detail::warmup_time), Detail::warmup_iterations };
+ }
+
+ template <typename Clock = default_clock>
+ void run() {
+ IConfigPtr cfg = getCurrentContext().getConfig();
+
+ auto env = Detail::measure_environment<Clock>();
+
+ getResultCapture().benchmarkPreparing(name);
+ CATCH_TRY{
+ auto plan = user_code([&] {
+ return prepare<Clock>(*cfg, env);
+ });
+
+ BenchmarkInfo info {
+ name,
+ plan.estimated_duration.count(),
+ plan.iterations_per_sample,
+ cfg->benchmarkSamples(),
+ cfg->benchmarkResamples(),
+ env.clock_resolution.mean.count(),
+ env.clock_cost.mean.count()
+ };
+
+ getResultCapture().benchmarkStarting(info);
+
+ auto samples = user_code([&] {
+ return plan.template run<Clock>(*cfg, env);
+ });
+
+ auto analysis = Detail::analyse(*cfg, env, samples.begin(), samples.end());
+ BenchmarkStats<std::chrono::duration<double, std::nano>> stats{ info, analysis.samples, analysis.mean, analysis.standard_deviation, analysis.outliers, analysis.outlier_variance };
+ getResultCapture().benchmarkEnded(stats);
+
+ } CATCH_CATCH_ALL{
+ if (translateActiveException() != Detail::benchmarkErrorMsg) // benchmark errors have been reported, otherwise rethrow.
+ std::rethrow_exception(std::current_exception());
+ }
+ }
+
+ // sets lambda to be used in fun *and* executes benchmark!
+ template <typename Fun,
+ typename std::enable_if<!Detail::is_related<Fun, Benchmark>::value, int>::type = 0>
+ Benchmark & operator=(Fun func) {
+ fun = Detail::BenchmarkFunction(func);
+ run();
+ return *this;
+ }
+
+ explicit operator bool() {
+ return true;
+ }
+
+ private:
+ Detail::BenchmarkFunction fun;
+ std::string name;
+ };
+ }
+} // namespace Catch
+
+#define INTERNAL_CATCH_GET_1_ARG(arg1, arg2, ...) arg1
+#define INTERNAL_CATCH_GET_2_ARG(arg1, arg2, ...) arg2
+
+#define INTERNAL_CATCH_BENCHMARK(BenchmarkName, name, benchmarkIndex)\
+ if( Catch::Benchmark::Benchmark BenchmarkName{name} ) \
+ BenchmarkName = [&](int benchmarkIndex)
+
+#define INTERNAL_CATCH_BENCHMARK_ADVANCED(BenchmarkName, name)\
+ if( Catch::Benchmark::Benchmark BenchmarkName{name} ) \
+ BenchmarkName = [&]
+
+// end catch_benchmark.hpp
+#endif
+
+#endif // ! CATCH_CONFIG_IMPL_ONLY
+
+#ifdef CATCH_IMPL
+// start catch_impl.hpp
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wweak-vtables"
+#endif
+
+// Keep these here for external reporters
+// start catch_test_case_tracker.h
+
+#include <string>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+namespace TestCaseTracking {
+
+ struct NameAndLocation {
+ std::string name;
+ SourceLineInfo location;
+
+ NameAndLocation( std::string const& _name, SourceLineInfo const& _location );
+ };
+
+ struct ITracker;
+
+ using ITrackerPtr = std::shared_ptr<ITracker>;
+
+ struct ITracker {
+ virtual ~ITracker();
+
+ // static queries
+ virtual NameAndLocation const& nameAndLocation() const = 0;
+
+ // dynamic queries
+ virtual bool isComplete() const = 0; // Successfully completed or failed
+ virtual bool isSuccessfullyCompleted() const = 0;
+ virtual bool isOpen() const = 0; // Started but not complete
+ virtual bool hasChildren() const = 0;
+
+ virtual ITracker& parent() = 0;
+
+ // actions
+ virtual void close() = 0; // Successfully complete
+ virtual void fail() = 0;
+ virtual void markAsNeedingAnotherRun() = 0;
+
+ virtual void addChild( ITrackerPtr const& child ) = 0;
+ virtual ITrackerPtr findChild( NameAndLocation const& nameAndLocation ) = 0;
+ virtual void openChild() = 0;
+
+ // Debug/ checking
+ virtual bool isSectionTracker() const = 0;
+ virtual bool isGeneratorTracker() const = 0;
+ };
+
+ class TrackerContext {
+
+ enum RunState {
+ NotStarted,
+ Executing,
+ CompletedCycle
+ };
+
+ ITrackerPtr m_rootTracker;
+ ITracker* m_currentTracker = nullptr;
+ RunState m_runState = NotStarted;
+
+ public:
+
+ ITracker& startRun();
+ void endRun();
+
+ void startCycle();
+ void completeCycle();
+
+ bool completedCycle() const;
+ ITracker& currentTracker();
+ void setCurrentTracker( ITracker* tracker );
+ };
+
+ class TrackerBase : public ITracker {
+ protected:
+ enum CycleState {
+ NotStarted,
+ Executing,
+ ExecutingChildren,
+ NeedsAnotherRun,
+ CompletedSuccessfully,
+ Failed
+ };
+
+ using Children = std::vector<ITrackerPtr>;
+ NameAndLocation m_nameAndLocation;
+ TrackerContext& m_ctx;
+ ITracker* m_parent;
+ Children m_children;
+ CycleState m_runState = NotStarted;
+
+ public:
+ TrackerBase( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent );
+
+ NameAndLocation const& nameAndLocation() const override;
+ bool isComplete() const override;
+ bool isSuccessfullyCompleted() const override;
+ bool isOpen() const override;
+ bool hasChildren() const override;
+
+ void addChild( ITrackerPtr const& child ) override;
+
+ ITrackerPtr findChild( NameAndLocation const& nameAndLocation ) override;
+ ITracker& parent() override;
+
+ void openChild() override;
+
+ bool isSectionTracker() const override;
+ bool isGeneratorTracker() const override;
+
+ void open();
+
+ void close() override;
+ void fail() override;
+ void markAsNeedingAnotherRun() override;
+
+ private:
+ void moveToParent();
+ void moveToThis();
+ };
+
+ class SectionTracker : public TrackerBase {
+ std::vector<std::string> m_filters;
+ public:
+ SectionTracker( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent );
+
+ bool isSectionTracker() const override;
+
+ bool isComplete() const override;
+
+ static SectionTracker& acquire( TrackerContext& ctx, NameAndLocation const& nameAndLocation );
+
+ void tryOpen();
+
+ void addInitialFilters( std::vector<std::string> const& filters );
+ void addNextFilters( std::vector<std::string> const& filters );
+ };
+
+} // namespace TestCaseTracking
+
+using TestCaseTracking::ITracker;
+using TestCaseTracking::TrackerContext;
+using TestCaseTracking::SectionTracker;
+
+} // namespace Catch
+
+// end catch_test_case_tracker.h
+
+// start catch_leak_detector.h
+
+namespace Catch {
+
+ struct LeakDetector {
+ LeakDetector();
+ ~LeakDetector();
+ };
+
+}
+// end catch_leak_detector.h
+// Cpp files will be included in the single-header file here
+// start catch_stats.cpp
+
+// Statistical analysis tools
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+
+#include <cassert>
+#include <random>
+
+#if defined(CATCH_CONFIG_USE_ASYNC)
+#include <future>
+#endif
+
+namespace {
+ double erf_inv(double x) {
+ // Code accompanying the article "Approximating the erfinv function" in GPU Computing Gems, Volume 2
+ double w, p;
+
+ w = -log((1.0 - x) * (1.0 + x));
+
+ if (w < 6.250000) {
+ w = w - 3.125000;
+ p = -3.6444120640178196996e-21;
+ p = -1.685059138182016589e-19 + p * w;
+ p = 1.2858480715256400167e-18 + p * w;
+ p = 1.115787767802518096e-17 + p * w;
+ p = -1.333171662854620906e-16 + p * w;
+ p = 2.0972767875968561637e-17 + p * w;
+ p = 6.6376381343583238325e-15 + p * w;
+ p = -4.0545662729752068639e-14 + p * w;
+ p = -8.1519341976054721522e-14 + p * w;
+ p = 2.6335093153082322977e-12 + p * w;
+ p = -1.2975133253453532498e-11 + p * w;
+ p = -5.4154120542946279317e-11 + p * w;
+ p = 1.051212273321532285e-09 + p * w;
+ p = -4.1126339803469836976e-09 + p * w;
+ p = -2.9070369957882005086e-08 + p * w;
+ p = 4.2347877827932403518e-07 + p * w;
+ p = -1.3654692000834678645e-06 + p * w;
+ p = -1.3882523362786468719e-05 + p * w;
+ p = 0.0001867342080340571352 + p * w;
+ p = -0.00074070253416626697512 + p * w;
+ p = -0.0060336708714301490533 + p * w;
+ p = 0.24015818242558961693 + p * w;
+ p = 1.6536545626831027356 + p * w;
+ } else if (w < 16.000000) {
+ w = sqrt(w) - 3.250000;
+ p = 2.2137376921775787049e-09;
+ p = 9.0756561938885390979e-08 + p * w;
+ p = -2.7517406297064545428e-07 + p * w;
+ p = 1.8239629214389227755e-08 + p * w;
+ p = 1.5027403968909827627e-06 + p * w;
+ p = -4.013867526981545969e-06 + p * w;
+ p = 2.9234449089955446044e-06 + p * w;
+ p = 1.2475304481671778723e-05 + p * w;
+ p = -4.7318229009055733981e-05 + p * w;
+ p = 6.8284851459573175448e-05 + p * w;
+ p = 2.4031110387097893999e-05 + p * w;
+ p = -0.0003550375203628474796 + p * w;
+ p = 0.00095328937973738049703 + p * w;
+ p = -0.0016882755560235047313 + p * w;
+ p = 0.0024914420961078508066 + p * w;
+ p = -0.0037512085075692412107 + p * w;
+ p = 0.005370914553590063617 + p * w;
+ p = 1.0052589676941592334 + p * w;
+ p = 3.0838856104922207635 + p * w;
+ } else {
+ w = sqrt(w) - 5.000000;
+ p = -2.7109920616438573243e-11;
+ p = -2.5556418169965252055e-10 + p * w;
+ p = 1.5076572693500548083e-09 + p * w;
+ p = -3.7894654401267369937e-09 + p * w;
+ p = 7.6157012080783393804e-09 + p * w;
+ p = -1.4960026627149240478e-08 + p * w;
+ p = 2.9147953450901080826e-08 + p * w;
+ p = -6.7711997758452339498e-08 + p * w;
+ p = 2.2900482228026654717e-07 + p * w;
+ p = -9.9298272942317002539e-07 + p * w;
+ p = 4.5260625972231537039e-06 + p * w;
+ p = -1.9681778105531670567e-05 + p * w;
+ p = 7.5995277030017761139e-05 + p * w;
+ p = -0.00021503011930044477347 + p * w;
+ p = -0.00013871931833623122026 + p * w;
+ p = 1.0103004648645343977 + p * w;
+ p = 4.8499064014085844221 + p * w;
+ }
+ return p * x;
+ }
+
+ double standard_deviation(std::vector<double>::iterator first, std::vector<double>::iterator last) {
+ auto m = Catch::Benchmark::Detail::mean(first, last);
+ double variance = std::accumulate(first, last, 0., [m](double a, double b) {
+ double diff = b - m;
+ return a + diff * diff;
+ }) / (last - first);
+ return std::sqrt(variance);
+ }
+
+}
+
+namespace Catch {
+ namespace Benchmark {
+ namespace Detail {
+
+ double weighted_average_quantile(int k, int q, std::vector<double>::iterator first, std::vector<double>::iterator last) {
+ auto count = last - first;
+ double idx = (count - 1) * k / static_cast<double>(q);
+ int j = static_cast<int>(idx);
+ double g = idx - j;
+ std::nth_element(first, first + j, last);
+ auto xj = first[j];
+ if (g == 0) return xj;
+
+ auto xj1 = *std::min_element(first + (j + 1), last);
+ return xj + g * (xj1 - xj);
+ }
+
+ double erfc_inv(double x) {
+ return erf_inv(1.0 - x);
+ }
+
+ double normal_quantile(double p) {
+ static const double ROOT_TWO = std::sqrt(2.0);
+
+ double result = 0.0;
+ assert(p >= 0 && p <= 1);
+ if (p < 0 || p > 1) {
+ return result;
+ }
+
+ result = -erfc_inv(2.0 * p);
+ // result *= normal distribution standard deviation (1.0) * sqrt(2)
+ result *= /*sd * */ ROOT_TWO;
+ // result += normal disttribution mean (0)
+ return result;
+ }
+
+ double outlier_variance(Estimate<double> mean, Estimate<double> stddev, int n) {
+ double sb = stddev.point;
+ double mn = mean.point / n;
+ double mg_min = mn / 2.;
+ double sg = std::min(mg_min / 4., sb / std::sqrt(n));
+ double sg2 = sg * sg;
+ double sb2 = sb * sb;
+
+ auto c_max = [n, mn, sb2, sg2](double x) -> double {
+ double k = mn - x;
+ double d = k * k;
+ double nd = n * d;
+ double k0 = -n * nd;
+ double k1 = sb2 - n * sg2 + nd;
+ double det = k1 * k1 - 4 * sg2 * k0;
+ return (int)(-2. * k0 / (k1 + std::sqrt(det)));
+ };
+
+ auto var_out = [n, sb2, sg2](double c) {
+ double nc = n - c;
+ return (nc / n) * (sb2 - nc * sg2);
+ };
+
+ return std::min(var_out(1), var_out(std::min(c_max(0.), c_max(mg_min)))) / sb2;
+ }
+
+ bootstrap_analysis analyse_samples(double confidence_level, int n_resamples, std::vector<double>::iterator first, std::vector<double>::iterator last) {
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS
+ static std::random_device entropy;
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+
+ auto n = static_cast<int>(last - first); // seriously, one can't use integral types without hell in C++
+
+ auto mean = &Detail::mean<std::vector<double>::iterator>;
+ auto stddev = &standard_deviation;
+
+#if defined(CATCH_CONFIG_USE_ASYNC)
+ auto Estimate = [=](double(*f)(std::vector<double>::iterator, std::vector<double>::iterator)) {
+ auto seed = entropy();
+ return std::async(std::launch::async, [=] {
+ std::mt19937 rng(seed);
+ auto resampled = resample(rng, n_resamples, first, last, f);
+ return bootstrap(confidence_level, first, last, resampled, f);
+ });
+ };
+
+ auto mean_future = Estimate(mean);
+ auto stddev_future = Estimate(stddev);
+
+ auto mean_estimate = mean_future.get();
+ auto stddev_estimate = stddev_future.get();
+#else
+ auto Estimate = [=](double(*f)(std::vector<double>::iterator, std::vector<double>::iterator)) {
+ auto seed = entropy();
+ std::mt19937 rng(seed);
+ auto resampled = resample(rng, n_resamples, first, last, f);
+ return bootstrap(confidence_level, first, last, resampled, f);
+ };
+
+ auto mean_estimate = Estimate(mean);
+ auto stddev_estimate = Estimate(stddev);
+#endif // CATCH_USE_ASYNC
+
+ double outlier_variance = Detail::outlier_variance(mean_estimate, stddev_estimate, n);
+
+ return { mean_estimate, stddev_estimate, outlier_variance };
+ }
+ } // namespace Detail
+ } // namespace Benchmark
+} // namespace Catch
+
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+// end catch_stats.cpp
+// start catch_approx.cpp
+
+#include <cmath>
+#include <limits>
+
+namespace {
+
+// Performs equivalent check of std::fabs(lhs - rhs) <= margin
+// But without the subtraction to allow for INFINITY in comparison
+bool marginComparison(double lhs, double rhs, double margin) {
+ return (lhs + margin >= rhs) && (rhs + margin >= lhs);
+}
+
+}
+
+namespace Catch {
+namespace Detail {
+
+ Approx::Approx ( double value )
+ : m_epsilon( std::numeric_limits<float>::epsilon()*100 ),
+ m_margin( 0.0 ),
+ m_scale( 0.0 ),
+ m_value( value )
+ {}
+
+ Approx Approx::custom() {
+ return Approx( 0 );
+ }
+
+ Approx Approx::operator-() const {
+ auto temp(*this);
+ temp.m_value = -temp.m_value;
+ return temp;
+ }
+
+ std::string Approx::toString() const {
+ ReusableStringStream rss;
+ rss << "Approx( " << ::Catch::Detail::stringify( m_value ) << " )";
+ return rss.str();
+ }
+
+ bool Approx::equalityComparisonImpl(const double other) const {
+ // First try with fixed margin, then compute margin based on epsilon, scale and Approx's value
+ // Thanks to Richard Harris for his help refining the scaled margin value
+ return marginComparison(m_value, other, m_margin) || marginComparison(m_value, other, m_epsilon * (m_scale + std::fabs(m_value)));
+ }
+
+ void Approx::setMargin(double newMargin) {
+ CATCH_ENFORCE(newMargin >= 0,
+ "Invalid Approx::margin: " << newMargin << '.'
+ << " Approx::Margin has to be non-negative.");
+ m_margin = newMargin;
+ }
+
+ void Approx::setEpsilon(double newEpsilon) {
+ CATCH_ENFORCE(newEpsilon >= 0 && newEpsilon <= 1.0,
+ "Invalid Approx::epsilon: " << newEpsilon << '.'
+ << " Approx::epsilon has to be in [0, 1]");
+ m_epsilon = newEpsilon;
+ }
+
+} // end namespace Detail
+
+namespace literals {
+ Detail::Approx operator "" _a(long double val) {
+ return Detail::Approx(val);
+ }
+ Detail::Approx operator "" _a(unsigned long long val) {
+ return Detail::Approx(val);
+ }
+} // end namespace literals
+
+std::string StringMaker<Catch::Detail::Approx>::convert(Catch::Detail::Approx const& value) {
+ return value.toString();
+}
+
+} // end namespace Catch
+// end catch_approx.cpp
+// start catch_assertionhandler.cpp
+
+// start catch_debugger.h
+
+namespace Catch {
+ bool isDebuggerActive();
+}
+
+#ifdef CATCH_PLATFORM_MAC
+
+ #define CATCH_TRAP() __asm__("int $3\n" : : ) /* NOLINT */
+
+#elif defined(CATCH_PLATFORM_LINUX)
+ // If we can use inline assembler, do it because this allows us to break
+ // directly at the location of the failing check instead of breaking inside
+ // raise() called from it, i.e. one stack frame below.
+ #if defined(__GNUC__) && (defined(__i386) || defined(__x86_64))
+ #define CATCH_TRAP() asm volatile ("int $3") /* NOLINT */
+ #else // Fall back to the generic way.
+ #include <signal.h>
+
+ #define CATCH_TRAP() raise(SIGTRAP)
+ #endif
+#elif defined(_MSC_VER)
+ #define CATCH_TRAP() __debugbreak()
+#elif defined(__MINGW32__)
+ extern "C" __declspec(dllimport) void __stdcall DebugBreak();
+ #define CATCH_TRAP() DebugBreak()
+#endif
+
+#ifdef CATCH_TRAP
+ #define CATCH_BREAK_INTO_DEBUGGER() []{ if( Catch::isDebuggerActive() ) { CATCH_TRAP(); } }()
+#else
+ #define CATCH_BREAK_INTO_DEBUGGER() []{}()
+#endif
+
+// end catch_debugger.h
+// start catch_run_context.h
+
+// start catch_fatal_condition.h
+
+// start catch_windows_h_proxy.h
+
+
+#if defined(CATCH_PLATFORM_WINDOWS)
+
+#if !defined(NOMINMAX) && !defined(CATCH_CONFIG_NO_NOMINMAX)
+# define CATCH_DEFINED_NOMINMAX
+# define NOMINMAX
+#endif
+#if !defined(WIN32_LEAN_AND_MEAN) && !defined(CATCH_CONFIG_NO_WIN32_LEAN_AND_MEAN)
+# define CATCH_DEFINED_WIN32_LEAN_AND_MEAN
+# define WIN32_LEAN_AND_MEAN
+#endif
+
+#ifdef __AFXDLL
+#include <AfxWin.h>
+#else
+#include <windows.h>
+#endif
+
+#ifdef CATCH_DEFINED_NOMINMAX
+# undef NOMINMAX
+#endif
+#ifdef CATCH_DEFINED_WIN32_LEAN_AND_MEAN
+# undef WIN32_LEAN_AND_MEAN
+#endif
+
+#endif // defined(CATCH_PLATFORM_WINDOWS)
+
+// end catch_windows_h_proxy.h
+#if defined( CATCH_CONFIG_WINDOWS_SEH )
+
+namespace Catch {
+
+ struct FatalConditionHandler {
+
+ static LONG CALLBACK handleVectoredException(PEXCEPTION_POINTERS ExceptionInfo);
+ FatalConditionHandler();
+ static void reset();
+ ~FatalConditionHandler();
+
+ private:
+ static bool isSet;
+ static ULONG guaranteeSize;
+ static PVOID exceptionHandlerHandle;
+ };
+
+} // namespace Catch
+
+#elif defined ( CATCH_CONFIG_POSIX_SIGNALS )
+
+#include <signal.h>
+
+namespace Catch {
+
+ struct FatalConditionHandler {
+
+ static bool isSet;
+ static struct sigaction oldSigActions[];
+ static stack_t oldSigStack;
+ static char altStackMem[];
+
+ static void handleSignal( int sig );
+
+ FatalConditionHandler();
+ ~FatalConditionHandler();
+ static void reset();
+ };
+
+} // namespace Catch
+
+#else
+
+namespace Catch {
+ struct FatalConditionHandler {
+ void reset();
+ };
+}
+
+#endif
+
+// end catch_fatal_condition.h
+#include <string>
+
+namespace Catch {
+
+ struct IMutableContext;
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class RunContext : public IResultCapture, public IRunner {
+
+ public:
+ RunContext( RunContext const& ) = delete;
+ RunContext& operator =( RunContext const& ) = delete;
+
+ explicit RunContext( IConfigPtr const& _config, IStreamingReporterPtr&& reporter );
+
+ ~RunContext() override;
+
+ void testGroupStarting( std::string const& testSpec, std::size_t groupIndex, std::size_t groupsCount );
+ void testGroupEnded( std::string const& testSpec, Totals const& totals, std::size_t groupIndex, std::size_t groupsCount );
+
+ Totals runTest(TestCase const& testCase);
+
+ IConfigPtr config() const;
+ IStreamingReporter& reporter() const;
+
+ public: // IResultCapture
+
+ // Assertion handlers
+ void handleExpr
+ ( AssertionInfo const& info,
+ ITransientExpression const& expr,
+ AssertionReaction& reaction ) override;
+ void handleMessage
+ ( AssertionInfo const& info,
+ ResultWas::OfType resultType,
+ StringRef const& message,
+ AssertionReaction& reaction ) override;
+ void handleUnexpectedExceptionNotThrown
+ ( AssertionInfo const& info,
+ AssertionReaction& reaction ) override;
+ void handleUnexpectedInflightException
+ ( AssertionInfo const& info,
+ std::string const& message,
+ AssertionReaction& reaction ) override;
+ void handleIncomplete
+ ( AssertionInfo const& info ) override;
+ void handleNonExpr
+ ( AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ AssertionReaction &reaction ) override;
+
+ bool sectionStarted( SectionInfo const& sectionInfo, Counts& assertions ) override;
+
+ void sectionEnded( SectionEndInfo const& endInfo ) override;
+ void sectionEndedEarly( SectionEndInfo const& endInfo ) override;
+
+ auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& override;
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ void benchmarkPreparing( std::string const& name ) override;
+ void benchmarkStarting( BenchmarkInfo const& info ) override;
+ void benchmarkEnded( BenchmarkStats<> const& stats ) override;
+ void benchmarkFailed( std::string const& error ) override;
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ void pushScopedMessage( MessageInfo const& message ) override;
+ void popScopedMessage( MessageInfo const& message ) override;
+
+ void emplaceUnscopedMessage( MessageBuilder const& builder ) override;
+
+ std::string getCurrentTestName() const override;
+
+ const AssertionResult* getLastResult() const override;
+
+ void exceptionEarlyReported() override;
+
+ void handleFatalErrorCondition( StringRef message ) override;
+
+ bool lastAssertionPassed() override;
+
+ void assertionPassed() override;
+
+ public:
+ // !TBD We need to do this another way!
+ bool aborting() const final;
+
+ private:
+
+ void runCurrentTest( std::string& redirectedCout, std::string& redirectedCerr );
+ void invokeActiveTestCase();
+
+ void resetAssertionInfo();
+ bool testForMissingAssertions( Counts& assertions );
+
+ void assertionEnded( AssertionResult const& result );
+ void reportExpr
+ ( AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ ITransientExpression const *expr,
+ bool negated );
+
+ void populateReaction( AssertionReaction& reaction );
+
+ private:
+
+ void handleUnfinishedSections();
+
+ TestRunInfo m_runInfo;
+ IMutableContext& m_context;
+ TestCase const* m_activeTestCase = nullptr;
+ ITracker* m_testCaseTracker = nullptr;
+ Option<AssertionResult> m_lastResult;
+
+ IConfigPtr m_config;
+ Totals m_totals;
+ IStreamingReporterPtr m_reporter;
+ std::vector<MessageInfo> m_messages;
+ std::vector<ScopedMessage> m_messageScopes; /* Keeps owners of so-called unscoped messages. */
+ AssertionInfo m_lastAssertionInfo;
+ std::vector<SectionEndInfo> m_unfinishedSections;
+ std::vector<ITracker*> m_activeSections;
+ TrackerContext m_trackerContext;
+ bool m_lastAssertionPassed = false;
+ bool m_shouldReportUnexpected = true;
+ bool m_includeSuccessfulResults;
+ };
+
+} // end namespace Catch
+
+// end catch_run_context.h
+namespace Catch {
+
+ namespace {
+ auto operator <<( std::ostream& os, ITransientExpression const& expr ) -> std::ostream& {
+ expr.streamReconstructedExpression( os );
+ return os;
+ }
+ }
+
+ LazyExpression::LazyExpression( bool isNegated )
+ : m_isNegated( isNegated )
+ {}
+
+ LazyExpression::LazyExpression( LazyExpression const& other ) : m_isNegated( other.m_isNegated ) {}
+
+ LazyExpression::operator bool() const {
+ return m_transientExpression != nullptr;
+ }
+
+ auto operator << ( std::ostream& os, LazyExpression const& lazyExpr ) -> std::ostream& {
+ if( lazyExpr.m_isNegated )
+ os << "!";
+
+ if( lazyExpr ) {
+ if( lazyExpr.m_isNegated && lazyExpr.m_transientExpression->isBinaryExpression() )
+ os << "(" << *lazyExpr.m_transientExpression << ")";
+ else
+ os << *lazyExpr.m_transientExpression;
+ }
+ else {
+ os << "{** error - unchecked empty expression requested **}";
+ }
+ return os;
+ }
+
+ AssertionHandler::AssertionHandler
+ ( StringRef const& macroName,
+ SourceLineInfo const& lineInfo,
+ StringRef capturedExpression,
+ ResultDisposition::Flags resultDisposition )
+ : m_assertionInfo{ macroName, lineInfo, capturedExpression, resultDisposition },
+ m_resultCapture( getResultCapture() )
+ {}
+
+ void AssertionHandler::handleExpr( ITransientExpression const& expr ) {
+ m_resultCapture.handleExpr( m_assertionInfo, expr, m_reaction );
+ }
+ void AssertionHandler::handleMessage(ResultWas::OfType resultType, StringRef const& message) {
+ m_resultCapture.handleMessage( m_assertionInfo, resultType, message, m_reaction );
+ }
+
+ auto AssertionHandler::allowThrows() const -> bool {
+ return getCurrentContext().getConfig()->allowThrows();
+ }
+
+ void AssertionHandler::complete() {
+ setCompleted();
+ if( m_reaction.shouldDebugBreak ) {
+
+ // If you find your debugger stopping you here then go one level up on the
+ // call-stack for the code that caused it (typically a failed assertion)
+
+ // (To go back to the test and change execution, jump over the throw, next)
+ CATCH_BREAK_INTO_DEBUGGER();
+ }
+ if (m_reaction.shouldThrow) {
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ throw Catch::TestFailureException();
+#else
+ CATCH_ERROR( "Test failure requires aborting test!" );
+#endif
+ }
+ }
+ void AssertionHandler::setCompleted() {
+ m_completed = true;
+ }
+
+ void AssertionHandler::handleUnexpectedInflightException() {
+ m_resultCapture.handleUnexpectedInflightException( m_assertionInfo, Catch::translateActiveException(), m_reaction );
+ }
+
+ void AssertionHandler::handleExceptionThrownAsExpected() {
+ m_resultCapture.handleNonExpr(m_assertionInfo, ResultWas::Ok, m_reaction);
+ }
+ void AssertionHandler::handleExceptionNotThrownAsExpected() {
+ m_resultCapture.handleNonExpr(m_assertionInfo, ResultWas::Ok, m_reaction);
+ }
+
+ void AssertionHandler::handleUnexpectedExceptionNotThrown() {
+ m_resultCapture.handleUnexpectedExceptionNotThrown( m_assertionInfo, m_reaction );
+ }
+
+ void AssertionHandler::handleThrowingCallSkipped() {
+ m_resultCapture.handleNonExpr(m_assertionInfo, ResultWas::Ok, m_reaction);
+ }
+
+ // This is the overload that takes a string and infers the Equals matcher from it
+ // The more general overload, that takes any string matcher, is in catch_capture_matchers.cpp
+ void handleExceptionMatchExpr( AssertionHandler& handler, std::string const& str, StringRef const& matcherString ) {
+ handleExceptionMatchExpr( handler, Matchers::Equals( str ), matcherString );
+ }
+
+} // namespace Catch
+// end catch_assertionhandler.cpp
+// start catch_assertionresult.cpp
+
+namespace Catch {
+ AssertionResultData::AssertionResultData(ResultWas::OfType _resultType, LazyExpression const & _lazyExpression):
+ lazyExpression(_lazyExpression),
+ resultType(_resultType) {}
+
+ std::string AssertionResultData::reconstructExpression() const {
+
+ if( reconstructedExpression.empty() ) {
+ if( lazyExpression ) {
+ ReusableStringStream rss;
+ rss << lazyExpression;
+ reconstructedExpression = rss.str();
+ }
+ }
+ return reconstructedExpression;
+ }
+
+ AssertionResult::AssertionResult( AssertionInfo const& info, AssertionResultData const& data )
+ : m_info( info ),
+ m_resultData( data )
+ {}
+
+ // Result was a success
+ bool AssertionResult::succeeded() const {
+ return Catch::isOk( m_resultData.resultType );
+ }
+
+ // Result was a success, or failure is suppressed
+ bool AssertionResult::isOk() const {
+ return Catch::isOk( m_resultData.resultType ) || shouldSuppressFailure( m_info.resultDisposition );
+ }
+
+ ResultWas::OfType AssertionResult::getResultType() const {
+ return m_resultData.resultType;
+ }
+
+ bool AssertionResult::hasExpression() const {
+ return m_info.capturedExpression[0] != 0;
+ }
+
+ bool AssertionResult::hasMessage() const {
+ return !m_resultData.message.empty();
+ }
+
+ std::string AssertionResult::getExpression() const {
+ if( isFalseTest( m_info.resultDisposition ) )
+ return "!(" + m_info.capturedExpression + ")";
+ else
+ return m_info.capturedExpression;
+ }
+
+ std::string AssertionResult::getExpressionInMacro() const {
+ std::string expr;
+ if( m_info.macroName[0] == 0 )
+ expr = m_info.capturedExpression;
+ else {
+ expr.reserve( m_info.macroName.size() + m_info.capturedExpression.size() + 4 );
+ expr += m_info.macroName;
+ expr += "( ";
+ expr += m_info.capturedExpression;
+ expr += " )";
+ }
+ return expr;
+ }
+
+ bool AssertionResult::hasExpandedExpression() const {
+ return hasExpression() && getExpandedExpression() != getExpression();
+ }
+
+ std::string AssertionResult::getExpandedExpression() const {
+ std::string expr = m_resultData.reconstructExpression();
+ return expr.empty()
+ ? getExpression()
+ : expr;
+ }
+
+ std::string AssertionResult::getMessage() const {
+ return m_resultData.message;
+ }
+ SourceLineInfo AssertionResult::getSourceInfo() const {
+ return m_info.lineInfo;
+ }
+
+ StringRef AssertionResult::getTestMacroName() const {
+ return m_info.macroName;
+ }
+
+} // end namespace Catch
+// end catch_assertionresult.cpp
+// start catch_capture_matchers.cpp
+
+namespace Catch {
+
+ using StringMatcher = Matchers::Impl::MatcherBase<std::string>;
+
+ // This is the general overload that takes a any string matcher
+ // There is another overload, in catch_assertionhandler.h/.cpp, that only takes a string and infers
+ // the Equals matcher (so the header does not mention matchers)
+ void handleExceptionMatchExpr( AssertionHandler& handler, StringMatcher const& matcher, StringRef const& matcherString ) {
+ std::string exceptionMessage = Catch::translateActiveException();
+ MatchExpr<std::string, StringMatcher const&> expr( exceptionMessage, matcher, matcherString );
+ handler.handleExpr( expr );
+ }
+
+} // namespace Catch
+// end catch_capture_matchers.cpp
+// start catch_commandline.cpp
+
+// start catch_commandline.h
+
+// start catch_clara.h
+
+// Use Catch's value for console width (store Clara's off to the side, if present)
+#ifdef CLARA_CONFIG_CONSOLE_WIDTH
+#define CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH
+#undef CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH
+#endif
+#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH CATCH_CONFIG_CONSOLE_WIDTH-1
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wweak-vtables"
+#pragma clang diagnostic ignored "-Wexit-time-destructors"
+#pragma clang diagnostic ignored "-Wshadow"
+#endif
+
+// start clara.hpp
+// Copyright 2017 Two Blue Cubes Ltd. All rights reserved.
+//
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
+//
+// See https://github.com/philsquared/Clara for more details
+
+// Clara v1.1.5
+
+
+#ifndef CATCH_CLARA_CONFIG_CONSOLE_WIDTH
+#define CATCH_CLARA_CONFIG_CONSOLE_WIDTH 80
+#endif
+
+#ifndef CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH
+#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH CATCH_CLARA_CONFIG_CONSOLE_WIDTH
+#endif
+
+#ifndef CLARA_CONFIG_OPTIONAL_TYPE
+#ifdef __has_include
+#if __has_include(<optional>) && __cplusplus >= 201703L
+#include <optional>
+#define CLARA_CONFIG_OPTIONAL_TYPE std::optional
+#endif
+#endif
+#endif
+
+// ----------- #included from clara_textflow.hpp -----------
+
+// TextFlowCpp
+//
+// A single-header library for wrapping and laying out basic text, by Phil Nash
+//
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
+//
+// This project is hosted at https://github.com/philsquared/textflowcpp
+
+
+#include <cassert>
+#include <ostream>
+#include <sstream>
+#include <vector>
+
+#ifndef CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH
+#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH 80
+#endif
+
+namespace Catch {
+namespace clara {
+namespace TextFlow {
+
+inline auto isWhitespace(char c) -> bool {
+ static std::string chars = " \t\n\r";
+ return chars.find(c) != std::string::npos;
+}
+inline auto isBreakableBefore(char c) -> bool {
+ static std::string chars = "[({<|";
+ return chars.find(c) != std::string::npos;
+}
+inline auto isBreakableAfter(char c) -> bool {
+ static std::string chars = "])}>.,:;*+-=&/\\";
+ return chars.find(c) != std::string::npos;
+}
+
+class Columns;
+
+class Column {
+ std::vector<std::string> m_strings;
+ size_t m_width = CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH;
+ size_t m_indent = 0;
+ size_t m_initialIndent = std::string::npos;
+
+public:
+ class iterator {
+ friend Column;
+
+ Column const& m_column;
+ size_t m_stringIndex = 0;
+ size_t m_pos = 0;
+
+ size_t m_len = 0;
+ size_t m_end = 0;
+ bool m_suffix = false;
+
+ iterator(Column const& column, size_t stringIndex)
+ : m_column(column),
+ m_stringIndex(stringIndex) {}
+
+ auto line() const -> std::string const& { return m_column.m_strings[m_stringIndex]; }
+
+ auto isBoundary(size_t at) const -> bool {
+ assert(at > 0);
+ assert(at <= line().size());
+
+ return at == line().size() ||
+ (isWhitespace(line()[at]) && !isWhitespace(line()[at - 1])) ||
+ isBreakableBefore(line()[at]) ||
+ isBreakableAfter(line()[at - 1]);
+ }
+
+ void calcLength() {
+ assert(m_stringIndex < m_column.m_strings.size());
+
+ m_suffix = false;
+ auto width = m_column.m_width - indent();
+ m_end = m_pos;
+ if (line()[m_pos] == '\n') {
+ ++m_end;
+ }
+ while (m_end < line().size() && line()[m_end] != '\n')
+ ++m_end;
+
+ if (m_end < m_pos + width) {
+ m_len = m_end - m_pos;
+ } else {
+ size_t len = width;
+ while (len > 0 && !isBoundary(m_pos + len))
+ --len;
+ while (len > 0 && isWhitespace(line()[m_pos + len - 1]))
+ --len;
+
+ if (len > 0) {
+ m_len = len;
+ } else {
+ m_suffix = true;
+ m_len = width - 1;
+ }
+ }
+ }
+
+ auto indent() const -> size_t {
+ auto initial = m_pos == 0 && m_stringIndex == 0 ? m_column.m_initialIndent : std::string::npos;
+ return initial == std::string::npos ? m_column.m_indent : initial;
+ }
+
+ auto addIndentAndSuffix(std::string const &plain) const -> std::string {
+ return std::string(indent(), ' ') + (m_suffix ? plain + "-" : plain);
+ }
+
+ public:
+ using difference_type = std::ptrdiff_t;
+ using value_type = std::string;
+ using pointer = value_type * ;
+ using reference = value_type & ;
+ using iterator_category = std::forward_iterator_tag;
+
+ explicit iterator(Column const& column) : m_column(column) {
+ assert(m_column.m_width > m_column.m_indent);
+ assert(m_column.m_initialIndent == std::string::npos || m_column.m_width > m_column.m_initialIndent);
+ calcLength();
+ if (m_len == 0)
+ m_stringIndex++; // Empty string
+ }
+
+ auto operator *() const -> std::string {
+ assert(m_stringIndex < m_column.m_strings.size());
+ assert(m_pos <= m_end);
+ return addIndentAndSuffix(line().substr(m_pos, m_len));
+ }
+
+ auto operator ++() -> iterator& {
+ m_pos += m_len;
+ if (m_pos < line().size() && line()[m_pos] == '\n')
+ m_pos += 1;
+ else
+ while (m_pos < line().size() && isWhitespace(line()[m_pos]))
+ ++m_pos;
+
+ if (m_pos == line().size()) {
+ m_pos = 0;
+ ++m_stringIndex;
+ }
+ if (m_stringIndex < m_column.m_strings.size())
+ calcLength();
+ return *this;
+ }
+ auto operator ++(int) -> iterator {
+ iterator prev(*this);
+ operator++();
+ return prev;
+ }
+
+ auto operator ==(iterator const& other) const -> bool {
+ return
+ m_pos == other.m_pos &&
+ m_stringIndex == other.m_stringIndex &&
+ &m_column == &other.m_column;
+ }
+ auto operator !=(iterator const& other) const -> bool {
+ return !operator==(other);
+ }
+ };
+ using const_iterator = iterator;
+
+ explicit Column(std::string const& text) { m_strings.push_back(text); }
+
+ auto width(size_t newWidth) -> Column& {
+ assert(newWidth > 0);
+ m_width = newWidth;
+ return *this;
+ }
+ auto indent(size_t newIndent) -> Column& {
+ m_indent = newIndent;
+ return *this;
+ }
+ auto initialIndent(size_t newIndent) -> Column& {
+ m_initialIndent = newIndent;
+ return *this;
+ }
+
+ auto width() const -> size_t { return m_width; }
+ auto begin() const -> iterator { return iterator(*this); }
+ auto end() const -> iterator { return { *this, m_strings.size() }; }
+
+ inline friend std::ostream& operator << (std::ostream& os, Column const& col) {
+ bool first = true;
+ for (auto line : col) {
+ if (first)
+ first = false;
+ else
+ os << "\n";
+ os << line;
+ }
+ return os;
+ }
+
+ auto operator + (Column const& other)->Columns;
+
+ auto toString() const -> std::string {
+ std::ostringstream oss;
+ oss << *this;
+ return oss.str();
+ }
+};
+
+class Spacer : public Column {
+
+public:
+ explicit Spacer(size_t spaceWidth) : Column("") {
+ width(spaceWidth);
+ }
+};
+
+class Columns {
+ std::vector<Column> m_columns;
+
+public:
+
+ class iterator {
+ friend Columns;
+ struct EndTag {};
+
+ std::vector<Column> const& m_columns;
+ std::vector<Column::iterator> m_iterators;
+ size_t m_activeIterators;
+
+ iterator(Columns const& columns, EndTag)
+ : m_columns(columns.m_columns),
+ m_activeIterators(0) {
+ m_iterators.reserve(m_columns.size());
+
+ for (auto const& col : m_columns)
+ m_iterators.push_back(col.end());
+ }
+
+ public:
+ using difference_type = std::ptrdiff_t;
+ using value_type = std::string;
+ using pointer = value_type * ;
+ using reference = value_type & ;
+ using iterator_category = std::forward_iterator_tag;
+
+ explicit iterator(Columns const& columns)
+ : m_columns(columns.m_columns),
+ m_activeIterators(m_columns.size()) {
+ m_iterators.reserve(m_columns.size());
+
+ for (auto const& col : m_columns)
+ m_iterators.push_back(col.begin());
+ }
+
+ auto operator ==(iterator const& other) const -> bool {
+ return m_iterators == other.m_iterators;
+ }
+ auto operator !=(iterator const& other) const -> bool {
+ return m_iterators != other.m_iterators;
+ }
+ auto operator *() const -> std::string {
+ std::string row, padding;
+
+ for (size_t i = 0; i < m_columns.size(); ++i) {
+ auto width = m_columns[i].width();
+ if (m_iterators[i] != m_columns[i].end()) {
+ std::string col = *m_iterators[i];
+ row += padding + col;
+ if (col.size() < width)
+ padding = std::string(width - col.size(), ' ');
+ else
+ padding = "";
+ } else {
+ padding += std::string(width, ' ');
+ }
+ }
+ return row;
+ }
+ auto operator ++() -> iterator& {
+ for (size_t i = 0; i < m_columns.size(); ++i) {
+ if (m_iterators[i] != m_columns[i].end())
+ ++m_iterators[i];
+ }
+ return *this;
+ }
+ auto operator ++(int) -> iterator {
+ iterator prev(*this);
+ operator++();
+ return prev;
+ }
+ };
+ using const_iterator = iterator;
+
+ auto begin() const -> iterator { return iterator(*this); }
+ auto end() const -> iterator { return { *this, iterator::EndTag() }; }
+
+ auto operator += (Column const& col) -> Columns& {
+ m_columns.push_back(col);
+ return *this;
+ }
+ auto operator + (Column const& col) -> Columns {
+ Columns combined = *this;
+ combined += col;
+ return combined;
+ }
+
+ inline friend std::ostream& operator << (std::ostream& os, Columns const& cols) {
+
+ bool first = true;
+ for (auto line : cols) {
+ if (first)
+ first = false;
+ else
+ os << "\n";
+ os << line;
+ }
+ return os;
+ }
+
+ auto toString() const -> std::string {
+ std::ostringstream oss;
+ oss << *this;
+ return oss.str();
+ }
+};
+
+inline auto Column::operator + (Column const& other) -> Columns {
+ Columns cols;
+ cols += *this;
+ cols += other;
+ return cols;
+}
+}
+
+}
+}
+
+// ----------- end of #include from clara_textflow.hpp -----------
+// ........... back in clara.hpp
+
+#include <cctype>
+#include <string>
+#include <memory>
+#include <set>
+#include <algorithm>
+
+#if !defined(CATCH_PLATFORM_WINDOWS) && ( defined(WIN32) || defined(__WIN32__) || defined(_WIN32) || defined(_MSC_VER) )
+#define CATCH_PLATFORM_WINDOWS
+#endif
+
+namespace Catch { namespace clara {
+namespace detail {
+
+ // Traits for extracting arg and return type of lambdas (for single argument lambdas)
+ template<typename L>
+ struct UnaryLambdaTraits : UnaryLambdaTraits<decltype( &L::operator() )> {};
+
+ template<typename ClassT, typename ReturnT, typename... Args>
+ struct UnaryLambdaTraits<ReturnT( ClassT::* )( Args... ) const> {
+ static const bool isValid = false;
+ };
+
+ template<typename ClassT, typename ReturnT, typename ArgT>
+ struct UnaryLambdaTraits<ReturnT( ClassT::* )( ArgT ) const> {
+ static const bool isValid = true;
+ using ArgType = typename std::remove_const<typename std::remove_reference<ArgT>::type>::type;
+ using ReturnType = ReturnT;
+ };
+
+ class TokenStream;
+
+ // Transport for raw args (copied from main args, or supplied via init list for testing)
+ class Args {
+ friend TokenStream;
+ std::string m_exeName;
+ std::vector<std::string> m_args;
+
+ public:
+ Args( int argc, char const* const* argv )
+ : m_exeName(argv[0]),
+ m_args(argv + 1, argv + argc) {}
+
+ Args( std::initializer_list<std::string> args )
+ : m_exeName( *args.begin() ),
+ m_args( args.begin()+1, args.end() )
+ {}
+
+ auto exeName() const -> std::string {
+ return m_exeName;
+ }
+ };
+
+ // Wraps a token coming from a token stream. These may not directly correspond to strings as a single string
+ // may encode an option + its argument if the : or = form is used
+ enum class TokenType {
+ Option, Argument
+ };
+ struct Token {
+ TokenType type;
+ std::string token;
+ };
+
+ inline auto isOptPrefix( char c ) -> bool {
+ return c == '-'
+#ifdef CATCH_PLATFORM_WINDOWS
+ || c == '/'
+#endif
+ ;
+ }
+
+ // Abstracts iterators into args as a stream of tokens, with option arguments uniformly handled
+ class TokenStream {
+ using Iterator = std::vector<std::string>::const_iterator;
+ Iterator it;
+ Iterator itEnd;
+ std::vector<Token> m_tokenBuffer;
+
+ void loadBuffer() {
+ m_tokenBuffer.resize( 0 );
+
+ // Skip any empty strings
+ while( it != itEnd && it->empty() )
+ ++it;
+
+ if( it != itEnd ) {
+ auto const &next = *it;
+ if( isOptPrefix( next[0] ) ) {
+ auto delimiterPos = next.find_first_of( " :=" );
+ if( delimiterPos != std::string::npos ) {
+ m_tokenBuffer.push_back( { TokenType::Option, next.substr( 0, delimiterPos ) } );
+ m_tokenBuffer.push_back( { TokenType::Argument, next.substr( delimiterPos + 1 ) } );
+ } else {
+ if( next[1] != '-' && next.size() > 2 ) {
+ std::string opt = "- ";
+ for( size_t i = 1; i < next.size(); ++i ) {
+ opt[1] = next[i];
+ m_tokenBuffer.push_back( { TokenType::Option, opt } );
+ }
+ } else {
+ m_tokenBuffer.push_back( { TokenType::Option, next } );
+ }
+ }
+ } else {
+ m_tokenBuffer.push_back( { TokenType::Argument, next } );
+ }
+ }
+ }
+
+ public:
+ explicit TokenStream( Args const &args ) : TokenStream( args.m_args.begin(), args.m_args.end() ) {}
+
+ TokenStream( Iterator it, Iterator itEnd ) : it( it ), itEnd( itEnd ) {
+ loadBuffer();
+ }
+
+ explicit operator bool() const {
+ return !m_tokenBuffer.empty() || it != itEnd;
+ }
+
+ auto count() const -> size_t { return m_tokenBuffer.size() + (itEnd - it); }
+
+ auto operator*() const -> Token {
+ assert( !m_tokenBuffer.empty() );
+ return m_tokenBuffer.front();
+ }
+
+ auto operator->() const -> Token const * {
+ assert( !m_tokenBuffer.empty() );
+ return &m_tokenBuffer.front();
+ }
+
+ auto operator++() -> TokenStream & {
+ if( m_tokenBuffer.size() >= 2 ) {
+ m_tokenBuffer.erase( m_tokenBuffer.begin() );
+ } else {
+ if( it != itEnd )
+ ++it;
+ loadBuffer();
+ }
+ return *this;
+ }
+ };
+
+ class ResultBase {
+ public:
+ enum Type {
+ Ok, LogicError, RuntimeError
+ };
+
+ protected:
+ ResultBase( Type type ) : m_type( type ) {}
+ virtual ~ResultBase() = default;
+
+ virtual void enforceOk() const = 0;
+
+ Type m_type;
+ };
+
+ template<typename T>
+ class ResultValueBase : public ResultBase {
+ public:
+ auto value() const -> T const & {
+ enforceOk();
+ return m_value;
+ }
+
+ protected:
+ ResultValueBase( Type type ) : ResultBase( type ) {}
+
+ ResultValueBase( ResultValueBase const &other ) : ResultBase( other ) {
+ if( m_type == ResultBase::Ok )
+ new( &m_value ) T( other.m_value );
+ }
+
+ ResultValueBase( Type, T const &value ) : ResultBase( Ok ) {
+ new( &m_value ) T( value );
+ }
+
+ auto operator=( ResultValueBase const &other ) -> ResultValueBase & {
+ if( m_type == ResultBase::Ok )
+ m_value.~T();
+ ResultBase::operator=(other);
+ if( m_type == ResultBase::Ok )
+ new( &m_value ) T( other.m_value );
+ return *this;
+ }
+
+ ~ResultValueBase() override {
+ if( m_type == Ok )
+ m_value.~T();
+ }
+
+ union {
+ T m_value;
+ };
+ };
+
+ template<>
+ class ResultValueBase<void> : public ResultBase {
+ protected:
+ using ResultBase::ResultBase;
+ };
+
+ template<typename T = void>
+ class BasicResult : public ResultValueBase<T> {
+ public:
+ template<typename U>
+ explicit BasicResult( BasicResult<U> const &other )
+ : ResultValueBase<T>( other.type() ),
+ m_errorMessage( other.errorMessage() )
+ {
+ assert( type() != ResultBase::Ok );
+ }
+
+ template<typename U>
+ static auto ok( U const &value ) -> BasicResult { return { ResultBase::Ok, value }; }
+ static auto ok() -> BasicResult { return { ResultBase::Ok }; }
+ static auto logicError( std::string const &message ) -> BasicResult { return { ResultBase::LogicError, message }; }
+ static auto runtimeError( std::string const &message ) -> BasicResult { return { ResultBase::RuntimeError, message }; }
+
+ explicit operator bool() const { return m_type == ResultBase::Ok; }
+ auto type() const -> ResultBase::Type { return m_type; }
+ auto errorMessage() const -> std::string { return m_errorMessage; }
+
+ protected:
+ void enforceOk() const override {
+
+ // Errors shouldn't reach this point, but if they do
+ // the actual error message will be in m_errorMessage
+ assert( m_type != ResultBase::LogicError );
+ assert( m_type != ResultBase::RuntimeError );
+ if( m_type != ResultBase::Ok )
+ std::abort();
+ }
+
+ std::string m_errorMessage; // Only populated if resultType is an error
+
+ BasicResult( ResultBase::Type type, std::string const &message )
+ : ResultValueBase<T>(type),
+ m_errorMessage(message)
+ {
+ assert( m_type != ResultBase::Ok );
+ }
+
+ using ResultValueBase<T>::ResultValueBase;
+ using ResultBase::m_type;
+ };
+
+ enum class ParseResultType {
+ Matched, NoMatch, ShortCircuitAll, ShortCircuitSame
+ };
+
+ class ParseState {
+ public:
+
+ ParseState( ParseResultType type, TokenStream const &remainingTokens )
+ : m_type(type),
+ m_remainingTokens( remainingTokens )
+ {}
+
+ auto type() const -> ParseResultType { return m_type; }
+ auto remainingTokens() const -> TokenStream { return m_remainingTokens; }
+
+ private:
+ ParseResultType m_type;
+ TokenStream m_remainingTokens;
+ };
+
+ using Result = BasicResult<void>;
+ using ParserResult = BasicResult<ParseResultType>;
+ using InternalParseResult = BasicResult<ParseState>;
+
+ struct HelpColumns {
+ std::string left;
+ std::string right;
+ };
+
+ template<typename T>
+ inline auto convertInto( std::string const &source, T& target ) -> ParserResult {
+ std::stringstream ss;
+ ss << source;
+ ss >> target;
+ if( ss.fail() )
+ return ParserResult::runtimeError( "Unable to convert '" + source + "' to destination type" );
+ else
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ inline auto convertInto( std::string const &source, std::string& target ) -> ParserResult {
+ target = source;
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ inline auto convertInto( std::string const &source, bool &target ) -> ParserResult {
+ std::string srcLC = source;
+ std::transform( srcLC.begin(), srcLC.end(), srcLC.begin(), []( char c ) { return static_cast<char>( std::tolower(c) ); } );
+ if (srcLC == "y" || srcLC == "1" || srcLC == "true" || srcLC == "yes" || srcLC == "on")
+ target = true;
+ else if (srcLC == "n" || srcLC == "0" || srcLC == "false" || srcLC == "no" || srcLC == "off")
+ target = false;
+ else
+ return ParserResult::runtimeError( "Expected a boolean value but did not recognise: '" + source + "'" );
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+#ifdef CLARA_CONFIG_OPTIONAL_TYPE
+ template<typename T>
+ inline auto convertInto( std::string const &source, CLARA_CONFIG_OPTIONAL_TYPE<T>& target ) -> ParserResult {
+ T temp;
+ auto result = convertInto( source, temp );
+ if( result )
+ target = std::move(temp);
+ return result;
+ }
+#endif // CLARA_CONFIG_OPTIONAL_TYPE
+
+ struct NonCopyable {
+ NonCopyable() = default;
+ NonCopyable( NonCopyable const & ) = delete;
+ NonCopyable( NonCopyable && ) = delete;
+ NonCopyable &operator=( NonCopyable const & ) = delete;
+ NonCopyable &operator=( NonCopyable && ) = delete;
+ };
+
+ struct BoundRef : NonCopyable {
+ virtual ~BoundRef() = default;
+ virtual auto isContainer() const -> bool { return false; }
+ virtual auto isFlag() const -> bool { return false; }
+ };
+ struct BoundValueRefBase : BoundRef {
+ virtual auto setValue( std::string const &arg ) -> ParserResult = 0;
+ };
+ struct BoundFlagRefBase : BoundRef {
+ virtual auto setFlag( bool flag ) -> ParserResult = 0;
+ virtual auto isFlag() const -> bool { return true; }
+ };
+
+ template<typename T>
+ struct BoundValueRef : BoundValueRefBase {
+ T &m_ref;
+
+ explicit BoundValueRef( T &ref ) : m_ref( ref ) {}
+
+ auto setValue( std::string const &arg ) -> ParserResult override {
+ return convertInto( arg, m_ref );
+ }
+ };
+
+ template<typename T>
+ struct BoundValueRef<std::vector<T>> : BoundValueRefBase {
+ std::vector<T> &m_ref;
+
+ explicit BoundValueRef( std::vector<T> &ref ) : m_ref( ref ) {}
+
+ auto isContainer() const -> bool override { return true; }
+
+ auto setValue( std::string const &arg ) -> ParserResult override {
+ T temp;
+ auto result = convertInto( arg, temp );
+ if( result )
+ m_ref.push_back( temp );
+ return result;
+ }
+ };
+
+ struct BoundFlagRef : BoundFlagRefBase {
+ bool &m_ref;
+
+ explicit BoundFlagRef( bool &ref ) : m_ref( ref ) {}
+
+ auto setFlag( bool flag ) -> ParserResult override {
+ m_ref = flag;
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ };
+
+ template<typename ReturnType>
+ struct LambdaInvoker {
+ static_assert( std::is_same<ReturnType, ParserResult>::value, "Lambda must return void or clara::ParserResult" );
+
+ template<typename L, typename ArgType>
+ static auto invoke( L const &lambda, ArgType const &arg ) -> ParserResult {
+ return lambda( arg );
+ }
+ };
+
+ template<>
+ struct LambdaInvoker<void> {
+ template<typename L, typename ArgType>
+ static auto invoke( L const &lambda, ArgType const &arg ) -> ParserResult {
+ lambda( arg );
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ };
+
+ template<typename ArgType, typename L>
+ inline auto invokeLambda( L const &lambda, std::string const &arg ) -> ParserResult {
+ ArgType temp{};
+ auto result = convertInto( arg, temp );
+ return !result
+ ? result
+ : LambdaInvoker<typename UnaryLambdaTraits<L>::ReturnType>::invoke( lambda, temp );
+ }
+
+ template<typename L>
+ struct BoundLambda : BoundValueRefBase {
+ L m_lambda;
+
+ static_assert( UnaryLambdaTraits<L>::isValid, "Supplied lambda must take exactly one argument" );
+ explicit BoundLambda( L const &lambda ) : m_lambda( lambda ) {}
+
+ auto setValue( std::string const &arg ) -> ParserResult override {
+ return invokeLambda<typename UnaryLambdaTraits<L>::ArgType>( m_lambda, arg );
+ }
+ };
+
+ template<typename L>
+ struct BoundFlagLambda : BoundFlagRefBase {
+ L m_lambda;
+
+ static_assert( UnaryLambdaTraits<L>::isValid, "Supplied lambda must take exactly one argument" );
+ static_assert( std::is_same<typename UnaryLambdaTraits<L>::ArgType, bool>::value, "flags must be boolean" );
+
+ explicit BoundFlagLambda( L const &lambda ) : m_lambda( lambda ) {}
+
+ auto setFlag( bool flag ) -> ParserResult override {
+ return LambdaInvoker<typename UnaryLambdaTraits<L>::ReturnType>::invoke( m_lambda, flag );
+ }
+ };
+
+ enum class Optionality { Optional, Required };
+
+ struct Parser;
+
+ class ParserBase {
+ public:
+ virtual ~ParserBase() = default;
+ virtual auto validate() const -> Result { return Result::ok(); }
+ virtual auto parse( std::string const& exeName, TokenStream const &tokens) const -> InternalParseResult = 0;
+ virtual auto cardinality() const -> size_t { return 1; }
+
+ auto parse( Args const &args ) const -> InternalParseResult {
+ return parse( args.exeName(), TokenStream( args ) );
+ }
+ };
+
+ template<typename DerivedT>
+ class ComposableParserImpl : public ParserBase {
+ public:
+ template<typename T>
+ auto operator|( T const &other ) const -> Parser;
+
+ template<typename T>
+ auto operator+( T const &other ) const -> Parser;
+ };
+
+ // Common code and state for Args and Opts
+ template<typename DerivedT>
+ class ParserRefImpl : public ComposableParserImpl<DerivedT> {
+ protected:
+ Optionality m_optionality = Optionality::Optional;
+ std::shared_ptr<BoundRef> m_ref;
+ std::string m_hint;
+ std::string m_description;
+
+ explicit ParserRefImpl( std::shared_ptr<BoundRef> const &ref ) : m_ref( ref ) {}
+
+ public:
+ template<typename T>
+ ParserRefImpl( T &ref, std::string const &hint )
+ : m_ref( std::make_shared<BoundValueRef<T>>( ref ) ),
+ m_hint( hint )
+ {}
+
+ template<typename LambdaT>
+ ParserRefImpl( LambdaT const &ref, std::string const &hint )
+ : m_ref( std::make_shared<BoundLambda<LambdaT>>( ref ) ),
+ m_hint(hint)
+ {}
+
+ auto operator()( std::string const &description ) -> DerivedT & {
+ m_description = description;
+ return static_cast<DerivedT &>( *this );
+ }
+
+ auto optional() -> DerivedT & {
+ m_optionality = Optionality::Optional;
+ return static_cast<DerivedT &>( *this );
+ };
+
+ auto required() -> DerivedT & {
+ m_optionality = Optionality::Required;
+ return static_cast<DerivedT &>( *this );
+ };
+
+ auto isOptional() const -> bool {
+ return m_optionality == Optionality::Optional;
+ }
+
+ auto cardinality() const -> size_t override {
+ if( m_ref->isContainer() )
+ return 0;
+ else
+ return 1;
+ }
+
+ auto hint() const -> std::string { return m_hint; }
+ };
+
+ class ExeName : public ComposableParserImpl<ExeName> {
+ std::shared_ptr<std::string> m_name;
+ std::shared_ptr<BoundValueRefBase> m_ref;
+
+ template<typename LambdaT>
+ static auto makeRef(LambdaT const &lambda) -> std::shared_ptr<BoundValueRefBase> {
+ return std::make_shared<BoundLambda<LambdaT>>( lambda) ;
+ }
+
+ public:
+ ExeName() : m_name( std::make_shared<std::string>( "<executable>" ) ) {}
+
+ explicit ExeName( std::string &ref ) : ExeName() {
+ m_ref = std::make_shared<BoundValueRef<std::string>>( ref );
+ }
+
+ template<typename LambdaT>
+ explicit ExeName( LambdaT const& lambda ) : ExeName() {
+ m_ref = std::make_shared<BoundLambda<LambdaT>>( lambda );
+ }
+
+ // The exe name is not parsed out of the normal tokens, but is handled specially
+ auto parse( std::string const&, TokenStream const &tokens ) const -> InternalParseResult override {
+ return InternalParseResult::ok( ParseState( ParseResultType::NoMatch, tokens ) );
+ }
+
+ auto name() const -> std::string { return *m_name; }
+ auto set( std::string const& newName ) -> ParserResult {
+
+ auto lastSlash = newName.find_last_of( "\\/" );
+ auto filename = ( lastSlash == std::string::npos )
+ ? newName
+ : newName.substr( lastSlash+1 );
+
+ *m_name = filename;
+ if( m_ref )
+ return m_ref->setValue( filename );
+ else
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ };
+
+ class Arg : public ParserRefImpl<Arg> {
+ public:
+ using ParserRefImpl::ParserRefImpl;
+
+ auto parse( std::string const &, TokenStream const &tokens ) const -> InternalParseResult override {
+ auto validationResult = validate();
+ if( !validationResult )
+ return InternalParseResult( validationResult );
+
+ auto remainingTokens = tokens;
+ auto const &token = *remainingTokens;
+ if( token.type != TokenType::Argument )
+ return InternalParseResult::ok( ParseState( ParseResultType::NoMatch, remainingTokens ) );
+
+ assert( !m_ref->isFlag() );
+ auto valueRef = static_cast<detail::BoundValueRefBase*>( m_ref.get() );
+
+ auto result = valueRef->setValue( remainingTokens->token );
+ if( !result )
+ return InternalParseResult( result );
+ else
+ return InternalParseResult::ok( ParseState( ParseResultType::Matched, ++remainingTokens ) );
+ }
+ };
+
+ inline auto normaliseOpt( std::string const &optName ) -> std::string {
+#ifdef CATCH_PLATFORM_WINDOWS
+ if( optName[0] == '/' )
+ return "-" + optName.substr( 1 );
+ else
+#endif
+ return optName;
+ }
+
+ class Opt : public ParserRefImpl<Opt> {
+ protected:
+ std::vector<std::string> m_optNames;
+
+ public:
+ template<typename LambdaT>
+ explicit Opt( LambdaT const &ref ) : ParserRefImpl( std::make_shared<BoundFlagLambda<LambdaT>>( ref ) ) {}
+
+ explicit Opt( bool &ref ) : ParserRefImpl( std::make_shared<BoundFlagRef>( ref ) ) {}
+
+ template<typename LambdaT>
+ Opt( LambdaT const &ref, std::string const &hint ) : ParserRefImpl( ref, hint ) {}
+
+ template<typename T>
+ Opt( T &ref, std::string const &hint ) : ParserRefImpl( ref, hint ) {}
+
+ auto operator[]( std::string const &optName ) -> Opt & {
+ m_optNames.push_back( optName );
+ return *this;
+ }
+
+ auto getHelpColumns() const -> std::vector<HelpColumns> {
+ std::ostringstream oss;
+ bool first = true;
+ for( auto const &opt : m_optNames ) {
+ if (first)
+ first = false;
+ else
+ oss << ", ";
+ oss << opt;
+ }
+ if( !m_hint.empty() )
+ oss << " <" << m_hint << ">";
+ return { { oss.str(), m_description } };
+ }
+
+ auto isMatch( std::string const &optToken ) const -> bool {
+ auto normalisedToken = normaliseOpt( optToken );
+ for( auto const &name : m_optNames ) {
+ if( normaliseOpt( name ) == normalisedToken )
+ return true;
+ }
+ return false;
+ }
+
+ using ParserBase::parse;
+
+ auto parse( std::string const&, TokenStream const &tokens ) const -> InternalParseResult override {
+ auto validationResult = validate();
+ if( !validationResult )
+ return InternalParseResult( validationResult );
+
+ auto remainingTokens = tokens;
+ if( remainingTokens && remainingTokens->type == TokenType::Option ) {
+ auto const &token = *remainingTokens;
+ if( isMatch(token.token ) ) {
+ if( m_ref->isFlag() ) {
+ auto flagRef = static_cast<detail::BoundFlagRefBase*>( m_ref.get() );
+ auto result = flagRef->setFlag( true );
+ if( !result )
+ return InternalParseResult( result );
+ if( result.value() == ParseResultType::ShortCircuitAll )
+ return InternalParseResult::ok( ParseState( result.value(), remainingTokens ) );
+ } else {
+ auto valueRef = static_cast<detail::BoundValueRefBase*>( m_ref.get() );
+ ++remainingTokens;
+ if( !remainingTokens )
+ return InternalParseResult::runtimeError( "Expected argument following " + token.token );
+ auto const &argToken = *remainingTokens;
+ if( argToken.type != TokenType::Argument )
+ return InternalParseResult::runtimeError( "Expected argument following " + token.token );
+ auto result = valueRef->setValue( argToken.token );
+ if( !result )
+ return InternalParseResult( result );
+ if( result.value() == ParseResultType::ShortCircuitAll )
+ return InternalParseResult::ok( ParseState( result.value(), remainingTokens ) );
+ }
+ return InternalParseResult::ok( ParseState( ParseResultType::Matched, ++remainingTokens ) );
+ }
+ }
+ return InternalParseResult::ok( ParseState( ParseResultType::NoMatch, remainingTokens ) );
+ }
+
+ auto validate() const -> Result override {
+ if( m_optNames.empty() )
+ return Result::logicError( "No options supplied to Opt" );
+ for( auto const &name : m_optNames ) {
+ if( name.empty() )
+ return Result::logicError( "Option name cannot be empty" );
+#ifdef CATCH_PLATFORM_WINDOWS
+ if( name[0] != '-' && name[0] != '/' )
+ return Result::logicError( "Option name must begin with '-' or '/'" );
+#else
+ if( name[0] != '-' )
+ return Result::logicError( "Option name must begin with '-'" );
+#endif
+ }
+ return ParserRefImpl::validate();
+ }
+ };
+
+ struct Help : Opt {
+ Help( bool &showHelpFlag )
+ : Opt([&]( bool flag ) {
+ showHelpFlag = flag;
+ return ParserResult::ok( ParseResultType::ShortCircuitAll );
+ })
+ {
+ static_cast<Opt &>( *this )
+ ("display usage information")
+ ["-?"]["-h"]["--help"]
+ .optional();
+ }
+ };
+
+ struct Parser : ParserBase {
+
+ mutable ExeName m_exeName;
+ std::vector<Opt> m_options;
+ std::vector<Arg> m_args;
+
+ auto operator|=( ExeName const &exeName ) -> Parser & {
+ m_exeName = exeName;
+ return *this;
+ }
+
+ auto operator|=( Arg const &arg ) -> Parser & {
+ m_args.push_back(arg);
+ return *this;
+ }
+
+ auto operator|=( Opt const &opt ) -> Parser & {
+ m_options.push_back(opt);
+ return *this;
+ }
+
+ auto operator|=( Parser const &other ) -> Parser & {
+ m_options.insert(m_options.end(), other.m_options.begin(), other.m_options.end());
+ m_args.insert(m_args.end(), other.m_args.begin(), other.m_args.end());
+ return *this;
+ }
+
+ template<typename T>
+ auto operator|( T const &other ) const -> Parser {
+ return Parser( *this ) |= other;
+ }
+
+ // Forward deprecated interface with '+' instead of '|'
+ template<typename T>
+ auto operator+=( T const &other ) -> Parser & { return operator|=( other ); }
+ template<typename T>
+ auto operator+( T const &other ) const -> Parser { return operator|( other ); }
+
+ auto getHelpColumns() const -> std::vector<HelpColumns> {
+ std::vector<HelpColumns> cols;
+ for (auto const &o : m_options) {
+ auto childCols = o.getHelpColumns();
+ cols.insert( cols.end(), childCols.begin(), childCols.end() );
+ }
+ return cols;
+ }
+
+ void writeToStream( std::ostream &os ) const {
+ if (!m_exeName.name().empty()) {
+ os << "usage:\n" << " " << m_exeName.name() << " ";
+ bool required = true, first = true;
+ for( auto const &arg : m_args ) {
+ if (first)
+ first = false;
+ else
+ os << " ";
+ if( arg.isOptional() && required ) {
+ os << "[";
+ required = false;
+ }
+ os << "<" << arg.hint() << ">";
+ if( arg.cardinality() == 0 )
+ os << " ... ";
+ }
+ if( !required )
+ os << "]";
+ if( !m_options.empty() )
+ os << " options";
+ os << "\n\nwhere options are:" << std::endl;
+ }
+
+ auto rows = getHelpColumns();
+ size_t consoleWidth = CATCH_CLARA_CONFIG_CONSOLE_WIDTH;
+ size_t optWidth = 0;
+ for( auto const &cols : rows )
+ optWidth = (std::max)(optWidth, cols.left.size() + 2);
+
+ optWidth = (std::min)(optWidth, consoleWidth/2);
+
+ for( auto const &cols : rows ) {
+ auto row =
+ TextFlow::Column( cols.left ).width( optWidth ).indent( 2 ) +
+ TextFlow::Spacer(4) +
+ TextFlow::Column( cols.right ).width( consoleWidth - 7 - optWidth );
+ os << row << std::endl;
+ }
+ }
+
+ friend auto operator<<( std::ostream &os, Parser const &parser ) -> std::ostream& {
+ parser.writeToStream( os );
+ return os;
+ }
+
+ auto validate() const -> Result override {
+ for( auto const &opt : m_options ) {
+ auto result = opt.validate();
+ if( !result )
+ return result;
+ }
+ for( auto const &arg : m_args ) {
+ auto result = arg.validate();
+ if( !result )
+ return result;
+ }
+ return Result::ok();
+ }
+
+ using ParserBase::parse;
+
+ auto parse( std::string const& exeName, TokenStream const &tokens ) const -> InternalParseResult override {
+
+ struct ParserInfo {
+ ParserBase const* parser = nullptr;
+ size_t count = 0;
+ };
+ const size_t totalParsers = m_options.size() + m_args.size();
+ assert( totalParsers < 512 );
+ // ParserInfo parseInfos[totalParsers]; // <-- this is what we really want to do
+ ParserInfo parseInfos[512];
+
+ {
+ size_t i = 0;
+ for (auto const &opt : m_options) parseInfos[i++].parser = &opt;
+ for (auto const &arg : m_args) parseInfos[i++].parser = &arg;
+ }
+
+ m_exeName.set( exeName );
+
+ auto result = InternalParseResult::ok( ParseState( ParseResultType::NoMatch, tokens ) );
+ while( result.value().remainingTokens() ) {
+ bool tokenParsed = false;
+
+ for( size_t i = 0; i < totalParsers; ++i ) {
+ auto& parseInfo = parseInfos[i];
+ if( parseInfo.parser->cardinality() == 0 || parseInfo.count < parseInfo.parser->cardinality() ) {
+ result = parseInfo.parser->parse(exeName, result.value().remainingTokens());
+ if (!result)
+ return result;
+ if (result.value().type() != ParseResultType::NoMatch) {
+ tokenParsed = true;
+ ++parseInfo.count;
+ break;
+ }
+ }
+ }
+
+ if( result.value().type() == ParseResultType::ShortCircuitAll )
+ return result;
+ if( !tokenParsed )
+ return InternalParseResult::runtimeError( "Unrecognised token: " + result.value().remainingTokens()->token );
+ }
+ // !TBD Check missing required options
+ return result;
+ }
+ };
+
+ template<typename DerivedT>
+ template<typename T>
+ auto ComposableParserImpl<DerivedT>::operator|( T const &other ) const -> Parser {
+ return Parser() | static_cast<DerivedT const &>( *this ) | other;
+ }
+} // namespace detail
+
+// A Combined parser
+using detail::Parser;
+
+// A parser for options
+using detail::Opt;
+
+// A parser for arguments
+using detail::Arg;
+
+// Wrapper for argc, argv from main()
+using detail::Args;
+
+// Specifies the name of the executable
+using detail::ExeName;
+
+// Convenience wrapper for option parser that specifies the help option
+using detail::Help;
+
+// enum of result types from a parse
+using detail::ParseResultType;
+
+// Result type for parser operation
+using detail::ParserResult;
+
+}} // namespace Catch::clara
+
+// end clara.hpp
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// Restore Clara's value for console width, if present
+#ifdef CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH
+#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH
+#undef CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH
+#endif
+
+// end catch_clara.h
+namespace Catch {
+
+ clara::Parser makeCommandLineParser( ConfigData& config );
+
+} // end namespace Catch
+
+// end catch_commandline.h
+#include <fstream>
+#include <ctime>
+
+namespace Catch {
+
+ clara::Parser makeCommandLineParser( ConfigData& config ) {
+
+ using namespace clara;
+
+ auto const setWarning = [&]( std::string const& warning ) {
+ auto warningSet = [&]() {
+ if( warning == "NoAssertions" )
+ return WarnAbout::NoAssertions;
+
+ if ( warning == "NoTests" )
+ return WarnAbout::NoTests;
+
+ return WarnAbout::Nothing;
+ }();
+
+ if (warningSet == WarnAbout::Nothing)
+ return ParserResult::runtimeError( "Unrecognised warning: '" + warning + "'" );
+ config.warnings = static_cast<WarnAbout::What>( config.warnings | warningSet );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const loadTestNamesFromFile = [&]( std::string const& filename ) {
+ std::ifstream f( filename.c_str() );
+ if( !f.is_open() )
+ return ParserResult::runtimeError( "Unable to load input file: '" + filename + "'" );
+
+ std::string line;
+ while( std::getline( f, line ) ) {
+ line = trim(line);
+ if( !line.empty() && !startsWith( line, '#' ) ) {
+ if( !startsWith( line, '"' ) )
+ line = '"' + line + '"';
+ config.testsOrTags.push_back( line + ',' );
+ }
+ }
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setTestOrder = [&]( std::string const& order ) {
+ if( startsWith( "declared", order ) )
+ config.runOrder = RunTests::InDeclarationOrder;
+ else if( startsWith( "lexical", order ) )
+ config.runOrder = RunTests::InLexicographicalOrder;
+ else if( startsWith( "random", order ) )
+ config.runOrder = RunTests::InRandomOrder;
+ else
+ return clara::ParserResult::runtimeError( "Unrecognised ordering: '" + order + "'" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setRngSeed = [&]( std::string const& seed ) {
+ if( seed != "time" )
+ return clara::detail::convertInto( seed, config.rngSeed );
+ config.rngSeed = static_cast<unsigned int>( std::time(nullptr) );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setColourUsage = [&]( std::string const& useColour ) {
+ auto mode = toLower( useColour );
+
+ if( mode == "yes" )
+ config.useColour = UseColour::Yes;
+ else if( mode == "no" )
+ config.useColour = UseColour::No;
+ else if( mode == "auto" )
+ config.useColour = UseColour::Auto;
+ else
+ return ParserResult::runtimeError( "colour mode must be one of: auto, yes or no. '" + useColour + "' not recognised" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setWaitForKeypress = [&]( std::string const& keypress ) {
+ auto keypressLc = toLower( keypress );
+ if( keypressLc == "start" )
+ config.waitForKeypress = WaitForKeypress::BeforeStart;
+ else if( keypressLc == "exit" )
+ config.waitForKeypress = WaitForKeypress::BeforeExit;
+ else if( keypressLc == "both" )
+ config.waitForKeypress = WaitForKeypress::BeforeStartAndExit;
+ else
+ return ParserResult::runtimeError( "keypress argument must be one of: start, exit or both. '" + keypress + "' not recognised" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setVerbosity = [&]( std::string const& verbosity ) {
+ auto lcVerbosity = toLower( verbosity );
+ if( lcVerbosity == "quiet" )
+ config.verbosity = Verbosity::Quiet;
+ else if( lcVerbosity == "normal" )
+ config.verbosity = Verbosity::Normal;
+ else if( lcVerbosity == "high" )
+ config.verbosity = Verbosity::High;
+ else
+ return ParserResult::runtimeError( "Unrecognised verbosity, '" + verbosity + "'" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setReporter = [&]( std::string const& reporter ) {
+ IReporterRegistry::FactoryMap const& factories = getRegistryHub().getReporterRegistry().getFactories();
+
+ auto lcReporter = toLower( reporter );
+ auto result = factories.find( lcReporter );
+
+ if( factories.end() != result )
+ config.reporterName = lcReporter;
+ else
+ return ParserResult::runtimeError( "Unrecognized reporter, '" + reporter + "'. Check available with --list-reporters" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+
+ auto cli
+ = ExeName( config.processName )
+ | Help( config.showHelp )
+ | Opt( config.listTests )
+ ["-l"]["--list-tests"]
+ ( "list all/matching test cases" )
+ | Opt( config.listTags )
+ ["-t"]["--list-tags"]
+ ( "list all/matching tags" )
+ | Opt( config.showSuccessfulTests )
+ ["-s"]["--success"]
+ ( "include successful tests in output" )
+ | Opt( config.shouldDebugBreak )
+ ["-b"]["--break"]
+ ( "break into debugger on failure" )
+ | Opt( config.noThrow )
+ ["-e"]["--nothrow"]
+ ( "skip exception tests" )
+ | Opt( config.showInvisibles )
+ ["-i"]["--invisibles"]
+ ( "show invisibles (tabs, newlines)" )
+ | Opt( config.outputFilename, "filename" )
+ ["-o"]["--out"]
+ ( "output filename" )
+ | Opt( setReporter, "name" )
+ ["-r"]["--reporter"]
+ ( "reporter to use (defaults to console)" )
+ | Opt( config.name, "name" )
+ ["-n"]["--name"]
+ ( "suite name" )
+ | Opt( [&]( bool ){ config.abortAfter = 1; } )
+ ["-a"]["--abort"]
+ ( "abort at first failure" )
+ | Opt( [&]( int x ){ config.abortAfter = x; }, "no. failures" )
+ ["-x"]["--abortx"]
+ ( "abort after x failures" )
+ | Opt( setWarning, "warning name" )
+ ["-w"]["--warn"]
+ ( "enable warnings" )
+ | Opt( [&]( bool flag ) { config.showDurations = flag ? ShowDurations::Always : ShowDurations::Never; }, "yes|no" )
+ ["-d"]["--durations"]
+ ( "show test durations" )
+ | Opt( loadTestNamesFromFile, "filename" )
+ ["-f"]["--input-file"]
+ ( "load test names to run from a file" )
+ | Opt( config.filenamesAsTags )
+ ["-#"]["--filenames-as-tags"]
+ ( "adds a tag for the filename" )
+ | Opt( config.sectionsToRun, "section name" )
+ ["-c"]["--section"]
+ ( "specify section to run" )
+ | Opt( setVerbosity, "quiet|normal|high" )
+ ["-v"]["--verbosity"]
+ ( "set output verbosity" )
+ | Opt( config.listTestNamesOnly )
+ ["--list-test-names-only"]
+ ( "list all/matching test cases names only" )
+ | Opt( config.listReporters )
+ ["--list-reporters"]
+ ( "list all reporters" )
+ | Opt( setTestOrder, "decl|lex|rand" )
+ ["--order"]
+ ( "test case order (defaults to decl)" )
+ | Opt( setRngSeed, "'time'|number" )
+ ["--rng-seed"]
+ ( "set a specific seed for random numbers" )
+ | Opt( setColourUsage, "yes|no" )
+ ["--use-colour"]
+ ( "should output be colourised" )
+ | Opt( config.libIdentify )
+ ["--libidentify"]
+ ( "report name and version according to libidentify standard" )
+ | Opt( setWaitForKeypress, "start|exit|both" )
+ ["--wait-for-keypress"]
+ ( "waits for a keypress before exiting" )
+ | Opt( config.benchmarkSamples, "samples" )
+ ["--benchmark-samples"]
+ ( "number of samples to collect (default: 100)" )
+ | Opt( config.benchmarkResamples, "resamples" )
+ ["--benchmark-resamples"]
+ ( "number of resamples for the bootstrap (default: 100000)" )
+ | Opt( config.benchmarkConfidenceInterval, "confidence interval" )
+ ["--benchmark-confidence-interval"]
+ ( "confidence interval for the bootstrap (between 0 and 1, default: 0.95)" )
+ | Opt( config.benchmarkNoAnalysis )
+ ["--benchmark-no-analysis"]
+ ( "perform only measurements; do not perform any analysis" )
+ | Arg( config.testsOrTags, "test name|pattern|tags" )
+ ( "which test or tests to use" );
+
+ return cli;
+ }
+
+} // end namespace Catch
+// end catch_commandline.cpp
+// start catch_common.cpp
+
+#include <cstring>
+#include <ostream>
+
+namespace Catch {
+
+ bool SourceLineInfo::empty() const noexcept {
+ return file[0] == '\0';
+ }
+ bool SourceLineInfo::operator == ( SourceLineInfo const& other ) const noexcept {
+ return line == other.line && (file == other.file || std::strcmp(file, other.file) == 0);
+ }
+ bool SourceLineInfo::operator < ( SourceLineInfo const& other ) const noexcept {
+ // We can assume that the same file will usually have the same pointer.
+ // Thus, if the pointers are the same, there is no point in calling the strcmp
+ return line < other.line || ( line == other.line && file != other.file && (std::strcmp(file, other.file) < 0));
+ }
+
+ std::ostream& operator << ( std::ostream& os, SourceLineInfo const& info ) {
+#ifndef __GNUG__
+ os << info.file << '(' << info.line << ')';
+#else
+ os << info.file << ':' << info.line;
+#endif
+ return os;
+ }
+
+ std::string StreamEndStop::operator+() const {
+ return std::string();
+ }
+
+ NonCopyable::NonCopyable() = default;
+ NonCopyable::~NonCopyable() = default;
+
+}
+// end catch_common.cpp
+// start catch_config.cpp
+
+namespace Catch {
+
+ Config::Config( ConfigData const& data )
+ : m_data( data ),
+ m_stream( openStream() )
+ {
+ TestSpecParser parser(ITagAliasRegistry::get());
+ if (!data.testsOrTags.empty()) {
+ m_hasTestFilters = true;
+ for( auto const& testOrTags : data.testsOrTags )
+ parser.parse( testOrTags );
+ }
+ m_testSpec = parser.testSpec();
+ }
+
+ std::string const& Config::getFilename() const {
+ return m_data.outputFilename ;
+ }
+
+ bool Config::listTests() const { return m_data.listTests; }
+ bool Config::listTestNamesOnly() const { return m_data.listTestNamesOnly; }
+ bool Config::listTags() const { return m_data.listTags; }
+ bool Config::listReporters() const { return m_data.listReporters; }
+
+ std::string Config::getProcessName() const { return m_data.processName; }
+ std::string const& Config::getReporterName() const { return m_data.reporterName; }
+
+ std::vector<std::string> const& Config::getTestsOrTags() const { return m_data.testsOrTags; }
+ std::vector<std::string> const& Config::getSectionsToRun() const { return m_data.sectionsToRun; }
+
+ TestSpec const& Config::testSpec() const { return m_testSpec; }
+ bool Config::hasTestFilters() const { return m_hasTestFilters; }
+
+ bool Config::showHelp() const { return m_data.showHelp; }
+
+ // IConfig interface
+ bool Config::allowThrows() const { return !m_data.noThrow; }
+ std::ostream& Config::stream() const { return m_stream->stream(); }
+ std::string Config::name() const { return m_data.name.empty() ? m_data.processName : m_data.name; }
+ bool Config::includeSuccessfulResults() const { return m_data.showSuccessfulTests; }
+ bool Config::warnAboutMissingAssertions() const { return !!(m_data.warnings & WarnAbout::NoAssertions); }
+ bool Config::warnAboutNoTests() const { return !!(m_data.warnings & WarnAbout::NoTests); }
+ ShowDurations::OrNot Config::showDurations() const { return m_data.showDurations; }
+ RunTests::InWhatOrder Config::runOrder() const { return m_data.runOrder; }
+ unsigned int Config::rngSeed() const { return m_data.rngSeed; }
+ UseColour::YesOrNo Config::useColour() const { return m_data.useColour; }
+ bool Config::shouldDebugBreak() const { return m_data.shouldDebugBreak; }
+ int Config::abortAfter() const { return m_data.abortAfter; }
+ bool Config::showInvisibles() const { return m_data.showInvisibles; }
+ Verbosity Config::verbosity() const { return m_data.verbosity; }
+
+ bool Config::benchmarkNoAnalysis() const { return m_data.benchmarkNoAnalysis; }
+ int Config::benchmarkSamples() const { return m_data.benchmarkSamples; }
+ double Config::benchmarkConfidenceInterval() const { return m_data.benchmarkConfidenceInterval; }
+ unsigned int Config::benchmarkResamples() const { return m_data.benchmarkResamples; }
+
+ IStream const* Config::openStream() {
+ return Catch::makeStream(m_data.outputFilename);
+ }
+
+} // end namespace Catch
+// end catch_config.cpp
+// start catch_console_colour.cpp
+
+#if defined(__clang__)
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wexit-time-destructors"
+#endif
+
+// start catch_errno_guard.h
+
+namespace Catch {
+
+ class ErrnoGuard {
+ public:
+ ErrnoGuard();
+ ~ErrnoGuard();
+ private:
+ int m_oldErrno;
+ };
+
+}
+
+// end catch_errno_guard.h
+#include <sstream>
+
+namespace Catch {
+ namespace {
+
+ struct IColourImpl {
+ virtual ~IColourImpl() = default;
+ virtual void use( Colour::Code _colourCode ) = 0;
+ };
+
+ struct NoColourImpl : IColourImpl {
+ void use( Colour::Code ) {}
+
+ static IColourImpl* instance() {
+ static NoColourImpl s_instance;
+ return &s_instance;
+ }
+ };
+
+ } // anon namespace
+} // namespace Catch
+
+#if !defined( CATCH_CONFIG_COLOUR_NONE ) && !defined( CATCH_CONFIG_COLOUR_WINDOWS ) && !defined( CATCH_CONFIG_COLOUR_ANSI )
+# ifdef CATCH_PLATFORM_WINDOWS
+# define CATCH_CONFIG_COLOUR_WINDOWS
+# else
+# define CATCH_CONFIG_COLOUR_ANSI
+# endif
+#endif
+
+#if defined ( CATCH_CONFIG_COLOUR_WINDOWS ) /////////////////////////////////////////
+
+namespace Catch {
+namespace {
+
+ class Win32ColourImpl : public IColourImpl {
+ public:
+ Win32ColourImpl() : stdoutHandle( GetStdHandle(STD_OUTPUT_HANDLE) )
+ {
+ CONSOLE_SCREEN_BUFFER_INFO csbiInfo;
+ GetConsoleScreenBufferInfo( stdoutHandle, &csbiInfo );
+ originalForegroundAttributes = csbiInfo.wAttributes & ~( BACKGROUND_GREEN | BACKGROUND_RED | BACKGROUND_BLUE | BACKGROUND_INTENSITY );
+ originalBackgroundAttributes = csbiInfo.wAttributes & ~( FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_BLUE | FOREGROUND_INTENSITY );
+ }
+
+ void use( Colour::Code _colourCode ) override {
+ switch( _colourCode ) {
+ case Colour::None: return setTextAttribute( originalForegroundAttributes );
+ case Colour::White: return setTextAttribute( FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_BLUE );
+ case Colour::Red: return setTextAttribute( FOREGROUND_RED );
+ case Colour::Green: return setTextAttribute( FOREGROUND_GREEN );
+ case Colour::Blue: return setTextAttribute( FOREGROUND_BLUE );
+ case Colour::Cyan: return setTextAttribute( FOREGROUND_BLUE | FOREGROUND_GREEN );
+ case Colour::Yellow: return setTextAttribute( FOREGROUND_RED | FOREGROUND_GREEN );
+ case Colour::Grey: return setTextAttribute( 0 );
+
+ case Colour::LightGrey: return setTextAttribute( FOREGROUND_INTENSITY );
+ case Colour::BrightRed: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_RED );
+ case Colour::BrightGreen: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_GREEN );
+ case Colour::BrightWhite: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_BLUE );
+ case Colour::BrightYellow: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_RED | FOREGROUND_GREEN );
+
+ case Colour::Bright: CATCH_INTERNAL_ERROR( "not a colour" );
+
+ default:
+ CATCH_ERROR( "Unknown colour requested" );
+ }
+ }
+
+ private:
+ void setTextAttribute( WORD _textAttribute ) {
+ SetConsoleTextAttribute( stdoutHandle, _textAttribute | originalBackgroundAttributes );
+ }
+ HANDLE stdoutHandle;
+ WORD originalForegroundAttributes;
+ WORD originalBackgroundAttributes;
+ };
+
+ IColourImpl* platformColourInstance() {
+ static Win32ColourImpl s_instance;
+
+ IConfigPtr config = getCurrentContext().getConfig();
+ UseColour::YesOrNo colourMode = config
+ ? config->useColour()
+ : UseColour::Auto;
+ if( colourMode == UseColour::Auto )
+ colourMode = UseColour::Yes;
+ return colourMode == UseColour::Yes
+ ? &s_instance
+ : NoColourImpl::instance();
+ }
+
+} // end anon namespace
+} // end namespace Catch
+
+#elif defined( CATCH_CONFIG_COLOUR_ANSI ) //////////////////////////////////////
+
+#include <unistd.h>
+
+namespace Catch {
+namespace {
+
+ // use POSIX/ ANSI console terminal codes
+ // Thanks to Adam Strzelecki for original contribution
+ // (http://github.com/nanoant)
+ // https://github.com/philsquared/Catch/pull/131
+ class PosixColourImpl : public IColourImpl {
+ public:
+ void use( Colour::Code _colourCode ) override {
+ switch( _colourCode ) {
+ case Colour::None:
+ case Colour::White: return setColour( "[0m" );
+ case Colour::Red: return setColour( "[0;31m" );
+ case Colour::Green: return setColour( "[0;32m" );
+ case Colour::Blue: return setColour( "[0;34m" );
+ case Colour::Cyan: return setColour( "[0;36m" );
+ case Colour::Yellow: return setColour( "[0;33m" );
+ case Colour::Grey: return setColour( "[1;30m" );
+
+ case Colour::LightGrey: return setColour( "[0;37m" );
+ case Colour::BrightRed: return setColour( "[1;31m" );
+ case Colour::BrightGreen: return setColour( "[1;32m" );
+ case Colour::BrightWhite: return setColour( "[1;37m" );
+ case Colour::BrightYellow: return setColour( "[1;33m" );
+
+ case Colour::Bright: CATCH_INTERNAL_ERROR( "not a colour" );
+ default: CATCH_INTERNAL_ERROR( "Unknown colour requested" );
+ }
+ }
+ static IColourImpl* instance() {
+ static PosixColourImpl s_instance;
+ return &s_instance;
+ }
+
+ private:
+ void setColour( const char* _escapeCode ) {
+ getCurrentContext().getConfig()->stream()
+ << '\033' << _escapeCode;
+ }
+ };
+
+ bool useColourOnPlatform() {
+ return
+#ifdef CATCH_PLATFORM_MAC
+ !isDebuggerActive() &&
+#endif
+#if !(defined(__DJGPP__) && defined(__STRICT_ANSI__))
+ isatty(STDOUT_FILENO)
+#else
+ false
+#endif
+ ;
+ }
+ IColourImpl* platformColourInstance() {
+ ErrnoGuard guard;
+ IConfigPtr config = getCurrentContext().getConfig();
+ UseColour::YesOrNo colourMode = config
+ ? config->useColour()
+ : UseColour::Auto;
+ if( colourMode == UseColour::Auto )
+ colourMode = useColourOnPlatform()
+ ? UseColour::Yes
+ : UseColour::No;
+ return colourMode == UseColour::Yes
+ ? PosixColourImpl::instance()
+ : NoColourImpl::instance();
+ }
+
+} // end anon namespace
+} // end namespace Catch
+
+#else // not Windows or ANSI ///////////////////////////////////////////////
+
+namespace Catch {
+
+ static IColourImpl* platformColourInstance() { return NoColourImpl::instance(); }
+
+} // end namespace Catch
+
+#endif // Windows/ ANSI/ None
+
+namespace Catch {
+
+ Colour::Colour( Code _colourCode ) { use( _colourCode ); }
+ Colour::Colour( Colour&& rhs ) noexcept {
+ m_moved = rhs.m_moved;
+ rhs.m_moved = true;
+ }
+ Colour& Colour::operator=( Colour&& rhs ) noexcept {
+ m_moved = rhs.m_moved;
+ rhs.m_moved = true;
+ return *this;
+ }
+
+ Colour::~Colour(){ if( !m_moved ) use( None ); }
+
+ void Colour::use( Code _colourCode ) {
+ static IColourImpl* impl = platformColourInstance();
+ // Strictly speaking, this cannot possibly happen.
+ // However, under some conditions it does happen (see #1626),
+ // and this change is small enough that we can let practicality
+ // triumph over purity in this case.
+ if (impl != NULL) {
+ impl->use( _colourCode );
+ }
+ }
+
+ std::ostream& operator << ( std::ostream& os, Colour const& ) {
+ return os;
+ }
+
+} // end namespace Catch
+
+#if defined(__clang__)
+# pragma clang diagnostic pop
+#endif
+
+// end catch_console_colour.cpp
+// start catch_context.cpp
+
+namespace Catch {
+
+ class Context : public IMutableContext, NonCopyable {
+
+ public: // IContext
+ IResultCapture* getResultCapture() override {
+ return m_resultCapture;
+ }
+ IRunner* getRunner() override {
+ return m_runner;
+ }
+
+ IConfigPtr const& getConfig() const override {
+ return m_config;
+ }
+
+ ~Context() override;
+
+ public: // IMutableContext
+ void setResultCapture( IResultCapture* resultCapture ) override {
+ m_resultCapture = resultCapture;
+ }
+ void setRunner( IRunner* runner ) override {
+ m_runner = runner;
+ }
+ void setConfig( IConfigPtr const& config ) override {
+ m_config = config;
+ }
+
+ friend IMutableContext& getCurrentMutableContext();
+
+ private:
+ IConfigPtr m_config;
+ IRunner* m_runner = nullptr;
+ IResultCapture* m_resultCapture = nullptr;
+ };
+
+ IMutableContext *IMutableContext::currentContext = nullptr;
+
+ void IMutableContext::createContext()
+ {
+ currentContext = new Context();
+ }
+
+ void cleanUpContext() {
+ delete IMutableContext::currentContext;
+ IMutableContext::currentContext = nullptr;
+ }
+ IContext::~IContext() = default;
+ IMutableContext::~IMutableContext() = default;
+ Context::~Context() = default;
+}
+// end catch_context.cpp
+// start catch_debug_console.cpp
+
+// start catch_debug_console.h
+
+#include <string>
+
+namespace Catch {
+ void writeToDebugConsole( std::string const& text );
+}
+
+// end catch_debug_console.h
+#ifdef CATCH_PLATFORM_WINDOWS
+
+ namespace Catch {
+ void writeToDebugConsole( std::string const& text ) {
+ ::OutputDebugStringA( text.c_str() );
+ }
+ }
+
+#else
+
+ namespace Catch {
+ void writeToDebugConsole( std::string const& text ) {
+ // !TBD: Need a version for Mac/ XCode and other IDEs
+ Catch::cout() << text;
+ }
+ }
+
+#endif // Platform
+// end catch_debug_console.cpp
+// start catch_debugger.cpp
+
+#ifdef CATCH_PLATFORM_MAC
+
+# include <assert.h>
+# include <stdbool.h>
+# include <sys/types.h>
+# include <unistd.h>
+# include <cstddef>
+# include <ostream>
+
+#ifdef __apple_build_version__
+ // These headers will only compile with AppleClang (XCode)
+ // For other compilers (Clang, GCC, ... ) we need to exclude them
+# include <sys/sysctl.h>
+#endif
+
+ namespace Catch {
+ #ifdef __apple_build_version__
+ // The following function is taken directly from the following technical note:
+ // https://developer.apple.com/library/archive/qa/qa1361/_index.html
+
+ // Returns true if the current process is being debugged (either
+ // running under the debugger or has a debugger attached post facto).
+ bool isDebuggerActive(){
+ int mib[4];
+ struct kinfo_proc info;
+ std::size_t size;
+
+ // Initialize the flags so that, if sysctl fails for some bizarre
+ // reason, we get a predictable result.
+
+ info.kp_proc.p_flag = 0;
+
+ // Initialize mib, which tells sysctl the info we want, in this case
+ // we're looking for information about a specific process ID.
+
+ mib[0] = CTL_KERN;
+ mib[1] = KERN_PROC;
+ mib[2] = KERN_PROC_PID;
+ mib[3] = getpid();
+
+ // Call sysctl.
+
+ size = sizeof(info);
+ if( sysctl(mib, sizeof(mib) / sizeof(*mib), &info, &size, nullptr, 0) != 0 ) {
+ Catch::cerr() << "\n** Call to sysctl failed - unable to determine if debugger is active **\n" << std::endl;
+ return false;
+ }
+
+ // We're being debugged if the P_TRACED flag is set.
+
+ return ( (info.kp_proc.p_flag & P_TRACED) != 0 );
+ }
+ #else
+ bool isDebuggerActive() {
+ // We need to find another way to determine this for non-appleclang compilers on macOS
+ return false;
+ }
+ #endif
+ } // namespace Catch
+
+#elif defined(CATCH_PLATFORM_LINUX)
+ #include <fstream>
+ #include <string>
+
+ namespace Catch{
+ // The standard POSIX way of detecting a debugger is to attempt to
+ // ptrace() the process, but this needs to be done from a child and not
+ // this process itself to still allow attaching to this process later
+ // if wanted, so is rather heavy. Under Linux we have the PID of the
+ // "debugger" (which doesn't need to be gdb, of course, it could also
+ // be strace, for example) in /proc/$PID/status, so just get it from
+ // there instead.
+ bool isDebuggerActive(){
+ // Libstdc++ has a bug, where std::ifstream sets errno to 0
+ // This way our users can properly assert over errno values
+ ErrnoGuard guard;
+ std::ifstream in("/proc/self/status");
+ for( std::string line; std::getline(in, line); ) {
+ static const int PREFIX_LEN = 11;
+ if( line.compare(0, PREFIX_LEN, "TracerPid:\t") == 0 ) {
+ // We're traced if the PID is not 0 and no other PID starts
+ // with 0 digit, so it's enough to check for just a single
+ // character.
+ return line.length() > PREFIX_LEN && line[PREFIX_LEN] != '0';
+ }
+ }
+
+ return false;
+ }
+ } // namespace Catch
+#elif defined(_MSC_VER)
+ extern "C" __declspec(dllimport) int __stdcall IsDebuggerPresent();
+ namespace Catch {
+ bool isDebuggerActive() {
+ return IsDebuggerPresent() != 0;
+ }
+ }
+#elif defined(__MINGW32__)
+ extern "C" __declspec(dllimport) int __stdcall IsDebuggerPresent();
+ namespace Catch {
+ bool isDebuggerActive() {
+ return IsDebuggerPresent() != 0;
+ }
+ }
+#else
+ namespace Catch {
+ bool isDebuggerActive() { return false; }
+ }
+#endif // Platform
+// end catch_debugger.cpp
+// start catch_decomposer.cpp
+
+namespace Catch {
+
+ ITransientExpression::~ITransientExpression() = default;
+
+ void formatReconstructedExpression( std::ostream &os, std::string const& lhs, StringRef op, std::string const& rhs ) {
+ if( lhs.size() + rhs.size() < 40 &&
+ lhs.find('\n') == std::string::npos &&
+ rhs.find('\n') == std::string::npos )
+ os << lhs << " " << op << " " << rhs;
+ else
+ os << lhs << "\n" << op << "\n" << rhs;
+ }
+}
+// end catch_decomposer.cpp
+// start catch_enforce.cpp
+
+#include <stdexcept>
+
+namespace Catch {
+#if defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) && !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS_CUSTOM_HANDLER)
+ [[noreturn]]
+ void throw_exception(std::exception const& e) {
+ Catch::cerr() << "Catch will terminate because it needed to throw an exception.\n"
+ << "The message was: " << e.what() << '\n';
+ std::terminate();
+ }
+#endif
+
+ [[noreturn]]
+ void throw_logic_error(std::string const& msg) {
+ throw_exception(std::logic_error(msg));
+ }
+
+ [[noreturn]]
+ void throw_domain_error(std::string const& msg) {
+ throw_exception(std::domain_error(msg));
+ }
+
+ [[noreturn]]
+ void throw_runtime_error(std::string const& msg) {
+ throw_exception(std::runtime_error(msg));
+ }
+
+} // namespace Catch;
+// end catch_enforce.cpp
+// start catch_enum_values_registry.cpp
+// start catch_enum_values_registry.h
+
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ namespace Detail {
+
+ std::unique_ptr<EnumInfo> makeEnumInfo( StringRef enumName, StringRef allValueNames, std::vector<int> const& values );
+
+ class EnumValuesRegistry : public IMutableEnumValuesRegistry {
+
+ std::vector<std::unique_ptr<EnumInfo>> m_enumInfos;
+
+ EnumInfo const& registerEnum( StringRef enumName, StringRef allEnums, std::vector<int> const& values) override;
+ };
+
+ std::vector<std::string> parseEnums( StringRef enums );
+
+ } // Detail
+
+} // Catch
+
+// end catch_enum_values_registry.h
+
+#include <map>
+#include <cassert>
+
+namespace Catch {
+
+ IMutableEnumValuesRegistry::~IMutableEnumValuesRegistry() {}
+
+ namespace Detail {
+
+ std::vector<std::string> parseEnums( StringRef enums ) {
+ auto enumValues = splitStringRef( enums, ',' );
+ std::vector<std::string> parsed;
+ parsed.reserve( enumValues.size() );
+ for( auto const& enumValue : enumValues ) {
+ auto identifiers = splitStringRef( enumValue, ':' );
+ parsed.push_back( Catch::trim( identifiers.back() ) );
+ }
+ return parsed;
+ }
+
+ EnumInfo::~EnumInfo() {}
+
+ StringRef EnumInfo::lookup( int value ) const {
+ for( auto const& valueToName : m_values ) {
+ if( valueToName.first == value )
+ return valueToName.second;
+ }
+ return "{** unexpected enum value **}";
+ }
+
+ std::unique_ptr<EnumInfo> makeEnumInfo( StringRef enumName, StringRef allValueNames, std::vector<int> const& values ) {
+ std::unique_ptr<EnumInfo> enumInfo( new EnumInfo );
+ enumInfo->m_name = enumName;
+ enumInfo->m_values.reserve( values.size() );
+
+ const auto valueNames = Catch::Detail::parseEnums( allValueNames );
+ assert( valueNames.size() == values.size() );
+ std::size_t i = 0;
+ for( auto value : values )
+ enumInfo->m_values.push_back({ value, valueNames[i++] });
+
+ return enumInfo;
+ }
+
+ EnumInfo const& EnumValuesRegistry::registerEnum( StringRef enumName, StringRef allValueNames, std::vector<int> const& values ) {
+ auto enumInfo = makeEnumInfo( enumName, allValueNames, values );
+ EnumInfo* raw = enumInfo.get();
+ m_enumInfos.push_back( std::move( enumInfo ) );
+ return *raw;
+ }
+
+ } // Detail
+} // Catch
+
+// end catch_enum_values_registry.cpp
+// start catch_errno_guard.cpp
+
+#include <cerrno>
+
+namespace Catch {
+ ErrnoGuard::ErrnoGuard():m_oldErrno(errno){}
+ ErrnoGuard::~ErrnoGuard() { errno = m_oldErrno; }
+}
+// end catch_errno_guard.cpp
+// start catch_exception_translator_registry.cpp
+
+// start catch_exception_translator_registry.h
+
+#include <vector>
+#include <string>
+#include <memory>
+
+namespace Catch {
+
+ class ExceptionTranslatorRegistry : public IExceptionTranslatorRegistry {
+ public:
+ ~ExceptionTranslatorRegistry();
+ virtual void registerTranslator( const IExceptionTranslator* translator );
+ std::string translateActiveException() const override;
+ std::string tryTranslators() const;
+
+ private:
+ std::vector<std::unique_ptr<IExceptionTranslator const>> m_translators;
+ };
+}
+
+// end catch_exception_translator_registry.h
+#ifdef __OBJC__
+#import "Foundation/Foundation.h"
+#endif
+
+namespace Catch {
+
+ ExceptionTranslatorRegistry::~ExceptionTranslatorRegistry() {
+ }
+
+ void ExceptionTranslatorRegistry::registerTranslator( const IExceptionTranslator* translator ) {
+ m_translators.push_back( std::unique_ptr<const IExceptionTranslator>( translator ) );
+ }
+
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ std::string ExceptionTranslatorRegistry::translateActiveException() const {
+ try {
+#ifdef __OBJC__
+ // In Objective-C try objective-c exceptions first
+ @try {
+ return tryTranslators();
+ }
+ @catch (NSException *exception) {
+ return Catch::Detail::stringify( [exception description] );
+ }
+#else
+ // Compiling a mixed mode project with MSVC means that CLR
+ // exceptions will be caught in (...) as well. However, these
+ // do not fill-in std::current_exception and thus lead to crash
+ // when attempting rethrow.
+ // /EHa switch also causes structured exceptions to be caught
+ // here, but they fill-in current_exception properly, so
+ // at worst the output should be a little weird, instead of
+ // causing a crash.
+ if (std::current_exception() == nullptr) {
+ return "Non C++ exception. Possibly a CLR exception.";
+ }
+ return tryTranslators();
+#endif
+ }
+ catch( TestFailureException& ) {
+ std::rethrow_exception(std::current_exception());
+ }
+ catch( std::exception& ex ) {
+ return ex.what();
+ }
+ catch( std::string& msg ) {
+ return msg;
+ }
+ catch( const char* msg ) {
+ return msg;
+ }
+ catch(...) {
+ return "Unknown exception";
+ }
+ }
+
+ std::string ExceptionTranslatorRegistry::tryTranslators() const {
+ if (m_translators.empty()) {
+ std::rethrow_exception(std::current_exception());
+ } else {
+ return m_translators[0]->translate(m_translators.begin() + 1, m_translators.end());
+ }
+ }
+
+#else // ^^ Exceptions are enabled // Exceptions are disabled vv
+ std::string ExceptionTranslatorRegistry::translateActiveException() const {
+ CATCH_INTERNAL_ERROR("Attempted to translate active exception under CATCH_CONFIG_DISABLE_EXCEPTIONS!");
+ }
+
+ std::string ExceptionTranslatorRegistry::tryTranslators() const {
+ CATCH_INTERNAL_ERROR("Attempted to use exception translators under CATCH_CONFIG_DISABLE_EXCEPTIONS!");
+ }
+#endif
+
+}
+// end catch_exception_translator_registry.cpp
+// start catch_fatal_condition.cpp
+
+#if defined(__GNUC__)
+# pragma GCC diagnostic push
+# pragma GCC diagnostic ignored "-Wmissing-field-initializers"
+#endif
+
+#if defined( CATCH_CONFIG_WINDOWS_SEH ) || defined( CATCH_CONFIG_POSIX_SIGNALS )
+
+namespace {
+ // Report the error condition
+ void reportFatal( char const * const message ) {
+ Catch::getCurrentContext().getResultCapture()->handleFatalErrorCondition( message );
+ }
+}
+
+#endif // signals/SEH handling
+
+#if defined( CATCH_CONFIG_WINDOWS_SEH )
+
+namespace Catch {
+ struct SignalDefs { DWORD id; const char* name; };
+
+ // There is no 1-1 mapping between signals and windows exceptions.
+ // Windows can easily distinguish between SO and SigSegV,
+ // but SigInt, SigTerm, etc are handled differently.
+ static SignalDefs signalDefs[] = {
+ { static_cast<DWORD>(EXCEPTION_ILLEGAL_INSTRUCTION), "SIGILL - Illegal instruction signal" },
+ { static_cast<DWORD>(EXCEPTION_STACK_OVERFLOW), "SIGSEGV - Stack overflow" },
+ { static_cast<DWORD>(EXCEPTION_ACCESS_VIOLATION), "SIGSEGV - Segmentation violation signal" },
+ { static_cast<DWORD>(EXCEPTION_INT_DIVIDE_BY_ZERO), "Divide by zero error" },
+ };
+
+ LONG CALLBACK FatalConditionHandler::handleVectoredException(PEXCEPTION_POINTERS ExceptionInfo) {
+ for (auto const& def : signalDefs) {
+ if (ExceptionInfo->ExceptionRecord->ExceptionCode == def.id) {
+ reportFatal(def.name);
+ }
+ }
+ // If its not an exception we care about, pass it along.
+ // This stops us from eating debugger breaks etc.
+ return EXCEPTION_CONTINUE_SEARCH;
+ }
+
+ FatalConditionHandler::FatalConditionHandler() {
+ isSet = true;
+ // 32k seems enough for Catch to handle stack overflow,
+ // but the value was found experimentally, so there is no strong guarantee
+ guaranteeSize = 32 * 1024;
+ exceptionHandlerHandle = nullptr;
+ // Register as first handler in current chain
+ exceptionHandlerHandle = AddVectoredExceptionHandler(1, handleVectoredException);
+ // Pass in guarantee size to be filled
+ SetThreadStackGuarantee(&guaranteeSize);
+ }
+
+ void FatalConditionHandler::reset() {
+ if (isSet) {
+ RemoveVectoredExceptionHandler(exceptionHandlerHandle);
+ SetThreadStackGuarantee(&guaranteeSize);
+ exceptionHandlerHandle = nullptr;
+ isSet = false;
+ }
+ }
+
+ FatalConditionHandler::~FatalConditionHandler() {
+ reset();
+ }
+
+bool FatalConditionHandler::isSet = false;
+ULONG FatalConditionHandler::guaranteeSize = 0;
+PVOID FatalConditionHandler::exceptionHandlerHandle = nullptr;
+
+} // namespace Catch
+
+#elif defined( CATCH_CONFIG_POSIX_SIGNALS )
+
+namespace Catch {
+
+ struct SignalDefs {
+ int id;
+ const char* name;
+ };
+
+ // 32kb for the alternate stack seems to be sufficient. However, this value
+ // is experimentally determined, so that's not guaranteed.
+ constexpr static std::size_t sigStackSize = 32768 >= MINSIGSTKSZ ? 32768 : MINSIGSTKSZ;
+
+ static SignalDefs signalDefs[] = {
+ { SIGINT, "SIGINT - Terminal interrupt signal" },
+ { SIGILL, "SIGILL - Illegal instruction signal" },
+ { SIGFPE, "SIGFPE - Floating point error signal" },
+ { SIGSEGV, "SIGSEGV - Segmentation violation signal" },
+ { SIGTERM, "SIGTERM - Termination request signal" },
+ { SIGABRT, "SIGABRT - Abort (abnormal termination) signal" }
+ };
+
+ void FatalConditionHandler::handleSignal( int sig ) {
+ char const * name = "<unknown signal>";
+ for (auto const& def : signalDefs) {
+ if (sig == def.id) {
+ name = def.name;
+ break;
+ }
+ }
+ reset();
+ reportFatal(name);
+ raise( sig );
+ }
+
+ FatalConditionHandler::FatalConditionHandler() {
+ isSet = true;
+ stack_t sigStack;
+ sigStack.ss_sp = altStackMem;
+ sigStack.ss_size = sigStackSize;
+ sigStack.ss_flags = 0;
+ sigaltstack(&sigStack, &oldSigStack);
+ struct sigaction sa = { };
+
+ sa.sa_handler = handleSignal;
+ sa.sa_flags = SA_ONSTACK;
+ for (std::size_t i = 0; i < sizeof(signalDefs)/sizeof(SignalDefs); ++i) {
+ sigaction(signalDefs[i].id, &sa, &oldSigActions[i]);
+ }
+ }
+
+ FatalConditionHandler::~FatalConditionHandler() {
+ reset();
+ }
+
+ void FatalConditionHandler::reset() {
+ if( isSet ) {
+ // Set signals back to previous values -- hopefully nobody overwrote them in the meantime
+ for( std::size_t i = 0; i < sizeof(signalDefs)/sizeof(SignalDefs); ++i ) {
+ sigaction(signalDefs[i].id, &oldSigActions[i], nullptr);
+ }
+ // Return the old stack
+ sigaltstack(&oldSigStack, nullptr);
+ isSet = false;
+ }
+ }
+
+ bool FatalConditionHandler::isSet = false;
+ struct sigaction FatalConditionHandler::oldSigActions[sizeof(signalDefs)/sizeof(SignalDefs)] = {};
+ stack_t FatalConditionHandler::oldSigStack = {};
+ char FatalConditionHandler::altStackMem[sigStackSize] = {};
+
+} // namespace Catch
+
+#else
+
+namespace Catch {
+ void FatalConditionHandler::reset() {}
+}
+
+#endif // signals/SEH handling
+
+#if defined(__GNUC__)
+# pragma GCC diagnostic pop
+#endif
+// end catch_fatal_condition.cpp
+// start catch_generators.cpp
+
+// start catch_random_number_generator.h
+
+#include <algorithm>
+#include <random>
+
+namespace Catch {
+
+ struct IConfig;
+
+ std::mt19937& rng();
+ void seedRng( IConfig const& config );
+ unsigned int rngSeed();
+
+}
+
+// end catch_random_number_generator.h
+#include <limits>
+#include <set>
+
+namespace Catch {
+
+IGeneratorTracker::~IGeneratorTracker() {}
+
+const char* GeneratorException::what() const noexcept {
+ return m_msg;
+}
+
+namespace Generators {
+
+ GeneratorUntypedBase::~GeneratorUntypedBase() {}
+
+ auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& {
+ return getResultCapture().acquireGeneratorTracker( lineInfo );
+ }
+
+} // namespace Generators
+} // namespace Catch
+// end catch_generators.cpp
+// start catch_interfaces_capture.cpp
+
+namespace Catch {
+ IResultCapture::~IResultCapture() = default;
+}
+// end catch_interfaces_capture.cpp
+// start catch_interfaces_config.cpp
+
+namespace Catch {
+ IConfig::~IConfig() = default;
+}
+// end catch_interfaces_config.cpp
+// start catch_interfaces_exception.cpp
+
+namespace Catch {
+ IExceptionTranslator::~IExceptionTranslator() = default;
+ IExceptionTranslatorRegistry::~IExceptionTranslatorRegistry() = default;
+}
+// end catch_interfaces_exception.cpp
+// start catch_interfaces_registry_hub.cpp
+
+namespace Catch {
+ IRegistryHub::~IRegistryHub() = default;
+ IMutableRegistryHub::~IMutableRegistryHub() = default;
+}
+// end catch_interfaces_registry_hub.cpp
+// start catch_interfaces_reporter.cpp
+
+// start catch_reporter_listening.h
+
+namespace Catch {
+
+ class ListeningReporter : public IStreamingReporter {
+ using Reporters = std::vector<IStreamingReporterPtr>;
+ Reporters m_listeners;
+ IStreamingReporterPtr m_reporter = nullptr;
+ ReporterPreferences m_preferences;
+
+ public:
+ ListeningReporter();
+
+ void addListener( IStreamingReporterPtr&& listener );
+ void addReporter( IStreamingReporterPtr&& reporter );
+
+ public: // IStreamingReporter
+
+ ReporterPreferences getPreferences() const override;
+
+ void noMatchingTestCases( std::string const& spec ) override;
+
+ static std::set<Verbosity> getSupportedVerbosities();
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ void benchmarkPreparing(std::string const& name) override;
+ void benchmarkStarting( BenchmarkInfo const& benchmarkInfo ) override;
+ void benchmarkEnded( BenchmarkStats<> const& benchmarkStats ) override;
+ void benchmarkFailed(std::string const&) override;
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ void testRunStarting( TestRunInfo const& testRunInfo ) override;
+ void testGroupStarting( GroupInfo const& groupInfo ) override;
+ void testCaseStarting( TestCaseInfo const& testInfo ) override;
+ void sectionStarting( SectionInfo const& sectionInfo ) override;
+ void assertionStarting( AssertionInfo const& assertionInfo ) override;
+
+ // The return value indicates if the messages buffer should be cleared:
+ bool assertionEnded( AssertionStats const& assertionStats ) override;
+ void sectionEnded( SectionStats const& sectionStats ) override;
+ void testCaseEnded( TestCaseStats const& testCaseStats ) override;
+ void testGroupEnded( TestGroupStats const& testGroupStats ) override;
+ void testRunEnded( TestRunStats const& testRunStats ) override;
+
+ void skipTest( TestCaseInfo const& testInfo ) override;
+ bool isMulti() const override;
+
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_listening.h
+namespace Catch {
+
+ ReporterConfig::ReporterConfig( IConfigPtr const& _fullConfig )
+ : m_stream( &_fullConfig->stream() ), m_fullConfig( _fullConfig ) {}
+
+ ReporterConfig::ReporterConfig( IConfigPtr const& _fullConfig, std::ostream& _stream )
+ : m_stream( &_stream ), m_fullConfig( _fullConfig ) {}
+
+ std::ostream& ReporterConfig::stream() const { return *m_stream; }
+ IConfigPtr ReporterConfig::fullConfig() const { return m_fullConfig; }
+
+ TestRunInfo::TestRunInfo( std::string const& _name ) : name( _name ) {}
+
+ GroupInfo::GroupInfo( std::string const& _name,
+ std::size_t _groupIndex,
+ std::size_t _groupsCount )
+ : name( _name ),
+ groupIndex( _groupIndex ),
+ groupsCounts( _groupsCount )
+ {}
+
+ AssertionStats::AssertionStats( AssertionResult const& _assertionResult,
+ std::vector<MessageInfo> const& _infoMessages,
+ Totals const& _totals )
+ : assertionResult( _assertionResult ),
+ infoMessages( _infoMessages ),
+ totals( _totals )
+ {
+ assertionResult.m_resultData.lazyExpression.m_transientExpression = _assertionResult.m_resultData.lazyExpression.m_transientExpression;
+
+ if( assertionResult.hasMessage() ) {
+ // Copy message into messages list.
+ // !TBD This should have been done earlier, somewhere
+ MessageBuilder builder( assertionResult.getTestMacroName(), assertionResult.getSourceInfo(), assertionResult.getResultType() );
+ builder << assertionResult.getMessage();
+ builder.m_info.message = builder.m_stream.str();
+
+ infoMessages.push_back( builder.m_info );
+ }
+ }
+
+ AssertionStats::~AssertionStats() = default;
+
+ SectionStats::SectionStats( SectionInfo const& _sectionInfo,
+ Counts const& _assertions,
+ double _durationInSeconds,
+ bool _missingAssertions )
+ : sectionInfo( _sectionInfo ),
+ assertions( _assertions ),
+ durationInSeconds( _durationInSeconds ),
+ missingAssertions( _missingAssertions )
+ {}
+
+ SectionStats::~SectionStats() = default;
+
+ TestCaseStats::TestCaseStats( TestCaseInfo const& _testInfo,
+ Totals const& _totals,
+ std::string const& _stdOut,
+ std::string const& _stdErr,
+ bool _aborting )
+ : testInfo( _testInfo ),
+ totals( _totals ),
+ stdOut( _stdOut ),
+ stdErr( _stdErr ),
+ aborting( _aborting )
+ {}
+
+ TestCaseStats::~TestCaseStats() = default;
+
+ TestGroupStats::TestGroupStats( GroupInfo const& _groupInfo,
+ Totals const& _totals,
+ bool _aborting )
+ : groupInfo( _groupInfo ),
+ totals( _totals ),
+ aborting( _aborting )
+ {}
+
+ TestGroupStats::TestGroupStats( GroupInfo const& _groupInfo )
+ : groupInfo( _groupInfo ),
+ aborting( false )
+ {}
+
+ TestGroupStats::~TestGroupStats() = default;
+
+ TestRunStats::TestRunStats( TestRunInfo const& _runInfo,
+ Totals const& _totals,
+ bool _aborting )
+ : runInfo( _runInfo ),
+ totals( _totals ),
+ aborting( _aborting )
+ {}
+
+ TestRunStats::~TestRunStats() = default;
+
+ void IStreamingReporter::fatalErrorEncountered( StringRef ) {}
+ bool IStreamingReporter::isMulti() const { return false; }
+
+ IReporterFactory::~IReporterFactory() = default;
+ IReporterRegistry::~IReporterRegistry() = default;
+
+} // end namespace Catch
+// end catch_interfaces_reporter.cpp
+// start catch_interfaces_runner.cpp
+
+namespace Catch {
+ IRunner::~IRunner() = default;
+}
+// end catch_interfaces_runner.cpp
+// start catch_interfaces_testcase.cpp
+
+namespace Catch {
+ ITestInvoker::~ITestInvoker() = default;
+ ITestCaseRegistry::~ITestCaseRegistry() = default;
+}
+// end catch_interfaces_testcase.cpp
+// start catch_leak_detector.cpp
+
+#ifdef CATCH_CONFIG_WINDOWS_CRTDBG
+#include <crtdbg.h>
+
+namespace Catch {
+
+ LeakDetector::LeakDetector() {
+ int flag = _CrtSetDbgFlag(_CRTDBG_REPORT_FLAG);
+ flag |= _CRTDBG_LEAK_CHECK_DF;
+ flag |= _CRTDBG_ALLOC_MEM_DF;
+ _CrtSetDbgFlag(flag);
+ _CrtSetReportMode(_CRT_WARN, _CRTDBG_MODE_FILE | _CRTDBG_MODE_DEBUG);
+ _CrtSetReportFile(_CRT_WARN, _CRTDBG_FILE_STDERR);
+ // Change this to leaking allocation's number to break there
+ _CrtSetBreakAlloc(-1);
+ }
+}
+
+#else
+
+ Catch::LeakDetector::LeakDetector() {}
+
+#endif
+
+Catch::LeakDetector::~LeakDetector() {
+ Catch::cleanUp();
+}
+// end catch_leak_detector.cpp
+// start catch_list.cpp
+
+// start catch_list.h
+
+#include <set>
+
+namespace Catch {
+
+ std::size_t listTests( Config const& config );
+
+ std::size_t listTestsNamesOnly( Config const& config );
+
+ struct TagInfo {
+ void add( std::string const& spelling );
+ std::string all() const;
+
+ std::set<std::string> spellings;
+ std::size_t count = 0;
+ };
+
+ std::size_t listTags( Config const& config );
+
+ std::size_t listReporters();
+
+ Option<std::size_t> list( std::shared_ptr<Config> const& config );
+
+} // end namespace Catch
+
+// end catch_list.h
+// start catch_text.h
+
+namespace Catch {
+ using namespace clara::TextFlow;
+}
+
+// end catch_text.h
+#include <limits>
+#include <algorithm>
+#include <iomanip>
+
+namespace Catch {
+
+ std::size_t listTests( Config const& config ) {
+ TestSpec testSpec = config.testSpec();
+ if( config.hasTestFilters() )
+ Catch::cout() << "Matching test cases:\n";
+ else {
+ Catch::cout() << "All available test cases:\n";
+ }
+
+ auto matchedTestCases = filterTests( getAllTestCasesSorted( config ), testSpec, config );
+ for( auto const& testCaseInfo : matchedTestCases ) {
+ Colour::Code colour = testCaseInfo.isHidden()
+ ? Colour::SecondaryText
+ : Colour::None;
+ Colour colourGuard( colour );
+
+ Catch::cout() << Column( testCaseInfo.name ).initialIndent( 2 ).indent( 4 ) << "\n";
+ if( config.verbosity() >= Verbosity::High ) {
+ Catch::cout() << Column( Catch::Detail::stringify( testCaseInfo.lineInfo ) ).indent(4) << std::endl;
+ std::string description = testCaseInfo.description;
+ if( description.empty() )
+ description = "(NO DESCRIPTION)";
+ Catch::cout() << Column( description ).indent(4) << std::endl;
+ }
+ if( !testCaseInfo.tags.empty() )
+ Catch::cout() << Column( testCaseInfo.tagsAsString() ).indent( 6 ) << "\n";
+ }
+
+ if( !config.hasTestFilters() )
+ Catch::cout() << pluralise( matchedTestCases.size(), "test case" ) << '\n' << std::endl;
+ else
+ Catch::cout() << pluralise( matchedTestCases.size(), "matching test case" ) << '\n' << std::endl;
+ return matchedTestCases.size();
+ }
+
+ std::size_t listTestsNamesOnly( Config const& config ) {
+ TestSpec testSpec = config.testSpec();
+ std::size_t matchedTests = 0;
+ std::vector<TestCase> matchedTestCases = filterTests( getAllTestCasesSorted( config ), testSpec, config );
+ for( auto const& testCaseInfo : matchedTestCases ) {
+ matchedTests++;
+ if( startsWith( testCaseInfo.name, '#' ) )
+ Catch::cout() << '"' << testCaseInfo.name << '"';
+ else
+ Catch::cout() << testCaseInfo.name;
+ if ( config.verbosity() >= Verbosity::High )
+ Catch::cout() << "\t@" << testCaseInfo.lineInfo;
+ Catch::cout() << std::endl;
+ }
+ return matchedTests;
+ }
+
+ void TagInfo::add( std::string const& spelling ) {
+ ++count;
+ spellings.insert( spelling );
+ }
+
+ std::string TagInfo::all() const {
+ std::string out;
+ for( auto const& spelling : spellings )
+ out += "[" + spelling + "]";
+ return out;
+ }
+
+ std::size_t listTags( Config const& config ) {
+ TestSpec testSpec = config.testSpec();
+ if( config.hasTestFilters() )
+ Catch::cout() << "Tags for matching test cases:\n";
+ else {
+ Catch::cout() << "All available tags:\n";
+ }
+
+ std::map<std::string, TagInfo> tagCounts;
+
+ std::vector<TestCase> matchedTestCases = filterTests( getAllTestCasesSorted( config ), testSpec, config );
+ for( auto const& testCase : matchedTestCases ) {
+ for( auto const& tagName : testCase.getTestCaseInfo().tags ) {
+ std::string lcaseTagName = toLower( tagName );
+ auto countIt = tagCounts.find( lcaseTagName );
+ if( countIt == tagCounts.end() )
+ countIt = tagCounts.insert( std::make_pair( lcaseTagName, TagInfo() ) ).first;
+ countIt->second.add( tagName );
+ }
+ }
+
+ for( auto const& tagCount : tagCounts ) {
+ ReusableStringStream rss;
+ rss << " " << std::setw(2) << tagCount.second.count << " ";
+ auto str = rss.str();
+ auto wrapper = Column( tagCount.second.all() )
+ .initialIndent( 0 )
+ .indent( str.size() )
+ .width( CATCH_CONFIG_CONSOLE_WIDTH-10 );
+ Catch::cout() << str << wrapper << '\n';
+ }
+ Catch::cout() << pluralise( tagCounts.size(), "tag" ) << '\n' << std::endl;
+ return tagCounts.size();
+ }
+
+ std::size_t listReporters() {
+ Catch::cout() << "Available reporters:\n";
+ IReporterRegistry::FactoryMap const& factories = getRegistryHub().getReporterRegistry().getFactories();
+ std::size_t maxNameLen = 0;
+ for( auto const& factoryKvp : factories )
+ maxNameLen = (std::max)( maxNameLen, factoryKvp.first.size() );
+
+ for( auto const& factoryKvp : factories ) {
+ Catch::cout()
+ << Column( factoryKvp.first + ":" )
+ .indent(2)
+ .width( 5+maxNameLen )
+ + Column( factoryKvp.second->getDescription() )
+ .initialIndent(0)
+ .indent(2)
+ .width( CATCH_CONFIG_CONSOLE_WIDTH - maxNameLen-8 )
+ << "\n";
+ }
+ Catch::cout() << std::endl;
+ return factories.size();
+ }
+
+ Option<std::size_t> list( std::shared_ptr<Config> const& config ) {
+ Option<std::size_t> listedCount;
+ getCurrentMutableContext().setConfig( config );
+ if( config->listTests() )
+ listedCount = listedCount.valueOr(0) + listTests( *config );
+ if( config->listTestNamesOnly() )
+ listedCount = listedCount.valueOr(0) + listTestsNamesOnly( *config );
+ if( config->listTags() )
+ listedCount = listedCount.valueOr(0) + listTags( *config );
+ if( config->listReporters() )
+ listedCount = listedCount.valueOr(0) + listReporters();
+ return listedCount;
+ }
+
+} // end namespace Catch
+// end catch_list.cpp
+// start catch_matchers.cpp
+
+namespace Catch {
+namespace Matchers {
+ namespace Impl {
+
+ std::string MatcherUntypedBase::toString() const {
+ if( m_cachedToString.empty() )
+ m_cachedToString = describe();
+ return m_cachedToString;
+ }
+
+ MatcherUntypedBase::~MatcherUntypedBase() = default;
+
+ } // namespace Impl
+} // namespace Matchers
+
+using namespace Matchers;
+using Matchers::Impl::MatcherBase;
+
+} // namespace Catch
+// end catch_matchers.cpp
+// start catch_matchers_floating.cpp
+
+// start catch_polyfills.hpp
+
+namespace Catch {
+ bool isnan(float f);
+ bool isnan(double d);
+}
+
+// end catch_polyfills.hpp
+// start catch_to_string.hpp
+
+#include <string>
+
+namespace Catch {
+ template <typename T>
+ std::string to_string(T const& t) {
+#if defined(CATCH_CONFIG_CPP11_TO_STRING)
+ return std::to_string(t);
+#else
+ ReusableStringStream rss;
+ rss << t;
+ return rss.str();
+#endif
+ }
+} // end namespace Catch
+
+// end catch_to_string.hpp
+#include <cstdlib>
+#include <cstdint>
+#include <cstring>
+#include <sstream>
+#include <iomanip>
+#include <limits>
+
+namespace Catch {
+namespace Matchers {
+namespace Floating {
+enum class FloatingPointKind : uint8_t {
+ Float,
+ Double
+};
+}
+}
+}
+
+namespace {
+
+template <typename T>
+struct Converter;
+
+template <>
+struct Converter<float> {
+ static_assert(sizeof(float) == sizeof(int32_t), "Important ULP matcher assumption violated");
+ Converter(float f) {
+ std::memcpy(&i, &f, sizeof(f));
+ }
+ int32_t i;
+};
+
+template <>
+struct Converter<double> {
+ static_assert(sizeof(double) == sizeof(int64_t), "Important ULP matcher assumption violated");
+ Converter(double d) {
+ std::memcpy(&i, &d, sizeof(d));
+ }
+ int64_t i;
+};
+
+template <typename T>
+auto convert(T t) -> Converter<T> {
+ return Converter<T>(t);
+}
+
+template <typename FP>
+bool almostEqualUlps(FP lhs, FP rhs, int maxUlpDiff) {
+ // Comparison with NaN should always be false.
+ // This way we can rule it out before getting into the ugly details
+ if (Catch::isnan(lhs) || Catch::isnan(rhs)) {
+ return false;
+ }
+
+ auto lc = convert(lhs);
+ auto rc = convert(rhs);
+
+ if ((lc.i < 0) != (rc.i < 0)) {
+ // Potentially we can have +0 and -0
+ return lhs == rhs;
+ }
+
+ auto ulpDiff = std::abs(lc.i - rc.i);
+ return ulpDiff <= maxUlpDiff;
+}
+
+template <typename FP>
+FP step(FP start, FP direction, int steps) {
+ for (int i = 0; i < steps; ++i) {
+ start = std::nextafter(start, direction);
+ }
+ return start;
+}
+
+} // end anonymous namespace
+
+namespace Catch {
+namespace Matchers {
+namespace Floating {
+ WithinAbsMatcher::WithinAbsMatcher(double target, double margin)
+ :m_target{ target }, m_margin{ margin } {
+ CATCH_ENFORCE(margin >= 0, "Invalid margin: " << margin << '.'
+ << " Margin has to be non-negative.");
+ }
+
+ // Performs equivalent check of std::fabs(lhs - rhs) <= margin
+ // But without the subtraction to allow for INFINITY in comparison
+ bool WithinAbsMatcher::match(double const& matchee) const {
+ return (matchee + m_margin >= m_target) && (m_target + m_margin >= matchee);
+ }
+
+ std::string WithinAbsMatcher::describe() const {
+ return "is within " + ::Catch::Detail::stringify(m_margin) + " of " + ::Catch::Detail::stringify(m_target);
+ }
+
+ WithinUlpsMatcher::WithinUlpsMatcher(double target, int ulps, FloatingPointKind baseType)
+ :m_target{ target }, m_ulps{ ulps }, m_type{ baseType } {
+ CATCH_ENFORCE(ulps >= 0, "Invalid ULP setting: " << ulps << '.'
+ << " ULPs have to be non-negative.");
+ }
+
+#if defined(__clang__)
+#pragma clang diagnostic push
+// Clang <3.5 reports on the default branch in the switch below
+#pragma clang diagnostic ignored "-Wunreachable-code"
+#endif
+
+ bool WithinUlpsMatcher::match(double const& matchee) const {
+ switch (m_type) {
+ case FloatingPointKind::Float:
+ return almostEqualUlps<float>(static_cast<float>(matchee), static_cast<float>(m_target), m_ulps);
+ case FloatingPointKind::Double:
+ return almostEqualUlps<double>(matchee, m_target, m_ulps);
+ default:
+ CATCH_INTERNAL_ERROR( "Unknown FloatingPointKind value" );
+ }
+ }
+
+#if defined(__clang__)
+#pragma clang diagnostic pop
+#endif
+
+ std::string WithinUlpsMatcher::describe() const {
+ std::stringstream ret;
+
+ ret << "is within " << m_ulps << " ULPs of " << ::Catch::Detail::stringify(m_target);
+
+ if (m_type == FloatingPointKind::Float) {
+ ret << 'f';
+ }
+
+ ret << " ([";
+ ret << std::fixed << std::setprecision(std::numeric_limits<double>::max_digits10);
+ if (m_type == FloatingPointKind::Double) {
+ ret << step(m_target, static_cast<double>(-INFINITY), m_ulps)
+ << ", "
+ << step(m_target, static_cast<double>(INFINITY), m_ulps);
+ } else {
+ ret << step<float>(static_cast<float>(m_target), -INFINITY, m_ulps)
+ << ", "
+ << step<float>(static_cast<float>(m_target), INFINITY, m_ulps);
+ }
+ ret << "])";
+
+ return ret.str();
+ //return "is within " + Catch::to_string(m_ulps) + " ULPs of " + ::Catch::Detail::stringify(m_target) + ((m_type == FloatingPointKind::Float)? "f" : "");
+ }
+
+}// namespace Floating
+
+Floating::WithinUlpsMatcher WithinULP(double target, int maxUlpDiff) {
+ return Floating::WithinUlpsMatcher(target, maxUlpDiff, Floating::FloatingPointKind::Double);
+}
+
+Floating::WithinUlpsMatcher WithinULP(float target, int maxUlpDiff) {
+ return Floating::WithinUlpsMatcher(target, maxUlpDiff, Floating::FloatingPointKind::Float);
+}
+
+Floating::WithinAbsMatcher WithinAbs(double target, double margin) {
+ return Floating::WithinAbsMatcher(target, margin);
+}
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_floating.cpp
+// start catch_matchers_generic.cpp
+
+std::string Catch::Matchers::Generic::Detail::finalizeDescription(const std::string& desc) {
+ if (desc.empty()) {
+ return "matches undescribed predicate";
+ } else {
+ return "matches predicate: \"" + desc + '"';
+ }
+}
+// end catch_matchers_generic.cpp
+// start catch_matchers_string.cpp
+
+#include <regex>
+
+namespace Catch {
+namespace Matchers {
+
+ namespace StdString {
+
+ CasedString::CasedString( std::string const& str, CaseSensitive::Choice caseSensitivity )
+ : m_caseSensitivity( caseSensitivity ),
+ m_str( adjustString( str ) )
+ {}
+ std::string CasedString::adjustString( std::string const& str ) const {
+ return m_caseSensitivity == CaseSensitive::No
+ ? toLower( str )
+ : str;
+ }
+ std::string CasedString::caseSensitivitySuffix() const {
+ return m_caseSensitivity == CaseSensitive::No
+ ? " (case insensitive)"
+ : std::string();
+ }
+
+ StringMatcherBase::StringMatcherBase( std::string const& operation, CasedString const& comparator )
+ : m_comparator( comparator ),
+ m_operation( operation ) {
+ }
+
+ std::string StringMatcherBase::describe() const {
+ std::string description;
+ description.reserve(5 + m_operation.size() + m_comparator.m_str.size() +
+ m_comparator.caseSensitivitySuffix().size());
+ description += m_operation;
+ description += ": \"";
+ description += m_comparator.m_str;
+ description += "\"";
+ description += m_comparator.caseSensitivitySuffix();
+ return description;
+ }
+
+ EqualsMatcher::EqualsMatcher( CasedString const& comparator ) : StringMatcherBase( "equals", comparator ) {}
+
+ bool EqualsMatcher::match( std::string const& source ) const {
+ return m_comparator.adjustString( source ) == m_comparator.m_str;
+ }
+
+ ContainsMatcher::ContainsMatcher( CasedString const& comparator ) : StringMatcherBase( "contains", comparator ) {}
+
+ bool ContainsMatcher::match( std::string const& source ) const {
+ return contains( m_comparator.adjustString( source ), m_comparator.m_str );
+ }
+
+ StartsWithMatcher::StartsWithMatcher( CasedString const& comparator ) : StringMatcherBase( "starts with", comparator ) {}
+
+ bool StartsWithMatcher::match( std::string const& source ) const {
+ return startsWith( m_comparator.adjustString( source ), m_comparator.m_str );
+ }
+
+ EndsWithMatcher::EndsWithMatcher( CasedString const& comparator ) : StringMatcherBase( "ends with", comparator ) {}
+
+ bool EndsWithMatcher::match( std::string const& source ) const {
+ return endsWith( m_comparator.adjustString( source ), m_comparator.m_str );
+ }
+
+ RegexMatcher::RegexMatcher(std::string regex, CaseSensitive::Choice caseSensitivity): m_regex(std::move(regex)), m_caseSensitivity(caseSensitivity) {}
+
+ bool RegexMatcher::match(std::string const& matchee) const {
+ auto flags = std::regex::ECMAScript; // ECMAScript is the default syntax option anyway
+ if (m_caseSensitivity == CaseSensitive::Choice::No) {
+ flags |= std::regex::icase;
+ }
+ auto reg = std::regex(m_regex, flags);
+ return std::regex_match(matchee, reg);
+ }
+
+ std::string RegexMatcher::describe() const {
+ return "matches " + ::Catch::Detail::stringify(m_regex) + ((m_caseSensitivity == CaseSensitive::Choice::Yes)? " case sensitively" : " case insensitively");
+ }
+
+ } // namespace StdString
+
+ StdString::EqualsMatcher Equals( std::string const& str, CaseSensitive::Choice caseSensitivity ) {
+ return StdString::EqualsMatcher( StdString::CasedString( str, caseSensitivity) );
+ }
+ StdString::ContainsMatcher Contains( std::string const& str, CaseSensitive::Choice caseSensitivity ) {
+ return StdString::ContainsMatcher( StdString::CasedString( str, caseSensitivity) );
+ }
+ StdString::EndsWithMatcher EndsWith( std::string const& str, CaseSensitive::Choice caseSensitivity ) {
+ return StdString::EndsWithMatcher( StdString::CasedString( str, caseSensitivity) );
+ }
+ StdString::StartsWithMatcher StartsWith( std::string const& str, CaseSensitive::Choice caseSensitivity ) {
+ return StdString::StartsWithMatcher( StdString::CasedString( str, caseSensitivity) );
+ }
+
+ StdString::RegexMatcher Matches(std::string const& regex, CaseSensitive::Choice caseSensitivity) {
+ return StdString::RegexMatcher(regex, caseSensitivity);
+ }
+
+} // namespace Matchers
+} // namespace Catch
+// end catch_matchers_string.cpp
+// start catch_message.cpp
+
+// start catch_uncaught_exceptions.h
+
+namespace Catch {
+ bool uncaught_exceptions();
+} // end namespace Catch
+
+// end catch_uncaught_exceptions.h
+#include <cassert>
+#include <stack>
+
+namespace Catch {
+
+ MessageInfo::MessageInfo( StringRef const& _macroName,
+ SourceLineInfo const& _lineInfo,
+ ResultWas::OfType _type )
+ : macroName( _macroName ),
+ lineInfo( _lineInfo ),
+ type( _type ),
+ sequence( ++globalCount )
+ {}
+
+ bool MessageInfo::operator==( MessageInfo const& other ) const {
+ return sequence == other.sequence;
+ }
+
+ bool MessageInfo::operator<( MessageInfo const& other ) const {
+ return sequence < other.sequence;
+ }
+
+ // This may need protecting if threading support is added
+ unsigned int MessageInfo::globalCount = 0;
+
+ ////////////////////////////////////////////////////////////////////////////
+
+ Catch::MessageBuilder::MessageBuilder( StringRef const& macroName,
+ SourceLineInfo const& lineInfo,
+ ResultWas::OfType type )
+ :m_info(macroName, lineInfo, type) {}
+
+ ////////////////////////////////////////////////////////////////////////////
+
+ ScopedMessage::ScopedMessage( MessageBuilder const& builder )
+ : m_info( builder.m_info ), m_moved()
+ {
+ m_info.message = builder.m_stream.str();
+ getResultCapture().pushScopedMessage( m_info );
+ }
+
+ ScopedMessage::ScopedMessage( ScopedMessage&& old )
+ : m_info( old.m_info ), m_moved()
+ {
+ old.m_moved = true;
+ }
+
+ ScopedMessage::~ScopedMessage() {
+ if ( !uncaught_exceptions() && !m_moved ){
+ getResultCapture().popScopedMessage(m_info);
+ }
+ }
+
+ Capturer::Capturer( StringRef macroName, SourceLineInfo const& lineInfo, ResultWas::OfType resultType, StringRef names ) {
+ auto trimmed = [&] (size_t start, size_t end) {
+ while (names[start] == ',' || isspace(names[start])) {
+ ++start;
+ }
+ while (names[end] == ',' || isspace(names[end])) {
+ --end;
+ }
+ return names.substr(start, end - start + 1);
+ };
+ auto skipq = [&] (size_t start, char quote) {
+ for (auto i = start + 1; i < names.size() ; ++i) {
+ if (names[i] == quote)
+ return i;
+ if (names[i] == '\\')
+ ++i;
+ }
+ CATCH_INTERNAL_ERROR("CAPTURE parsing encountered unmatched quote");
+ };
+
+ size_t start = 0;
+ std::stack<char> openings;
+ for (size_t pos = 0; pos < names.size(); ++pos) {
+ char c = names[pos];
+ switch (c) {
+ case '[':
+ case '{':
+ case '(':
+ // It is basically impossible to disambiguate between
+ // comparison and start of template args in this context
+// case '<':
+ openings.push(c);
+ break;
+ case ']':
+ case '}':
+ case ')':
+// case '>':
+ openings.pop();
+ break;
+ case '"':
+ case '\'':
+ pos = skipq(pos, c);
+ break;
+ case ',':
+ if (start != pos && openings.size() == 0) {
+ m_messages.emplace_back(macroName, lineInfo, resultType);
+ m_messages.back().message = trimmed(start, pos);
+ m_messages.back().message += " := ";
+ start = pos;
+ }
+ }
+ }
+ assert(openings.size() == 0 && "Mismatched openings");
+ m_messages.emplace_back(macroName, lineInfo, resultType);
+ m_messages.back().message = trimmed(start, names.size() - 1);
+ m_messages.back().message += " := ";
+ }
+ Capturer::~Capturer() {
+ if ( !uncaught_exceptions() ){
+ assert( m_captured == m_messages.size() );
+ for( size_t i = 0; i < m_captured; ++i )
+ m_resultCapture.popScopedMessage( m_messages[i] );
+ }
+ }
+
+ void Capturer::captureValue( size_t index, std::string const& value ) {
+ assert( index < m_messages.size() );
+ m_messages[index].message += value;
+ m_resultCapture.pushScopedMessage( m_messages[index] );
+ m_captured++;
+ }
+
+} // end namespace Catch
+// end catch_message.cpp
+// start catch_output_redirect.cpp
+
+// start catch_output_redirect.h
+#ifndef TWOBLUECUBES_CATCH_OUTPUT_REDIRECT_H
+#define TWOBLUECUBES_CATCH_OUTPUT_REDIRECT_H
+
+#include <cstdio>
+#include <iosfwd>
+#include <string>
+
+namespace Catch {
+
+ class RedirectedStream {
+ std::ostream& m_originalStream;
+ std::ostream& m_redirectionStream;
+ std::streambuf* m_prevBuf;
+
+ public:
+ RedirectedStream( std::ostream& originalStream, std::ostream& redirectionStream );
+ ~RedirectedStream();
+ };
+
+ class RedirectedStdOut {
+ ReusableStringStream m_rss;
+ RedirectedStream m_cout;
+ public:
+ RedirectedStdOut();
+ auto str() const -> std::string;
+ };
+
+ // StdErr has two constituent streams in C++, std::cerr and std::clog
+ // This means that we need to redirect 2 streams into 1 to keep proper
+ // order of writes
+ class RedirectedStdErr {
+ ReusableStringStream m_rss;
+ RedirectedStream m_cerr;
+ RedirectedStream m_clog;
+ public:
+ RedirectedStdErr();
+ auto str() const -> std::string;
+ };
+
+ class RedirectedStreams {
+ public:
+ RedirectedStreams(RedirectedStreams const&) = delete;
+ RedirectedStreams& operator=(RedirectedStreams const&) = delete;
+ RedirectedStreams(RedirectedStreams&&) = delete;
+ RedirectedStreams& operator=(RedirectedStreams&&) = delete;
+
+ RedirectedStreams(std::string& redirectedCout, std::string& redirectedCerr);
+ ~RedirectedStreams();
+ private:
+ std::string& m_redirectedCout;
+ std::string& m_redirectedCerr;
+ RedirectedStdOut m_redirectedStdOut;
+ RedirectedStdErr m_redirectedStdErr;
+ };
+
+#if defined(CATCH_CONFIG_NEW_CAPTURE)
+
+ // Windows's implementation of std::tmpfile is terrible (it tries
+ // to create a file inside system folder, thus requiring elevated
+ // privileges for the binary), so we have to use tmpnam(_s) and
+ // create the file ourselves there.
+ class TempFile {
+ public:
+ TempFile(TempFile const&) = delete;
+ TempFile& operator=(TempFile const&) = delete;
+ TempFile(TempFile&&) = delete;
+ TempFile& operator=(TempFile&&) = delete;
+
+ TempFile();
+ ~TempFile();
+
+ std::FILE* getFile();
+ std::string getContents();
+
+ private:
+ std::FILE* m_file = nullptr;
+ #if defined(_MSC_VER)
+ char m_buffer[L_tmpnam] = { 0 };
+ #endif
+ };
+
+ class OutputRedirect {
+ public:
+ OutputRedirect(OutputRedirect const&) = delete;
+ OutputRedirect& operator=(OutputRedirect const&) = delete;
+ OutputRedirect(OutputRedirect&&) = delete;
+ OutputRedirect& operator=(OutputRedirect&&) = delete;
+
+ OutputRedirect(std::string& stdout_dest, std::string& stderr_dest);
+ ~OutputRedirect();
+
+ private:
+ int m_originalStdout = -1;
+ int m_originalStderr = -1;
+ TempFile m_stdoutFile;
+ TempFile m_stderrFile;
+ std::string& m_stdoutDest;
+ std::string& m_stderrDest;
+ };
+
+#endif
+
+} // end namespace Catch
+
+#endif // TWOBLUECUBES_CATCH_OUTPUT_REDIRECT_H
+// end catch_output_redirect.h
+#include <cstdio>
+#include <cstring>
+#include <fstream>
+#include <sstream>
+#include <stdexcept>
+
+#if defined(CATCH_CONFIG_NEW_CAPTURE)
+ #if defined(_MSC_VER)
+ #include <io.h> //_dup and _dup2
+ #define dup _dup
+ #define dup2 _dup2
+ #define fileno _fileno
+ #else
+ #include <unistd.h> // dup and dup2
+ #endif
+#endif
+
+namespace Catch {
+
+ RedirectedStream::RedirectedStream( std::ostream& originalStream, std::ostream& redirectionStream )
+ : m_originalStream( originalStream ),
+ m_redirectionStream( redirectionStream ),
+ m_prevBuf( m_originalStream.rdbuf() )
+ {
+ m_originalStream.rdbuf( m_redirectionStream.rdbuf() );
+ }
+
+ RedirectedStream::~RedirectedStream() {
+ m_originalStream.rdbuf( m_prevBuf );
+ }
+
+ RedirectedStdOut::RedirectedStdOut() : m_cout( Catch::cout(), m_rss.get() ) {}
+ auto RedirectedStdOut::str() const -> std::string { return m_rss.str(); }
+
+ RedirectedStdErr::RedirectedStdErr()
+ : m_cerr( Catch::cerr(), m_rss.get() ),
+ m_clog( Catch::clog(), m_rss.get() )
+ {}
+ auto RedirectedStdErr::str() const -> std::string { return m_rss.str(); }
+
+ RedirectedStreams::RedirectedStreams(std::string& redirectedCout, std::string& redirectedCerr)
+ : m_redirectedCout(redirectedCout),
+ m_redirectedCerr(redirectedCerr)
+ {}
+
+ RedirectedStreams::~RedirectedStreams() {
+ m_redirectedCout += m_redirectedStdOut.str();
+ m_redirectedCerr += m_redirectedStdErr.str();
+ }
+
+#if defined(CATCH_CONFIG_NEW_CAPTURE)
+
+#if defined(_MSC_VER)
+ TempFile::TempFile() {
+ if (tmpnam_s(m_buffer)) {
+ CATCH_RUNTIME_ERROR("Could not get a temp filename");
+ }
+ if (fopen_s(&m_file, m_buffer, "w")) {
+ char buffer[100];
+ if (strerror_s(buffer, errno)) {
+ CATCH_RUNTIME_ERROR("Could not translate errno to a string");
+ }
+ CATCH_RUNTIME_ERROR("Could not open the temp file: '" << m_buffer << "' because: " << buffer);
+ }
+ }
+#else
+ TempFile::TempFile() {
+ m_file = std::tmpfile();
+ if (!m_file) {
+ CATCH_RUNTIME_ERROR("Could not create a temp file.");
+ }
+ }
+
+#endif
+
+ TempFile::~TempFile() {
+ // TBD: What to do about errors here?
+ std::fclose(m_file);
+ // We manually create the file on Windows only, on Linux
+ // it will be autodeleted
+#if defined(_MSC_VER)
+ std::remove(m_buffer);
+#endif
+ }
+
+ FILE* TempFile::getFile() {
+ return m_file;
+ }
+
+ std::string TempFile::getContents() {
+ std::stringstream sstr;
+ char buffer[100] = {};
+ std::rewind(m_file);
+ while (std::fgets(buffer, sizeof(buffer), m_file)) {
+ sstr << buffer;
+ }
+ return sstr.str();
+ }
+
+ OutputRedirect::OutputRedirect(std::string& stdout_dest, std::string& stderr_dest) :
+ m_originalStdout(dup(1)),
+ m_originalStderr(dup(2)),
+ m_stdoutDest(stdout_dest),
+ m_stderrDest(stderr_dest) {
+ dup2(fileno(m_stdoutFile.getFile()), 1);
+ dup2(fileno(m_stderrFile.getFile()), 2);
+ }
+
+ OutputRedirect::~OutputRedirect() {
+ Catch::cout() << std::flush;
+ fflush(stdout);
+ // Since we support overriding these streams, we flush cerr
+ // even though std::cerr is unbuffered
+ Catch::cerr() << std::flush;
+ Catch::clog() << std::flush;
+ fflush(stderr);
+
+ dup2(m_originalStdout, 1);
+ dup2(m_originalStderr, 2);
+
+ m_stdoutDest += m_stdoutFile.getContents();
+ m_stderrDest += m_stderrFile.getContents();
+ }
+
+#endif // CATCH_CONFIG_NEW_CAPTURE
+
+} // namespace Catch
+
+#if defined(CATCH_CONFIG_NEW_CAPTURE)
+ #if defined(_MSC_VER)
+ #undef dup
+ #undef dup2
+ #undef fileno
+ #endif
+#endif
+// end catch_output_redirect.cpp
+// start catch_polyfills.cpp
+
+#include <cmath>
+
+namespace Catch {
+
+#if !defined(CATCH_CONFIG_POLYFILL_ISNAN)
+ bool isnan(float f) {
+ return std::isnan(f);
+ }
+ bool isnan(double d) {
+ return std::isnan(d);
+ }
+#else
+ // For now we only use this for embarcadero
+ bool isnan(float f) {
+ return std::_isnan(f);
+ }
+ bool isnan(double d) {
+ return std::_isnan(d);
+ }
+#endif
+
+} // end namespace Catch
+// end catch_polyfills.cpp
+// start catch_random_number_generator.cpp
+
+namespace Catch {
+
+ std::mt19937& rng() {
+ static std::mt19937 s_rng;
+ return s_rng;
+ }
+
+ void seedRng( IConfig const& config ) {
+ if( config.rngSeed() != 0 ) {
+ std::srand( config.rngSeed() );
+ rng().seed( config.rngSeed() );
+ }
+ }
+
+ unsigned int rngSeed() {
+ return getCurrentContext().getConfig()->rngSeed();
+ }
+}
+// end catch_random_number_generator.cpp
+// start catch_registry_hub.cpp
+
+// start catch_test_case_registry_impl.h
+
+#include <vector>
+#include <set>
+#include <algorithm>
+#include <ios>
+
+namespace Catch {
+
+ class TestCase;
+ struct IConfig;
+
+ std::vector<TestCase> sortTests( IConfig const& config, std::vector<TestCase> const& unsortedTestCases );
+ bool matchTest( TestCase const& testCase, TestSpec const& testSpec, IConfig const& config );
+
+ void enforceNoDuplicateTestCases( std::vector<TestCase> const& functions );
+
+ std::vector<TestCase> filterTests( std::vector<TestCase> const& testCases, TestSpec const& testSpec, IConfig const& config );
+ std::vector<TestCase> const& getAllTestCasesSorted( IConfig const& config );
+
+ class TestRegistry : public ITestCaseRegistry {
+ public:
+ virtual ~TestRegistry() = default;
+
+ virtual void registerTest( TestCase const& testCase );
+
+ std::vector<TestCase> const& getAllTests() const override;
+ std::vector<TestCase> const& getAllTestsSorted( IConfig const& config ) const override;
+
+ private:
+ std::vector<TestCase> m_functions;
+ mutable RunTests::InWhatOrder m_currentSortOrder = RunTests::InDeclarationOrder;
+ mutable std::vector<TestCase> m_sortedFunctions;
+ std::size_t m_unnamedCount = 0;
+ std::ios_base::Init m_ostreamInit; // Forces cout/ cerr to be initialised
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class TestInvokerAsFunction : public ITestInvoker {
+ void(*m_testAsFunction)();
+ public:
+ TestInvokerAsFunction( void(*testAsFunction)() ) noexcept;
+
+ void invoke() const override;
+ };
+
+ std::string extractClassName( StringRef const& classOrQualifiedMethodName );
+
+ ///////////////////////////////////////////////////////////////////////////
+
+} // end namespace Catch
+
+// end catch_test_case_registry_impl.h
+// start catch_reporter_registry.h
+
+#include <map>
+
+namespace Catch {
+
+ class ReporterRegistry : public IReporterRegistry {
+
+ public:
+
+ ~ReporterRegistry() override;
+
+ IStreamingReporterPtr create( std::string const& name, IConfigPtr const& config ) const override;
+
+ void registerReporter( std::string const& name, IReporterFactoryPtr const& factory );
+ void registerListener( IReporterFactoryPtr const& factory );
+
+ FactoryMap const& getFactories() const override;
+ Listeners const& getListeners() const override;
+
+ private:
+ FactoryMap m_factories;
+ Listeners m_listeners;
+ };
+}
+
+// end catch_reporter_registry.h
+// start catch_tag_alias_registry.h
+
+// start catch_tag_alias.h
+
+#include <string>
+
+namespace Catch {
+
+ struct TagAlias {
+ TagAlias(std::string const& _tag, SourceLineInfo _lineInfo);
+
+ std::string tag;
+ SourceLineInfo lineInfo;
+ };
+
+} // end namespace Catch
+
+// end catch_tag_alias.h
+#include <map>
+
+namespace Catch {
+
+ class TagAliasRegistry : public ITagAliasRegistry {
+ public:
+ ~TagAliasRegistry() override;
+ TagAlias const* find( std::string const& alias ) const override;
+ std::string expandAliases( std::string const& unexpandedTestSpec ) const override;
+ void add( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo );
+
+ private:
+ std::map<std::string, TagAlias> m_registry;
+ };
+
+} // end namespace Catch
+
+// end catch_tag_alias_registry.h
+// start catch_startup_exception_registry.h
+
+#include <vector>
+#include <exception>
+
+namespace Catch {
+
+ class StartupExceptionRegistry {
+ public:
+ void add(std::exception_ptr const& exception) noexcept;
+ std::vector<std::exception_ptr> const& getExceptions() const noexcept;
+ private:
+ std::vector<std::exception_ptr> m_exceptions;
+ };
+
+} // end namespace Catch
+
+// end catch_startup_exception_registry.h
+// start catch_singletons.hpp
+
+namespace Catch {
+
+ struct ISingleton {
+ virtual ~ISingleton();
+ };
+
+ void addSingleton( ISingleton* singleton );
+ void cleanupSingletons();
+
+ template<typename SingletonImplT, typename InterfaceT = SingletonImplT, typename MutableInterfaceT = InterfaceT>
+ class Singleton : SingletonImplT, public ISingleton {
+
+ static auto getInternal() -> Singleton* {
+ static Singleton* s_instance = nullptr;
+ if( !s_instance ) {
+ s_instance = new Singleton;
+ addSingleton( s_instance );
+ }
+ return s_instance;
+ }
+
+ public:
+ static auto get() -> InterfaceT const& {
+ return *getInternal();
+ }
+ static auto getMutable() -> MutableInterfaceT& {
+ return *getInternal();
+ }
+ };
+
+} // namespace Catch
+
+// end catch_singletons.hpp
+namespace Catch {
+
+ namespace {
+
+ class RegistryHub : public IRegistryHub, public IMutableRegistryHub,
+ private NonCopyable {
+
+ public: // IRegistryHub
+ RegistryHub() = default;
+ IReporterRegistry const& getReporterRegistry() const override {
+ return m_reporterRegistry;
+ }
+ ITestCaseRegistry const& getTestCaseRegistry() const override {
+ return m_testCaseRegistry;
+ }
+ IExceptionTranslatorRegistry const& getExceptionTranslatorRegistry() const override {
+ return m_exceptionTranslatorRegistry;
+ }
+ ITagAliasRegistry const& getTagAliasRegistry() const override {
+ return m_tagAliasRegistry;
+ }
+ StartupExceptionRegistry const& getStartupExceptionRegistry() const override {
+ return m_exceptionRegistry;
+ }
+
+ public: // IMutableRegistryHub
+ void registerReporter( std::string const& name, IReporterFactoryPtr const& factory ) override {
+ m_reporterRegistry.registerReporter( name, factory );
+ }
+ void registerListener( IReporterFactoryPtr const& factory ) override {
+ m_reporterRegistry.registerListener( factory );
+ }
+ void registerTest( TestCase const& testInfo ) override {
+ m_testCaseRegistry.registerTest( testInfo );
+ }
+ void registerTranslator( const IExceptionTranslator* translator ) override {
+ m_exceptionTranslatorRegistry.registerTranslator( translator );
+ }
+ void registerTagAlias( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ) override {
+ m_tagAliasRegistry.add( alias, tag, lineInfo );
+ }
+ void registerStartupException() noexcept override {
+ m_exceptionRegistry.add(std::current_exception());
+ }
+ IMutableEnumValuesRegistry& getMutableEnumValuesRegistry() override {
+ return m_enumValuesRegistry;
+ }
+
+ private:
+ TestRegistry m_testCaseRegistry;
+ ReporterRegistry m_reporterRegistry;
+ ExceptionTranslatorRegistry m_exceptionTranslatorRegistry;
+ TagAliasRegistry m_tagAliasRegistry;
+ StartupExceptionRegistry m_exceptionRegistry;
+ Detail::EnumValuesRegistry m_enumValuesRegistry;
+ };
+ }
+
+ using RegistryHubSingleton = Singleton<RegistryHub, IRegistryHub, IMutableRegistryHub>;
+
+ IRegistryHub const& getRegistryHub() {
+ return RegistryHubSingleton::get();
+ }
+ IMutableRegistryHub& getMutableRegistryHub() {
+ return RegistryHubSingleton::getMutable();
+ }
+ void cleanUp() {
+ cleanupSingletons();
+ cleanUpContext();
+ }
+ std::string translateActiveException() {
+ return getRegistryHub().getExceptionTranslatorRegistry().translateActiveException();
+ }
+
+} // end namespace Catch
+// end catch_registry_hub.cpp
+// start catch_reporter_registry.cpp
+
+namespace Catch {
+
+ ReporterRegistry::~ReporterRegistry() = default;
+
+ IStreamingReporterPtr ReporterRegistry::create( std::string const& name, IConfigPtr const& config ) const {
+ auto it = m_factories.find( name );
+ if( it == m_factories.end() )
+ return nullptr;
+ return it->second->create( ReporterConfig( config ) );
+ }
+
+ void ReporterRegistry::registerReporter( std::string const& name, IReporterFactoryPtr const& factory ) {
+ m_factories.emplace(name, factory);
+ }
+ void ReporterRegistry::registerListener( IReporterFactoryPtr const& factory ) {
+ m_listeners.push_back( factory );
+ }
+
+ IReporterRegistry::FactoryMap const& ReporterRegistry::getFactories() const {
+ return m_factories;
+ }
+ IReporterRegistry::Listeners const& ReporterRegistry::getListeners() const {
+ return m_listeners;
+ }
+
+}
+// end catch_reporter_registry.cpp
+// start catch_result_type.cpp
+
+namespace Catch {
+
+ bool isOk( ResultWas::OfType resultType ) {
+ return ( resultType & ResultWas::FailureBit ) == 0;
+ }
+ bool isJustInfo( int flags ) {
+ return flags == ResultWas::Info;
+ }
+
+ ResultDisposition::Flags operator | ( ResultDisposition::Flags lhs, ResultDisposition::Flags rhs ) {
+ return static_cast<ResultDisposition::Flags>( static_cast<int>( lhs ) | static_cast<int>( rhs ) );
+ }
+
+ bool shouldContinueOnFailure( int flags ) { return ( flags & ResultDisposition::ContinueOnFailure ) != 0; }
+ bool shouldSuppressFailure( int flags ) { return ( flags & ResultDisposition::SuppressFail ) != 0; }
+
+} // end namespace Catch
+// end catch_result_type.cpp
+// start catch_run_context.cpp
+
+#include <cassert>
+#include <algorithm>
+#include <sstream>
+
+namespace Catch {
+
+ namespace Generators {
+ struct GeneratorTracker : TestCaseTracking::TrackerBase, IGeneratorTracker {
+ GeneratorBasePtr m_generator;
+
+ GeneratorTracker( TestCaseTracking::NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent )
+ : TrackerBase( nameAndLocation, ctx, parent )
+ {}
+ ~GeneratorTracker();
+
+ static GeneratorTracker& acquire( TrackerContext& ctx, TestCaseTracking::NameAndLocation const& nameAndLocation ) {
+ std::shared_ptr<GeneratorTracker> tracker;
+
+ ITracker& currentTracker = ctx.currentTracker();
+ if( TestCaseTracking::ITrackerPtr childTracker = currentTracker.findChild( nameAndLocation ) ) {
+ assert( childTracker );
+ assert( childTracker->isGeneratorTracker() );
+ tracker = std::static_pointer_cast<GeneratorTracker>( childTracker );
+ }
+ else {
+ tracker = std::make_shared<GeneratorTracker>( nameAndLocation, ctx, ¤tTracker );
+ currentTracker.addChild( tracker );
+ }
+
+ if( !ctx.completedCycle() && !tracker->isComplete() ) {
+ tracker->open();
+ }
+
+ return *tracker;
+ }
+
+ // TrackerBase interface
+ bool isGeneratorTracker() const override { return true; }
+ auto hasGenerator() const -> bool override {
+ return !!m_generator;
+ }
+ void close() override {
+ TrackerBase::close();
+ // Generator interface only finds out if it has another item on atual move
+ if (m_runState == CompletedSuccessfully && m_generator->next()) {
+ m_children.clear();
+ m_runState = Executing;
+ }
+ }
+
+ // IGeneratorTracker interface
+ auto getGenerator() const -> GeneratorBasePtr const& override {
+ return m_generator;
+ }
+ void setGenerator( GeneratorBasePtr&& generator ) override {
+ m_generator = std::move( generator );
+ }
+ };
+ GeneratorTracker::~GeneratorTracker() {}
+ }
+
+ RunContext::RunContext(IConfigPtr const& _config, IStreamingReporterPtr&& reporter)
+ : m_runInfo(_config->name()),
+ m_context(getCurrentMutableContext()),
+ m_config(_config),
+ m_reporter(std::move(reporter)),
+ m_lastAssertionInfo{ StringRef(), SourceLineInfo("",0), StringRef(), ResultDisposition::Normal },
+ m_includeSuccessfulResults( m_config->includeSuccessfulResults() || m_reporter->getPreferences().shouldReportAllAssertions )
+ {
+ m_context.setRunner(this);
+ m_context.setConfig(m_config);
+ m_context.setResultCapture(this);
+ m_reporter->testRunStarting(m_runInfo);
+ }
+
+ RunContext::~RunContext() {
+ m_reporter->testRunEnded(TestRunStats(m_runInfo, m_totals, aborting()));
+ }
+
+ void RunContext::testGroupStarting(std::string const& testSpec, std::size_t groupIndex, std::size_t groupsCount) {
+ m_reporter->testGroupStarting(GroupInfo(testSpec, groupIndex, groupsCount));
+ }
+
+ void RunContext::testGroupEnded(std::string const& testSpec, Totals const& totals, std::size_t groupIndex, std::size_t groupsCount) {
+ m_reporter->testGroupEnded(TestGroupStats(GroupInfo(testSpec, groupIndex, groupsCount), totals, aborting()));
+ }
+
+ Totals RunContext::runTest(TestCase const& testCase) {
+ Totals prevTotals = m_totals;
+
+ std::string redirectedCout;
+ std::string redirectedCerr;
+
+ auto const& testInfo = testCase.getTestCaseInfo();
+
+ m_reporter->testCaseStarting(testInfo);
+
+ m_activeTestCase = &testCase;
+
+ ITracker& rootTracker = m_trackerContext.startRun();
+ assert(rootTracker.isSectionTracker());
+ static_cast<SectionTracker&>(rootTracker).addInitialFilters(m_config->getSectionsToRun());
+ do {
+ m_trackerContext.startCycle();
+ m_testCaseTracker = &SectionTracker::acquire(m_trackerContext, TestCaseTracking::NameAndLocation(testInfo.name, testInfo.lineInfo));
+ runCurrentTest(redirectedCout, redirectedCerr);
+ } while (!m_testCaseTracker->isSuccessfullyCompleted() && !aborting());
+
+ Totals deltaTotals = m_totals.delta(prevTotals);
+ if (testInfo.expectedToFail() && deltaTotals.testCases.passed > 0) {
+ deltaTotals.assertions.failed++;
+ deltaTotals.testCases.passed--;
+ deltaTotals.testCases.failed++;
+ }
+ m_totals.testCases += deltaTotals.testCases;
+ m_reporter->testCaseEnded(TestCaseStats(testInfo,
+ deltaTotals,
+ redirectedCout,
+ redirectedCerr,
+ aborting()));
+
+ m_activeTestCase = nullptr;
+ m_testCaseTracker = nullptr;
+
+ return deltaTotals;
+ }
+
+ IConfigPtr RunContext::config() const {
+ return m_config;
+ }
+
+ IStreamingReporter& RunContext::reporter() const {
+ return *m_reporter;
+ }
+
+ void RunContext::assertionEnded(AssertionResult const & result) {
+ if (result.getResultType() == ResultWas::Ok) {
+ m_totals.assertions.passed++;
+ m_lastAssertionPassed = true;
+ } else if (!result.isOk()) {
+ m_lastAssertionPassed = false;
+ if( m_activeTestCase->getTestCaseInfo().okToFail() )
+ m_totals.assertions.failedButOk++;
+ else
+ m_totals.assertions.failed++;
+ }
+ else {
+ m_lastAssertionPassed = true;
+ }
+
+ // We have no use for the return value (whether messages should be cleared), because messages were made scoped
+ // and should be let to clear themselves out.
+ static_cast<void>(m_reporter->assertionEnded(AssertionStats(result, m_messages, m_totals)));
+
+ if (result.getResultType() != ResultWas::Warning)
+ m_messageScopes.clear();
+
+ // Reset working state
+ resetAssertionInfo();
+ m_lastResult = result;
+ }
+ void RunContext::resetAssertionInfo() {
+ m_lastAssertionInfo.macroName = StringRef();
+ m_lastAssertionInfo.capturedExpression = "{Unknown expression after the reported line}"_sr;
+ }
+
+ bool RunContext::sectionStarted(SectionInfo const & sectionInfo, Counts & assertions) {
+ ITracker& sectionTracker = SectionTracker::acquire(m_trackerContext, TestCaseTracking::NameAndLocation(sectionInfo.name, sectionInfo.lineInfo));
+ if (!sectionTracker.isOpen())
+ return false;
+ m_activeSections.push_back(§ionTracker);
+
+ m_lastAssertionInfo.lineInfo = sectionInfo.lineInfo;
+
+ m_reporter->sectionStarting(sectionInfo);
+
+ assertions = m_totals.assertions;
+
+ return true;
+ }
+ auto RunContext::acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& {
+ using namespace Generators;
+ GeneratorTracker& tracker = GeneratorTracker::acquire( m_trackerContext, TestCaseTracking::NameAndLocation( "generator", lineInfo ) );
+ assert( tracker.isOpen() );
+ m_lastAssertionInfo.lineInfo = lineInfo;
+ return tracker;
+ }
+
+ bool RunContext::testForMissingAssertions(Counts& assertions) {
+ if (assertions.total() != 0)
+ return false;
+ if (!m_config->warnAboutMissingAssertions())
+ return false;
+ if (m_trackerContext.currentTracker().hasChildren())
+ return false;
+ m_totals.assertions.failed++;
+ assertions.failed++;
+ return true;
+ }
+
+ void RunContext::sectionEnded(SectionEndInfo const & endInfo) {
+ Counts assertions = m_totals.assertions - endInfo.prevAssertions;
+ bool missingAssertions = testForMissingAssertions(assertions);
+
+ if (!m_activeSections.empty()) {
+ m_activeSections.back()->close();
+ m_activeSections.pop_back();
+ }
+
+ m_reporter->sectionEnded(SectionStats(endInfo.sectionInfo, assertions, endInfo.durationInSeconds, missingAssertions));
+ m_messages.clear();
+ m_messageScopes.clear();
+ }
+
+ void RunContext::sectionEndedEarly(SectionEndInfo const & endInfo) {
+ if (m_unfinishedSections.empty())
+ m_activeSections.back()->fail();
+ else
+ m_activeSections.back()->close();
+ m_activeSections.pop_back();
+
+ m_unfinishedSections.push_back(endInfo);
+ }
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ void RunContext::benchmarkPreparing(std::string const& name) {
+ m_reporter->benchmarkPreparing(name);
+ }
+ void RunContext::benchmarkStarting( BenchmarkInfo const& info ) {
+ m_reporter->benchmarkStarting( info );
+ }
+ void RunContext::benchmarkEnded( BenchmarkStats<> const& stats ) {
+ m_reporter->benchmarkEnded( stats );
+ }
+ void RunContext::benchmarkFailed(std::string const & error) {
+ m_reporter->benchmarkFailed(error);
+ }
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ void RunContext::pushScopedMessage(MessageInfo const & message) {
+ m_messages.push_back(message);
+ }
+
+ void RunContext::popScopedMessage(MessageInfo const & message) {
+ m_messages.erase(std::remove(m_messages.begin(), m_messages.end(), message), m_messages.end());
+ }
+
+ void RunContext::emplaceUnscopedMessage( MessageBuilder const& builder ) {
+ m_messageScopes.emplace_back( builder );
+ }
+
+ std::string RunContext::getCurrentTestName() const {
+ return m_activeTestCase
+ ? m_activeTestCase->getTestCaseInfo().name
+ : std::string();
+ }
+
+ const AssertionResult * RunContext::getLastResult() const {
+ return &(*m_lastResult);
+ }
+
+ void RunContext::exceptionEarlyReported() {
+ m_shouldReportUnexpected = false;
+ }
+
+ void RunContext::handleFatalErrorCondition( StringRef message ) {
+ // First notify reporter that bad things happened
+ m_reporter->fatalErrorEncountered(message);
+
+ // Don't rebuild the result -- the stringification itself can cause more fatal errors
+ // Instead, fake a result data.
+ AssertionResultData tempResult( ResultWas::FatalErrorCondition, { false } );
+ tempResult.message = message;
+ AssertionResult result(m_lastAssertionInfo, tempResult);
+
+ assertionEnded(result);
+
+ handleUnfinishedSections();
+
+ // Recreate section for test case (as we will lose the one that was in scope)
+ auto const& testCaseInfo = m_activeTestCase->getTestCaseInfo();
+ SectionInfo testCaseSection(testCaseInfo.lineInfo, testCaseInfo.name);
+
+ Counts assertions;
+ assertions.failed = 1;
+ SectionStats testCaseSectionStats(testCaseSection, assertions, 0, false);
+ m_reporter->sectionEnded(testCaseSectionStats);
+
+ auto const& testInfo = m_activeTestCase->getTestCaseInfo();
+
+ Totals deltaTotals;
+ deltaTotals.testCases.failed = 1;
+ deltaTotals.assertions.failed = 1;
+ m_reporter->testCaseEnded(TestCaseStats(testInfo,
+ deltaTotals,
+ std::string(),
+ std::string(),
+ false));
+ m_totals.testCases.failed++;
+ testGroupEnded(std::string(), m_totals, 1, 1);
+ m_reporter->testRunEnded(TestRunStats(m_runInfo, m_totals, false));
+ }
+
+ bool RunContext::lastAssertionPassed() {
+ return m_lastAssertionPassed;
+ }
+
+ void RunContext::assertionPassed() {
+ m_lastAssertionPassed = true;
+ ++m_totals.assertions.passed;
+ resetAssertionInfo();
+ m_messageScopes.clear();
+ }
+
+ bool RunContext::aborting() const {
+ return m_totals.assertions.failed >= static_cast<std::size_t>(m_config->abortAfter());
+ }
+
+ void RunContext::runCurrentTest(std::string & redirectedCout, std::string & redirectedCerr) {
+ auto const& testCaseInfo = m_activeTestCase->getTestCaseInfo();
+ SectionInfo testCaseSection(testCaseInfo.lineInfo, testCaseInfo.name);
+ m_reporter->sectionStarting(testCaseSection);
+ Counts prevAssertions = m_totals.assertions;
+ double duration = 0;
+ m_shouldReportUnexpected = true;
+ m_lastAssertionInfo = { "TEST_CASE"_sr, testCaseInfo.lineInfo, StringRef(), ResultDisposition::Normal };
+
+ seedRng(*m_config);
+
+ Timer timer;
+ CATCH_TRY {
+ if (m_reporter->getPreferences().shouldRedirectStdOut) {
+#if !defined(CATCH_CONFIG_EXPERIMENTAL_REDIRECT)
+ RedirectedStreams redirectedStreams(redirectedCout, redirectedCerr);
+
+ timer.start();
+ invokeActiveTestCase();
+#else
+ OutputRedirect r(redirectedCout, redirectedCerr);
+ timer.start();
+ invokeActiveTestCase();
+#endif
+ } else {
+ timer.start();
+ invokeActiveTestCase();
+ }
+ duration = timer.getElapsedSeconds();
+ } CATCH_CATCH_ANON (TestFailureException&) {
+ // This just means the test was aborted due to failure
+ } CATCH_CATCH_ALL {
+ // Under CATCH_CONFIG_FAST_COMPILE, unexpected exceptions under REQUIRE assertions
+ // are reported without translation at the point of origin.
+ if( m_shouldReportUnexpected ) {
+ AssertionReaction dummyReaction;
+ handleUnexpectedInflightException( m_lastAssertionInfo, translateActiveException(), dummyReaction );
+ }
+ }
+ Counts assertions = m_totals.assertions - prevAssertions;
+ bool missingAssertions = testForMissingAssertions(assertions);
+
+ m_testCaseTracker->close();
+ handleUnfinishedSections();
+ m_messages.clear();
+ m_messageScopes.clear();
+
+ SectionStats testCaseSectionStats(testCaseSection, assertions, duration, missingAssertions);
+ m_reporter->sectionEnded(testCaseSectionStats);
+ }
+
+ void RunContext::invokeActiveTestCase() {
+ FatalConditionHandler fatalConditionHandler; // Handle signals
+ m_activeTestCase->invoke();
+ fatalConditionHandler.reset();
+ }
+
+ void RunContext::handleUnfinishedSections() {
+ // If sections ended prematurely due to an exception we stored their
+ // infos here so we can tear them down outside the unwind process.
+ for (auto it = m_unfinishedSections.rbegin(),
+ itEnd = m_unfinishedSections.rend();
+ it != itEnd;
+ ++it)
+ sectionEnded(*it);
+ m_unfinishedSections.clear();
+ }
+
+ void RunContext::handleExpr(
+ AssertionInfo const& info,
+ ITransientExpression const& expr,
+ AssertionReaction& reaction
+ ) {
+ m_reporter->assertionStarting( info );
+
+ bool negated = isFalseTest( info.resultDisposition );
+ bool result = expr.getResult() != negated;
+
+ if( result ) {
+ if (!m_includeSuccessfulResults) {
+ assertionPassed();
+ }
+ else {
+ reportExpr(info, ResultWas::Ok, &expr, negated);
+ }
+ }
+ else {
+ reportExpr(info, ResultWas::ExpressionFailed, &expr, negated );
+ populateReaction( reaction );
+ }
+ }
+ void RunContext::reportExpr(
+ AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ ITransientExpression const *expr,
+ bool negated ) {
+
+ m_lastAssertionInfo = info;
+ AssertionResultData data( resultType, LazyExpression( negated ) );
+
+ AssertionResult assertionResult{ info, data };
+ assertionResult.m_resultData.lazyExpression.m_transientExpression = expr;
+
+ assertionEnded( assertionResult );
+ }
+
+ void RunContext::handleMessage(
+ AssertionInfo const& info,
+ ResultWas::OfType resultType,
+ StringRef const& message,
+ AssertionReaction& reaction
+ ) {
+ m_reporter->assertionStarting( info );
+
+ m_lastAssertionInfo = info;
+
+ AssertionResultData data( resultType, LazyExpression( false ) );
+ data.message = message;
+ AssertionResult assertionResult{ m_lastAssertionInfo, data };
+ assertionEnded( assertionResult );
+ if( !assertionResult.isOk() )
+ populateReaction( reaction );
+ }
+ void RunContext::handleUnexpectedExceptionNotThrown(
+ AssertionInfo const& info,
+ AssertionReaction& reaction
+ ) {
+ handleNonExpr(info, Catch::ResultWas::DidntThrowException, reaction);
+ }
+
+ void RunContext::handleUnexpectedInflightException(
+ AssertionInfo const& info,
+ std::string const& message,
+ AssertionReaction& reaction
+ ) {
+ m_lastAssertionInfo = info;
+
+ AssertionResultData data( ResultWas::ThrewException, LazyExpression( false ) );
+ data.message = message;
+ AssertionResult assertionResult{ info, data };
+ assertionEnded( assertionResult );
+ populateReaction( reaction );
+ }
+
+ void RunContext::populateReaction( AssertionReaction& reaction ) {
+ reaction.shouldDebugBreak = m_config->shouldDebugBreak();
+ reaction.shouldThrow = aborting() || (m_lastAssertionInfo.resultDisposition & ResultDisposition::Normal);
+ }
+
+ void RunContext::handleIncomplete(
+ AssertionInfo const& info
+ ) {
+ m_lastAssertionInfo = info;
+
+ AssertionResultData data( ResultWas::ThrewException, LazyExpression( false ) );
+ data.message = "Exception translation was disabled by CATCH_CONFIG_FAST_COMPILE";
+ AssertionResult assertionResult{ info, data };
+ assertionEnded( assertionResult );
+ }
+ void RunContext::handleNonExpr(
+ AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ AssertionReaction &reaction
+ ) {
+ m_lastAssertionInfo = info;
+
+ AssertionResultData data( resultType, LazyExpression( false ) );
+ AssertionResult assertionResult{ info, data };
+ assertionEnded( assertionResult );
+
+ if( !assertionResult.isOk() )
+ populateReaction( reaction );
+ }
+
+ IResultCapture& getResultCapture() {
+ if (auto* capture = getCurrentContext().getResultCapture())
+ return *capture;
+ else
+ CATCH_INTERNAL_ERROR("No result capture instance");
+ }
+}
+// end catch_run_context.cpp
+// start catch_section.cpp
+
+namespace Catch {
+
+ Section::Section( SectionInfo const& info )
+ : m_info( info ),
+ m_sectionIncluded( getResultCapture().sectionStarted( m_info, m_assertions ) )
+ {
+ m_timer.start();
+ }
+
+ Section::~Section() {
+ if( m_sectionIncluded ) {
+ SectionEndInfo endInfo{ m_info, m_assertions, m_timer.getElapsedSeconds() };
+ if( uncaught_exceptions() )
+ getResultCapture().sectionEndedEarly( endInfo );
+ else
+ getResultCapture().sectionEnded( endInfo );
+ }
+ }
+
+ // This indicates whether the section should be executed or not
+ Section::operator bool() const {
+ return m_sectionIncluded;
+ }
+
+} // end namespace Catch
+// end catch_section.cpp
+// start catch_section_info.cpp
+
+namespace Catch {
+
+ SectionInfo::SectionInfo
+ ( SourceLineInfo const& _lineInfo,
+ std::string const& _name )
+ : name( _name ),
+ lineInfo( _lineInfo )
+ {}
+
+} // end namespace Catch
+// end catch_section_info.cpp
+// start catch_session.cpp
+
+// start catch_session.h
+
+#include <memory>
+
+namespace Catch {
+
+ class Session : NonCopyable {
+ public:
+
+ Session();
+ ~Session() override;
+
+ void showHelp() const;
+ void libIdentify();
+
+ int applyCommandLine( int argc, char const * const * argv );
+ #if defined(CATCH_CONFIG_WCHAR) && defined(WIN32) && defined(UNICODE)
+ int applyCommandLine( int argc, wchar_t const * const * argv );
+ #endif
+
+ void useConfigData( ConfigData const& configData );
+
+ template<typename CharT>
+ int run(int argc, CharT const * const argv[]) {
+ if (m_startupExceptions)
+ return 1;
+ int returnCode = applyCommandLine(argc, argv);
+ if (returnCode == 0)
+ returnCode = run();
+ return returnCode;
+ }
+
+ int run();
+
+ clara::Parser const& cli() const;
+ void cli( clara::Parser const& newParser );
+ ConfigData& configData();
+ Config& config();
+ private:
+ int runInternal();
+
+ clara::Parser m_cli;
+ ConfigData m_configData;
+ std::shared_ptr<Config> m_config;
+ bool m_startupExceptions = false;
+ };
+
+} // end namespace Catch
+
+// end catch_session.h
+// start catch_version.h
+
+#include <iosfwd>
+
+namespace Catch {
+
+ // Versioning information
+ struct Version {
+ Version( Version const& ) = delete;
+ Version& operator=( Version const& ) = delete;
+ Version( unsigned int _majorVersion,
+ unsigned int _minorVersion,
+ unsigned int _patchNumber,
+ char const * const _branchName,
+ unsigned int _buildNumber );
+
+ unsigned int const majorVersion;
+ unsigned int const minorVersion;
+ unsigned int const patchNumber;
+
+ // buildNumber is only used if branchName is not null
+ char const * const branchName;
+ unsigned int const buildNumber;
+
+ friend std::ostream& operator << ( std::ostream& os, Version const& version );
+ };
+
+ Version const& libraryVersion();
+}
+
+// end catch_version.h
+#include <cstdlib>
+#include <iomanip>
+
+namespace Catch {
+
+ namespace {
+ const int MaxExitCode = 255;
+
+ IStreamingReporterPtr createReporter(std::string const& reporterName, IConfigPtr const& config) {
+ auto reporter = Catch::getRegistryHub().getReporterRegistry().create(reporterName, config);
+ CATCH_ENFORCE(reporter, "No reporter registered with name: '" << reporterName << "'");
+
+ return reporter;
+ }
+
+ IStreamingReporterPtr makeReporter(std::shared_ptr<Config> const& config) {
+ if (Catch::getRegistryHub().getReporterRegistry().getListeners().empty()) {
+ return createReporter(config->getReporterName(), config);
+ }
+
+ // On older platforms, returning std::unique_ptr<ListeningReporter>
+ // when the return type is std::unique_ptr<IStreamingReporter>
+ // doesn't compile without a std::move call. However, this causes
+ // a warning on newer platforms. Thus, we have to work around
+ // it a bit and downcast the pointer manually.
+ auto ret = std::unique_ptr<IStreamingReporter>(new ListeningReporter);
+ auto& multi = static_cast<ListeningReporter&>(*ret);
+ auto const& listeners = Catch::getRegistryHub().getReporterRegistry().getListeners();
+ for (auto const& listener : listeners) {
+ multi.addListener(listener->create(Catch::ReporterConfig(config)));
+ }
+ multi.addReporter(createReporter(config->getReporterName(), config));
+ return ret;
+ }
+
+ Catch::Totals runTests(std::shared_ptr<Config> const& config) {
+ auto reporter = makeReporter(config);
+
+ RunContext context(config, std::move(reporter));
+
+ Totals totals;
+
+ context.testGroupStarting(config->name(), 1, 1);
+
+ TestSpec testSpec = config->testSpec();
+
+ auto const& allTestCases = getAllTestCasesSorted(*config);
+ for (auto const& testCase : allTestCases) {
+ bool matching = (!testSpec.hasFilters() && !testCase.isHidden()) ||
+ (testSpec.hasFilters() && matchTest(testCase, testSpec, *config));
+
+ if (!context.aborting() && matching)
+ totals += context.runTest(testCase);
+ else
+ context.reporter().skipTest(testCase);
+ }
+
+ if (config->warnAboutNoTests() && totals.testCases.total() == 0) {
+ ReusableStringStream testConfig;
+
+ bool first = true;
+ for (const auto& input : config->getTestsOrTags()) {
+ if (!first) { testConfig << ' '; }
+ first = false;
+ testConfig << input;
+ }
+
+ context.reporter().noMatchingTestCases(testConfig.str());
+ totals.error = -1;
+ }
+
+ context.testGroupEnded(config->name(), totals, 1, 1);
+ return totals;
+ }
+
+ void applyFilenamesAsTags(Catch::IConfig const& config) {
+ auto& tests = const_cast<std::vector<TestCase>&>(getAllTestCasesSorted(config));
+ for (auto& testCase : tests) {
+ auto tags = testCase.tags;
+
+ std::string filename = testCase.lineInfo.file;
+ auto lastSlash = filename.find_last_of("\\/");
+ if (lastSlash != std::string::npos) {
+ filename.erase(0, lastSlash);
+ filename[0] = '#';
+ }
+
+ auto lastDot = filename.find_last_of('.');
+ if (lastDot != std::string::npos) {
+ filename.erase(lastDot);
+ }
+
+ tags.push_back(std::move(filename));
+ setTags(testCase, tags);
+ }
+ }
+
+ } // anon namespace
+
+ Session::Session() {
+ static bool alreadyInstantiated = false;
+ if( alreadyInstantiated ) {
+ CATCH_TRY { CATCH_INTERNAL_ERROR( "Only one instance of Catch::Session can ever be used" ); }
+ CATCH_CATCH_ALL { getMutableRegistryHub().registerStartupException(); }
+ }
+
+ // There cannot be exceptions at startup in no-exception mode.
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ const auto& exceptions = getRegistryHub().getStartupExceptionRegistry().getExceptions();
+ if ( !exceptions.empty() ) {
+ config();
+ getCurrentMutableContext().setConfig(m_config);
+
+ m_startupExceptions = true;
+ Colour colourGuard( Colour::Red );
+ Catch::cerr() << "Errors occurred during startup!" << '\n';
+ // iterate over all exceptions and notify user
+ for ( const auto& ex_ptr : exceptions ) {
+ try {
+ std::rethrow_exception(ex_ptr);
+ } catch ( std::exception const& ex ) {
+ Catch::cerr() << Column( ex.what() ).indent(2) << '\n';
+ }
+ }
+ }
+#endif
+
+ alreadyInstantiated = true;
+ m_cli = makeCommandLineParser( m_configData );
+ }
+ Session::~Session() {
+ Catch::cleanUp();
+ }
+
+ void Session::showHelp() const {
+ Catch::cout()
+ << "\nCatch v" << libraryVersion() << "\n"
+ << m_cli << std::endl
+ << "For more detailed usage please see the project docs\n" << std::endl;
+ }
+ void Session::libIdentify() {
+ Catch::cout()
+ << std::left << std::setw(16) << "description: " << "A Catch test executable\n"
+ << std::left << std::setw(16) << "category: " << "testframework\n"
+ << std::left << std::setw(16) << "framework: " << "Catch Test\n"
+ << std::left << std::setw(16) << "version: " << libraryVersion() << std::endl;
+ }
+
+ int Session::applyCommandLine( int argc, char const * const * argv ) {
+ if( m_startupExceptions )
+ return 1;
+
+ auto result = m_cli.parse( clara::Args( argc, argv ) );
+ if( !result ) {
+ config();
+ getCurrentMutableContext().setConfig(m_config);
+ Catch::cerr()
+ << Colour( Colour::Red )
+ << "\nError(s) in input:\n"
+ << Column( result.errorMessage() ).indent( 2 )
+ << "\n\n";
+ Catch::cerr() << "Run with -? for usage\n" << std::endl;
+ return MaxExitCode;
+ }
+
+ if( m_configData.showHelp )
+ showHelp();
+ if( m_configData.libIdentify )
+ libIdentify();
+ m_config.reset();
+ return 0;
+ }
+
+#if defined(CATCH_CONFIG_WCHAR) && defined(WIN32) && defined(UNICODE)
+ int Session::applyCommandLine( int argc, wchar_t const * const * argv ) {
+
+ char **utf8Argv = new char *[ argc ];
+
+ for ( int i = 0; i < argc; ++i ) {
+ int bufSize = WideCharToMultiByte( CP_UTF8, 0, argv[i], -1, NULL, 0, NULL, NULL );
+
+ utf8Argv[ i ] = new char[ bufSize ];
+
+ WideCharToMultiByte( CP_UTF8, 0, argv[i], -1, utf8Argv[i], bufSize, NULL, NULL );
+ }
+
+ int returnCode = applyCommandLine( argc, utf8Argv );
+
+ for ( int i = 0; i < argc; ++i )
+ delete [] utf8Argv[ i ];
+
+ delete [] utf8Argv;
+
+ return returnCode;
+ }
+#endif
+
+ void Session::useConfigData( ConfigData const& configData ) {
+ m_configData = configData;
+ m_config.reset();
+ }
+
+ int Session::run() {
+ if( ( m_configData.waitForKeypress & WaitForKeypress::BeforeStart ) != 0 ) {
+ Catch::cout() << "...waiting for enter/ return before starting" << std::endl;
+ static_cast<void>(std::getchar());
+ }
+ int exitCode = runInternal();
+ if( ( m_configData.waitForKeypress & WaitForKeypress::BeforeExit ) != 0 ) {
+ Catch::cout() << "...waiting for enter/ return before exiting, with code: " << exitCode << std::endl;
+ static_cast<void>(std::getchar());
+ }
+ return exitCode;
+ }
+
+ clara::Parser const& Session::cli() const {
+ return m_cli;
+ }
+ void Session::cli( clara::Parser const& newParser ) {
+ m_cli = newParser;
+ }
+ ConfigData& Session::configData() {
+ return m_configData;
+ }
+ Config& Session::config() {
+ if( !m_config )
+ m_config = std::make_shared<Config>( m_configData );
+ return *m_config;
+ }
+
+ int Session::runInternal() {
+ if( m_startupExceptions )
+ return 1;
+
+ if (m_configData.showHelp || m_configData.libIdentify) {
+ return 0;
+ }
+
+ CATCH_TRY {
+ config(); // Force config to be constructed
+
+ seedRng( *m_config );
+
+ if( m_configData.filenamesAsTags )
+ applyFilenamesAsTags( *m_config );
+
+ // Handle list request
+ if( Option<std::size_t> listed = list( m_config ) )
+ return static_cast<int>( *listed );
+
+ auto totals = runTests( m_config );
+ // Note that on unices only the lower 8 bits are usually used, clamping
+ // the return value to 255 prevents false negative when some multiple
+ // of 256 tests has failed
+ return (std::min) (MaxExitCode, (std::max) (totals.error, static_cast<int>(totals.assertions.failed)));
+ }
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ catch( std::exception& ex ) {
+ Catch::cerr() << ex.what() << std::endl;
+ return MaxExitCode;
+ }
+#endif
+ }
+
+} // end namespace Catch
+// end catch_session.cpp
+// start catch_singletons.cpp
+
+#include <vector>
+
+namespace Catch {
+
+ namespace {
+ static auto getSingletons() -> std::vector<ISingleton*>*& {
+ static std::vector<ISingleton*>* g_singletons = nullptr;
+ if( !g_singletons )
+ g_singletons = new std::vector<ISingleton*>();
+ return g_singletons;
+ }
+ }
+
+ ISingleton::~ISingleton() {}
+
+ void addSingleton(ISingleton* singleton ) {
+ getSingletons()->push_back( singleton );
+ }
+ void cleanupSingletons() {
+ auto& singletons = getSingletons();
+ for( auto singleton : *singletons )
+ delete singleton;
+ delete singletons;
+ singletons = nullptr;
+ }
+
+} // namespace Catch
+// end catch_singletons.cpp
+// start catch_startup_exception_registry.cpp
+
+namespace Catch {
+void StartupExceptionRegistry::add( std::exception_ptr const& exception ) noexcept {
+ CATCH_TRY {
+ m_exceptions.push_back(exception);
+ } CATCH_CATCH_ALL {
+ // If we run out of memory during start-up there's really not a lot more we can do about it
+ std::terminate();
+ }
+ }
+
+ std::vector<std::exception_ptr> const& StartupExceptionRegistry::getExceptions() const noexcept {
+ return m_exceptions;
+ }
+
+} // end namespace Catch
+// end catch_startup_exception_registry.cpp
+// start catch_stream.cpp
+
+#include <cstdio>
+#include <iostream>
+#include <fstream>
+#include <sstream>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ Catch::IStream::~IStream() = default;
+
+ namespace Detail { namespace {
+ template<typename WriterF, std::size_t bufferSize=256>
+ class StreamBufImpl : public std::streambuf {
+ char data[bufferSize];
+ WriterF m_writer;
+
+ public:
+ StreamBufImpl() {
+ setp( data, data + sizeof(data) );
+ }
+
+ ~StreamBufImpl() noexcept {
+ StreamBufImpl::sync();
+ }
+
+ private:
+ int overflow( int c ) override {
+ sync();
+
+ if( c != EOF ) {
+ if( pbase() == epptr() )
+ m_writer( std::string( 1, static_cast<char>( c ) ) );
+ else
+ sputc( static_cast<char>( c ) );
+ }
+ return 0;
+ }
+
+ int sync() override {
+ if( pbase() != pptr() ) {
+ m_writer( std::string( pbase(), static_cast<std::string::size_type>( pptr() - pbase() ) ) );
+ setp( pbase(), epptr() );
+ }
+ return 0;
+ }
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ struct OutputDebugWriter {
+
+ void operator()( std::string const&str ) {
+ writeToDebugConsole( str );
+ }
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class FileStream : public IStream {
+ mutable std::ofstream m_ofs;
+ public:
+ FileStream( StringRef filename ) {
+ m_ofs.open( filename.c_str() );
+ CATCH_ENFORCE( !m_ofs.fail(), "Unable to open file: '" << filename << "'" );
+ }
+ ~FileStream() override = default;
+ public: // IStream
+ std::ostream& stream() const override {
+ return m_ofs;
+ }
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class CoutStream : public IStream {
+ mutable std::ostream m_os;
+ public:
+ // Store the streambuf from cout up-front because
+ // cout may get redirected when running tests
+ CoutStream() : m_os( Catch::cout().rdbuf() ) {}
+ ~CoutStream() override = default;
+
+ public: // IStream
+ std::ostream& stream() const override { return m_os; }
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class DebugOutStream : public IStream {
+ std::unique_ptr<StreamBufImpl<OutputDebugWriter>> m_streamBuf;
+ mutable std::ostream m_os;
+ public:
+ DebugOutStream()
+ : m_streamBuf( new StreamBufImpl<OutputDebugWriter>() ),
+ m_os( m_streamBuf.get() )
+ {}
+
+ ~DebugOutStream() override = default;
+
+ public: // IStream
+ std::ostream& stream() const override { return m_os; }
+ };
+
+ }} // namespace anon::detail
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ auto makeStream( StringRef const &filename ) -> IStream const* {
+ if( filename.empty() )
+ return new Detail::CoutStream();
+ else if( filename[0] == '%' ) {
+ if( filename == "%debug" )
+ return new Detail::DebugOutStream();
+ else
+ CATCH_ERROR( "Unrecognised stream: '" << filename << "'" );
+ }
+ else
+ return new Detail::FileStream( filename );
+ }
+
+ // This class encapsulates the idea of a pool of ostringstreams that can be reused.
+ struct StringStreams {
+ std::vector<std::unique_ptr<std::ostringstream>> m_streams;
+ std::vector<std::size_t> m_unused;
+ std::ostringstream m_referenceStream; // Used for copy state/ flags from
+
+ auto add() -> std::size_t {
+ if( m_unused.empty() ) {
+ m_streams.push_back( std::unique_ptr<std::ostringstream>( new std::ostringstream ) );
+ return m_streams.size()-1;
+ }
+ else {
+ auto index = m_unused.back();
+ m_unused.pop_back();
+ return index;
+ }
+ }
+
+ void release( std::size_t index ) {
+ m_streams[index]->copyfmt( m_referenceStream ); // Restore initial flags and other state
+ m_unused.push_back(index);
+ }
+ };
+
+ ReusableStringStream::ReusableStringStream()
+ : m_index( Singleton<StringStreams>::getMutable().add() ),
+ m_oss( Singleton<StringStreams>::getMutable().m_streams[m_index].get() )
+ {}
+
+ ReusableStringStream::~ReusableStringStream() {
+ static_cast<std::ostringstream*>( m_oss )->str("");
+ m_oss->clear();
+ Singleton<StringStreams>::getMutable().release( m_index );
+ }
+
+ auto ReusableStringStream::str() const -> std::string {
+ return static_cast<std::ostringstream*>( m_oss )->str();
+ }
+
+ ///////////////////////////////////////////////////////////////////////////
+
+#ifndef CATCH_CONFIG_NOSTDOUT // If you #define this you must implement these functions
+ std::ostream& cout() { return std::cout; }
+ std::ostream& cerr() { return std::cerr; }
+ std::ostream& clog() { return std::clog; }
+#endif
+}
+// end catch_stream.cpp
+// start catch_string_manip.cpp
+
+#include <algorithm>
+#include <ostream>
+#include <cstring>
+#include <cctype>
+#include <vector>
+
+namespace Catch {
+
+ namespace {
+ char toLowerCh(char c) {
+ return static_cast<char>( std::tolower( c ) );
+ }
+ }
+
+ bool startsWith( std::string const& s, std::string const& prefix ) {
+ return s.size() >= prefix.size() && std::equal(prefix.begin(), prefix.end(), s.begin());
+ }
+ bool startsWith( std::string const& s, char prefix ) {
+ return !s.empty() && s[0] == prefix;
+ }
+ bool endsWith( std::string const& s, std::string const& suffix ) {
+ return s.size() >= suffix.size() && std::equal(suffix.rbegin(), suffix.rend(), s.rbegin());
+ }
+ bool endsWith( std::string const& s, char suffix ) {
+ return !s.empty() && s[s.size()-1] == suffix;
+ }
+ bool contains( std::string const& s, std::string const& infix ) {
+ return s.find( infix ) != std::string::npos;
+ }
+ void toLowerInPlace( std::string& s ) {
+ std::transform( s.begin(), s.end(), s.begin(), toLowerCh );
+ }
+ std::string toLower( std::string const& s ) {
+ std::string lc = s;
+ toLowerInPlace( lc );
+ return lc;
+ }
+ std::string trim( std::string const& str ) {
+ static char const* whitespaceChars = "\n\r\t ";
+ std::string::size_type start = str.find_first_not_of( whitespaceChars );
+ std::string::size_type end = str.find_last_not_of( whitespaceChars );
+
+ return start != std::string::npos ? str.substr( start, 1+end-start ) : std::string();
+ }
+
+ bool replaceInPlace( std::string& str, std::string const& replaceThis, std::string const& withThis ) {
+ bool replaced = false;
+ std::size_t i = str.find( replaceThis );
+ while( i != std::string::npos ) {
+ replaced = true;
+ str = str.substr( 0, i ) + withThis + str.substr( i+replaceThis.size() );
+ if( i < str.size()-withThis.size() )
+ i = str.find( replaceThis, i+withThis.size() );
+ else
+ i = std::string::npos;
+ }
+ return replaced;
+ }
+
+ std::vector<StringRef> splitStringRef( StringRef str, char delimiter ) {
+ std::vector<StringRef> subStrings;
+ std::size_t start = 0;
+ for(std::size_t pos = 0; pos < str.size(); ++pos ) {
+ if( str[pos] == delimiter ) {
+ if( pos - start > 1 )
+ subStrings.push_back( str.substr( start, pos-start ) );
+ start = pos+1;
+ }
+ }
+ if( start < str.size() )
+ subStrings.push_back( str.substr( start, str.size()-start ) );
+ return subStrings;
+ }
+
+ pluralise::pluralise( std::size_t count, std::string const& label )
+ : m_count( count ),
+ m_label( label )
+ {}
+
+ std::ostream& operator << ( std::ostream& os, pluralise const& pluraliser ) {
+ os << pluraliser.m_count << ' ' << pluraliser.m_label;
+ if( pluraliser.m_count != 1 )
+ os << 's';
+ return os;
+ }
+
+}
+// end catch_string_manip.cpp
+// start catch_stringref.cpp
+
+#if defined(__clang__)
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wexit-time-destructors"
+#endif
+
+#include <ostream>
+#include <cstring>
+#include <cstdint>
+
+namespace {
+ const uint32_t byte_2_lead = 0xC0;
+ const uint32_t byte_3_lead = 0xE0;
+ const uint32_t byte_4_lead = 0xF0;
+}
+
+namespace Catch {
+ StringRef::StringRef( char const* rawChars ) noexcept
+ : StringRef( rawChars, static_cast<StringRef::size_type>(std::strlen(rawChars) ) )
+ {}
+
+ StringRef::operator std::string() const {
+ return std::string( m_start, m_size );
+ }
+
+ void StringRef::swap( StringRef& other ) noexcept {
+ std::swap( m_start, other.m_start );
+ std::swap( m_size, other.m_size );
+ std::swap( m_data, other.m_data );
+ }
+
+ auto StringRef::c_str() const -> char const* {
+ if( !isSubstring() )
+ return m_start;
+
+ const_cast<StringRef *>( this )->takeOwnership();
+ return m_data;
+ }
+ auto StringRef::currentData() const noexcept -> char const* {
+ return m_start;
+ }
+
+ auto StringRef::isOwned() const noexcept -> bool {
+ return m_data != nullptr;
+ }
+ auto StringRef::isSubstring() const noexcept -> bool {
+ return m_start[m_size] != '\0';
+ }
+
+ void StringRef::takeOwnership() {
+ if( !isOwned() ) {
+ m_data = new char[m_size+1];
+ memcpy( m_data, m_start, m_size );
+ m_data[m_size] = '\0';
+ }
+ }
+ auto StringRef::substr( size_type start, size_type size ) const noexcept -> StringRef {
+ if( start < m_size )
+ return StringRef( m_start+start, size );
+ else
+ return StringRef();
+ }
+ auto StringRef::operator == ( StringRef const& other ) const noexcept -> bool {
+ return
+ size() == other.size() &&
+ (std::strncmp( m_start, other.m_start, size() ) == 0);
+ }
+ auto StringRef::operator != ( StringRef const& other ) const noexcept -> bool {
+ return !operator==( other );
+ }
+
+ auto StringRef::operator[](size_type index) const noexcept -> char {
+ return m_start[index];
+ }
+
+ auto StringRef::numberOfCharacters() const noexcept -> size_type {
+ size_type noChars = m_size;
+ // Make adjustments for uft encodings
+ for( size_type i=0; i < m_size; ++i ) {
+ char c = m_start[i];
+ if( ( c & byte_2_lead ) == byte_2_lead ) {
+ noChars--;
+ if (( c & byte_3_lead ) == byte_3_lead )
+ noChars--;
+ if( ( c & byte_4_lead ) == byte_4_lead )
+ noChars--;
+ }
+ }
+ return noChars;
+ }
+
+ auto operator + ( StringRef const& lhs, StringRef const& rhs ) -> std::string {
+ std::string str;
+ str.reserve( lhs.size() + rhs.size() );
+ str += lhs;
+ str += rhs;
+ return str;
+ }
+ auto operator + ( StringRef const& lhs, const char* rhs ) -> std::string {
+ return std::string( lhs ) + std::string( rhs );
+ }
+ auto operator + ( char const* lhs, StringRef const& rhs ) -> std::string {
+ return std::string( lhs ) + std::string( rhs );
+ }
+
+ auto operator << ( std::ostream& os, StringRef const& str ) -> std::ostream& {
+ return os.write(str.currentData(), str.size());
+ }
+
+ auto operator+=( std::string& lhs, StringRef const& rhs ) -> std::string& {
+ lhs.append(rhs.currentData(), rhs.size());
+ return lhs;
+ }
+
+} // namespace Catch
+
+#if defined(__clang__)
+# pragma clang diagnostic pop
+#endif
+// end catch_stringref.cpp
+// start catch_tag_alias.cpp
+
+namespace Catch {
+ TagAlias::TagAlias(std::string const & _tag, SourceLineInfo _lineInfo): tag(_tag), lineInfo(_lineInfo) {}
+}
+// end catch_tag_alias.cpp
+// start catch_tag_alias_autoregistrar.cpp
+
+namespace Catch {
+
+ RegistrarForTagAliases::RegistrarForTagAliases(char const* alias, char const* tag, SourceLineInfo const& lineInfo) {
+ CATCH_TRY {
+ getMutableRegistryHub().registerTagAlias(alias, tag, lineInfo);
+ } CATCH_CATCH_ALL {
+ // Do not throw when constructing global objects, instead register the exception to be processed later
+ getMutableRegistryHub().registerStartupException();
+ }
+ }
+
+}
+// end catch_tag_alias_autoregistrar.cpp
+// start catch_tag_alias_registry.cpp
+
+#include <sstream>
+
+namespace Catch {
+
+ TagAliasRegistry::~TagAliasRegistry() {}
+
+ TagAlias const* TagAliasRegistry::find( std::string const& alias ) const {
+ auto it = m_registry.find( alias );
+ if( it != m_registry.end() )
+ return &(it->second);
+ else
+ return nullptr;
+ }
+
+ std::string TagAliasRegistry::expandAliases( std::string const& unexpandedTestSpec ) const {
+ std::string expandedTestSpec = unexpandedTestSpec;
+ for( auto const& registryKvp : m_registry ) {
+ std::size_t pos = expandedTestSpec.find( registryKvp.first );
+ if( pos != std::string::npos ) {
+ expandedTestSpec = expandedTestSpec.substr( 0, pos ) +
+ registryKvp.second.tag +
+ expandedTestSpec.substr( pos + registryKvp.first.size() );
+ }
+ }
+ return expandedTestSpec;
+ }
+
+ void TagAliasRegistry::add( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ) {
+ CATCH_ENFORCE( startsWith(alias, "[@") && endsWith(alias, ']'),
+ "error: tag alias, '" << alias << "' is not of the form [@alias name].\n" << lineInfo );
+
+ CATCH_ENFORCE( m_registry.insert(std::make_pair(alias, TagAlias(tag, lineInfo))).second,
+ "error: tag alias, '" << alias << "' already registered.\n"
+ << "\tFirst seen at: " << find(alias)->lineInfo << "\n"
+ << "\tRedefined at: " << lineInfo );
+ }
+
+ ITagAliasRegistry::~ITagAliasRegistry() {}
+
+ ITagAliasRegistry const& ITagAliasRegistry::get() {
+ return getRegistryHub().getTagAliasRegistry();
+ }
+
+} // end namespace Catch
+// end catch_tag_alias_registry.cpp
+// start catch_test_case_info.cpp
+
+#include <cctype>
+#include <exception>
+#include <algorithm>
+#include <sstream>
+
+namespace Catch {
+
+ namespace {
+ TestCaseInfo::SpecialProperties parseSpecialTag( std::string const& tag ) {
+ if( startsWith( tag, '.' ) ||
+ tag == "!hide" )
+ return TestCaseInfo::IsHidden;
+ else if( tag == "!throws" )
+ return TestCaseInfo::Throws;
+ else if( tag == "!shouldfail" )
+ return TestCaseInfo::ShouldFail;
+ else if( tag == "!mayfail" )
+ return TestCaseInfo::MayFail;
+ else if( tag == "!nonportable" )
+ return TestCaseInfo::NonPortable;
+ else if( tag == "!benchmark" )
+ return static_cast<TestCaseInfo::SpecialProperties>( TestCaseInfo::Benchmark | TestCaseInfo::IsHidden );
+ else
+ return TestCaseInfo::None;
+ }
+ bool isReservedTag( std::string const& tag ) {
+ return parseSpecialTag( tag ) == TestCaseInfo::None && tag.size() > 0 && !std::isalnum( static_cast<unsigned char>(tag[0]) );
+ }
+ void enforceNotReservedTag( std::string const& tag, SourceLineInfo const& _lineInfo ) {
+ CATCH_ENFORCE( !isReservedTag(tag),
+ "Tag name: [" << tag << "] is not allowed.\n"
+ << "Tag names starting with non alphanumeric characters are reserved\n"
+ << _lineInfo );
+ }
+ }
+
+ TestCase makeTestCase( ITestInvoker* _testCase,
+ std::string const& _className,
+ NameAndTags const& nameAndTags,
+ SourceLineInfo const& _lineInfo )
+ {
+ bool isHidden = false;
+
+ // Parse out tags
+ std::vector<std::string> tags;
+ std::string desc, tag;
+ bool inTag = false;
+ std::string _descOrTags = nameAndTags.tags;
+ for (char c : _descOrTags) {
+ if( !inTag ) {
+ if( c == '[' )
+ inTag = true;
+ else
+ desc += c;
+ }
+ else {
+ if( c == ']' ) {
+ TestCaseInfo::SpecialProperties prop = parseSpecialTag( tag );
+ if( ( prop & TestCaseInfo::IsHidden ) != 0 )
+ isHidden = true;
+ else if( prop == TestCaseInfo::None )
+ enforceNotReservedTag( tag, _lineInfo );
+
+ // Merged hide tags like `[.approvals]` should be added as
+ // `[.][approvals]`. The `[.]` is added at later point, so
+ // we only strip the prefix
+ if (startsWith(tag, '.') && tag.size() > 1) {
+ tag.erase(0, 1);
+ }
+ tags.push_back( tag );
+ tag.clear();
+ inTag = false;
+ }
+ else
+ tag += c;
+ }
+ }
+ if( isHidden ) {
+ tags.push_back( "." );
+ }
+
+ TestCaseInfo info( nameAndTags.name, _className, desc, tags, _lineInfo );
+ return TestCase( _testCase, std::move(info) );
+ }
+
+ void setTags( TestCaseInfo& testCaseInfo, std::vector<std::string> tags ) {
+ std::sort(begin(tags), end(tags));
+ tags.erase(std::unique(begin(tags), end(tags)), end(tags));
+ testCaseInfo.lcaseTags.clear();
+
+ for( auto const& tag : tags ) {
+ std::string lcaseTag = toLower( tag );
+ testCaseInfo.properties = static_cast<TestCaseInfo::SpecialProperties>( testCaseInfo.properties | parseSpecialTag( lcaseTag ) );
+ testCaseInfo.lcaseTags.push_back( lcaseTag );
+ }
+ testCaseInfo.tags = std::move(tags);
+ }
+
+ TestCaseInfo::TestCaseInfo( std::string const& _name,
+ std::string const& _className,
+ std::string const& _description,
+ std::vector<std::string> const& _tags,
+ SourceLineInfo const& _lineInfo )
+ : name( _name ),
+ className( _className ),
+ description( _description ),
+ lineInfo( _lineInfo ),
+ properties( None )
+ {
+ setTags( *this, _tags );
+ }
+
+ bool TestCaseInfo::isHidden() const {
+ return ( properties & IsHidden ) != 0;
+ }
+ bool TestCaseInfo::throws() const {
+ return ( properties & Throws ) != 0;
+ }
+ bool TestCaseInfo::okToFail() const {
+ return ( properties & (ShouldFail | MayFail ) ) != 0;
+ }
+ bool TestCaseInfo::expectedToFail() const {
+ return ( properties & (ShouldFail ) ) != 0;
+ }
+
+ std::string TestCaseInfo::tagsAsString() const {
+ std::string ret;
+ // '[' and ']' per tag
+ std::size_t full_size = 2 * tags.size();
+ for (const auto& tag : tags) {
+ full_size += tag.size();
+ }
+ ret.reserve(full_size);
+ for (const auto& tag : tags) {
+ ret.push_back('[');
+ ret.append(tag);
+ ret.push_back(']');
+ }
+
+ return ret;
+ }
+
+ TestCase::TestCase( ITestInvoker* testCase, TestCaseInfo&& info ) : TestCaseInfo( std::move(info) ), test( testCase ) {}
+
+ TestCase TestCase::withName( std::string const& _newName ) const {
+ TestCase other( *this );
+ other.name = _newName;
+ return other;
+ }
+
+ void TestCase::invoke() const {
+ test->invoke();
+ }
+
+ bool TestCase::operator == ( TestCase const& other ) const {
+ return test.get() == other.test.get() &&
+ name == other.name &&
+ className == other.className;
+ }
+
+ bool TestCase::operator < ( TestCase const& other ) const {
+ return name < other.name;
+ }
+
+ TestCaseInfo const& TestCase::getTestCaseInfo() const
+ {
+ return *this;
+ }
+
+} // end namespace Catch
+// end catch_test_case_info.cpp
+// start catch_test_case_registry_impl.cpp
+
+#include <sstream>
+
+namespace Catch {
+
+ std::vector<TestCase> sortTests( IConfig const& config, std::vector<TestCase> const& unsortedTestCases ) {
+
+ std::vector<TestCase> sorted = unsortedTestCases;
+
+ switch( config.runOrder() ) {
+ case RunTests::InLexicographicalOrder:
+ std::sort( sorted.begin(), sorted.end() );
+ break;
+ case RunTests::InRandomOrder:
+ seedRng( config );
+ std::shuffle( sorted.begin(), sorted.end(), rng() );
+ break;
+ case RunTests::InDeclarationOrder:
+ // already in declaration order
+ break;
+ }
+ return sorted;
+ }
+ bool matchTest( TestCase const& testCase, TestSpec const& testSpec, IConfig const& config ) {
+ return testSpec.matches( testCase ) && ( config.allowThrows() || !testCase.throws() );
+ }
+
+ void enforceNoDuplicateTestCases( std::vector<TestCase> const& functions ) {
+ std::set<TestCase> seenFunctions;
+ for( auto const& function : functions ) {
+ auto prev = seenFunctions.insert( function );
+ CATCH_ENFORCE( prev.second,
+ "error: TEST_CASE( \"" << function.name << "\" ) already defined.\n"
+ << "\tFirst seen at " << prev.first->getTestCaseInfo().lineInfo << "\n"
+ << "\tRedefined at " << function.getTestCaseInfo().lineInfo );
+ }
+ }
+
+ std::vector<TestCase> filterTests( std::vector<TestCase> const& testCases, TestSpec const& testSpec, IConfig const& config ) {
+ std::vector<TestCase> filtered;
+ filtered.reserve( testCases.size() );
+ for (auto const& testCase : testCases) {
+ if ((!testSpec.hasFilters() && !testCase.isHidden()) ||
+ (testSpec.hasFilters() && matchTest(testCase, testSpec, config))) {
+ filtered.push_back(testCase);
+ }
+ }
+ return filtered;
+ }
+ std::vector<TestCase> const& getAllTestCasesSorted( IConfig const& config ) {
+ return getRegistryHub().getTestCaseRegistry().getAllTestsSorted( config );
+ }
+
+ void TestRegistry::registerTest( TestCase const& testCase ) {
+ std::string name = testCase.getTestCaseInfo().name;
+ if( name.empty() ) {
+ ReusableStringStream rss;
+ rss << "Anonymous test case " << ++m_unnamedCount;
+ return registerTest( testCase.withName( rss.str() ) );
+ }
+ m_functions.push_back( testCase );
+ }
+
+ std::vector<TestCase> const& TestRegistry::getAllTests() const {
+ return m_functions;
+ }
+ std::vector<TestCase> const& TestRegistry::getAllTestsSorted( IConfig const& config ) const {
+ if( m_sortedFunctions.empty() )
+ enforceNoDuplicateTestCases( m_functions );
+
+ if( m_currentSortOrder != config.runOrder() || m_sortedFunctions.empty() ) {
+ m_sortedFunctions = sortTests( config, m_functions );
+ m_currentSortOrder = config.runOrder();
+ }
+ return m_sortedFunctions;
+ }
+
+ ///////////////////////////////////////////////////////////////////////////
+ TestInvokerAsFunction::TestInvokerAsFunction( void(*testAsFunction)() ) noexcept : m_testAsFunction( testAsFunction ) {}
+
+ void TestInvokerAsFunction::invoke() const {
+ m_testAsFunction();
+ }
+
+ std::string extractClassName( StringRef const& classOrQualifiedMethodName ) {
+ std::string className = classOrQualifiedMethodName;
+ if( startsWith( className, '&' ) )
+ {
+ std::size_t lastColons = className.rfind( "::" );
+ std::size_t penultimateColons = className.rfind( "::", lastColons-1 );
+ if( penultimateColons == std::string::npos )
+ penultimateColons = 1;
+ className = className.substr( penultimateColons, lastColons-penultimateColons );
+ }
+ return className;
+ }
+
+} // end namespace Catch
+// end catch_test_case_registry_impl.cpp
+// start catch_test_case_tracker.cpp
+
+#include <algorithm>
+#include <cassert>
+#include <stdexcept>
+#include <memory>
+#include <sstream>
+
+#if defined(__clang__)
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wexit-time-destructors"
+#endif
+
+namespace Catch {
+namespace TestCaseTracking {
+
+ NameAndLocation::NameAndLocation( std::string const& _name, SourceLineInfo const& _location )
+ : name( _name ),
+ location( _location )
+ {}
+
+ ITracker::~ITracker() = default;
+
+ ITracker& TrackerContext::startRun() {
+ m_rootTracker = std::make_shared<SectionTracker>( NameAndLocation( "{root}", CATCH_INTERNAL_LINEINFO ), *this, nullptr );
+ m_currentTracker = nullptr;
+ m_runState = Executing;
+ return *m_rootTracker;
+ }
+
+ void TrackerContext::endRun() {
+ m_rootTracker.reset();
+ m_currentTracker = nullptr;
+ m_runState = NotStarted;
+ }
+
+ void TrackerContext::startCycle() {
+ m_currentTracker = m_rootTracker.get();
+ m_runState = Executing;
+ }
+ void TrackerContext::completeCycle() {
+ m_runState = CompletedCycle;
+ }
+
+ bool TrackerContext::completedCycle() const {
+ return m_runState == CompletedCycle;
+ }
+ ITracker& TrackerContext::currentTracker() {
+ return *m_currentTracker;
+ }
+ void TrackerContext::setCurrentTracker( ITracker* tracker ) {
+ m_currentTracker = tracker;
+ }
+
+ TrackerBase::TrackerBase( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent )
+ : m_nameAndLocation( nameAndLocation ),
+ m_ctx( ctx ),
+ m_parent( parent )
+ {}
+
+ NameAndLocation const& TrackerBase::nameAndLocation() const {
+ return m_nameAndLocation;
+ }
+ bool TrackerBase::isComplete() const {
+ return m_runState == CompletedSuccessfully || m_runState == Failed;
+ }
+ bool TrackerBase::isSuccessfullyCompleted() const {
+ return m_runState == CompletedSuccessfully;
+ }
+ bool TrackerBase::isOpen() const {
+ return m_runState != NotStarted && !isComplete();
+ }
+ bool TrackerBase::hasChildren() const {
+ return !m_children.empty();
+ }
+
+ void TrackerBase::addChild( ITrackerPtr const& child ) {
+ m_children.push_back( child );
+ }
+
+ ITrackerPtr TrackerBase::findChild( NameAndLocation const& nameAndLocation ) {
+ auto it = std::find_if( m_children.begin(), m_children.end(),
+ [&nameAndLocation]( ITrackerPtr const& tracker ){
+ return
+ tracker->nameAndLocation().location == nameAndLocation.location &&
+ tracker->nameAndLocation().name == nameAndLocation.name;
+ } );
+ return( it != m_children.end() )
+ ? *it
+ : nullptr;
+ }
+ ITracker& TrackerBase::parent() {
+ assert( m_parent ); // Should always be non-null except for root
+ return *m_parent;
+ }
+
+ void TrackerBase::openChild() {
+ if( m_runState != ExecutingChildren ) {
+ m_runState = ExecutingChildren;
+ if( m_parent )
+ m_parent->openChild();
+ }
+ }
+
+ bool TrackerBase::isSectionTracker() const { return false; }
+ bool TrackerBase::isGeneratorTracker() const { return false; }
+
+ void TrackerBase::open() {
+ m_runState = Executing;
+ moveToThis();
+ if( m_parent )
+ m_parent->openChild();
+ }
+
+ void TrackerBase::close() {
+
+ // Close any still open children (e.g. generators)
+ while( &m_ctx.currentTracker() != this )
+ m_ctx.currentTracker().close();
+
+ switch( m_runState ) {
+ case NeedsAnotherRun:
+ break;
+
+ case Executing:
+ m_runState = CompletedSuccessfully;
+ break;
+ case ExecutingChildren:
+ if( m_children.empty() || m_children.back()->isComplete() )
+ m_runState = CompletedSuccessfully;
+ break;
+
+ case NotStarted:
+ case CompletedSuccessfully:
+ case Failed:
+ CATCH_INTERNAL_ERROR( "Illogical state: " << m_runState );
+
+ default:
+ CATCH_INTERNAL_ERROR( "Unknown state: " << m_runState );
+ }
+ moveToParent();
+ m_ctx.completeCycle();
+ }
+ void TrackerBase::fail() {
+ m_runState = Failed;
+ if( m_parent )
+ m_parent->markAsNeedingAnotherRun();
+ moveToParent();
+ m_ctx.completeCycle();
+ }
+ void TrackerBase::markAsNeedingAnotherRun() {
+ m_runState = NeedsAnotherRun;
+ }
+
+ void TrackerBase::moveToParent() {
+ assert( m_parent );
+ m_ctx.setCurrentTracker( m_parent );
+ }
+ void TrackerBase::moveToThis() {
+ m_ctx.setCurrentTracker( this );
+ }
+
+ SectionTracker::SectionTracker( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent )
+ : TrackerBase( nameAndLocation, ctx, parent )
+ {
+ if( parent ) {
+ while( !parent->isSectionTracker() )
+ parent = &parent->parent();
+
+ SectionTracker& parentSection = static_cast<SectionTracker&>( *parent );
+ addNextFilters( parentSection.m_filters );
+ }
+ }
+
+ bool SectionTracker::isComplete() const {
+ bool complete = true;
+
+ if ((m_filters.empty() || m_filters[0] == "") ||
+ std::find(m_filters.begin(), m_filters.end(),
+ m_nameAndLocation.name) != m_filters.end())
+ complete = TrackerBase::isComplete();
+ return complete;
+
+ }
+
+ bool SectionTracker::isSectionTracker() const { return true; }
+
+ SectionTracker& SectionTracker::acquire( TrackerContext& ctx, NameAndLocation const& nameAndLocation ) {
+ std::shared_ptr<SectionTracker> section;
+
+ ITracker& currentTracker = ctx.currentTracker();
+ if( ITrackerPtr childTracker = currentTracker.findChild( nameAndLocation ) ) {
+ assert( childTracker );
+ assert( childTracker->isSectionTracker() );
+ section = std::static_pointer_cast<SectionTracker>( childTracker );
+ }
+ else {
+ section = std::make_shared<SectionTracker>( nameAndLocation, ctx, ¤tTracker );
+ currentTracker.addChild( section );
+ }
+ if( !ctx.completedCycle() )
+ section->tryOpen();
+ return *section;
+ }
+
+ void SectionTracker::tryOpen() {
+ if( !isComplete() && (m_filters.empty() || m_filters[0].empty() || m_filters[0] == m_nameAndLocation.name ) )
+ open();
+ }
+
+ void SectionTracker::addInitialFilters( std::vector<std::string> const& filters ) {
+ if( !filters.empty() ) {
+ m_filters.push_back(""); // Root - should never be consulted
+ m_filters.push_back(""); // Test Case - not a section filter
+ m_filters.insert( m_filters.end(), filters.begin(), filters.end() );
+ }
+ }
+ void SectionTracker::addNextFilters( std::vector<std::string> const& filters ) {
+ if( filters.size() > 1 )
+ m_filters.insert( m_filters.end(), ++filters.begin(), filters.end() );
+ }
+
+} // namespace TestCaseTracking
+
+using TestCaseTracking::ITracker;
+using TestCaseTracking::TrackerContext;
+using TestCaseTracking::SectionTracker;
+
+} // namespace Catch
+
+#if defined(__clang__)
+# pragma clang diagnostic pop
+#endif
+// end catch_test_case_tracker.cpp
+// start catch_test_registry.cpp
+
+namespace Catch {
+
+ auto makeTestInvoker( void(*testAsFunction)() ) noexcept -> ITestInvoker* {
+ return new(std::nothrow) TestInvokerAsFunction( testAsFunction );
+ }
+
+ NameAndTags::NameAndTags( StringRef const& name_ , StringRef const& tags_ ) noexcept : name( name_ ), tags( tags_ ) {}
+
+ AutoReg::AutoReg( ITestInvoker* invoker, SourceLineInfo const& lineInfo, StringRef const& classOrMethod, NameAndTags const& nameAndTags ) noexcept {
+ CATCH_TRY {
+ getMutableRegistryHub()
+ .registerTest(
+ makeTestCase(
+ invoker,
+ extractClassName( classOrMethod ),
+ nameAndTags,
+ lineInfo));
+ } CATCH_CATCH_ALL {
+ // Do not throw when constructing global objects, instead register the exception to be processed later
+ getMutableRegistryHub().registerStartupException();
+ }
+ }
+
+ AutoReg::~AutoReg() = default;
+}
+// end catch_test_registry.cpp
+// start catch_test_spec.cpp
+
+#include <algorithm>
+#include <string>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ TestSpec::Pattern::~Pattern() = default;
+ TestSpec::NamePattern::~NamePattern() = default;
+ TestSpec::TagPattern::~TagPattern() = default;
+ TestSpec::ExcludedPattern::~ExcludedPattern() = default;
+
+ TestSpec::NamePattern::NamePattern( std::string const& name )
+ : m_wildcardPattern( toLower( name ), CaseSensitive::No )
+ {}
+ bool TestSpec::NamePattern::matches( TestCaseInfo const& testCase ) const {
+ return m_wildcardPattern.matches( toLower( testCase.name ) );
+ }
+
+ TestSpec::TagPattern::TagPattern( std::string const& tag ) : m_tag( toLower( tag ) ) {}
+ bool TestSpec::TagPattern::matches( TestCaseInfo const& testCase ) const {
+ return std::find(begin(testCase.lcaseTags),
+ end(testCase.lcaseTags),
+ m_tag) != end(testCase.lcaseTags);
+ }
+
+ TestSpec::ExcludedPattern::ExcludedPattern( PatternPtr const& underlyingPattern ) : m_underlyingPattern( underlyingPattern ) {}
+ bool TestSpec::ExcludedPattern::matches( TestCaseInfo const& testCase ) const { return !m_underlyingPattern->matches( testCase ); }
+
+ bool TestSpec::Filter::matches( TestCaseInfo const& testCase ) const {
+ // All patterns in a filter must match for the filter to be a match
+ for( auto const& pattern : m_patterns ) {
+ if( !pattern->matches( testCase ) )
+ return false;
+ }
+ return true;
+ }
+
+ bool TestSpec::hasFilters() const {
+ return !m_filters.empty();
+ }
+ bool TestSpec::matches( TestCaseInfo const& testCase ) const {
+ // A TestSpec matches if any filter matches
+ for( auto const& filter : m_filters )
+ if( filter.matches( testCase ) )
+ return true;
+ return false;
+ }
+}
+// end catch_test_spec.cpp
+// start catch_test_spec_parser.cpp
+
+namespace Catch {
+
+ TestSpecParser::TestSpecParser( ITagAliasRegistry const& tagAliases ) : m_tagAliases( &tagAliases ) {}
+
+ TestSpecParser& TestSpecParser::parse( std::string const& arg ) {
+ m_mode = None;
+ m_exclusion = false;
+ m_start = std::string::npos;
+ m_arg = m_tagAliases->expandAliases( arg );
+ m_escapeChars.clear();
+ for( m_pos = 0; m_pos < m_arg.size(); ++m_pos )
+ visitChar( m_arg[m_pos] );
+ if( m_mode == Name )
+ addPattern<TestSpec::NamePattern>();
+ return *this;
+ }
+ TestSpec TestSpecParser::testSpec() {
+ addFilter();
+ return m_testSpec;
+ }
+
+ void TestSpecParser::visitChar( char c ) {
+ if( m_mode == None ) {
+ switch( c ) {
+ case ' ': return;
+ case '~': m_exclusion = true; return;
+ case '[': return startNewMode( Tag, ++m_pos );
+ case '"': return startNewMode( QuotedName, ++m_pos );
+ case '\\': return escape();
+ default: startNewMode( Name, m_pos ); break;
+ }
+ }
+ if( m_mode == Name ) {
+ if( c == ',' ) {
+ addPattern<TestSpec::NamePattern>();
+ addFilter();
+ }
+ else if( c == '[' ) {
+ if( subString() == "exclude:" )
+ m_exclusion = true;
+ else
+ addPattern<TestSpec::NamePattern>();
+ startNewMode( Tag, ++m_pos );
+ }
+ else if( c == '\\' )
+ escape();
+ }
+ else if( m_mode == EscapedName )
+ m_mode = Name;
+ else if( m_mode == QuotedName && c == '"' )
+ addPattern<TestSpec::NamePattern>();
+ else if( m_mode == Tag && c == ']' )
+ addPattern<TestSpec::TagPattern>();
+ }
+ void TestSpecParser::startNewMode( Mode mode, std::size_t start ) {
+ m_mode = mode;
+ m_start = start;
+ }
+ void TestSpecParser::escape() {
+ if( m_mode == None )
+ m_start = m_pos;
+ m_mode = EscapedName;
+ m_escapeChars.push_back( m_pos );
+ }
+ std::string TestSpecParser::subString() const { return m_arg.substr( m_start, m_pos - m_start ); }
+
+ void TestSpecParser::addFilter() {
+ if( !m_currentFilter.m_patterns.empty() ) {
+ m_testSpec.m_filters.push_back( m_currentFilter );
+ m_currentFilter = TestSpec::Filter();
+ }
+ }
+
+ TestSpec parseTestSpec( std::string const& arg ) {
+ return TestSpecParser( ITagAliasRegistry::get() ).parse( arg ).testSpec();
+ }
+
+} // namespace Catch
+// end catch_test_spec_parser.cpp
+// start catch_timer.cpp
+
+#include <chrono>
+
+static const uint64_t nanosecondsInSecond = 1000000000;
+
+namespace Catch {
+
+ auto getCurrentNanosecondsSinceEpoch() -> uint64_t {
+ return std::chrono::duration_cast<std::chrono::nanoseconds>( std::chrono::high_resolution_clock::now().time_since_epoch() ).count();
+ }
+
+ namespace {
+ auto estimateClockResolution() -> uint64_t {
+ uint64_t sum = 0;
+ static const uint64_t iterations = 1000000;
+
+ auto startTime = getCurrentNanosecondsSinceEpoch();
+
+ for( std::size_t i = 0; i < iterations; ++i ) {
+
+ uint64_t ticks;
+ uint64_t baseTicks = getCurrentNanosecondsSinceEpoch();
+ do {
+ ticks = getCurrentNanosecondsSinceEpoch();
+ } while( ticks == baseTicks );
+
+ auto delta = ticks - baseTicks;
+ sum += delta;
+
+ // If we have been calibrating for over 3 seconds -- the clock
+ // is terrible and we should move on.
+ // TBD: How to signal that the measured resolution is probably wrong?
+ if (ticks > startTime + 3 * nanosecondsInSecond) {
+ return sum / ( i + 1u );
+ }
+ }
+
+ // We're just taking the mean, here. To do better we could take the std. dev and exclude outliers
+ // - and potentially do more iterations if there's a high variance.
+ return sum/iterations;
+ }
+ }
+ auto getEstimatedClockResolution() -> uint64_t {
+ static auto s_resolution = estimateClockResolution();
+ return s_resolution;
+ }
+
+ void Timer::start() {
+ m_nanoseconds = getCurrentNanosecondsSinceEpoch();
+ }
+ auto Timer::getElapsedNanoseconds() const -> uint64_t {
+ return getCurrentNanosecondsSinceEpoch() - m_nanoseconds;
+ }
+ auto Timer::getElapsedMicroseconds() const -> uint64_t {
+ return getElapsedNanoseconds()/1000;
+ }
+ auto Timer::getElapsedMilliseconds() const -> unsigned int {
+ return static_cast<unsigned int>(getElapsedMicroseconds()/1000);
+ }
+ auto Timer::getElapsedSeconds() const -> double {
+ return getElapsedMicroseconds()/1000000.0;
+ }
+
+} // namespace Catch
+// end catch_timer.cpp
+// start catch_tostring.cpp
+
+#if defined(__clang__)
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wexit-time-destructors"
+# pragma clang diagnostic ignored "-Wglobal-constructors"
+#endif
+
+// Enable specific decls locally
+#if !defined(CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER)
+#define CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER
+#endif
+
+#include <cmath>
+#include <iomanip>
+
+namespace Catch {
+
+namespace Detail {
+
+ const std::string unprintableString = "{?}";
+
+ namespace {
+ const int hexThreshold = 255;
+
+ struct Endianness {
+ enum Arch { Big, Little };
+
+ static Arch which() {
+ union _{
+ int asInt;
+ char asChar[sizeof (int)];
+ } u;
+
+ u.asInt = 1;
+ return ( u.asChar[sizeof(int)-1] == 1 ) ? Big : Little;
+ }
+ };
+ }
+
+ std::string rawMemoryToString( const void *object, std::size_t size ) {
+ // Reverse order for little endian architectures
+ int i = 0, end = static_cast<int>( size ), inc = 1;
+ if( Endianness::which() == Endianness::Little ) {
+ i = end-1;
+ end = inc = -1;
+ }
+
+ unsigned char const *bytes = static_cast<unsigned char const *>(object);
+ ReusableStringStream rss;
+ rss << "0x" << std::setfill('0') << std::hex;
+ for( ; i != end; i += inc )
+ rss << std::setw(2) << static_cast<unsigned>(bytes[i]);
+ return rss.str();
+ }
+}
+
+template<typename T>
+std::string fpToString( T value, int precision ) {
+ if (Catch::isnan(value)) {
+ return "nan";
+ }
+
+ ReusableStringStream rss;
+ rss << std::setprecision( precision )
+ << std::fixed
+ << value;
+ std::string d = rss.str();
+ std::size_t i = d.find_last_not_of( '0' );
+ if( i != std::string::npos && i != d.size()-1 ) {
+ if( d[i] == '.' )
+ i++;
+ d = d.substr( 0, i+1 );
+ }
+ return d;
+}
+
+//// ======================================================= ////
+//
+// Out-of-line defs for full specialization of StringMaker
+//
+//// ======================================================= ////
+
+std::string StringMaker<std::string>::convert(const std::string& str) {
+ if (!getCurrentContext().getConfig()->showInvisibles()) {
+ return '"' + str + '"';
+ }
+
+ std::string s("\"");
+ for (char c : str) {
+ switch (c) {
+ case '\n':
+ s.append("\\n");
+ break;
+ case '\t':
+ s.append("\\t");
+ break;
+ default:
+ s.push_back(c);
+ break;
+ }
+ }
+ s.append("\"");
+ return s;
+}
+
+#ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+std::string StringMaker<std::string_view>::convert(std::string_view str) {
+ return ::Catch::Detail::stringify(std::string{ str });
+}
+#endif
+
+std::string StringMaker<char const*>::convert(char const* str) {
+ if (str) {
+ return ::Catch::Detail::stringify(std::string{ str });
+ } else {
+ return{ "{null string}" };
+ }
+}
+std::string StringMaker<char*>::convert(char* str) {
+ if (str) {
+ return ::Catch::Detail::stringify(std::string{ str });
+ } else {
+ return{ "{null string}" };
+ }
+}
+
+#ifdef CATCH_CONFIG_WCHAR
+std::string StringMaker<std::wstring>::convert(const std::wstring& wstr) {
+ std::string s;
+ s.reserve(wstr.size());
+ for (auto c : wstr) {
+ s += (c <= 0xff) ? static_cast<char>(c) : '?';
+ }
+ return ::Catch::Detail::stringify(s);
+}
+
+# ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+std::string StringMaker<std::wstring_view>::convert(std::wstring_view str) {
+ return StringMaker<std::wstring>::convert(std::wstring(str));
+}
+# endif
+
+std::string StringMaker<wchar_t const*>::convert(wchar_t const * str) {
+ if (str) {
+ return ::Catch::Detail::stringify(std::wstring{ str });
+ } else {
+ return{ "{null string}" };
+ }
+}
+std::string StringMaker<wchar_t *>::convert(wchar_t * str) {
+ if (str) {
+ return ::Catch::Detail::stringify(std::wstring{ str });
+ } else {
+ return{ "{null string}" };
+ }
+}
+#endif
+
+std::string StringMaker<int>::convert(int value) {
+ return ::Catch::Detail::stringify(static_cast<long long>(value));
+}
+std::string StringMaker<long>::convert(long value) {
+ return ::Catch::Detail::stringify(static_cast<long long>(value));
+}
+std::string StringMaker<long long>::convert(long long value) {
+ ReusableStringStream rss;
+ rss << value;
+ if (value > Detail::hexThreshold) {
+ rss << " (0x" << std::hex << value << ')';
+ }
+ return rss.str();
+}
+
+std::string StringMaker<unsigned int>::convert(unsigned int value) {
+ return ::Catch::Detail::stringify(static_cast<unsigned long long>(value));
+}
+std::string StringMaker<unsigned long>::convert(unsigned long value) {
+ return ::Catch::Detail::stringify(static_cast<unsigned long long>(value));
+}
+std::string StringMaker<unsigned long long>::convert(unsigned long long value) {
+ ReusableStringStream rss;
+ rss << value;
+ if (value > Detail::hexThreshold) {
+ rss << " (0x" << std::hex << value << ')';
+ }
+ return rss.str();
+}
+
+std::string StringMaker<bool>::convert(bool b) {
+ return b ? "true" : "false";
+}
+
+std::string StringMaker<signed char>::convert(signed char value) {
+ if (value == '\r') {
+ return "'\\r'";
+ } else if (value == '\f') {
+ return "'\\f'";
+ } else if (value == '\n') {
+ return "'\\n'";
+ } else if (value == '\t') {
+ return "'\\t'";
+ } else if ('\0' <= value && value < ' ') {
+ return ::Catch::Detail::stringify(static_cast<unsigned int>(value));
+ } else {
+ char chstr[] = "' '";
+ chstr[1] = value;
+ return chstr;
+ }
+}
+std::string StringMaker<char>::convert(char c) {
+ return ::Catch::Detail::stringify(static_cast<signed char>(c));
+}
+std::string StringMaker<unsigned char>::convert(unsigned char c) {
+ return ::Catch::Detail::stringify(static_cast<char>(c));
+}
+
+std::string StringMaker<std::nullptr_t>::convert(std::nullptr_t) {
+ return "nullptr";
+}
+
+int StringMaker<float>::precision = 5;
+
+std::string StringMaker<float>::convert(float value) {
+ return fpToString(value, precision) + 'f';
+}
+
+int StringMaker<double>::precision = 10;
+
+std::string StringMaker<double>::convert(double value) {
+ return fpToString(value, precision);
+}
+
+std::string ratio_string<std::atto>::symbol() { return "a"; }
+std::string ratio_string<std::femto>::symbol() { return "f"; }
+std::string ratio_string<std::pico>::symbol() { return "p"; }
+std::string ratio_string<std::nano>::symbol() { return "n"; }
+std::string ratio_string<std::micro>::symbol() { return "u"; }
+std::string ratio_string<std::milli>::symbol() { return "m"; }
+
+} // end namespace Catch
+
+#if defined(__clang__)
+# pragma clang diagnostic pop
+#endif
+
+// end catch_tostring.cpp
+// start catch_totals.cpp
+
+namespace Catch {
+
+ Counts Counts::operator - ( Counts const& other ) const {
+ Counts diff;
+ diff.passed = passed - other.passed;
+ diff.failed = failed - other.failed;
+ diff.failedButOk = failedButOk - other.failedButOk;
+ return diff;
+ }
+
+ Counts& Counts::operator += ( Counts const& other ) {
+ passed += other.passed;
+ failed += other.failed;
+ failedButOk += other.failedButOk;
+ return *this;
+ }
+
+ std::size_t Counts::total() const {
+ return passed + failed + failedButOk;
+ }
+ bool Counts::allPassed() const {
+ return failed == 0 && failedButOk == 0;
+ }
+ bool Counts::allOk() const {
+ return failed == 0;
+ }
+
+ Totals Totals::operator - ( Totals const& other ) const {
+ Totals diff;
+ diff.assertions = assertions - other.assertions;
+ diff.testCases = testCases - other.testCases;
+ return diff;
+ }
+
+ Totals& Totals::operator += ( Totals const& other ) {
+ assertions += other.assertions;
+ testCases += other.testCases;
+ return *this;
+ }
+
+ Totals Totals::delta( Totals const& prevTotals ) const {
+ Totals diff = *this - prevTotals;
+ if( diff.assertions.failed > 0 )
+ ++diff.testCases.failed;
+ else if( diff.assertions.failedButOk > 0 )
+ ++diff.testCases.failedButOk;
+ else
+ ++diff.testCases.passed;
+ return diff;
+ }
+
+}
+// end catch_totals.cpp
+// start catch_uncaught_exceptions.cpp
+
+#include <exception>
+
+namespace Catch {
+ bool uncaught_exceptions() {
+#if defined(CATCH_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS)
+ return std::uncaught_exceptions() > 0;
+#else
+ return std::uncaught_exception();
+#endif
+ }
+} // end namespace Catch
+// end catch_uncaught_exceptions.cpp
+// start catch_version.cpp
+
+#include <ostream>
+
+namespace Catch {
+
+ Version::Version
+ ( unsigned int _majorVersion,
+ unsigned int _minorVersion,
+ unsigned int _patchNumber,
+ char const * const _branchName,
+ unsigned int _buildNumber )
+ : majorVersion( _majorVersion ),
+ minorVersion( _minorVersion ),
+ patchNumber( _patchNumber ),
+ branchName( _branchName ),
+ buildNumber( _buildNumber )
+ {}
+
+ std::ostream& operator << ( std::ostream& os, Version const& version ) {
+ os << version.majorVersion << '.'
+ << version.minorVersion << '.'
+ << version.patchNumber;
+ // branchName is never null -> 0th char is \0 if it is empty
+ if (version.branchName[0]) {
+ os << '-' << version.branchName
+ << '.' << version.buildNumber;
+ }
+ return os;
+ }
+
+ Version const& libraryVersion() {
+ static Version version( 2, 9, 1, "", 0 );
+ return version;
+ }
+
+}
+// end catch_version.cpp
+// start catch_wildcard_pattern.cpp
+
+#include <sstream>
+
+namespace Catch {
+
+ WildcardPattern::WildcardPattern( std::string const& pattern,
+ CaseSensitive::Choice caseSensitivity )
+ : m_caseSensitivity( caseSensitivity ),
+ m_pattern( adjustCase( pattern ) )
+ {
+ if( startsWith( m_pattern, '*' ) ) {
+ m_pattern = m_pattern.substr( 1 );
+ m_wildcard = WildcardAtStart;
+ }
+ if( endsWith( m_pattern, '*' ) ) {
+ m_pattern = m_pattern.substr( 0, m_pattern.size()-1 );
+ m_wildcard = static_cast<WildcardPosition>( m_wildcard | WildcardAtEnd );
+ }
+ }
+
+ bool WildcardPattern::matches( std::string const& str ) const {
+ switch( m_wildcard ) {
+ case NoWildcard:
+ return m_pattern == adjustCase( str );
+ case WildcardAtStart:
+ return endsWith( adjustCase( str ), m_pattern );
+ case WildcardAtEnd:
+ return startsWith( adjustCase( str ), m_pattern );
+ case WildcardAtBothEnds:
+ return contains( adjustCase( str ), m_pattern );
+ default:
+ CATCH_INTERNAL_ERROR( "Unknown enum" );
+ }
+ }
+
+ std::string WildcardPattern::adjustCase( std::string const& str ) const {
+ return m_caseSensitivity == CaseSensitive::No ? toLower( str ) : str;
+ }
+}
+// end catch_wildcard_pattern.cpp
+// start catch_xmlwriter.cpp
+
+#include <iomanip>
+
+using uchar = unsigned char;
+
+namespace Catch {
+
+namespace {
+
+ size_t trailingBytes(unsigned char c) {
+ if ((c & 0xE0) == 0xC0) {
+ return 2;
+ }
+ if ((c & 0xF0) == 0xE0) {
+ return 3;
+ }
+ if ((c & 0xF8) == 0xF0) {
+ return 4;
+ }
+ CATCH_INTERNAL_ERROR("Invalid multibyte utf-8 start byte encountered");
+ }
+
+ uint32_t headerValue(unsigned char c) {
+ if ((c & 0xE0) == 0xC0) {
+ return c & 0x1F;
+ }
+ if ((c & 0xF0) == 0xE0) {
+ return c & 0x0F;
+ }
+ if ((c & 0xF8) == 0xF0) {
+ return c & 0x07;
+ }
+ CATCH_INTERNAL_ERROR("Invalid multibyte utf-8 start byte encountered");
+ }
+
+ void hexEscapeChar(std::ostream& os, unsigned char c) {
+ std::ios_base::fmtflags f(os.flags());
+ os << "\\x"
+ << std::uppercase << std::hex << std::setfill('0') << std::setw(2)
+ << static_cast<int>(c);
+ os.flags(f);
+ }
+
+} // anonymous namespace
+
+ XmlEncode::XmlEncode( std::string const& str, ForWhat forWhat )
+ : m_str( str ),
+ m_forWhat( forWhat )
+ {}
+
+ void XmlEncode::encodeTo( std::ostream& os ) const {
+ // Apostrophe escaping not necessary if we always use " to write attributes
+ // (see: http://www.w3.org/TR/xml/#syntax)
+
+ for( std::size_t idx = 0; idx < m_str.size(); ++ idx ) {
+ uchar c = m_str[idx];
+ switch (c) {
+ case '<': os << "<"; break;
+ case '&': os << "&"; break;
+
+ case '>':
+ // See: http://www.w3.org/TR/xml/#syntax
+ if (idx > 2 && m_str[idx - 1] == ']' && m_str[idx - 2] == ']')
+ os << ">";
+ else
+ os << c;
+ break;
+
+ case '\"':
+ if (m_forWhat == ForAttributes)
+ os << """;
+ else
+ os << c;
+ break;
+
+ default:
+ // Check for control characters and invalid utf-8
+
+ // Escape control characters in standard ascii
+ // see http://stackoverflow.com/questions/404107/why-are-control-characters-illegal-in-xml-1-0
+ if (c < 0x09 || (c > 0x0D && c < 0x20) || c == 0x7F) {
+ hexEscapeChar(os, c);
+ break;
+ }
+
+ // Plain ASCII: Write it to stream
+ if (c < 0x7F) {
+ os << c;
+ break;
+ }
+
+ // UTF-8 territory
+ // Check if the encoding is valid and if it is not, hex escape bytes.
+ // Important: We do not check the exact decoded values for validity, only the encoding format
+ // First check that this bytes is a valid lead byte:
+ // This means that it is not encoded as 1111 1XXX
+ // Or as 10XX XXXX
+ if (c < 0xC0 ||
+ c >= 0xF8) {
+ hexEscapeChar(os, c);
+ break;
+ }
+
+ auto encBytes = trailingBytes(c);
+ // Are there enough bytes left to avoid accessing out-of-bounds memory?
+ if (idx + encBytes - 1 >= m_str.size()) {
+ hexEscapeChar(os, c);
+ break;
+ }
+ // The header is valid, check data
+ // The next encBytes bytes must together be a valid utf-8
+ // This means: bitpattern 10XX XXXX and the extracted value is sane (ish)
+ bool valid = true;
+ uint32_t value = headerValue(c);
+ for (std::size_t n = 1; n < encBytes; ++n) {
+ uchar nc = m_str[idx + n];
+ valid &= ((nc & 0xC0) == 0x80);
+ value = (value << 6) | (nc & 0x3F);
+ }
+
+ if (
+ // Wrong bit pattern of following bytes
+ (!valid) ||
+ // Overlong encodings
+ (value < 0x80) ||
+ (0x80 <= value && value < 0x800 && encBytes > 2) ||
+ (0x800 < value && value < 0x10000 && encBytes > 3) ||
+ // Encoded value out of range
+ (value >= 0x110000)
+ ) {
+ hexEscapeChar(os, c);
+ break;
+ }
+
+ // If we got here, this is in fact a valid(ish) utf-8 sequence
+ for (std::size_t n = 0; n < encBytes; ++n) {
+ os << m_str[idx + n];
+ }
+ idx += encBytes - 1;
+ break;
+ }
+ }
+ }
+
+ std::ostream& operator << ( std::ostream& os, XmlEncode const& xmlEncode ) {
+ xmlEncode.encodeTo( os );
+ return os;
+ }
+
+ XmlWriter::ScopedElement::ScopedElement( XmlWriter* writer )
+ : m_writer( writer )
+ {}
+
+ XmlWriter::ScopedElement::ScopedElement( ScopedElement&& other ) noexcept
+ : m_writer( other.m_writer ){
+ other.m_writer = nullptr;
+ }
+ XmlWriter::ScopedElement& XmlWriter::ScopedElement::operator=( ScopedElement&& other ) noexcept {
+ if ( m_writer ) {
+ m_writer->endElement();
+ }
+ m_writer = other.m_writer;
+ other.m_writer = nullptr;
+ return *this;
+ }
+
+ XmlWriter::ScopedElement::~ScopedElement() {
+ if( m_writer )
+ m_writer->endElement();
+ }
+
+ XmlWriter::ScopedElement& XmlWriter::ScopedElement::writeText( std::string const& text, bool indent ) {
+ m_writer->writeText( text, indent );
+ return *this;
+ }
+
+ XmlWriter::XmlWriter( std::ostream& os ) : m_os( os )
+ {
+ writeDeclaration();
+ }
+
+ XmlWriter::~XmlWriter() {
+ while( !m_tags.empty() )
+ endElement();
+ }
+
+ XmlWriter& XmlWriter::startElement( std::string const& name ) {
+ ensureTagClosed();
+ newlineIfNecessary();
+ m_os << m_indent << '<' << name;
+ m_tags.push_back( name );
+ m_indent += " ";
+ m_tagIsOpen = true;
+ return *this;
+ }
+
+ XmlWriter::ScopedElement XmlWriter::scopedElement( std::string const& name ) {
+ ScopedElement scoped( this );
+ startElement( name );
+ return scoped;
+ }
+
+ XmlWriter& XmlWriter::endElement() {
+ newlineIfNecessary();
+ m_indent = m_indent.substr( 0, m_indent.size()-2 );
+ if( m_tagIsOpen ) {
+ m_os << "/>";
+ m_tagIsOpen = false;
+ }
+ else {
+ m_os << m_indent << "</" << m_tags.back() << ">";
+ }
+ m_os << std::endl;
+ m_tags.pop_back();
+ return *this;
+ }
+
+ XmlWriter& XmlWriter::writeAttribute( std::string const& name, std::string const& attribute ) {
+ if( !name.empty() && !attribute.empty() )
+ m_os << ' ' << name << "=\"" << XmlEncode( attribute, XmlEncode::ForAttributes ) << '"';
+ return *this;
+ }
+
+ XmlWriter& XmlWriter::writeAttribute( std::string const& name, bool attribute ) {
+ m_os << ' ' << name << "=\"" << ( attribute ? "true" : "false" ) << '"';
+ return *this;
+ }
+
+ XmlWriter& XmlWriter::writeText( std::string const& text, bool indent ) {
+ if( !text.empty() ){
+ bool tagWasOpen = m_tagIsOpen;
+ ensureTagClosed();
+ if( tagWasOpen && indent )
+ m_os << m_indent;
+ m_os << XmlEncode( text );
+ m_needsNewline = true;
+ }
+ return *this;
+ }
+
+ XmlWriter& XmlWriter::writeComment( std::string const& text ) {
+ ensureTagClosed();
+ m_os << m_indent << "<!--" << text << "-->";
+ m_needsNewline = true;
+ return *this;
+ }
+
+ void XmlWriter::writeStylesheetRef( std::string const& url ) {
+ m_os << "<?xml-stylesheet type=\"text/xsl\" href=\"" << url << "\"?>\n";
+ }
+
+ XmlWriter& XmlWriter::writeBlankLine() {
+ ensureTagClosed();
+ m_os << '\n';
+ return *this;
+ }
+
+ void XmlWriter::ensureTagClosed() {
+ if( m_tagIsOpen ) {
+ m_os << ">" << std::endl;
+ m_tagIsOpen = false;
+ }
+ }
+
+ void XmlWriter::writeDeclaration() {
+ m_os << "<?xml version=\"1.0\" encoding=\"UTF-8\"?>\n";
+ }
+
+ void XmlWriter::newlineIfNecessary() {
+ if( m_needsNewline ) {
+ m_os << std::endl;
+ m_needsNewline = false;
+ }
+ }
+}
+// end catch_xmlwriter.cpp
+// start catch_reporter_bases.cpp
+
+#include <cstring>
+#include <cfloat>
+#include <cstdio>
+#include <cassert>
+#include <memory>
+
+namespace Catch {
+ void prepareExpandedExpression(AssertionResult& result) {
+ result.getExpandedExpression();
+ }
+
+ // Because formatting using c++ streams is stateful, drop down to C is required
+ // Alternatively we could use stringstream, but its performance is... not good.
+ std::string getFormattedDuration( double duration ) {
+ // Max exponent + 1 is required to represent the whole part
+ // + 1 for decimal point
+ // + 3 for the 3 decimal places
+ // + 1 for null terminator
+ const std::size_t maxDoubleSize = DBL_MAX_10_EXP + 1 + 1 + 3 + 1;
+ char buffer[maxDoubleSize];
+
+ // Save previous errno, to prevent sprintf from overwriting it
+ ErrnoGuard guard;
+#ifdef _MSC_VER
+ sprintf_s(buffer, "%.3f", duration);
+#else
+ std::sprintf(buffer, "%.3f", duration);
+#endif
+ return std::string(buffer);
+ }
+
+ std::string serializeFilters( std::vector<std::string> const& container ) {
+ ReusableStringStream oss;
+ bool first = true;
+ for (auto&& filter : container)
+ {
+ if (!first)
+ oss << ' ';
+ else
+ first = false;
+
+ oss << filter;
+ }
+ return oss.str();
+ }
+
+ TestEventListenerBase::TestEventListenerBase(ReporterConfig const & _config)
+ :StreamingReporterBase(_config) {}
+
+ std::set<Verbosity> TestEventListenerBase::getSupportedVerbosities() {
+ return { Verbosity::Quiet, Verbosity::Normal, Verbosity::High };
+ }
+
+ void TestEventListenerBase::assertionStarting(AssertionInfo const &) {}
+
+ bool TestEventListenerBase::assertionEnded(AssertionStats const &) {
+ return false;
+ }
+
+} // end namespace Catch
+// end catch_reporter_bases.cpp
+// start catch_reporter_compact.cpp
+
+namespace {
+
+#ifdef CATCH_PLATFORM_MAC
+ const char* failedString() { return "FAILED"; }
+ const char* passedString() { return "PASSED"; }
+#else
+ const char* failedString() { return "failed"; }
+ const char* passedString() { return "passed"; }
+#endif
+
+ // Colour::LightGrey
+ Catch::Colour::Code dimColour() { return Catch::Colour::FileName; }
+
+ std::string bothOrAll( std::size_t count ) {
+ return count == 1 ? std::string() :
+ count == 2 ? "both " : "all " ;
+ }
+
+} // anon namespace
+
+namespace Catch {
+namespace {
+// Colour, message variants:
+// - white: No tests ran.
+// - red: Failed [both/all] N test cases, failed [both/all] M assertions.
+// - white: Passed [both/all] N test cases (no assertions).
+// - red: Failed N tests cases, failed M assertions.
+// - green: Passed [both/all] N tests cases with M assertions.
+void printTotals(std::ostream& out, const Totals& totals) {
+ if (totals.testCases.total() == 0) {
+ out << "No tests ran.";
+ } else if (totals.testCases.failed == totals.testCases.total()) {
+ Colour colour(Colour::ResultError);
+ const std::string qualify_assertions_failed =
+ totals.assertions.failed == totals.assertions.total() ?
+ bothOrAll(totals.assertions.failed) : std::string();
+ out <<
+ "Failed " << bothOrAll(totals.testCases.failed)
+ << pluralise(totals.testCases.failed, "test case") << ", "
+ "failed " << qualify_assertions_failed <<
+ pluralise(totals.assertions.failed, "assertion") << '.';
+ } else if (totals.assertions.total() == 0) {
+ out <<
+ "Passed " << bothOrAll(totals.testCases.total())
+ << pluralise(totals.testCases.total(), "test case")
+ << " (no assertions).";
+ } else if (totals.assertions.failed) {
+ Colour colour(Colour::ResultError);
+ out <<
+ "Failed " << pluralise(totals.testCases.failed, "test case") << ", "
+ "failed " << pluralise(totals.assertions.failed, "assertion") << '.';
+ } else {
+ Colour colour(Colour::ResultSuccess);
+ out <<
+ "Passed " << bothOrAll(totals.testCases.passed)
+ << pluralise(totals.testCases.passed, "test case") <<
+ " with " << pluralise(totals.assertions.passed, "assertion") << '.';
+ }
+}
+
+// Implementation of CompactReporter formatting
+class AssertionPrinter {
+public:
+ AssertionPrinter& operator= (AssertionPrinter const&) = delete;
+ AssertionPrinter(AssertionPrinter const&) = delete;
+ AssertionPrinter(std::ostream& _stream, AssertionStats const& _stats, bool _printInfoMessages)
+ : stream(_stream)
+ , result(_stats.assertionResult)
+ , messages(_stats.infoMessages)
+ , itMessage(_stats.infoMessages.begin())
+ , printInfoMessages(_printInfoMessages) {}
+
+ void print() {
+ printSourceInfo();
+
+ itMessage = messages.begin();
+
+ switch (result.getResultType()) {
+ case ResultWas::Ok:
+ printResultType(Colour::ResultSuccess, passedString());
+ printOriginalExpression();
+ printReconstructedExpression();
+ if (!result.hasExpression())
+ printRemainingMessages(Colour::None);
+ else
+ printRemainingMessages();
+ break;
+ case ResultWas::ExpressionFailed:
+ if (result.isOk())
+ printResultType(Colour::ResultSuccess, failedString() + std::string(" - but was ok"));
+ else
+ printResultType(Colour::Error, failedString());
+ printOriginalExpression();
+ printReconstructedExpression();
+ printRemainingMessages();
+ break;
+ case ResultWas::ThrewException:
+ printResultType(Colour::Error, failedString());
+ printIssue("unexpected exception with message:");
+ printMessage();
+ printExpressionWas();
+ printRemainingMessages();
+ break;
+ case ResultWas::FatalErrorCondition:
+ printResultType(Colour::Error, failedString());
+ printIssue("fatal error condition with message:");
+ printMessage();
+ printExpressionWas();
+ printRemainingMessages();
+ break;
+ case ResultWas::DidntThrowException:
+ printResultType(Colour::Error, failedString());
+ printIssue("expected exception, got none");
+ printExpressionWas();
+ printRemainingMessages();
+ break;
+ case ResultWas::Info:
+ printResultType(Colour::None, "info");
+ printMessage();
+ printRemainingMessages();
+ break;
+ case ResultWas::Warning:
+ printResultType(Colour::None, "warning");
+ printMessage();
+ printRemainingMessages();
+ break;
+ case ResultWas::ExplicitFailure:
+ printResultType(Colour::Error, failedString());
+ printIssue("explicitly");
+ printRemainingMessages(Colour::None);
+ break;
+ // These cases are here to prevent compiler warnings
+ case ResultWas::Unknown:
+ case ResultWas::FailureBit:
+ case ResultWas::Exception:
+ printResultType(Colour::Error, "** internal error **");
+ break;
+ }
+ }
+
+private:
+ void printSourceInfo() const {
+ Colour colourGuard(Colour::FileName);
+ stream << result.getSourceInfo() << ':';
+ }
+
+ void printResultType(Colour::Code colour, std::string const& passOrFail) const {
+ if (!passOrFail.empty()) {
+ {
+ Colour colourGuard(colour);
+ stream << ' ' << passOrFail;
+ }
+ stream << ':';
+ }
+ }
+
+ void printIssue(std::string const& issue) const {
+ stream << ' ' << issue;
+ }
+
+ void printExpressionWas() {
+ if (result.hasExpression()) {
+ stream << ';';
+ {
+ Colour colour(dimColour());
+ stream << " expression was:";
+ }
+ printOriginalExpression();
+ }
+ }
+
+ void printOriginalExpression() const {
+ if (result.hasExpression()) {
+ stream << ' ' << result.getExpression();
+ }
+ }
+
+ void printReconstructedExpression() const {
+ if (result.hasExpandedExpression()) {
+ {
+ Colour colour(dimColour());
+ stream << " for: ";
+ }
+ stream << result.getExpandedExpression();
+ }
+ }
+
+ void printMessage() {
+ if (itMessage != messages.end()) {
+ stream << " '" << itMessage->message << '\'';
+ ++itMessage;
+ }
+ }
+
+ void printRemainingMessages(Colour::Code colour = dimColour()) {
+ if (itMessage == messages.end())
+ return;
+
+ // using messages.end() directly yields (or auto) compilation error:
+ std::vector<MessageInfo>::const_iterator itEnd = messages.end();
+ const std::size_t N = static_cast<std::size_t>(std::distance(itMessage, itEnd));
+
+ {
+ Colour colourGuard(colour);
+ stream << " with " << pluralise(N, "message") << ':';
+ }
+
+ for (; itMessage != itEnd; ) {
+ // If this assertion is a warning ignore any INFO messages
+ if (printInfoMessages || itMessage->type != ResultWas::Info) {
+ stream << " '" << itMessage->message << '\'';
+ if (++itMessage != itEnd) {
+ Colour colourGuard(dimColour());
+ stream << " and";
+ }
+ }
+ }
+ }
+
+private:
+ std::ostream& stream;
+ AssertionResult const& result;
+ std::vector<MessageInfo> messages;
+ std::vector<MessageInfo>::const_iterator itMessage;
+ bool printInfoMessages;
+};
+
+} // anon namespace
+
+ std::string CompactReporter::getDescription() {
+ return "Reports test results on a single line, suitable for IDEs";
+ }
+
+ ReporterPreferences CompactReporter::getPreferences() const {
+ return m_reporterPrefs;
+ }
+
+ void CompactReporter::noMatchingTestCases( std::string const& spec ) {
+ stream << "No test cases matched '" << spec << '\'' << std::endl;
+ }
+
+ void CompactReporter::assertionStarting( AssertionInfo const& ) {}
+
+ bool CompactReporter::assertionEnded( AssertionStats const& _assertionStats ) {
+ AssertionResult const& result = _assertionStats.assertionResult;
+
+ bool printInfoMessages = true;
+
+ // Drop out if result was successful and we're not printing those
+ if( !m_config->includeSuccessfulResults() && result.isOk() ) {
+ if( result.getResultType() != ResultWas::Warning )
+ return false;
+ printInfoMessages = false;
+ }
+
+ AssertionPrinter printer( stream, _assertionStats, printInfoMessages );
+ printer.print();
+
+ stream << std::endl;
+ return true;
+ }
+
+ void CompactReporter::sectionEnded(SectionStats const& _sectionStats) {
+ if (m_config->showDurations() == ShowDurations::Always) {
+ stream << getFormattedDuration(_sectionStats.durationInSeconds) << " s: " << _sectionStats.sectionInfo.name << std::endl;
+ }
+ }
+
+ void CompactReporter::testRunEnded( TestRunStats const& _testRunStats ) {
+ printTotals( stream, _testRunStats.totals );
+ stream << '\n' << std::endl;
+ StreamingReporterBase::testRunEnded( _testRunStats );
+ }
+
+ CompactReporter::~CompactReporter() {}
+
+ CATCH_REGISTER_REPORTER( "compact", CompactReporter )
+
+} // end namespace Catch
+// end catch_reporter_compact.cpp
+// start catch_reporter_console.cpp
+
+#include <cfloat>
+#include <cstdio>
+
+#if defined(_MSC_VER)
+#pragma warning(push)
+#pragma warning(disable:4061) // Not all labels are EXPLICITLY handled in switch
+ // Note that 4062 (not all labels are handled and default is missing) is enabled
+#endif
+
+#if defined(__clang__)
+# pragma clang diagnostic push
+// For simplicity, benchmarking-only helpers are always enabled
+# pragma clang diagnostic ignored "-Wunused-function"
+#endif
+
+namespace Catch {
+
+namespace {
+
+// Formatter impl for ConsoleReporter
+class ConsoleAssertionPrinter {
+public:
+ ConsoleAssertionPrinter& operator= (ConsoleAssertionPrinter const&) = delete;
+ ConsoleAssertionPrinter(ConsoleAssertionPrinter const&) = delete;
+ ConsoleAssertionPrinter(std::ostream& _stream, AssertionStats const& _stats, bool _printInfoMessages)
+ : stream(_stream),
+ stats(_stats),
+ result(_stats.assertionResult),
+ colour(Colour::None),
+ message(result.getMessage()),
+ messages(_stats.infoMessages),
+ printInfoMessages(_printInfoMessages) {
+ switch (result.getResultType()) {
+ case ResultWas::Ok:
+ colour = Colour::Success;
+ passOrFail = "PASSED";
+ //if( result.hasMessage() )
+ if (_stats.infoMessages.size() == 1)
+ messageLabel = "with message";
+ if (_stats.infoMessages.size() > 1)
+ messageLabel = "with messages";
+ break;
+ case ResultWas::ExpressionFailed:
+ if (result.isOk()) {
+ colour = Colour::Success;
+ passOrFail = "FAILED - but was ok";
+ } else {
+ colour = Colour::Error;
+ passOrFail = "FAILED";
+ }
+ if (_stats.infoMessages.size() == 1)
+ messageLabel = "with message";
+ if (_stats.infoMessages.size() > 1)
+ messageLabel = "with messages";
+ break;
+ case ResultWas::ThrewException:
+ colour = Colour::Error;
+ passOrFail = "FAILED";
+ messageLabel = "due to unexpected exception with ";
+ if (_stats.infoMessages.size() == 1)
+ messageLabel += "message";
+ if (_stats.infoMessages.size() > 1)
+ messageLabel += "messages";
+ break;
+ case ResultWas::FatalErrorCondition:
+ colour = Colour::Error;
+ passOrFail = "FAILED";
+ messageLabel = "due to a fatal error condition";
+ break;
+ case ResultWas::DidntThrowException:
+ colour = Colour::Error;
+ passOrFail = "FAILED";
+ messageLabel = "because no exception was thrown where one was expected";
+ break;
+ case ResultWas::Info:
+ messageLabel = "info";
+ break;
+ case ResultWas::Warning:
+ messageLabel = "warning";
+ break;
+ case ResultWas::ExplicitFailure:
+ passOrFail = "FAILED";
+ colour = Colour::Error;
+ if (_stats.infoMessages.size() == 1)
+ messageLabel = "explicitly with message";
+ if (_stats.infoMessages.size() > 1)
+ messageLabel = "explicitly with messages";
+ break;
+ // These cases are here to prevent compiler warnings
+ case ResultWas::Unknown:
+ case ResultWas::FailureBit:
+ case ResultWas::Exception:
+ passOrFail = "** internal error **";
+ colour = Colour::Error;
+ break;
+ }
+ }
+
+ void print() const {
+ printSourceInfo();
+ if (stats.totals.assertions.total() > 0) {
+ printResultType();
+ printOriginalExpression();
+ printReconstructedExpression();
+ } else {
+ stream << '\n';
+ }
+ printMessage();
+ }
+
+private:
+ void printResultType() const {
+ if (!passOrFail.empty()) {
+ Colour colourGuard(colour);
+ stream << passOrFail << ":\n";
+ }
+ }
+ void printOriginalExpression() const {
+ if (result.hasExpression()) {
+ Colour colourGuard(Colour::OriginalExpression);
+ stream << " ";
+ stream << result.getExpressionInMacro();
+ stream << '\n';
+ }
+ }
+ void printReconstructedExpression() const {
+ if (result.hasExpandedExpression()) {
+ stream << "with expansion:\n";
+ Colour colourGuard(Colour::ReconstructedExpression);
+ stream << Column(result.getExpandedExpression()).indent(2) << '\n';
+ }
+ }
+ void printMessage() const {
+ if (!messageLabel.empty())
+ stream << messageLabel << ':' << '\n';
+ for (auto const& msg : messages) {
+ // If this assertion is a warning ignore any INFO messages
+ if (printInfoMessages || msg.type != ResultWas::Info)
+ stream << Column(msg.message).indent(2) << '\n';
+ }
+ }
+ void printSourceInfo() const {
+ Colour colourGuard(Colour::FileName);
+ stream << result.getSourceInfo() << ": ";
+ }
+
+ std::ostream& stream;
+ AssertionStats const& stats;
+ AssertionResult const& result;
+ Colour::Code colour;
+ std::string passOrFail;
+ std::string messageLabel;
+ std::string message;
+ std::vector<MessageInfo> messages;
+ bool printInfoMessages;
+};
+
+std::size_t makeRatio(std::size_t number, std::size_t total) {
+ std::size_t ratio = total > 0 ? CATCH_CONFIG_CONSOLE_WIDTH * number / total : 0;
+ return (ratio == 0 && number > 0) ? 1 : ratio;
+}
+
+std::size_t& findMax(std::size_t& i, std::size_t& j, std::size_t& k) {
+ if (i > j && i > k)
+ return i;
+ else if (j > k)
+ return j;
+ else
+ return k;
+}
+
+struct ColumnInfo {
+ enum Justification { Left, Right };
+ std::string name;
+ int width;
+ Justification justification;
+};
+struct ColumnBreak {};
+struct RowBreak {};
+
+class Duration {
+ enum class Unit {
+ Auto,
+ Nanoseconds,
+ Microseconds,
+ Milliseconds,
+ Seconds,
+ Minutes
+ };
+ static const uint64_t s_nanosecondsInAMicrosecond = 1000;
+ static const uint64_t s_nanosecondsInAMillisecond = 1000 * s_nanosecondsInAMicrosecond;
+ static const uint64_t s_nanosecondsInASecond = 1000 * s_nanosecondsInAMillisecond;
+ static const uint64_t s_nanosecondsInAMinute = 60 * s_nanosecondsInASecond;
+
+ uint64_t m_inNanoseconds;
+ Unit m_units;
+
+public:
+ explicit Duration(double inNanoseconds, Unit units = Unit::Auto)
+ : Duration(static_cast<uint64_t>(inNanoseconds), units) {
+ }
+
+ explicit Duration(uint64_t inNanoseconds, Unit units = Unit::Auto)
+ : m_inNanoseconds(inNanoseconds),
+ m_units(units) {
+ if (m_units == Unit::Auto) {
+ if (m_inNanoseconds < s_nanosecondsInAMicrosecond)
+ m_units = Unit::Nanoseconds;
+ else if (m_inNanoseconds < s_nanosecondsInAMillisecond)
+ m_units = Unit::Microseconds;
+ else if (m_inNanoseconds < s_nanosecondsInASecond)
+ m_units = Unit::Milliseconds;
+ else if (m_inNanoseconds < s_nanosecondsInAMinute)
+ m_units = Unit::Seconds;
+ else
+ m_units = Unit::Minutes;
+ }
+
+ }
+
+ auto value() const -> double {
+ switch (m_units) {
+ case Unit::Microseconds:
+ return m_inNanoseconds / static_cast<double>(s_nanosecondsInAMicrosecond);
+ case Unit::Milliseconds:
+ return m_inNanoseconds / static_cast<double>(s_nanosecondsInAMillisecond);
+ case Unit::Seconds:
+ return m_inNanoseconds / static_cast<double>(s_nanosecondsInASecond);
+ case Unit::Minutes:
+ return m_inNanoseconds / static_cast<double>(s_nanosecondsInAMinute);
+ default:
+ return static_cast<double>(m_inNanoseconds);
+ }
+ }
+ auto unitsAsString() const -> std::string {
+ switch (m_units) {
+ case Unit::Nanoseconds:
+ return "ns";
+ case Unit::Microseconds:
+ return "us";
+ case Unit::Milliseconds:
+ return "ms";
+ case Unit::Seconds:
+ return "s";
+ case Unit::Minutes:
+ return "m";
+ default:
+ return "** internal error **";
+ }
+
+ }
+ friend auto operator << (std::ostream& os, Duration const& duration) -> std::ostream& {
+ return os << duration.value() << " " << duration.unitsAsString();
+ }
+};
+} // end anon namespace
+
+class TablePrinter {
+ std::ostream& m_os;
+ std::vector<ColumnInfo> m_columnInfos;
+ std::ostringstream m_oss;
+ int m_currentColumn = -1;
+ bool m_isOpen = false;
+
+public:
+ TablePrinter( std::ostream& os, std::vector<ColumnInfo> columnInfos )
+ : m_os( os ),
+ m_columnInfos( std::move( columnInfos ) ) {}
+
+ auto columnInfos() const -> std::vector<ColumnInfo> const& {
+ return m_columnInfos;
+ }
+
+ void open() {
+ if (!m_isOpen) {
+ m_isOpen = true;
+ *this << RowBreak();
+
+ Columns headerCols;
+ Spacer spacer(2);
+ for (auto const& info : m_columnInfos) {
+ headerCols += Column(info.name).width(static_cast<std::size_t>(info.width - 2));
+ headerCols += spacer;
+ }
+ m_os << headerCols << "\n";
+
+ m_os << Catch::getLineOfChars<'-'>() << "\n";
+ }
+ }
+ void close() {
+ if (m_isOpen) {
+ *this << RowBreak();
+ m_os << std::endl;
+ m_isOpen = false;
+ }
+ }
+
+ template<typename T>
+ friend TablePrinter& operator << (TablePrinter& tp, T const& value) {
+ tp.m_oss << value;
+ return tp;
+ }
+
+ friend TablePrinter& operator << (TablePrinter& tp, ColumnBreak) {
+ auto colStr = tp.m_oss.str();
+ // This takes account of utf8 encodings
+ auto strSize = Catch::StringRef(colStr).numberOfCharacters();
+ tp.m_oss.str("");
+ tp.open();
+ if (tp.m_currentColumn == static_cast<int>(tp.m_columnInfos.size() - 1)) {
+ tp.m_currentColumn = -1;
+ tp.m_os << "\n";
+ }
+ tp.m_currentColumn++;
+
+ auto colInfo = tp.m_columnInfos[tp.m_currentColumn];
+ auto padding = (strSize + 2 < static_cast<std::size_t>(colInfo.width))
+ ? std::string(colInfo.width - (strSize + 2), ' ')
+ : std::string();
+ if (colInfo.justification == ColumnInfo::Left)
+ tp.m_os << colStr << padding << " ";
+ else
+ tp.m_os << padding << colStr << " ";
+ return tp;
+ }
+
+ friend TablePrinter& operator << (TablePrinter& tp, RowBreak) {
+ if (tp.m_currentColumn > 0) {
+ tp.m_os << "\n";
+ tp.m_currentColumn = -1;
+ }
+ return tp;
+ }
+};
+
+ConsoleReporter::ConsoleReporter(ReporterConfig const& config)
+ : StreamingReporterBase(config),
+ m_tablePrinter(new TablePrinter(config.stream(),
+ {
+ { "benchmark name", CATCH_CONFIG_CONSOLE_WIDTH - 32, ColumnInfo::Left },
+ { "samples mean std dev", 14, ColumnInfo::Right },
+ { "iterations low mean low std dev", 14, ColumnInfo::Right },
+ { "estimated high mean high std dev", 14, ColumnInfo::Right }
+ })) {}
+ConsoleReporter::~ConsoleReporter() = default;
+
+std::string ConsoleReporter::getDescription() {
+ return "Reports test results as plain lines of text";
+}
+
+void ConsoleReporter::noMatchingTestCases(std::string const& spec) {
+ stream << "No test cases matched '" << spec << '\'' << std::endl;
+}
+
+void ConsoleReporter::assertionStarting(AssertionInfo const&) {}
+
+bool ConsoleReporter::assertionEnded(AssertionStats const& _assertionStats) {
+ AssertionResult const& result = _assertionStats.assertionResult;
+
+ bool includeResults = m_config->includeSuccessfulResults() || !result.isOk();
+
+ // Drop out if result was successful but we're not printing them.
+ if (!includeResults && result.getResultType() != ResultWas::Warning)
+ return false;
+
+ lazyPrint();
+
+ ConsoleAssertionPrinter printer(stream, _assertionStats, includeResults);
+ printer.print();
+ stream << std::endl;
+ return true;
+}
+
+void ConsoleReporter::sectionStarting(SectionInfo const& _sectionInfo) {
+ m_tablePrinter->close();
+ m_headerPrinted = false;
+ StreamingReporterBase::sectionStarting(_sectionInfo);
+}
+void ConsoleReporter::sectionEnded(SectionStats const& _sectionStats) {
+ m_tablePrinter->close();
+ if (_sectionStats.missingAssertions) {
+ lazyPrint();
+ Colour colour(Colour::ResultError);
+ if (m_sectionStack.size() > 1)
+ stream << "\nNo assertions in section";
+ else
+ stream << "\nNo assertions in test case";
+ stream << " '" << _sectionStats.sectionInfo.name << "'\n" << std::endl;
+ }
+ if (m_config->showDurations() == ShowDurations::Always) {
+ stream << getFormattedDuration(_sectionStats.durationInSeconds) << " s: " << _sectionStats.sectionInfo.name << std::endl;
+ }
+ if (m_headerPrinted) {
+ m_headerPrinted = false;
+ }
+ StreamingReporterBase::sectionEnded(_sectionStats);
+}
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+void ConsoleReporter::benchmarkPreparing(std::string const& name) {
+ lazyPrintWithoutClosingBenchmarkTable();
+
+ auto nameCol = Column(name).width(static_cast<std::size_t>(m_tablePrinter->columnInfos()[0].width - 2));
+
+ bool firstLine = true;
+ for (auto line : nameCol) {
+ if (!firstLine)
+ (*m_tablePrinter) << ColumnBreak() << ColumnBreak() << ColumnBreak();
+ else
+ firstLine = false;
+
+ (*m_tablePrinter) << line << ColumnBreak();
+ }
+}
+
+void ConsoleReporter::benchmarkStarting(BenchmarkInfo const& info) {
+ (*m_tablePrinter) << info.samples << ColumnBreak()
+ << info.iterations << ColumnBreak()
+ << Duration(info.estimatedDuration) << ColumnBreak();
+}
+void ConsoleReporter::benchmarkEnded(BenchmarkStats<> const& stats) {
+ (*m_tablePrinter) << ColumnBreak()
+ << Duration(stats.mean.point.count()) << ColumnBreak()
+ << Duration(stats.mean.lower_bound.count()) << ColumnBreak()
+ << Duration(stats.mean.upper_bound.count()) << ColumnBreak() << ColumnBreak()
+ << Duration(stats.standardDeviation.point.count()) << ColumnBreak()
+ << Duration(stats.standardDeviation.lower_bound.count()) << ColumnBreak()
+ << Duration(stats.standardDeviation.upper_bound.count()) << ColumnBreak() << ColumnBreak() << ColumnBreak() << ColumnBreak() << ColumnBreak();
+}
+
+void ConsoleReporter::benchmarkFailed(std::string const& error) {
+ Colour colour(Colour::Red);
+ (*m_tablePrinter)
+ << "Benchmark failed (" << error << ")"
+ << ColumnBreak() << RowBreak();
+}
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+void ConsoleReporter::testCaseEnded(TestCaseStats const& _testCaseStats) {
+ m_tablePrinter->close();
+ StreamingReporterBase::testCaseEnded(_testCaseStats);
+ m_headerPrinted = false;
+}
+void ConsoleReporter::testGroupEnded(TestGroupStats const& _testGroupStats) {
+ if (currentGroupInfo.used) {
+ printSummaryDivider();
+ stream << "Summary for group '" << _testGroupStats.groupInfo.name << "':\n";
+ printTotals(_testGroupStats.totals);
+ stream << '\n' << std::endl;
+ }
+ StreamingReporterBase::testGroupEnded(_testGroupStats);
+}
+void ConsoleReporter::testRunEnded(TestRunStats const& _testRunStats) {
+ printTotalsDivider(_testRunStats.totals);
+ printTotals(_testRunStats.totals);
+ stream << std::endl;
+ StreamingReporterBase::testRunEnded(_testRunStats);
+}
+void ConsoleReporter::testRunStarting(TestRunInfo const& _testInfo) {
+ StreamingReporterBase::testRunStarting(_testInfo);
+ printTestFilters();
+}
+
+void ConsoleReporter::lazyPrint() {
+
+ m_tablePrinter->close();
+ lazyPrintWithoutClosingBenchmarkTable();
+}
+
+void ConsoleReporter::lazyPrintWithoutClosingBenchmarkTable() {
+
+ if (!currentTestRunInfo.used)
+ lazyPrintRunInfo();
+ if (!currentGroupInfo.used)
+ lazyPrintGroupInfo();
+
+ if (!m_headerPrinted) {
+ printTestCaseAndSectionHeader();
+ m_headerPrinted = true;
+ }
+}
+void ConsoleReporter::lazyPrintRunInfo() {
+ stream << '\n' << getLineOfChars<'~'>() << '\n';
+ Colour colour(Colour::SecondaryText);
+ stream << currentTestRunInfo->name
+ << " is a Catch v" << libraryVersion() << " host application.\n"
+ << "Run with -? for options\n\n";
+
+ if (m_config->rngSeed() != 0)
+ stream << "Randomness seeded to: " << m_config->rngSeed() << "\n\n";
+
+ currentTestRunInfo.used = true;
+}
+void ConsoleReporter::lazyPrintGroupInfo() {
+ if (!currentGroupInfo->name.empty() && currentGroupInfo->groupsCounts > 1) {
+ printClosedHeader("Group: " + currentGroupInfo->name);
+ currentGroupInfo.used = true;
+ }
+}
+void ConsoleReporter::printTestCaseAndSectionHeader() {
+ assert(!m_sectionStack.empty());
+ printOpenHeader(currentTestCaseInfo->name);
+
+ if (m_sectionStack.size() > 1) {
+ Colour colourGuard(Colour::Headers);
+
+ auto
+ it = m_sectionStack.begin() + 1, // Skip first section (test case)
+ itEnd = m_sectionStack.end();
+ for (; it != itEnd; ++it)
+ printHeaderString(it->name, 2);
+ }
+
+ SourceLineInfo lineInfo = m_sectionStack.back().lineInfo;
+
+ if (!lineInfo.empty()) {
+ stream << getLineOfChars<'-'>() << '\n';
+ Colour colourGuard(Colour::FileName);
+ stream << lineInfo << '\n';
+ }
+ stream << getLineOfChars<'.'>() << '\n' << std::endl;
+}
+
+void ConsoleReporter::printClosedHeader(std::string const& _name) {
+ printOpenHeader(_name);
+ stream << getLineOfChars<'.'>() << '\n';
+}
+void ConsoleReporter::printOpenHeader(std::string const& _name) {
+ stream << getLineOfChars<'-'>() << '\n';
+ {
+ Colour colourGuard(Colour::Headers);
+ printHeaderString(_name);
+ }
+}
+
+// if string has a : in first line will set indent to follow it on
+// subsequent lines
+void ConsoleReporter::printHeaderString(std::string const& _string, std::size_t indent) {
+ std::size_t i = _string.find(": ");
+ if (i != std::string::npos)
+ i += 2;
+ else
+ i = 0;
+ stream << Column(_string).indent(indent + i).initialIndent(indent) << '\n';
+}
+
+struct SummaryColumn {
+
+ SummaryColumn( std::string _label, Colour::Code _colour )
+ : label( std::move( _label ) ),
+ colour( _colour ) {}
+ SummaryColumn addRow( std::size_t count ) {
+ ReusableStringStream rss;
+ rss << count;
+ std::string row = rss.str();
+ for (auto& oldRow : rows) {
+ while (oldRow.size() < row.size())
+ oldRow = ' ' + oldRow;
+ while (oldRow.size() > row.size())
+ row = ' ' + row;
+ }
+ rows.push_back(row);
+ return *this;
+ }
+
+ std::string label;
+ Colour::Code colour;
+ std::vector<std::string> rows;
+
+};
+
+void ConsoleReporter::printTotals( Totals const& totals ) {
+ if (totals.testCases.total() == 0) {
+ stream << Colour(Colour::Warning) << "No tests ran\n";
+ } else if (totals.assertions.total() > 0 && totals.testCases.allPassed()) {
+ stream << Colour(Colour::ResultSuccess) << "All tests passed";
+ stream << " ("
+ << pluralise(totals.assertions.passed, "assertion") << " in "
+ << pluralise(totals.testCases.passed, "test case") << ')'
+ << '\n';
+ } else {
+
+ std::vector<SummaryColumn> columns;
+ columns.push_back(SummaryColumn("", Colour::None)
+ .addRow(totals.testCases.total())
+ .addRow(totals.assertions.total()));
+ columns.push_back(SummaryColumn("passed", Colour::Success)
+ .addRow(totals.testCases.passed)
+ .addRow(totals.assertions.passed));
+ columns.push_back(SummaryColumn("failed", Colour::ResultError)
+ .addRow(totals.testCases.failed)
+ .addRow(totals.assertions.failed));
+ columns.push_back(SummaryColumn("failed as expected", Colour::ResultExpectedFailure)
+ .addRow(totals.testCases.failedButOk)
+ .addRow(totals.assertions.failedButOk));
+
+ printSummaryRow("test cases", columns, 0);
+ printSummaryRow("assertions", columns, 1);
+ }
+}
+void ConsoleReporter::printSummaryRow(std::string const& label, std::vector<SummaryColumn> const& cols, std::size_t row) {
+ for (auto col : cols) {
+ std::string value = col.rows[row];
+ if (col.label.empty()) {
+ stream << label << ": ";
+ if (value != "0")
+ stream << value;
+ else
+ stream << Colour(Colour::Warning) << "- none -";
+ } else if (value != "0") {
+ stream << Colour(Colour::LightGrey) << " | ";
+ stream << Colour(col.colour)
+ << value << ' ' << col.label;
+ }
+ }
+ stream << '\n';
+}
+
+void ConsoleReporter::printTotalsDivider(Totals const& totals) {
+ if (totals.testCases.total() > 0) {
+ std::size_t failedRatio = makeRatio(totals.testCases.failed, totals.testCases.total());
+ std::size_t failedButOkRatio = makeRatio(totals.testCases.failedButOk, totals.testCases.total());
+ std::size_t passedRatio = makeRatio(totals.testCases.passed, totals.testCases.total());
+ while (failedRatio + failedButOkRatio + passedRatio < CATCH_CONFIG_CONSOLE_WIDTH - 1)
+ findMax(failedRatio, failedButOkRatio, passedRatio)++;
+ while (failedRatio + failedButOkRatio + passedRatio > CATCH_CONFIG_CONSOLE_WIDTH - 1)
+ findMax(failedRatio, failedButOkRatio, passedRatio)--;
+
+ stream << Colour(Colour::Error) << std::string(failedRatio, '=');
+ stream << Colour(Colour::ResultExpectedFailure) << std::string(failedButOkRatio, '=');
+ if (totals.testCases.allPassed())
+ stream << Colour(Colour::ResultSuccess) << std::string(passedRatio, '=');
+ else
+ stream << Colour(Colour::Success) << std::string(passedRatio, '=');
+ } else {
+ stream << Colour(Colour::Warning) << std::string(CATCH_CONFIG_CONSOLE_WIDTH - 1, '=');
+ }
+ stream << '\n';
+}
+void ConsoleReporter::printSummaryDivider() {
+ stream << getLineOfChars<'-'>() << '\n';
+}
+
+void ConsoleReporter::printTestFilters() {
+ if (m_config->testSpec().hasFilters())
+ stream << Colour(Colour::BrightYellow) << "Filters: " << serializeFilters( m_config->getTestsOrTags() ) << '\n';
+}
+
+CATCH_REGISTER_REPORTER("console", ConsoleReporter)
+
+} // end namespace Catch
+
+#if defined(_MSC_VER)
+#pragma warning(pop)
+#endif
+
+#if defined(__clang__)
+# pragma clang diagnostic pop
+#endif
+// end catch_reporter_console.cpp
+// start catch_reporter_junit.cpp
+
+#include <cassert>
+#include <sstream>
+#include <ctime>
+#include <algorithm>
+
+namespace Catch {
+
+ namespace {
+ std::string getCurrentTimestamp() {
+ // Beware, this is not reentrant because of backward compatibility issues
+ // Also, UTC only, again because of backward compatibility (%z is C++11)
+ time_t rawtime;
+ std::time(&rawtime);
+ auto const timeStampSize = sizeof("2017-01-16T17:06:45Z");
+
+#ifdef _MSC_VER
+ std::tm timeInfo = {};
+ gmtime_s(&timeInfo, &rawtime);
+#else
+ std::tm* timeInfo;
+ timeInfo = std::gmtime(&rawtime);
+#endif
+
+ char timeStamp[timeStampSize];
+ const char * const fmt = "%Y-%m-%dT%H:%M:%SZ";
+
+#ifdef _MSC_VER
+ std::strftime(timeStamp, timeStampSize, fmt, &timeInfo);
+#else
+ std::strftime(timeStamp, timeStampSize, fmt, timeInfo);
+#endif
+ return std::string(timeStamp);
+ }
+
+ std::string fileNameTag(const std::vector<std::string> &tags) {
+ auto it = std::find_if(begin(tags),
+ end(tags),
+ [] (std::string const& tag) {return tag.front() == '#'; });
+ if (it != tags.end())
+ return it->substr(1);
+ return std::string();
+ }
+ } // anonymous namespace
+
+ JunitReporter::JunitReporter( ReporterConfig const& _config )
+ : CumulativeReporterBase( _config ),
+ xml( _config.stream() )
+ {
+ m_reporterPrefs.shouldRedirectStdOut = true;
+ m_reporterPrefs.shouldReportAllAssertions = true;
+ }
+
+ JunitReporter::~JunitReporter() {}
+
+ std::string JunitReporter::getDescription() {
+ return "Reports test results in an XML format that looks like Ant's junitreport target";
+ }
+
+ void JunitReporter::noMatchingTestCases( std::string const& /*spec*/ ) {}
+
+ void JunitReporter::testRunStarting( TestRunInfo const& runInfo ) {
+ CumulativeReporterBase::testRunStarting( runInfo );
+ xml.startElement( "testsuites" );
+ }
+
+ void JunitReporter::testGroupStarting( GroupInfo const& groupInfo ) {
+ suiteTimer.start();
+ stdOutForSuite.clear();
+ stdErrForSuite.clear();
+ unexpectedExceptions = 0;
+ CumulativeReporterBase::testGroupStarting( groupInfo );
+ }
+
+ void JunitReporter::testCaseStarting( TestCaseInfo const& testCaseInfo ) {
+ m_okToFail = testCaseInfo.okToFail();
+ }
+
+ bool JunitReporter::assertionEnded( AssertionStats const& assertionStats ) {
+ if( assertionStats.assertionResult.getResultType() == ResultWas::ThrewException && !m_okToFail )
+ unexpectedExceptions++;
+ return CumulativeReporterBase::assertionEnded( assertionStats );
+ }
+
+ void JunitReporter::testCaseEnded( TestCaseStats const& testCaseStats ) {
+ stdOutForSuite += testCaseStats.stdOut;
+ stdErrForSuite += testCaseStats.stdErr;
+ CumulativeReporterBase::testCaseEnded( testCaseStats );
+ }
+
+ void JunitReporter::testGroupEnded( TestGroupStats const& testGroupStats ) {
+ double suiteTime = suiteTimer.getElapsedSeconds();
+ CumulativeReporterBase::testGroupEnded( testGroupStats );
+ writeGroup( *m_testGroups.back(), suiteTime );
+ }
+
+ void JunitReporter::testRunEndedCumulative() {
+ xml.endElement();
+ }
+
+ void JunitReporter::writeGroup( TestGroupNode const& groupNode, double suiteTime ) {
+ XmlWriter::ScopedElement e = xml.scopedElement( "testsuite" );
+
+ TestGroupStats const& stats = groupNode.value;
+ xml.writeAttribute( "name", stats.groupInfo.name );
+ xml.writeAttribute( "errors", unexpectedExceptions );
+ xml.writeAttribute( "failures", stats.totals.assertions.failed-unexpectedExceptions );
+ xml.writeAttribute( "tests", stats.totals.assertions.total() );
+ xml.writeAttribute( "hostname", "tbd" ); // !TBD
+ if( m_config->showDurations() == ShowDurations::Never )
+ xml.writeAttribute( "time", "" );
+ else
+ xml.writeAttribute( "time", suiteTime );
+ xml.writeAttribute( "timestamp", getCurrentTimestamp() );
+
+ // Write properties if there are any
+ if (m_config->hasTestFilters() || m_config->rngSeed() != 0) {
+ auto properties = xml.scopedElement("properties");
+ if (m_config->hasTestFilters()) {
+ xml.scopedElement("property")
+ .writeAttribute("name", "filters")
+ .writeAttribute("value", serializeFilters(m_config->getTestsOrTags()));
+ }
+ if (m_config->rngSeed() != 0) {
+ xml.scopedElement("property")
+ .writeAttribute("name", "random-seed")
+ .writeAttribute("value", m_config->rngSeed());
+ }
+ }
+
+ // Write test cases
+ for( auto const& child : groupNode.children )
+ writeTestCase( *child );
+
+ xml.scopedElement( "system-out" ).writeText( trim( stdOutForSuite ), false );
+ xml.scopedElement( "system-err" ).writeText( trim( stdErrForSuite ), false );
+ }
+
+ void JunitReporter::writeTestCase( TestCaseNode const& testCaseNode ) {
+ TestCaseStats const& stats = testCaseNode.value;
+
+ // All test cases have exactly one section - which represents the
+ // test case itself. That section may have 0-n nested sections
+ assert( testCaseNode.children.size() == 1 );
+ SectionNode const& rootSection = *testCaseNode.children.front();
+
+ std::string className = stats.testInfo.className;
+
+ if( className.empty() ) {
+ className = fileNameTag(stats.testInfo.tags);
+ if ( className.empty() )
+ className = "global";
+ }
+
+ if ( !m_config->name().empty() )
+ className = m_config->name() + "." + className;
+
+ writeSection( className, "", rootSection );
+ }
+
+ void JunitReporter::writeSection( std::string const& className,
+ std::string const& rootName,
+ SectionNode const& sectionNode ) {
+ std::string name = trim( sectionNode.stats.sectionInfo.name );
+ if( !rootName.empty() )
+ name = rootName + '/' + name;
+
+ if( !sectionNode.assertions.empty() ||
+ !sectionNode.stdOut.empty() ||
+ !sectionNode.stdErr.empty() ) {
+ XmlWriter::ScopedElement e = xml.scopedElement( "testcase" );
+ if( className.empty() ) {
+ xml.writeAttribute( "classname", name );
+ xml.writeAttribute( "name", "root" );
+ }
+ else {
+ xml.writeAttribute( "classname", className );
+ xml.writeAttribute( "name", name );
+ }
+ xml.writeAttribute( "time", ::Catch::Detail::stringify( sectionNode.stats.durationInSeconds ) );
+
+ writeAssertions( sectionNode );
+
+ if( !sectionNode.stdOut.empty() )
+ xml.scopedElement( "system-out" ).writeText( trim( sectionNode.stdOut ), false );
+ if( !sectionNode.stdErr.empty() )
+ xml.scopedElement( "system-err" ).writeText( trim( sectionNode.stdErr ), false );
+ }
+ for( auto const& childNode : sectionNode.childSections )
+ if( className.empty() )
+ writeSection( name, "", *childNode );
+ else
+ writeSection( className, name, *childNode );
+ }
+
+ void JunitReporter::writeAssertions( SectionNode const& sectionNode ) {
+ for( auto const& assertion : sectionNode.assertions )
+ writeAssertion( assertion );
+ }
+
+ void JunitReporter::writeAssertion( AssertionStats const& stats ) {
+ AssertionResult const& result = stats.assertionResult;
+ if( !result.isOk() ) {
+ std::string elementName;
+ switch( result.getResultType() ) {
+ case ResultWas::ThrewException:
+ case ResultWas::FatalErrorCondition:
+ elementName = "error";
+ break;
+ case ResultWas::ExplicitFailure:
+ elementName = "failure";
+ break;
+ case ResultWas::ExpressionFailed:
+ elementName = "failure";
+ break;
+ case ResultWas::DidntThrowException:
+ elementName = "failure";
+ break;
+
+ // We should never see these here:
+ case ResultWas::Info:
+ case ResultWas::Warning:
+ case ResultWas::Ok:
+ case ResultWas::Unknown:
+ case ResultWas::FailureBit:
+ case ResultWas::Exception:
+ elementName = "internalError";
+ break;
+ }
+
+ XmlWriter::ScopedElement e = xml.scopedElement( elementName );
+
+ xml.writeAttribute( "message", result.getExpandedExpression() );
+ xml.writeAttribute( "type", result.getTestMacroName() );
+
+ ReusableStringStream rss;
+ if( !result.getMessage().empty() )
+ rss << result.getMessage() << '\n';
+ for( auto const& msg : stats.infoMessages )
+ if( msg.type == ResultWas::Info )
+ rss << msg.message << '\n';
+
+ rss << "at " << result.getSourceInfo();
+ xml.writeText( rss.str(), false );
+ }
+ }
+
+ CATCH_REGISTER_REPORTER( "junit", JunitReporter )
+
+} // end namespace Catch
+// end catch_reporter_junit.cpp
+// start catch_reporter_listening.cpp
+
+#include <cassert>
+
+namespace Catch {
+
+ ListeningReporter::ListeningReporter() {
+ // We will assume that listeners will always want all assertions
+ m_preferences.shouldReportAllAssertions = true;
+ }
+
+ void ListeningReporter::addListener( IStreamingReporterPtr&& listener ) {
+ m_listeners.push_back( std::move( listener ) );
+ }
+
+ void ListeningReporter::addReporter(IStreamingReporterPtr&& reporter) {
+ assert(!m_reporter && "Listening reporter can wrap only 1 real reporter");
+ m_reporter = std::move( reporter );
+ m_preferences.shouldRedirectStdOut = m_reporter->getPreferences().shouldRedirectStdOut;
+ }
+
+ ReporterPreferences ListeningReporter::getPreferences() const {
+ return m_preferences;
+ }
+
+ std::set<Verbosity> ListeningReporter::getSupportedVerbosities() {
+ return std::set<Verbosity>{ };
+ }
+
+ void ListeningReporter::noMatchingTestCases( std::string const& spec ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->noMatchingTestCases( spec );
+ }
+ m_reporter->noMatchingTestCases( spec );
+ }
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ void ListeningReporter::benchmarkPreparing( std::string const& name ) {
+ for (auto const& listener : m_listeners) {
+ listener->benchmarkPreparing(name);
+ }
+ m_reporter->benchmarkPreparing(name);
+ }
+ void ListeningReporter::benchmarkStarting( BenchmarkInfo const& benchmarkInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->benchmarkStarting( benchmarkInfo );
+ }
+ m_reporter->benchmarkStarting( benchmarkInfo );
+ }
+ void ListeningReporter::benchmarkEnded( BenchmarkStats<> const& benchmarkStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->benchmarkEnded( benchmarkStats );
+ }
+ m_reporter->benchmarkEnded( benchmarkStats );
+ }
+
+ void ListeningReporter::benchmarkFailed( std::string const& error ) {
+ for (auto const& listener : m_listeners) {
+ listener->benchmarkFailed(error);
+ }
+ m_reporter->benchmarkFailed(error);
+ }
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ void ListeningReporter::testRunStarting( TestRunInfo const& testRunInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testRunStarting( testRunInfo );
+ }
+ m_reporter->testRunStarting( testRunInfo );
+ }
+
+ void ListeningReporter::testGroupStarting( GroupInfo const& groupInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testGroupStarting( groupInfo );
+ }
+ m_reporter->testGroupStarting( groupInfo );
+ }
+
+ void ListeningReporter::testCaseStarting( TestCaseInfo const& testInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testCaseStarting( testInfo );
+ }
+ m_reporter->testCaseStarting( testInfo );
+ }
+
+ void ListeningReporter::sectionStarting( SectionInfo const& sectionInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->sectionStarting( sectionInfo );
+ }
+ m_reporter->sectionStarting( sectionInfo );
+ }
+
+ void ListeningReporter::assertionStarting( AssertionInfo const& assertionInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->assertionStarting( assertionInfo );
+ }
+ m_reporter->assertionStarting( assertionInfo );
+ }
+
+ // The return value indicates if the messages buffer should be cleared:
+ bool ListeningReporter::assertionEnded( AssertionStats const& assertionStats ) {
+ for( auto const& listener : m_listeners ) {
+ static_cast<void>( listener->assertionEnded( assertionStats ) );
+ }
+ return m_reporter->assertionEnded( assertionStats );
+ }
+
+ void ListeningReporter::sectionEnded( SectionStats const& sectionStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->sectionEnded( sectionStats );
+ }
+ m_reporter->sectionEnded( sectionStats );
+ }
+
+ void ListeningReporter::testCaseEnded( TestCaseStats const& testCaseStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testCaseEnded( testCaseStats );
+ }
+ m_reporter->testCaseEnded( testCaseStats );
+ }
+
+ void ListeningReporter::testGroupEnded( TestGroupStats const& testGroupStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testGroupEnded( testGroupStats );
+ }
+ m_reporter->testGroupEnded( testGroupStats );
+ }
+
+ void ListeningReporter::testRunEnded( TestRunStats const& testRunStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testRunEnded( testRunStats );
+ }
+ m_reporter->testRunEnded( testRunStats );
+ }
+
+ void ListeningReporter::skipTest( TestCaseInfo const& testInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->skipTest( testInfo );
+ }
+ m_reporter->skipTest( testInfo );
+ }
+
+ bool ListeningReporter::isMulti() const {
+ return true;
+ }
+
+} // end namespace Catch
+// end catch_reporter_listening.cpp
+// start catch_reporter_xml.cpp
+
+#if defined(_MSC_VER)
+#pragma warning(push)
+#pragma warning(disable:4061) // Not all labels are EXPLICITLY handled in switch
+ // Note that 4062 (not all labels are handled
+ // and default is missing) is enabled
+#endif
+
+namespace Catch {
+ XmlReporter::XmlReporter( ReporterConfig const& _config )
+ : StreamingReporterBase( _config ),
+ m_xml(_config.stream())
+ {
+ m_reporterPrefs.shouldRedirectStdOut = true;
+ m_reporterPrefs.shouldReportAllAssertions = true;
+ }
+
+ XmlReporter::~XmlReporter() = default;
+
+ std::string XmlReporter::getDescription() {
+ return "Reports test results as an XML document";
+ }
+
+ std::string XmlReporter::getStylesheetRef() const {
+ return std::string();
+ }
+
+ void XmlReporter::writeSourceInfo( SourceLineInfo const& sourceInfo ) {
+ m_xml
+ .writeAttribute( "filename", sourceInfo.file )
+ .writeAttribute( "line", sourceInfo.line );
+ }
+
+ void XmlReporter::noMatchingTestCases( std::string const& s ) {
+ StreamingReporterBase::noMatchingTestCases( s );
+ }
+
+ void XmlReporter::testRunStarting( TestRunInfo const& testInfo ) {
+ StreamingReporterBase::testRunStarting( testInfo );
+ std::string stylesheetRef = getStylesheetRef();
+ if( !stylesheetRef.empty() )
+ m_xml.writeStylesheetRef( stylesheetRef );
+ m_xml.startElement( "Catch" );
+ if( !m_config->name().empty() )
+ m_xml.writeAttribute( "name", m_config->name() );
+ if (m_config->testSpec().hasFilters())
+ m_xml.writeAttribute( "filters", serializeFilters( m_config->getTestsOrTags() ) );
+ if( m_config->rngSeed() != 0 )
+ m_xml.scopedElement( "Randomness" )
+ .writeAttribute( "seed", m_config->rngSeed() );
+ }
+
+ void XmlReporter::testGroupStarting( GroupInfo const& groupInfo ) {
+ StreamingReporterBase::testGroupStarting( groupInfo );
+ m_xml.startElement( "Group" )
+ .writeAttribute( "name", groupInfo.name );
+ }
+
+ void XmlReporter::testCaseStarting( TestCaseInfo const& testInfo ) {
+ StreamingReporterBase::testCaseStarting(testInfo);
+ m_xml.startElement( "TestCase" )
+ .writeAttribute( "name", trim( testInfo.name ) )
+ .writeAttribute( "description", testInfo.description )
+ .writeAttribute( "tags", testInfo.tagsAsString() );
+
+ writeSourceInfo( testInfo.lineInfo );
+
+ if ( m_config->showDurations() == ShowDurations::Always )
+ m_testCaseTimer.start();
+ m_xml.ensureTagClosed();
+ }
+
+ void XmlReporter::sectionStarting( SectionInfo const& sectionInfo ) {
+ StreamingReporterBase::sectionStarting( sectionInfo );
+ if( m_sectionDepth++ > 0 ) {
+ m_xml.startElement( "Section" )
+ .writeAttribute( "name", trim( sectionInfo.name ) );
+ writeSourceInfo( sectionInfo.lineInfo );
+ m_xml.ensureTagClosed();
+ }
+ }
+
+ void XmlReporter::assertionStarting( AssertionInfo const& ) { }
+
+ bool XmlReporter::assertionEnded( AssertionStats const& assertionStats ) {
+
+ AssertionResult const& result = assertionStats.assertionResult;
+
+ bool includeResults = m_config->includeSuccessfulResults() || !result.isOk();
+
+ if( includeResults || result.getResultType() == ResultWas::Warning ) {
+ // Print any info messages in <Info> tags.
+ for( auto const& msg : assertionStats.infoMessages ) {
+ if( msg.type == ResultWas::Info && includeResults ) {
+ m_xml.scopedElement( "Info" )
+ .writeText( msg.message );
+ } else if ( msg.type == ResultWas::Warning ) {
+ m_xml.scopedElement( "Warning" )
+ .writeText( msg.message );
+ }
+ }
+ }
+
+ // Drop out if result was successful but we're not printing them.
+ if( !includeResults && result.getResultType() != ResultWas::Warning )
+ return true;
+
+ // Print the expression if there is one.
+ if( result.hasExpression() ) {
+ m_xml.startElement( "Expression" )
+ .writeAttribute( "success", result.succeeded() )
+ .writeAttribute( "type", result.getTestMacroName() );
+
+ writeSourceInfo( result.getSourceInfo() );
+
+ m_xml.scopedElement( "Original" )
+ .writeText( result.getExpression() );
+ m_xml.scopedElement( "Expanded" )
+ .writeText( result.getExpandedExpression() );
+ }
+
+ // And... Print a result applicable to each result type.
+ switch( result.getResultType() ) {
+ case ResultWas::ThrewException:
+ m_xml.startElement( "Exception" );
+ writeSourceInfo( result.getSourceInfo() );
+ m_xml.writeText( result.getMessage() );
+ m_xml.endElement();
+ break;
+ case ResultWas::FatalErrorCondition:
+ m_xml.startElement( "FatalErrorCondition" );
+ writeSourceInfo( result.getSourceInfo() );
+ m_xml.writeText( result.getMessage() );
+ m_xml.endElement();
+ break;
+ case ResultWas::Info:
+ m_xml.scopedElement( "Info" )
+ .writeText( result.getMessage() );
+ break;
+ case ResultWas::Warning:
+ // Warning will already have been written
+ break;
+ case ResultWas::ExplicitFailure:
+ m_xml.startElement( "Failure" );
+ writeSourceInfo( result.getSourceInfo() );
+ m_xml.writeText( result.getMessage() );
+ m_xml.endElement();
+ break;
+ default:
+ break;
+ }
+
+ if( result.hasExpression() )
+ m_xml.endElement();
+
+ return true;
+ }
+
+ void XmlReporter::sectionEnded( SectionStats const& sectionStats ) {
+ StreamingReporterBase::sectionEnded( sectionStats );
+ if( --m_sectionDepth > 0 ) {
+ XmlWriter::ScopedElement e = m_xml.scopedElement( "OverallResults" );
+ e.writeAttribute( "successes", sectionStats.assertions.passed );
+ e.writeAttribute( "failures", sectionStats.assertions.failed );
+ e.writeAttribute( "expectedFailures", sectionStats.assertions.failedButOk );
+
+ if ( m_config->showDurations() == ShowDurations::Always )
+ e.writeAttribute( "durationInSeconds", sectionStats.durationInSeconds );
+
+ m_xml.endElement();
+ }
+ }
+
+ void XmlReporter::testCaseEnded( TestCaseStats const& testCaseStats ) {
+ StreamingReporterBase::testCaseEnded( testCaseStats );
+ XmlWriter::ScopedElement e = m_xml.scopedElement( "OverallResult" );
+ e.writeAttribute( "success", testCaseStats.totals.assertions.allOk() );
+
+ if ( m_config->showDurations() == ShowDurations::Always )
+ e.writeAttribute( "durationInSeconds", m_testCaseTimer.getElapsedSeconds() );
+
+ if( !testCaseStats.stdOut.empty() )
+ m_xml.scopedElement( "StdOut" ).writeText( trim( testCaseStats.stdOut ), false );
+ if( !testCaseStats.stdErr.empty() )
+ m_xml.scopedElement( "StdErr" ).writeText( trim( testCaseStats.stdErr ), false );
+
+ m_xml.endElement();
+ }
+
+ void XmlReporter::testGroupEnded( TestGroupStats const& testGroupStats ) {
+ StreamingReporterBase::testGroupEnded( testGroupStats );
+ // TODO: Check testGroupStats.aborting and act accordingly.
+ m_xml.scopedElement( "OverallResults" )
+ .writeAttribute( "successes", testGroupStats.totals.assertions.passed )
+ .writeAttribute( "failures", testGroupStats.totals.assertions.failed )
+ .writeAttribute( "expectedFailures", testGroupStats.totals.assertions.failedButOk );
+ m_xml.endElement();
+ }
+
+ void XmlReporter::testRunEnded( TestRunStats const& testRunStats ) {
+ StreamingReporterBase::testRunEnded( testRunStats );
+ m_xml.scopedElement( "OverallResults" )
+ .writeAttribute( "successes", testRunStats.totals.assertions.passed )
+ .writeAttribute( "failures", testRunStats.totals.assertions.failed )
+ .writeAttribute( "expectedFailures", testRunStats.totals.assertions.failedButOk );
+ m_xml.endElement();
+ }
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+ void XmlReporter::benchmarkStarting(BenchmarkInfo const &info) {
+ m_xml.startElement("BenchmarkResults")
+ .writeAttribute("name", info.name)
+ .writeAttribute("samples", info.samples)
+ .writeAttribute("resamples", info.resamples)
+ .writeAttribute("iterations", info.iterations)
+ .writeAttribute("clockResolution", static_cast<uint64_t>(info.clockResolution))
+ .writeAttribute("estimatedDuration", static_cast<uint64_t>(info.estimatedDuration))
+ .writeComment("All values in nano seconds");
+ }
+
+ void XmlReporter::benchmarkEnded(BenchmarkStats<> const& benchmarkStats) {
+ m_xml.startElement("mean")
+ .writeAttribute("value", static_cast<uint64_t>(benchmarkStats.mean.point.count()))
+ .writeAttribute("lowerBound", static_cast<uint64_t>(benchmarkStats.mean.lower_bound.count()))
+ .writeAttribute("upperBound", static_cast<uint64_t>(benchmarkStats.mean.upper_bound.count()))
+ .writeAttribute("ci", benchmarkStats.mean.confidence_interval);
+ m_xml.endElement();
+ m_xml.startElement("standardDeviation")
+ .writeAttribute("value", benchmarkStats.standardDeviation.point.count())
+ .writeAttribute("lowerBound", benchmarkStats.standardDeviation.lower_bound.count())
+ .writeAttribute("upperBound", benchmarkStats.standardDeviation.upper_bound.count())
+ .writeAttribute("ci", benchmarkStats.standardDeviation.confidence_interval);
+ m_xml.endElement();
+ m_xml.startElement("outliers")
+ .writeAttribute("variance", benchmarkStats.outlierVariance)
+ .writeAttribute("lowMild", benchmarkStats.outliers.low_mild)
+ .writeAttribute("lowSevere", benchmarkStats.outliers.low_severe)
+ .writeAttribute("highMild", benchmarkStats.outliers.high_mild)
+ .writeAttribute("highSevere", benchmarkStats.outliers.high_severe);
+ m_xml.endElement();
+ m_xml.endElement();
+ }
+
+ void XmlReporter::benchmarkFailed(std::string const &error) {
+ m_xml.scopedElement("failed").
+ writeAttribute("message", error);
+ m_xml.endElement();
+ }
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+ CATCH_REGISTER_REPORTER( "xml", XmlReporter )
+
+} // end namespace Catch
+
+#if defined(_MSC_VER)
+#pragma warning(pop)
+#endif
+// end catch_reporter_xml.cpp
+
+namespace Catch {
+ LeakDetector leakDetector;
+}
+
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// end catch_impl.hpp
+#endif
+
+#ifdef CATCH_CONFIG_MAIN
+// start catch_default_main.hpp
+
+#ifndef __OBJC__
+
+#if defined(CATCH_CONFIG_WCHAR) && defined(WIN32) && defined(_UNICODE) && !defined(DO_NOT_USE_WMAIN)
+// Standard C/C++ Win32 Unicode wmain entry point
+extern "C" int wmain (int argc, wchar_t * argv[], wchar_t * []) {
+#else
+// Standard C/C++ main entry point
+int main (int argc, char * argv[]) {
+#endif
+
+ return Catch::Session().run( argc, argv );
+}
+
+#else // __OBJC__
+
+// Objective-C entry point
+int main (int argc, char * const argv[]) {
+#if !CATCH_ARC_ENABLED
+ NSAutoreleasePool * pool = [[NSAutoreleasePool alloc] init];
+#endif
+
+ Catch::registerTestMethods();
+ int result = Catch::Session().run( argc, (char**)argv );
+
+#if !CATCH_ARC_ENABLED
+ [pool drain];
+#endif
+
+ return result;
+}
+
+#endif // __OBJC__
+
+// end catch_default_main.hpp
+#endif
+
+#if !defined(CATCH_CONFIG_IMPL_ONLY)
+
+#ifdef CLARA_CONFIG_MAIN_NOT_DEFINED
+# undef CLARA_CONFIG_MAIN
+#endif
+
+#if !defined(CATCH_CONFIG_DISABLE)
+//////
+// If this config identifier is defined then all CATCH macros are prefixed with CATCH_
+#ifdef CATCH_CONFIG_PREFIX_ALL
+
+#define CATCH_REQUIRE( ... ) INTERNAL_CATCH_TEST( "CATCH_REQUIRE", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define CATCH_REQUIRE_FALSE( ... ) INTERNAL_CATCH_TEST( "CATCH_REQUIRE_FALSE", Catch::ResultDisposition::Normal | Catch::ResultDisposition::FalseTest, __VA_ARGS__ )
+
+#define CATCH_REQUIRE_THROWS( ... ) INTERNAL_CATCH_THROWS( "CATCH_REQUIRE_THROWS", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define CATCH_REQUIRE_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "CATCH_REQUIRE_THROWS_AS", exceptionType, Catch::ResultDisposition::Normal, expr )
+#define CATCH_REQUIRE_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "CATCH_REQUIRE_THROWS_WITH", Catch::ResultDisposition::Normal, matcher, expr )
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "CATCH_REQUIRE_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::Normal, matcher, expr )
+#endif// CATCH_CONFIG_DISABLE_MATCHERS
+#define CATCH_REQUIRE_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "CATCH_REQUIRE_NOTHROW", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+
+#define CATCH_CHECK( ... ) INTERNAL_CATCH_TEST( "CATCH_CHECK", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_CHECK_FALSE( ... ) INTERNAL_CATCH_TEST( "CATCH_CHECK_FALSE", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::FalseTest, __VA_ARGS__ )
+#define CATCH_CHECKED_IF( ... ) INTERNAL_CATCH_IF( "CATCH_CHECKED_IF", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_CHECKED_ELSE( ... ) INTERNAL_CATCH_ELSE( "CATCH_CHECKED_ELSE", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_CHECK_NOFAIL( ... ) INTERNAL_CATCH_TEST( "CATCH_CHECK_NOFAIL", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::SuppressFail, __VA_ARGS__ )
+
+#define CATCH_CHECK_THROWS( ... ) INTERNAL_CATCH_THROWS( "CATCH_CHECK_THROWS", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_CHECK_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "CATCH_CHECK_THROWS_AS", exceptionType, Catch::ResultDisposition::ContinueOnFailure, expr )
+#define CATCH_CHECK_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "CATCH_CHECK_THROWS_WITH", Catch::ResultDisposition::ContinueOnFailure, matcher, expr )
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "CATCH_CHECK_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::ContinueOnFailure, matcher, expr )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define CATCH_CHECK_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "CATCH_CHECK_NOTHROW", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_CHECK_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "CATCH_CHECK_THAT", matcher, Catch::ResultDisposition::ContinueOnFailure, arg )
+
+#define CATCH_REQUIRE_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "CATCH_REQUIRE_THAT", matcher, Catch::ResultDisposition::Normal, arg )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+#define CATCH_INFO( msg ) INTERNAL_CATCH_INFO( "CATCH_INFO", msg )
+#define CATCH_UNSCOPED_INFO( msg ) INTERNAL_CATCH_UNSCOPED_INFO( "CATCH_UNSCOPED_INFO", msg )
+#define CATCH_WARN( msg ) INTERNAL_CATCH_MSG( "CATCH_WARN", Catch::ResultWas::Warning, Catch::ResultDisposition::ContinueOnFailure, msg )
+#define CATCH_CAPTURE( ... ) INTERNAL_CATCH_CAPTURE( INTERNAL_CATCH_UNIQUE_NAME(capturer), "CATCH_CAPTURE",__VA_ARGS__ )
+
+#define CATCH_TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE( __VA_ARGS__ )
+#define CATCH_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_METHOD_AS_TEST_CASE( method, ... ) INTERNAL_CATCH_METHOD_AS_TEST_CASE( method, __VA_ARGS__ )
+#define CATCH_REGISTER_TEST_CASE( Function, ... ) INTERNAL_CATCH_REGISTER_TESTCASE( Function, __VA_ARGS__ )
+#define CATCH_SECTION( ... ) INTERNAL_CATCH_SECTION( __VA_ARGS__ )
+#define CATCH_DYNAMIC_SECTION( ... ) INTERNAL_CATCH_DYNAMIC_SECTION( __VA_ARGS__ )
+#define CATCH_FAIL( ... ) INTERNAL_CATCH_MSG( "CATCH_FAIL", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define CATCH_FAIL_CHECK( ... ) INTERNAL_CATCH_MSG( "CATCH_FAIL_CHECK", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_SUCCEED( ... ) INTERNAL_CATCH_MSG( "CATCH_SUCCEED", Catch::ResultWas::Ok, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+
+#define CATCH_ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ )
+#else
+#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) )
+#endif
+
+#if !defined(CATCH_CONFIG_RUNTIME_STATIC_REQUIRE)
+#define CATCH_STATIC_REQUIRE( ... ) static_assert( __VA_ARGS__ , #__VA_ARGS__ ); CATCH_SUCCEED( #__VA_ARGS__ )
+#define CATCH_STATIC_REQUIRE_FALSE( ... ) static_assert( !(__VA_ARGS__), "!(" #__VA_ARGS__ ")" ); CATCH_SUCCEED( #__VA_ARGS__ )
+#else
+#define CATCH_STATIC_REQUIRE( ... ) CATCH_REQUIRE( __VA_ARGS__ )
+#define CATCH_STATIC_REQUIRE_FALSE( ... ) CATCH_REQUIRE_FALSE( __VA_ARGS__ )
+#endif
+
+// "BDD-style" convenience wrappers
+#define CATCH_SCENARIO( ... ) CATCH_TEST_CASE( "Scenario: " __VA_ARGS__ )
+#define CATCH_SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, "Scenario: " __VA_ARGS__ )
+#define CATCH_GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Given: " << desc )
+#define CATCH_AND_GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( "And given: " << desc )
+#define CATCH_WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " When: " << desc )
+#define CATCH_AND_WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And when: " << desc )
+#define CATCH_THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Then: " << desc )
+#define CATCH_AND_THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And: " << desc )
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+#define CATCH_BENCHMARK(...) \
+ INTERNAL_CATCH_BENCHMARK(INTERNAL_CATCH_UNIQUE_NAME(____C_A_T_C_H____B_E_N_C_H____), INTERNAL_CATCH_GET_1_ARG(__VA_ARGS__,,), INTERNAL_CATCH_GET_2_ARG(__VA_ARGS__,,))
+#define CATCH_BENCHMARK_ADVANCED(name) \
+ INTERNAL_CATCH_BENCHMARK_ADVANCED(INTERNAL_CATCH_UNIQUE_NAME(____C_A_T_C_H____B_E_N_C_H____), name)
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+// If CATCH_CONFIG_PREFIX_ALL is not defined then the CATCH_ prefix is not required
+#else
+
+#define REQUIRE( ... ) INTERNAL_CATCH_TEST( "REQUIRE", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define REQUIRE_FALSE( ... ) INTERNAL_CATCH_TEST( "REQUIRE_FALSE", Catch::ResultDisposition::Normal | Catch::ResultDisposition::FalseTest, __VA_ARGS__ )
+
+#define REQUIRE_THROWS( ... ) INTERNAL_CATCH_THROWS( "REQUIRE_THROWS", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define REQUIRE_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "REQUIRE_THROWS_AS", exceptionType, Catch::ResultDisposition::Normal, expr )
+#define REQUIRE_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "REQUIRE_THROWS_WITH", Catch::ResultDisposition::Normal, matcher, expr )
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "REQUIRE_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::Normal, matcher, expr )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define REQUIRE_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "REQUIRE_NOTHROW", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+
+#define CHECK( ... ) INTERNAL_CATCH_TEST( "CHECK", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CHECK_FALSE( ... ) INTERNAL_CATCH_TEST( "CHECK_FALSE", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::FalseTest, __VA_ARGS__ )
+#define CHECKED_IF( ... ) INTERNAL_CATCH_IF( "CHECKED_IF", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CHECKED_ELSE( ... ) INTERNAL_CATCH_ELSE( "CHECKED_ELSE", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CHECK_NOFAIL( ... ) INTERNAL_CATCH_TEST( "CHECK_NOFAIL", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::SuppressFail, __VA_ARGS__ )
+
+#define CHECK_THROWS( ... ) INTERNAL_CATCH_THROWS( "CHECK_THROWS", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CHECK_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "CHECK_THROWS_AS", exceptionType, Catch::ResultDisposition::ContinueOnFailure, expr )
+#define CHECK_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "CHECK_THROWS_WITH", Catch::ResultDisposition::ContinueOnFailure, matcher, expr )
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "CHECK_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::ContinueOnFailure, matcher, expr )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define CHECK_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "CHECK_NOTHROW", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CHECK_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "CHECK_THAT", matcher, Catch::ResultDisposition::ContinueOnFailure, arg )
+
+#define REQUIRE_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "REQUIRE_THAT", matcher, Catch::ResultDisposition::Normal, arg )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+#define INFO( msg ) INTERNAL_CATCH_INFO( "INFO", msg )
+#define UNSCOPED_INFO( msg ) INTERNAL_CATCH_UNSCOPED_INFO( "UNSCOPED_INFO", msg )
+#define WARN( msg ) INTERNAL_CATCH_MSG( "WARN", Catch::ResultWas::Warning, Catch::ResultDisposition::ContinueOnFailure, msg )
+#define CAPTURE( ... ) INTERNAL_CATCH_CAPTURE( INTERNAL_CATCH_UNIQUE_NAME(capturer), "CAPTURE",__VA_ARGS__ )
+
+#define TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE( __VA_ARGS__ )
+#define TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define METHOD_AS_TEST_CASE( method, ... ) INTERNAL_CATCH_METHOD_AS_TEST_CASE( method, __VA_ARGS__ )
+#define REGISTER_TEST_CASE( Function, ... ) INTERNAL_CATCH_REGISTER_TESTCASE( Function, __VA_ARGS__ )
+#define SECTION( ... ) INTERNAL_CATCH_SECTION( __VA_ARGS__ )
+#define DYNAMIC_SECTION( ... ) INTERNAL_CATCH_DYNAMIC_SECTION( __VA_ARGS__ )
+#define FAIL( ... ) INTERNAL_CATCH_MSG( "FAIL", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define FAIL_CHECK( ... ) INTERNAL_CATCH_MSG( "FAIL_CHECK", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define SUCCEED( ... ) INTERNAL_CATCH_MSG( "SUCCEED", Catch::ResultWas::Ok, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ )
+#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ )
+#define TEMPLATE_LIST_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE(__VA_ARGS__)
+#define TEMPLATE_LIST_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#else
+#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) )
+#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ ) )
+#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) )
+#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) )
+#define TEMPLATE_LIST_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE( __VA_ARGS__ ) )
+#define TEMPLATE_LIST_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_LIST_TEST_CASE_METHOD( className, __VA_ARGS__ ) )
+#endif
+
+#if !defined(CATCH_CONFIG_RUNTIME_STATIC_REQUIRE)
+#define STATIC_REQUIRE( ... ) static_assert( __VA_ARGS__, #__VA_ARGS__ ); SUCCEED( #__VA_ARGS__ )
+#define STATIC_REQUIRE_FALSE( ... ) static_assert( !(__VA_ARGS__), "!(" #__VA_ARGS__ ")" ); SUCCEED( "!(" #__VA_ARGS__ ")" )
+#else
+#define STATIC_REQUIRE( ... ) REQUIRE( __VA_ARGS__ )
+#define STATIC_REQUIRE_FALSE( ... ) REQUIRE_FALSE( __VA_ARGS__ )
+#endif
+
+#endif
+
+#define CATCH_TRANSLATE_EXCEPTION( signature ) INTERNAL_CATCH_TRANSLATE_EXCEPTION( signature )
+
+// "BDD-style" convenience wrappers
+#define SCENARIO( ... ) TEST_CASE( "Scenario: " __VA_ARGS__ )
+#define SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, "Scenario: " __VA_ARGS__ )
+
+#define GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Given: " << desc )
+#define AND_GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( "And given: " << desc )
+#define WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " When: " << desc )
+#define AND_WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And when: " << desc )
+#define THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Then: " << desc )
+#define AND_THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And: " << desc )
+
+#if defined(CATCH_CONFIG_ENABLE_BENCHMARKING)
+#define BENCHMARK(...) \
+ INTERNAL_CATCH_BENCHMARK(INTERNAL_CATCH_UNIQUE_NAME(____C_A_T_C_H____B_E_N_C_H____), INTERNAL_CATCH_GET_1_ARG(__VA_ARGS__,,), INTERNAL_CATCH_GET_2_ARG(__VA_ARGS__,,))
+#define BENCHMARK_ADVANCED(name) \
+ INTERNAL_CATCH_BENCHMARK_ADVANCED(INTERNAL_CATCH_UNIQUE_NAME(____C_A_T_C_H____B_E_N_C_H____), name)
+#endif // CATCH_CONFIG_ENABLE_BENCHMARKING
+
+using Catch::Detail::Approx;
+
+#else // CATCH_CONFIG_DISABLE
+
+//////
+// If this config identifier is defined then all CATCH macros are prefixed with CATCH_
+#ifdef CATCH_CONFIG_PREFIX_ALL
+
+#define CATCH_REQUIRE( ... ) (void)(0)
+#define CATCH_REQUIRE_FALSE( ... ) (void)(0)
+
+#define CATCH_REQUIRE_THROWS( ... ) (void)(0)
+#define CATCH_REQUIRE_THROWS_AS( expr, exceptionType ) (void)(0)
+#define CATCH_REQUIRE_THROWS_WITH( expr, matcher ) (void)(0)
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0)
+#endif// CATCH_CONFIG_DISABLE_MATCHERS
+#define CATCH_REQUIRE_NOTHROW( ... ) (void)(0)
+
+#define CATCH_CHECK( ... ) (void)(0)
+#define CATCH_CHECK_FALSE( ... ) (void)(0)
+#define CATCH_CHECKED_IF( ... ) if (__VA_ARGS__)
+#define CATCH_CHECKED_ELSE( ... ) if (!(__VA_ARGS__))
+#define CATCH_CHECK_NOFAIL( ... ) (void)(0)
+
+#define CATCH_CHECK_THROWS( ... ) (void)(0)
+#define CATCH_CHECK_THROWS_AS( expr, exceptionType ) (void)(0)
+#define CATCH_CHECK_THROWS_WITH( expr, matcher ) (void)(0)
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define CATCH_CHECK_NOTHROW( ... ) (void)(0)
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_CHECK_THAT( arg, matcher ) (void)(0)
+
+#define CATCH_REQUIRE_THAT( arg, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+#define CATCH_INFO( msg ) (void)(0)
+#define CATCH_UNSCOPED_INFO( msg ) (void)(0)
+#define CATCH_WARN( msg ) (void)(0)
+#define CATCH_CAPTURE( msg ) (void)(0)
+
+#define CATCH_TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define CATCH_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define CATCH_METHOD_AS_TEST_CASE( method, ... )
+#define CATCH_REGISTER_TEST_CASE( Function, ... ) (void)(0)
+#define CATCH_SECTION( ... )
+#define CATCH_DYNAMIC_SECTION( ... )
+#define CATCH_FAIL( ... ) (void)(0)
+#define CATCH_FAIL_CHECK( ... ) (void)(0)
+#define CATCH_SUCCEED( ... ) (void)(0)
+
+#define CATCH_ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__)
+#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__)
+#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__)
+#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#else
+#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__) )
+#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__) )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#endif
+
+// "BDD-style" convenience wrappers
+#define CATCH_SCENARIO( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define CATCH_SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_METHOD_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), className )
+#define CATCH_GIVEN( desc )
+#define CATCH_AND_GIVEN( desc )
+#define CATCH_WHEN( desc )
+#define CATCH_AND_WHEN( desc )
+#define CATCH_THEN( desc )
+#define CATCH_AND_THEN( desc )
+
+#define CATCH_STATIC_REQUIRE( ... ) (void)(0)
+#define CATCH_STATIC_REQUIRE_FALSE( ... ) (void)(0)
+
+// If CATCH_CONFIG_PREFIX_ALL is not defined then the CATCH_ prefix is not required
+#else
+
+#define REQUIRE( ... ) (void)(0)
+#define REQUIRE_FALSE( ... ) (void)(0)
+
+#define REQUIRE_THROWS( ... ) (void)(0)
+#define REQUIRE_THROWS_AS( expr, exceptionType ) (void)(0)
+#define REQUIRE_THROWS_WITH( expr, matcher ) (void)(0)
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define REQUIRE_NOTHROW( ... ) (void)(0)
+
+#define CHECK( ... ) (void)(0)
+#define CHECK_FALSE( ... ) (void)(0)
+#define CHECKED_IF( ... ) if (__VA_ARGS__)
+#define CHECKED_ELSE( ... ) if (!(__VA_ARGS__))
+#define CHECK_NOFAIL( ... ) (void)(0)
+
+#define CHECK_THROWS( ... ) (void)(0)
+#define CHECK_THROWS_AS( expr, exceptionType ) (void)(0)
+#define CHECK_THROWS_WITH( expr, matcher ) (void)(0)
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define CHECK_NOTHROW( ... ) (void)(0)
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CHECK_THAT( arg, matcher ) (void)(0)
+
+#define REQUIRE_THAT( arg, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+#define INFO( msg ) (void)(0)
+#define UNSCOPED_INFO( msg ) (void)(0)
+#define WARN( msg ) (void)(0)
+#define CAPTURE( msg ) (void)(0)
+
+#define TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define METHOD_AS_TEST_CASE( method, ... )
+#define REGISTER_TEST_CASE( Function, ... ) (void)(0)
+#define SECTION( ... )
+#define DYNAMIC_SECTION( ... )
+#define FAIL( ... ) (void)(0)
+#define FAIL_CHECK( ... ) (void)(0)
+#define SUCCEED( ... ) (void)(0)
+#define ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__)
+#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__)
+#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__)
+#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#else
+#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__) )
+#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__) )
+#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__ ) )
+#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#endif
+
+#define STATIC_REQUIRE( ... ) (void)(0)
+#define STATIC_REQUIRE_FALSE( ... ) (void)(0)
+
+#endif
+
+#define CATCH_TRANSLATE_EXCEPTION( signature ) INTERNAL_CATCH_TRANSLATE_EXCEPTION_NO_REG( INTERNAL_CATCH_UNIQUE_NAME( catch_internal_ExceptionTranslator ), signature )
+
+// "BDD-style" convenience wrappers
+#define SCENARIO( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ) )
+#define SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_METHOD_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), className )
+
+#define GIVEN( desc )
+#define AND_GIVEN( desc )
+#define WHEN( desc )
+#define AND_WHEN( desc )
+#define THEN( desc )
+#define AND_THEN( desc )
+
+using Catch::Detail::Approx;
+
+#endif
+
+#endif // ! CATCH_CONFIG_IMPL_ONLY
+
+// start catch_reenable_warnings.h
+
+
+#ifdef __clang__
+# ifdef __ICC // icpc defines the __clang__ macro
+# pragma warning(pop)
+# else
+# pragma clang diagnostic pop
+# endif
+#elif defined __GNUC__
+# pragma GCC diagnostic pop
+#endif
+
+// end catch_reenable_warnings.h
+// end catch.hpp
+#endif // TWOBLUECUBES_SINGLE_INCLUDE_CATCH_HPP_INCLUDED
+